| DISCLAIMER: This is an unofficial excel table containing the substances with harmonised classification and labelling up until the 15th Adaptation to Technical Progress, i.e. Commission Delegated Regulation (EU) No 2020/1182 amending, for the purposes of its adaptation to technical and scientific progress, Regulation (EC) No 1272/2008 of the European Parliament and of the Council on classification, labelling and packaging of substances and mixtures and correcting that Regulation. ECHA assumes no responsibility of any kind for your use of the data inter alia in the context of fulfilling the requirements of the relevant legal obligations. Please note that this document should be treated only for informative purposes not including commercial activities or reproduction |
||||||||||||
| Updated on December 2020 | ||||||||||||
| Index No | International Chemical Identification | Magyar név | EC No | CAS No | Classification | Labelling | Specific Conc. Limits, M-factors | Notes | ATP inserted/ATP Updated | |||
| Hazard Class and Category Code(s) | Hazard Statement Code(s) | Pictogram, Signal Word Code(s) | Hazard statement Code(s) | Suppl. Hazard statement Code(s) | ||||||||
| 001-001-00-9 | hydrogen | hidrogén | 215-605-7 | 1333-74-0 | Flam.
Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
U | CLP00 | ||
| 001-002-00-4 | aluminium lithium hydride | lítium-alumínium-hidrid | 240-877-9 | 16853-85-3 | Water-react.
1 Skin Corr. 1A |
H260 H314 |
GHS02 GHS05 Dgr |
H260 H314 |
CLP00/ATP01 | |||
| 001-003-00-X | sodium hydride | nátrium-hidrid | 231-587-3 | 7646-69-7 | Water-react.
1 |
H260 |
GHS02 Dgr |
H260 |
CLP00 | |||
| 001-004-00-5 | calcium hydride | kálcium-hidrid | 232-189-2 | 7789-78-8 | Water-react.
1 |
H260 |
GHS02 Dgr |
H260 |
CLP00 | |||
| 003-001-00-4 | lithium | lítium | 231-102-5 | 7439-93-2 | Water-react.
1 Skin Corr. 1B |
H260 H314 |
GHS02 GHS05 Dgr |
H260 H314 |
EUH014 |
CLP00 | ||
| 003-002-00-X | n-hexyllithium | n-hexil-lítium | 404-950-0 | 21369-64-2 | Pyr.
Sol. 1 Water-react. 1 Skin Corr. 1A |
H250 H260 H314 |
GHS02 GHS05 Dgr |
H260 H250 H314 |
EUH014 |
CLP00 | ||
| 003-003-00-5 | (2-methylpropyl)lithium; isobutyllithium | (2-metilpropil)lítium; izobutil-lítium | 440-620-2 | 920-36-5 | Pyr.
Liq. 1 Water-react. 1 STOT SE 3 Skin Corr. 1A Aquatic Acute 1 Aquatic Chronic 1 |
H250 H260 H336 H314 H400 H410 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H260 H250 H314 H336 H410 |
EUH014 |
ATP01 | ||
| 004-001-00-7 | beryllium | berillium | 231-150-7 | 7440-41-7 | Carc.
1B Acute Tox. 2 * Acute Tox. 3 * STOT SE 3 STOT RE 1 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H350i H330 H301 H335 H372 ** H315 H319 H317 |
GHS06 GHS08 Dgr |
H350i H330 H301 H372 ** H319 H335 H315 H317 |
CLP00 | |||
| 004-002-00-2 | beryllium compounds with the exception of aluminium beryllium silicates, and with those specified elsewhere in this Annex | berilliumvegyületek, kivéve a berillium-alumínium-szilikátokat és az e mellékletben külön szereplő vegyületeket | Carc.
1B Acute Tox. 2 * Acute Tox. 3 * STOT SE 3 STOT RE 1 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H350i H330 H301 H335 H372 ** H315 H319 H317 H411 |
GHS06 GHS08 GHS09 Dgr |
H350i H330 H301 H372 ** H319 H335 H315 H317 H411 |
A | CLP00 | ||||
| 004-003-00-8 | beryllium oxide | berillium-oxid | 215-133-1 | 1304-56-9 | Carc.
1B Acute Tox. 2 * Acute Tox. 3 * STOT SE 3 STOT RE 1 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H350i H330 H301 H335 H372 ** H315 H319 H317 |
GHS06 GHS08 Dgr |
H350i H330 H301 H372 ** H319 H335 H315 H317 |
CLP00 | |||
| 005-001-00-X | boron trifluoride | bór-trifluorid | 231-569-5 | 7637-07-2 | Press.
Gas Acute Tox. 2 * Skin Corr. 1A |
H330 H314 |
GHS04 GHS06 GHS05 Dgr |
H330 H314 |
EUH014 |
U | CLP00 | |
| 005-002-00-5 | boron trichloride | bór-triklorid | 233-658-4 | 10294-34-5 | Press.
Gas Acute Tox. 2 * Acute Tox. 2 * Skin Corr. 1B |
H330 H300 H314 |
GHS04 GHS06 GHS05 Dgr |
H330 H300 H314 |
EUH014 |
U | CLP00 | |
| 005-003-00-0 | boron tribromide | bór-tribromid | 233-657-9 | 10294-33-4 | Acute
Tox. 2 * Acute Tox. 2 * Skin Corr. 1A |
H330 H300 H314 |
GHS06 GHS05 Dgr |
H330 H300 H314 |
EUH014 |
CLP00 | ||
| 005-004-00-6 | trialkylboranes | trialkil-boránok, szilárd | Pyr.
Sol. 1 Skin Corr. 1B |
H250 H314 |
GHS02 GHS05 Dgr |
H250 H314 |
A | CLP00 | ||||
| 005-004-01-3 | trialkylboranes, liquid | trialkil-boránok, folyékony | Pyr.
Liq. 1 Skin Corr. 1B |
H250 H314 |
GHS02 GHS05 Dgr |
H250 H314 |
A | CLP00 | ||||
| 005-005-00-1 | trimethyl borate | trimetil-borát | 204-468-9 | 121-43-7 | Flam.
Liq. 3 Acute Tox. 4 * |
H226 H312 |
GHS02 GHS07 Wng |
H226 H312 |
CLP00 | |||
| 005-006-00-7 | dibutyltin hydrogen borate | dibutil-ón-hidrogén-borát | 401-040-5 | 75113-37-0 | Muta.
2 Repr. 1B Acute Tox. 4 * Acute Tox. 4 * STOT RE 1 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H341 H360FD H312 H302 H372 ** H318 H317 H400 H410 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H302 H312 H318 H317 H341 H360FD H372 ** H410 |
CLP00/ATP01corr | |||
| 005-007-00-2 | boric
acid [1] boric acid [2] |
bórsav;
[1] bórsav; [2] |
233-139-2
[1] 234-343-4 [2] |
10043-35-3
[1] 11113-50-1 [2] |
Repr.
1B |
H360FD |
GHS08 Dgr |
H360FD |
Repr.
1B; H360FD: C ≥ 5,5 % |
ATP01/ATP01corr | ||
| 005-008-00-8 | diboron trioxide; boric oxide | dibór-trioxid; bór-oxid |
215-125-8 | 1303-86-2 | Repr.
1B |
H360FD |
GHS08 Dgr |
H360FD |
Repr.
1B; H360FD: C ≥ 3,1 % |
ATP01 | ||
| 005-009-00-3 | tetrabutylammonium butyltriphenylborate | tetrabutil-ammónium-butiltrifenil-borát | 418-080-4 | 120307-06-4 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
CLP00 | |||
| 005-010-00-9 | N,N-dimethylanilinium tetrakis(pentafluorophenyl)borate | N, N-dimetilanilinium-tetrakisz-(pentafluorfenil)borát | 422-050-6 | 118612-00-3 | Carc.
2 Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 |
H351 H302 H315 H318 |
GHS08 GHS05 GHS07 Dgr |
H351 H302 H315 H318 |
CLP00 | |||
| 005-011-00-4 | disodium
tetraborate, anhydrous; boric acid, disodium salt [1] tetraboron disodium heptaoxide, hydrate [2] orthoboric acid, sodium salt [3] |
dinátrium-tetraborát,
vízmentes; bórsav, dinátriumsó; [1] tetrabór-dinátrium-heptaoxid, hidrát; [2] ortobórsav, nátriumsó [3] |
215-540-4
[1] 235-541-3 [2] 237-560-2 [3] |
1330-43-4
[1] 12267-73-1 [2] 13840-56-7 [3] |
Repr.
1B |
H360FD |
GHS08 Dgr |
H360FD |
Repr.
1B; H360FD: C ≥ 4,5 % |
ATP01 | ||
| 005-011-01-1 | disodium tetraborate decahydrate; borax decahydrate | dinátrium-tetraborát-dekahidrát; bórax-dekahidrát |
215-540-4 | 1303-96-4 | Repr.
1B |
H360FD |
GHS08 Dgr |
H360FD |
Repr.
1B; H360FD: C ≥ 8,5 % |
ATP01 | ||
| 005-011-02-9 | disodium tetraborate pentahydrate; borax pentahydrate | dinátrium-tetraborát-pentahidrát; bórax-pentahidrát |
215-540-4 | 12179-04-3 | Repr.
1B |
H360FD |
GHS08 Dgr |
H360FD |
Repr.
1B; H360FD: C ≥ 6,5 % |
ATP01 | ||
| 005-012-00-X | diethyl{}{4-[1,5,5-tris(4-diethylaminophenyl)penta-2,4-dienylidene]cyclohexa-2,5-dienylidene}}ammonium butyltriphenylborate | dietil{4-[1,5,5-trisz(4-dietilamino-fenil)penta-2,4-dienilidin]ciklohexa-2,5-dienilidin}ammónium-butiltrifenil-borát | 418-070-1 | 141714-54-7 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
CLP00 | |||
| 005-013-00-5 | diethylmethoxyborane | dietil-metoxi-borán | 425-380-9 | 7397-46-8 | Pyr.
Liq. 1 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 4 |
H250 H332 H312 H302 H373 ** H314 H317 H413 |
GHS02 GHS05 GHS08 GHS07 Dgr |
H250 H332 H312 H302 H373 ** H314 H317 H413 |
ATP01 | |||
| 005-014-00-0 | 4-formylphenylboronic acid | 4-formilfenil-bórsav | 438-670-5 | 87199-17-5 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
ATP01 | |||
| 005-015-00-6 | 1-chloromethyl-4-fluoro-1,4-diazoniabicyclo[2.2.2]octane bis(tetrafluoroborate) | 1-klór-metil-4-fluor-1,4-diazoniabiciklo[2.2.2]oktán bisz(tetrafluor-borát) | 414-380-4 | 140681-55-6 | Acute
Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H302 H318 H317 H412 |
GHS05 GHS07 Dgr |
H302 H318 H317 H412 |
ATP01 | |||
| 005-016-00-1 | tetrabutylammonium butyl tris-(4-tert-butylphenyl)borate | tetra-butil-ammónium-butil-trisz-(4-terc-butil-fenil)borát | 431-370-5 | - | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 005-017-00-7 | sodium
perborate; [containing = 0,1 % (w/w) of particles with an aerodynamic
diameter of below 50 µm] [1] sodium peroxometaborate; sodium peroxoborate; [containing = 0,1 % (w/w) of particles with an aerodynamic diameter of below 50 µm] [2] |
nátrium-perborát;
[1] nátrium-peroxo-metaborát; [2] nátrium-peroxoborát; [< 0,1 % (w/w) 50 μm-nél kisebb aerodinamikai átmérőjű részecskét tartalmaz] |
239-172-9
[1] 231-556-4 [2] |
15120-21-5
[1] 7632-04-4 [2] |
Ox.
Sol. 2 Repr. 1B Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H272 H360Df H302 H335 H318 |
GHS03 GHS05 GHS08 GHS07 Dgr |
H272 H302 H318 H360Df H335 |
Repr.
1B; H360D: 6,5 % ≤ C < 9 % Repr. 1B; H360Df: C ≥ 9 % Eye Dam. 1; H318: C ≥ 22 % Eye Irrit. 2; H319: 14 % ≤ C < 22 % |
ATP01/ATP01corr | ||
| 005-017-01-4 | sodium
perborate; [containing = 0,1 % (w/w) of particles with an aerodynamic
diameter of below 50 µm] [1] sodium peroxometaborate; sodium peroxoborate; [containing < 0,1 % (w/w) of particles with an aerodynamic diameter of below 50 µm] [2] |
nátrium-perborát;
[1] nátrium-peroxo-metaborát; [2] nátrium-peroxoborát; [≥ 0,1 % (w/w) 50 μm-nél kisebb aerodinamikai átmérőjű részecskét tartalmaz] |
239-172-9
[1] 231-556-4 [2] |
15120-21-5
[1] 7632-04-4 [2] |
Ox.
Sol. 2 Repr. 1B Acute Tox. 3 * Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H272 H360Df H331 H302 H335 H318 |
GHS03 GHS06 GHS05 GHS08 Dgr |
H272 H302 H331 H318 H360Df H335 |
Repr.
1B; H360D: 6,5 % ≤ C < 9 % Repr. 1B; H360Df: C ≥ 9 % Eye Dam. 1; H318: C ≥ 22 % Eye Irrit. 2; H319: 14 % ≤ C < 22 % |
ATP01/ATP01corr | ||
| 005-018-00-2 | perboric
acid (H3BO2(O2)), monosodium salt trihydrate; [containing < 0,1 % (w/w) of
particles with an aerodynamic diameter of below 50 µm] [1] perboric acid, sodium salt, tetrahydrate; [containing < 0,1 % (w/w) of particles with an aerodynamic diameter of below 50 µm] [2] perboric acid (HBO(O2)), sodium salt, tetrahydrate sodium peroxoborate hexahydrate; [containing < 0,1 % (w/w) of particles with an aerodynamic diameter of below 50 µm] [3] |
perbórsav
(H3BO2(O2)), mononátriumsó, trihidrát; [1] perbórsav, nátriumsó, tetrahidrát; [2] perbórsav (HBO(O2)), nátriumsó, tetrahidrát [3] nátrium-peroxoborát, hexahidrát; [< 0,1 % (w/w) 50 μm-nél kisebb aerodinamikai átmérőjű részecskét tartalmaz] |
239-172-9
[1] 234-390-0 [2] 231-556-4 [3] |
13517-20-9
[1] 37244-98-7 [2] 10486-00-7 [3] |
Repr.
1B STOT SE 3 Eye Dam. 1 |
H360Df H335 H318 |
GHS05 GHS08 GHS07 Dgr |
H318 H360Df H335 |
Repr.
1B; H360D: 10 % ≤ C < 14 % Repr. 1B; H360Df: C ≥ 14 % Eye Dam. 1; H318: C ≥ 36 % Eye Irrit. 2; H319: 22 % ≤ C < 36 % |
ATP01/ATP01corr | ||
| 005-018-01-X | perboric
acid (H3BO2(O2)), monosodium salt, trihydrate [1] perboric acid, sodium salt, tetrahydrate [2] perboric acid (HBO(O2)), sodium salt, tetrahydrate [3] |
perbórsav
(H3BO2(O2)), mononátriumsó, trihidrát; [1] perbórsav, nátriumsó, tetrahidrát; [2] perbórsav (HBO(O2)), nátriumsó, tetrahidrát [3] nátrium-peroxoborát, hexahidrát; [≥ 0,1 % (w/w) 50 μm-nél kisebb aerodinamikai átmérőjű részecskét tartalmaz] |
239-172-9
[1] 234-390-0 [2] 231-556-4 [3] |
13517-20-9
[1] 37244-98-7 [2] 10486-00-7 [3] |
Repr.
1B Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H360Df H332 H335 H318 |
GHS05 GHS08 GHS07 Dgr |
H360Df H332 H335 H318 |
Repr.
1B; H360 Df: C ≥ 14 % Repr. 1B; H360D: 10 % ≤ C < 14 % Eye Dam. 1; H318: C ≥ 36 % Eye Irrit. 2; H319: 22 % ≤ C < 36 % |
ATP01 | ||
| 005-019-00-8 | perboric
acid, sodium salt; [containing < 0,1 % (w/w) of particles with an
aerodynamic diameter of below 50 µm] [1] perboric acid, sodium salt, monohydrate; [containing < 0,1 % (w/w) of particles with an aerodynamic diameter of below 50 µm] [2] perboric acid (HBO(O2)), sodium salt, monohydrate; sodium peroxoborate; [containing < 0,1 % (w/w) of particles with an aerodynamic diameter of below 50 µm] [3] |
perbórsav,
nátriumsó; [1] perbórsav, nátriumsó, monohidrát; [2] perbórsav (HBO(O2)), nátriumsó, monohidrát [3] nátrium-peroxoborát; [< 0,1 % (w/w) 50 μm-nél kisebb aerodinamikai átmérőjű részecskét tartalmaz] |
234-390-0
[1] 234-390-0 [2] 231-556-4 [3] |
11138-47-9
[1] 12040-72-1 [2] 10332-33-9 [3] |
Ox.
Sol. 3 Repr. 1B Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H272 H360Df H302 H335 H318 |
GHS03 GHS05 GHS08 GHS07 Dgr |
H272 H302 H318 H360Df H335 |
Repr.
1B; H360D: 6,5 % ≤ C < 9 % Repr. 1B; H360Df: C ≥ 9 % Eye Dam. 1; H318: C ≥ 22 % Eye Irrit. 2; H319: 14 % ≤ C < 22 % |
ATP01/ATP01corr | ||
| 005-019-01-5 | perboric
acid, sodium salt [1] perboric acid, sodium salt, monohydrate; [containing = 0,1 % (w/w) of particles with an aerodynamic diameter of below 50 µm] [2] perboric acid (HBO(O2)), sodium salt, monohydrate; sodium peroxoborate; [containing = 0,1 % (w/w) of particles with an aerodynamic diameter of below 50 µm] [3] |
perbórsav,
nátriumsó; [1] perbórsav, nátriumsó, monohidrát; [2] perbórsav (HBO(O2)), nátriumsó, monohidrát [3] nátrium-peroxoborát; [≥ 0,1 % (w/w) 50 μm-nél kisebb aerodinamikai átmérőjű részecskét tartalmaz] |
234-390-0
[1] 234-390-0 [2] 231-556-4 [3] |
11138-47-9
[1] 12040-72-1 [2] 10332-33-9 [3] |
Ox.
Sol. 3 Repr. 1B Acute Tox. 3 * Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H272 H360Df H331 H302 H335 H318 |
GHS03 GHS06 GHS05 GHS08 Dgr |
H272 H302 H331 H318 H360Df H335 |
Repr.
1B; H360D: 6,5 % ≤ C < 9 % Repr. 1B; H360Df: C ≥ 9 % Eye Dam. 1; H318: C ≥ 22 % Eye Irrit. 2; H319: 14 % ≤ C < 22 % |
ATP01/ATP01corr | ||
| 005-020-00-3 | disodium
octaborate anhydrous [1] disodium octaborate tetrahydrate [2] |
dinátrium-oktaborát,
vízmentes; [1] dinátrium-oktaborát-tetrahidrát [2] |
234-541-0
[1] 234-541-0 [2] |
12008-41-2
[1] 12280-03-4 [2] |
Repr.
1B |
H360FD |
GHS08 Dgr |
H360FD |
ATP09 | |||
| 006-001-00-2 | carbon monoxide | szén-monoxid | 211-128-3 | 630-08-0 | Flam.
Gas 1 Press. Gas Repr. 1A Acute Tox. 3 * STOT RE 1 |
H220 H360D *** H331 H372 ** |
GHS02 GHS04 GHS06 GHS08 Dgr |
H220 H360D *** H331 H372 ** |
U | CLP00 | ||
| 006-002-00-8 | phosgene; carbonyl chloride | foszgén; karbonil-klorid | 200-870-3 | 75-44-5 | Press.
Gas Acute Tox. 2 * Skin Corr. 1B |
H330 H314 |
GHS04 GHS06 GHS05 Dgr |
H330 H314 |
U | CLP00 | ||
| 006-003-00-3 | carbon disulphide | szén-diszulfid | 200-843-6 | 75-15-0 | Flam.
Liq. 2 Repr. 2 STOT RE 1 Skin Irrit. 2 Eye Irrit. 2 |
H225 H361fd H372 ** H315 H319 |
GHS02 GHS08 GHS07 Dgr |
H225 H361fd H372 ** H319 H315 |
Repr.
2; H361fd: C ≥ 1 % STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,2 % ≤C < 1 % |
CLP00 | ||
| 006-004-00-9 | calcium carbide | kálcium-karbid | 200-848-3 | 75-20-7 | Water-react.
1 |
H260 |
GHS02 Dgr |
H260 |
T | CLP00 | ||
| 006-005-00-4 | thiram (ISO); tetramethylthiuram disulphide | tiram
(ISO); tetrametiltiuram-diszulfid |
205-286-2 | 137-26-8 | Acute
Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H373 ** H315 H319 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H332 H302 H373 ** H319 H315 H317 H410 |
M=10 |
CLP00 | ||
| 006-006-00-X | hydrogen cyanide; hydrocyanic acid | hidrogén-cianid; hidrociánsav |
200-821-6 | 74-90-8 | Flam.
Liq. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H224 H330 H400 H410 |
GHS02 GHS06 GHS09 Dgr |
H224 H330 H410 |
CLP00 | |||
| 006-006-01-7 | hydrogen cyanide ...%; hydrocyanic acid ...% | hidrogén-cianid
…%; hidrociánsav …% |
200-821-6 | 74-90-8 | Acute
Tox. 1 Acute Tox. 2 * Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H330 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H300 H410 |
B | CLP00 | ||
| 006-007-00-5 | salts of hydrogen cyanide with the exception of complex cyanides such as ferrocyanides, ferricyanides and mercuric oxycyanide and those specified elsewhere in this Annex | hidrogén-cianid sói, kivéve a komplex cianidokat, mint például a ferro-cianidok, ferri-cianidok és higany-oxicianid, valamint az e mellékletben külön szereplő vegyületeket | - | - | Acute
Tox. 1 Acute Tox. 2 * Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H330 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H300 H410 |
EUH032 |
A | CLP00/ATP01 | |
| 006-008-00-0 | antu (ISO); 1-(1-naphthyl)-2-thiourea | antu
(ISO); 1-(1-naftil)-2-tiokarbamid |
201-706-3 | 86-88-4 | Carc.
2 Acute Tox. 2 * |
H351 H300 |
GHS06 GHS08 Dgr |
H300 H351 |
CLP00 | |||
| 006-009-00-6 | 1-isopropyl-3-methylpyrazol-5-yl dimethylcarbamate; Isolan | 1-izopropil-3-metilpirazol-5-il-dimetilkarbamát; izolán |
204-318-2 | 119-38-0 | Acute
Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
CLP00 | |||
| 006-010-00-1 | 5,5-dimethyl-3-oxocyclohex-1-enyl dimethylcarbamate 5,5-dimethyldihydroresorcinol dimethylcarbamate; Dimetan | 5,5-dimetil-3-oxociklohex-1-enil-dimetil-karbamát 5,5-dimetil-dihidrorezorcinol-dimetil-karbamát; dimetán |
204-525-8 | 122-15-6 | Acute
Tox. 3 * |
H301 |
GHS06 Dgr |
H301 |
CLP00 | |||
| 006-011-00-7 | carbaryl (ISO); 1-naphthyl methylcarbamate | karbaril
(ISO); 1-naftil-metilkarbamát |
200-555-0 | 63-25-2 | Carc.
2 Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 |
H351 H332 H302 H400 |
GHS08 GHS07 GHS09 Wng |
H351 H332 H302 H400 |
M=100 |
CLP00/ATP01 | ||
| 006-012-00-2 | ziram (ISO); zinc bis dimethyldithiocarbamate | zirám
(ISO); cink-bisz(dimetil-ditiokarbamát) |
205-288-3 | 137-30-4 | Acute
Tox. 2 * Acute Tox. 4 * STOT SE 3 STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H302 H335 H373 ** H318 H317 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H330 H302 H373 ** H335 H318 H317 H410 |
M=100 |
CLP00 | ||
| 006-013-00-8 | metam-sodium (ISO); sodium methyldithiocarbamate | metám-nátrium
(ISO); nátrium-metil-ditiokarbamát |
205-293-0 | 137-42-8 | Acute
Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H317 H410 |
EUH031 |
CLP00 | ||
| 006-014-00-3 | nabam (ISO); disodium ethylenebis(N,N'-dithiocarbamate) | nabám
(ISO); dinátrium-etilén-bisz(N, N'-ditiokarbamát) |
205-547-0 | 142-59-6 | Acute
Tox. 4 * STOT SE 3 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H335 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H335 H317 H410 |
CLP00 | |||
| 006-015-00-9 | diuron (ISO); 3-(3,4-dichlorophenyl)-1,1-dimethylurea | diuron
(ISO); 3-(3,4-diklór-fenil)-1,1-dimetil-karbamid |
206-354-4 | 330-54-1 | Carc.
2 Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H351 H373 ** H410 |
M=10 |
CLP00/ATP01corr | ||
| 006-016-00-4 | propoxur (ISO); 2-isopropyloxyphenyl N-methylcarbamate; 2-isopropoxyphenyl methylcarbamate | propoxur
(ISO); 2-izopropil-oxifenil-N-metilkarbamát; 2-izopropoxifenil-metilkarbamát |
204-043-8 | 114-26-1 | Acute
Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
CLP00 | |||
| 006-017-00-X | aldicarb (ISO); 2-methyl-2-(methylthio)propanal-O-(N-methylcarbamoyl)oxime | aldikarb
(ISO); 2-metil-2-(metiltio)propanal-O-(N-metilkarbamoil)oxim |
204-123-2 | 116-06-3 | Acute
Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H311 H410 |
CLP00 | |||
| 006-018-00-5 | aminocarb (ISO); 4-dimethylamino-3-tolyl methylcarbamate | aminokarb
(ISO); 4-dimetilamino-3-tolil-metilkarbamát |
217-990-7 | 2032-59-9 | Acute
Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
CLP00 | |||
| 006-019-00-0 | di-allate (ISO); S-(2,3-dichloroallyl)-N,N-diisopropylthiocarbamate | diallát
(ISO); S-(2,3-diklórallil)-N,N- diizopropil-tiokarbamát |
218-961-1 | 2303-16-4 | Carc.
2 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H410 |
CLP00 | |||
| 006-020-00-6 | barban (ISO); 4-chlorbut-2-ynyl N-(3-chlorophenyl)carbamate | barban
(ISO); 4-klórbut-2-inil-N-(3-klórfenil)karbamát |
202-930-4 | 101-27-9 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
CLP00 | |||
| 006-021-00-1 | linuron (ISO); 3-(3,4-dichlorophenyl)-1-methoxy-1-methylurea | linuron
(ISO); 3-(3,4-diklór-fenil)-1-metoxi-1-metil-karbamid |
206-356-5 | 330-55-2 | Carc.
2 Repr. 1B Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H360Df H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H360Df H351 H302 H373 ** H410 |
CLP00 | |||
| 006-022-00-7 | decarbofuran (ISO); 2,3-dihydro-2-methylbenzofuran-7-yl methylcarbamate | dekarbofurán
(ISO); 2,3-dihidro-2-metilbenzofurán-7-ilmetilkarbamát |
1563-67-3 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
CLP00 | ||||
| 006-023-00-2 | mercaptodimethur (ISO); methiocarb (ISO); 3,5-dimethyl-4-methylthiophenyl N-methylcarbamate | merkaptodimetur
(ISO); metiokarb (ISO); 3,5-dimetil-4-metiltiofenil-N-metilkarbamát |
217-991-2 | 2032-65-7 | Acute
Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
CLP00 | |||
| 006-024-00-8 | proxan-sodium (ISO); sodium O-isopropyldithiocarbonate | proxán-nátrium
(ISO); nátrium-O-izopropil-ditiokarbonát |
205-443-5 | 140-93-2 | Acute
Tox. 4 * Skin Irrit. 2 Aquatic Chronic 2 |
H302 H315 H411 |
GHS07 GHS09 Wng |
H302 H315 H411 |
CLP00 | |||
| 006-025-00-3 | allethrin;
(RS)-3-allyl-2-methyl-4-oxocyclopent-2-enyl
(1RS,3RS;1RS,3SR)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate;
bioallethrin; (RS)-3-allyl-2-methyl-4-oxocyclopent-2-enyl
(1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate [1] S-bioallethrin; (S)-3-allyl-2-methyl-4-oxocyclopent-2-enyl (1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate [2] esbiothrin; (RS)-3-allyl-2-methyl-4-oxocyclopent-2-enyl (1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate [3] |
alletrin; (RS)-3-allil-2-metil-4-oxociklopent-2-enil-(1RS,3RS;1RS,3SR)-2,2-dimetil-3-(2-metilprop-1-enil)ciklopropán-karboxilát; bioalletrin; (RS)-3-allil-2-metil-4-oxociklopent-2-enil-(1R,3R)-2,2-dimetil-3-(2-metilprop-1-enil)ciklopropán-karboxilát; [1] S-bioalletrin; [3] (S)-3-allil-2-metil-4-oxociklopent-2-enil-(1R,3R)-2,2-dimetil-3-(2-metilprop-1-enil)ciklopropán-karboxilát; [2] esbiotrin; (RS)-3-allil-2-metil-4-oxociklopent-2-enil-(1R,3R)-2,2-dimetil-3-(2-metilprop-1-enil)ciklopropán-karboxilát [3] |
209-542-4
[1] 249-013-5 [2] 249-013-5 [3] |
584-79-2
[1] 28434-00-6 [2] 84030-86-4 [3] |
Acute
Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H302 H410 |
C | CLP00 | ||
| 006-026-00-9 | carbofuran (ISO); 2,3-dihydro-2,2-dimethylbenzofuran-7-yl N-methylcarbamate | karbofurán
(ISO) 2,3-dihidro-2,2-dimetilbenzo-furán-7-il-N-metilkarbamát |
216-353-0 | 1563-66-2 | Acute
Tox. 2 * Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H410 |
CLP00 | |||
| 006-028-00-X | dinobuton (ISO); 2-(1-methylpropyl)-4,6-dinitrophenyl isopropyl carbonate | dinobuton
(ISO); 2-(1-metilpropil)-4,6-dinitro-fenil-izopropil-karbonát |
213-546-1 | 973-21-7 | Acute
Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
CLP00 | |||
| 006-029-00-5 | dioxacarb (ISO); 2-(1,3-dioxolan-2-yl)phenyl N-methylcarbamate | dioxakarb
(ISO); 2-(1,3-dioxolán-2-il)fenil-N-metilkarbamát |
230-253-4 | 6988-21-2 | Acute
Tox. 3 * Aquatic Chronic 2 |
H301 H411 |
GHS06 GHS09 Dgr |
H301 H411 |
CLP00 | |||
| 006-030-00-0 | EPTC (ISO); S-ethyl dipropylthiocarbamate | EPTC
(ISO); S-etil-dipropiltiokarbamát |
212-073-8 | 759-94-4 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 006-031-00-6 | formetanate (ISO); 3-[(EZ)-dimethylaminomethyleneamino]phenyl methylcarbamate | formetanát
(ISO); 3-[(EZ)-dimetilamino-metilénamino]fenilmetilkarbamát |
244-879-0 | 22259-30-9 | Acute
Tox. 2 * Acute Tox. 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H317 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H317 H410 |
CLP00 | |||
| 006-032-00-1 | monolinuron (ISO); 3-(4-chlorophenyl)-1-methoxy-1-methylurea | monolinuron
(ISO); 3-(4-klór-fenil)-1-metoxi-1-metil-karbamid |
217-129-5 | 1746-81-2 | Acute
Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H410 |
CLP00 | |||
| 006-033-00-7 | metoxuron (ISO); 3-(3-chloro-4-methoxyphenyl)-1,1-dimethylurea | metoxuron
(ISO); 3-(3-klór-4-metoxifenil)-1,1-dimetilkarbamid |
243-433-2 | 19937-59-8 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 006-034-00-2 | pebulate (ISO); N-butyl-N-ethyl-S-propylthiocarbamate | pebulát
(ISO); N-butil-N-etil-S-propil-tiokarbamát |
214-215-4 | 1114-71-2 | Acute
Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
CLP00 | |||
| 006-035-00-8 | pirimicarb (ISO); 2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl dimethylcarbamate | pirimikarb (ISO); 2-(dimetil-amino)-5,6-dimetil-pirimidin-4-il dimetil-karbamát | 245-430-1 | 23103-98-2 | Carc.
2 Acute Tox. 3 Acute Tox. 3 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H331 H301 H317 H400 H410 |
GHS08 GHS06 GHS09 Dgr |
H331 H301 H317 H351 H410 |
M=10 M=100 |
CLP00/ATP09 | ||
| 006-036-00-3 | benzthiazuron (ISO); 1-benzothiazol-2-yl-3-methylurea | benztiazuron
(ISO); 1-benzotiazol-2-il-3-metilkarbamid |
217-685-9 | 1929-88-0 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 006-037-00-9 | promecarb (ISO); 3-isopropyl-5-methylphenyl N-methylcarbamate | promekarb
(ISO); 3-izopropil-5-metilfenil-N-metilkarbamát |
220-113-0 | 2631-37-0 | Acute
Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
CLP00 | |||
| 006-038-00-4 | sulfallate (ISO); 2-chloroallyl N,N-dimethyldithiocarbamate | szulfallát
(ISO); 2-klórallil-N, N-dimetilditiokarbamát |
202-388-9 | 95-06-7 | Carc.
1B Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H410 |
CLP00 | |||
| 006-039-00-X | tri-allate (ISO); S-2,3,3-trichloroallyl diisopropylthiocarbamate | triallát
(ISO); S-2,3,3-triklórallil-diizopropil-tiokarbamát |
218-962-7 | 2303-17-5 | Acute
Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H317 H410 |
CLP00 | |||
| 006-040-00-5 | 3-methylpyrazol-5-yl-dimethylcarbamate; monometilan | 3-metilpirazol-5-il-dimetilkarbamát; monometilán | 2532-43-6 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
CLP00 | ||||
| 006-041-00-0 | dimethylcarbamoyl chloride | dimetil-karbamoil-klorid | 201-208-6 | 79-44-7 | Carc.
1B Acute Tox. 3 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 |
H350 H331 H302 H335 H315 H319 |
GHS06 GHS08 Dgr |
H350 H331 H302 H319 H335 H315 |
Carc.
1B; H350: C ≥ 0,001 % |
CLP00 | ||
| 006-042-00-6 | monuron (ISO); 3-(4-chlorophenyl)-1,1-dimethylurea | monuron
(ISO); 3-(4-klór-fenil)-1,1-dimetil-karbamid |
205-766-1 | 150-68-5 | Carc.
2 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H410 |
CLP00 | |||
| 006-043-00-1 | 3-(4-chlorophenyl)-1,1-dimethyluronium trichloroacetate; monuron-TCA | 3-(4-klór-fenil)-1,1-dimetil-urónium-triklór-acetát; monuron-TCA |
140-41-0 | Carc.
2 Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H315 H319 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H319 H315 H410 |
CLP00 | ||||
| 006-044-00-7 | isoproturon
(ISO); 3-(4-isopropylphenyl)-1,1-dimethylurea |
izoproturon
(ISO); 3-(4-izopropil-fenil)-1,1-dimetil-karbamid |
251-835-4 | 34123-59-6 | Carc.
2 STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H373 (blood) H400 H410 |
GHS08 GHS09 Wng |
H351 H373 (blood) H410 |
M=10 M=10 |
CLP00/ATP13 | ||
| 006-045-00-2 | methomyl (ISO); 1-(methylthio)ethylideneamino N-methylcarbamate | metomil
(ISO); 1-(metiltio)etilidén-amino-N-metil-karbamát |
240-815-0 | 16752-77-5 | Acute
Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H400 H410 |
GHS06 GHS09 Dgr |
H300 H410 |
M=100 |
CLP00/ATP01 | ||
| 006-046-00-8 | bendiocarb (ISO); 2,2-dimethyl-1,3-benzodioxol-4-yl N-methylcarbamate; 2,2-dimethyl-1,3-benzodioxol-4-yl methylcarbamate | bendiokarb
(ISO); 2,2-dimetil-1,3-benzodioxol-4-il-N-metilkarbamát; 2,2-dimetil-1,3-benzodioxol-4-il metilkarbamát |
245-216-8 | 22781-23-3 | Acute
Tox. 2 Acute Tox. 3 Acute Tox. 3 Aquatic Acute 1 Aquatic Chronic 1 |
H300 H331 H311 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H300 H410 |
M=10 M=100 |
CLP00/ATP10 | ||
| 006-047-00-3 | bufencarb (ISO); reaction mass of 3-(1-methylbutyl)phenyl N-methylcarbamate and 3-(1-ethylpropyl)phenyl N-methylcarbamate | bufenkarb
(ISO); a következő anyagok 3-(1-metilbutil)fenil-N-metil-karbamát és 3-(1-etilpropil)fenil-N-metil-karbamát keveréke |
8065-36-9 | Acute
Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
CLP00 | ||||
| 006-048-00-9 | ethiofencarb (ISO); 2-(ethylthiomethyl)phenyl N-methylcarbamate | etiofenkarb
(ISO); 2-(etiltiometil)fenil-N-metil-karbamát |
249-981-9 | 29973-13-5 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | |||
| 006-049-00-4 | dixanthogen; O,O-diethyl dithiobis(thioformate) | dixantogén; O, O-dietil-ditiobisz(tioformát) |
207-944-4 | 502-55-6 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 006-050-00-X | 1,1-dimethyl-3-phenyluronium trichloroacetate; fenuron-TCA | 1,1-dimetil-3-fenil-urónium-triklór-acetát; fenuron-TCA |
4482-55-7 | Skin
Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
CLP00 | ||||
| 006-051-00-5 | ferbam (ISO); iron tris(dimethyldithiocarbamate) | ferbám
(ISO); vas-trisz(dimetil-ditiokarbamát) |
238-484-2 | 14484-64-1 | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H335 H315 H319 H400 H410 |
GHS07 GHS09 Wng |
H319 H335 H315 H410 |
CLP00 | |||
| 006-052-00-0 | formetanate hydrochloride; 3-(N,N-dimethylaminomethyleneamino)phenyl N-methylcarbamate | formetanát-hidroklorid; 3-(N, N-dimetilamino-metilénamino)fenil-N-metilkarbamát |
245-656-0 | 23422-53-9 | Acute
Tox. 2 * Acute Tox. 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H317 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H317 H410 |
CLP00 | |||
| 006-053-00-6 | isoprocarb (ISO); 2-isopropylphenyl N-methylcarbamate | izoprokarb
(ISO); 2-izopropilfenil-N-metilkarbamát |
220-114-6 | 2631-40-5 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | |||
| 006-054-00-1 | mexacarbate (ISO); 3,5-dimethyl-4-dimethylaminophenyl N-methylcarbamate | mexakarbát
(ISO); 3,5-dimetil-4-dimetilaminofenil-N-metilkarbamát |
206-249-3 | 315-18-4 | Acute
Tox. 2 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H312 H400 H410 |
GHS06 GHS09 Dgr |
H300 H312 H410 |
CLP00 | |||
| 006-055-00-7 | xylylcarb (ISO); 3,4-dimethylphenyl N-methylcarbamate; 3,4-xylyl methylcarbamate; MPMC | xililkarb
(ISO); 3,4-dimetilfenil-N-metilkarbamát; 3,4-xilil-metilkarbamát; MPMC |
219-364-9 | 2425-10-7 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | |||
| 006-056-00-2 | metolcarb (ISO); m-tolyl methylcarbamate; MTMC | metolkarb
(ISO); m-tolil-metilkarbamát; MTMC |
214-446-0 | 1129-41-5 | Acute
Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
CLP00 | |||
| 006-057-00-8 | nitrapyrin (ISO); 2-chloro-6-trichloromethylpyridine | nitrapirin
(ISO); 2-klór-6-triklórmetil-piridin |
217-682-2 | 1929-82-4 | Acute
Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
CLP00 | |||
| 006-058-00-3 | noruron (ISO); 1,1-dimethyl-3-(perhydro-4,7-methanoinden-5-yl)urea | noruron
(ISO); 1,1-dimetil-3-(perhidro-4,7-metanoindén-5-il)karbamid |
2163-79-3 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | ||||
| 006-059-00-9 | oxamyl (ISO); N',N'-dimethylcarbamoyl(methylthio)methylenamine N-methylcarbamate | oxamil
(ISO); N',N'-dimetil-karbamoil(metiltio)metilén-amin-N-metilkarbamát; |
245-445-3 | 23135-22-0 | Acute
Tox. 2 * Acute Tox. 2 * Acute Tox. 4 * Aquatic Chronic 2 |
H330 H300 H312 H411 |
GHS06 GHS09 Dgr |
H330 H300 H312 H411 |
CLP00 | |||
| 006-060-00-4 | oxycarboxin (ISO); 2,3-dihydro-6-methyl-5-(N-phenylcarbamoyl)-1,4-oxothiine 4,4-dioxide | oxikarboxin
(ISO); 2,3-dihidro-6-metil-5-(N- fenilkarbamoil)-1,4-oxotiin-4,4-dioxid |
226-066-2 | 5259-88-1 | Acute
Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
CLP00 | |||
| 006-061-00-X | S-ethyl N-(dimethylaminopropyl)thiocarbamatehydrochloride; prothiocarb hydrochloride | S-etil-N-(dimetilamino-propil)tiokarbamát-hidroklorid; protiokarb-hidroklorid |
243-193-9 | 19622-19-6 | Acute
Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
CLP00 | |||
| 006-062-00-5 | methyl 3,4-dichlorophenylcarbanilate; SWEP. | metil-3,4-diklórfenil-karbanilát; SWEP. |
1918-18-9 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | ||||
| 006-063-00-0 | thiobencarb (ISO); S-4-chlorobenzyl diethylthiocarbamate | tiobenkarb
(ISO); S-4-klórbenzil-dietiltiokarbamát |
248-924-5 | 28249-77-6 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | |||
| 006-064-00-6 | thiofanox (ISO); 3,3-dimethyl-1-(methylthio)butanone-O-(N-methylcarbamoyl)oxime | tiofanox
(ISO); 3,3-dimetil-1-(metiltio)butanon-O-(N-metilkarbamoil)oxim |
254-346-4 | 39196-18-4 | Acute
Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
CLP00 | |||
| 006-065-00-1 | 3-chloro-6-cyano-bicyclo(2,2,1)heptan-2-one-O-(N-methylcarbamoyl)oxime; triamid | 3-klór-6-cianobiciklo(2,2,1)heptán-2-on-O-
(N-metilkarbamoil)oxim; triamid |
15271-41-7 | Acute
Tox. 2 * Acute Tox. 3 * Aquatic Chronic 2 |
H300 H311 H411 |
GHS06 GHS09 Dgr |
H300 H311 H411 |
CLP00 | ||||
| 006-066-00-7 | vernolate (ISO); S-propyl dipropylthiocarbamate | vernolát
(ISO); S-propil-dipropil-tiokarbamát |
217-681-7 | 1929-77-7 | Acute
Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
CLP00 | |||
| 006-067-00-2 | XMC; 3,5-xylyl methylcarbamate | XMC; 3,5-xilil-metilkarbamát |
2655-14-3 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | ||||
| 006-068-00-8 | diazomethane | diazometán | 206-382-7 | 334-88-3 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 006-069-00-3 | thiophanate-methyl (ISO); 1,2-di-(3-methoxycarbonyl-2-thioureido)benzene | tiofanát-metil
(ISO); 1,2-di-(3-metoxikarbonil-2-tioureido)benzol |
245-740-7 | 23564-05-8 | Muta.
2 Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H341 H332 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H341 H332 H317 H410 |
CLP00 | |||
| 006-070-00-9 | furmecyclox (ISO); N-cyclohexyl-N-methoxy-2,5-dimethyl-3-furamide | furmeciklox
(ISO); N-ciklohexil-N-metoxi-2,5-dimetil-3-furamid |
262-302-0 | 60568-05-0 | Carc.
2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
CLP00 | |||
| 006-071-00-4 | cyclooct-4-en-1-yl methyl carbonate | ciklookt-4-én-1-il-metil-karbonát | 401-620-8 | 87731-18-8 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 006-072-00-X | prosulfocarb(ISO); S-benzyl N,N-dipropylthiocarbamate | proszulfokarb
(ISO); S-benzil-N, N-dipropil-tiokarbamát |
401-730-6 | 52888-80-9 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
CLP00 | |||
| 006-073-00-5 | 3-(dimethylamino)propylurea | 3-(dimetilamino)propilkarbamid | 401-950-2 | 31506-43-1 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | |||
| 006-074-00-0 | 2-(3-(prop-1-en-2-yl)phenyl)prop-2-yl isocyanate | 2-(3-(prop-1-én-2-il)fenil)prop-2-il-izocianát | 402-440-2 | 2094-99-7 | Acute
Tox. 2 * STOT RE 2 * Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H373 ** H314 H334 H317 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H330 H314 H373 ** H334 H317 H410 |
CLP00 | |||
| 006-076-00-1 | mancozeb (ISO); manganese ethylenebis(dithiocarbamate) (polymeric) complex with zinc salt | mankozeb
(ISO); mangán-etilén-bisz(ditiokarbamát) (polimer)komplex cinksóval |
- | 8018-01-7 | Repr.
2 Skin Sens. 1 Aquatic Acute 1 |
H361d
*** H317 H400 |
GHS08 GHS07 GHS09 Wng |
H361d
*** H317 H400 |
M=10 |
CLP00/ATP01 | ||
| 006-077-00-7 | maneb (ISO); manganese ethylenebis(dithiocarbamate) (polymeric) | maneb
(ISO); mangán etilén-bisz(ditiokarbamát) (polimer) |
235-654-8 | 12427-38-2 | Repr.
2 Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361d
*** H332 H319 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361d
*** H332 H319 H317 H410 |
M=10 |
CLP00/ATP01 | ||
| 006-078-00-2 | zineb (ISO); zinc ethylenebis(dithiocarbamate) (polymeric) | zineb
(ISO); cink-etilén-bisz(ditiokarbamát)(polimer) |
235-180-1 | 12122-67-7 | STOT
SE 3 Skin Sens. 1 |
H335 H317 |
GHS07 Wng |
H335 H317 |
CLP00 | |||
| 006-079-00-8 | disulfiram; tetraethylthiuramdisulfide | diszulfiram; tetraetiltiuram-diszulfid |
202-607-8 | 97-77-8 | Acute
Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H317 H410 |
CLP00 | |||
| 006-080-00-3 | tetramethylthiuram monosulphide | tetrametiltiuram-monoszulfid | 202-605-7 | 97-74-5 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
CLP00 | |||
| 006-081-00-9 | zinc bis(dibutyldithiocarbamate) | cink-bisz(dibutilditiokarbamát) | 205-232-8 | 136-23-2 | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H335 H315 H319 H317 H400 H410 |
GHS07 GHS09 Wng |
H319 H335 H315 H317 H410 |
CLP00 | |||
| 006-082-00-4 | zinc bis(diethyldithiocarbamate) | cink-bisz(dietilditiokarbamát) | 238-270-9 | 14324-55-1 | Acute
Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H335 H315 H319 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H335 H315 H317 H410 |
CLP00 | |||
| 006-083-00-X | butocarboxim (ISO); 3-(methylthio)-2-butanone O-[(methylamino)carbonyl]oxime | butokarboxim
(ISO); 3-(metiltio)-2-butanon-O-[(metilamino)karbonil]oxim |
252-139-3 | 34681-10-2 | Flam.
Liq. 3 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H331 H311 H301 H319 H400 H410 |
GHS02 GHS06 GHS09 Dgr |
H226 H331 H311 H301 H319 H410 |
CLP00 | |||
| 006-084-00-5 | carbosulfan (ISO); 2,3-dihydro-2,2-dimethyl-7-benzofuryl [(dibutylamino)thio]methylcarbamate | karboszulfán
(ISO); 2,3-dihidro-2,2-dimetil-7-benzofuril-[(dibutilamino)tio]-metilkarbamát |
259-565-9 | 55285-14-8 | Acute
Tox. 2 * Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H301 H317 H400 H410 |
GHS06 GHS09 Dgr |
H330 H301 H317 H410 |
CLP00/ATP01 | |||
| 006-085-00-0 | fenobucarb (ISO); 2-butylphenyl methylcarbamate | fenobukarb
(ISO); 2-butilfenil-metilkarbamát |
223-188-8 | 3766-81-2 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | |||
| 006-086-00-6 | fenoxycarb (ISO); ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate | fenoxikarb
(ISO); etil-[2-(4-fenoxifenoxi)etil]karbamát |
276-696-7 | 72490-01-8 | Carc.
2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
M=1 M=10000 |
CLP00/ATP06 | ||
| 006-087-00-1 | furathiocarb (ISO); 2,3-dihydro-2,2-dimethyl-7-benzofuryl 2,4-dimethyl-6-oxa-5-oxo-3-thia-2,4-diazadecanoate | furatiokarb
(ISO); 2,3-dihidro-2,2-dimetil-7-benzofuril-2,4-dimetil-6-oxa-5-oxo-3-tia-2,4-diaza-dekanoát |
265-974-3 | 65907-30-4 | Acute
Tox. 2 * Acute Tox. 3 * STOT RE 2 * Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H301 H373 ** H315 H319 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H301 H330 H315 H319 H317 H373 ** H410 |
M=100 |
CLP00/ATP01corr | ||
| 006-088-00-7 | benfuracarb (ISO); ethyl N-[2,3-dihydro-2,2-dimethylbenzofuran-7-yloxycarbonyl(methyl)aminothio]-N-isopropyl- β-alaninate | benfurakarb
(ISO); etil-N-[2,3-dihidro-2,2-dimetil-benzofurán-7-il-oxi-karbonil(metil)aminotio]-N-izopropil-ß-alaninát |
- | 82560-54-1 | Repr.
2 Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H361f
*** H331 H302 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H361f
*** H331 H302 H410 |
CLP00/ATP01 | |||
| 006-090-00-8 | 2-(3-iodoprop-2-yn-1-yloxy)ethyl phenylcarbamate | 2-(3-jód-prop-2-in-1-il-oxi)etil-fenilkarbamát | 408-010-0 | 88558-41-2 | Acute
Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H332 H318 H412 |
GHS05 GHS07 Dgr |
H332 H318 H412 |
CLP00 | |||
| 006-091-00-3 | propineb (ISO); polymeric zinc propylenebis(dithiocarbamate) | propineb
(ISO); polimer cink-propilén-bisz(ditiokarbamát) |
- | 9016-72-2 | Acute
Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 |
H332 H373 ** H317 H400 |
GHS08 GHS07 GHS09 Wng |
H332 H373 ** H317 H400 |
ATP01 | |||
| 006-092-00-9 | tert-butyl (1S)-N-[1-((2S)-2-oxiranyl)-2-phenylethyl]carbamate | terc-butil-(1S)-N-[1-((2S)-2-oxiranil)-2-fenil-etil]karbamát | 425-420-5 | 98737-29-2 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
ATP01 | |||
| 006-093-00-4 | 2,2'-dithio di(ethylammonium)-bis(dibenzyldithiocarbamate) | 2,2'-ditio-di(etil-ammónium)-bisz(dibenzil-ditiokarbamát) | 427-180-7 | - | Acute
Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
ATP01 | |||
| 006-094-00-X | O-isobutyl-N-ethoxy carbonylthiocarbamate | O-izobutil-N-etoxikarbonil-tiokarbamát | 434-350-4 | 103122-66-3 | Flam.
Liq. 3 Carc. 1B Muta. 1B Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Chronic 2 |
H226 H350 H340 H302 H373 ** H317 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H226 H350 H340 H302 H373 ** H317 H411 |
ATP01 | |||
| 006-095-00-5 | fosetyl-aluminium (ISO); aluminium triethyl triphosphonate | foszetil-alumínium
(ISO); alumínium-trietil-trifoszfonát |
254-320-2 | 39148-24-8 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 006-096-00-0 | chlorpropham (ISO); isopropyl 3-chlorocarbanilate | klórprofám
(ISO); izopropil-3-klór-karbanilát |
202-925-7 | 101-21-3 | Carc.
2 STOT RE 2 * Aquatic Chronic 2 |
H351 H373 ** H411 |
GHS08 GHS09 Wng |
H351 H373 ** H411 |
ATP01 | |||
| 006-097-00-6 | 1-phenyl-3-(p-toluenesulfonyl)urea | 1-fenil-3-(p-toluolszulfonil)karbamid | 424-620-1 | 13909-63-2 | Acute
Tox. 4 * STOT RE 2 * Aquatic Chronic 3 |
H302 H373 ** H412 |
GHS08 GHS07 Wng |
H302 H373 ** H412 |
ATP01 | |||
| 006-098-00-1 | tert-butyl (1R,5S)-3-azabicyclo[3.1.0]hex-6-ylcarbamate | terc-butil-(1R,5S)-3-azabiciklo[3.1.0]hex-6-ilkarbamát | 429-170-8 | 134575-17-0 | Acute
Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 |
H302 H373 ** H318 H317 |
GHS05 GHS08 GHS07 Dgr |
H302 H318 H317 H373 ** |
ATP01/ATP01corr | |||
| 006-099-00-7 | N-(p-toluenesulfonyl)-N'-(3-(p-toluenesulfonyloxy)phenyl)urea; 3-({[(4-methylphenyl)sulfonyl]carbamoyl}amino)phenyl 4-methylbenzenesulfonate | N-(p-toluolszulfonil)-N'-(3-(p-toluolszulfoniloxi)fenil)karbamid; 3-][(4-metilfenil)szulfonil]karbamoil}amino)fenil-4-metil-benzol szulfonát |
432-520-2 | 232938-43-1 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
ATP01 | |||
| 006-101-00-6 | reaction mass of: N,N''-(methylenedi-4,1-phenylene)bis[N'-phenylurea]; N-(4-[[4-[[(phenylamino)carbonyl]amino]phenylmethyl]phenyl]-N'-cyclohexylurea; N,N''-(methylenedi-4,1-phenylene)bis[N'-cyclohexylurea] | a
következő anyagok keveréke: N,
N''-(metilén-di-4,1-fenilén)bisz[N'-fenilkarbamid]; N-(4-[[4-[[(fenilamino)karbonil]amino]fenilmetil]fenil]-N'-ciklohexilkarbamid; N, N''-(metilén-di-4,1-fenilén)bisz[N'-ciklohexilkarbamid] |
423-070-8 | - | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 006-102-00-1 | O-hexyl-N-ethoxycarbonylthiocarbamate | O-hexil-N-etoxikarbonil-tiokarbamát | 432-750-3 | - | Carc.
1B Muta. 1B Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Chronic 2 |
H350 H340 H302 H373 ** H317 H411 |
GHS08 GHS07 GHS09 Dgr |
H350 H340 H302 H373 ** H317 H411 |
ATP01 | |||
| 006-103-00-7 | N,N''-(methylenedi-4,1-phenylene)bis[N'-octyl]urea | N, N′′-(metilén-di-4,1-fenilén)-bisz[N′-oktil]karbamid | 445-760-8 | - | Eye
Dam. 1 Resp. Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H334 H400 H410 |
GHS05 GHS08 GHS09 Dgr |
H318 H334 H410 |
M=100 |
ATP01 | ||
| 007-001-00-5 | ammonia, anhydrous | ammónia, vízmentes | 231-635-3 | 7664-41-7 | Flam.
Gas 2 Press. Gas Acute Tox. 3 * Skin Corr. 1B Aquatic Acute 1 |
H221 H331 H314 H400 |
GHS04 GHS06 GHS05 GHS09 Dgr |
H221 H331 H314 H400 |
U | CLP00 | ||
| 007-001-01-2 | ammonia ....% | ammónia ….% | 215-647-6 | 1336-21-6 | Skin
Corr. 1B Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
STOT
SE 3; H335: C ≥ 5 % |
B | CLP00 | |
| 007-002-00-0 | nitrogen
dioxide [1] dinitrogen tetraoxide [2] |
nitrogén-dioxid;
[1] dinitrogén-tetraoxid [2] |
233-272-6
[1] 234-126-4 [2] |
10102-44-0
[1] 10544-72-6 [2] |
Ox.
Gas 1 Press. Gas Acute Tox. 2 * Skin Corr. 1B |
H270 H330 H314 |
GHS04 GHS03 GHS06 GHS05 Dgr |
H270 H330 H314 |
* STOT SE 3; H335: C ≥ 0,5 % |
5 | CLP00/ATP01 | |
| 007-003-00-6 | chlormequat chloride (ISO); 2-chloroethyltrimethylammonium chloride | klórmekvát-klorid
(ISO); 2-klóretil-trimetilammónium-klorid |
213-666-4 | 999-81-5 | Acute
Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
CLP00 | |||
| 007-004-00-1 | nitric acid ...% [C > 70 %] | salétromsav …% | 231-714-2 | 7697-37-2 | Ox.
Liq. 2 Acute Tox. 1 Skin Corr. 1A |
H272 H330 H314 |
GHS03 GHS06 GHS05 Dgr |
H272 H330 H314 |
EUH071 |
Ox.
Liq. 2; H272: C ≥ 99 % Ox. Liq. 3; H272: 70 % ≤ C < 99 % |
B | CLP00/ATP15 |
| 007-006-00-2 | ethyl nitrite | etil-nitrit | 203-722-6 | 109-95-5 | Flam.
Gas 1 Press. Gas Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H220 H332 H312 H302 |
GHS02 GHS04 GHS07 Dgr |
H220 H332 H312 H302 |
U | CLP00 | ||
| 007-007-00-8 | ethyl nitrate | etil-nitrát | 210-903-3 | 625-58-1 | Unst.
Expl. |
H200 |
GHS01 Dgr |
H200 |
CLP00/ATP01corr | |||
| 007-008-00-3 | hydrazine | hidrazin | 206-114-9 | 302-01-2 | Flam.
Liq. 3 Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H350 H331 H311 H301 H314 H317 H400 H410 |
GHS02 GHS06 GHS08 GHS05 GHS09 Dgr |
H226 H350 H331 H311 H301 H314 H317 H410 |
Skin
Corr. 1B; H314: C ≥ 10 % Skin Irrit. 2; H315: 3 % ≤ C < 10 % Eye Irrit. 2; H319: 3 % ≤ C < 10 % |
CLP00 | ||
| 007-009-00-9 | dicyclohexylammonium nitrite | diciklohexil-ammónium-nitrit | 221-515-9 | 3129-91-7 | Acute
Tox. 4 * Acute Tox. 4 * |
H332 H302 |
GHS07 Wng |
H332 H302 |
* |
CLP00 | ||
| 007-010-00-4 | sodium nitrite | nátrium-nitrit | 231-555-9 | 7632-00-0 | Ox.
Sol. 3 Acute Tox. 3 * Aquatic Acute 1 |
H272 H301 H400 |
GHS03 GHS06 GHS09 Dgr |
H272 H301 H400 |
* |
CLP00 | ||
| 007-011-00-X | potassium nitrite | kálium-nitrit | 231-832-4 | 7758-09-0 | Ox.
Sol. 2 Acute Tox. 3 * Aquatic Acute 1 |
H272 H301 H400 |
GHS03 GHS06 GHS09 Dgr |
H272 H301 H400 |
* |
CLP00 | ||
| 007-012-00-5 | N,N-dimethylhydrazine | N,N-dimetilhidrazin | 200-316-0 | 57-14-7 | Flam.
Liq. 2 Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Aquatic Chronic 2 |
H225 H350 H331 H301 H314 H411 |
GHS02 GHS06 GHS08 GHS05 GHS09 Dgr |
H225 H350 H331 H301 H314 H411 |
CLP00 | |||
| 007-013-00-0 | 1,2-dimethylhydrazine | 1,2-dimetilhidrazin | 540-73-8 | Carc.
1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Chronic 2 |
H350 H331 H311 H301 H411 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H311 H301 H411 |
Carc.
1B; H350: C ≥ 0,01 % |
CLP00 | |||
| 007-014-00-6 | salts of hydrazine | hidrazin sói | Carc.
1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H331 H311 H301 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H311 H301 H317 H410 |
A | CLP00 | ||||
| 007-015-00-1 | O-ethylhydroxylamine | O-etil-hidroxilamin | 402-030-3 | 624-86-2 | Flam.
Liq. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 |
H225 H331 H311 H301 H372 ** H319 H317 H400 |
GHS02 GHS06 GHS08 GHS09 Dgr |
H225 H331 H311 H301 H372 ** H319 H317 H400 |
CLP00 | |||
| 007-016-00-7 | butyl nitrite | butil-nitrit | 208-862-1 | 544-16-1 | Flam.
Liq. 2 Acute Tox. 3 * Acute Tox. 3 * |
H225 H331 H301 |
GHS02 GHS06 Dgr |
H225 H331 H301 |
CLP00 | |||
| 007-017-00-2 | isobutyl nitrite | izobutilnitrit | 208-819-7 | 542-56-3 | Flam.
Liq. 2 Carc. 1B Muta. 2 Acute Tox. 4 * Acute Tox. 4 * |
H225 H350 H341 H332 H302 |
GHS02 GHS08 GHS07 Dgr |
H225 H350 H341 H332 H302 |
CLP00 | |||
| 007-018-00-8 | sec-butyl nitrite | szek-butil-nitrit | 213-104-8 | 924-43-6 | Flam.
Liq. 2 Acute Tox. 4 * Acute Tox. 4 * |
H225 H332 H302 |
GHS02 GHS07 Dgr |
H225 H332 H302 |
CLP00 | |||
| 007-019-00-3 | tert-butyl nitrite | terc-butil-nitrit | 208-757-0 | 540-80-7 | Flam.
Liq. 2 Acute Tox. 4 * Acute Tox. 4 * |
H225 H332 H302 |
GHS02 GHS07 Dgr |
H225 H332 H302 |
CLP00 | |||
| 007-020-00-9 | pentyl
nitrite [1] ‘amyl nitrite’, mixed isomers [2] |
pentil-nitrit;
[1] „amil-nitrit”, kevert izomerek [2] |
207-332-7
[1] 203-770-8 [2] |
463-04-7
[1] 110-46-3 [2] |
Flam.
Liq. 2 Acute Tox. 4 * Acute Tox. 4 * |
H225 H332 H302 |
GHS02 GHS07 Dgr |
H225 H332 H302 |
CLP00 | |||
| 007-021-00-4 | hydrazobenzene; 1,2-diphenylhydrazine | hidrazobenzol; 1,2-difenilhidrazin |
204-563-5 | 122-66-7 | Carc.
1B Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H410 |
CLP00 | |||
| 007-022-00-X | hydrazine bis(3-carboxy-4-hydroxybenzensulfonate) | hidrazin-bisz(3-karboxi-4-hidroxi-benzol-szulfonát) | 405-030-1 | Carc.
1B Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H350 H302 H314 H317 H412 |
GHS08 GHS05 GHS07 Dgr |
H350 H302 H314 H317 H412 |
CLP00 | ||||
| 007-023-00-5 | sodium 3,5-bis(3-(2,4-di-tert-pentylphenoxy)propylcarbamoyl)benzenesulfonate | nátrium-3,5-bisz(3-(2,4-di-terc-pentilfenoxi)propilkarbamoil)benzolszulfonát | 405-510-0 | Skin
Irrit. 2 Skin Sens. 1 |
H315 H317 |
GHS07 Wng |
H315 H317 |
CLP00 | ||||
| 007-024-00-0 | 2-(decylthio)ethylammonium chloride | 2-(deciltio)etilammónium-klorid | 405-640-8 | 36362-09-1 | STOT
RE 2 * Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373
** H315 H318 H400 H410 |
GHS08 GHS05 GHS09 Dgr |
H373
** H315 H318 H410 |
CLP00 | |||
| 007-025-00-6 | (4-hydrazinophenyl)-N-methylmethanesulfonamide hydrochloride | (4-hidrazinofenil)-N-metilmetánszulfonamid-hidroklorid | 406-090-1 | 81880-96-8 | Muta.
2 Acute Tox. 3 * STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H341 H301 H372 ** H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H341 H301 H372 ** H317 H410 |
CLP00 | |||
| 007-026-00-1 | oxo-((2,2,6,6-tetramethylpiperidin-4-yl)amino)carbonylacetohydrazide | oxo-((2,2,6,6-tetrametilpiperidin-4-il)amino)karbonilaceto-hidrazid | 413-230-5 | 122035-71-6 | Eye
Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
CLP00 | |||
| 007-027-00-7 | 1,6-bis(3,3-bis((1-methylpentylidenimino)propyl)ureido)hexane | 1,6-bisz(3,3-bisz((1-metilpentilidén-imino)propil)ureido)hexán | 420-190-2 | 771478-66-1 | Acute
Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H373 ** H314 H317 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H312 H302 H373 ** H314 H317 H410 |
CLP00 | |||
| 007-028-00-2 | hydroxylammonium nitrate | hidroxil-ammónium-nitrát | 236-691-2 | 13465-08-2 | Expl.
1.1 **** Carc. 2 Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 |
H201 H351 H311 H302 H373 ** H315 H319 H317 H400 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H201 H351 H311 H302 H373 ** H319 H315 H317 H400 |
ATP01 | |||
| 007-029-00-8 | diethyldimethylammonium hydroxide | dietil-dimetil-ammónium-hidroxid | 419-400-5 | 95500-19-9 | Acute
Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
ATP01 | |||
| 007-030-00-3 | nitric acid …% [C ≤ 70 %] | #HIÁNYZIK | 231-714-2 | 7697-37-2 | Ox.
Liq. 3 Acute Tox. 3 Skin Corr. 1A |
H272 H331 H314 |
GHS03 GHS06 GHS05 Dgr |
H272 H331 H314 |
EUH071 |
Inhalation:
ATE = 2.65 mg/L (Vapours) Ox. Liq. 3; H272: C ≥ 65 % Skin Corr. 1A; H314: C ≥ 20 % Skin Corr. 1B; H314: 5 % ≤ C < 20 % |
B | ATP15 |
| 008-001-00-8 | oxygen | oxigén | 231-956-9 | 7782-44-7 | Ox.
Gas 1 Press. Gas |
H270 |
GHS03 GHS04 Dgr |
H270 |
U | CLP00 | ||
| 008-003-00-9 | hydrogen peroxide solution ...% | hidrogén-peroxid oldat …% | 231-765-0 | 7722-84-1 | Ox.
Liq. 1 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H271 H332 H302 H314 |
GHS03 GHS05 GHS07 Dgr |
H271 H332 H302 H314 |
Ox.
Liq. 1; H271: C ≥ 70 %**** Ox. Liq. 2; H272: 50 % ≤ C < 70 % **** * Skin Corr. 1A; H314: C ≥ 70 % Skin Corr. 1B; H314: 50 % ≤ C < 70 % Skin Irrit. 2; H315: 35 % ≤ C < 50 % Eye Dam. 1; H318: 8 % ≤ C < 50 % Eye Irrit. 2; H319: 5 % ≤ C < 8 % STOT SE 3; H335; C ≥ 35 % |
B | CLP00 | |
| 009-001-00-0 | fluorine | fluor | 231-954-8 | 7782-41-4 | Ox.
Gas 1 Press. Gas Acute Tox. 2 * Skin Corr. 1A |
H270 H330 H314 |
GHS04 GHS03 GHS06 GHS05 Dgr |
H270 H330 H314 |
CLP00/ATP01 | |||
| 009-002-00-6 | hydrogen fluoride | hidrogén-fluorid | 231-634-8 | 7664-39-3 | Acute
Tox. 1 Acute Tox. 2 * Acute Tox. 2 * Skin Corr. 1A |
H310 H330 H300 H314 |
GHS06 GHS05 Dgr |
H330 H310 H300 H314 |
CLP00 | |||
| 009-003-00-1 | hydrofluoric acid ... % | fluorsav …% | 231-634-8 | 7664-39-3 | Acute
Tox. 1 Acute Tox. 2 * Acute Tox. 2 * Skin Corr. 1A |
H310 H330 H300 H314 |
GHS06 GHS05 Dgr |
H330 H310 H300 H314 |
Skin
Corr. 1A; H314: C ≥ 7 % Skin Corr. 1B; H314: 1 % ≤ C < 7 % Eye Irrit. 2; H319: 0,1 % ≤ C < 1 % |
B | CLP00 | |
| 009-004-00-7 | sodium fluoride | nátrium-fluorid | 231-667-8 | 7681-49-4 | Acute
Tox. 3 * Skin Irrit. 2 Eye Irrit. 2 |
H301 H315 H319 |
GHS06 Dgr |
H301 H319 H315 |
EUH032 |
CLP00 | ||
| 009-005-00-2 | potassium fluoride | kálium-fluorid | 232-151-5 | 7789-23-3 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
CLP00 | |||
| 009-006-00-8 | ammonium fluoride | ammónium-fluorid | 235-185-9 | 12125-01-8 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
CLP00 | |||
| 009-007-00-3 | sodium bifluoride; sodium hydrogen difluoride | nátrium-bifluorid; nátrium-hidrogén-difluorid |
215-608-3 | 1333-83-1 | Acute
Tox. 3 * Skin Corr. 1B |
H301 H314 |
GHS06 GHS05 Dgr |
H301 H314 |
* Skin Corr. 1B; H314: C ≥ 1 % Skin Irrit. 2; H315: 0,1 % ≤ C < 1 % Eye Irrit. 2; H319: 0,1 % ≤ C < 1 % |
CLP00 | ||
| 009-008-00-9 | potassium bifluoride; potassium hydrogen difluoride | kálium-bifluorid; kálium-hidrogén-difluorid |
232-156-2 | 7789-29-9 | Acute
Tox. 3 * Skin Corr. 1B |
H301 H314 |
GHS06 GHS05 Dgr |
H301 H314 |
* Skin Corr. 1B; H314: C ≥ 1 % Skin Irrit. 2; H315: 0,1 % ≤ C < 1 % Eye Irrit. 2; H319: 0,1 % ≤ C < 1 % |
CLP00 | ||
| 009-009-00-4 | ammonium bifluoride; ammonium hydrogen difluoride | ammónium-bifluorid; ammónium-hidrogén-difluorid |
215-676-4 | 1341-49-7 | Acute
Tox. 3 * Skin Corr. 1B |
H301 H314 |
GHS06 GHS05 Dgr |
H301 H314 |
* Skin Corr. 1B; H314: C ≥ 1 % Skin Irrit. 2; H315: 0,1 % ≤ C < 1 % Eye Irrit. 2; H319: 0,1 % ≤ C < 1 % |
CLP00 | ||
| 009-010-00-X | fluoroboric acid ... % | fluorbórsav … % | 240-898-3 | 16872-11-0 | Skin
Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
Skin
Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 10 % ≤ C < 25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
B | CLP00 | |
| 009-011-00-5 | fluorosilicic acid ... % | fluorkovasav … % | 241-034-8 | 16961-83-4 | Skin
Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
B | CLP00 | ||
| 009-012-00-0 | alkali
fluorosilicates(Na) [1] alkali fluorosilicates(K) [2] alkali fluorosilicates(NH4) [3] |
alkáli-fluorszilikátok
(Na); [1] alkáli-fluorszilikátok (K); [2] alkáli-fluorszilikátok (NH4) [3] |
240-934-8
[1] 240-896-2 [2] 240-968-3 [3] |
16893-85-9
[1] 16871-90-2 [2] 16919-19-0 [3] |
Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
* |
A | CLP00 | |
| 009-013-00-6 | fluorosilicates, with the exception of those specified elsewhere in this annex | fluorszilikátok, kivéve az e mellékletben külön szereplőket | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
* |
A | CLP00 | |||
| 009-014-00-1 | lead hexafluorosilicate | ólom-hexafluorszilikát | 247-278-1 | 25808-74-6 | Repr.
1A Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H332 H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H360Df H332 H302 H373 ** H410 |
1 | CLP00 | ||
| 009-015-00-7 | sulphuryl difluoride | szulfuril-difluorid | 220-281-5 | 2699-79-8 | Press.
Gas Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 |
H331 H373 ** H400 |
GHS04 GHS06 GHS08 GHS09 Dgr |
H331 H373 ** H400 |
U | CLP00 | ||
| 009-016-00-2 | trisodium
hexafluoroaluminate [1] trisodium hexafluoroaluminate (cryolite) [2] |
trinátrium-hexafluoraluminát
[1] trinátrium-hexafluoraluminát (kriolit) [2] |
237-410-6
[1] 239-148-8 [2] |
13775-53-6
[1] 15096-52-3 [2] |
Acute
Tox. 4 STOT RE 1 Aquatic Chronic 2 |
H332 H372 H411 |
GHS07 GHS08 GHS09 Dgr |
H372 H332 H411 |
CLP00/ATP03 | |||
| 009-017-00-8 | potassium mu-fluoro-bis(triethylaluminium) | kálium-mu-fluorbisz(trietil-alumínium) | 400-040-2 | 12091-08-6 | Flam.
Sol. 1 Water-react. 1 Acute Tox. 4 * Skin Corr. 1A |
H228 H260 H332 H314 |
GHS02 GHS05 GHS07 Dgr |
H228 H260 H332 H314 |
EUH014 |
T | CLP00 | |
| 009-018-00-3 | magnesium hexafluorosilicate | magnézium-hexafluorszilikát | 241-022-2 | 16949-65-8 | Acute
Tox. 3 * |
H301 |
GHS06 Dgr |
H301 |
* |
CLP00 | ||
| 011-001-00-0 | sodium | nátrium | 231-132-9 | 7440-23-5 | Water-react.
1 Skin Corr. 1B |
H260 H314 |
GHS02 GHS05 Dgr |
H260 H314 |
EUH014 |
CLP00 | ||
| 011-002-00-6 | sodium hydroxide; caustic soda | nátrium
hidroxid; marónátron |
215-185-5 | 1310-73-2 | Skin
Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
Skin
Corr. 1A; H314: C ≥ 5 % Skin Corr. 1B; H314: 2 % ≤ C < 5 % Skin Irrit. 2; H315: 0,5 % ≤ C < 2 % Eye Irrit. 2; H319: 0,5 % ≤ C < 2 % |
CLP00 | ||
| 011-003-00-1 | sodium peroxide | nátrium-peroxid | 215-209-4 | 1313-60-6 | Ox.
Sol. 1 Skin Corr. 1A |
H271 H314 |
GHS03 GHS05 Dgr |
H271 H314 |
CLP00 | |||
| 011-004-00-7 | sodium azide | nátrium-azid | 247-852-1 | 26628-22-8 | Acute
Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H400 H410 |
GHS06 GHS09 Dgr |
H300 H400 H410 |
EUH032 |
CLP00 | ||
| 011-005-00-2 | sodium carbonate | nátrium-karbonát | 207-838-8 | 497-19-8 | Eye
Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
CLP00 | |||
| 011-006-00-8 | sodium cyanate | nátrium-cianát | 213-030-6 | 917-61-3 | Acute
Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
CLP00 | |||
| 011-007-00-3 | propoxycarbazone-sodium | propoxikarbazon-nátrium | 181274-15-7 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
M=10 |
CLP00 | |||
| 012-001-00-3 | magnesium powder (pyrophoric) | magnéziumpor (pirofóros) | 231-104-6 | 7439-95-4 | Pyr.
Sol. 1 Water-react. 1 |
H250 H260 |
GHS02 Dgr |
H260 H250 |
T | CLP00 | ||
| 012-002-00-9 | magnesium, powder or turnings | magnézium, por vagy forgács | 231-104-6 | Flam.
Sol. 1 Self-heat. 1 Water-react. 2 |
H228 H252 H261 |
GHS02 Dgr |
H228 H261 H252 |
T | CLP00 | |||
| 012-003-00-4 | magnesium alkyls | magnézium-alkilek | Pyr.
Liq. 1 Water-react. 1 Skin Corr. 1B |
H250 H260 H314 |
GHS02 GHS05 Dgr |
H250 H260 H314 |
EUH014 |
A | CLP00 | |||
| 012-004-00-X | aluminium-magnesium-carbonate-hydroxide-perchlorate-hydrate | alumínium-magnézium-karbonát-hidroxid-perklorát-hidrát | 422-150-1 | - | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
ATP01 | |||
| 013-001-00-6 | aluminium powder (pyrophoric) | alumíniumpor (pirofóros) | 231-072-3 | 7429-90-5 | Pyr.
Sol. 1 Water-react. 2 |
H250 H261 |
GHS02 Dgr |
H261 H250 |
T | CLP00 | ||
| 013-002-00-1 | aluminium powder (stabilised) | alumínium por (stabilizált) | 231-072-3 | 7429-90-5 | Flam.
Sol. 1 Water-react. 2 |
H228 H261 |
GHS02 Dgr |
H261 H228 |
T | CLP00/ATP01 | ||
| 013-003-00-7 | aluminium chloride, anhydrous | alumínium-klorid, vízmentes | 231-208-1 | 7446-70-0 | Skin
Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
CLP00 | |||
| 013-004-00-2 | aluminium alkyls | alumínium-alkilek | Pyr.
Liq. 1 Water-react. 1 Skin Corr. 1B |
H250 H260 H314 |
GHS02 GHS05 Dgr |
H250 H260 H314 |
EUH014 |
A | CLP00 | |||
| 013-005-00-8 | diethyl(ethyldimethylsilanolato)aluminium | dietil(etildimetilszilánoláto)alumínium | 401-160-8 | 55426-95-4 | Pyr.
Liq. 1 Water-react. 1 Skin Corr. 1A |
H250 H260 H314 |
GHS02 GHS05 Dgr |
H260 H250 H314 |
EUH014 |
CLP00 | ||
| 013-006-00-3 | (ethyl-3-oxobutanoato-O'1,O'3)(2-dimethylaminoethanolato)(1-methoxypropan-2-olato)aluminium(III), dimerised | (etil-3-oxobutanoáto- O'1,O'3)(2-dimetilaminoetanoláto)(1-metoxipropán-2-oláto)alumínium(III), dimer | 402-370-2 | Flam.
Liq. 3 Eye Dam. 1 |
H226 H318 |
GHS02 GHS05 Dgr |
H226 H318 |
CLP00 | ||||
| 013-007-00-9 | poly(oxo(2-butoxyethyl-3-oxobutanoato-O'1,O'3)aluminium) | poli(oxo(2-butoxietil-3-oxobutanoáto-O'1,O'3)alumínium) | 403-430-0 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | ||||
| 013-008-00-4 | di-n-octylaluminium iodide | di-n-oktil-alumínium-jodid | 408-190-0 | 7585-14-0 | Pyr.
Liq. 1 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H250 H314 H400 H410 |
GHS02 GHS05 GHS09 Dgr |
H250 H314 H410 |
EUH014 |
CLP00 | ||
| 013-009-00-X | sodium((n-butyl)x(ethyl)y-1,5-dihydro)aluminate) x = 0,5, y = 1,5 | nátrium((n-butil)x(etil)y-1,5-dihidro)aluminát) x = 0,5, y = 1,5 | 418-720-2 | Flam.
Sol. 1 Pyr. Sol. 1 Water-react. 1 Acute Tox. 4 * Skin Corr. 1A |
H228 H250 H260 H332 H314 |
GHS02 GHS05 GHS07 Dgr |
H228 H260 H250 H332 H314 |
EUH014 |
T | CLP00 | ||
| 013-010-00-5 | hydroxy aluminium bis(2,4,8,10-tetra-tert-butyl-6-hydroxy-12H-dibenzo[d,g][1.3.2]dioxaphosphocin-6-oxide) | hidroxi-alumínium-bisz-(2,4,8,10-tetra-terc-butil-6-hidroxi-12H-dibenzo[d, g][1.3.2]dioxa-foszfocin-6-oxid) | 430-650-4 | 151841-65-5 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
ATP01 | |||
| 014-001-00-9 | trichlorosilane | triklórszilán | 233-042-5 | 10025-78-2 | Flam.
Liq. 1 Pyr. Liq. 1 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H224 H250 H332 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H224 H250 H332 H302 H314 |
EUH014 EUH029 |
* STOT SE 3; H335: C ≥ 1 % |
T | CLP00 |
| 014-002-00-4 | silicon tetrachloride | szilícium-tetraklorid | 233-054-0 | 10026-04-7 | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 |
H335 H315 H319 |
GHS07 Wng |
H319 H335 H315 |
EUH014 |
CLP00 | ||
| 014-003-00-X | dimethyldichlorosilane | dimetil-diklór-szilán | 200-901-0 | 75-78-5 | Flam.
Liq. 2 STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 |
H225 H335 H315 H319 |
GHS02 GHS07 Dgr |
H225 H319 H335 H315 |
CLP00 | |||
| 014-004-00-5 | trichloro(methyl)silane; methyltrichlorosilane | triklór(metil)szilán; metil-triklór-szilán |
200-902-6 | 75-79-6 | Flam.
Liq. 2 STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 |
H225 H335 H315 H319 |
GHS02 GHS07 Dgr |
H225 H319 H335 H315 |
EUH014 |
Skin
Irrit. 2; H315: C ≥ 1 % Eye Irrit. 2; H319: C ≥ 1 % STOT SE 3; H335: C ≥ 1 % |
CLP00 | |
| 014-005-00-0 | tetraethyl silicate; ethyl silicate | tetraetil-szilikát; etil-szilikát |
201-083-8 | 78-10-4 | Flam.
Liq. 3 Acute Tox. 4 * STOT SE 3 Eye Irrit. 2 |
H226 H332 H335 H319 |
GHS02 GHS07 Wng |
H226 H332 H319 H335 |
CLP00 | |||
| 014-006-00-6 | bis(4-fluorophenyl)-methyl-(1,2,4-triazol-4-ylmethyl)silane hydrochloride | bisz(4-fluorfenil)-(metil)-(1,2,4-triazol-4-ilmetil)szilán-hidroklorid | 401-380-4 | Eye
Irrit. 2 Aquatic Chronic 2 |
H319 H411 |
GHS07 GHS09 Wng |
H319 H411 |
CLP00 | ||||
| 014-007-00-1 | triethoxyisobutylsilane | trietoxi-izobutil-szilán | 402-810-3 | 17980-47-1 | Skin
Irrit. 2 |
H315 |
GHS07 Wng |
H315 |
CLP00 | |||
| 014-008-00-7 | (chloromethyl)bis(4-fluorophenyl)methylsilane | (klórmetil)bisz(4-fluorfenil)metilszilán | 401-200-4 | 85491-26-5 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 014-009-00-2 | isobutylisopropyldimethoxysilane | izobutil-izopropil-dimetoxiszilán | 402-580-4 | 111439-76-0 | Flam.
Liq. 3 Acute Tox. 4 * Skin Irrit. 2 |
H226 H332 H315 |
GHS02 GHS07 Wng |
H226 H332 H315 |
CLP00 | |||
| 014-010-00-8 | disodium metasilicate | dinátrium-metaszilikát | 229-912-9 | 6834-92-0 | STOT
SE 3 Skin Corr. 1B |
H335 H314 |
GHS05 GHS07 Dgr |
H314 H335 |
CLP00 | |||
| 014-011-00-3 | cyclohexyldimethoxymethylsilane | ciklohexil-dimetoxi-metilszilán | 402-140-1 | 17865-32-6 | Skin
Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
CLP00 | |||
| 014-012-00-9 | bis(3-(trimethoxysilyl)propyl)amine | bisz(3-(trimetoxiszilil)propil)amin | 403-480-3 | Eye
Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
CLP00 | ||||
| 014-013-00-4 | α-hydroxypoly(methyl-(3-(2,2,6,6-tetramethylpiperidin-4-yloxy)propyl)siloxane) | α-hidroxipoli(metil-(3-(2,2,6,6-tetrametilpiperidin-4-iloxi)propil)sziloxán) | 404-920-7 | Acute
Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 2 |
H312 H302 H314 H411 |
GHS05 GHS07 GHS09 Dgr |
H312 H302 H314 H411 |
CLP00 | ||||
| 014-014-00-X | etacelasil (ISO); 6-(2-chloroethyl)-6-(2-methoxyethoxy)-2,5,7,10-tetraoxa-6-silaundecane | etacelaszil
(ISO); 6-(2-klóretil)-6-(2-metoxietoxi)-2,5,7,10-tetraoxa-6-szilaundekán |
253-704-7 | 37894-46-5 | Repr.
1B Acute Tox. 4 * STOT RE 2 * |
H360D
*** H302 H373 ** |
GHS08 GHS07 Dgr |
H360D
*** H302 H373 ** |
CLP00 | |||
| 014-015-00-5 | α-trimethylsilanyl-ω-trimethylsiloxypoly[oxy(methyl-3-(2-(2-methoxypropoxy)propoxy)propylsilanediyl]-co-oxy(dimethylsilane)) | α-trimetilszilanil-ω-trimetilsziloxopoli[oxi(metil-3-(2-(2-metoxipropoxi)propoxi)propilszilándiil]-ko-oxi(dimetilszilán)) | 406-420-4 | 69430-40-6 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 014-016-00-0 | reaction mass of: 1,3-dihex-5-en-1-yl-1,1,3,3-tetramethyldisiloxane; 1,3-dihex-n-en-1-yl-1,1,3,3-tetramethyldisiloxane | 1,3-dihex-5-én-1-il-1,1,3,3-tetrametildisziloxán; 1,3-dihex-n-én-1-il-1,1,3,3-tetrametildisziloxán keveréke |
406-490-6 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | ||||
| 014-017-00-6 | flusilazole (ISO); bis(4-fluorophenyl)(methyl)(1H-1,2,4-triazol-1-ylmethyl)silane | fluszilazol
(ISO); bisz(4-fluorfenil)(metil)(1H-1,2,4-triazol-1-ilmetil)szilán |
85509-19-9 | Carc.
2 Repr. 1B Acute Tox. 4 * Aquatic Chronic 2 |
H351 H360D *** H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H351 H360D *** H302 H411 |
CLP00 | ||||
| 014-018-00-1 | octamethylcyclotetrasiloxane; [D4] | oktametil-ciklotetrasziloxán | 209-136-7 | 556-67-2 | Repr.
2 Aquatic Chronic 1 |
H361f
*** H410 |
GHS08 GHS09 Wng |
H361f
*** H410 |
M=10 |
CLP00/ATP15 | ||
| 014-019-00-7 | reaction mass of: 4-[[bis-(4-fluorophenyl)methylsilyl]methyl]-4H-1,2,4-triazole; 1-[[bis-(4-fluorophenyl)methylsilyl]methyl]-1H-1,2,4-triazole | 4-[[bisz-(4-fluorfenil)metilszilil)metil]-4H-1,2,4-triazol; 1-[[bisz-(4-fluorfenil)metil-szilil]metil]-1H-1,2,4-triazol keveréke |
403-250-2 | Carc.
2 Repr. 1B Acute Tox. 4 * Aquatic Chronic 2 |
H351 H360D *** H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H351 H360D *** H302 H411 |
CLP00 | ||||
| 014-020-00-2 | bis(1,1-dimethyl-2-propynyloxy)dimethylsilane | bisz(1,1-dimetil-2-propiniloxi)dimetilszilán | 414-960-7 | 53863-99-3 | Acute
Tox. 4 * |
H332 |
GHS07 Wng |
H332 |
CLP00 | |||
| 014-021-00-8 | tris(isopropenyloxy)phenyl silane | trisz(izopropeniloxi)fenilszilán | 411-340-8 | 52301-18-5 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H400 H410 |
CLP00 | |||
| 014-022-00-3 | reaction product of: (2-hydroxy-4-(3-propenoxy)benzophenone and triethoxysilane) with (hydrolysis product of silica and methyltrimethoxysilane) | a következő anyagok reakcióterméke: (2-hidroxi-4-(3-propénoxi)benzofenon és trietoxiszilán) és (szilícium-dioxid és metil-trimetoxiszilán hidrolízis terméke) | 401-530-9 | Flam.
Sol. 1 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT SE 1 |
H228 H332 H312 H302 H370 ** |
GHS02 GHS08 GHS07 Dgr |
H228 H370 ** H332 H312 H302 |
T | CLP00 | |||
| 014-023-00-9 | α, ω-dihydroxypoly(hex-5-en-1-ylmethylsiloxane)hoxysilane with (hydrolysis product of silica and methyltrimethoxysilane)iazole | α, ω-dihidroxipoli(hex-5-én-1-ilmetilsziloxán)oxiszilán és (szilícium-dioxid és metiltrimetoxiszilán)iazole | 408-160-7 | 125613-45-8 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 014-024-00-4 | 1-((3-(3-chloro-4-fluorophenyl)propyl)dimethylsilanyl)-4-ethoxybenzene | 1-[[3-(3-klór-4-fluorfenil)propil] dimetilszilanil]-4-etoxibenzol | 412-620-2 | 121626-74-2 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 014-025-00-X | 4-[3-(diethoxymethylsilylpropoxy)-2,2,6,6-tetramethyl]piperidine | 4-[3-(dietoxi-metil-szili-propoxi)-2,2,6,6-tetrametil]piperidin | 411-400-3 | 102089-33-8 | Acute
Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H302 H373 ** H315 H318 H412 |
GHS08 GHS05 GHS07 Dgr |
H302 H373 ** H315 H318 H412 |
CLP00 | |||
| 014-026-00-5 | dichloro-(3-(3-chloro-4-fluorophenyl)propyl)methylsilane | diklór-(3-(3-klór-4-fluorfenil)propil)metilszilán | 407-180-3 | 770722-36-6 | Skin
Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
CLP00 | |||
| 014-027-00-0 | chloro(3-(3-chloro-4-fluorophenyl)propyl)dimethylsilane | klór(3-(3-klór-4-fluorfenil)propil)dimetilszilán | 410-270-5 | 770722-46-8 | Skin
Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
CLP00 | |||
| 014-028-00-6 | α-[3-(1-oxoprop-2-eny)l-1-oxypropyl]dimethoxysilyloxy-ω-[3(1-oxoprop-2-enyl)-1-oxypropyl]dimethoxysilyl poly(dimethylsiloxane) | α-[3-(1-oxoprop-2-enil)-1-oxipropil]dimetoxiszililoxi-ω-[3(1-oxoprop-2-enil) 1-oxipropil]dimetoxiszilil-poli(dimetilsziloxán) | 415-290-8 | 193159-06-7 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 014-029-00-1 | O,O'-(ethenylmethylsilylene)di[(4-methylpentan-2-one)oxime] | O, O′-(etenilmetilszililén)-di[(4-metilpentan-2-on)-oxim] | 421-870-1 | 156145-66-3 | Repr.
2 Acute Tox. 4 * STOT RE 2 * |
H361f
*** H302 H373 ** |
GHS08 GHS07 Wng |
H361f
*** H302 H373 ** |
CLP00 | |||
| 014-030-00-7 | [(dimethylsilylene)bis((1,2,3,3a,7a-η)-1H-inden-1-ylidene)dimethyl]hafnium | [(dimetilszililén)bisz((1,2,3,3a,7a-η)-1 H-indén-1-ilidén)dimetil]-hafnium | 422-060-0 | 137390-08-0 | Acute
Tox. 2 * |
H300 |
GHS06 Dgr |
H300 |
CLP00 | |||
| 014-031-00-2 | bis(1-methylethyl)-dimethoxysilane | bisz(1-metiletil)dimetoxi szilán | 421-540-7 | 18230-61-0 | Flam.
Liq. 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H226 H315 H317 H412 |
GHS02 GHS07 Wng |
H226 H315 H317 H412 |
CLP00 | |||
| 014-032-00-8 | dicyclopentyldimethoxysilane | diciklopentil-dimetoxi-szilán | 404-370-8 | 126990-35-0 | Skin
Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H400 H410 |
GHS05 GHS09 Dgr |
H315 H318 H410 |
CLP00 | |||
| 014-033-00-3 | 2-methyl-3-(trimethoxysilyl)propyl-2-propenoate hydrolysis product with silica | 2-metil-3-(trimetoxi-szilil)propil-2-propenoát szilícium-dioxidos hidrolízisének terméke | 419-030-4 | 125804-20-8 | Flam.
Liq. 2 STOT SE 3 Eye Irrit. 2 |
H225 H336 H319 |
GHS02 GHS07 Dgr |
H225 H319 H336 |
ATP01 | |||
| 014-034-00-9 | 3-hexylheptamethyltrisiloxane | 3-hexil-heptametil-trisziloxán | 428-700-5 | 1873-90-1 | Acute
Tox. 4 * Aquatic Chronic 4 |
H332 H413 |
GHS07 Wng |
H332 H413 |
ATP01 | |||
| 014-035-00-4 | 2-(3,4-epoxycyclohexyl)ethyltriethoxy silane | 2-(3,4-epoxi-ciklohexil)etil-trietoxi-szilán | 425-050-4 | 10217-34-2 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
ATP01 | |||
| 014-036-00-X | (4-ethoxyphenyl)(3-(4-fluoro-3-phenoxyphenyl)propyl)dimethylsilane | (4-etoxifenil)(3-(4-fluor-3-fenoxifenil)propil)dimetil-szilán | 405-020-7 | 105024-66-6 | Repr.
1B Aquatic Acute 1 Aquatic Chronic 1 |
H360F
*** H400 H410 |
GHS08 GHS09 Dgr |
H360F
*** H410 |
M=1000 |
ATP01 | ||
| 014-037-00-5 | 2-butanone-O,O',O''-(phenylsilylidyne)trioxime | 2-butanon-O, O',O''-(fenilszililidin)trioxim | 433-360-6 | 34036-80-1 | STOT
RE 2 * Skin Sens. 1 Aquatic Chronic 3 |
H373
** H317 H412 |
GHS08 GHS07 Wng |
H373
** H317 H412 |
ATP01 | |||
| 014-038-00-0 | S-(3-(triethoxysilyl)propyl)octanethioate | S-(3-(trietoxiszilil)propil)oktán-tioát | 436-690-9 | 220727-26-4 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
ATP01 | |||
| 014-039-00-6 | (2,3-dimethylbut-2-yl)-trimethoxysilane | (2,3-dimetilbut-2-il)-trimetoxi-szilán | 439-360-2 | 142877-45-0 | Skin
Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H315 H318 H412 |
GHS05 Dgr |
H315 H318 H412 |
ATP01 | |||
| 014-041-00-7 | N,N-bis(trimethylsilyl)aminopropylmethyldiethoxysilane | N, N-bisz(trimetilszilil)amino-propilmetil-dietoxiszilán | 445-890-5 | 201290-01-9 | Acute
Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
ATP01 | |||
| 014-042-00-2 | reaction mass of: O,O',O'',O'''-silanetetrayl tetrakis(4-methyl-2-pentanone oxime) (3 stereoisomers) | O,O',O'',O'''- szilántetrail-tetrakisz(4-metil-2-pentanon-oxim) (3 sztereoizomer) keveréke | 423-010-0 | - | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 014-043-00-8 | reaction product of amorphous silica (50-85 %), butyl (1-methylpropyl) magnesium (3-15 %), tetraethyl orthosilicate (5-15 %) and titanium tetrachloride (5-20 %) | amorf szilícium-dioxid (50-85 %), butil(1-metilpropil)-magnézium (3-15 %), tetraetil-ortoszilikát (5-15 %) és titán-tetraklorid (5-20 %) reakcióterméke | 432-200-2 | STOT
SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H335 H315 H318 H412 |
GHS05 GHS07 Dgr |
H315 H318 H335 H412 |
ATP01/ATP01corr | ||||
| 014-044-00-3 | 3-[(4'-acetoxy-3'-methoxyphenyl) propyl]trimethoxysilane | 3-[(4'-acetoxi-3'-metoxifenil)propil]trimetoxiszilán | 433-050-0 | - | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
ATP01 | |||
| 014-045-00-9 | magnesium sodium fluoride silicate | magnézium-nátrium-fluorid-szilikát | 442-650-1 | - | STOT
RE 2 * |
H373
** |
GHS08 Wng |
H373
** |
ATP01 | |||
| 014-046-00-4 | e-glass microfibres of representative composition; [Calcium-aluminium-silicate fibres with random orientation with the following representative composition (% given by weight): SiO2 50,0-56,0 %, Al2O3 13,0-16,0 %, B2O3 5,8-10,0 %, Na2O < 0,6 %, K2O < 0,4 %, CaO 15,0-24,0 %, MgO < 5,5 %, Fe2O3 < 0,5 %, F2 < 1,0 %. Process: typically produced by flame attenuation and rotary process. (Additional individual elements may be present at low levels; the process list does not preclude innovation).] | jellemző összetételű E-üveg mikroszálak; [véletlenszerű irányokban elhelyezkedő kalcium-alumínium-szilikát szálak, melyek jellemző összetétele a következő (%-érték tömegszázalékban értendő): SiO2 50,0-56,0 %, Al2O3 13,0-16,0 %, B2O3 5,8-10,0 %, Na2O < 0,6 %, K2O < 0,4 %, CaO 15,0-24,0 %, MgO < 5,5 %, Fe2O3 < 0,5 %, F2 < 1,0 %. Eljárás: előállítása jellemzően olvasztáson és centrifugáláson alapuló vékonyítási eljárással történik. (További önálló elemek alacsony szinten jelen lehetnek; az eljárási jegyzék nem zárja ki az innovációt).] | Carc.
1B |
H350i |
GHS08 Dgr |
H350i |
A | ATP09 | ||||
| 014-047-00-X | glass microfibres of representative composition; [Calcium-aluminium-silicate fibres with random orientation with the following composition (% given by weight): SiO2 55,0-60,0 %, Al2O3 4,0-7,0 %, B2O3 8,0-11,0 %, ZrO2 0,0-4,0 %, Na2O 9,5-13,5 %, K2O 0,0-4,0 %, CaO 1,0-5,0 %, MgO 0,0-2,0 %, Fe2O3 < 0,2 %, ZnO 2,0-5,0 %, BaO 3,0-6,0 %, F2 < 1,0 %. Process: typically produced by flame attenuation and rotary process. (Additional individual elements may be present at low levels; the process list does not preclude innovation).] | jellemző összetételű üveg mikroszálak; [véletlenszerű irányokban elhelyezkedő kalcium-alumínium-szilikát szálak, melyek összetétele a következő (%-érték tömegszázalékban értendő): SiO2 55,0-60,0 %, Al2O3 4,0-7,0 %, B2O3 8,0-11,0 %, ZrO2 0,0-4,0 %, Na2O 9,5-13,5 %, K2O 0,0-4,0 %, CaO 1,0-5,0 %, MgO 0,0-2,0 %, Fe2O3 < 0,2 %, ZnO 2,0-5,0 %, BaO 3,0-6,0 %, F2 < 1,0 %. Eljárás: előállítása jellemzően olvasztáson és centrifugáláson alapuló vékonyítási eljárással történik. (További önálló elemek alacsony szinten jelen lehetnek; az eljárási jegyzék nem zárja ki az innovációt).] | Carc.
2 |
H351
(Inhalation) |
GHS08 Wng |
H351
(Inhalation) |
A | ATP09 | ||||
| 014-048-00-5 | silicon carbide fibres (with diameter < 3 μm, length > 5 μm and aspect ratio ≥ 3:1) | #HIÁNYZIK | 206-991-8 | 409-21-2 | Carc.
1B |
H350i |
GHS08 Dgr |
H350i |
ATP15 | |||
| 014-049-00-0 | trimethoxyvinylsilane; trimethoxy(vinyl)silane | #HIÁNYZIK | 220-449-8 | 2768-02-7 | Skin
Sens. 1B |
H317 |
GHS07 Wng |
H317 |
ATP15 | |||
| 014-050-00-6 | tris(2-methoxyethoxy) vinylsilane; 6-(2-methoxyethoxy)- 6-vinyl-2,5,7,10-tetraoxa-6-silaundecane | #HIÁNYZIK | 213-934-0 | 1067-53-4 | Repr.
1B |
H360FD |
GHS08 Dgr |
H360FD |
ATP15 | |||
| 015-001-00-1 | white phosphorus | foszfor (fehér, sárga) | 231-768-7 | 12185-10-3 | Pyr.
Sol. 1 Acute Tox. 2 * Acute Tox. 2 * Skin Corr. 1A Aquatic Acute 1 |
H250 H330 H300 H314 H400 |
GHS02 GHS06 GHS05 GHS09 Dgr |
H250 H330 H300 H314 H400 |
CLP00 | |||
| 015-002-00-7 | red phosphorus | vörös foszfor | 231-768-7 | 7723-14-0 | Flam.
Sol. 1 Aquatic Chronic 3 |
H228 H412 |
GHS02 Dgr |
H228 H412 |
CLP00 | |||
| 015-003-00-2 | calcium phosphide; tricalcium diphosphide | kalcium-foszfid; trikalcium-difoszfid | 215-142-0 | 1305-99-3 | Water-react.
1 Acute Tox. 1 Acute Tox. 2 Acute Tox. 3 Eye Dam. 1 Aquatic Acute 1 |
H260 H330 H300 H311 H318 H400 |
GHS02 GHS06 GHS05 GHS09 Dgr |
H260 H300 H311 H330 H318 H400 |
EUH029 EUH032 |
M=100 |
CLP00/ATP07 | |
| 015-004-00-8 | aluminium phosphide | alumínium-foszfid | 244-088-0 | 20859-73-8 | Water-react.
1 Acute Tox. 1 Acute Tox. 2 Acute Tox. 3 Aquatic Acute 1 |
H260 H330 H300 H311 H400 |
GHS02 GHS06 GHS09 Dgr |
H260 H300 H311 H330 H400 |
EUH029 EUH032 |
M=100 |
CLP00/ATP05 | |
| 015-005-00-3 | magnesium phosphide; trimagnesium diphosphide | magnézium-foszfid; trimagnézium-difoszfid |
235-023-7 | 12057-74-8 | Water-react.
1 Acute Tox. 1 Acute Tox. 2 Acute Tox. 3 Aquatic Acute 1 |
H260 H330 H300 H311 H400 |
GHS02 GHS06 GHS09 Dgr |
H260 H300 H311 H330 H400 |
EUH029 EUH032 |
M=100 |
CLP00/ATP05 | |
| 015-006-00-9 | trizinc diphosphide; zinc phosphide | tricink-difoszfid; cink-foszfid |
215-244-5 | 1314-84-7 | Water-react.
1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H260 H300 H400 H410 |
GHS02 GHS06 GHS09 Dgr |
H260 H300 H410 |
EUH029 EUH032 |
M=100 |
T | CLP00/ATP01 |
| 015-007-00-4 | phosphorus trichloride | foszfor-triklorid | 231-749-3 | 7719-12-2 | Acute
Tox. 2 * Acute Tox. 2 * STOT RE 2 * Skin Corr. 1A |
H330 H300 H373 ** H314 |
GHS06 GHS08 GHS05 Dgr |
H330 H300 H373 ** H314 |
EUH014 EUH029 |
CLP00 | ||
| 015-008-00-X | phosphorus pentachloride | foszfor-pentaklorid | 233-060-3 | 10026-13-8 | Acute
Tox. 2 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B |
H330 H302 H373 ** H314 |
GHS06 GHS08 GHS05 Dgr |
H330 H302 H373 ** H314 |
EUH014 EUH029 |
CLP00 | ||
| 015-009-00-5 | phosphoryl trichloride | foszforil-triklorid | 233-046-7 | 10025-87-3 | Acute
Tox. 2 * Acute Tox. 4 * STOT RE 1 Skin Corr. 1A |
H330 H302 H372 ** H314 |
GHS06 GHS08 GHS05 Dgr |
H330 H372 ** H302 H314 |
EUH014 EUH029 |
CLP00 | ||
| 015-010-00-0 | phosphorus pentoxide | foszfor-pentoxid | 215-236-1 | 1314-56-3 | Skin
Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
CLP00 | |||
| 015-011-00-6 | phosphoric acid ... %, orthophosphoric acid ... % | foszforsav … %, ortofoszforsav … % | 231-633-2 | 7664-38-2 | Skin
Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
Skin
Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 10 % ≤ C < 25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
B | CLP00 | |
| 015-012-00-1 | tetraphosphorus trisulphide; phosphorus sesquisulphid | tetrafoszfor-triszulfid; foszfor-szeszkviszulfid |
215-245-0 | 1314-85-8 | Flam.
Sol. 2 Water-react. 1 Acute Tox. 4 * Aquatic Acute 1 |
H228 H260 H302 H400 |
GHS02 GHS07 GHS09 Dgr |
H228 H260 H302 H400 |
T | CLP00 | ||
| 015-013-00-7 | triethyl phosphate | trietil-foszfát | 201-114-5 | 78-40-0 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 015-014-00-2 | tributyl phosphate | tributil-foszfát | 204-800-2 | 126-73-8 | Carc.
2 Acute Tox. 4 * Skin Irrit. 2 |
H351 H302 H315 |
GHS08 GHS07 Wng |
H351 H302 H315 |
CLP00 | |||
| 015-015-00-8 | tricresyl phosphate (o-o-o-, o-o-m-, o-o-p-, o-m-m-, o-m-p-, o-p-p-); tritolyl phosphate (o-o-o-, o-o-m-, o-o-p-, o-m-m-, o-m-p-, o-p-p-) | trikrezil-foszfát
(o-o-o-, o-o- m-, o-o-p-, o-m-m-, o-m-p-, o-p- p-); tritolil-foszfát (o-o-o-, o-o-m-, o-o-p-, o-m-m-, o-m-p-, o-p-p-); |
201-103-5 | 78-30-8 | STOT
SE 1 Aquatic Chronic 2 |
H370
** H411 |
GHS08 GHS09 Dgr |
H370
** H411 |
STOT
SE 1; H370: C ≥ 1 % STOT SE 2; H371: 0,2 % ≤ C < 1 % |
C | CLP00 | |
| 015-016-00-3 | tricresyl phosphate (m-m-m-, m-m-p-, m-p-p-, p-p-p-); tritolyl phosphate (m-m-m-, m-m-p-, m-p-p-, p-p-p-) | trikrezil-foszfát
(m-m-m-, m-m-p-, m-p-p-, p-p-p-); tritolil-foszfát (m-m-m-, m-m-p-, m-p-p-, p-p-p-); |
201-105-6 | 78-32-0 | Acute
Tox. 4 * Acute Tox. 4 * Aquatic Chronic 2 |
H312 H302 H411 |
GHS07 GHS09 Wng |
H312 H302 H411 |
* |
C | CLP00 | |
| 015-019-00-X | dichlorvos (ISO); 2,2-dichlorovinyl dimethyl phosphate | diklórvosz
(ISO); 2,2-diklórvinil-dimetil-foszfát |
200-547-7 | 62-73-7 | Acute
Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 |
H330 H311 H301 H317 H400 |
GHS06 GHS09 Dgr |
H330 H311 H301 H317 H400 |
M=1000 |
CLP00/ATP01 | ||
| 015-020-00-5 | mevinphos (ISO); 2-methoxycarbonyl-1-methylvinyl dimethyl phosphate | mevinfosz
(ISO); 2-metoxikarbonil-1-metilvinil-dimetil-foszfát |
232-095-1 | 7786-34-7 | Acute
Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
M=10000 |
CLP00 | ||
| 015-021-00-0 | trichlorfon (ISO); dimethyl 2,2,2-trichloro-1-hydroxyethylphosphonate | triklórfon
(ISO); dimetil-2,2,2-triklór-1-hidroxietilfoszfonát |
200-149-3 | 52-68-6 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H400 H410 |
M=1000 |
CLP00 | ||
| 015-022-00-6 | phosphamidon (ISO); 2-chloro-2-diethylcarbamoyl-1-methylvinyl dimethyl phosphate | foszfamidon
(ISO); 2-klór-2-dimetilkarbamoil-1-metilvinil-dimetil-foszfát |
236-116-5 | 13171-21-6 | Muta.
2 Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H341 H300 H311 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H341 H300 H311 H410 |
CLP00 | |||
| 015-023-00-1 | pyrazoxon; diethyl 3-methylpyrazol-5-yl phosphate | pirazoxon; dietil-3-metilpirazol-5-il-foszfát |
108-34-9 | Acute
Tox. 1 Acute Tox. 2 * Acute Tox. 2 * |
H310 H330 H300 |
GHS06 Dgr |
H330 H310 H300 |
CLP00 | ||||
| 015-024-00-7 | triamiphos (ISO); 5-amino-3-phenyl-1,2,4-triazol-1-yl-N,N,N',N'-tetramethylphosphonic diamide | triamfosz
(ISO); 5-amino-3-fenil-1,2,4-triazol-1-il-N, N,N’,N’-tetrametilfoszfonsav-diamid |
1031-47-6 | Acute
Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
CLP00 | ||||
| 015-025-00-2 | TEPP (ISO); tetraethyl pyrophosphate | TEPP
(ISO); tetraetil-pirofoszfát |
203-495-3 | 107-49-3 | Acute
Tox. 1 Acute Tox. 2 * Aquatic Acute 1 |
H310 H300 H400 |
GHS06 GHS09 Dgr |
H310 H300 H400 |
CLP00 | |||
| 015-026-00-8 | schradan (ISO); octamethylpyrophosphoramide | sradan
(ISO); oktametil-pirofoszforamid |
205-801-0 | 152-16-9 | Acute
Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
CLP00 | |||
| 015-027-00-3 | sulfotep (ISO); O,O,O,O-tetraethyl dithiopyrophosphate | szulfotep
(ISO); O, O,O, O-tetraetil-ditiopirofoszfát |
222-995-2 | 3689-24-5 | Acute
Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
M=1000 |
CLP00 | ||
| 015-028-00-9 | demeton-O (ISO); O,O-diethyl-O-2-ethylthioethyl phosphorothioate | demeton-O (ISO); O,O-dietil-O-2-etiltioetil-tiofoszfát |
206-053-8 | 298-03-3 | Acute
Tox. 1 Acute Tox. 2 * Aquatic Acute 1 |
H310 H300 H400 |
GHS06 GHS09 Dgr |
H310 H300 H400 |
CLP00 | |||
| 015-029-00-4 | demeton-S (ISO); diethyl-S-2-ethylthioethyl phosphorothioate | demeton-S (ISO); dietil-S-2-etiltioetil-tiofoszfát |
204-801-8 | 126-75-0 | Acute
Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
CLP00 | |||
| 015-030-00-X | demeton-O-methyl (ISO); O-2-ethylthioethyl O,O-dimethyl phosphorothioate | demeton-O-metil
(ISO); O-2-etiltioetil O,O-dimetil-tiofoszfát |
212-758-1 | 867-27-6 | Acute
Tox. 3 * |
H301 |
GHS06 Dgr |
H301 |
CLP00 | |||
| 015-031-00-5 | demeton-S-methyl (ISO); S-2-ethylthioethyl dimethyl phosphorothioate | demeton-S-metil
(ISO); S-2-etiltioetil-dimetil-tiofoszfát |
213-052-6 | 919-86-8 | Acute
Tox. 3 * Acute Tox. 3 * Aquatic Chronic 2 |
H311 H301 H411 |
GHS06 GHS09 Dgr |
H311 H301 H411 |
CLP00 | |||
| 015-032-00-0 | prothoate (ISO); O,O-diethyl isopropylcarbamoylmethyl phosphorodithioate | protoát
(ISO); O,O-dietil-izopropil-karbamoilmetil-ditiofoszfát |
218-893-2 | 2275-18-5 | Acute
Tox. 1 Acute Tox. 2 * Aquatic Chronic 3 |
H310 H300 H412 |
GHS06 Dgr |
H310 H300 H412 |
CLP00 | |||
| 015-033-00-6 | phorate (ISO); O,O-diethyl ethylthiomethyl phosphorodithioate | forát
(ISO); O,O-dietil-etiltiometil-ditiofoszfát |
206-052-2 | 298-02-2 | Acute
Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
M=1000 |
CLP00 | ||
| 015-034-00-1 | parathion (ISO); O,O-diethyl O-4-nitrophenyl phosphorothioate | paration
(ISO); O,O-dietil O-4-nitrofenil-tiofoszfát |
200-271-7 | 56-38-2 | Acute
Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H311 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H300 H311 H372 ** H410 |
M=100 |
CLP00 | ||
| 015-035-00-7 | parathion - methyl (ISO); O,O-dimethyl O-4-nitrophenyl phosphorothioate | paration-metil
(ISO); O,O-dimetil O-4-nitrofenil-tiofoszfát |
206-050-1 | 298-00-0 | Flam.
Liq. 3 Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H226 H330 H300 H311 H373 ** H400 H410 |
GHS02 GHS06 GHS08 GHS09 Dgr |
H226 H330 H300 H311 H373 ** H410 |
M=100 |
CLP00 | ||
| 015-036-00-2 | O-ethyl O-4-nitrophenyl phenylphosphonothioate; EPN | O-etil O-4-nitrofenil-fenil-tiofoszfonát; EPN |
218-276-8 | 2104-64-5 | Acute
Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
CLP00 | |||
| 015-037-00-8 | phenkapton (ISO); S-(2,5-dichlorophenylthiomethyl) O,O-diethyl phosphorodithioate | fenkapton
(ISO); S-(2,5-diklórfeniltiometil) O, O-dietil-ditiofoszfát |
218-892-7 | 2275-14-1 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H410 |
CLP00 | |||
| 015-038-00-3 | coumaphos (ISO); O-3-chloro-4-methylcoumarin-7-yl O,O-diethyl phosphorothioate | kumafosz
(ISO); O-3-klór-4-metilkumarin-7-il O,O-dietil-tiofoszfát |
200-285-3 | 56-72-4 | Acute
Tox. 2 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H312 H400 H410 |
GHS06 GHS09 Dgr |
H300 H312 H410 |
CLP00 | |||
| 015-039-00-9 | azinphos-methyl (ISO); O,O-dimethyl-4-oxobenzotriazin-3-ylmethyl phosphorodithioate | azinfosz-metil
(ISO); O,O-dimetil-4-oxobenzotriazin-3-ilmetil-ditiofoszfát |
201-676-1 | 86-50-0 | Acute
Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H311 H317 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H311 H317 H410 |
CLP00 | |||
| 015-040-00-4 | diazinon (ISO); O,O-diethyl O-2-isopropyl-6-methylpyrimidin-4-yl phosphorothioate | diazinon
(ISO); O,O-dietil O-2-izopropil-6-metilpirimidin-4-il-tiofoszfát |
206-373-8 | 333-41-5 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H400 H410 |
CLP00 | |||
| 015-041-00-X | malathion (ISO); 1,2-bis(ethoxycarbonyl)ethyl O,O-dimethyl phosphorodithioate; [containing ≤ 0.03 % isomalathion] | malation
(ISO); 1,2-bisz(etoxikarbonil)etil-O, O-dimetil-ditiofoszfát; [≤ 0,03 % izomalationt tartalmaz] |
204-497-7 | 121-75-5 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
M=1000 |
CLP00/ATP01 | ||
| 015-042-00-5 | chlorthion; O-(3-chloro-4-nitrophenyl) O,O-dimethyl phosphorothioate | klórtion O-(3-klór-4-nitrofenil)-O, O-dimetil-tiofoszfát | 207-902-5 | 500-28-7 | Acute
Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
M=100 |
CLP00 | ||
| 015-043-00-0 | phosnichlor (ISO); O-4-chloro-3-nitrophenyl O,O-dimethyl phosphorothioate | foszniklór
(ISO); O-4-klór-3-nitrofenil O, O-dimetil-tiofoszfát |
5826-76-6 | Acute
Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H332 H312 H302 |
GHS07 Wng |
H332 H312 H302 |
CLP00 | ||||
| 015-044-00-6 | carbophenothion (ISO); 4-chlorophenylthiomethyl O,O-diethyl phosphorodithioate | karbofenotion
(ISO); 4-klórfeniltiometil-O, O- dietil-ditiofoszfát |
212-324-1 | 786-19-6 | Acute
Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
CLP00 | |||
| 015-045-00-1 | mecarbam (ISO); N-ethoxycarbonyl-N-methylcarbamoylmethyl O,O-diethyl phosphorodithioate | mekarbam
(ISO); N-etoxikarbonil-N-metilkarbamoilmetil-O, O-dietil-ditiofoszfát |
219-993-9 | 2595-54-2 | Acute
Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H400 H410 |
CLP00 | |||
| 015-046-00-7 | oxydemeton-methyl; S-2-(ethylsulphinyl)ethyl O,O-dimethyl phosphorothioate | oxidemeton-metil; S-2-(etilszulfinil)etil O, O-dimetil-tiofoszfát |
206-110-7 | 301-12-2 | Acute
Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 |
H311 H301 H400 |
GHS06 GHS09 Dgr |
H311 H301 H400 |
CLP00 | |||
| 015-047-00-2 | ethion (ISO); O,O,O',O'-tetraethyl S,S'-methylenedi (phosphorodithioate); diethion | etion
(ISO); O, O,O',O'-tetraetil-S, S'-metiléndi(tiofoszfát); dietion |
209-242-3 | 563-12-2 | Acute
Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H301 H312 H410 |
M=10000 |
CLP00 | ||
| 015-048-00-8 | fenthion (ISO); O,O-dimethyl-O-(4-methylthion-m-tolyl) phosphorothioate | fention
(ISO); O, O-dimetil-O-(4-metiltion-m-tolil)-tiofoszfát |
200-231-9 | 55-38-9 | Muta.
2 Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H341 H331 H312 H302 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H341 H331 H312 H302 H372 ** H410 |
M=100 |
CLP00/ATP01 | ||
| 015-049-00-3 | endothion (ISO); S-5-methoxy-4-oxopyran-2-ylmethyl dimethyl phosphorothioate | endotion
(ISO); S-5-metoxi-4-oxopyran-2-ilmetil-dimetil-tiofoszfát |
220-472-3 | 2778-04-3 | Acute
Tox. 3 * Acute Tox. 3 * |
H311 H301 |
GHS06 Dgr |
H311 H301 |
CLP00 | |||
| 015-050-00-9 | thiometon (ISO); S-2-ethylthioethyl O,O-dimethyl phosphorodithioate | tiometon
(ISO); S-2-etiltioetil-O, O-dimetil-ditiofoszfát |
211-362-6 | 640-15-3 | Acute
Tox. 3 * Acute Tox. 4 * |
H301 H312 |
GHS06 Dgr |
H301 H312 |
CLP00 | |||
| 015-051-00-4 | dimethoate (ISO); O,O-dimethyl methylcarbamoylmethyl phosphorodithioate | dimetoát
(ISO); O, O-dimetil-metilkarbamoil-metil-ditiofoszfát |
200-480-3 | 60-51-5 | Acute
Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
CLP00 | |||
| 015-052-00-X | fenchlorphos (ISO); O,O-dimethyl O-2,4,5-trichlorophenyl phosphorothioate | fenklórfosz
(ISO); O, O-dimetil O-2,4,5-triklórfenil-tiofoszfát |
206-082-6 | 299-84-3 | Acute
Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
CLP00 | |||
| 015-053-00-5 | menazon (ISO); S-[(4,6-diamino-1,3,5-triazin-2-yl)methyl] O,O-dimethyl phosphorodithioate | menazon
(ISO); S-[(4,6-diamino-1,3,5-triazin-2-il)metil] O, O-dimetil-ditiofoszfát |
201-123-4 | 78-57-9 | Acute
Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
CLP00 | |||
| 015-054-00-0 | fenitrothion (ISO); O,O-dimethyl O-4-nitro-m-tolyl phosphorothioate | fenitrotion
(ISO); O, O-dimetil O-4-nitro-m-tolil-tiofoszfát |
204-524-2 | 122-14-5 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | |||
| 015-055-00-6 | naled (ISO); 1,2-dibromo-2,2-dichloroethyl dimethyl phosphate | naled
(ISO); 1,2-dibróm-2,2-diklóretil-dimetil-foszfát |
206-098-3 | 300-76-5 | Acute
Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 |
H312 H302 H315 H319 H400 |
GHS07 GHS09 Wng |
H312 H302 H319 H315 H400 |
M=1000 |
CLP00 | ||
| 015-056-00-1 | azinphos-ethyl (ISO); O,O-diethyl 4-oxobenzotriazin-3-ylmethyl phosphorodithioate | azinfosz-etil
(ISO); O, O-dietil-4-oxobenzotriazin-3-ilmetil-ditiofoszfát |
220-147-6 | 2642-71-9 | Acute
Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
M=100 |
CLP00/ATP01 | ||
| 015-057-00-7 | formothion (ISO); N-formyl-N-methylcarbamoylmethyl O,O-dimethyl phosphorodithioate | formotion
(ISO); N-formil-N-metilkarbamoilmetil-O, O-dimetil-ditiofoszfát |
219-818-6 | 2540-82-1 | Acute
Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
CLP00 | |||
| 015-058-00-2 | morphothion (ISO); O,O-dimethyl-S-(morpholinocarbonylmethyl) phosphorodithioate | morfotion
(ISO); O, O-dimetil-S-(morfolinokarbonilmetil)-ditiofoszfát |
205-628-0 | 144-41-2 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H410 |
CLP00 | |||
| 015-059-00-8 | vamidothion (ISO); O,O-dimethyl S-2-(1-methylcarbamoylethylthio) ethyl phosphorothioate | vamidotion
(ISO); O, O-dimetil S-2-(1-metilkarbamoil-etiltio) etil-tiofoszfát |
218-894-8 | 2275-23-2 | Acute
Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 |
H301 H312 H400 |
GHS06 GHS09 Dgr |
H301 H312 H400 |
CLP00 | |||
| 015-060-00-3 | disulfoton (ISO); O,O-diethyl 2-ethylthioethyl phosphorodithioate | diszulfoton
(ISO); O, O-dietil-2-etiltioetil-ditiofoszfát |
206-054-3 | 298-04-4 | Acute
Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
CLP00 | |||
| 015-061-00-9 | dimefox (ISO); tetramethylphosphorodiamidic fluoride | dimefox (ISO); tetrametilfluorfoszforsav-diamid | 204-076-8 | 115-26-4 | Acute
Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
CLP00 | |||
| 015-062-00-4 | mipafox (ISO); N,N'- di-isopropylphosphorodiamidic fluoride | mipafox
(ISO); N,N'-di-izopropilfluorfoszforsav-diamid |
206-742-3 | 371-86-8 | STOT
SE 1 |
H370
** |
GHS08 Dgr |
H370
** |
CLP00 | |||
| 015-063-00-X | dioxathion (ISO); 1,4-dioxan-2,3-diyl-O,O,O',O'-tetraethyl di(phosphorodithioate) | dioxation
(ISO); 1,4-dioxán-2,3-diil-O, O,O',O'-tetraetil-di(ditiofoszfát) |
201-107-7 | 78-34-2 | Acute
Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H311 H410 |
M=1000 |
CLP00 | ||
| 015-064-00-5 | bromophos-ethyl (ISO); O-4-bromo-2,5-dichlorophenyl O,O-diethyl phosphorothioate | bromofosz-etil
(ISO); O-4-bróm-2,5-diklórfenil-O, O-dietil-tiofoszfát |
225-399-0 | 4824-78-6 | Acute
Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H301 H312 H410 |
CLP00 | |||
| 015-065-00-0 | S-[2-(ethylsulphinyl)ethyl] O,O-dimethyl phosphorodithioate | O, O-dimetil-S-[2-(etilszulfinil)etil] ditiofoszfát | 2703-37-9 | Acute
Tox. 1 Acute Tox. 2 * Acute Tox. 2 * Aquatic Chronic 2 |
H310 H330 H300 H411 |
GHS06 GHS09 Dgr |
H330 H310 H300 H411 |
CLP00 | ||||
| 015-066-00-6 | omethoate (ISO); O,O-dimethyl S-methylcarbamoylmethyl phosphorothioate | ometoát
(ISO); O, O-dimetil-S-metilkarbamoilmetil-tiofoszfát |
214-197-8 | 1113-02-6 | Acute
Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 |
H301 H312 H400 |
GHS06 GHS09 Dgr |
H301 H312 H400 |
CLP00 | |||
| 015-067-00-1 | phosalone (ISO); S-(6-chloro-2-oxobenzoxazolin-3-ylmethyl) O,O-diethyl phosphorodithioate | foszalon
(ISO); S-(6-klór-2-oxobenzoxazolin-3-ilmetil) O, O-dietil-ditiofoszfát |
218-996-2 | 2310-17-0 | Acute
Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H332 H312 H317 H400 H410 |
GHS06 GHS09 Dgr |
H301 H332 H312 H317 H410 |
M=1000 |
CLP00/ATP01 | ||
| 015-068-00-7 | dichlofenthion (ISO); O-,4-dichlorophenyl O,O-diethyl phosphorothioate | diklofention
(ISO); O-2,4-diklórfenil-O, O-dietil-tiofoszfát |
202-564-5 | 97-17-6 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H400 H410 |
CLP00 | |||
| 015-069-00-2 | methidathion (ISO); 2,3-dihydro-5-methoxy-2-oxo-1,3,4-thiadiazol-3-ylmethyl-O,O-dimethylphosphorodithioate | metidation
(ISO); 2,3-dihidro-5-metoxi-2-oxo-1,3,4-tiadiazol-3-ilmetil-O, O-dimetil-ditiofoszfát |
213-449-4 | 950-37-8 | Acute
Tox. 2 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H312 H400 H410 |
GHS06 GHS09 Dgr |
H300 H312 H410 |
CLP00 | |||
| 015-070-00-8 | cyanthoate (ISO); S-(N-(1-cyano-1-methylethyl)carbamoylmethyl) O,O-diethyl phosphorothioate | ciantoát
(ISO); S-(N-(1-ciano-1-metiletil)karbamoilmetil) O, O-dietil-tiofoszfát |
223-099-4 | 3734-95-0 | Acute
Tox. 2 * Acute Tox. 3 * |
H300 H311 |
GHS06 Dgr |
H300 H311 |
CLP00 | |||
| 015-071-00-3 | chlorfenvinphos (ISO); 2-chloro-1-(2,4 dichlorophenyl) vinyl diethyl phosphate | klórfenvinfosz
(ISO); 2-klór-1-(2,4 diklórfenil)vinil-dietil-foszfát |
207-432-0 | 470-90-6 | Acute
Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
CLP00 | |||
| 015-072-00-9 | monocrotophos (ISO); dimethyl-1-methyl-2-(methylcarbamoyl)vinyl phosphate | monokrotofosz
(ISO); dimetil-1-metil-2-(metilkarbamoil)vinil-foszfát |
230-042-7 | 6923-22-4 | Muta.
2 Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H341 H330 H300 H311 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H341 H330 H300 H311 H410 |
CLP00 | |||
| 015-073-00-4 | dicrotophos (ISO); (Z)-2-dimethylcarbamoyl-1-methylvinyl dimethyl phosphate | dikrotofosz
(ISO); (Z)-2-dimetilkarbamoil-1-metilvinil-dimetil-foszfát |
205-494-3 | 141-66-2 | Acute
Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
CLP00 | |||
| 015-074-00-X | crufomate (ISO); 4-tert-butyl-2-chlorophenyl methyl methylphosphoramidate | krufomát
(ISO); 4-terc-butil-2-klórfenilmetil-metilfoszforamidát |
206-083-1 | 299-86-5 | Acute
Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
CLP00 | |||
| 015-075-00-5 | S-[2-(isopropylsulphinyl)ethyl] O,O-dimethyl phosphorothioate | O, O-dimetil-S-[2-(izopropilszulfinil)etil]-tiofoszfát | 2635-50-9 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
CLP00 | ||||
| 015-076-00-0 | potasan; O,O-diethyl O-(4-methylcoumarin-7-yl) phosphorothioate | potazan; O, O-dietil-O-(4-metilkumarin-7-il)-tiofoszfát |
299-45-6 | Acute
Tox. 1 Acute Tox. 2 * Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H330 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H300 H410 |
M=1000 |
CLP00 | |||
| 015-077-00-6 | 2,2-dichlorovinyl 2-ethylsulphinylethyl methyl phosphate | 2,2-diklórvinil-2-etilszulfiniletil-metil-foszfát | 7076-53-1 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
CLP00 | ||||
| 015-078-00-1 | demeton-S-methylsulphon (ISO); S-2-ethylsulphonylethyl dimethyl phosphorothioate | demeton-S-metilszulfon
(ISO); S-2-etilszulfoniletil-dimetil-tiofoszfát |
241-109-5 | 17040-19-6 | Acute
Tox. 3 * Acute Tox. 4 * Aquatic Chronic 2 |
H301 H312 H411 |
GHS06 GHS09 Dgr |
H301 H312 H411 |
CLP00 | |||
| 015-079-00-7 | acephate (ISO); O,S-dimethyl acetylphosphoramidothioate | acefát
(ISO); O,S-dimetil-acetilfoszforamidotioát |
250-241-2 | 30560-19-1 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 015-080-00-2 | amidithion (ISO); 2-methoxyethylcarbamoylmethyl O,O-dimethyl phosphorodithioate | amidition
(ISO); 2-metoxietilkarbamoilmetil-O,O-dimetil-tiofoszfát |
919-76-6 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | ||||
| 015-081-00-8 | O,O,O',O'-tetrapropyl dithiopyrophosphate | O,O,O',O'-tetrapropil-ditiopirofoszfát | 221-817-0 | 3244-90-4 | Acute
Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
CLP00 | |||
| 015-082-00-3 | azothoate (ISO); O-4-(4-chlorophenylazo)phenyl O,O-dimethyl phosphorothioate | azotoát
(ISO); O-4-(4-klórfenilazo)fenil-O,O-dimetil-tiofoszfát |
227-419-3 | 5834-96-8 | Acute
Tox. 4 * Acute Tox. 4 * |
H332 H302 |
GHS07 Wng |
H332 H302 |
CLP00 | |||
| 015-083-00-9 | bensulide (ISO); O,O-diisopropyl 2-phenylsulphonylaminoethyl phosphorodithioate | benszulid
(ISO); O, O-diizopropil-2-fenilszulfonilaminoetil-ditiofoszfát |
212-010-4 | 741-58-2 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | |||
| 015-084-00-4 | chlorpyrifos (ISO); O,O-diethyl O-3,5,6-trichloro-2-pyridyl phosphorothioate | klórpirifosz
(ISO); O,O-dietil-O-3,5,6-triklór-2-piridil-tiofoszfát |
220-864-4 | 2921-88-2 | Acute
Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H400 H410 |
M=10000 |
CLP00 | ||
| 015-085-00-X | chlorphonium chloride (ISO); tributyl (2,4-dichlorobenzyl) phosphonium chloride | klórfónium-klorid
(ISO); tributil-(2,4-diklórbenzil)foszfónium-klorid |
204-105-4 | 115-78-6 | Acute
Tox. 3 * Acute Tox. 4 * Skin Irrit. 2 Eye Irrit. 2 |
H301 H312 H315 H319 |
GHS06 Dgr |
H301 H312 H319 H315 |
CLP00 | |||
| 015-086-00-5 | coumithoate (ISO); O,O-diethyl O-,8,9,10-tetrahydro-6-oxo-benzo(c)chromen-3-yl phosphorothioate | kumitoát
(ISO); O,O-dietil-O-7,8,9,10-tetrahidro-6-oxobenzo(c)kromén-3-il-tiofoszfát |
572-48-5 | Acute
Tox. 3 * |
H301 |
GHS06 Dgr |
H301 |
CLP00 | ||||
| 015-087-00-0 | cyanophos (ISO); O-4-cyanophenyl O,O-dimethyl phosphorothioate | cianofosz
(ISO); O-4-cianofenil-O,O-dimetil-tiofoszfát |
220-130-3 | 2636-26-2 | Acute
Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
CLP00 | |||
| 015-088-00-6 | dialifos (ISO); 2-chloro-1-phthalimidoethyl O,O-diethyl phosphorodithioate | dialifosz
(ISO); 2-klór-1-ftalimidoetil-O,O-dietil-ditiofoszfát |
233-689-3 | 10311-84-9 | Acute
Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H400 H410 |
CLP00 | |||
| 015-089-00-1 | ethoate-methyl (ISO); ethylcarbamoylmethyl O,O-dimethyl phosphorodithioate | etoát-metil
(ISO); etilkarbamoilmetil-O,O-dimetil-ditiofoszfát |
204-121-1 | 116-01-8 | Acute
Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
CLP00 | |||
| 015-090-00-7 | fensulfothion (ISO); O,O-diethyl O-4-methylsulfinylphenyl phosphorothioate | fenszulfotion
(ISO); O,O-dietil-O-4-metilszulfinilfenil-tiofoszfát |
204-114-3 | 115-90-2 | Acute
Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
CLP00 | |||
| 015-091-00-2 | fonofos (ISO); O-ethyl phenyl ethylphosphonodithioate | fonofosz
(ISO); O-etil-feniletil-ditiofoszfonát |
213-408-0 | 944-22-9 | Acute
Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
CLP00 | |||
| 015-092-00-8 | phosacetim (ISO); O,O-bis(4-chlorophenyl) N-acetimidoylphosphoramidothioate | foszacetim
(ISO); O,O-bisz(4-klórfenil) N-acetimidoil-foszforamidotioát |
223-874-7 | 4104-14-7 | Acute
Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
CLP00 | |||
| 015-093-00-3 | leptophos (ISO); O-4-bromo-2,5-dichlorophenyl O-methyl phenylphosphorothioate | leptofosz
(ISO); O-4-bróm-2,5-diklórfenil-O-metilfenil-tiofoszfát |
244-472-8 | 21609-90-5 | Acute
Tox. 3 * Acute Tox. 4 * STOT SE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H312 H370 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H301 H370 ** H312 H410 |
CLP00 | |||
| 015-094-00-9 | mephosfolan (ISO); diethyl 4-methyl-1,3-dithiolan-2-ylidenephosphoramidate | mefoszfolán
(ISO); dietil-4-metil-1,3-ditiolan-2- ilidén-foszforamidát |
213-447-3 | 950-10-7 | Acute
Tox. 1 Acute Tox. 2 * Aquatic Chronic 2 |
H310 H300 H411 |
GHS06 GHS09 Dgr |
H310 H300 H411 |
CLP00 | |||
| 015-095-00-4 | methamidophos (ISO); O,S-dimethyl phosphoramidothioate | metamidofosz
(ISO); O,S-dimetil-foszforamidotioát |
233-606-0 | 10265-92-6 | Acute
Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 |
H330 H300 H311 H400 |
GHS06 GHS09 Dgr |
H330 H300 H311 H400 |
CLP00 | |||
| 015-096-00-X | oxydisulfoton (ISO); O, O-diethyl S-2-ethylsulphinylethyl phosphorodithioate | oxidiszulfoton
(ISO); O, O-dietil-S-2-etilszulfiniletil-ditiofoszfát |
219-679-1 | 2497-07-6 | Acute
Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
M=10 |
CLP00 | ||
| 015-097-00-5 | phenthoate (ISO); ethyl 2-(dimethoxyphosphinothioylthio)-2-phenylacetate | fentoát
(ISO); etil 2-(dimetoxifoszfinotioiltio)-2-fenilacetát |
219-997-0 | 2597-03-7 | Acute
Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
M=100 |
CLP00 | ||
| 015-098-00-0 | trichloronate (ISO); O-ethyl O-2,4,5-trichlorophenyl ethylphosphonothioate | trikloronát
(ISO); O-etil-O-2,4,5-triklórfenil-etiltiofoszfonát |
206-326-1 | 327-98-0 | Acute
Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
CLP00 | |||
| 015-099-00-6 | pirimiphos-ethyl (ISO); O,O-diethyl O-2-diethylamino-6-methylpyrimidin-4-yl phosphorothioate | pirimifosz-etil
(ISO); O, O-dietil-O-2-dietilamino-6-metilpirimidin-4-il-tiofoszfát |
245-704-0 | 23505-41-1 | Acute
Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H301 H312 H410 |
CLP00 | |||
| 015-100-00-X | phoxim (ISO); α-(diethoxyphosphinothioylimino) phenylacetonitrile | foxim
(ISO); α-(dietoxi-foszfin-tioilimino)fenil-acetonitril |
238-887-3 | 14816-18-3 | Repr.
2 Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361f
*** H302 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361f
*** H302 H317 H410 |
M=1000 |
CLP00/ATP01 | ||
| 015-101-00-5 | phosmet
(ISO); S-[(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)methyl] O,O-di-methyl phosphorodithioate; O,O-dimethyl-S-phthalimido-methyl phosphorodithioate |
foszmet
(ISO); S-[(1,3-dioxo-1,3-dihidro-2H-izoindol-2-il)metil] O,O-dimetil-ditiofoszfát; O,O-dimetil-S-ftalimidometil-ditiofoszfát |
211-987-4 | 732-11-6 | Repr.
2 Acute Tox. 3 Acute Tox. 4 STOT SE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361f H301 H332 H370 (nervous system) H400 H410 |
GHS08 GHS06 GHS09 Dgr |
H332 H301 H361f H370 (nervous system) H410 |
M=100 M=100 |
CLP00/ATP13 | ||
| 015-102-00-0 | tris(2-chloroethyl)phosphate | trisz(2-klóretil)foszfát | 204-118-5 | 115-96-8 | Carc.
2 Repr. 1B Acute Tox. 4 * Aquatic Chronic 2 |
H351 H360F *** H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H351 H360F *** H302 H411 |
CLP00/ATP01 | |||
| 015-103-00-6 | phosphorus tribromide | foszfor-tribromid | 232-178-2 | 7789-60-8 | STOT
SE 3 Skin Corr. 1B |
H335 H314 |
GHS05 GHS07 Dgr |
H314 H335 |
EUH014 |
CLP00 | ||
| 015-104-00-1 | diphosphorus pentasulphide; phosphorus pentasulphide | difoszfor-pentaszulfid; foszfor-pentaszulfid |
215-242-4 | 1314-80-3 | Flam.
Sol. 1 Water-react. 1 Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 |
H228 H260 H332 H302 H400 |
GHS02 GHS07 GHS09 Dgr |
H228 H260 H332 H302 H400 |
EUH029 |
T | CLP00 | |
| 015-105-00-7 | triphenyl phosphite | trifenil-foszfit | 202-908-4 | 101-02-0 | Skin
Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H319 H400 H410 |
GHS07 GHS09 Wng |
H319 H315 H410 |
Skin
Irrit. 2; H315: C ≥ 5 % Eye Irrit. 2; H319: C ≥ 5 % |
CLP00 | ||
| 015-106-00-2 | hexamethylphosphoric triamide; hexamethylphosphoramide | hexametil-foszforsav-triamid; hexametil-foszfor-amid | 211-653-8 | 680-31-9 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
Carc.
1B; H350: C ≥ 0,01 % |
CLP00 | ||
| 015-107-00-8 | ethoprophos (ISO); ethyl-S,S-dipropyl phosphorodithioate | etoprofosz
(ISO); etil-S,S-dipropil-ditiofoszfát |
236-152-1 | 13194-48-4 | Acute
Tox. 1 Acute Tox. 2 * Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H310 H330 H301 H317 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H301 H317 H410 |
CLP00 | |||
| 015-108-00-3 | bromophos (ISO); O-4-bromo-2,5-dichlorophenyl O,O-dimethyl phosphorothioate | bromofosz
(ISO); O-4-bróm-2,5-diklórfenil-O,O-dimetil-tiofoszfát |
218-277-3 | 2104-96-3 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
M=100 |
CLP00 | ||
| 015-109-00-9 | crotoxyphos (ISO); 1-phenylethyl 3-(dimethoxyphosphinyloxy) isocrotonate | krotoxifosz
(ISO); 1-feniletil-3-(dimetoxifoszfiniloxi)-izokrotonát |
231-720-5 | 7700-17-6 | Acute
Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
M=10 |
CLP00 | ||
| 015-110-00-4 | cyanofenphos (ISO); O-4-cyanophenyl O-ethyl phenylphosphonothioate | cianofenfosz
(ISO); O-4-cianofenil-O-etil-tiofoszfonát |
13067-93-1 | Acute
Tox. 3 * Acute Tox. 4 * STOT SE 1 Eye Irrit. 2 Aquatic Chronic 2 |
H301 H312 H370 ** H319 H411 |
GHS06 GHS08 GHS09 Dgr |
H301 H370 ** H312 H319 H411 |
CLP00 | ||||
| 015-111-00-X | phosfolan (ISO); diethyl 1,3-dithiolan-2-ylidenephosphoramidate | foszfolán
(ISO); dietil-1,3-ditiolán-2-ilidén-foszforamidát |
213-423-2 | 947-02-4 | Acute
Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
CLP00 | |||
| 015-112-00-5 | thionazin (ISO); O,O-diethyl O-pyrazin-2-yl phosphorothioate | tionazin
(ISO); O,O-dietil-O-pirazin-2-il-tiofoszfát; |
206-049-6 | 297-97-2 | Acute
Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
CLP00 | |||
| 015-113-00-0 | tolclofos-methyl (ISO); O-(2,6-dichloro-p-tolyl)-O,O-dimethyl thiophosphate | tolklofosz-metil
(ISO); O-(2,6-diklór-p-tolil)-O,O- dimetil-tiofoszfát |
260-515-3 | 57018-04-9 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
ATP01 | |||
| 015-114-00-6 | chlormephos (ISO); S-chloromethyl O,O-diethyl phosphorodithioate | klórmefosz
(ISO); S-klórmetil-O,O-dietil-ditiofoszfát |
246-538-1 | 24934-91-6 | Acute
Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H300 H310 H410 |
M=10 |
CLP00/ATP01corr | ||
| 015-115-00-1 | chlorthiophos (ISO); [isomeric reaction mass in which O-2,5-dichlorophenyl-4-methylthiophenyl O,O-diethyl phosphorothioate predominates] | klórtiofosz
(ISO); [izomerkeverék, amelyben O-2,5-diklórfenil-4-metiltiofenil-O, O-dietil-tiofoszfát van túlsúlyban] |
244-663-6 | 21923-23-9 | Acute
Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
M=1000 |
CLP00/ATP01corr | ||
| 015-116-00-7 | demephion-O (ISO); O,O-dimethyl O-2-methylthioethyl phosphorothioate | demefion-O (ISO); O, O-dimetil-O-2-metiltioetil-tiofoszfát |
211-666-9 | 682-80-4 | Acute
Tox. 2 * Acute Tox. 3 * |
H300 H311 |
GHS06 Dgr |
H300 H311 |
CLP00 | |||
| 015-117-00-2 | demephion-S (ISO); O,O-dimethyl S-2-methylthioethyl phosphorothioate | demefion-S (ISO); O, O-dimetil-S-2-metiltioetil-tiofoszfát |
219-971-9 | 2587-90-8 | Acute
Tox. 2 * Acute Tox. 3 * |
H300 H311 |
GHS06 Dgr |
H300 H311 |
CLP00 | |||
| 015-118-00-8 | demeton | demeton | 8065-48-3 | Acute
Tox. 1 Acute Tox. 2 * Aquatic Acute 1 |
H310 H300 H400 |
GHS06 GHS09 Dgr |
H310 H300 H400 |
CLP00 | ||||
| 015-119-00-3 | dimethyl 4-(methylthio)phenyl phosphate | dimetil-4-(metiltio)fenil-foszfát | 3254-63-5 | Acute
Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
CLP00 | ||||
| 015-120-00-9 | ditalimfos (ISO); O,O-diethyl phthalimidophosphonothioate | ditalimfosz
(ISO); O, O-dietil-ftálimido-tiofoszfonát |
225-875-8 | 5131-24-8 | Skin
Irrit. 2 Skin Sens. 1 |
H315 H317 |
GHS07 Wng |
H315 H317 |
CLP00 | |||
| 015-121-00-4 | edifenphos (ISO); O-ethyl S,S-diphenyl phosphorodithioate | edifenfosz
(ISO); O-etil-S, S-difenil-tiofoszfát |
241-178-1 | 17109-49-8 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H312 H317 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H312 H317 H410 |
CLP00 | |||
| 015-122-00-X | etrimfos (ISO); O-6-ethoxy-2-ethylpyrimidin-4-yl O,O-dimethylphosphorothioate | etrimfosz(ISO); O-6-etoxi-2-etilpirimidin-4-il-O, O-dimetil-tiofoszfát |
253-855-9 | 38260-54-7 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
M=10 |
CLP00 | ||
| 015-123-00-5 | fenamiphos (ISO); ethyl-4-methylthio-m-tolyl isopropyl phosphoramidate | fenamifosz
(ISO); etil-4-metiltio-m-tolil-izopropil-foszforamidát |
244-848-1 | 22224-92-6 | Acute
Tox. 2 Acute Tox. 2 Acute Tox. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H319 H400 H410 |
GHS06 GHS09 Dgr |
H300 H310 H330 H319 H410 |
M=100 M=100 |
CLP00/ATP05 | ||
| 015-124-00-0 | fosthietan (ISO); diethyl 1,3-dithietan-2-ylidenephosphoramidate | fosztietán
(ISO); dietil-1,3-ditietan-2-ilidén-foszforamidát |
244-437-7 | 21548-32-3 | Acute
Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
CLP00 | |||
| 015-125-00-6 | glyphosine (ISO); N,N-bis(phosphonomethyl)glycine | glifozin
(ISO); N,N-bisz(foszfonometil)glicin |
219-468-4 | 2439-99-8 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | |||
| 015-126-00-1 | heptenophos (ISO); 7-chlorobicyclo(3.2.0)hepta-2,6-dien-6-yl dimethyl phosphate | heptenofosz
(ISO); 7-klórbiciklo(3.2.0)hepta-2,6-dién-6-il-dimetil-foszfát |
245-737-0 | 23560-59-0 | Acute
Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
M=100 |
CLP00 | ||
| 015-127-00-7 | iprobenfos (ISO); S-benzyl diisopropyl phosphorothioate | iprobenfosz
(ISO); S-benzil-diizopropil-tiofoszfát |
247-449-0 | 26087-47-8 | Acute
Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
CLP00 | |||
| 015-128-00-2 | IPSP; S-ethylsulphinylmethyl O,O-diisopropylphosphorodithioate | IPSP; O, O-diizopropil-S-etiszulfinilmetil-ditiofoszfát |
5827-05-4 | Acute
Tox. 1 Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H301 H400 H410 |
GHS06 GHS09 Dgr |
H310 H301 H410 |
M=100 |
CLP00 | |||
| 015-129-00-8 | isofenphos (ISO); O-ethyl O-2-isopropoxycarbonylphenyl-isopropylphosphoramidothioate | izofenfosz
(ISO); O-etil O-2-izopropoxi-karbonil-fenil-izopropil-foszforamidotioát |
246-814-1 | 25311-71-1 | Acute
Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
M=100 |
CLP00 | ||
| 015-130-00-3 | isothioate (ISO); S-2-isopropylthioethyl O,O-dimethyl phosphorodithioate | izotioát
(ISO); S-2-izopropiltioetil-O,O- dimetil-ditiofoszfát; |
36614-38-7 | Acute
Tox. 3 * Acute Tox. 3 * |
H311 H301 |
GHS06 Dgr |
H311 H301 |
CLP00 | ||||
| 015-131-00-9 | isoxathion (ISO); O,O-diethyl O-5-phenylisoxazol-3-ylphosphorothioate | izoxation
(ISO); O,O-dietil-O-5-fenil-izoxazol-3-il-tiofoszfát |
242-624-8 | 18854-01-8 | Acute
Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
CLP00 | |||
| 015-132-00-4 | S-(chlorophenylthiomethyl) O,O-dimethylphosphorodithioate; methylcarbophenothione | S-(klórfenil-tiometil)-O,O-dimetil-ditiofoszfát; metilkarbofenotion |
953-17-3 | Acute
Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
M=1000 |
CLP00 | |||
| 015-133-00-X | piperophos (ISO); S-2-methylpiperidinocarbonylmethyl-O,O-dipropyl phosphorodithioate | piperofosz
(ISO); S-2-metilpiperidin-karbonilmetil-O, O-dipropil-ditiofoszfát |
24151-93-7 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
M=10 |
CLP00 | |||
| 015-134-00-5 | pirimiphos-methyl (ISO); O-[2-(diethylamino)-6-methylpyrimidin-4-yl] O,O-dimethyl phosphorothioate | pirimifosz-metil
(ISO); O-(2-dietilamino-6-metilpirimidin-4-il)-O, O-dimetil-tiofoszfát |
249-528-5 | 29232-93-7 | Acute
Tox. 4 STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H372 (nervous system) H400 H410 |
GHS07 GHS08 GHS09 Dgr |
H302 H372 (nervous system) H410 |
Oral:
ATE = 1414 mg/kg M=1000 M=1000 |
CLP00/ATP15 | ||
| 015-135-00-0 | profenofos (ISO); O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl phosphorothioate | profenofosz
(ISO); O-(4-bróm-2-klórfenil)-O-etil-S-propil-tiofoszfát; |
255-255-2 | 41198-08-7 | Acute
Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
M=1000 |
CLP00 | ||
| 015-136-00-6 | trans-isopropyl-3-[[(ethylamino)methoxyfosfinothioyl]oxy]crotonate; isopropyl 3-[[(ethylamino)methoxyphosphinothioyl]oxy]isocrotonate; propetamphos (ISO) | transz-izopropil-3-[[(etilamino)metoxi-foszfinotioil]oxi]krotonát; izopropil-3-[[(etilamino)metoxi-foszfinotioil]oxi]izokrotonát; propetamfosz (ISO) |
250-517-2 | 31218-83-4 | Acute
Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
M=100 |
CLP00 | ||
| 015-137-00-1 | pyrazophos (ISO); O,O-diethyl O-(6-ethoxycarbonyl-5-methylpyrazolo[2,3-a]pyrimidin-2-yl) phosphorothioate | pirazofosz
(ISO); O, O-dietil-O-(6-etoxikarbonil-5-metilpirazolo[2,3-a]pirimidin-2-il)-tiofoszfát |
236-656-1 | 13457-18-6 | Acute
Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H302 H410 |
CLP00 | |||
| 015-138-00-7 | quinalphos (ISO); O,O-diethyl-O-quinoxalin-2-yl phosphorothioate | kvinalfosz
(ISO); O, O-dietil-O-kinoxalin-2-il-tiofoszfát |
237-031-6 | 13593-03-8 | Acute
Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H301 H312 H410 |
M=1000 |
CLP00 | ||
| 015-139-00-2 | terbufos (ISO); S-tert-butylthiomethyl O,O-diethylphosphorodithioate | terbufosz
(ISO); S-terc-butiltiometil-O, O- dietil-ditiofoszfát; |
235-963-8 | 13071-79-9 | Acute
Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
M=1000 |
CLP00 | ||
| 015-140-00-8 | triazophos (ISO); O,O-diethyl-O-1-phenyl-1H-1,2,4-triazol-3-yl phosphorothioate | triazofosz
(ISO); O, O-dietil-O-1-fenil-1H-1,2,4-triazol-3-il-tiofoszfát |
245-986-5 | 24017-47-8 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H312 H410 |
M=100 |
CLP00/ATP01 | ||
| 015-141-00-3 | ethylenediammonium O,O-bis(octyl) phosphorodithioate, mixed isomers | etilén-diammónium-O, O-bisz(oktil)-ditiofoszfát (kevert izomerek) | 400-520-1 | Acute
Tox. 4 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H302 H314 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H314 H302 H410 |
CLP00 | ||||
| 015-142-00-9 | butyl (dialkyloxy(dibutoxyphosphoryloxy))titanium (trialkyloxy)titanium phosphate | butil(dialkiloxi(dibutoxi-foszforiloxi))-titán-tri(alkiloxi)-titán-foszfát | 401-100-0 | Flam.
Liq. 2 Eye Irrit. 2 Aquatic Chronic 2 |
H225 H319 H411 |
GHS02 GHS07 GHS09 Dgr |
H225 H319 H411 |
T | CLP00 | |||
| 015-143-00-4 | reaction mass of 2-chloroethyl chloropropyl 2-chloroethylphosphonate, mixture reaction mass of isomers and 2-chloroethyl chloropropyl 2-chloropropylphosphonate, reaction mass of isomers | 2-klóretil
klórpropil 2-klóretil-foszfonát izomerkeverék és 2-klóretil klórpropil 2-klórpropil-foszfonát izomerkeverék elegye |
401-740-0 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | ||||
| 015-144-00-X | reaction mass of pentyl methylphosphinate and 2-methylbutyl methylphosphinate | pentil-metilfoszfinát és 2-metilbutil-metilfoszfinát keveréke | 402-090-0 | 87025-52-3 | Skin
Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
CLP00 | |||
| 015-145-00-5 | reaction mass of copper(I) O,O-diisopropyl phosphorodithioate and copper(I) O-isopropyl O-(4-methylpent-2-yl) phosphorodithioate and copper(I) O,O-bis(4-methylpent-2-yl) phosphorodithioate | a következő anyagok keveréke: réz(I)-O, O-diizopropil-ditiofoszfát, réz(I)-O-izopropil-O-(4-metilpent-2-il)-ditiofoszfát és réz(I)-O, O-bisz(4-metilpent-2-il)-ditiofoszfát | 401-520-4 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | ||||
| 015-146-00-0 | S-(tricyclo(5.2.1.02,6)deca-3-en-8(or 9)-yl O-(isopropyl or isobutyl or 2-ethylhexyl) O-(isopropyl or isobutyl or 2-ethylhexyl) phosphorodithioate | O-(izopropil vagy izobutil vagy 2-etilhexil)-O-(izopropil vagy izobutil vagy 2-etilhexil)-S-(triciklo(5.2.1.02,6)deka-3-én-8-(vagy 9)-il-ditiofoszfát | 401-850-9 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | ||||
| 015-147-00-6 | reaction mass of C12-14-tert-alkylammonium diphenyl phosphorothioate and dinonyl sulphide (or disulphide) | C12-C14-terc-alkilammónium-difenil-tiofoszfát és dinonil-szulfid (vagy -diszulfid) keveréke | 400-930-0 | Skin
Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H315 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H411 |
CLP00 | ||||
| 015-148-00-1 | 2-(diphosphonomethyl)succinic acid | 2-(difoszfonometil)borostyánkősav | 403-070-4 | 51395-42-7 | Skin
Corr. 1B Skin Sens. 1 |
H314 H317 |
GHS05 GHS07 Dgr |
H314 H317 |
CLP00 | |||
| 015-149-00-7 | reaction mass of: hexyldioctylphosphineoxide; dihexyloctylphosphineoxide; trioctylphosphineoxide | hexil-dioktil-foszfin-oxid; dihexiloktil-foszfin-oxid; trioktilfoszfin-oxid keveréke |
403-470-9 | Skin
Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
CLP00 | ||||
| 015-150-00-2 | (2-(1,3-dioxolan-2-yl)ethyl)triphenylphosphonium bromide | (2-(1,3-dioxolán-2-il)etil)trifenilfoszfónium-bromid | 404-940-6 | 86608-70-0 | Acute
Tox. 4 * STOT RE 2 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H373 ** H318 H412 |
GHS08 GHS05 GHS07 Dgr |
H302 H318 H373 ** H412 |
CLP00 | |||
| 015-151-00-8 | tris(isopropyl/tert-butylphenyl) phosphate | trisz(izopropil/terc-butilfenil)foszfát | 405-010-2 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | ||||
| 015-152-00-3 | dioxabenzofos (ISO); 2-methoxy-4H-1,3,2-benzodioxaphosphorin 2-sulphide | dioxabenzofosz
(ISO); 2-metoxi-4H-1,3,2-benzodioxafoszforin-2-szulfid |
223-292-3 | 3811-49-2 | Acute
Tox. 3 * Acute Tox. 3 * STOT SE 1 Aquatic Chronic 2 |
H311 H301 H370 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H311 H301 H370 ** H411 |
CLP00 | |||
| 015-153-00-9 | isazofos (ISO); O-(5-chloro-1-isopropyl-1,2,4-triazol-3-yl) O,O-diethyl phosphorothioate | izazofosz
(ISO); O-(5-klór-1-izopropil-1,2,4-triazol-3-il)-O, O-dietil-tiofoszfát |
255-863-8 | 42509-80-8 | Acute
Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H311 H301 H373 ** H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H311 H301 H373 ** H317 H410 |
CLP00 | |||
| 015-154-00-4 | ethephon; 2-chloroethylphosphonic acid | etefon; 2-klóretilfoszfonsav |
240-718-3 | 16672-87-0 | Acute
Tox. 3 Acute Tox. 4 Acute Tox. 4 Skin Corr. 1C Aquatic Chronic 2 |
H311 H332 H302 H314 H411 |
GHS06 GHS05 GHS09 Dgr |
H302 H311 H332 H314 H411 |
EUH071 |
STOT
SE 3; H335: C ≥ 5 % |
CLP00/ATP06 | |
| 015-155-00-X | glufosinate ammonium (ISO); ammonium 2-amino-4-(hydroxymethylphosphinyl)butyrate | glufoszinát-ammónium (ISO); ammónium-2-amino-4-(hidroximetilfoszfinil)butirát | 278-636-5 | 77182-82-2 | Repr.
1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * |
H360Fd H332 H312 H302 H373 ** |
GHS08 GHS07 Dgr |
H360Fd H332 H312 H302 H373 ** |
CLP00/ATP01 | |||
| 015-156-00-5 | methyl
3-[(dimethoxyphosphinothioyl)oxy]methacrylate [1] methacrifos (ISO); methyl (E)-3-[(dimethoxyphosphinothioyl)oxy]methacrylate [2] |
metil-3-[(dimetoxifoszfinotioil)oxi]metakrilát;
[1] metakrifosz (ISO); metil-(E)-3-[(dimetoxifoszfinotioil)oxi]metakrilát [2] |
250-366-2
[1] 250-366-2 [2] |
30864-28-9
[1] 62610-77-9 [2] |
Acute
Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
CLP00 | |||
| 015-157-00-0 | phosphonic
acid [1] phosphorous acid [2] |
foszfonsav;
[1] foszforos-sav [2] |
237-066-7
[1] 233-663-1 [2] |
13598-36-2
[1] 10294-56-1 [2] |
Acute
Tox. 4 * Skin Corr. 1A |
H302 H314 |
GHS05 GHS07 Dgr |
H302 H314 |
CLP00 | |||
| 015-158-00-6 | (η-cyclopentadienyl)(η-cumenyl)iron(1+)hexafluorophosphate(1-) | (η-ciklopenta-dienil)(η-kumenil)vas(1+)-hexafluorofoszfát(1-) | 402-340-9 | 32760-80-8 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | ||||
| 015-159-00-1 | hydroxyphosphonoacetic acid | hidroxifoszfonecetsav | 405-710-8 | 23783-26-8 | Acute
Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 |
H302 H373 ** H314 H317 |
GHS08 GHS05 GHS07 Dgr |
H302 H373 ** H314 H317 |
CLP00 | |||
| 015-160-00-7 | vanadyl pyrophosphate | vanádium-pirofoszfát | 406-260-5 | 58834-75-6 | Eye
Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H319 H317 H412 |
GHS07 Wng |
H319 H317 H412 |
CLP00 | |||
| 015-161-00-2 | divanadyl pyrophosphate | divanádium-pirofoszfát | 407-130-0 | 65232-89-5 | Acute
Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H302 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H317 H411 |
CLP00 | |||
| 015-162-00-8 | vanadium(IV) oxide hydrogen phosphate hemihydrate, lithium, zinc, molybdenum, iron and chlorine-doped | vanádium(IV)-oxid-hidrogén-foszfát-hemihidrát, lítium, cink, molibdén, vas és klór adalékkal | 407-350-7 | Acute
Tox. 4 * STOT RE 2 * Eye Dam. 1 Aquatic Chronic 2 |
H332 H373 ** H318 H411 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H332 H373 ** H318 H411 |
CLP00 | ||||
| 015-163-00-3 | bis(2,6-dimethoxybenzoyl)-2,4,4-trimethylpentylphosphinoxide | bisz(2,6-dimetoxibenzoil)-2,4,4-trimetilpentilfoszfin-oxid | 412-010-6 | 145052-34-2 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
CLP00 | |||
| 015-164-00-9 | calcium P,P'-(1-hydroxyethylene)bis(hydrogen phosphonate)dihydrate | kálcium-P, P'-(1-hidroxietilén)bisz(hidrogén-foszfonát)dihidrát | 400-480-5 | 36669-85-9 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | ||||
| 015-165-00-4 | reaction mass of: thiobis(4,1-phenylene)-S,S,S',S'-tetraphenyldisulfonium bishexafluorophosphate; diphenyl(4-phenylthiophenyl)sulfonium hexafluorophosphate | tiobisz(4,1-fenilén)-S,
S,S',S'-tetrafenildiszulfónium-biszhexafluorfoszfát; difenil(4-feniltiofenil)szulfónium-hexafluorantimonát keveréke |
404-986-7 | Eye
Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
CLP00 | ||||
| 015-166-00-X | 3,9-bis(2,6-di-tert-butyl-4-methylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane | 3,9-bisz(2,6-di-terc-butil-4-metilfenoxi)-2,4,8,10- tetraoxa-3,9-difoszfaspiro[5.5]undekán | 410-290-4 | 80693-00-1 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 015-167-00-5 | 3-(hydroxyphenylphosphinyl)propanoic acid | 3-(hidroxifenilfoszfinil)propánsav | 411-200-6 | 14657-64-8 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | |||
| 015-168-00-0 | fosthiazate (ISO); (RS)-S-sec-butyl-O-ethyl-2-oxo-1,3-thiazolidin-3-ylphosphonothioate | fosztiazát
(ISO); (RS)-S-szek-butil-O-etil-2-oxo-1,3-tiazolidin-3-il-tiofoszfát |
98886-44-3 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H312 H317 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H312 H317 H410 |
EUH070 |
CLP00 | |||
| 015-169-00-6 | tributyltetradecylphosphonium tetrafluoroborate | tributiltetradecilfoszfónium-tetrafluoroborát | 413-520-1 | Acute
Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H314 H317 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H302 H373 ** H314 H317 H410 |
CLP00 | ||||
| 015-170-00-1 | reaction mass of: di-(1-octane-N,N,N-trimethylammonium) octylphosphate; 1-octane-N,N,N-trimethylammonium di-octylphosphate; 1-octane-N,N,N-trimethylammonium octylphosphate | a
következő anyagok keveréke: di-(1-oktán-N, N,N-trimetil-ammónium) oktil-foszfát; 1-oktán-N, N,N-trimetil-ammónium-di-oktil-foszfát; 1-oktán-N, N,N-trimetil-ammónium oktil-foszfát |
407-490-9 | Acute
Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
CLP00 | ||||
| 015-171-00-7 | O,O,O-tris(2(or 4)-C9-10-isoalkylphenyl) phosphorothioate | O, O,O-trisz(2(vagy 4)-C9-10-izoalkilfenil)-tiofoszfát | 406-940-1 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | ||||
| 015-172-00-2 | reaction mass of: bis(isotridecylammonium)mono(di-(4-methylpent-2-yloxy)thiophosphorothionylisopropyl)phosphate; isotridecylammonium bis(di-(4-methylpent-2-yloxy)thiophosphorothionylisopropyl)phosphate | bisz(izotridecilammónium)mono(di-(4-metilpent-2-iloxi)tiofoszforotionil-izopropil)-foszfát; izotridecilammónium-bisz(di-(4- metilpent-2-iloxi)tiofoszforotionil-izopropil)-foszfát keveréke |
406-240-6 | Flam.
Liq. 3 Skin Corr. 1B Aquatic Chronic 2 |
H226 H314 H411 |
GHS02 GHS05 GHS09 Dgr |
H226 H314 H411 |
CLP00 | ||||
| 015-173-00-8 | methyl [2-(1,1-dimethylethyl)-6-methoxypyrimidin-4-yl]ethylphosphonothioate | metil-[2-(1,1-dimetiletil)-6-metoxipirimidin-4-il]etiltiofoszfonát | 414-080-3 | 117291-73-3 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | |||
| 015-174-00-3 | 1-chloro-N,N-diethyl-1,1-diphenyl-1-(phenylmethyl)phosphoramine | 1-klór-N,N-dietil-1,1-difenil-1-(fenilmetil)foszforamin | 411-370-1 | 82857-68-9 | Acute
Tox. 3 * Eye Dam. 1 Aquatic Chronic 2 |
H301 H318 H411 |
GHS06 GHS05 GHS09 Dgr |
H301 H318 H411 |
CLP00 | |||
| 015-175-00-9 | tert-butyl (triphenylphosphoranylidene) acetate | terc-butil(trifenilfoszforanilidén)-acetát | 412-880-7 | 35000-38-5 | Acute
Tox. 3 * STOT RE 2 * Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H301 H373 ** H319 H317 H411 |
GHS06 GHS08 GHS09 Dgr |
H301 H373 ** H319 H317 H411 |
CLP00 | |||
| 015-176-00-4 | P,P,P',P'-tetrakis-(o-methoxyphenyl)propane-1,3-diphosphine | P, P,P',P'-tetrakisz-(o-metoxifenil)propán-1,3-difoszfin | 413-430-2 | 116163-96-3 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 015-177-00-X | ((4-phenylbutyl)hydroxyphosphoryl)acetic acid | [(4-fenilbutil)hidroxifoszforil] ecetsav | 412-170-7 | 83623-61-4 | STOT
RE 2 * Eye Dam. 1 Skin Sens. 1 |
H373
** H318 H317 |
GHS08 GHS05 Dgr |
H373
** H318 H317 |
CLP00 | |||
| 015-178-00-5 | (R)-α-phenylethylammonium (-)-(1R, 2S)-(1,2-epoxypropyl)phosphonate monohydrate | (R)-α-feniletilammónium(-)-(1R, 2S)-(1,2-epoxipropil)foszfonát-monohidrát | 418-570-8 | 25383-07-7 | Repr.
2 Aquatic Chronic 2 |
H361f
*** H411 |
GHS08 GHS09 Wng |
H361f
*** H411 |
CLP00 | |||
| 015-179-00-0 | UVCB condensation product of: tetrakis-hydroxymethylphosphonium chloride, urea and distilled hydrogenated C16-18 tallow alkylamine | tetrakisz-hidroximetilfoszfónium-klorid, karbamid és desztillált, hidrogénezett C16-18 helyen alkilaminezett viasz UVCB kondenzációs terméke | 422-720-8 | 166242-53-1 | Carc.
2 Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H373 ** H314 H317 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H351 H302 H373 ** H314 H317 H410 |
CLP00 | |||
| 015-180-00-6 | [R-(R*,S*)]-[[2-methyl-1-(1-oxopropoxy)propoxy]-(4-phenylbutyl)phosphinyl] acetic acid, (-)-cinchonidine (1:1) salt | [R-(R*,S*)]-[[2-metil-1-(1-oxopropoxi)propoxi]-(4-fenilbutil)foszfinil]ecetsav, (-)-cinkonidin (1:1) só | 415-820-8 | 137590-32-0 | Eye
Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
CLP00 | |||
| 015-181-00-1 | phosphine | foszfin | 232-260-8 | 7803-51-2 | Flam.
Gas 1 Press. Gas Acute Tox. 1 Skin Corr. 1B Aquatic Acute 1 |
H220 H330 H314 H400 |
GHS02 GHS04 GHS06 GHS05 GHS09 Dgr |
H220 H330 H314 H400 |
Inhalation:
ATE = 10 ppmV (Gases) |
U | CLP00/ATP15 | |
| 015-182-00-7 | tetrapropan-2-yl (dichloromethanediyl)bis(phosphonate) | tetrapropán-2-il (diklórmetán-diil)bisz(foszfonát) | 430-630-5 | 10596-22-2 | Acute
Tox. 4 * Eye Irrit. 2 Skin Sens. 1 |
H302 H319 H317 |
GHS07 Wng |
H302 H319 H317 |
ATP01/ATP01corr | |||
| 015-183-00-2 | (1-hydroxydodecylidene)diphosphonic acid | (1-hidroxi-dodecilidén)difoszfonsav | 425-230-2 | 16610-63-2 | Skin
Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
ATP01 | |||
| 015-184-00-8 | Salts of glyphosate, with the exception of those specified elsewhere in this Annex | glifozát sói, kivéve az e mellékletben külön szereplőket | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
A | CLP00 | ||||
| 015-186-00-9 | chlorpyrifos-methyl (ISO),; O, O-dimethyl O-3,5,6-trichloro-2-pyridyl phosphorothioate | klórpirifosz-metil
(ISO); O, O-dimetil-O-3,5,6-triklór-2-piridil-tiofoszfát |
227-011-5 | 5598-13-0 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
M=10000 |
CLP00 | ||
| 015-187-00-4 | reaction mass of: tetrasodium(((2-hydroxyethyl)imino)bis(methylene))bisphosphonate, N-oxide; trisodium ((tetrahydro-2-hydroxy-4H-1,4,2-oxazaphosphorin-4-yl)-methyl)phosphonate, N-oxide, P-oxide | tetranátrium(((2-hidroxi-etil)imino)bisz(metilén))biszfoszfonát, N-oxid; trinátrium ((tetrahidro-2-hidroxi-4H-1,4,2-oxazafoszforin-4-il)-metil)foszfonát, N-oxid, P-oxid keveréke |
417-540-1 | Eye
Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
CLP00 | ||||
| 015-189-00-5 | phenyl bis(2,4,6-trimethylbenzoyl)-phosphine oxide | fenil-bisz(2,4,6-trimetilbenzoil)-foszfin-oxid | 423-340-5 | 162881-26-7 | Skin
Sens. 1A Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
CLP00/ATP14 | |||
| 015-190-00-0 | bis(2,4-dicumylphenyl) neopentyl diphosphite; 3,9-bis[2,4-bis(1-methyl-1-phenylethyl)phenoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane | bisz(2,4-dikumilfenil)neopentil-difoszfit; 3,9-bisz[2,4-bisz(1-metil-1-feniletil)fenoxi]-2,4,8,10- tetraoxa-3,9-difoszfázpiro[5.5]undekán |
421-920-2 | 154862-43-8 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 015-191-00-6 | dodecyldiphenyl phosphate | dodecildifenil-foszfát | 431-760-5 | 27460-02-2 | Skin
Irrit. 2 Aquatic Chronic 3 |
H315 H412 |
GHS07 Wng |
H315 H412 |
ATP01 | |||
| 015-192-00-1 | tetrakis(2,6-dimethylphenyl)-m-phenylene biphosphate | tetrakisz(2,6-dimetilfenil)-m-fenilén-bifoszfát | 432-770-2 | 139189-30-3 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
ATP01/ATP06 | |||
| 015-193-00-7 | triphenyl(phenylmethyl)phosphonium 1,1,2,2,3,3,4,4,4-nonafluoro-N-methyl-1-butanesulfonamide (1:1) | trifenil(fenilmetil)foszfónium 1,1,2,2,3,3,4,4,4-nonafluor-N-metil-1-butánszulfonamid (1:1) | 442-960-7 | 332350-93-3 | Acute
Tox. 3 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H318 H400 H410 |
GHS05 GHS06 GHS09 Dgr |
H301 H318 H410 |
ATP01 | |||
| 015-194-00-2 | tetrabutyl-phosphonium nonafluoro-butane-1-sulfonate | tetrabutil-foszfónium-nonafluor-bután-1-szulfonát | 444-440-5 | 220689-12-3 | Acute
Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
ATP01 | |||
| 015-195-00-8 | reaction mass of: potassium o-toluenephosphonate; potassium m-toluenephosphonate; potassium p-toluenephosphonate | kálium-o-toluolfoszfonát; kálium-m-toluolfoszfonát; kálium-p-toluolfoszfonát keveréke |
433-860-4 | - | Eye
Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H319 H317 H412 |
GHS07 Wng |
H319 H317 H412 |
ATP01 | |||
| 015-196-00-3 | reaction mass of: dimethyl (2-(hydroxymethylcarbamoyl)ethyl)phosphonate; diethyl (2-(hydroxymethylcarbamoyl)ethyl)phosphonate; methyl ethyl (2-(hydroxymethylcarbamoyl)ethyl)phosphonate | dimetil-(2-(hidroximetilkarbamoil)etil)foszfonát; dietil-(2-(hidroximetilkarbamoil)etil)foszfonát; metil-etil-(2-(hidroximetilkarbamoil)etil)foszfonát keveréke |
435-960-3 | - | Carc.
1B Muta. 1B Skin Sens. 1 |
H350 H340 H317 |
GHS08 GHS07 Dgr |
H350 H340 H317 |
ATP01 | |||
| 015-197-00-9 | bis(2,4,4-trimethylpentyl)dithiophosphonic acid | bisz(2,4,4-trimetilpentil)-ditiofoszfonsav | 420-160-9 | 107667-02-7 | Flam.
Liq. 3 Acute Tox. 3 * Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 2 |
H226 H331 H302 H314 H411 |
GHS02 GHS06 GHS05 GHS09 Dgr |
H226 H331 H302 H314 H411 |
ATP01 | |||
| 015-198-00-4 | (4-phenylbutyl)phosphinic acid | (4-fenilbutil)foszfinsav; | 420-450-5 | 86552-32-1 | Carc.
2 Eye Dam. 1 |
H351 H318 |
GHS05 GHS08 Dgr |
H351 H318 |
ATP01 | |||
| 015-199-00-X | tris[2-chloro-1-(chloromethyl)ethyl] phosphate | trisz[2-klór-1-klórmetil)etil]-foszfát | 237-159-2 | 13674-87-8 | Carc.
2 |
H351 |
GHS08 Wng |
H351 |
ATP03 | |||
| 015-200-00-3 | indium phosphide | indium-foszfid | 244-959-5 | 22398-80-7 | Carc.
1B Repr. 2 STOT RE 1 |
H350 H361f H372 (lungs) |
GHS08 Dgr |
H350 H361f H372 (lungs) |
Carc
1B; H350: C ≥ ,01 % STOT RE 1; : C ≥ ,1 % STOT RE 2; H373: ,01 % ≤ C < ,1 % |
ATP03 | ||
| 015-201-00-9 | trixylyl phosphate | trixilil-foszfát | 246-677-8 | 25155-23-1 | Repr.
1B |
H360F |
GHS08 Dgr |
H360F |
ATP03 | |||
| 015-202-00-4 | tris(nonylphenyl) phosphite | trisz(nonil-fenil)-foszfit | 247-759-6 | 26523-78-4 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
ATP03 | |||
| 015-203-00-X | diphenyl(2,4,6-trimethylbenzoyl)phosphine oxide | difenil(2,4,6-trimetilbenzoil)foszfin-oxid | 278-355-8 | 75980-60-8 | Repr.
2 |
H361f
(causing atrophy of the testes) |
GHS08 Wng |
H361f
(causing atrophy of the testes) |
ATP03 | |||
| 016-001-00-4 | hydrogen sulphide | hidrogén-szulfid; kén-hidrogén |
231-977-3 | 7783-06-4 | Flam.
Gas 1 Press. Gas Acute Tox. 2 * Aquatic Acute 1 |
H220 H330 H400 |
GHS02 GHS04 GHS06 GHS09 Dgr |
H220 H330 H400 |
U | CLP00 | ||
| 016-002-00-X | barium sulphide | bárium-szulfid | 244-214-4 | 21109-95-5 | Acute
Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 |
H332 H302 H400 |
GHS07 GHS09 Wng |
H332 H302 H400 |
EUH031 |
CLP00 | ||
| 016-003-00-5 | barium polysulphides | bárium-poliszulfidok | 256-814-3 | 50864-67-0 | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 |
H335 H315 H319 H400 |
GHS07 GHS09 Wng |
H319 H335 H315 H400 |
EUH031 |
CLP00 | ||
| 016-004-00-0 | calcium sulphide | kálcium-szulfid | 243-873-5 | 20548-54-3 | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 |
H335 H315 H319 H400 |
GHS07 GHS09 Wng |
H319 H335 H315 H400 |
EUH031 |
CLP00 | ||
| 016-005-00-6 | calcium polysulphides | kálcium-poliszulfidok | 215-709-2 | 1344-81-6 | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 |
H335 H315 H319 H400 |
GHS07 GHS09 Wng |
H319 H335 H315 H400 |
EUH031 |
CLP00 | ||
| 016-006-00-1 | dipotassium sulphide; potassium sulphide | dikálium-szulfid; kálium-szulfid |
215-197-0 | 1312-73-8 | Skin
Corr. 1B Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
EUH031 |
CLP00 | ||
| 016-007-00-7 | potassium polysulphides | kálium-poliszulfidok | 253-390-1 | 37199-66-9 | Skin
Corr. 1B Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
EUH031 |
CLP00 | ||
| 016-008-00-2 | ammonium polysulphides | ammónium-poliszulfidok | 232-989-1 | 9080-17-5 | Skin
Corr. 1B Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
EUH031 |
EUH031:
C ≥ 1 % |
CLP00 | |
| 016-009-00-8 | disodium sulfide; sodium sulfide | dinátrium-szulfid; nátrium-szulfid |
215-211-5 | 1313-82-2 | Acute
Tox. 3 * Acute Tox. 4 * Skin Corr. 1B Aquatic Acute 1 |
H311 H302 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H311 H302 H314 H400 |
CLP00/ATP01 | |||
| 016-010-00-3 | sodium polysulphides | nátrium-poliszulfidok | 215-686-9 | 1344-08-7 | Acute
Tox. 3 * Skin Corr. 1B Aquatic Acute 1 |
H301 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H301 H314 H400 |
EUH031 |
CLP00 | ||
| 016-011-00-9 | sulphur dioxide | kén-dioxid | 231-195-2 | 7446-09-5 | Press.
Gas Acute Tox. 3 * Skin Corr. 1B |
H331 H314 |
GHS04 GHS06 GHS05 Dgr |
H331 H314 |
* |
5 U | CLP00 | |
| 016-012-00-4 | disulphur dichloride; sulfur monochloride | dikén-diklorid; kén-monoklorid |
233-036-2 | 10025-67-9 | Acute
Tox. 3 * Acute Tox. 4 * Skin Corr. 1A Aquatic Acute 1 |
H301 H332 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H301 H332 H314 H400 |
EUH014 EUH029 |
STOT
SE 3; H335: C ≥ 1 % |
CLP00 | |
| 016-013-00-X | sulphur dichloride | kén-diklorid | 234-129-0 | 10545-99-0 | STOT
SE 3 Skin Corr. 1B Aquatic Acute 1 |
H335 H314 H400 |
GHS05 GHS07 GHS09 Dgr |
H314 H335 H400 |
EUH014 |
STOT
SE 3; H335: C ≥ 5 % |
CLP00 | |
| 016-014-00-5 | sulphur tetrachloride | kén-tetraklorid | 13451-08-6 | Skin
Corr. 1B Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
EUH014 |
STOT
SE 3; H335: C ≥ 5 % |
CLP00 | ||
| 016-015-00-0 | thionyl dichloride; thionyl chloride | tionil-diklorid; tionil-klorid |
231-748-8 | 7719-09-7 | Acute
Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H332 H302 H314 |
GHS05 GHS07 Dgr |
H332 H302 H314 |
EUH014 EUH029 |
STOT
SE 3; H335: C ≥ 1 % |
CLP00 | |
| 016-016-00-6 | sulphuryl chloride | szulfuril-diklorid | 232-245-6 | 7791-25-5 | STOT
SE 3 Skin Corr. 1B |
H335 H314 |
GHS05 GHS07 Dgr |
H314 H335 |
EUH014 |
CLP00 | ||
| 016-017-00-1 | chlorosulphonic acid | klórszulfonsav | 232-234-6 | 7790-94-5 | STOT
SE 3 Skin Corr. 1A |
H335 H314 |
GHS05 GHS07 Dgr |
H314 H335 |
EUH014 |
CLP00 | ||
| 016-018-00-7 | fluorosulphonic acid | fluorszulfonsav | 232-149-4 | 7789-21-1 | Acute
Tox. 4 * Skin Corr. 1A |
H332 H314 |
GHS05 GHS07 Dgr |
H332 H314 |
CLP00 | |||
| 016-019-00-2 | oleum ... % SO3 | óleum … % SO3 | STOT
SE 3 Skin Corr. 1A |
H335 H314 |
GHS05 GHS07 Dgr |
H314 H335 |
EUH014 |
B | CLP00 | |||
| 016-020-00-8 | sulphuric acid ... % | kénsav … % | 231-639-5 | 7664-93-9 | Skin
Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
Skin
Corr. 1A; H314: C ≥ 15 % Skin Irrit. 2; H315: 5 % ≤ C < 15 % Eye Irrit. 2; H319: 5 % ≤ C < 15 % |
B | CLP00 | |
| 016-021-00-3 | methanethiol; methyl mercaptan | metántiol; metil-merkaptán |
200-822-1 | 74-93-1 | Flam.
Gas 1 Press. Gas Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H220 H331 H400 H410 |
GHS02 GHS04 GHS06 GHS09 Dgr |
H220 H331 H410 |
U | CLP00 | ||
| 016-022-00-9 | ethanethiol; ethyl mercaptan | etántiol; etil-merkaptán |
200-837-3 | 75-08-1 | Flam.
Liq. 2 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H225 H332 H400 H410 |
GHS02 GHS07 GHS09 Dgr |
H225 H332 H410 |
CLP00 | |||
| 016-023-00-4 | dimethyl sulphate | dimetil-szulfát | 201-058-1 | 77-78-1 | Carc.
1B Muta. 2 Acute Tox. 2 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 |
H350 H341 H330 H301 H314 H317 |
GHS06 GHS08 GHS05 Dgr |
H350 H341 H330 H301 H314 H317 |
Carc.
1B; H350: C ≥ 0,01 % Muta. 2; H341: C ≥ 0,01 % STOT SE 3; H335: C ≥ 5 % |
CLP00 | ||
| 016-024-00-X | dimexano (ISO); bis(methoxythiocarbonyl) disulphide | dimexano(ISO); bisz(metoxitiokarbonil)diszulfid | 215-993-8 | 1468-37-7 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | |||
| 016-025-00-5 | disul (ISO); 2-(2,4-dichlorophenoxy)ethyl hydrogensulphate; 2,4-DES | diszul
(ISO); 2-(2,4-diklórfenoxi)etil-hidrogén-szulfát; 2,4-DES |
205-259-5 | 149-26-8 | Acute
Tox. 4 * Skin Irrit. 2 Eye Dam. 1 |
H302 H315 H318 |
GHS05 GHS07 Dgr |
H302 H315 H318 |
CLP00 | |||
| 016-026-00-0 | sulphamidic acid; sulphamic acid; sulfamic acid | szulfamidsav; szulfaminsav; szulfaminsav |
226-218-8 | 5329-14-6 | Skin
Irrit. 2 Eye Irrit. 2 Aquatic Chronic 3 |
H315 H319 H412 |
GHS07 Wng |
H319 H315 H412 |
CLP00 | |||
| 016-027-00-6 | diethyl sulphate | dietil-szulfát | 200-589-6 | 64-67-5 | Carc.
1B Muta. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H350 H340 H332 H312 H302 H314 |
GHS05 GHS08 GHS07 Dgr |
H350 H340 H332 H312 H302 H314 |
CLP00 | |||
| 016-028-00-1 | sodium dithionite; sodium hydrosulphite | nátrium-ditionit; nátrium-hidroszulfit |
231-890-0 | 7775-14-6 | Self-heat.
1 Acute Tox. 4 * |
H251 H302 |
GHS02 GHS07 Dgr |
H251 H302 |
EUH031 |
CLP00 | ||
| 016-029-00-7 | p-toluenesulphonic acid, containing more than 5 % H2SO4 | p-toluolszulfonsav (kénsav (H2SO4) tartalom több mint 5 %) | Skin
Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
Skin
Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 10 % ≤ C < 25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
CLP00 | ||||
| 016-030-00-2 | p-toluenesulphonic acid (containing a maximum of 5 % H2SO4) | p-toluolszulfonsav (kénsav (H2SO4) tartalom max. 5 %) | 203-180-0 | 104-15-4 | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 |
H335 H315 H319 |
GHS07 Wng |
H319 H335 H315 |
STOT
SE 3; H335: C ≥ 20 % |
CLP00 | ||
| 016-031-00-8 | tetrahydrothiophene-1,1-dioxide; sulpholane | tetrahidrotiofén-1,1-dioxid; szulfolán | 204-783-1 | 126-33-0 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 016-032-00-3 | 1,3-propanesultone; 1,2-oxathiolane 2,2-dioxide | 1,3-propánszulton; 1,2-oxatiolán-2,2-dioxid |
214-317-9 | 1120-71-4 | Carc.
1B Acute Tox. 4 * Acute Tox. 4 * |
H350 H312 H302 |
GHS08 GHS07 Dgr |
H350 H312 H302 |
Carc.
1B; H350: C ≥ 0,01 % |
CLP00 | ||
| 016-033-00-9 | dimethylsulfamoylchloride | dimetilszulfamoil-klorid | 236-412-4 | 13360-57-1 | Carc.
1B Acute Tox. 2 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H350 H330 H312 H302 H314 |
GHS06 GHS05 GHS08 Dgr |
H350 H330 H312 H302 H314 |
CLP00 | |||
| 016-034-00-4 | tetrasodium 3,3'-(piperazine-1,4-diylbis((6-chloro-1,3,5-triazine-2,4-diyl)imino(2-acetamido)-4,1-phenyleneazo))bis(naphthalene-1,5-disulphonate) | tetranátrium-3,3’-[piperazin-1,4-diilbisz[(6-klór-1,3,5-triazin-2,4,-diil)imino(2-acetamido)-4,1-fenilénazo]]bisz(naftalin-1,5-diszulfonát) | 400-010-9 | 81898-60-4 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 016-035-00-X | pentasodium 5-anilino-3-(4-(4-(6-chloro-4-(3-sulphonatoanilino)-1,3,5-triazin-2-ylamino)-2,5-dimethylphenylazo)-2,5-disulphonatophenylazo)-4-hydroxynaphthalene-2,7-disulphonate | pentanátrium-5-anilino-3-(4-(4-(6-klór-4-(3-szulfonátoanilino)-1,3,5-triazin-2-ilamino)-2,5-dimetilfenilazo)-2,5- diszulfonátofenilazo)-4- hidroxinaftalin-2,7-diszulfonát | 400-120-7 | Eye
Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
CLP00 | ||||
| 016-036-00-5 | tetrasodium 5-(4,6-dichloro-5-cyanopyrimidin-2-ylamino)-4-hydroxy-2,3-azodinaphthalene-1,2,5,7-disulphonate | tetranátrium-5-(4,6-diklór-5-cianopirimidin-2-ilamino)-4-hidroxi-2,3-azodinaftalin -1,2,5,7-diszulfonát | 400-130-1 | Resp.
Sens. 1 Aquatic Chronic 2 |
H334 H411 |
GHS08 GHS09 Dgr |
H334 H411 |
CLP00 | ||||
| 016-037-00-0 | disodium 1-amino-4-(4-benzenesulphonamido-3-sulphonatoanilino)anthraquinone-2-sulphonate | dinátrium-1-amino-4-(4-benzolszulfonamido-3-szulfonátoanilino)antrakinon-2-szulfonát | 400-350-8 | 85153-93-1 | Eye
Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
CLP00 | |||
| 016-038-00-6 | disodium 6-((4-chloro-6-(N-methyl)-2-toluidino)-1,3,5-triazin-2-ylamino)-1-hydroxy-2-(4-methoxy-2-sulphonatophenylazo)naphthalene-3-sulphonate | dinátrium-6-((4-klór-6-(N- metil)-2-toluidino)-1,3,5-triazin-2-ilamino)-1-hidroxi-2- (4-metoxi-2-szulfonátofenilazo)-naftalin-3-szulfonát | 400-380-1 | 86393-35-3 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 016-039-00-1 | tetrasodium 2-(6-chloro-4-(4-(2,5-dimethyl-4-(2,5-disulphonatophenylazo)phenylazo)-3-ureidoanilino)-1,3,5-triazin-2-ylamino)benzene-1,4-disulphonate | tetranátrium-2-(6-klór-4-(4-(2,5-dimetil-4-(2,5-diszulfonátofenilazo) fenilazo)-3-ureidoanilino)-1,3,5-triazin-2-ilamino)benzol-1,4-diszulfonát |
400-430-2 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | ||||
| 016-040-00-7 | reaction mass of disodium 6-(2,4-dihydroxyphenylazo)-3-(4-(4-(2,4-dihydroxyphenylazo)anilino)-3-sulphonatophenylazo)-4-hydroxynaphthalene-2-sulphonate and disodium 6-(2,4-diaminophenylazo)-3-(4-(4-(2,4-diaminophenylazo)anilino)-3-sulphonatophenylazo)-4-hydroxynaphthalene-2-sulphonate and trisodium 6-(2,4-dihydroxyphenylazo)-3-(4-(4-(7-(2,4-dihydroxyphenylazo)-1-hydroxy-3-sulphonato-2-naphthylazo)anilino)-3-sulphonatophenylazo)-4-hydroxynaphthalene-2-sulphonate | a
következő anyagok keveréke: dinátrium-6- (2,4-dihidroxifenilazo)-3-(4-(4-(2,4-dihidroxifenilazo)anilino)-3-szulfonátofenilazo)-4-hidroxinaftalin-2-szulfonát és dinátrium-6-(2,4-diaminofenilazo)-3-(4-(4-(2,4-diaminofenilazo)anilino)-3-szulfonátofenilazo)-4-hidroxinaftalin-2-szulfonát és trinátrium 6-(2,4-dihidroxifenilazo)-3-(4-(4-(7-(2,4-dihidroxifenilazo)-1-hidroxi-3- szulfonáto-2-naftilazo)anilino)-3-szulfonátofenilazo)-4-hidroxinaftalin-2-szulfonát |
400-570-4 | Eye
Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
CLP00 | ||||
| 016-041-00-2 | calcium 2,5-dichloro-4-(4-((5-chloro-4-methyl-2-sulphonatophenyl)azo)-5-hydroxy-3-methylpyrazol-1-yl)benzenesulphonate | kálcium-2,5-diklór-4-(4-((5-klór-4-metil-2-szulfonátofenil)azo)-5-hidroxi-3-metilpirazol-1-il)benzolszulfonát | 400-710-4 | Acute
Tox. 4 * |
H332 |
GHS07 Wng |
H332 |
CLP00 | ||||
| 016-042-00-8 | tetrasodium 5-benzamido-3-(5-(4-fluoro-6-(1-sulphonato-2-naphthylamino)-1,3,5-triazin-2-ylamino)-2-sulphonatophenylazo)-4-hydroxynaphthalene-2,7- disulphonate | tetranátrium-5-benzamido-3-(5-(4-fluor-6-(1-szulfonáto-2- naftilamino)-1,3,5-triazin-2- ilamino)-2-szulfonátofenilazo)-4-hidroxinaftalin-2,7-diszulfonát | 400-790-0 | 85665-97-0 | Skin
Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H315 H319 H317 |
GHS07 Wng |
H319 H315 H317 |
CLP00 | |||
| 016-043-00-3 | dilithium 6-acetamido-4-hydroxy-3-(4-((2-sulphonatooxy)ethylsulphonyl)phenylazo)naphthalene-2-sulphonate | dilítium-6-acetamido-4-hidroxi-3-(4-((2-szulfonátooxi)etilszulfonil)fenilazo)naftalin-2-szulfonát | 401-010-1 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | ||||
| 016-044-00-9 | disodium S,S-hexane-1,6-diyldi(thiosulphate) dihydrate | dinátrium-S, S-hexán-1,6-diil-di(tioszulfát)-dihidrát | 401-320-7 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
CLP00 | ||||
| 016-045-00-4 | lithium sodium hydrogen 4-amino-6-(5-(5-chloro-2,6-difluoropyrimidin-4-ylamino)-2-sulphonatophenylazo)-5-hydroxy-3-(4-(2-(sulphonatooxy)ethylsulphonyl)phenylazo)naphthalene-2,7-disulphonate | lítium-nátrium-hidrogén-4-amino-6-[5-(5-klór-2,6-difluorpirimidin-4-ilamino)-2-szulfonátofenilazo]-5-hidroxi-3-[4-[2-(szulfonátooxi)etilszolfonil])fenilazo]naftalin-2,7-diszulfonát | 401-560-2 | 108624-00-6 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 016-046-00-X | sodium hydrogensulphate | nátrium-hidrogén-szulfát | 231-665-7 | 7681-38-1 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | |||
| 016-047-00-5 | hexasodium 7-(4-(4-(4-(2,5-disulphonatoanilino)-6-fluoro-1,3,5-triazin-2-ylamino)-2-methylphenylazo)-7-sulphonatonaphthylazo)naphthalene-1,3,5- trisulphonate | hexanátrium-7-[4-[4-[4-(2,5-diszulfonátoanilino)-6-fluor-1,3,5-triazin-2-ilamino]-2-metilfenilazo]-7-szulfonátonaftilazo]naftalin-1,3,5-triszulfonát | 401-650-1 | 85665-96-9 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 016-048-00-0 | sodium 3,5-dichloro-2-(5-cyano-2,6-bis(3-hydroxypropylamino)-4-methylpyridin-3-ylazo)benzenesulphonate | nátrium-3,5-diklór-2-(5-ciano-2,6-bisz(3-hidroxipropilamino)-4-metilpiridin-3-ilazo)benzolszulfonát | 401-870-8 | Eye
Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
CLP00 | ||||
| 016-049-00-6 | calcium octadecylxylenesulphonate | kálcium-oktadecilxilolszulfonát | 402-040-8 | Skin
Corr. 1B Aquatic Chronic 2 |
H314 H411 |
GHS05 GHS09 Dgr |
H314 H411 |
CLP00 | ||||
| 016-050-00-1 | potassium sodium 5-(4-chloro-6-(N-(4-(4-chloro-6-(5-hydroxy-2,7-disulphonato-6-(2-sulphonatophenylazo)-4-naphthylamino)-1,3,5-triazin-2-ylamino) phenyl-N-methyl)amino)-1,3,5-triazin-2-ylamino)-4-hydroxy-3-(2-sulphonatophenylazo)naphthalene-2,7-disulphonat | kálium-nátrium-5-(4-klór-6-(N-(4-(4-klór-6-(5-hidroxi-2,7-diszulfonáto-6-(2-szulfonátofenilazo)-4-naftilamino)-1,3,5-triazin-2-ilamino) fenil-N-metil)amino)-1,3,5- triazin-2-ilamino)-4-hidroxi-3-(2-szulfonátofenilazo)naftalin-2,7-diszulfonát | 402-150-6 | Eye
Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
CLP00 | ||||
| 016-051-00-7 | trisodium 7-(4-(6-fluoro-4-(2-(2-vinylsulphonylethoxy)ethylamino)-1,3,5-triazin-2-ylamino)-2-ureidophenylazo)naphthalene-1,3,6- trisulphonate | trinátrium-7-[4-[6-fluor-4-[2-(2-vinilszulfoniletoxi)etilamino]-1,3,5-triazin-2-ilamino]-2-ureidofenilazo]naftalin-1,3,6-triszulfonát | 402-170-5 | 106359-91-5 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 016-052-00-2 | benzyltributylammonium 4-hydroxynaphthalene-1-sulphonate | benziltributilammónium-4-hidroxinaftalin-1-szulfonát | 402-240-5 | 102561-46-6 | Acute
Tox. 4 * Aquatic Chronic 2 |
H332 H411 |
GHS07 GHS09 Wng |
H332 H411 |
CLP00 | |||
| 016-053-00-8 | (C16 or C18-n-alkyl)(C16 or C18-n-alkyl)ammonium 2-((C16 or C18-n-alkyl)(C16 or C18-n-alkyl)carbamoyl)benzenesulphonate | (C16 vagy C18-n-alkil)(C16 vagy C18-n-alkil)ammónium-2-((C16 vagy C18-n-alkil)(C16 vagy C18-n-alkil)karbamoil)benzolszulfonát | 402-460-1 | Skin
Irrit. 2 Skin Sens. 1 Aquatic Chronic 4 |
H315 H317 H413 |
GHS07 Wng |
H315 H317 H413 |
CLP00 | ||||
| 016-054-00-3 | sodium 4-(2,4,4-trimethylpentylcarbonyloxy)benzenesulfonate | nátrium-4-(2,4,4-trimetilpentilkarboniloxi)-benzolszulfonát | 400-030-8 | Acute
Tox. 3 * Acute Tox. 4 * STOT SE 3 STOT RE 1 Eye Irrit. 2 Skin Sens. 1 |
H331 H302 H335 H372 ** H319 H317 |
GHS06 GHS08 Dgr |
H331 H372 ** H302 H319 H335 H317 |
CLP00 | ||||
| 016-055-00-9 | tetrasodium 4-amino-3,6-bis(5-(6-chloro-4-(2-hydroxyethylamino)-1,3,5-triazin-2-ylamino)-2-sulfonatophenylazo)-5-hydroxynaphthalene-2,7-sulfonate (containing > 35 % sodium chloride and sodium acetate) | tetranátrium-4-amino-3,6-bisz[5-[6-klór-4-(2-hidroxietilamino)-1,3,5-triazin-2-ilamino]-2-szulfonátofenilazo]-5-hidroxinaftalin-2,7-szulfonát (> 35 % nátrium-kloridot és nátrium-acetátot tartalmaz) | 400-510-7 | Eye
Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
CLP00 | ||||
| 016-056-00-4 | potassium hydrogensulphate | kálium-hidrogén-szulfát | 231-594-1 | 7646-93-7 | STOT
SE 3 Skin Corr. 1B |
H335 H314 |
GHS05 GHS07 Dgr |
H314 H335 |
CLP00 | |||
| 016-057-00-X | styrene-4-sulfonyl chloride | sztirol-4-szulfonil-klorid | 404-770-2 | 2633-67-2 | Skin
Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H315 H318 H317 |
GHS05 GHS07 Dgr |
H315 H318 H317 |
CLP00 | |||
| 016-058-00-5 | thionyl chloride, reaction products with 1,3,4-thiadiazol-2,5-dithiol, tert-nonanethiol and C12-14-tert-alkylamine | tionil-klorid reakcióterméke 1,3,4-tiadiazol-2,5-ditiollal, terc-nonánetiollal és C12-14-terc-alkil-aminnal | 404-820-3 | Skin
Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H315 H317 H412 |
GHS07 Wng |
H315 H317 H412 |
CLP00 | ||||
| 016-059-00-0 | N,N,N',N'-tetramethyldithiobis(ethylene)diamine dihydrochloride | N, N,N',N'-tetrametil-ditiobisz(etilén)diamin-dihidroklorid | 405-300-9 | 17339-60-5 | Acute
Tox. 4 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H317 H410 |
CLP00 | |||
| 016-060-00-6 | diammonium peroxodisulphate; ammonium persulphate | diammónium-peroxodiszulfát; ammónium-perszulfát | 231-786-5 | 7727-54-0 | Ox.
Sol. 3 Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Resp. Sens. 1 Skin Sens. 1 |
H272 H302 H335 H315 H319 H334 H317 |
GHS03 GHS08 GHS07 Dgr |
H272 H302 H319 H335 H315 H334 H317 |
CLP00 | |||
| 016-061-00-1 | dipotassium peroxodisulphate; potassium persulphate | dikálium-peroxodiszulfát; kálium-perszulfát |
231-781-8 | 7727-21-1 | Ox.
Sol. 3 Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Resp. Sens. 1 Skin Sens. 1 |
H272 H302 H335 H315 H319 H334 H317 |
GHS03 GHS08 GHS07 Dgr |
H272 H302 H319 H335 H315 H334 H317 |
CLP00 | |||
| 016-062-00-7 | bensultap (ISO); 1,3-bis(phenylsulfonylthio)-2-(N,N-dimethylamino)propane | benszultap
(ISO); 1,3-bisz(fenilszulfoniltio)-2-(N,N-dimetilamino)propán |
17606-31-4 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | ||||
| 016-063-00-2 | sodium metabisulphite | nátrium-metabiszulfit | 231-673-0 | 7681-57-4 | Acute
Tox. 4 * Eye Dam. 1 |
H302 H318 |
GHS05 GHS07 Dgr |
H302 H318 |
EUH031 |
CLP00 | ||
| 016-064-00-8 | sodium hydrogensulphite … %; sodium bisulphite … % | nátrium-hidrogén-szulfit
. %; nátrium-biszulfit . . . % |
231-548-0 | 7631-90-5 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
EUH031 |
B | CLP00 | |
| 016-065-00-3 | sodium 1-amino-4-[2-methyl-5-(4-methylphenylsulfonylamino)phenylamino]anthraquinone-2-sulfonate | nátrium-1-amino-4-[2-metil-5-(4-metilfenilszulfonilamino)fenilamino]antrakinon-2-szulfonát | 400-100-8 | 84057-97-6 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 016-066-00-9 | tetrasodium [5-((4-amino-6-chloro-1,3,5-triazin-2-yl)amino)-2-((2-hydroxy-3,5-disulfonatophenylazo)-2- sulfonatobenzylidenehydrazino)benzoate]copper(II) | tetranátrium-[5-((4-amino-6-klór-1,3,5-triazin-2-il)amino)-2-((2-hidroxi-3,5-diszulfonátofenilazo)-2-szulfonátobenzilidén-hidrazino)benzoát]réz(II) | 404-070-7 | 116912-62-0 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | ||||
| 016-067-00-4 | (4-methylphenyl)mesitylene sulfonate | (4-metilfenil)mezitilén-szulfonát | 407-530-5 | 67811-06-7 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 016-068-00-X | sodium 3,5-bis(tetradecyloxycarbonyl)benzenesulfinate | nátrium-3,5-bisz(tetradeciloxikarbonil)benzolszulfinát | 407-720-8 | 155160-86-4 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | |||
| 016-069-00-5 | 3,5-bis-(tetradecyloxycarbonyl)benzenesulfinic acid | 3,5-bisz(tetradeciloxikarbonil)benzolszulfinsav | 407-990-7 | 141915-64-2 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | |||
| 016-070-00-0 | 4-benzyloxy-4'-(2,3-epoxy-2-methylprop-1-yloxy)diphenylsulfone | 4-benziloxi-4'-(2,3-epoxi-2-metilprop-1-iloxi)difenilszulfon | 408-220-2 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | |||||
| 016-071-00-6 | trisodium 3-amino-6,13-dichloro-10-((3-((4-chloro-6-(2-sulfophenylamino)-1,3,5-triazin-2-yl)amino)propyl) amino)-4,11-triphenoxydioxazinedisulfonate | trinátrium-3-amino-6,13-diklór-10-[[3-[[4-klór-6-(2-szulfofenilamino)-1,3,5-triazin-2-il]amino]propil]amino]-4,11- trifenoxidioxazin-diszulfonát |
410-130-3 | 136248-03-8 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 016-072-00-1 | 3-amino-4-hydroxy-N-(2-methoxyethyl)-benzenesulfonamide | 3-amino-4-hidroxi-N-(2-metoxietil)-benzolszulfonamid | 411-520-6 | 112195-27-4 | Eye
Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H411 |
CLP00 | |||
| 016-073-00-7 | tetrakis(phenylmethyl)thioperoxydi(carbothioamide) | tetrakisz(fenilmetil)tioperoxidi(karbotioamid) | 404-310-0 | 10591-85-2 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 016-074-00-2 | 6-fluoro-2-methyl-3-(4-methylthiobenzyl)indene | 6-fluor-2-metil-3-(4-metiltiobenzil)indén | 405-410-7 | Skin
Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H315 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H411 |
CLP00 | ||||
| 016-075-00-8 | 2,2'-diallyl-4,4'-sulfonyldiphenol | 2,2'-diallil-4,4'-szulfonildifenol | 411-570-9 | 41481-66-7 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | |||
| 016-076-00-3 | 2,3-bis((2-mercaptoethyl)thio)-1-propanethiol | 2,3-bisz[(2-merkaptoetil)tio]-1-propántiol | 411-290-7 | 131538-00-6 | Acute
Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H410 |
CLP00 | |||
| 016-077-00-9 | 2-chloro-p-toluenesulfochloride | 2-klór-p-toluolszulfoklorid | 412-890-1 | 42413-03-6 | Skin
Corr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H314 H317 H412 |
GHS05 GHS07 Dgr |
H314 H317 H412 |
CLP00 | |||
| 016-078-00-4 | 4-methyl-N,N-bis(2-(((4-methylphenyl)sulfonyl)amino)ethyl)benzenesulfonamide | 4-metil-N, N-bisz(2-(((4-metilfenil)szulfonil)amino)etil)benzolszulfonamid | 413-300-5 | 56187-04-3 | Aquatic
Chronic 4 |
H413 |
CLP00 | |||||
| 016-079-00-X | N,N-bis(2-(p-toluenesulfonyloxy)ethyl)-p-toluenesulfonamide | N, N-bisz(2-(p-toluolszulfoniloxi)etil)-p-toluolszulfonamid | 412-920-3 | 16695-22-0 | Skin
Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
CLP00 | |||
| 016-080-00-5 | sodium 2-anilino-5-(2-nitro-4-(N-phenylsulfamoyl))anilinobenzenesulfonate | nátrium-2-anilino-5-[2-nitro-4-(N-fenilszulfamoil)]anilinobenzol-szulfonát | 412-320-1 | 31361-99-6 | Eye
Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
CLP00 | |||
| 016-081-00-0 | hexahydrocyclopenta[c]pyrrole-1-(1H)-ammonium N-ethoxycarbonyl-N-(p-tolylsulfonyl)azanide | hexahidrociklopenta[c]pirrol-1-(1H)-ammónium-N-etoxikarbonil-N-(p-tolilszulfonil)azanid | 418-350-1 | Muta.
2 Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H341 H302 H319 H317 H411 |
GHS08 GHS07 GHS09 Wng |
H341 H302 H319 H317 H411 |
CLP00 | ||||
| 016-082-00-6 | ethoxysulfuron (ISO); 1-(4,6-dimethoxypyrimidin-2-yl)-3-(2-ethoxyphenoxysulfonyl)urea | etoxiszulfuron
(ISO); 1-(4,6-dimetoxipirimidin-2-il)-3-(2-etoxifenoxiszulfonil)urea |
126801-58-9 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | ||||
| 016-083-00-1 | acibenzolar-S-methyl; benzo[1,2,3]thiadiazole-7-carbothioic acid S-methyl ester | acibenzolar-S-metil; benzo[1,2,3]tiadiazol-7-tiokarbonsav S-metil-észter | 420-050-0 | 135158-54-2 | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H335 H315 H319 H317 H400 H410 |
GHS07 GHS09 Wng |
H319 H335 H315 H317 H410 |
CLP00 | |||
| 016-084-00-7 | prosulfuron (ISO); 1-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-3-[2-(3,3,3-trifluoropropyl)phenylsulfonyl]urea | proszulfuron
(ISO); 1-(4-metoxi-6-metil-1,3,5-triazin-2-il)-3-[2-(3,3,3-trifluoropropil)fenilszulfonil]karbamid |
- | 94125-34-5 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
M=100 |
CLP00/ATP01 | ||
| 016-085-00-2 | flazasulfuron (ISO); 1-(4,6-dimethoxypyrimidin-2-yl)-3-(3-trifluoromethyl-2-pyridylsulfonyl)urea | flazaszulfuron
(ISO); 1-(4,6-dimetoxipirimidin-2-il)-3-(3-trifluormetil-2-piridilszulfonil)karbamid |
104040-78-0 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | ||||
| 016-086-00-8 | tetrasodium 10-amino-6,13-dichloro-3-(3-(4-(2,5-disulfonatoanilino)-6-fluoro-1,3,5-triazin-2-ylamino)prop-3-ylamino)-5,12-dioxa-7,14-diazapentacene-4,11-disulfonate | tetranátrium-10-amino-6,13- diklór-3-(3-(4-(2,5-diszulfonátoanilino)-6-fluor-1,3,5-triazin-2-ilamino)prop-3- ilamino)-5,12-dioxa-7,14-diazapentacén-4,11-diszulfonát | 402-590-9 | 109125-56-6 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | |||
| 016-087-00-3 | reaction mass of: thiobis(4,1-phenylene)-S,S,S',S'-tetraphenyldisulfonium bishexafluorophosphate; diphenyl(4-phenylthiophenyl)sulfonium hexafluorophosphate; propylene carbonate | tiobisz(4,1-fenilén)-S,
S,S',S'-tetrafenildiszulfónium-biszhexafluorfoszfát; difenil(4-feniltiofenil)szulfónium-hexafluorofoszfát; propilén-karbonát keveréke |
403-490-8 | 104558-95-4 | Eye
Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H317 H400 H410 |
GHS07 GHS09 Wng |
H319 H317 H410 |
CLP00 | |||
| 016-088-00-9 | 4-(bis(4-(diethylamino)phenyl)methyl)benzene-1,2-dimethanesulfonic acid | 4-(bisz(4-dietilamino)fenil)metil)benzol-1,2-dimetánszulfonsav | 407-280-7 | 71297-11-5 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | ||||
| 016-089-00-4 | reaction mass of esters of 5,5',6,6',7,7'-hexahydroxy-3,3,3',3'-tetramethyl-1,1'-spirobiindan and 2-diazo-1,2-dihydro-1-oxo-5-sulfonaphthalene | 5,5',6,6',7,7'-hexahidroxi-3,3,3',3'-tetrametil-1,1'-spirobiindán és 2-diazo-1,2-dihidro-1-oxo-5-szulfonaftalin észtereinek keveréke | 413-840-1 | Self-react.
C **** Aquatic Chronic 4 |
H242 H413 |
GHS02 Dgr |
H242 H413 |
CLP00 | ||||
| 016-090-00-X | 4-methyl-N-(methylsulfonyl)benzenesulfonamide | 4-metil-N-(metilszulfonil)benzolszulfonamid | 415-040-8 | 14653-91-9 | Acute
Tox. 4 * STOT SE 3 Eye Dam. 1 |
H302 H335 H318 |
GHS05 GHS07 Dgr |
H302 H335 H318 |
CLP00 | |||
| 016-091-00-5 | C12-14-tert-alkyl ammonium 1-amino-9,10-dihydro-9,10-dioxo-4-(2,4,6-trimethylanilino)-anthracen-2-sulfonate | C12-14-terc-alkil-ammónium-1-amino-9,10-dihidro-9,10-dioxo-4-(2,4,6-trimetilanilino)- antracén-2-szulfonát | 414-110-5 | Eye
Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
CLP00 | ||||
| 016-092-00-0 | reaction mass of: 4,7-bis(mercaptomethyl)-3,6,9-trithia-1,11-undecanedithiol; 4,8-bis(mercaptomethyl)-3,6,9-trithia-1,11-undecanedithiol; 5,7-bis(mercaptomethyl)-3,6,9-trithia-1,11-undecanedithiol | 4,7-bisz(merkaptometil)-3,6,9-tritia-1,11-undekánditiol; 4,8-bisz(merkaptometil)-3,6,9- tritia-1,11-undekánditiol; 5,7-bisz(merkaptometil)-3,6,9-tritia-1,11-undekánditiol keveréke |
427-050-1 | Repr.
2 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361f H315 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H315 H317 H361f H410 |
ATP01/ATP01corr | ||||
| 016-093-00-6 | reaction mass of: 4-(7-hydroxy-2,4,4-trimethyl-2-chromanyl)resorcinol-4-yl-tris(6-diazo-5,6-dihydro-5-oxonaphthalen-1-sulfonate); 4-(7-hydroxy-2,4,4-trimethyl-2-chromanyl)resorcinolbis(6-diazo-5,6-dihydro-5-oxonaphthalen-1-sulfonate) (2:1) | 4-(7-hidroxi-2,4,4-trimetil-2-kromanil)rezorcin-4-il-trisz(6-diazo-5,6-
dihidro-5-oxonaftalin-1- szulfonát); 4-(7-hidroxi-2,4,4-trimetil-2-kromanil)rezorcin bisz(6-diazo-5,6-dihidro-5-oxonaftalin-1-szulfonát) (2:1 arányú) keveréke |
414-770-4 | 140698-96-0 | Self-react.
C **** Carc. 2 |
H242 H351 |
GHS02 GHS08 Dgr |
H242 H351 |
CLP00 | |||
| 016-094-00-1 | sulfur | kén | 231-722-6 | 7704-34-9 | Skin
Irrit. 2 |
H315 |
GHS07 Wng |
H315 |
ATP01 | |||
| 016-095-00-7 | reaction mass of: reaction product of 4,4'-methylenebis[2-(4-hydroxybenzyl)-3,6-dimethylphenol] and 6-diazo-5,6-dihydro-5-oxo-naphthalenesulfonate (1:2); Reaction product of 4,4'-methylenebis[2-(4-hydroxybenzyl)-3,6-dimethylphenol] and 6-diazo-5,6-dihydro-5-oxo-naphthalenesulfonate (1:3) | 4,4′-metilén-bisz[2-(4-hidroxibenzil)-3,6-dimetilfenol]
és 6-diazo-5,6-dihidro-5-oxonaftalin-szulfonát (1:2) reakciótermékének; 4,4′-metilén-bisz[2-(4-hidroxibenzil)-3,6-dimetilfenol] és 6-diazo-5,6-dihidro-5-oxonaftalin-szulfonát (1:3) reakciótermékének keveréke |
417-980-4 | Self-react.
C **** Carc. 2 |
H242 H351 |
GHS02 GHS08 Dgr |
H242 H351 |
CLP00 | ||||
| 016-096-00-2 | thifensulfuron-methyl
(ISO); methyl 3-(4-methoxy-6-methyl-1,3,5-triazin-2-ylcarbamoylsulfamoyl)thiophene-2-carboxylate |
tifenszulfuron-metil
(ISO); metil 3-(4-metoxi-6-metil-1,3,5-triazin-2-il-karbamoil-szulfamoil) tiofén-2-karboxilát |
79277-27-3 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
M=100 M=100 |
CLP00/ATP13 | |||
| 016-097-00-8 | 1-amino-2-methyl-2-propanethiol hydrochloride | 1-amino-2-metil-2- propántiol-hidroklorid | 434-480-1 | 32047-53-3 | Acute
Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H302 H314 H317 H412 |
GHS05 GHS07 Dgr |
H302 H314 H317 H412 |
ATP01 | |||
| 016-098-00-3 | dimethyl disulphide | #HIÁNYZIK | 210-871-0 | 624-92-0 | Flam.
Liq. 2 Acute Tox. 3 Acute Tox. 3 STOT SE 3 STOT SE 1 Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H225 H331 H301 H336 H370 (upper respiratory tract) (Inhalation) H319 H317 H400 H410 |
GHS02 GHS06 GHS08 GHS09 Dgr |
H225 H331 H301 H319 H317 H370 (upper respiratory tract) (Inhalation) H336 H410 |
Inhalation:
ATE = 5 mg/L (Vapours) Oral: ATE = 190 mg/kg M=1 M=10 |
ATP15 | ||
| 017-001-00-7 | chlorine | klór | 231-959-5 | 7782-50-5 | Ox.
Gas 1 Press. Gas Acute Tox. 3 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 |
H270 H331 H335 H315 H319 H400 |
GHS03 GHS04 GHS06 GHS09 Dgr |
H270 H331 H315 H319 H335 H400 |
M=100 |
U | CLP00/ATP01corr | |
| 017-002-00-2 | hydrogen chloride | hidrogén-klorid (gáz) | 231-595-7 | 7647-01-0 | Press.
Gas Acute Tox. 3 * Skin Corr. 1A |
H331 H314 |
GHS04 GHS06 GHS05 Dgr |
H331 H314 |
5 U | CLP00 | ||
| 017-002-01-X | hydrochloric acid ... % | hidrogén-klorid … % | 231-595-7 | STOT
SE 3 Skin Corr. 1B |
H335 H314 |
GHS05 GHS07 Dgr |
H314 H335 |
Skin
Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 10 % ≤ C < 25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % STOT SE 3; H335: C ≥ 10 % |
B | CLP00 | ||
| 017-003-00-8 | barium chlorate | bárium-klorát | 236-760-7 | 13477-00-4 | Ox.
Sol. 1 Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 2 |
H271 H332 H302 H411 |
GHS03 GHS07 GHS09 Dgr |
H271 H332 H302 H411 |
CLP00 | |||
| 017-004-00-3 | potassium chlorate | kálium-klorát | 223-289-7 | 3811-04-9 | Ox.
Sol. 1 Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 2 |
H271 H332 H302 H411 |
GHS03 GHS07 GHS09 Dgr |
H271 H332 H302 H411 |
CLP00 | |||
| 017-005-00-9 | sodium chlorate | nátrium-klorát | 231-887-4 | 7775-09-9 | Ox.
Sol. 1 Acute Tox. 4 * Aquatic Chronic 2 |
H271 H302 H411 |
GHS03 GHS07 GHS09 Dgr |
H271 H302 H411 |
CLP00 | |||
| 017-006-00-4 | perchloric acid ... % | perklórsav … % | 231-512-4 | 7601-90-3 | Ox.
Liq. 1 Skin Corr. 1A |
H271 H314 |
GHS03 GHS05 Dgr |
H271 H314 |
Skin
Corr. 1A; H314: C ≥ 50 % Skin Corr. 1B; H314: 10 % ≤ C < 50 % Skin Irrit. 2; H315: 1 % ≤ C < 10 % Eye Irrit. 2; H319: 1 % ≤ C < 10 % Ox. Liq. 1; H271: C > 50 % Ox. Liq. 2; H272: C ≤ 50 % |
B | CLP00 | |
| 017-007-00-X | barium perchlorate | bárium-perklorát | 236-710-4 | 13465-95-7 | Ox.
Sol. 1 Acute Tox. 4 * Acute Tox. 4 * |
H271 H332 H302 |
GHS03 GHS07 Dgr |
H271 H332 H302 |
CLP00 | |||
| 017-008-00-5 | potassium perchlorate | kálium-perklorát | 231-912-9 | 7778-74-7 | Ox.
Sol. 1 Acute Tox. 4 * |
H271 H302 |
GHS03 GHS07 Dgr |
H271 H302 |
CLP00 | |||
| 017-009-00-0 | ammonium perchlorate; [containing ≥ 80 % of 0-30 µm particles] | ammónium-perklorát | 232-235-1 | 7790-98-9 | Expl.
1.1 Ox. Sol. 1 |
H201 H271 |
GHS01 Dgr |
H201 H271 |
T | CLP00/ATP01 | ||
| 017-010-00-6 | sodium perchlorate | nátrium-perklorát | 231-511-9 | 7601-89-0 | Ox.
Sol. 1 Acute Tox. 4 * |
H271 H302 |
GHS03 GHS07 Dgr |
H271 H302 |
CLP00 | |||
| 017-011-00-1 | sodium hypochlorite, solution ... % Cl active | nátrium-hipoklorit, oldat… % aktív klór | 231-668-3 | 7681-52-9 | Skin
Corr. 1B Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H314 H318 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
EUH031 |
EUH031:
C ≥ 5 % M=10 M=1 |
B | CLP00/ATP13 |
| 017-012-00-7 | calcium hypochlorite | kálcium-hipoklorit | 231-908-7 | 7778-54-3 | Ox.
Sol. 2 Acute Tox. 4 * Skin Corr. 1B Aquatic Acute 1 |
H272 H302 H314 H400 |
GHS03 GHS05 GHS07 GHS09 Dgr |
H272 H302 H314 H400 |
EUH031 |
Skin
Corr. 1B; H314: C ≥ 5 % Skin Irrit. 2; H315: 1 % ≤ C < 5 % Eye Dam. 1; H318: 3 % ≤ C < 5 % Eye Irrit. 2; H319: 0,5 % < C < 3 % M=10 |
T | CLP00/ATP01corr |
| 017-013-00-2 | calcium chloride | kálcium-klorid | 233-140-8 | 10043-52-4 | Eye
Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
CLP00 | |||
| 017-014-00-8 | ammonium chloride | ammónium-klorid | 235-186-4 | 12125-02-9 | Acute
Tox. 4 * Eye Irrit. 2 |
H302 H319 |
GHS07 Wng |
H302 H319 |
CLP00 | |||
| 017-015-00-3 | (2-(aminomethyl)phenyl)acetylchloride hydrochloride | (2-(aminometil)fenil)acetil-klorid-hidroklorid | 417-410-4 | 61807-67-8 | Acute
Tox. 4 * Skin Corr. 1A Skin Sens. 1 |
H302 H314 H317 |
GHS05 GHS07 Dgr |
H302 H314 H317 |
CLP00 | |||
| 017-016-00-9 | methyltriphenylphosphonium chloride | metiltrifenilfoszfónium-klorid | 418-400-2 | 1031-15-8 | Acute
Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 2 |
H312 H302 H315 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H312 H302 H315 H318 H411 |
CLP00 | |||
| 017-017-00-4 | (Z)-13-docosenyl-N,N-bis(2-hydroxyethyl)-N-methyl-ammonium-chloride | (Z)-13-dokozenil-N,N-bisz(2- hidroxietil)-N-metil-ammónium-klorid | 426-210-6 | 120086-58-0 | Skin
Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
CLP00 | |||
| 017-018-00-X | N,N,N-trimethyl-2,3-bis(stearoyloxy)propylammonium chloride | N, N,N-trimetil-2,3-bisz(sztearoiloxi)propil-ammónium-klorid | 405-660-7 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | ||||
| 017-019-00-5 | (R)-1,2,3,4-tetrahydro-6,7-dimethoxy-1-veratrylisoquinoline hydrochloride | (R)-1,2,3,4-tetrahidro-6,7-dimetoxi-1-veratrilizokinolin-hidroklorid | 415-110-8 | 54417-53-7 | Acute
Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
CLP00 | |||
| 017-020-00-0 | ethyl propoxy aluminium chloride | etilpropoxi-alumínium-klorid | 421-790-7 | 13014-29-4 | Water-react.
1 Skin Corr. 1A |
H260 H314 |
GHS02 GHS05 Dgr |
H260 H314 |
EUH014 |
CLP00 | ||
| 017-021-00-6 | behenamidopropyl-dimethyl-(dihydroxypropyl) ammonium chloride | behenamidopropil-dimetil(dihidroxipropil)ammónium-klorid | 423-420-1 | 136920-10-0 | Eye
Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H410 |
CLP00 | |||
| 017-023-00-7 | [phosphinyldynetris(oxy)] tris[3-aminopropyl-2-hydroxy-N,N-dimethyl-N-(C6-18)-alkyl] trichlorides | [foszfinildin-trisz(oxi)]-trisz[3-aminopropil-2-hidroxi-N, N- dimetil-N-(C6-18)-alkil]-trikloridok | 425-520-9 | 197179-61-6 | Eye
Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
ATP01 | |||
| 017-026-00-3 | chlorine dioxide | klór-dioxid | 233-162-8 | 10049-04-4 | Ox.
Gas 1 Press. Gas Acute Tox. 2 * Skin Corr. 1B Aquatic Acute 1 |
H270 H330 H314 H400 |
GHS04 GHS03 GHS06 GHS05 GHS09 Dgr |
H270 H330 H314 H400 |
M=10 |
5 | CLP00/ATP01corr | |
| 017-026-01-0 | chlorine dioxide … % | klór-dioxid …% | 233-162-8 | 10049-04-4 | Acute
Tox. 3 * Skin Corr. 1B Aquatic Acute 1 |
H301 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H301 H314 H400 |
STOT
SE 3; H335: C ≥ 3 % Skin Corr. 1B; H314: C ≥ 5 % Skin Irrit. 2; H315: 1 % ≤ C < 5 % Eye Dam. 1; H318: 3 % ≤ C < 5 % Eye Irrit. 2; H319: 0,3 % ≤ C < 3 % M=10 |
B | CLP00/ATP01corr | |
| 019-001-00-2 | potassium | kálium | 231-119-8 | 7440-09-7 | Water-react.
1 Skin Corr. 1B |
H260 H314 |
GHS02 GHS05 Dgr |
H260 H314 |
EUH014 |
CLP00 | ||
| 019-002-00-8 | potassium hydroxide; caustic potash | kálium-hidroxid; marókáli |
215-181-3 | 1310-58-3 | Acute
Tox. 4 * Skin Corr. 1A |
H302 H314 |
GHS05 GHS07 Dgr |
H302 H314 |
Skin
Corr. 1A; H314: C ≥ 5 % Skin Corr. 1B; H314: 2 % ≤ C < 5 % Skin Irrit. 2; H315: 0,5 % ≤ C < 2 % Eye Irrit. 2; H319: 0,5 % ≤ C < 2 % |
CLP00 | ||
| 019-003-00-3 | potassium (E,E)-hexa-2,4-dienoate | kálium-(E,E)-hexa-2,4-dienoát; kálium-szorbát | 246-376-1 | 24634-61-5 | Eye
Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
ATP07 | |||
| 020-001-00-X | calcium | kálcium | 231-179-5 | 7440-70-2 | Water-react.
2 |
H261 |
GHS02 Dgr |
H261 |
CLP00 | |||
| 020-002-00-5 | calcium cyanide | kálcium-cianid | 209-740-0 | 592-01-8 | Acute
Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H400 H410 |
GHS06 GHS09 Dgr |
H300 H410 |
EUH032 |
CLP00 | ||
| 020-003-00-0 | reaction mass of: dicalcium (bis(2-hydroxy-5-tetra-propenylphenylmethyl)methylamine)dihydroxide; tri-calcium (tris(2-hydroxy-5-tetra-propenylphenylmethyl)methylamine)tri-hydroxide; poly[calcium ((2-hydroxy-5-tetra-propenyl-phenylmethyl)methylamine)hydroxide] | dikálcium-(bisz(2-hidroxi-5-tetrapropenilfenilmetil)metil
amin)-dihidroxid; trikálcium-(trisz(2-hidroxi-5-tetrapropenilfenilmetil)metilamin)-trihidroxid; poli[kálcium-((2-hidroxi-5-tetrapropenilfenilmetil)metilamin)hidroxid] keveréke |
420-470-4 | Skin
Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H315 H319 H317 |
GHS07 Wng |
H319 H315 H317 |
CLP00 | ||||
| 022-001-00-5 | titanium tetrachloride | titán-tetraklorid | 231-441-9 | 7550-45-0 | Skin
Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
EUH014 |
CLP00 | ||
| 022-002-00-0 | titanium(4+) oxalate | titán(4+)-oxalát | 403-260-7 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | ||||
| 022-003-00-6 | bis(η5-cyclopentadienyl)-bis(2,6-difluoro-3-[pyrrol-1-yl]-phenyl)titanium | bisz(η5-ciklopenta-dienil)-bisz(2,6-difluor-3-[pirrol-1-il]-fenil)titán | 412-000-1 | 125051-32-3 | Flam.
Sol. 1 Repr. 2 STOT RE 2 * Aquatic Chronic 2 |
H228 H361f *** H373 ** H411 |
GHS02 GHS08 GHS09 Dgr |
H228 H361f *** H373 ** H411 |
T | CLP00 | ||
| 022-004-00-1 | potassium titanium oxide (K2Ti6O13) | kálium-titán-oxid (K2Ti6O13) | 432-240-0 | 12056-51-8 | Carc.
2 |
H351 |
GHS08 Wng |
H351 |
ATP01/ATP01corr | |||
| 022-005-00-7 | [N-(1,1-dimethylethyl)-1,1-dimethyl-1-[(1,2,3,4,5-η)-2,3,4,5-tetramethyl-2,4-cyclopentadien-1-yl]silanaminato(2-)-κN][(1,2,3,4-η)-1,3-pentadiene]-titanium | [N-(1,1-dimetiletil)-1,1-dimetil-1-[(1,2,3,4,5-η)-2,3,4,5-tetrametil-2,4-ciklopentadién-1-il]szilánamináto(2-)-κN][1,2,3,4-η)-1,3-pentadién]-titán | 419-840-8 | 169104-71-6 | Flam.
Sol. 1 **** Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 4 |
H228 H314 H317 H413 |
GHS02 GHS05 GHS07 Dgr |
H228 H314 H317 H413 |
ATP01 | |||
| 022-006-00-2 | titanium dioxide; [in powder form containing 1 % or more of particles with aerodynamic diameter ≤ 10 μm] | #HIÁNYZIK | 236-675-5 | 13463-67-7 | Carc.
2 |
H351
(Inhalation) |
GHS08 Wng |
H351
(Inhalation) |
ATP14 | |||
| 023-001-00-8 | divanadium pentaoxide; vanadium pentoxide | divanádium-pentoxid; vanádium-pentoxid |
215-239-8 | 1314-62-1 | Muta.
2 Repr. 2 Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 STOT RE 1 Aquatic Chronic 2 |
H341 H361d *** H332 H302 H335 H372 ** H411 |
GHS08 GHS07 GHS09 Dgr |
H341 H361d *** H372 ** H332 H302 H335 H411 |
CLP00 | |||
| 024-001-00-0 | chromium (VI) trioxide | króm(VI)-trioxid | 215-607-8 | 1333-82-0 | Ox.
Sol. 1 Carc. 1A Muta. 1B Repr. 2 Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Skin Corr. 1A Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H271 H350 H340 H361f *** H330 H311 H301 H372 ** H314 H334 H317 H400 H410 |
GHS03 GHS06 GHS08 GHS05 GHS09 Dgr |
H271 H350 H340 H361f *** H330 H311 H301 H372 ** H314 H334 H317 H410 |
STOT
SE 3; H335: C ≥ 1 % |
CLP00 | ||
| 024-002-00-6 | potassium dichromate | kálium-dikromát | 231-906-6 | 7778-50-9 | Ox.
Sol. 2 Carc. 1B Muta. 1B Repr. 1B Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 4 * STOT RE 1 Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H272 H350 H340 H360FD H330 H301 H312 H372 ** H314 H334 H317 H400 H410 |
GHS03 GHS06 GHS08 GHS05 GHS09 Dgr |
H272 H350 H340 H360FD H330 H301 H372 ** H312 H314 H334 H317 H410 |
STOT
SE 3; H335: C ≥ 5 % |
3 | CLP00 | |
| 024-003-00-1 | ammonium dichromate | ammónium-dikromát | 232-143-1 | 7789-09-5 | Ox.
Sol. 2 **** Carc. 1B Muta. 1B Repr. 1B Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 4 * STOT RE 1 Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H272 H350 H340 H360FD H330 H301 H312 H372 ** H314 H334 H317 H400 H410 |
GHS03 GHS06 GHS08 GHS05 GHS09 Dgr |
H272 H350 H340 H360FD H330 H301 H372 ** H312 H314 H334 H317 H410 |
STOT
SE 3; H335: C ≥ 5 % Resp. Sens.; H334: C ≥ 0,2 % Skin Sens.; H317: C ≥ 0,2 % |
3 G | CLP00 | |
| 024-004-00-7 | sodium dichromate | nátrium-dikromát | 234-190-3 | 10588-01-9 | Ox.
Sol. 2 Carc. 1B Muta. 1B Repr. 1B Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 4 * STOT RE 1 Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H272 H350 H340 H360FD H330 H301 H312 H372 ** H314 H334 H317 H400 H410 |
GHS03 GHS06 GHS05 GHS08 GHS09 Dgr |
H272 H301 H312 H330 H314 H334 H317 H340 H350 H360FD H372 ** H410 |
STOT
SE 3; H335: C ≥ 5 % Resp. Sens. 1; H334: C ≥ 0,2 % Skin Sens. 1; H317: C ≥ 0,2 % |
3 | CLP00/ATP01corr | |
| 024-005-00-2 | chromyl dichloride; chromic oxychloride | kromil-diklorid; króm-oxiklorid |
239-056-8 | 14977-61-8 | Ox.
Liq. 1 Carc. 1B Muta. 1B Skin Corr. 1A Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H271 H350i H340 H314 H317 H400 H410 |
GHS03 GHS08 GHS05 GHS07 GHS09 Dgr |
H271 H350i H340 H314 H317 H410 |
Skin
Corr. 1A; H314: C ≥ 10 % Skin Corr. 1B; H314: 5 % ≤ C < 10 % Skin Irrit. 2; H315: 0,5 % ≤ C < 5 % Eye Irrit. 2; H319: 0,5 % ≤ C < 5 % STOT SE 3; H335: 0,5 % ≤ C < 5 % Skin Sens. 1; H317: C ≥ 0,5 % |
3 T | CLP00 | |
| 024-006-00-8 | potassium chromate | kálium-kromát | 232-140-5 | 7789-00-6 | Carc.
1B Muta. 1B STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H340 H335 H315 H319 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H340 H319 H335 H315 H317 H410 |
Skin
Sens. 1; H317: C ≥ 0,5 % |
3 | CLP00 | |
| 024-007-00-3 | zinc chromates including zinc potassium chromate | cink-kromátok (beleértve a cink-kálium-kromátot is) | Carc.
1A Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H317 H410 |
A | CLP00 | ||||
| 024-008-00-9 | calcium chromate | kálcium-kromát | 237-366-8 | 13765-19-0 | Carc.
1B Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H410 |
CLP00 | |||
| 024-009-00-4 | strontium chromate | stroncium-kromát | 232-142-6 | 7789-06-2 | Carc.
1B Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H400 H410 |
CLP00 | |||
| 024-010-00-X | dichromium tris(chromate); chromium III chromate; chromic chromate | dikróm-triszkromát; króm(III)-kromát; króm-kromát |
246-356-2 | 24613-89-6 | Ox.
Sol. 1 Carc. 1B Skin Corr. 1A Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H271 H350 H314 H317 H400 H410 |
GHS03 GHS08 GHS05 GHS07 GHS09 Dgr |
H271 H350 H314 H317 H410 |
T | CLP00 | ||
| 024-011-00-5 | ammonium bis(1-(3,5-dinitro-2-oxidophenylazo)-3-(N-phenylcarbamoyl)-2-naphtholato)chromate(1-) | ammónium-bisz(1-(3,5-dinitro-2- oxidofenilazo)-3-(N- fenilkarbamoil)-2-naftoláto)kromát(1-) | 400-110-2 | 109125-51-1 | Self-react.
C **** Aquatic Acute 1 Aquatic Chronic 1 |
H242 H400 H410 |
GHS02 GHS09 Dgr |
H242 H410 |
CLP00 | |||
| 024-012-00-0 | trisodium bis(7-acetamido-2-(4-nitro-2-oxidophenylazo)-3-sulphonato-1-naphtholato)chromate(1-) | trinátrium bisz(7-acetamido-2-(4-nitro-2-oxidofenilazo)-3-szulfonáto-1-naftoláto)kromát(1-) | 400-810-8 | Muta.
2 |
H341 |
GHS08 Wng |
H341 |
CLP00 | ||||
| 024-013-00-6 | trisodium (6-anilino-2-(5-nitro-2-oxidophenylazo)-3-sulphonato-1-naphtholato)(4-sulphonato-1,1'-azodi-2,2'naphtholato)chromate(1-) | trinátrium-(6-anilino-2-(5-nitro-2-oxidofenilazo)-3-szulfonát-1-naftoláto)(4- szulfonát-1,1'-azodi-2,2'-naftoláto)kromát(1-) | 402-500-8 | Eye
Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
CLP00 | ||||
| 024-014-00-1 | trisodium bis(2-(5-chloro-4-nitro-2-oxidophenylazo)-5-sulphonato-1-naphtholato)chromate(1-) | trinátrium-bisz(2-(5-klór-4-nitro-2-oxidofenilazo)-5-szulfonáto-1-naftoláto)kromát(1-) | 402-870-0 | 93952-24-0 | Eye
Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
CLP00 | |||
| 024-015-00-7 | disodium (3-methyl-4-(5-nitro-2-oxidophenylazo)-1-phenylpyrazololato)(1-(3-nitro-2-oxido-5-sulfonatophenylazo)-2-naphtholato)chromate(1-) | dinátrium (3-metil-4-(5-nitro-2-oxidofenilazo)-1-fenilpirazololáto)(1-(3-nitro-2-oxido-5- szulfonátofenilazo)-2-naftoláto)kromát(1-) | 404-930-1 | Acute
Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H332 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H332 H318 H411 |
CLP00 | ||||
| 024-016-00-2 | tetradecylammonium bis(1-(5-chloro-2-oxidophenylazo)-2-naphtholato)chromate(1-) | tetradecilammónium-bisz[1-(5-klór-2-oxidofenilazo)- 2-naftoláto]-kromát(1-) |
405-110-6 | 88377-66-6 | STOT
RE 2 * Aquatic Chronic 4 |
H373
** H413 |
GHS08 Wng |
H373
** H413 |
CLP00 | |||
| 024-017-00-8 | Chromium (VI) compounds, with the exception of barium chromate and of compounds specified elsewhere in this Annex | króm(VI) vegyületek (kivéve a bárium-kromátot és az e mellékletben külön szereplő vegyületeket) | Carc.
1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H317 H410 |
A | CLP00 | ||||
| 024-018-00-3 | sodium chromate | nátrium-kromát | 231-889-5 | 7775-11-3 | Carc.
1B Muta. 1B Repr. 1B Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 4 * STOT RE 1 Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H340 H360FD H330 H301 H312 H372 ** H314 H334 H317 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H350 H340 H360FD H330 H301 H372 ** H312 H314 H334 H317 H410 |
Resp.
Sens.; H334: C ≥ 0,2 % Skin Sens.; H317: C ≥ 0,2 % |
3 | CLP00 | |
| 024-019-00-9 | Main component: acetoacetic acid anilide/3-amino-1-hydroxybenzene (ATAN-MAP): trisodium {}{6-[(2 or 3 or 4)-amino-(4 or 5 or 6)-hydroxyphenylazo]-5'-(phenylsulfamoyl)-3-sulfonatonaphthalene-2-azobenzene-1,2'-diolato}}-{}{6''-[1-(phenylcarbamoyl)ethylazo]-5'''-(phenylsulfamoyl)-3''-sulfonatonaphthalene-2''-azobenzene-1'',2'''-diolato}}chromate (III); by-product 1: acetoacetic acid anilide/acetoacetic acid anilide (ATAN-ATAN): trisodium bis{}{6-[1-(phenylcarbamoyl)ethylazo]-5'-(phenylsulfonyl)-3-sulfonatonaphthalene-2-azobenzene-1,2'-diolato}}chromate (III); by-product 2: 3-amino-1-hydroxybenzene/3-amino-1-hydroxybenzene (MAP-MAP): trisodium bis{}{6-[(2 or 3 or 4)-amino-(4 or 5 or 6)-hydroxyphenylazo]-5'-(phenylsulfamoyl)-3-sulfonatonaphthalene-2-azobenzene-1,2'-diolato}} chromate (III) | Fő
komponens: acetecetanilid/3-amino-1-hidroxibenzol (ATAN- MAP): trinátrium-{6-[(2 vagy 3 vagy 4)-amino-(4 vagy 5 vagy 6)- hidroxifenilazo]-5’-(fenilszulfamoil)-3-szulfonátonaftalin-2- azobenzol-1,2’-dioláto}-{6”-[1-(fenilkarbamoil)etilazo]-5’- (fenilszulfamoil)-3-szulfonátonaftalin-2”-azobenzol-1”,2”’-dioláto}-kromát(III); 1. melléktermék: acetecetanilid/acetecetanilid (ATAN-ATAN): trinátrium-bisz{6-[1-(fenilkarbamoil)etilazo]-5’”-(fenilszulfonil)-3”-szulfonátonaftalin-2-azobenzol-1,2’-dioláto}-kromát(III); 2. melléktermék: 3-amino-1-hidroxibenzol/3-amino-1-idroxibenzol (MAP-MAP): trinátrium-bisz{6-[(2 vagy 3 vagy 4)-amino-(4 vagy 5 vagy 6)-hidroxifenilazo]-5’-(fenilszulfamoil)-3-szulfonátonaftalin-2- azobenzol-1,2’-dioláto}-kromát(III) |
419-230-1 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
CLP00 | ||||
| 024-020-00-4 | trisodium bis[(3'-nitro-5'-sulfonato(6-amino-2-[4-(2-hydroxy-1-naphtylazo)phenylsulfonylamino]pyrimidin-5-azo)benzene-2',4-diolato)]chromate (III) | trinátrium bisz[(3'-nitro-5'-szulfonáto(6-amino-2-[4-(2-hidroxi-1-naftilazo)fenilszulfonilamino]pirimidin-5-azo)benzol-2',4-dioláto)]kromát(III) | 418-220-4 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
CLP00 | ||||
| 024-021-00-X | potassium tetrasodium bis[(N,N'-n)-1'-(phenylcarbamoyl)-3,5-disulfonatobenzeneazo-1'-prop-1'-ene-2,2'-diolato]chromate(III) | kálium-tetranátrium-bisz[(N,N'- n)-1'-(fenil-karbamoil)-3,5- diszulfonátobenzénazo-1'-prop-1'-én-2,2'-dioláto]kromát(III) | 425-830-4 | - | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 025-001-00-3 | manganese dioxide | mangán-dioxid | 215-202-6 | 1313-13-9 | Acute
Tox. 4 * Acute Tox. 4 * |
H332 H302 |
GHS07 Wng |
H332 H302 |
CLP00 | |||
| 025-002-00-9 | potassium permanganate | kálium-permanganát | 231-760-3 | 7722-64-7 | Ox.
Sol. 2 Repr. 2 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H272 H361d H302 H400 H410 |
GHS03 GHS08 GHS07 GHS09 Dgr |
H272 H302 H361d H410 |
CLP00/ATP13 | |||
| 025-003-00-4 | manganese sulphate | mangán-szulfát | 232-089-9 | 7785-87-7 | STOT
RE 2 * Aquatic Chronic 2 |
H373
** H411 |
GHS08 GHS09 Wng |
H373
** H411 |
CLP00 | |||
| 025-004-00-X | bis(N,N',N''-trimethyl-1,4,7-triazacyclononane)-trioxo-dimanganese (IV) di(hexafluorophosphate) monohydrate | bisz(N, N',N''-trimetil-1,4,7-triazaciklononán)-trioxodimangán (IV)-di(hexafluorofoszfát) monohidrát | 411-760-1 | 116633-53-5 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 025-005-00-5 | reaction mass of: tri-sodium [29H, 31H-phthalocyanine-C,C,C-trisulfonato (6-)-N29,N30,N31,N32] manganate (3-); tetrasodium [29H,31H-phthalocyanine-C,C,C,C-tetrasulfonato (6-)-N29,N30,N31,N32], manganate (3-); pentasodium [29H,31H-phthalocyanine-C,C,C,C,C-pentasulfonato (6-)-N29,N30,N31,N32] manganate (3-) | trinátrium
[29H, 31H-ftalocianin-C, C,C-triszulfonáto-(6-)-N29, N30,N31,N32]
manganát(3-); tetranátrium [29H,31H-ftalocianin-C, C,C,
C-tetraszulfonáto(6-)-N29,N30,N31,N32], manganát(3-); pentanátrium [29H,31H-ftalocianin-C, C,C, C,C-pentaszulfonáto(6-)-N29,N30,N31,N32]manganát(3-) keveréke |
417-660-4 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | ||||
| 026-001-00-6 | (η-cumene)-(η-cyclopentadienyl)iron(II) hexafluoroantimonate | (η-kumol)-(η-ciklopenta-dienil)vas(II)-hexafluorantimonát | 407-840-0 | 100011-37-8 | Acute
Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
CLP00 | |||
| 026-002-00-1 | (η-cumene)-(η-cyclopentadienyl)iron(II) trifluoromethane-sulfonate | (η-kumol)-(η-ciklopenta-dienil)vas(II)-trifluormetán-szulfonát | 407-880-9 | 117549-13-0 | Acute
Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
CLP00 | |||
| 026-003-00-7 | iron (II) sulfate | vas(II)-szulfát | 231-753-5 | 7720-78-7 | Acute
Tox. 4 * Skin Irrit. 2 Eye Irrit. 2 |
H302 H315 H319 |
GHS07 Wng |
H302 H319 H315 |
ATP01 | |||
| 026-003-01-4 | iron (II) sulfate (1:1) heptahydrate; sulfuric acid, iron(II) salt (1:1), heptahydrate; ferrous sulfate heptahydrate | vas(II)-szulfát
(1:1) heptahidrát; kénsav, vas(II) só (1:1), heptahidrát; vas-szulfát-heptahidrát |
231-753-5 | 7782-63-0 | Acute
Tox. 4 * Skin Irrit. 2 Eye Irrit. 2 |
H302 H315 H319 |
GHS07 Wng |
H302 H319 H315 |
Skin
Irrit. 2; H315: C ≥ 25 % |
ATP01 | ||
| 026-004-00-2 | potassium ferrite | kálium-ferrit | 430-010-4 | 12160-44-0 | Skin
Corr. 1B Skin Sens. 1 |
H314 H317 |
GHS05 GHS07 Dgr |
H314 H317 |
ATP01 | |||
| 027-001-00-9 | cobalt | kobalt | 231-158-0 | 7440-48-4 | Carc.
1B Muta. 2 Repr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Chronic 4 |
H350 H341 H360F H334 H317 H413 |
GHS08 Dgr |
H334 H317 H341 H350 H360F H413 |
CLP00/ATP14 | |||
| 027-002-00-4 | cobalt oxide | kobalt-oxid | 215-154-6 | 1307-96-6 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
M=10 |
CLP00/ATP01 | ||
| 027-003-00-X | cobalt sulfide | kobalt-szulfid | 215-273-3 | 1317-42-6 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
M=10 |
CLP00/ATP01 | ||
| 027-004-00-5 | cobalt dichloride | kobalt-diklorid | 231-589-4 | 7646-79-9 | Carc.
1B Muta. 2 Repr. 1B Acute Tox. 4 * Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360F *** H302 H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H360F *** H302 H334 H317 H410 |
Carc.
1B; H350i: C ≥ 0,01 % M=10 |
1 | CLP00/ATP01 | |
| 027-005-00-0 | cobalt sulfate | kobalt-szulfát | 233-334-2 | 10124-43-3 | Carc.
1B Muta. 2 Repr. 1B Acute Tox. 4 * Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360F *** H302 H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H360F *** H302 H334 H317 H410 |
Carc.
1B; H350i: C ≥ ,01 % M=10 |
1 | CLP00/ATP01 | |
| 027-006-00-6 | cobalt di(acetate) | kobalt-diacetát | 200-755-8 | 71-48-7 | Carc.
1B Muta. 2 Repr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360F *** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H334 H317 H341 H350i H360F *** H410 |
Carc.
1B; H350i: C ≥ 0,01 % M=10 |
1 | ATP01/ATP01corr | |
| 027-007-00-1 | zinc hexacyanocobaltate(III), tertiary butyl alcohol/polypropylene glycol complex | cink-hexaciano-kobaltát(III), tercier butil-alkohol/polipropilén-glikol komplex | 425-240-7 | - | Eye
Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
ATP01 | |||
| 027-008-00-7 | complex of cobalt(III)-bis(N-phenyl-4-(5-ethylsulfonyl-2-hydroxyphenylazo)-3-hydroxynaphthylamide), hydrated (n H2O, 2 | kobalt(III)-bisz(N-fenil-4-(5-etilszulfonil-2-hidroxifenilazo)-3-hidroxinaftilamid), hidratált (n H2O, 2<n<3) komplex | 427-390-9 | - | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
ATP01 | |||
| 027-009-00-2 | cobalt dinitrate | kobalt-dinitrát | 233-402-1 | 10141-05-6 | Carc.
1B Muta. 2 Repr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360F *** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H334 H317 H341 H350i H360F *** H410 |
Carc.
1B; H350i: C ≥ 0,01 % M=10 |
1 | ATP01/ATP01corr | |
| 027-010-00-8 | cobalt carbonate | kobalt-karbonát | 208-169-4 | 513-79-1 | Carc.
1B Muta. 2 Repr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360F *** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360F *** H334 H317 H410 |
Carc.
1B; H350i: C ≥ 0,01 % M=10 |
1 | ATP01 | |
| 028-001-00-1 | tetracarbonylnickel; nickel tetracarbonyl | tetrakarbonil-nikkel; nikkel-tetrakarbonil |
236-669-2 | 13463-39-3 | Flam.
Liq. 2 Carc. 2 Repr. 1B Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H225 H351 H360D *** H330 H400 H410 |
GHS02 GHS06 GHS08 GHS09 Dgr |
H225 H351 H360D *** H330 H410 |
CLP00 | |||
| 028-002-00-7 | nickel | nikkel | 231-111-4 | 7440-02-0 | Carc.
2 STOT RE 1 Skin Sens. 1 |
H351 H372 ** H317 |
GHS08 GHS07 Dgr |
H351 H372 ** H317 |
7 S | CLP00/ATP01 | ||
| 028-002-01-4 | nickel powder; [particle diameter < 1 mm] | nikkelpor; [részecske-átmérő < 1 mm] |
231-111-4 | 7440-02-0 | Carc.
2 STOT RE 1 Skin Sens. 1 Aquatic Chronic 3 |
H351 H372 ** H317 H412 |
GHS08 GHS07 Dgr |
H351 H372 ** H317 H412 |
ATP01 | |||
| 028-003-00-2 | nickel
monoxide [1] nickel oxide [2] bunsenite [3] |
nikkel-monoxid;
[1] nikkel-oxid; [2] bunzenit [3] |
215-215-7
[1] 234-323-5 [2] |
1313-99-1
[1] 11099-02-8 [2] 34492-97-2 [3] |
Carc.
1A STOT RE 1 Skin Sens. 1 Aquatic Chronic 4 |
H350i H372 ** H317 H413 |
GHS08 GHS07 Dgr |
H350i H372 ** H317 H413 |
CLP00/ATP01 | |||
| 028-004-00-8 | nickel dioxide | nikkel-dioxid | 234-823-3 | 12035-36-8 | Carc.
1A STOT RE 1 Skin Sens. 1 Aquatic Chronic 4 |
H350i H372 ** H317 H413 |
GHS08 GHS07 Dgr |
H350i H372 ** H317 H413 |
CLP00/ATP01 | |||
| 028-005-00-3 | dinickel trioxide | dinikkel-trioxid | 215-217-8 | 1314-06-3 | Carc.
1A STOT RE 1 Skin Sens. 1 Aquatic Chronic 4 |
H350i H372 ** H317 H413 |
GHS08 GHS07 Dgr |
H350i H372 ** H317 H413 |
CLP00/ATP01 | |||
| 028-006-00-9 | nickel
(II) sulfide [1] nickel sulfide [2] millerite [3] |
nikkel
(II) szulfid; [1] nikkel-szulfid; [2] millerit [3] |
240-841-2
[1] 234-349-7 [2] |
16812-54-7
[1] 11113-75-0 [2] 1314-04-1 [3] |
Carc.
1A Muta. 2 STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H372 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H372 ** H317 H410 |
CLP00/ATP01 | |||
| 028-007-00-4 | trinickel
disulfide; nickel subsulfide [1] heazlewoodite [2] |
trinikkel-diszulfid; nikkel-szubszulfid; [1] heazlewoodite [2] |
234-829-6
[1] |
12035-72-2
[1] 12035-71-1 [2] |
Carc.
1A Muta. 2 STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H372 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H372 ** H317 H410 |
CLP00/ATP01 | |||
| 028-008-00-X | nickel
dihydroxide [1] nickel hydroxide [2] |
nikkel-dihidroxid;
[1] nikkel-hidroxid [2] |
235-008-5
[1] 234-348-1 [2] |
12054-48-7
[1] 11113-74-9 [2] |
Carc.
1A Muta. 2 Repr. 1B Acute Tox. 4 * Acute Tox. 4 * STOT RE 1 Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H332 H302 H372 ** H315 H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H360D *** H341 H372 ** H332 H302 H315 H334 H317 H410 |
CLP00/ATP01 | |||
| 028-009-00-5 | nickel sulfate | nikkel-szulfát | 232-104-9 | 7786-81-4 | Carc.
1A Muta. 2 Repr. 1B Acute Tox. 4 * Acute Tox. 4 * STOT RE 1 Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H332 H302 H372 ** H315 H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H302 H332 H315 H334 H317 H341 H350i H360D *** H372 ** H410 |
STOT
RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Irrit. 2; H315: C ≥ 20 % Skin Sens. 1; H317: C ≥ 0,01 % M=1 |
CLP00/ATP01corr | ||
| 028-010-00-0 | nickel
carbonate; basic nickel carbonate; carbonic acid, nickel (2+) salt [1] carbonic acid, nickel salt [2] [µ-[carbonato(2-)-O:O’]] dihydroxy trinickel [3] [carbonato(2-)] tetrahydroxytrinickel [4] |
nikkel-karbonát; bázikus nikkel-karbonát; karbonsav, nikkel (2+) só; [1] karbonsav, nikkelsó; [2] [μ-[karbonát(2-)-O:O']]dihidroxi-trinikkel; [3] [karbonát(2-)] tetrahidroxi-trinikkel[4] |
222-068-2
[1] 240-408-8 [2] 265-748-4 [3] 235-715-9 [4] |
3333-67-3
[1] 16337-84-1 [2] 65405-96-1 [3] 12607-70-4 [4] |
Carc.
1A Muta. 2 Repr. 1B Acute Tox. 4 * Acute Tox. 4 * STOT RE 1 Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H332 H302 H372 ** H315 H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H360D *** H372 ** H332 H302 H315 H334 H317 H410 |
CLP00/ATP01 | |||
| 028-011-00-6 | nickel dichloride | nikkel-diklorid | 231-743-0 | 7718-54-9 | Carc.
1A Muta. 2 Repr. 1B Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H331 H301 H372 ** H315 H334 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H301 H331 H315 H334 H317 H341 H350i H360D *** H372 ** H410 |
STOT
RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % < C < 1 % Skin Irrit. 2; H315: C ≥ 20 % Skin Sens. 1; H317: C ≥ 0,01 % M=1 |
ATP01/ATP01corr | ||
| 028-012-00-1 | nickel
dinitrate [1] nitric acid, nickel salt [2] |
nikkel-dinitrát;
[1] salétromsav, nikkelsó [2] |
236-068-5
[1] 238-076-4 [2] |
13138-45-9
[1] 14216-75-2 [2] |
Ox.
Sol. 2 Carc. 1A Muta. 2 Repr. 1B Acute Tox. 4 * Acute Tox. 4 * STOT RE 1 Skin Irrit. 2 Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H272 H350i H341 H360D *** H332 H302 H372 ** H315 H318 H334 H317 H400 H410 |
GHS03 GHS05 GHS08 GHS07 GHS09 Dgr |
H272 H302 H332 H315 H318 H334 H317 H341 H350i H360D *** H372 ** H410 |
STOT
RE 1; H372: C ≥ 1 % STOT RE 2; H373: ,1 % < C < 1 % Skin Irrit. 2; H315: C ≥ 20 % Skin Sens. 1; H317: C > ,01 % M=1 |
ATP01/ATP01corr | ||
| 028-013-00-7 | nickel matte | nikkel-kéneskő | 273-749-6 | 69012-50-6 | Carc.
1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372 ** H317 H410 |
ATP01 | |||
| 028-014-00-2 | slimes and sludges, copper electrolytic refining, decopperised, nickel sulfate | iszap, üledék, elektrolitos rézfinomítás, réztelenített, nikkel-szulfát | 295-859-3 | 92129-57-2 | Carc.
1A Muta. 2 Repr. 1B Acute Tox. 4 * Acute Tox. 4 * STOT RE 1 Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H332 H302 H372 ** H315 H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H360D *** H372 ** H332 H302 H315 H334 H317 H410 |
STOT
RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 % M=1 |
ATP01 | ||
| 028-015-00-8 | slimes and sludges, copper electrolyte refining, decopperised | iszap, üledék, elektrolitos rézfinomítás, réztelenített | 305-433-1 | 94551-87-8 | Carc.
1A Muta. 2 Repr. 1A STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D *** H372 ** H334 H317 H410 |
ATP01 | |||
| 028-016-00-3 | nickel diperchlorate; perchloric acid, nickel(II) salt | nikkel-diperklorát; perklórsav, nikkel(II) só |
237-124-1 | 13637-71-3 | Carc.
1A Muta. 2 Repr. 1B STOT RE 1 Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H314 H334 H317 H400 H410 |
GHS05 GHS08 GHS09 Dgr |
H350i H341 H360D *** H372 ** H314 H334 H317 H410 |
STOT
RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 % M=1 |
ATP01 | ||
| 028-017-00-9 | nickel
dipotassium bis(sulfate) [1] diammonium nickel bis(sulfate) [2] |
nikkel-dikálium-bisz(szulfát);
[1] diammónium-nikkel-bisz(szulfát) [2] |
237-563-9
[1] 239-793-5 [2] |
13842-46-1
[1] 15699-18-0 [2] |
Carc.
1A Muta. 2 Repr. 1B Acute Tox. 4 * Acute Tox. 4 * STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H332 H302 H372 ** H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H360D *** H372 ** H332 H302 H334 H317 H410 |
STOT
RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 % M=1 |
ATP01 | ||
| 028-018-00-4 | nickel
bis(sulfamidate); nickel sulfamate |
nikkel-bisz(szulfamidát); nikkel-szulfamát |
237-396-1 | 13770-89-3 | Carc.
1A Muta. 2 Repr. 1B Acute Tox. 4 STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H302 H372 ** H334 H317 H400 H410 |
GHS07 GHS08 GHS09 Dgr |
H334 H317 H341 H350i H360D *** H372 ** H410 |
Oral:
ATE = 853 mg/kg STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: ,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ ,01 % M=1 |
ATP01/ATP14 | ||
| 028-019-00-X | nickel bis(tetrafluoroborate) | nikkel-bisz(tetrafluoroborát) | 238-753-4 | 14708-14-6 | Carc.
1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D *** H372 ** H334 H317 H410 |
STOT
RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 % M=1 |
ATP01 | ||
| 028-021-00-0 | nickel
diformate [1] formic acid, nickel salt [2] formic acid, copper nickel salt [3] |
nikkel-diformiát;
[1] hangyasav, nikkelsó; [2] hangyasav, réz-nikkelsó [3] |
222-101-0
[1] 239-946-6 [2] 268-755-0 [3] |
3349-06-2
[1] 15843-02-4 [2] 68134-59-8 [3] |
Carc.
1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D *** H372 ** H334 H317 H410 |
STOT
RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 % M=1 |
ATP01 | ||
| 028-022-00-6 | nickel
di(acetate) [1] nickel acetate [2] |
nikkel-di(acetát);
[1] nikkel-acetát [2] |
206-761-7
[1] 239-086-1 [2] |
373-02-4
[1] 14998-37-9 [2] |
Carc.
1A Muta. 2 Repr. 1B Acute Tox. 4 * Acute Tox. 4 * STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H332 H302 H372 ** H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H302 H332 H334 H317 H341 H350i H360D *** H372 ** H410 |
STOT
RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 % M=1 |
ATP01/ATP01corr | ||
| 028-024-00-7 | nickel dibenzoate | nikkel-dibenzoát | 209-046-8 | 553-71-9 | Carc.
1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D *** H372 ** H334 H317 H410 |
STOT
RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 % M=1 |
ATP01 | ||
| 028-025-00-2 | nickel bis(4-cyclohexylbutyrate) | nikkel-bisz(4-ciklohexilbutirát) | 223-463-2 | 3906-55-6 | Carc.
1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D *** H372 ** H334 H317 H410 |
STOT
RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 % M=1 |
ATP01 | ||
| 028-026-00-8 | nickel(II) stearate; nickel(II) octadecanoate | nikkel(II)-sztearát; nikkel(II)-oktadekanoát |
218-744-1 | 2223-95-2 | Carc.
1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D *** H372 ** H334 H317 H410 |
STOT
RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 % M=1 |
ATP01 | ||
| 028-027-00-3 | nickel dilactate | nikkel-dilaktát | - | 16039-61-5 | Carc.
1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D *** H372 ** H334 H317 H410 |
STOT
RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 % M=1 |
ATP01 | ||
| 028-028-00-9 | nickel(II) octanoate | nikkel(II)-oktanoát | 225-656-7 | 4995-91-9 | Carc.
1A Muta. 2 Repr. 1B STOT RE 1 Skin Corr. 1A Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H314 H334 H317 H400 H410 |
GHS05 GHS08 GHS09 Dgr |
H350i H341 H360D *** H372 ** H314 H334 H317 H410 |
STOT
RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 % M=1 |
ATP01 | ||
| 028-029-00-4 | nickel
difluoride [1] nickel dibromide [2] nickel diiodide [3] nickel potassium fluoride [4] |
nikkel-difluorid;
[1] nikkel-dibromid; [2] nikkel-dijodid; [3] nikkel-kálium-fluorid [4] |
233-071-3
[1] 236-665-0 [2] 236-666-6 [3] |
10028-18-9
[1] 13462-88-9 [2] 13462-90-3 [3] 11132-10-8 [4] |
Carc.
1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D *** H372 ** H334 H317 H410 |
STOT
RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 % M=1 |
ATP01 | ||
| 028-030-00-X | nickel hexafluorosilicate | nikkel-hexafluoro-szilikát | 247-430-7 | 26043-11-8 | Carc.
1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D *** H372 ** H334 H317 H410 |
STOT
RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 % M=1 |
ATP01 | ||
| 028-031-00-5 | nickel selenate | nikkel-szelenát | 239-125-2 | 15060-62-5 | Carc.
1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D *** H372 ** H334 H317 H410 |
STOT
RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 % M=1 |
ATP01 | ||
| 028-032-00-0 | nickel
hydrogen phosphate [1] nickel bis(dihydrogen phosphate) [2] trinickel bis(orthophosphate) [3] dinickel diphosphate [4] nickel bis(phosphinate) [5] nickel phosphinate [6] phosphoric acid, calcium nickel salt [7] diphosphoric acid, nickel(II) salt [8] |
nikkel-hidrogén-foszfát;
[1] nikkel-bisz(dihidrogén-foszfát); [2] trinikkel-bisz(ortofoszfát); [3] dinikkel-difoszfát; [4] nikkel-bisz(foszfinát); [5] nikkel-foszfinát; [6] foszforsav, kálcium-nikkelsó; [7] difoszforsav, nikkel(II) só [8] |
238-278-2
[1] 242-522-3 [2] 233-844-5 [3] 238-426-6 [4] 238-511-8 [5] 252-840-4 [6] |
14332-34-4
[1] 18718-11-1 [2] 10381-36-9 [3] 14448-18-1 [4] 14507-36-9 [5] 36026-88-7 [6] 17169-61-8 [7] 19372-20-4 [8] |
Carc.
1A STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H372 ** H334 H317 H410 |
ATP01 | |||
| 028-033-00-6 | diammonium nickel hexacyanoferrate | diammónium-nikkel-hexacianoferrát | - | 74195-78-1 | Carc.
1A STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H372 ** H334 H317 H410 |
ATP01 | |||
| 028-034-00-1 | nickel dicyanide | nikkel-dicianid | 209-160-8 | 557-19-7 | Carc.
1A STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H372 ** H334 H317 H410 |
EUH032 |
ATP01 | ||
| 028-035-00-7 | nickel chromate | nikkel-kromát | 238-766-5 | 14721-18-7 | Carc.
1A STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H372 ** H334 H317 H410 |
ATP01 | |||
| 028-036-00-2 | nickel(II)
silicate [1] dinickel orthosilicate [2] nickel silicate (3:4) [3] silicic acid, nickel salt [4] trihydrogen hydroxybis[orthosilicato(4-)]trinickelate(3-) [5] |
nikkel(II)
szilikát; [1] dinikkel-ortoszilikát; [2] nikkel-szilikát (3:4); [3] kovasav, nikkelsó; [4] trihidrogén-hidroxi-bisz[ortoszilikáto(4-)]trinikkel(3-) [5] |
244-578-4
[1] 237-411-1 [2] 250-788-7 [3] 253-461-7 [4] 235-688-3 [5] |
21784-78-1
[1] 13775-54-7 [2] 31748-25-1 [3] 37321-15-6 [4] 12519-85-6 [5] |
Carc.
1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372 ** H317 H410 |
ATP01 | |||
| 028-037-00-8 | dinickel hexacyanoferrate | dinikkel-hexacianoferrát | 238-946-3 | 14874-78-3 | Carc.
1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372 ** H317 H410 |
ATP01 | |||
| 028-038-00-3 | trinickel bis(arsenate); nickel(II) arsenate | trinikkel-bisz(arzenát); nikkel(II) arzenát |
236-771-7 | 13477-70-8 | Carc.
1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H372 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H372 ** H317 H410 |
ATP01 | |||
| 028-039-00-9 | nickel
oxalate [1] oxalic acid, nickel salt [2] |
nikkel-oxalát;
[1] oxálsav, nikkelsó [2] |
208-933-7
[1] 243-867-2 [2] |
547-67-1
[1] 20543-06-0 [2] |
Carc.
1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372 ** H317 H410 |
ATP01 | |||
| 028-040-00-4 | nickel telluride | nikkel-tellurid | 235-260-6 | 12142-88-0 | Carc.
1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372 ** H317 H410 |
ATP01 | |||
| 028-041-00-X | trinickel tetrasulfide | trinikkel-tetraszulfid | - | 12137-12-1 | Carc.
1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372 ** H317 H410 |
ATP01 | |||
| 028-042-00-5 | trinickel bis(arsenite) | trinikkel-bisz(arzenit) | - | 74646-29-0 | Carc.
1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372 ** H317 H410 |
ATP01 | |||
| 028-043-00-0 | cobalt
nickel gray periclase; C.I. Pigment Black 25; C.I. 77332 [1] cobalt nickel dioxide [2] cobalt nickel oxide [3] |
kobalt-nikkel
szürke periklász; C.I. Pigment Black 25; C.I. 77332; [1] kobalt-nikkel-dioxid; [2] kobalt-nikkel-oxid [3] |
269-051-6
[1] 261-346-8 [2] |
68186-89-0
[1] 58591-45-0 [2] 12737-30-3 [3] |
Carc.
1A STOT RE 1 Skin Sens. 1 |
H350i H372 ** H317 |
GHS08 GHS07 Dgr |
H350i H372 ** H317 |
ATP01 | |||
| 028-044-00-6 | nickel tin trioxide; nickel stannate | nikkel-ón-trioxid; nikkel-sztannát |
234-824-9 | 12035-38-0 | Carc.
1A STOT RE 1 Skin Sens. 1 |
H350i H372 ** H317 |
GHS08 GHS07 Dgr |
H350i H372 ** H317 |
ATP01 | |||
| 028-045-00-1 | nickel triuranium decaoxide | nikkel-triuránium-dekaoxid | 239-876-6 | 15780-33-3 | Carc.
1A STOT RE 1 Skin Sens. 1 |
H350i H372 ** H317 |
GHS08 GHS07 Dgr |
H350i H372 ** H317 |
ATP01 | |||
| 028-046-00-7 | nickel dithiocyanate | nikkel-ditiocianát | 237-205-1 | 13689-92-4 | Carc.
1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D *** H372 ** H334 H317 H410 |
EUH032 |
STOT
RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 % M=1 |
ATP01 | |
| 028-047-00-2 | nickel dichromate | nikkel-dikromát | 239-646-5 | 15586-38-6 | Carc.
1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D *** H372 ** H334 H317 H410 |
STOT
RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 % M=1 |
ATP01 | ||
| 028-048-00-8 | nickel(II) selenite | nikkel(II)-szelenit | 233-263-7 | 10101-96-9 | Carc.
1A STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H372 ** H334 H317 H410 |
ATP01 | |||
| 028-049-00-3 | nickel selenide | nikkel-szelenid | 215-216-2 | 1314-05-2 | Carc.
1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372 ** H317 H410 |
ATP01 | |||
| 028-050-00-9 | silicic acid, lead nickel salt | kovasav, ólom-nikkelsó | - | 68130-19-8 | Carc.
1A Repr. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H360Df H372 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H360Df H372 ** H317 H410 |
ATP01 | |||
| 028-051-00-4 | nickel
diarsenide [1] nickel arsenide [2] |
nikkel-diarzenid;
[1] nikkel-arzenid[2] |
235-103-1
[1] 248-169-1 [2] |
12068-61-0
[1] 27016-75-7 [2] |
Carc.
1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372 ** H317 H410 |
ATP01 | |||
| 028-052-00-X | nickel barium titanium primrose priderite; C.I. Pigment Yellow 157; C.I. 77900 | nikkel-bárium-titán
sárga priderit; C.I. Pigment Yellow 157; C.I. 77900 |
271-853-6 | 68610-24-2 | Carc.
1A STOT RE 1 Skin Sens. 1 |
H350i H372 ** H317 |
GHS08 GHS07 Dgr |
H317 H350i H372 ** |
ATP01/ATP01corr | |||
| 028-053-00-5 | nickel
dichlorate [1] nickel dibromate [2] ethyl hydrogen sulfate, nickel(II) salt [3] |
nikkel-diklorát;
[1] nikkel-dibromát; [2] etil-hidrogénszulfát, nikkel(II) só [3] |
267-897-0
[1] 238-596-1 [2] 275-897-7 [3] |
67952-43-6
[1] 14550-87-9 [2] 71720-48-4 [3] |
Carc.
1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D *** H372 ** H334 H317 H410 |
STOT
RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 %1 M=1 |
ATP01 | ||
| 028-054-00-0 | nickel(II)
trifluoroacetate [1] nickel(II) propionate [2] nickel bis(benzenesulfonate) [3] nickel(II) hydrogen citrate [4] citric acid, ammonium nickel salt [5] citric acid, nickel salt [6] nickel bis(2-ethylhexanoate) [7] 2-ethylhexanoic acid, nickel salt [8] dimethylhexanoic acid nickel salt [9] nickel(II) isooctanoate [10] nickel isooctanoate [11] nickel bis(isononanoate) [12] nickel(II) neononanoate [13] nickel(II) isodecanoate [14] nickel(II) neodecanoate [15] neodecanoic acid, nickel salt [16] nickel(II) neoundecanoate [17] bis(.sc.d.sc.-gluconato-O1,O2)nickel [18] nickel 3,5-bis(tert-butyl)-4-hydroxybenzoate (1:2) [19] nickel(II) palmitate [20] (2-ethylhexanoato-O)(isononanoato-O)nickel [21] (isononanoato-O)(isooctanoato-O)nickel [22] (isooctanoato-O)(neodecanoato-O)nickel [23] (2-ethylhexanoato-O)(isodecanoato-O)nickel [24] (2-ethylhexanoato-O)(neodecanoato-O)nickel [25] (isodecanoato-O)(isooctanoato-O)nickel [26] (isodecanoato-O)(isononanoato-O)nickel [27] (isononanoato-O)(neodecanoato-O)nickel [28] fatty acids, C6-19-branched, nickel salts [29] fatty acids, C8-18 and C18-unsaturated, nickel salts [30] 2,7-naphthalenedisulfonic acid, nickel(II) salt [31] |
nikkel(II)
trifluoracetát; [1] nikkel(II)-propionát; [2] nikkel-bisz(benzolszulfonát); [3] nikkel(II)-hidrogén-citrát; [4] citromsav, ammónium-nikkelsó; [5] citromsav, nikkelsó; [6] nikkel-bisz(2-etilhexanoát); [7] 2-etil-hexánsav, nikkelsó; [8] dimetil-hexánsav nikkelsó; [9] nikkel(II)-izooktanoát; [10] nikkel-izooktanoát; [11] nikkel-bisz(izononanoát); [12] nikkel(II)-neononanoát; [13] nikkel(II)-izodekanoát; [14] nikkel(II)-neodekanoát; [15] neodekánsav, nikkelsó;[16] nikkel(II)-neoundekanoát; [17] bisz(d-glukonáto-O1,O2)nikkel; [18] nikkel 3,5-bisz(terc-butil)-4- hidroxibenzoát (1:2); [19] nikkel(II)-palmitát; [20] (2-etilhexanoáto-O)(izononanoáto-O)nikkel; [21] (izononanoáto-O)(izooktanoáto-O)nikkel; [22] (izooktanoáto-O)(neodekanoáto-O)nikkel; [23] (2-etilhexanoáto-O)(izodekanoáto-O)nikkel; [24] 2-etilhexanoáto-O)(neodekanoáto-O)nikkel; [25] (izodekanoáto-O)(izooktanoáto- O)nikkel; [26] (izodekanoáto-O)(izononanoáto-O)nikkel; [27] (izononanoáto-O)(neodekanoáto-O)nikkel; [28] zsírsavak, C6-19-elágazó, nikkelsók; [29] zsírsavak, C8-18 és C18- telítetlen, nikkelsók; [30] 2,7-naftalin-diszulfonsav, nikkel(II) só; [31] |
240-235-8
[1] 222-102-6 [2] 254-642-3 [3] 242-533-3 [4] 242-161-1 [5] 245-119-0 [6] 224-699-9 [7] 231-480-1 [8] 301-323-2 [9] 249-555-2 [10] 248-585-3 [11] 284-349-6 [12] 300-094-6 [13] 287-468-1 [14] 287-469-7 [15] 257-447-1 [16] 300-093-0 [17] 276-205-6 [18] 258-051-1 [19] 237-138-8 [20] 287-470-2 [21] 287-471-8 [22] 284-347-5 [23] 284-351-7 [24] 285-698-7 [25] 285-909-2 [26] 284-348-0 [27] 287-592-6 [28] 294-302-1 [29] 283-972-0 [30] |
16083-14-0
[1] 3349-08-4 [2] 39819-65-3 [3] 18721-51-2 [4] 18283-82-4 [5] 22605-92-1 [6] 4454-16-4 [7] 7580-31-6 [8] 93983-68-7 [9] 29317-63-3 [10] 27637-46-3 [11] 84852-37-9 [12] 93920-10-6 [13] 85508-43-6 [14] 85508-44-7 [15] 51818-56-5 [16] 93920-09-3 [17] 71957-07-8 [18] 52625-25-9 [19] 13654-40-5 [20] 85508-45-8 [21] 85508-46-9 [22] 84852-35-7 [23] 84852-39-1 [24] 85135-77-9 [25] 85166-19-4 [26] 84852-36-8 [27] 85551-28-6 [28] 91697-41-5 [29] 84776-45-4 [30] 72319-19-8 [31] |
Carc.
1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D *** H372 ** H334 H317 H410 |
STOT
RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 % M=1 |
ATP01 | ||
| 028-055-00-6 | nickel(II)
sulfite [1] nickel tellurium trioxide [2] nickel tellurium tetraoxide [3] molybdenum nickel hydroxide oxide phosphate [4] |
nikkel(II)-szulfit;
[1] nikkel-tellúr-trioxid; [2] nikkel-tellúr-tetraoxid; [3] molibdén-nikkel-hidroxid-oxid-foszfát [4] |
231-827-7
[1] 239-967-0 [2] 239-974-9 [3] 268-585-7 [4] |
7757-95-1
[1] 15851-52-2 [2] 15852-21-8 [3] 68130-36-9 [4] |
Carc.
1A STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H372 ** H334 H317 H410 |
ATP01 | |||
| 028-056-00-1 | nickel
boride (NiB) [1] dinickel boride [2] trinickel boride [3] nickel boride [4] dinickel silicide [5] nickel disilicide [6] dinickel phosphide [7] nickel boron phosphide [8] |
nikkel-borid
(NiB); [1] dinikkel-borid; [2] trinikkel-borid; [3] nikkel-borid; [4] dinikkel-szilicid; [5] nikkel-diszilicid; [6] dinikkel-foszfid; [7] nikkel-bór-foszfid [8] |
234-493-0
[1] 234-494-6 [2] 234-495-1 [3] 235-723-2 [4] 235-033-1 [5] 235-379-3 [6] 234-828-0 [7] |
12007-00-0
[1] 12007-01-1 [2] 12007-02-2 [3] 12619-90-8 [4] 12059-14-2 [5] 12201-89-7 [6] 12035-64-2 [7] 65229-23-4 [8] |
Carc.
1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372 ** H317 H410 |
ATP01 | |||
| 028-057-00-7 | dialuminium
nickel tetraoxide [1] nickel titanium trioxide [2] nickel titanium oxide [3] nickel divanadium hexaoxide [4] cobalt dimolybdenum nickel octaoxide [5] nickel zirkonium trioxide [6] molybdenum nickel tetraoxide [7] nickel tungsten tetraoxide [8] olivine, nickel green [9] lithium nickel dioxide [10] molybdenum nickel oxide [11] |
dialumínium-nikkel-tetraoxid;
[1] nikkel-titán-trioxid; [2] nikkel-titán-oxid; [3] nikkel-divanádium-hexaoxid; [4] kobalt-dimolibdén-nikkel-oktaoxid; [5] nikkel-cirkónium-trioxid; [6] molibdén-nikkel-tetraoxid; [7] nikkel-volfrám-tetraoxid; [8] olivin, zöld nikkel; [9] lítium-nikkel-dioxid; [10] molibdén-nikkel-oxid; [11] |
234-454-8
[1] 234-825-4 [2] 235-752-0 [3] 257-970-5 [4] 268-169-5 [5] 274-755-1 [6] 238-034-5 [7] 238-032-4 [8] 271-112-7 [9] |
12004-35-2
[1] 12035-39-1 [2] 12653-76-8 [3] 52502-12-2 [4] 68016-03-5 [5] 70692-93-2 [6] 14177-55-0 [7] 14177-51-6 [8] 68515-84-4 [9] 12031-65-1 [10] 12673-58-4 [11] |
Carc.
1A STOT RE 1 Skin Sens. 1 |
H350i H372 ** H317 |
GHS08 GHS07 Dgr |
H350i H372 ** H317 |
ATP01 | |||
| 028-058-00-2 | cobalt lithium nickel oxide | kobalt-lítium-nikkel-oxid | 442-750-5 | - | Carc.
1A Acute Tox. 2 * STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H330 H372 ** H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350i H330 H372 ** H317 H410 |
ATP01 | |||
| 029-001-00-4 | copper chloride; copper (I) chloride; cuprous chloride | réz-klorid; réz(I)-klorid; réz(I)-klorid |
231-842-9 | 7758-89-6 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H400 H410 |
CLP00 | |||
| 029-002-00-X | dicopper oxide; copper (I) oxide | diréz-oxid; réz (I)-oxid |
215-270-7 | 1317-39-1 | Acute
Tox. 4 Acute Tox. 4 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H318 H400 H410 |
GHS07 GHS05 GHS09 Dgr |
H332 H302 H318 H410 |
M=100 |
CLP00/ATP09 | ||
| 029-003-00-5 | Naphthenic acids, copper salts; copper naphthenate | nafténsavak,
réz sók; réz-naftenátok |
215-657-0 | 1338-02-9 | Flam.
Liq. 3 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H226 H302 H400 H410 |
GHS02 GHS07 GHS09 Wng |
H226 H302 H410 |
CLP00 | |||
| 029-004-00-0 | copper sulphate | réz(II)-szulfát | 231-847-6 | 7758-98-7 | Acute
Tox. 4 * Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H319 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H315 H410 |
CLP00 | |||
| 029-005-00-6 | (tris(chloromethyl)phthalocyaninato)copper(II), reaction products with N-methylpiperazine and methoxyacetic acid | (trisz(klórmetil)ftalocianináto)réz(II) reakciótermékei N-metilpiperazinnal és metoxiecetsavval | 401-260-1 | Eye
Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
CLP00 | ||||
| 029-006-00-1 | tris(octadec-9-enylammonium) (trisulfonatophthalocyaninato)copper(II) | trisz(oktadec-9-enilammónium) (triszulfonát-ftalocianináto)réz(II) | 403-210-4 | Eye
Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
CLP00 | ||||
| 029-007-00-7 | (trisodium (2-((3-(6-(2-chloro-5-sulfonato)anilino)-4-(3-carboxypyridinio)-1,3,5-triazin-2-ylamino)-2-oxido-5-sulfonatophenylazo)phenylmethylazo)-4-sulfonatobenzoato)copper(3-)) hydroxide | [trinátrium-[2-[(3-[6-(2-klór-5-szulfonáto)anilino]-4-(3-karboxipiridinio)-1,3,5-triazin-2-ilamino]-2-oxido-5-szulfonátofenilazo]fenilmetilazo]-4-szulfonátobenzoáto]-réz(3-)-hidroxid | 404-670-9 | 89797-01-3 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
G | CLP00 | ||
| 029-008-00-2 | copper(II) methanesulfonate | réz(II)-metánszulfonát | 405-400-2 | 54253-62-2 | Acute
Tox. 4 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H410 |
CLP00 | |||
| 029-009-00-8 | phthalocyanine-N-[3-(diethylamino)propyl]sulfonamide copper complex | ftalocianin-N-[3-(dietilamino)propil]szulfonamid réz komplex | 413-650-9 | 93971-95-0 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | ||||
| 029-010-00-3 | reaction mass of compounds from (dodecakis(p-tolylthio)phthalocyaninato)copper(II) to (hexadecakis(p-tolylthio)phthalocyaninato)copper(II) | (dodekakisz(p-toliltio)ftalocianináto)réz(II)-től [hexadekakisz(p-toliltio)ftalocianináto]réz(II)-ig terjedő vegyületek keveréke | 407-700-9 | 101408-30-4 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 029-011-00-9 | sodium [29H,31H-phthalocyaninato-(2-)-N29,N30,N31,N32]-((3-(N-methyl-N-(2-hydroxyethyl)amino)propyl)amino)sulfonyl-sulfonato, copper complex | nátrium [29H,31H-ftalocianináto-(2-)-N29,N30,N31,N32]-((3-(N-metil-N-(2-hidroxi-etil)amino)propil)amino)szulfonil-szulfonát, réz komplex | 412-730-0 | 150522-10-4 | Skin
Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
CLP00 | |||
| 029-012-00-4 | sodium ((N-(3-trimethylammoniopropyl)sulfamoyl)methylsulfonatophthalocyaninato)copper(II) | nátrium ((N-(3-trimetilammóniopropil)szulfamoil)metil-szulfonátoftalocianináto)-réz(II) | 407-340-2 | 124719-24-0 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | |||
| 029-013-00-X | trisodium(2-(α-(3-(4-chloro-6-(2-(2-(vinylsulfonyl)ethoxy)ethylamino)-1,3,5-triazin-2-ylamino)-2-oxido-5-sulfonatophenylazo)benzylidenehydrazino)-4-sulfonatobenzoato)copper(II) | trinátrium(2-(α-(3-(4-klór-6- (2-(2-(vinilszulfonil)etoxi)etilamino)-1,3,5- triazin-2-ilamino)-2-oxido-5- szulfonátofenilazo)benzilidénhidrazino)-4-szulfonátobenzoáto)réz(II) | 407-580-8 | 130201-51-3 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00/ATP01 | |||
| 029-014-00-5 | reaction mass of: 2,2'-[[cis-1,2-cyclohexanediylbis(nitrilomethylidene)]bis[phenolate]](2-)N,N',O,O'-copper complex; 2,2'-[[trans-1,2-cyclohexanediylbis(nitrilomethylidyne)]bis[phenolate]](2-)N,N',O,O'-copper complex | 2,2'-[[cisz-1,2-
ciklohexándiil-bisz(nitrilometilidén)]bisz[fenolát]](2-)N, N',O, O'-réz
komplex; 2,2'-[[transz-1,2-ciklohexándiil-bisz(nitrilometilidin)]bisz[fenolát]](2-)N, N',O, O'-réz komplex keveréke |
419-610-7 | 171866-24-3 | STOT
RE 2 * Aquatic Chronic 2 |
H373
** H411 |
GHS08 GHS09 Wng |
H373
** H411 |
ATP01 | |||
| 029-015-00-0 | copper thiocyanate | réz-tiocianát | 214-183-1 | 1111-67-7 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
EUH032 |
M=10 |
ATP09 | |
| 029-016-00-6 | copper(II) oxide | réz (II)-oxid | 215-269-1 | 1317-38-0 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
M=100 |
ATP09 | ||
| 029-017-00-1 | dicopper chloride trihydroxide | diréz-klorid-trihidroxid | 215-572-9 | 1332-65-6 | Acute
Tox. 3 Acute Tox. 4 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H332 H400 H410 |
GHS06 GHS09 Dgr |
H332 H301 H410 |
M=10 |
ATP09 | ||
| 029-018-00-7 | tetracopper
hexahydroxide sulphate [1] tetracopper hexahydroxide sulphate hydrate [2] |
tetraréz
hexahidroxid szulfát; [1] tetraréz hexahidroxid szulfát hidrát [2] |
215-582-3
[1] 215-582-3 [2] |
1333-22-8
[1] 12527-76-3 [2] |
Acute
Tox. 4 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
M=10 |
ATP09 | ||
| 029-019-01-X | copper flakes (coated with aliphatic acid) | rézpelyhek (alifás sav bevonattal) | Acute
Tox. 3 Acute Tox. 4 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H302 H319 H400 H410 |
GHS06 GHS09 Dgr |
H331 H302 H319 H410 |
M=10 |
ATP09 | ||||
| 029-020-00-8 | copper(II) carbonate--copper(II) hydroxide (1:1) | réz(II)-karbonát – réz(II)-hidroxid (1:1) | 235-113-6 | 12069-69-1 | Acute
Tox. 4 Acute Tox. 4 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H319 H400 H410 |
GHS07 GHS09 Wng |
H332 H302 H319 H410 |
M=10 |
ATP09 | ||
| 029-021-00-3 | copper dihydroxide; copper(II) hydroxide | réz(II)-dihidroxid; réz(II)-hidroxid |
243-815-9 | 20427-59-2 | Acute
Tox. 2 Acute Tox. 4 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H302 H318 H400 H410 |
GHS06 GHS05 GHS09 Dgr |
H330 H302 H318 H410 |
M=10 |
ATP09 | ||
| 029-022-00-9 | bordeaux
mixture; reaction products of copper sulphate with calcium dihydroxide |
bordeaux-i
keverék; a réz-szulfát kalcium-dihidroxiddal való reakciótermékei |
8011-63-0 | Acute
Tox. 4 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H318 H400 H410 |
GHS07 GHS05 GHS09 Dgr |
H332 H318 H410 |
M=10 |
ATP09 | |||
| 029-023-00-4 | copper sulphate pentahydrate | réz-szulfát-pentahidrát | 231-847-6 | 7758-99-8 | Acute
Tox. 4 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H318 H400 H410 |
GHS07 GHS05 GHS09 Dgr |
H302 H318 H410 |
M=10 |
ATP09 | ||
| 029-024-00-X | granulated copper; [particle length: from 0,9 mm to 6,0 mm; particle width: from 0,494 to 0,949 mm] | #HIÁNYZIK | 231-159-6 | 7440-50-8 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
ATP15 | |||
| 029-025-00-5 | bis(N-hydroxy-N-nitrosocyclohexylaminato-O,O’)copper; bis(N-cyclohexyl-diazenium-dioxy)-copper; [Cu-HDO] | #HIÁNYZIK | 239-703-4 | 312600-89-8 | Flam.
Sol. 1 Acute Tox. 4 STOT RE 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H228 H302 H373 (liver) H318 H400 H410 |
GHS02 GHS07 GHS08 GHS05 GHS09 Dgr |
H228 H302 H318 H373 (liver) H410 |
Oral:
ATE = 360 mg/kg M=1 M=1 |
ATP15 | ||
| 030-001-00-1 | zinc powder - zinc dust (pyrophoric) | cinkpor (pirofóros) | 231-175-3 | 7440-66-6 | Pyr.
Sol. 1 Water-react. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H250 H260 H400 H410 |
GHS02 GHS09 Dgr |
H260 H250 H410 |
T | CLP00 | ||
| 030-001-01-9 | zinc powder - zinc dust (stabilised) | cinkpor (stabilizált) | 231-175-3 | 7440-66-6 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 030-003-00-2 | zinc chloride | cink-klorid | 231-592-0 | 7646-85-7 | Acute
Tox. 4 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H302 H314 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H410 |
STOT
SE 3; H335: C ≥ 5 % |
CLP00 | ||
| 030-004-00-8 | dimethylzinc
[1] diethylzinc [2] |
dimetil-cink;
[1] dietil-cink [2] |
208-884-1
[1] 209-161-3 [2] |
544-97-8
[1] 557-20-0 [2] |
Pyr.
Liq. 1 Water-react. 1 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H250 H260 H314 H400 H410 |
GHS02 GHS05 GHS09 Dgr |
H250 H260 H314 H410 |
EUH014 |
CLP00 | ||
| 030-005-00-3 | diamminediisocyanatozinc | diammin-diizocianáto-cink | 401-610-3 | Acute
Tox. 4 * Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 |
H302 H318 H334 H317 H400 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H302 H318 H334 H317 H400 |
CLP00 | ||||
| 030-006-00-9 | zinc
sulphate (hydrous) (mono-, hexa- and hepta hydrate) [1] zinc sulphate (anhydrous) [2] |
cink-szulfát
(mono-, hexa- és heptahidrát); [1] cink-szulfát (vízmentes) [2] |
231-793-3
[1] 231-793-3 [2] |
7446-19-7
[1] 7733-02-0 [2] |
Acute
Tox. 4 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H410 |
CLP00 | |||
| 030-007-00-4 | bis(3,5-di-tert-butylsalicylato-O1,O2)zinc | bisz[3,5-di-(terc-butil)szaliciláto-O 1,O 2]-cink | 403-360-0 | 42405-40-3 | Flam.
Sol. 1 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H228 H302 H400 H410 |
GHS02 GHS07 GHS09 Dgr |
H228 H302 H410 |
T | CLP00 | ||
| 030-008-00-X | hydroxo(2-(benzenesulfonamido)benzoato)zinc(II) | hidroxo[2-benzolszulfonamido)benzoáto]-cink(II) | 403-750-0 | 113036-91-2 | Acute
Tox. 4 * Aquatic Chronic 2 |
H332 H411 |
GHS07 GHS09 Wng |
H332 H411 |
CLP00 | |||
| 030-009-00-5 | zinc-bis(4-(n-octyloxycarbonylamino)salicylate) dihydrate | cink-bisz(4-(n-oktiloxikarbonilamino)szalicilát) dihidrát | 417-130-2 | - | Eye
Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
ATP01 | |||
| 030-010-00-0 | 2-dodec-1-enylbutanedioic acid, 4-methyl ester zinc salt | 2-dodec-1-enilbutándisav, 4-metilészter cinksó | 430-740-3 | - | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
ATP01 | |||
| 030-011-00-6 | trizinc bis(orthophosphate) | tricink-bisz(ortofoszfát) | 231-944-3 | 7779-90-0 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 030-012-00-1 | aluminium-magnesium-zinc-carbonate-hydroxide | alumínium-magnézium-cink-karbonát-hidroxid | 423-570-6 | 169314-88-9 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01/ATP05 | |||
| 030-013-00-7 | zinc oxide | cink-oxid | 215-222-5 | 1314-13-2 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 030-015-00-8 | tetrazinc(2+)bis(hexacyanocobalt(3+))diacetate | tetracink(2+)-bisz(hexaciano-kobalt(3+))diacetát | 440-060-9 | - | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
ATP01 | |||
| 031-001-00-4 | gallium arsenide | gallium-arzenid | 215-114-8 | 1303-00-0 | Carc.
1B Repr. 1B STOT RE 1 |
H350 H360F H372 (respiratory and haematopoietic systems) |
GHS08 Dgr |
H350 H360F H372 (respiratory and haematopoietic systems) |
ATP05/ATP07 | |||
| 033-001-00-X | arsenic | arzén | 231-148-6 | 7440-38-2 | Acute
Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H410 |
CLP00 | |||
| 033-002-00-5 | arsenic compounds, with the exception of those specified elsewhere in this Annex | arzén vegyületei (kivéve az e mellékletben külön szereplőket) | Acute
Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H410 |
* |
1 A | CLP00 | |||
| 033-003-00-0 | diarsenic trioxide; arsenic trioxide | diarzén-trioxid; arzén-trioxid |
215-481-4 | 1327-53-3 | Carc.
1A Acute Tox. 2 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H300 H314 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H350 H300 H314 H410 |
CLP00 | |||
| 033-004-00-6 | diarsenic pentaoxide; arsenic pentoxide; arsenic oxide | diarzén-pentoxid; arzén-pentoxid; arzén-oxid |
215-116-9 | 1303-28-2 | Carc.
1A Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H331 H301 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H301 H410 |
CLP00 | |||
| 033-005-00-1 | arsenic acid and its salts with the exception of those specified elsewhere in this Annex | arzénsav és sói (kivéve az e mellékletben külön szereplőket) | - | - | Carc.
1A Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H331 H301 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H301 H410 |
A | CLP00/ATP01 | ||
| 033-006-00-7 | arsine | arzin | 232-066-3 | 7784-42-1 | Flam.
Gas 1 Press. Gas Acute Tox. 2 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H220 H330 H373 ** H400 H410 |
GHS02 GHS04 GHS06 GHS08 GHS09 Dgr |
H220 H330 H373 ** H410 |
U | CLP00 | ||
| 033-007-00-2 | tert-butylarsine | terc-butilarzin | 423-320-6 | 4262-43-5 | Pyr.
Liq. 1 Acute Tox. 2 * |
H250 H330 |
GHS02 GHS06 Dgr |
H250 H330 |
CLP00 | |||
| 034-001-00-2 | selenium | szelén | 231-957-4 | 7782-49-2 | Acute
Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 4 |
H331 H301 H373 ** H413 |
GHS06 GHS08 Dgr |
H331 H301 H373 ** H413 |
CLP00 | |||
| 034-002-00-8 | selenium compounds with the exception of cadmium sulphoselenide and those specified elsewhere in this Annex | szelénvegyületek (kivéve a kadmium-szulfoszelenidet és az e mellékletben külön szereplő vegyületeket) | - | - | Acute
Tox. 3 * Acute Tox. 3 * STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H331 H301 H373 ** H410 |
A | CLP00/ATP01 | ||
| 034-003-00-3 | sodium selenite | nátrium-szelenit | 233-267-9 | 10102-18-8 | Acute
Tox. 2 * Acute Tox. 3 * Skin Sens. 1 Aquatic Chronic 2 |
H300 H331 H317 H411 |
GHS06 GHS09 Dgr |
H300 H331 H317 H411 |
EUH031 |
CLP00 | ||
| 035-001-00-5 | bromine | bróm | 231-778-1 | 7726-95-6 | Acute
Tox. 2 * Skin Corr. 1A Aquatic Acute 1 |
H330 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H330 H314 H400 |
CLP00 | |||
| 035-002-00-0 | hydrogen bromide | hidrogén-bromid (gáz) | 233-113-0 | 10035-10-6 | Press.
Gas STOT SE 3 Skin Corr. 1A |
H335 H314 |
GHS04 GHS05 GHS07 Dgr |
H314 H335 |
U | CLP00 | ||
| 035-002-01-8 | hydrobromic acid ... % | hidrogén-bromid …% % | STOT
SE 3 Skin Corr. 1B |
H335 H314 |
GHS05 GHS07 Dgr |
H314 H335 |
Skin
Corr. 1B; H314: C ≥ 40 % Skin Irrit. 2; H315: 10 % ≤ C < 40 % Eye Irrit. 2; H319: 10 % ≤ C < 40 % STOT SE 3; H335: C ≥ 10 % |
B | CLP00 | |||
| 035-003-00-6 | potassium bromate | kálium-bromát | 231-829-8 | 7758-01-2 | Ox.
Sol. 1 Carc. 1B Acute Tox. 3 * |
H271 H350 H301 |
GHS03 GHS06 GHS08 Dgr |
H271 H350 H301 |
CLP00 | |||
| 035-004-00-1 | 2-hydroxyethylammonium perbromide | 2-hidroxietilammónium-perbromid | 407-440-6 | Ox.
Sol. 2 **** Acute Tox. 4 * Skin Corr. 1A Skin Sens. 1 Aquatic Acute 1 |
H272 H302 H314 H317 H400 |
GHS03 GHS05 GHS07 GHS09 Dgr |
H272 H302 H314 H317 H400 |
CLP00 | ||||
| 040-001-00-3 | zirconium powder (pyrophoric) | cirkóniumpor (pirofóros) | 231-176-9 | 7440-67-7 | Pyr.
Sol. 1 Water-react. 1 |
H250 H260 |
GHS02 Dgr |
H260 H250 |
T | CLP00 | ||
| 040-002-00-9 | zirconium powder (non pyrophoric) | cirkónium por, száraz (nem pirofóros) | Self-heat.
1 |
H251 |
GHS02 Dgr |
H251 |
T | CLP00 | ||||
| 040-003-00-4 | reaction product of 3,5-di-tert-butylsalicylic acid and zirconium oxychloride, dehydrated, basic Zr : DTBS = 1.0 : 1.0 to 1.0 : 1.5 | 3,5-di-terc-butilszalicilsav (DTBS) és cirkónium-oxiklorid reakció terméke, dehidrált, bázikus Zr:DTBS = 1,0:1,0 – 1,0: 1,5 | 430-610-6 | 226996-19-6 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
ATP01 | |||
| 042-001-00-9 | molybdenum trioxide | molibdén-trioxid | 215-204-7 | 1313-27-5 | Carc.
2 STOT SE 3 Eye Irrit. 2 |
H351 H335 H319 |
GHS08 GHS07 Wng |
H351 H319 H335 |
CLP00/ATP01 | |||
| 042-002-00-4 | tetrakis(dimethylditetradecylammonium) hexa-μ-oxotetra-μ3-oxodi-μ5-oxotetradecaoxooctamolybdate(4-) | tetrakisz(dimetilditetradecilammónium) hexa-μ-oxotetra-μ3-oxodi-μ5-oxotetradekaoxooktamolibdát(4-) | 404-760-8 | 117342-25-3 | Acute
Tox. 3 * Eye Dam. 1 |
H331 H318 |
GHS06 GHS05 Dgr |
H331 H318 |
CLP00/ATP01 | |||
| 042-003-00-X | tetrakis(trimethylhexadecylammonium) hexa-mu-oxotetra-mu3-oxodi-mu5-oxotetradecaoxooctamolybdate(4-) | tetrakisz(trimetilhexadecilammónium) hexa-μ-oxotetra-μ3-oxodi-μ5-oxotetradekaoxooktamolibdát(4-) | 404-860-1 | 116810-46-9 | Flam.
Sol. 1 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H228 H318 H400 H410 |
GHS02 GHS05 GHS09 Dgr |
H228 H318 H410 |
T | CLP00 | ||
| 042-004-00-5 | Reaction product of ammonium molybdate and C12-C24-diethoxylated alkylamine (1:5-1:3) | ammónium-molibdát és dietoxilált-C12-C24-alkilamin reakcióterméke (1:5-1:3) | 412-780-3 | Skin
Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H315 H317 H411 |
GHS07 GHS09 Wng |
H315 H317 H411 |
CLP00 | ||||
| 042-005-00-0 | reaction mass of: mono- and di-glycerols of canola oil; canola oil acid amide of branched 1,3-propanediamine,N-[3-(tridecyloxy)-propyl]; N,N-diorgano dithiocarbamate molybdenum complex | kanola
olaj mono- és diglicerinjeinek keveréke; elágazó 1,3-propándiamin, N-[3-(trideciloxi)-propil] kanola olaj savamidja; N, N-diorgano-ditiokarbamát-molibdén komplex |
434-240-6 | - | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
ATP01 | |||
| 046-001-00-X | tetraammine palladium (II) hydrogen carbonate | tetraammin-palládium(II)-hidrogénkarbonát | 425-270-0 | 134620-00-1 | Acute
Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H318 H317 H400 H410 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H302 H373 ** H318 H317 H410 |
ATP01 | |||
| 047-001-00-2 | silver nitrate | ezüst-nitrát | 231-853-9 | 7761-88-8 | Ox.
Sol. 2 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H272 H314 H400 H410 |
GHS03 GHS05 GHS09 Dgr |
H272 H314 H410 |
CLP00/ATP01 | |||
| 047-002-00-8 | polyphosphoric acid, copper, sodium, magnesium, calcium, silver and zinc salt | polifoszforsav, réz, nátrium, magnézium, kálcium, ezüst és cink só | 416-850-4 | - | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
ATP01 | |||
| 047-003-00-3 | silver
zinc zeolite (Zeolite, LTA framework type, surface-modified with silver and
zinc ions) [This entry covers LTA (Linde Type A) framework type zeolite which has been surface-modified with both silver and zinc ions at contents Ag+ 0,5 %-6 %, Zn2 + 5 %-16 %, and potentially with phosphorus, NH4+, Mg2+ and/or Ca2+ each at level < 3 %] |
ezüst
cink zeolit (zeolit, LTA típusú, felülete ezüst- és cinkionokkal
módosítva) (Ez a besorolási tétel az LTA [Linde A] típusú zeolitra vonatkozik, amelynek a felületét mind ezüst-, mind cinkionokkal [Ag+ 0,5–6 %, Zn2 + 5–16 %] és esetleg a következőkkel módosították: foszfor, NH4+, Mg2+ és/vagy Ca2+, mindegyik esetében < 3 %.) |
130328-20-0 | Repr.
2 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361d H315 H318 H400 H410 |
GHS08 GHS05 GHS09 Dgr |
H315 H318 H361d H410 |
M=100 M=100 |
ATP10 | |||
| 048-001-00-5 | cadmium compounds, with the exception of cadmium sulphoselenide (xCdS.yCdSe), reaction mass of cadmium sulphide with zinc sulphide (xCdS.yZnS), reaction mass of cadmium sulphide with mercury sulphide (xCdS.yHgS), and those specified elsewhere in this Annex | kadmium vegyületei, kivéve a kadmium-szulfoszelenidet (xCdS.yCdSe), a kadmium-szulfid és cink-szulfid keverékét (xCdS.yZnS), a kadmium-szulfid és a higany-szulfid keverékét (xCdS.yHgS) és az e mellékletben külön szereplő vegyületeket | Acute
Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
* |
1 A | CLP00 | |||
| 048-002-00-0 | cadmium
(non-pyrophoric) [1] cadmium oxide (non-pyrophoric) [2] |
kadmium
(nem pirofóros); [1] kadmium-oxid (nem pirofóros) [2] |
231-152-8
[1] 215-146-2 [2] |
7440-43-9
[1] 1306-19-0 [2] |
Carc.
1B Muta. 2 Repr. 2 Acute Tox. 2 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H341 H361fd H330 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H341 H361fd H330 H372 ** H410 |
CLP00 | |||
| 048-003-00-6 | cadmium diformate; cadmiumformate | kadmium-diformiát; kadmium-formiát |
224-729-0 | 4464-23-7 | Carc.
2 Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H331 H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H331 H301 H351 H373 ** H410 |
* STOT RE 2; H373: C ≥ 0,25 % |
CLP00 | ||
| 048-004-00-1 | cadmium cyanide | kadmium-cianid | 208-829-1 | 542-83-6 | Carc.
2 Acute Tox. 1 Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H310 H330 H300 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H310 H300 H351 H373 ** H410 |
EUH032 |
STOT
RE 2; H373: C ≥ 0,1 % EUH032: C ≥ 1 % |
CLP00 | |
| 048-005-00-7 | cadmiumhexafluorosilicate(2-); cadmium fluorosilica | kadmium-hexafluorszilikát(2-); kadmium-fluorszilikát |
241-084-0 | 17010-21-8 | Carc.
2 Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H331 H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H331 H301 H351 H373 ** H410 |
* STOT RE 2; H373: C ≥ 0,1 % |
CLP00 | ||
| 048-006-00-2 | cadmium fluoride | kadmium-fluorid | 232-222-0 | 7790-79-6 | Carc.
1B Muta. 1B Repr. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H340 H360FD H330 H301 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H340 H360FD H330 H301 H372 ** H410 |
*
Oral Carc. 1B; H350: C ≥ ,01 % STOT RE 1; H372: C ≥ 7 % STOT RE 2; H373: ,1 % ≤ C < 7 % |
CLP00 | ||
| 048-007-00-8 | cadmium iodide | kadmium-jodid | 232-223-6 | 7790-80-9 | Carc.
2 Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H331 H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H331 H301 H351 H373 ** H410 |
* STOT RE 2; H373: C ≥ 0,1 % |
CLP00 | ||
| 048-008-00-3 | cadmium chloride | kadmium-klorid | 233-296-7 | 10108-64-2 | Carc.
1B Muta. 1B Repr. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H340 H360FD H330 H301 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H340 H360FD H330 H301 H372 ** H410 |
Carc.
1B; H350: C ≥ 0,01 % * oral STOT RE 1; H372: C ≥ 7 % STOT RE 2; H373: 0,1 % ≤ C < 7 % |
CLP00 | ||
| 048-009-00-9 | cadmium sulphate | kadmium-szulfát | 233-331-6 | 10124-36-4 | Carc.
1B Muta. 1B Repr. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H340 H360FD H330 H301 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H340 H360FD H330 H301 H372 ** H410 |
Carc.
1B; H350: C ≥ 0,01 % * oral STOT RE 1; H372: C ≥ 7 % STOT RE 2; H373: 0,1 % ≤ C < 7 % |
CLP00 | ||
| 048-010-00-4 | cadmium sulphide | kadmium-szulfid | 215-147-8 | 1306-23-6 | Carc.
1B Muta. 2 Repr. 2 Acute Tox. 4 * STOT RE 1 Aquatic Chronic 4 |
H350 H341 H361fd H302 H372 ** H413 |
GHS08 GHS07 Dgr |
H350 H341 H361fd H372 ** H302 H413 |
* STOT RE 1; H372: C ≥ 10 % STOT RE 2; H373: 0,1 % ≤ C < 10 % |
1 | CLP00 | |
| 048-011-00-X | cadmium (pyrophoric) | kadmium (piroforos) | 231-152-8 | 7440-43-9 | Pyr.
Sol. 1 Carc. 1B Muta. 2 Repr. 2 Acute Tox. 2 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H250 H350 H341 H361fd H330 H372 ** H400 H410 |
GHS02 GHS06 GHS08 GHS09 Dgr |
H250 H350 H341 H361fd H330 H372 ** H410 |
CLP00 | |||
| 048-012-00-5 | cadmium carbonate | kadmium-karbonát | 208-168-9 | 513-78-0 | Carc.
1B Muta. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H340 H332 H312 H302 H372 (kidney, bone) H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H332 H312 H302 H340 H350 H372 (kidney, bone) H410 |
1 A | ATP10 | ||
| 048-013-00-0 | cadmium
hydroxide; cadmium dihydroxide |
kadmium-hidroxid; kadmium-dihidroxid |
244-168-5 | 21041-95-2 | Carc.
1B Muta. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H340 H332 H312 H302 H372 (kidney, bone) H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H332 H312 H302 H340 H350 H372 (kidney, bone) H410 |
1 A | ATP10 | ||
| 048-014-00-6 | cadmium nitrate; cadmium dinitrate | kadmium-nitrát; kadmium-dinitrát |
233-710-6 | 10325-94-7 | Carc.
1B Muta. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H340 H332 H312 H302 H372 (kidney, bone) H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H332 H312 H302 H340 H350 H372 (kidney, bone) H410 |
Carc.
1B; H350: C ≥ 0,01 % |
1 A | ATP10 | |
| 050-001-00-5 | tin tetrachloride; stannic chloride | ón-tetraklorid; ón-klorid |
231-588-9 | 7646-78-8 | Skin
Corr. 1B Aquatic Chronic 3 |
H314 H412 |
GHS05 Dgr |
H314 H412 |
STOT
SE 3; H335: C ≥ 5 % |
CLP00 | ||
| 050-002-00-0 | cyhexatin (ISO); hydroxytricyclohexylstannane; tri(cyclohexyl)tin hydroxide | cihexatin
(ISO); hidroxitriciklohexil-ón; tri(ciklohexil)ón-hidroxid |
236-049-1 | 13121-70-5 | Acute
Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
M=1000 |
CLP00/ATP01 | ||
| 050-003-00-6 | fentin acetate (ISO); triphenyltin acetate | fentin-acetát
(ISO); trifeniltin-acetát |
212-984-0 | 900-95-8 | Carc.
2 Repr. 2 Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * STOT SE 3 STOT RE 1 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H361d *** H330 H311 H301 H335 H372 ** H315 H318 H400 H410 |
GHS06 GHS05 GHS08 GHS09 Dgr |
H351 H361d *** H330 H311 H301 H372 ** H335 H315 H318 H410 |
M=10 |
CLP00/ATP01 | ||
| 050-004-00-1 | fentin hydroxide (ISO); triphenyltin hydroxide | fentin-hidroxid
(ISO); trifeniltin-hidroxid |
200-990-6 | 76-87-9 | Carc.
2 Repr. 2 Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * STOT SE 3 STOT RE 1 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H361d *** H330 H311 H301 H335 H372 ** H315 H318 H400 H410 |
GHS06 GHS05 GHS08 GHS09 Dgr |
H351 H361d *** H330 H311 H301 H372 ** H335 H315 H318 H410 |
M=10 |
CLP00/ATP01 | ||
| 050-005-00-7 | trimethyltin compounds, with the exception of those specified elsewhere in this Annex | trimetil-ón vegyületek (kivéve az e mellékletben külön szereplőket) | Acute
Tox. 1 Acute Tox. 2 * Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H330 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H300 H410 |
* |
1 A | CLP00 | |||
| 050-006-00-2 | triethyltin compounds, with the exception of those specified elsewhere in this Annex | trietil-ón vegyületek (kivéve az e mellékletben külön szereplőket) | Acute
Tox. 1 Acute Tox. 2 * Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H330 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H300 H410 |
* |
1 A | CLP00 | |||
| 050-007-00-8 | tripropyltin compounds, with the exception of those specified elsewhere in this Annex | tripropil-ón vegyületek (kivéve az e mellékletben külön szereplőket) | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H410 |
* |
1 A | CLP00 | |||
| 050-008-00-3 | tributyltin compounds, with the exception of those specified elsewhere in this annex | tributilón-vegyületek, az e mellékletben máshol meghatározottak kivételével | Repr.
1B Acute Tox. 3 Acute Tox. 4 * STOT RE 1 Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H360FD H301 H312 H372 ** H315 H319 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H312 H301 H315 H319 H360FD H372 ** H410 |
* STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,25 % ≤ C < 1 % Skin Irrit. 2; H315: C ≥ 1 % Eye Irrit. 2; H319: C ≥ 1 % M=10 |
1 A | CLP00/ATP07 | |||
| 050-009-00-9 | fluorotripentylstannane
[1] hexapentyldistannoxane [2] |
fluortripentil-ón;
[1] hexapentil-dión-oxid [2] |
243-546-7
[1] 247-143-7 [2] |
20153-49-5
[1] 25637-27-8 [2] |
Acute
Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
* |
1 | CLP00 | |
| 050-010-00-4 | fluorotrihexylstannane | fluortrihexil-ón | 243-547-2 | 20153-50-8 | Acute
Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
* |
1 | CLP00 | |
| 050-011-00-X | triphenyltin compounds, with the exception of those specified elsewhere in this Annex | trifenil-ón vegyületek (kivéve az e mellékletben külön szereplőket) | - | - | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H410 |
* M=100 |
1 A | CLP00/ATP01 | |
| 050-012-00-5 | tetracyclohexylstannane
[1] chlorotricyclohexylstannane [2] butyltricyclohexylstannane [3] |
tetraciklohexil-ón;
[1] klórtriciklohexil-ón; [2] butiltriciklohexil-ón [3] |
215-910-5
[1] 221-437-5 [2] 230-358-5 [3] |
1449-55-4
[1] 3091-32-5 [2] 7067-44-9 [3] |
Acute
Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
* |
1 A | CLP00 | |
| 050-013-00-0 | trioctyltin compounds, with the exception of those specified elsewhere in this Annex | trioktil-ón vegyületek (kivéve az e mellékletben külön szereplőket) | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 Aquatic Chronic 4 |
H335 H315 H319 H413 |
GHS07 Wng |
H319 H335 H315 H413 |
Skin
Irrit. 2; H315: C ≥ 1 % Eye Irrit. 2; H319: C ≥ 1 % STOT SE 3; H335: C ≥ 1 % |
1 A | CLP00 | |||
| 050-017-00-2 | fenbutatin oxide (ISO); bis(tris(2-methyl-2-phenylpropyl)tin)oxide | fenbutatin-oxid
(ISO); bisz(trisz(2-metil-2-fenilpropil)ón)oxid |
236-407-7 | 13356-08-6 | Acute
Tox. 2 * Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H315 H319 H400 H410 |
GHS06 GHS09 Dgr |
H330 H319 H315 H410 |
CLP00 | |||
| 050-018-00-8 | tin(II) methanesulphonate | ón(II)-metánszulfonát | 401-640-7 | 53408-94-9 | Acute
Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H302 H314 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H314 H302 H317 H411 |
CLP00/ATP01 | |||
| 050-019-00-3 | azocyclotin (ISO); 1-(tricyclohexylstannyl)-1H-1,2,4-triazole | azociklotin
(ISO); 1-(triciklohexil-ón) 1H-1,2,4-triazol |
255-209-1 | 41083-11-8 | Acute
Tox. 2 * Acute Tox. 3 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H301 H335 H315 H318 H400 H410 |
GHS06 GHS05 GHS09 Dgr |
H330 H301 H335 H315 H318 H410 |
CLP00 | |||
| 050-020-00-9 | trioctylstannane | trioktil-ón | 413-320-4 | 869-59-0 | STOT
RE 1 Skin Irrit. 2 Aquatic Chronic 4 |
H372
** H315 H413 |
GHS08 GHS07 Dgr |
H372
** H315 H413 |
CLP00 | |||
| 050-021-00-4 | dichlorodioctylstannane | diklórdioktil-ón | 222-583-2 | 3542-36-7 | Repr.
1B Acute Tox. 2 STOT RE 1 Aquatic Chronic 3 |
H360D H330 H372 ** H412 |
GHS08 GHS06 Dgr |
H330 H360D H372 ** H412 |
Inhalation:
ATE = 0.098 mg/L (dusts/mists) Repr. 1B; H360D: C ≥ 0,03 % |
ATP01/ATP15 | ||
| 050-022-00-X | dibutyltin dichloride; (DBTC) | dibutil-ón-diklorid (DBTC) |
211-670-0 | 683-18-1 | Muta.
2 Repr. 1B Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 4 * STOT RE 1 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H341 H360FD H330 H301 H312 H372 ** H314 H400 H410 |
GHS06 GHS05 GHS08 GHS09 Dgr |
H341 H360FD H330 H301 H312 H372 ** H314 H410 |
Skin
Corr. 1B; H314: C ≥ 5 % Skin Irrit. 2; H315: 0,01 % ≤ C < 5 % Eye Dam. 1; H318: 3 % ≤ C < 5 % Eye Irrit. 2; H319: 0,01 % ≤ C < 3 % M=10 |
ATP01 | ||
| 050-023-00-5 | reaction mass of: bis[(2-ethyl-1-oxohexyl)oxy]dioctyl stannane; bis[((2-ethyl-1-oxohexyl)oxy)dioctylstannyl]oxide; bis(1-phenyl-1,3-decanedionyl)dioctyl stannane; ((2-ethyl-1-oxohexyl)oxy)-(1-phenyl-1,3-decanedionyl)dioctyl stannane | a
következő anyagok keveréke: bisz[(2-etil-1- oxohexil)oxi]dioktil ón;
bisz[((2-etil-1-oxohexil)oxi)dioktil-ón]oxid; bisz(1-fenil-1,3-dekándionil)dioktil ón; ((2-etil-1-oxohexil)oxi)-(1- fenil-1,3-dekándionil)dioktil ón |
422-920-5 | - | STOT
RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H373
** H400 H410 |
GHS08 GHS09 Wng |
H373
** H410 |
M=10 |
ATP01 | ||
| 050-024-00-0 | reaction mass of: tri-p-tolyltin hydroxide; hexa-p-tolyl-distannoxane | tri-p-tolil-ón
hidroxid; hexa-p-tolil-disztannoxán keveréke |
432-230-6 | - | Acute
Tox. 4 * STOT RE 1 Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H372 ** H315 H318 H317 H400 H410 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H372
** H302 H315 H318 H317 H410 |
ATP01 | |||
| 050-025-00-6 | trichloromethylstannane | triklórmetil-ón | 213-608-8 | 993-16-8 | Repr.
2 |
H361d |
GHS08 Wng |
H361d |
ATP05 | |||
| 050-026-00-1 | 2-ethylhexyl 10-ethyl-4-[[2-[(2-ethylhexyl)oxy]-2-oxoethyl]thio]-4-methyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoate | 2-etil-hexil-10-etil-4-[[2-[(2-etil-hexil)oxi]-2-oxoetil]-tio]-4-metil-7-oxo-8-oxa-3,5-ditia-4-sztanna-tetradekanoát | 260-828-5 | 57583-34-3 | Repr.
2 |
H361d |
GHS08 Wng |
H361d |
ATP05 | |||
| 050-027-00-7 | 2-ethylhexyl 10-ethyl-4,4-dioctyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoate; [DOTE] | 2-etilhexil-10-etil-4,4- dioktil-7-oxo-8-oxa-3,5-ditia-4-sztanna-tetradekanoát | 239-622-4 | 15571-58-1 | Repr.
1B STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360D H372 (immune system) H400 H410 |
GHS08 GHS09 Dgr |
H360D H372 (immune system) H410 |
ATP05/ATP15 | |||
| 050-028-00-2 | 2-ethylhexyl 10-ethyl-4,4-dimethyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoate | 2-etilhexil-10-etil-4,4- dimetil-7-oxo-8-oxa-3,5-ditia-4-sztanna-tetradekanoát | 260-829-0 | 57583-35-4 | Repr.
2 Acute Tox. 4 STOT RE 1 Skin Sens. 1A |
H361d H302 H372 (nervous system, immune system) H317 |
GHS08 GHS07 Dgr |
H302 H317 H361d H372 (nervous system, immune system) |
ATP06 | |||
| 050-029-00-8 | dimethyltin dichloride | dimetil-ón-diklorid | 212-039-2 | 753-73-1 | Repr.
2 Acute Tox. 2 Acute Tox. 3 Acute Tox. 3 STOT RE 1 Skin Corr. 1B |
H361d H330 H311 H301 H372 (nervous system, immune system) H314 |
GHS08 GHS06 GHS05 Dgr |
H301 H311 H330 H314 H361d H372 (nervous system, immune system) |
EUH071 |
ATP06 | ||
| 050-030-00-3 | dibutyltin dilaurate; dibutyl[bis(dodecanoyloxy)]stannane | dibutiltin dilaurát; dibutil[bisz(dodekanoiloxi)]sztannán | 201-039-8 | 77-58-7 | Muta.
2 Repr. 1B STOT RE 1 |
H341 H360FD H372 (immune system) |
GHS08 Dgr |
H341 H360FD H372 (immune system) |
ATP10 | |||
| 050-031-00-9 | dioctyltin
dilaurate [1] stannane, dioctyl-, bis (coco acyloxy) derivs. [2] |
#HIÁNYZIK | 222-883-3
[1] 293-901-5 [2] |
3648-18-8
[1] 91648-39-4 [2] |
Repr.
1B STOT RE 1 |
H360D H372 (immune system) |
GHS08 Dgr |
H360D H372 (immune system) |
ATP15 | |||
| 051-001-00-8 | antimony trichloride | antimon-triklorid | 233-047-2 | 10025-91-9 | Skin
Corr. 1B Aquatic Chronic 2 |
H314 H411 |
GHS05 GHS09 Dgr |
H314 H411 |
STOT
SE 3; H335: C ≥ 5 % |
CLP00 | ||
| 051-002-00-3 | antimony pentachloride | antimon-pentaklorid | 231-601-8 | 7647-18-9 | Skin
Corr. 1B Aquatic Chronic 2 |
H314 H411 |
GHS05 GHS09 Dgr |
H314 H411 |
STOT
SE 3; H335: C ≥ 5 % |
CLP00 | ||
| 051-003-00-9 | antimony compounds, with the exception of the tetroxide (Sb2O4), pentoxide (Sb2O5), trisulphide (Sb2S3), pentasulphide (Sb2S5) and those specified elsewhere in this Annex | antimon és vegyületei (kivéve tetraoxid (Sb2O4), pentoxid (Sb2O5), triszulfid (Sb2S3), pentaszulfid (Sb2S5) és az e mellékletben külön szereplők) | Acute
Tox. 4 * Acute Tox. 4 * Aquatic Chronic 2 |
H332 H302 H411 |
GHS07 GHS09 Wng |
H332 H302 H411 |
* |
1 A | CLP00 | |||
| 051-004-00-4 | antimony trifluoride | antimon-trifluorid | 232-009-2 | 7783-56-4 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Chronic 2 |
H331 H311 H301 H411 |
GHS06 GHS09 Dgr |
H331 H311 H301 H411 |
CLP00 | |||
| 051-005-00-X | antimony trioxide | antimon-trioxid | 215-175-0 | 1309-64-4 | Carc.
2 |
H351 |
GHS08 Wng |
H351 |
CLP00 | |||
| 051-006-00-5 | diphenyl(4-phenylthiophenyl)sulfonium hexafluoroantimonate | difenil(4-feniltiofenil)szulfónium-hexafluorantimonát | 403-500-0 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
CLP00 | ||||
| 051-007-00-0 | bis(4-dodecylphenyl)iodonium hexafluoroantimonate | bisz(4-dodecilfenil)jodónium-hexafluoroantimonát | 404-420-9 | 71786-70-4 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
CLP00 | |||
| 053-001-00-3 | iodine | jód | 231-442-4 | 7553-56-2 | Acute
Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 |
H332 H312 H400 |
GHS07 GHS09 Wng |
H332 H312 H400 |
CLP00 | |||
| 053-002-00-9 | hydrogen iodide | hidrogén-jodid (gáz) | 233-109-9 | 10034-85-2 | Press.
Gas Skin Corr. 1A |
H314 |
GHS04 GHS05 Dgr |
H314 |
Skin
Corr. 1A; H314: C ≥ 10 % Skin Corr. 1B; H314: 0,2 % ≤ C < 10 % Skin Irrit. 2; H315: 0,02 % ≤ C < 0,2 % Eye Irrit. 2; H319: 0,02 % ≤ C < 0,2 % STOT SE 3; H335: C ≥ 0,02 % |
5 U | CLP00 | |
| 053-002-01-6 | hydriodic acid ... % | hidrogén-jodid … % (oldat) | Skin
Corr. 1B |
H314 |
GHS05 Dgr |
Skin
Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 10 % ≤ C < 25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
B | CLP00 | ||||
| 053-003-00-4 | iodoxybenzene | jód-oxibenzol | 696-33-3 | Expl.
1.1 **** |
H201
**** |
**** |
**** |
CLP00/ATP01corr | ||||
| 053-004-00-X | calcium iodoxybenzoate | kálcium-jód-oxibenzoát | Expl.
1.1 **** |
H201
**** |
**** |
**** |
C | CLP00/ATP01corr | ||||
| 053-005-00-5 | (4-(1-methylethyl)phenyl)-(4-methylphenyl)iodonium tetrakis(pentafluorophenyl)borate (1-) | (4-(1-metiletil)fenil)-(4-metilfenil)jodónium-tetrakisz(pentafluorfenil)-borát (1-) | 422-960-3 | 178233-72-2 | Acute
Tox. 4 * Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Wng |
H312 H302 H373 ** H410 |
CLP00 | |||
| 056-001-00-1 | barium peroxide | bárium-peroxid | 215-128-4 | 1304-29-6 | Ox.
Sol. 2 Acute Tox. 4 * Acute Tox. 4 * |
H272 H332 H302 |
GHS03 GHS07 Dgr |
H272 H332 H302 |
CLP00 | |||
| 056-002-00-7 | barium salts, with the exception of barium sulphate, salts of 1-azo-2-hydroxynaphthalenyl aryl sulphonic acid, and of salts specified elsewhere in this Annex | bárium sók (a bárimszulfátot, az 1-azo-2-hidroxinaftalin-aril-szulfonsav sóit és az e mellékletben külön szereplő sókat kivéve) | Acute
Tox. 4 * Acute Tox. 4 * |
H332 H302 |
GHS07 Wng |
H332 H302 |
* |
1 A | CLP00 | |||
| 056-003-00-2 | barium carbonate | bárium-karbonát | 208-167-3 | 513-77-9 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 056-004-00-8 | barium chloride | bárium-klorid | 233-788-1 | 10361-37-2 | Acute
Tox. 3 * Acute Tox. 4 * |
H301 H332 |
GHS06 Dgr |
H301 H332 |
CLP00 | |||
| 064-001-00-8 | gadolinium(III)sulfite trihydrate | gadolínium(III)-szulfit-trihidrát | 456-900-2 | 51285-81-5 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
ATP01 | |||
| 072-001-00-4 | hafnium tetra-n-butoxide | hafnium tetra-n-butoxid | 411-740-2 | 22411-22-9 | Eye
Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
CLP00 | |||
| 074-001-00-X | hexasodium tungstate hydrate | hexanátrium-dihidrogén-dodekavolframát | 412-770-9 | 12141-67-2 | Acute
Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
CLP00 | |||
| 074-002-00-5 | Reaction products of tungsten hexachloride with 2-methylpropan-2-ol, nonylphenol and pentane-2,4-dione | volfram-hexaklorid reakcióterméke 2-metilpropán-2-ollal, nonilfenollal és pentán-2,4-dionnal | 408-250-6 | Flam.
Liq. 2 Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H225 H332 H314 H317 H400 H410 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H225 H332 H314 H317 H410 |
CLP00 | ||||
| 076-001-00-5 | osmium tetraoxide; osmic acid | ozmium-tetraoxid; ozmiumsav |
244-058-7 | 20816-12-0 | Acute
Tox. 1 Acute Tox. 2 * Acute Tox. 2 * Skin Corr. 1B |
H310 H330 H300 H314 |
GHS06 GHS05 Dgr |
H330 H310 H300 H314 |
CLP00 | |||
| 078-001-00-0 | tetrachloroplatinates with the exception of those specified elsewhere in this Annex | tetraklór-platinátok (kivéve az e mellékletben külön szereplőket) | Acute
Tox. 3 * Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H301 H318 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H318 H334 H317 |
A | CLP00 | ||||
| 078-002-00-6 | diammonium tetrachloroplatinate | diammónium-tetraklór-platinát | 237-499-1 | 13820-41-2 | Acute
Tox. 3 * Skin Irrit. 2 Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H301 H315 H318 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H315 H318 H334 H317 |
CLP00 | |||
| 078-003-00-1 | disodium tetrachloroplatinate | dinátrium-tetraklór-platinát | 233-051-4 | 10026-00-3 | Acute
Tox. 3 * Skin Irrit. 2 Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H301 H315 H318 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H315 H318 H334 H317 |
CLP00 | |||
| 078-004-00-7 | dipotassium tetrachloroplatinate | dikálium-tetraklór-platinát | 233-050-9 | 10025-99-7 | Acute
Tox. 3 * Skin Irrit. 2 Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H301 H315 H318 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H315 H318 H334 H317 |
CLP00 | |||
| 078-005-00-2 | hexachloroplatinates with the exception of those specified elsewhere in this Annex | hexaklór-platinátok (kivéve az e mellékletben külön szereplőket) | Acute
Tox. 3 * Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H301 H318 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H318 H334 H317 |
A | CLP00 | ||||
| 078-006-00-8 | disodium hexachloroplatinate | dinátrium-hexaklór-platinát | 240-983-5 | 16923-58-3 | Acute
Tox. 3 * Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H301 H318 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H318 H334 H317 |
CLP00 | |||
| 078-007-00-3 | dipotassium hexachloroplatinate | dikálium-hexaklór-platinát | 240-979-3 | 16921-30-5 | Acute
Tox. 3 * Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H301 H318 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H318 H334 H317 |
CLP00 | |||
| 078-008-00-9 | diammonium hexachloroplatinate | diammónium-hexaklór-platinát | 240-973-0 | 16919-58-7 | Acute
Tox. 3 * Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H301 H318 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H318 H334 H317 |
CLP00 | |||
| 078-009-00-4 | hexachloroplatinic acid | hexaklór-platinasav | 241-010-7 | 16941-12-1 | Acute
Tox. 3 * Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 |
H301 H314 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H314 H334 H317 |
CLP00 | |||
| 078-010-00-X | tetraammine platinum (II) hydrogen carbonate | tetraammin-platina(II) hidrogén-karbonát |
426-730-3 | 123439-82-7 | Acute
Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
ATP01 | |||
| 078-011-00-5 | hydroxydisulfito platinum(II) acid | hidroxi-diszulfito-platina(II) sav | 423-310-1 | 61420-92-6 | Acute
Tox. 4 * STOT RE 2 * Skin Corr. 1A Resp. Sens. 1 Skin Sens. 1 Aquatic Chronic 3 |
H302 H373 H314 H334 H317 H412 |
GHS05 GHS08 GHS07 Dgr |
H302 H373 H314 H334 H317 H412 |
ATP01 | |||
| 078-012-00-0 | platinum(IV) nitrate/nitric acid solution | platina(IV)-nitrát/salétromsav-oldat; | 432-400-1 | - | Skin
Corr. 1A Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
ATP01 | |||
| 080-001-00-0 | mercury | higany | 231-106-7 | 7439-97-6 | Repr.
1B Acute Tox. 2 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360D
*** H330 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H360D
*** H330 H372 ** H410 |
CLP00/ATP01 | |||
| 080-002-00-6 | inorganic compounds of mercury with the exception of mercuric sulphide and those specified elsewhere in this Annex | szervetlen higanyvegyületek (kivéve a higany-szulfidot és az e mellékletben külön szereplő vegyületeket) | Acute
Tox. 1 Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H330 H300 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H310 H300 H373 ** H410 |
* STOT RE 2; H373: C ≥ 0,1 % |
1 A | CLP00 | |||
| 080-003-00-1 | dimercury dichloride; mercurous chloride; calomel | dihigany-diklorid; higany-klorid; kalomel |
233-307-5 | 10112-91-1 | Acute
Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H335 H315 H319 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H335 H315 H410 |
CLP00 | |||
| 080-004-00-7 | organic compounds of mercury with the exception of those specified elsewhere in this Annex | higany szerves vegyületei (kivéve az e mellékletben külön szereplőket) | Acute
Tox. 1 Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H330 H300 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H310 H300 H373 ** H410 |
* STOT RE 2; H373: C ≥ 0,1 % |
1 A | CLP00 | |||
| 080-005-00-2 | mercury difulminate; mercuric fulminate; fulminate of mercury | higany-difulminát; higany-fulminát; higany-fulminát |
211-057-8 | 628-86-4 | Unst.
Expl. Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H200 H331 H311 H301 H373 ** H400 H410 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H200 H331 H311 H301 H373 ** H400 H410 |
CLP00 | |||
| 080-005-01-X | mercury difulminate; mercuric fulminate; fulminate of mercury [≥ 20 % phlegmatiser] | higany-difulminát; higany-fulminát; higany-fulminát [≥ 20 % flegmatizálószer] |
211-057-8 | 628-86-4 | Expl.
1.1 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H201 H331 H311 H301 H373 ** H400 H410 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H201 H331 H311 H301 H373 ** H400 H410 |
CLP00 | |||
| 080-006-00-8 | dimercury dicyanide oxide; mercuric oxycyanide | dihigany-dicianid-oxid; higany-oxicianid |
215-629-8 | 1335-31-5 | Expl.
1.1 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H201 H331 H311 H301 H373 ** H400 H410 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H201 H331 H311 H301 H373 ** H410 |
CLP00/ATP01 | |||
| 080-007-00-3 | dimethylmercury
[1] diethylmercury [2] |
dimetil-higany;
[1] dietil-higany [2] |
209-805-3
[1] 211-000-7 [2] |
593-74-8
[1] 627-44-1 [2] |
Acute
Tox. 1 Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H330 H300 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H310 H300 H373 ** H410 |
* STOT RE 2; H373: C ≥ 0,05 % |
1 | CLP00 | |
| 080-008-00-9 | phenylmercury
nitrate [1] phenylmercury hydroxide [2] basic phenylmercury nitrate [3] |
fenil-higany-nitrát;
[1] fenil-higany-hidroxid; [2] bázikus fenil-higany-nitrát [3] |
200-242-9
[1] 202-866-7 [2] |
55-68-5
[1] 100-57-2 [2] 8003-05-2 [3] |
Acute
Tox. 3 * STOT RE 1 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H301 H372 ** H314 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H301 H372 ** H314 H410 |
CLP00 | |||
| 080-009-00-4 | 2-methoxyethylmercury chloride | 2-metoxietil-higany-klorid | 204-659-7 | 123-88-6 | Acute
Tox. 3 * STOT RE 1 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H301 H372 ** H314 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H301 H372 ** H314 H410 |
CLP00 | |||
| 080-010-00-X | mercury dichloride; mercuric chloride | higany-diklorid; higany(II)-klorid |
231-299-8 | 7487-94-7 | Muta.
2 Repr. 2 Acute Tox. 2 * STOT RE 1 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H341 H361f *** H300 H372 ** H314 H400 H410 |
GHS06 GHS05 GHS08 GHS09 Dgr |
H341 H361f *** H300 H372 ** H314 H410 |
CLP00/ATP01 | |||
| 080-011-00-5 | phenylmercury acetate | fenil-higany-acetát | 200-532-5 | 62-38-4 | Acute
Tox. 3 * STOT RE 1 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H301 H372 ** H314 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H301 H372 ** H314 H410 |
CLP00 | |||
| 080-012-00-0 | methylmercuric chloride | #HIÁNYZIK | 204-064-2 | 115-09-3 | Carc.
2 Repr. 1A Lact. Acute Tox. 2 Acute Tox. 2 Acute Tox. 2 STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H360Df H362 H330 H310 H300 H372 (nervous system, kidneys) H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H310 H300 H351 H360Df H362 H372 (nervous system, kidneys) H410 |
Inhalation:
ATE = 0.05 mg/L (dusts/mists) Dermal: ATE = 50 mg/kg Oral: ATE = 5 mg/kg |
1 | ATP14 | |
| 081-001-00-3 | thallium | tallium | 231-138-1 | 7440-28-0 | Acute
Tox. 2 * Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 4 |
H330 H300 H373 ** H413 |
GHS06 GHS08 Dgr |
H330 H300 H373 ** H413 |
CLP00 | |||
| 081-002-00-9 | thallium compounds, with the exception of those specified elsewhere in this Annex | talliumvegyületek (kivéve az e mellékletben külön szereplőket) | Acute
Tox. 2 * Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 2 |
H330 H300 H373 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H330 H300 H373 ** H411 |
A | CLP00 | ||||
| 081-003-00-4 | dithallium sulphate; thallic sulphate | ditallium-szulfát; tallium-szulfát |
231-201-3 | 7446-18-6 | Acute
Tox. 2 * STOT RE 1 Skin Irrit. 2 Aquatic Chronic 2 |
H300 H372 ** H315 H411 |
GHS06 GHS08 GHS09 Dgr |
H300 H372 ** H315 H411 |
CLP00 | |||
| 082-001-00-6 | lead compounds with the exception of those specified elsewhere in this Annex | ólomvegyületek (kivéve az e mellékletben külön szereplőket) | Repr.
1A Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H332 H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H360Df H332 H302 H373 ** H410 |
Repr.
2; H361f: C ≥ 2,5 % * STOT RE 2; H373: C ≥ 0,5 % |
1 A | CLP00 | |||
| 082-002-00-1 | lead alkyls | ólom-alkilek | Repr.
1A Acute Tox. 1 Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H310 H330 H300 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H360Df H330 H310 H300 H373 ** H410 |
Repr.
1A; H360D: C ≥ 0,1 % * STOT RE 2; H373: C ≥ 0,05 % |
1 A | CLP00 | |||
| 082-003-00-7 | lead diazide; lead azide | ólom-diazid; ólom-azid |
236-542-1 | 13424-46-9 | Unst.
Expl. Repr. 1A Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H200 H360Df H332 H302 H373 ** H400 H410 |
GHS01 GHS08 GHS07 GHS09 Dgr |
H200 H360Df H332 H302 H373 ** H410 |
1 | CLP00 | ||
| 082-003-01-4 | lead diazide; lead azide [≥ 20 % phlegmatiser] | ólom-diazid; ólom-azid [≥ 20 % flegmatizálószer] |
236-542-1 | 13424-46-9 | Expl.
1.1 Repr. 1A Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H201 H360Df H332 H302 H373 ** H400 H410 |
GHS01 GHS08 GHS07 GHS09 Dgr |
H201 H360Df H332 H302 H373 ** H410 |
1 | CLP00 | ||
| 082-004-00-2 | lead chromate | ólom-kromát | 231-846-0 | 7758-97-6 | Carc.
1B Repr. 1A STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H360Df H373 ** H400 H410 |
GHS08 GHS09 Dgr |
H350 H360Df H373 ** H410 |
1 | CLP00/ATP01 | ||
| 082-005-00-8 | lead di(acetate) | ólom-diacetát | 206-104-4 | 301-04-2 | Repr.
1A STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H373 ** H400 H410 |
GHS08 GHS09 Dgr |
H360Df H373 ** H410 |
1 | CLP00 | ||
| 082-006-00-3 | trilead bis(orthophosphate) | triólom-bisz(ortofoszfát) | 231-205-5 | 7446-27-7 | Repr.
1A STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H373 ** H400 H410 |
GHS08 GHS09 Dgr |
H360Df H373 ** H410 |
1 | CLP00 | ||
| 082-007-00-9 | lead acetate, basic | ólom-acetát (bázikus) | 215-630-3 | 1335-32-6 | Carc.
2 Repr. 1A STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H360Df H373 ** H400 H410 |
GHS08 GHS09 Dgr |
H351 H360Df H373 ** H410 |
1 | CLP00 | ||
| 082-008-00-4 | lead(II) methanesulphonate | ólom(II)-metánszulfonát | 401-750-5 | 17570-76-2 | Repr.
1A Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 |
H360Df H332 H302 H373 ** H315 H318 |
GHS08 GHS05 GHS07 Dgr |
H360Df H332 H302 H373 ** H315 H318 |
1 | CLP00 | ||
| 082-009-00-X | lead sulfochromate yellow; C.I. Pigment Yellow 34; [This substance is identified in the Colour Index by Colour Index Constitution Number, C.I. 77603.] | ólom–szulfokromát
sárga; C.I. Pigment Yellow 34; [Ez az anyag a C.I. 77603 színindexszám alatt szerepel.] |
215-693-7 | 1344-37-2 | Carc.
1B Repr. 1A STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H360Df H373 ** H400 H410 |
GHS08 GHS09 Dgr |
H350 H360Df H373 ** H410 |
1 | CLP00/ATP01 | ||
| 082-010-00-5 | lead chromate molybdate sulfate red; C.I. Pigment Red 104; [This substance is identified in the Colour Index by Colour Index Constitution Number, C.I. 77605.] | ólom-kromát
molibdát-szulfát vörös; C.I. Pigment Red 104; [Ez az anyag a C.I. 77605 színindexszám alatt szerepel.] |
235-759-9 | 12656-85-8 | Carc.
1B Repr. 1A STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H360Df H373 ** H400 H410 |
GHS08 GHS09 Dgr |
H350 H360Df H373 ** H410 |
1 | CLP00/ATP01 | ||
| 082-011-00-0 | lead hydrogen arsenate | ólom-hidrogén-arzenát | 232-064-2 | 7784-40-9 | Carc.
1A Repr. 1A Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H360Df H331 H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H360Df H331 H301 H373 ** H410 |
1 | CLP00 | ||
| 082-012-00-6 | barium calcium cesium lead samarium strontium bromide chloride fluoride iodide europium doped | bárium kálcium cézium ólom szamárium stroncium bromid klorid fluorid jodid európium adalékolt | 431-780-4 | 199876-46-5 | Acute
Tox. 4 * STOT RE 2 * Aquatic Chronic 2 |
H302 H373 ** H411 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H411 |
ATP01 | |||
| 082-013-00-1 | lead
powder; [particle diameter < 1 mm] |
ólom
por formában; [részecskeátmérő < 1 mm] |
231-100-4 | 7439-92-1 | Repr.
1A Lact. Aquatic Acute 1 Aquatic Chronic 1 |
H360FD H362 H400 H410 |
GHS08 GHS09 Dgr |
H360FD H362 H410 |
Repr.
1A; : C ≥ 0,03 % M=1 M=10 |
ATP09/ATP15 | ||
| 082-014-00-7 | lead
massive: [particle diameter ≥ 1 mm] |
ólom
tömör formában; [részecskeátmérő ≥ 1 mm] |
231-100-4 | 7439-92-1 | Repr.
1A Lact. |
H360FD H362 |
GHS08 Dgr |
H360FD H362 |
ATP09 | |||
| 092-001-00-8 | uranium | urán | 231-170-6 | 7440-61-1 | Acute
Tox. 2 * Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 4 |
H330 H300 H373 ** H413 |
GHS06 GHS08 Dgr |
H330 H300 H373 ** H413 |
CLP00 | |||
| 092-002-00-3 | uranium compounds with the exception of those specified elsewhere in this Annex | uránvegyületek (kivéve az e mellékletben külön szereplőket) | - | - | Acute
Tox. 2 * Acute Tox. 2 * STOT RE 2 Aquatic Chronic 2 |
H330 H300 H373 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H330 H300 H373 ** H411 |
A | CLP00/ATP01 | ||
| 601-001-00-4 | methane | metán | 200-812-7 | 74-82-8 | Flam.
Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
U | CLP00 | ||
| 601-002-00-X | ethane | etán | 200-814-8 | 74-84-0 | Flam.
Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
U | CLP00 | ||
| 601-003-00-5 | propane | propán | 200-827-9 | 74-98-6 | Flam.
Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
U | CLP00 | ||
| 601-004-00-0 | butane
[1] and isobutane [2] |
bután; [1] és izobután [2] | 203-448-7
[1] 200-857-2 [2] |
106-97-8
[1] 75-28-5 [2] |
Flam.
Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
C U | CLP00 | ||
| 601-004-01-8 | butane
(containing ≥ 0,1 % butadiene (203-450-8)) [1] isobutane (containing ≥ 0,1 % butadiene (203-450-8)) [2] |
bután
(≥ 0,1 % butadién (203-450-8) tartalommal); [1] izobután (≥ 0,1 % butadién (203-450-8) tartalommal) [2] |
203-448-7
[1] 200-857-2 [2] |
106-97-8
[1] 75-28-5 [2] |
Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS02 GHS04 GHS08 Dgr |
H220 H350 H340 |
C S U | CLP00 | ||
| 601-005-00-6 | 2,2-dimethylpropane; neopentane | 2,2-dimetilpropán; neopentán |
207-343-7 | 463-82-1 | Flam.
Gas 1 Press. Gas Aquatic Chronic 2 |
H220 H411 |
GHS02 GHS04 GHS09 Dgr |
H220 H411 |
U | CLP00 | ||
| 601-006-00-1 | pentane | pentán | 203-692-4 | 109-66-0 | Flam.
Liq. 2 Asp. Tox. 1 STOT SE 3 Aquatic Chronic 2 |
H225 H304 H336 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H304 H336 H411 |
EUH066 |
C | CLP00 | |
| 601-007-00-7 | hexane
(containing < 5 % n-hexane (203-777-6)); 2-methylpentane [1] 3-methylpentane [2] 2,2-dimethylbutane [3] 2,3-dimethylbutane [4] |
hexán
(< 5 % n- hexán (203-777-6) tartalommal); 2-metilpentán; [1] 3-metilpentán; [2] 2,2-dimetilbután; [3] 2,3-dimetilbután [4] |
203-523-4
[1] 202-481-4 [2] 200-906-8 [3] 201-193-6 [4] |
107-83-5
[1] 96-14-0 [2] 75-83-2 [3] 79-29-8 [4] |
Flam.
Liq. 2 Asp. Tox. 1 STOT SE 3 Skin Irrit. 2 Aquatic Chronic 2 |
H225 H304 H336 H315 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H304 H315 H336 H411 |
C | CLP00/ATP01 | ||
| 601-008-00-2 | heptane;
n-heptane [1] 2,4-dimethylpentane [2] 2,2,3-trimethylbutane [3] 3,3-dimethylpentane [4] 2,3-dimethylpentane [5] 3-methylhexane [6] 2,2-dimethylpentane [7] 2-methylhexane [8] 3-ethylpentane [9] isoheptane [10] |
heptán; n-heptán;
[1] 2,4-dimetilpentán; [2] 2,2,3-trimetilbután; [3] 3,3-dimetilpentán; [4] 2,3-dimetilpentán; [5] 3-metilhexán; [6] 2,2-dimetilpentán; [7] 2-metilhexán; [8] 3-etilpentán; [9] izoheptán; [10] |
205-563-8
[1] 203-548-0 [2] 207-346-3 [3] 209-230-8 [4] 209-280-0 [5] 209-643-3 [6] 209-680-5 [7] 209-730-6 [8] 210-529-0 [9] 250-610-8 [10] |
142-82-5
[1] 108-08-7 [2] 464-06-2 [3] 562-49-2 [4] 565-59-3 [5] 589-34-4 [6] 590-35-2 [7] 591-76-4 [8] 617-78-7 [9] 31394-54-4 [10] |
Flam.
Liq. 2 Asp. Tox. 1 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H225 H304 H336 H315 H400 H410 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H304 H315 H336 H410 |
C | CLP00/ATP01 | ||
| 601-009-00-8 | octane;
n-octane [1] 2,2,4-trimethylpentane [2] 2,3,3-trimethylpentane [3] 3,3-dimethylhexane [4] 2,2,3-trimethylpentane [5] 2,3,4-trimethylpentane [6] 3,4-dimethylhexane [7] 2,3-dimethylhexane [8] 2,4-dimethylhexane [9] 4-methylheptane [10] 3-methylheptane [11] 2,2-dimethylhexane [12] 2,5-dimethylhexane [13] 2-methylheptane [14] 2,2,3,3-tetramethylbutane [15] 3-ethyl-2-methylpentane [16] 3-ethylhexane [17] 3-ethyl-3-methylpentane [18] isooctane [19] |
oktán; n-oktán;
[1] 2,2,4-trimetilpentán; [2] 2,3,3-trimetilpentán; [3] 3,3-dimetilhexán; [4] 2,2,3-trimetilpentán; [5] 2,3,4-trimetilpentán; [6] 3,4-dimetilhexán; [7] 2,3-dimetilhexán; [8] 2,4-dimetilhexán; [9] 4-metilheptán; [10] 3-metilheptán; [11] 2,2-dimetilhexán; [12] 2,5-dimetilhexán; [13] 2-metilheptán; [14] 2,2,3,3-tetrametilbután; [15] 3-etil-2-metilpentán; [16] 3-etilhexán; [17] 3-etil-3-metilpentán; [18] izooktán; [19] |
203-892-1
[1] 208-759-1 [2] 209-207-2 [3] 209-243-9 [4] 209-266-4 [5] 209-292-6 [6] 209-504-7 [7] 209-547-1 [8] 209-649-6 [9] 209-650-1 [10] 209-660-6 [11] 209-689-4 [12] 209-745-8 [13] 209-747-9 [14] 209-855-6 [15] 210-187-2 [16] 210-621-0 [17] 213-923-0 [18] 247-861-0 [19] |
111-65-9
[1] 540-84-1 [2] 560-21-4 [3] 563-16-6 [4] 564-02-3 [5] 565-75-3 [6] 583-48-2 [7] 584-94-1 [8] 589-43-5 [9] 589-53-7 [10] 589-81-1 [11] 590-73-8 [12] 592-13-2 [13] 592-27-8 [14] 594-82-1 [15] 609-26-7 [16] 619-99-8 [17] 1067-08-9 [18] 26635-64-3 [19] |
Flam.
Liq. 2 Asp. Tox. 1 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H225 H304 H336 H315 H400 H410 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H304 H315 H336 H410 |
C | CLP00/ATP01 | ||
| 601-010-00-3 | ethylene | etilén | 200-815-3 | 74-85-1 | Flam.
Gas 1 Press. Gas STOT SE 3 |
H220 H336 |
GHS02 GHS04 GHS07 Dgr |
H220 H336 |
U | CLP00 | ||
| 601-011-00-9 | propene; propylene | propén; propilén |
204-062-1 | 115-07-1 | Flam.
Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
U | CLP00 | ||
| 601-012-00-4 | but-1-ene
[1] butene, mixed-1-and-2-isomers [2] 2-methylpropene [3] (Z)-but-2-ene [4] (E)-but-2-ene [5] |
but-1-én;
[1] butén, - 1- és - 2-vegyes izomerek; [2] 2-metilpropén; [3] (Z)-but-2-én; [4] (E)-but-2-én [5] |
203-449-2
[1] 203-452-9 [2] 204-066-3 [3] 209-673-7 [4] 210-855-3 [5] |
106-98-9
[1] 107-01-7 [2] 115-11-7 [3] 590-18-1 [4] 624-64-6 [5] |
Flam.
Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
C U | CLP00 | ||
| 601-013-00-X | 1,3-butadiene; buta-1,3-diene | 1,3-butadién; buta-1,3-dién |
203-450-8 | 106-99-0 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS02 GHS04 GHS08 Dgr |
H220 H350 H340 |
D U | CLP00 | ||
| 601-014-00-5 | isoprene (stabilised); 2-methyl-1,3-butadiene | izoprén
(stabilizált) 2-metil-1,3-butadién |
201-143-3 | 78-79-5 | Flam.
Liq. 1 Carc. 1B Muta. 2 Aquatic Chronic 3 |
H224 H350 H341 H412 |
GHS02 GHS08 Dgr |
H224 H350 H341 H412 |
D | CLP00 | ||
| 601-015-00-0 | acetylene; ethyne | acetylene; ethyne |
200-816-9 | 74-86-2 | Flam.
Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
U | CLP00 | ||
| 601-016-00-6 | cyclopropane | ciklopropán | 200-847-8 | 75-19-4 | Flam.
Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
U | CLP00 | ||
| 601-017-00-1 | cyclohexane | ciklohexán | 203-806-2 | 110-82-7 | Flam.
Liq. 2 Asp. Tox. 1 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H225 H304 H336 H315 H400 H410 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H304 H315 H336 H410 |
CLP00 | |||
| 601-018-00-7 | methylcyclohexane | metilciklohexán | 203-624-3 | 108-87-2 | Flam.
Liq. 2 Asp. Tox. 1 STOT SE 3 Skin Irrit. 2 Aquatic Chronic 2 |
H225 H304 H336 H315 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H304 H315 H336 H411 |
CLP00 | |||
| 601-019-00-2 | 1,4-dimethylcyclohexane | 1,4-dimetilciklohexán | 209-663-2 | 589-90-2 | Flam.
Liq. 2 Asp. Tox. 1 STOT SE 3 Skin Irrit. 2 Aquatic Chronic 2 |
H225 H304 H336 H315 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H304 H315 H336 H411 |
CLP00 | |||
| 601-020-00-8 | benzene | benzol | 200-753-7 | 71-43-2 | Flam.
Liq. 2 Carc. 1A Muta. 1B Asp. Tox. 1 STOT RE 1 Skin Irrit. 2 Eye Irrit. 2 |
H225 H350 H340 H304 H372 ** H315 H319 |
GHS02 GHS08 GHS07 Dgr |
H225 H350 H340 H372 ** H304 H319 H315 |
E | CLP00 | ||
| 601-021-00-3 | toluene | toluol | 203-625-9 | 108-88-3 | Flam.
Liq. 2 Repr. 2 Asp. Tox. 1 STOT SE 3 STOT RE 2 * Skin Irrit. 2 |
H225 H361d *** H304 H336 H373 ** H315 |
GHS02 GHS08 GHS07 Dgr |
H225 H361d *** H304 H373 ** H315 H336 |
CLP00 | |||
| 601-022-00-9 | o-xylene
[1] p-xylene [2] m-xylene [3] xylene [4] |
o-xilol;
[1] p-xilol; [2] m-xilol; [3] xilol [4] |
202-422-2
[1] 203-396-5 [2] 203-576-3 [3] 215-535-7 [4] |
95-47-6
[1] 106-42-3 [2] 108-38-3 [3] 1330-20-7 [4] |
Flam.
Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 |
H226 H332 H312 H315 |
GHS02 GHS07 Wng |
H226 H332 H312 H315 |
* |
C | CLP00 | |
| 601-023-00-4 | ethylbenzene | etilbenzol | 202-849-4 | 100-41-4 | Flam.
Liq. 2 Acute Tox. 4 * Asp. Tox. 1 STOT RE 2 |
H225 H332 H304 H373 (hearing organs) |
GHS02 GHS07 GHS08 Dgr |
H225 H332 H373 (hearing organs) H304 |
CLP00/ATP06 | |||
| 601-024-00-X | cumene
[1] propylbenzene [2] |
kumol;
[1] propilbenzol [2] |
202-704-5
[1] 203-132-9 [2] |
98-82-8
[1] 103-65-1 [2] |
Flam.
Liq. 3 Asp. Tox. 1 STOT SE 3 Aquatic Chronic 2 |
H226 H304 H335 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H226 H304 H335 H411 |
C | CLP00 | ||
| 601-025-00-5 | mesitylene; 1,3,5-trimethylbenzene | mezitilén; 1,3,5-trimetilbenzol |
203-604-4 | 108-67-8 | Flam.
Liq. 3 STOT SE 3 Aquatic Chronic 2 |
H226 H335 H411 |
GHS02 GHS07 GHS09 Wng |
H226 H335 H411 |
STOT
SE 3; H335: C ≥ 25 % |
CLP00 | ||
| 601-026-00-0 | styrene | sztirol | 202-851-5 | 100-42-5 | Flam.
Liq. 3 Repr. 2 Acute Tox. 4 * STOT RE 1 Skin Irrit. 2 Eye Irrit. 2 |
H226 H361d H332 H372 (hearing organs) H315 H319 |
GHS02 GHS08 GHS07 Dgr |
H226 H332 H315 H319 H361d H372 (hearing organs) |
* |
D | CLP00/ATP06 | |
| 601-027-00-6 | 2-phenylpropene; α-methylstyrene | 2-fenilpropén; α-metilsztirol |
202-705-0 | 98-83-9 | Flam.
Liq. 3 STOT SE 3 Eye Irrit. 2 Aquatic Chronic 2 |
H226 H335 H319 H411 |
GHS02 GHS07 GHS09 Wng |
H226 H319 H335 H411 |
STOT
SE 3; H335: C ≥ 25 % |
CLP00 | ||
| 601-028-00-1 | 2-methylstyrene; 2-vinyltoluene | 2-metilsztirol; 2-viniltoluol |
210-256-7 | 611-15-4 | Acute
Tox. 4 * Aquatic Chronic 2 |
H332 H411 |
GHS07 GHS09 Wng |
H332 H411 |
CLP00 | |||
| 601-029-00-7 | dipentene;
limonene [1] (R)-p-mentha-1,8-diene; d-limonene [2] (S)-p-mentha-1,8-diene; l-limonene [3] trans-1-methyl-4-(1-methylvinyl)cyclohexene [4] (±)-1-methyl-4-(1-methylvinyl)cyclohexene [5] |
dipentén;
limonén; [1] (R)-p-menta-1,8-dién; d-limonén; [2] (S)-p-menta-1,8-dién; l-limonén;[3] transz-1-metil-4-(1-metilvinil)ciklohexén; [4] (±)-1-metil-4-(1-metilvinil)ciklohexén [5] |
205-341-0
[1] 227-813-5 [2] 227-815-6 [3] 229-977-3 [4] 231-732-0 [5] |
138-86-3
[1] 5989-27-5 [2] 5989-54-8 [3] 6876-12-6 [4] 7705-14-8 [5] |
Flam.
Liq. 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H315 H317 H400 H410 |
GHS02 GHS07 GHS09 Wng |
H226 H315 H317 H410 |
C | CLP00 | ||
| 601-030-00-2 | cyclopentane | ciklopentán | 206-016-6 | 287-92-3 | Flam.
Liq. 2 Aquatic Chronic 3 |
H225 H412 |
GHS02 Dgr |
H225 H412 |
CLP00 | |||
| 601-031-00-8 | 2,4,4-trimethylpent-1-ene | 2,4,4-trimetilpent-1-én | 203-486-4 | 107-39-1 | Flam.
Liq. 2 Aquatic Chronic 2 |
H225 H411 |
GHS02 GHS09 Dgr |
H225 H411 |
CLP00 | |||
| 601-032-00-3 | benzo[a]pyrene; benzo[def]chrysene | benzo[a]pirén; benzo[def]krizén |
200-028-5 | 50-32-8 | Carc.
1B Muta. 1B Repr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H340 H360FD H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H340 H360FD H317 H410 |
Carc.
1B; H350: C ≥ 0,01 % |
CLP00 | ||
| 601-033-00-9 | benz[a]anthracene | benz[a]antracén | 200-280-6 | 56-55-3 | Carc.
1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H400 H410 |
GHS08 GHS09 Dgr |
H350 H410 |
M=100 |
CLP00/ATP01 | ||
| 601-034-00-4 | benz[e]acephenanthrylene | benz[e]acefenantrilén | 205-911-9 | 205-99-2 | Carc.
1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H400 H410 |
GHS08 GHS09 Dgr |
H350 H410 |
CLP00 | |||
| 601-035-00-X | benzo[j]fluoranthene | benzo[j]fluorantén | 205-910-3 | 205-82-3 | Carc.
1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H400 H410 |
GHS08 GHS09 Dgr |
H350 H410 |
CLP00 | |||
| 601-036-00-5 | benzo[k]fluoranthene | benzo[k]fluorantén | 205-916-6 | 207-08-9 | Carc.
1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H400 H410 |
GHS08 GHS09 Dgr |
H350 H410 |
CLP00 | |||
| 601-037-00-0 | n-hexane | n-hexán | 203-777-6 | 110-54-3 | Flam.
Liq. 2 Repr. 2 Asp. Tox. 1 STOT SE 3 STOT RE 2 * Skin Irrit. 2 Aquatic Chronic 2 |
H225 H361f *** H304 H336 H373 ** H315 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H361f *** H304 H373 ** H315 H336 H411 |
STOT
RE 2; H373: C ≥ 5 % |
CLP00 | ||
| 601-041-00-2 | dibenz[a,h]anthracene | dibenz[a,h]antracén | 200-181-8 | 53-70-3 | Carc.
1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H400 H410 |
GHS08 GHS09 Dgr |
H350 H410 |
Carc.
1B; H350: C ≥ 0,01 % M=100 |
CLP00/ATP01 | ||
| 601-042-00-8 | biphenyl; diphenyl | bifenil; difenil |
202-163-5 | 92-52-4 | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H335 H315 H319 H400 H410 |
GHS07 GHS09 Wng |
H319 H335 H315 H410 |
CLP00 | |||
| 601-043-00-3 | 1,2,4-trimethylbenzene | 1,2,4-trimetilbenzol | 202-436-9 | 95-63-6 | Flam.
Liq. 3 Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Aquatic Chronic 2 |
H226 H332 H335 H315 H319 H411 |
GHS02 GHS07 GHS09 Wng |
H226 H332 H319 H335 H315 H411 |
CLP00 | |||
| 601-044-00-9 | 3a,4,7,7a-tetrahydro-4,7-methanoindene | 3a,4,7,7a-tetrahidro-4,7-metanoindén | 201-052-9 | 77-73-6 | Flam.
Liq. 2 Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Aquatic Chronic 2 |
H225 H332 H302 H335 H315 H319 H411 |
GHS02 GHS07 GHS09 Dgr |
H225 H332 H302 H319 H335 H315 H411 |
CLP00 | |||
| 601-045-00-4 | 1,2,3,4-tetrahydronaphthalene | 1,2,3,4-tetrahidronaftalin | 204-340-2 | 119-64-2 | Skin
Irrit. 2 Eye Irrit. 2 Aquatic Chronic 2 |
H315 H319 H411 |
GHS07 GHS09 Wng |
H319 H315 H411 |
EUH019 |
CLP00 | ||
| 601-046-00-X | 7-methylocta-1,6-diene | 7-metilokta-1,6-dién | 404-210-7 | 42152-47-6 | Flam.
Liq. 3 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H400 H410 |
GHS02 GHS09 Wng |
H226 H410 |
CLP00 | |||
| 601-047-00-5 | m-mentha-1,3(8)-diene | m-menta-1,3(8)-dién | 404-150-1 | 17092-80-7 | Skin
Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
CLP00 | |||
| 601-048-00-0 | chrysene | krizén | 205-923-4 | 218-01-9 | Carc.
1B Muta. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H341 H400 H410 |
GHS08 GHS09 Dgr |
H350 H341 H410 |
CLP00 | |||
| 601-049-00-6 | benzo[e]pyrene | benzo[e]pirén | 205-892-7 | 192-97-2 | Carc.
1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H400 H410 |
GHS08 GHS09 Dgr |
H350 H410 |
CLP00 | |||
| 601-051-00-7 | 4-phenylbut-1-ene | 4-fenilbut-1-én | 405-980-7 | 768-56-9 | Skin
Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
CLP00 | |||
| 601-052-00-2 | naphthalene | naftalin | 202-049-5 | 91-20-3 | Carc.
2 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H400 H410 |
GHS07 GHS08 GHS09 Wng |
H351 H302 H410 |
CLP00 | |||
| 601-053-00-8 | nonylphenol
[1] 4-nonylphenol, branched [2] |
nonilfenol;
[1] 4-nonilfenol, elágazó [2] |
246-672-0
[1] 284-325-5 [2] |
25154-52-3
[1] 84852-15-3 [2] |
Repr.
2 Acute Tox. 4 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H361fd H302 H314 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H361fd H302 H314 H410 |
CLP00 | |||
| 601-054-00-3 | reaction mass of isomers of: dibenzylbenzene; dibenzyl(methyl)benzene; dibenzyl(dimethyl)benzene; dibenzyl(trimethyl)benzene | dibenzilbenzol; dibenzil(metil)benzol; dibenzil(dimetil)benzol; dibenzil(trimetil)benzol izomereinek keveréke |
405-570-8 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | ||||
| 601-055-00-9 | reaction mass of isomers of: mono-(2-tetradecyl)naphthalenes; di-(2-tetradecyl)naphthalenes; tri-(2-tetradecyl)naphthalenes | mono-(2-tetradecil)naftalinok; di-(2-tetradecil)naftalinok; tri-(2-tetradecil)naftalinok izomereinek keveréke |
410-190-0 | 132983-41-6 | Eye
Irrit. 2 Aquatic Chronic 4 |
H319 H413 |
GHS07 Wng |
H319 H413 |
CLP00 | |||
| 601-056-00-4 | reaction mass of isomers of: methyldiphenylmethane; dimethyldiphenylmethane | metildifenilmetán; dimetildifenilmetán izomereinek keveréke |
405-470-4 | 73807-39-3 | Skin
Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
CLP00 | |||
| 601-057-00-X | N-dodecyl-[3-(4-(dimethylamino)benzamido)-propyl]dimethylammonium tosylate | N-dodecil-[3-(4-(dimetilamino)benzamido)-propil]dimetilammónium-tozilát | 421-130-8 | 156679-41-3 | Eye
Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H410 |
CLP00 | |||
| 601-058-00-5 | di-L-para-menthene | di-L-para-mentén | 417-870-6 | 83648-84-4 | Skin
Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H315 H317 H410 |
CLP00 | |||
| 601-059-00-0 | methyl 2-benzylidene-3-oxobutyrate | metil 2-benzilidén-3-oxobutirát | 420-940-9 | 15768-07-7 | Skin
Irrit. 2 Eye Irrit. 2 Aquatic Chronic 2 |
H315 H319 H411 |
GHS07 GHS09 Wng |
H319 H315 H411 |
CLP00 | |||
| 601-060-00-6 | 1,2-bis[4-fluoro-6-{}{4-sulfo-5-(2-(4-sulfonaphtalene-3-ylazo)-1-hydroxy-3,6-disulfo-8-aminonaphthalene-7-ylazo)phenylamino}}-1,3,5-triazin-2ylamino]ethane; x-sodium, y-potassium salts x = 7,755 y = 0,245 | 1,2-bisz[4-fluor-6-{4-szulfo-5-(2-
(4-szulfonaftalin-3-ilazo)-1-hidroxi-3,6-diszulfo-8-aminonaftalin-7-ilazo)fenilamino}-1,3,5-triazin-2-ilamino]etán; x-nátrium sók, y-kálium sók, x = 7,755 y = 0,245 |
417-610-1 | 155522-09-1 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 601-061-00-1 | (ethyl-1,2-ethanediyl)[-2-[[[(2-hydroxyethyl)methylamino]acetyl]-propyl]ω-(nonylphenoxy)poly]oxy-(methyl-1,2-ethanediyl) | (etil-1,2-etándiil)[-2-[[[(2- hidroxietil)metil amino]acetil]-propil]ω-(nonilfenoxi)poli]oxi-(metil-1,2- etándiil) | 418-960-8 | Skin
Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H314 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H411 |
CLP00 | ||||
| 601-062-00-7 | reaction mass of: branched triacontane; branched dotriacontane; branched tetratriacontane; branched hexatriacontane | elágazó
láncú triakontán; elágazó láncú dotriakontán; elágazó láncú tetratriakontán; elágazó láncú hexatriakontán keveréke |
417-030-9 | 151006-59-6 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 601-063-00-2 | reaction mass of isomers of branched tetracosane | elágazó láncú tetrakozán izomereinek keveréke | 417-060-2 | 151006-61-0 | Acute
Tox. 4 * Aquatic Chronic 4 |
H332 H413 |
GHS07 Wng |
H332 H413 |
CLP00 | |||
| 601-065-00-3 | reaction mass of: (1'α,3'α,6'α)-2,2,3',7',7'-pentamethylspiro(1,3-dioxane-5,2'-norcarane); (1'α,3'β,6'α)-2,2,3',7',7'-pentamethylspiro(1,3-dioxane-5,2'-norcarane) | (1'α,
3'α, 6'α)-2,2,3' ,7',
7'-pentametilspiro(1,3-dioxán-5,2'-norkarán); (1'α, 3'β, 6'α)-2,2,3', 7', 7'-pentametilspiro(1,3-dioxán-5,2'-norkarán) keveréke |
416-930-9 | - | Skin
Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
CLP00/ATP01 | |||
| 601-066-00-9 | 1-(4-(trans-4-heptylcyclohexyl)phenyl)ethanone | 1-(4-(transz-4-heptil-ciklohexil)fenil)etanon | 426-820-2 | 78531-60-9 | Skin
Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
CLP00 | |||
| 601-067-00-4 | triethyl arsenate | trietil-arzenát | 427-700-2 | 15606-95-8 | Carc.
1A Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H331 H301 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H301 H410 |
CLP00 | |||
| 601-068-00-X | 1,2-diacetoxybut-3-ene | 1,2-diacetoxibut-3-én | 421-720-5 | 18085-02-4 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 601-069-00-5 | 2-ethyl-1-(2-(1,3-dioxanyl)ethyl)-pyridinium bromide | 2-etil-1-(2-(1,3-dioxanil)etil)piridínium-bromid | 422-680-1 | 287933-44-2 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | ||||
| 601-070-00-0 | reaction mass of: branched icosane; branched docosane; branched tetracosane | elágazó
láncú ikozán; elágazó láncú dokozán; elágazó láncú tetrakozán keveréke |
417-050-8 | 151006-58-5 | Acute
Tox. 4 * Aquatic Chronic 4 |
H332 H413 |
GHS07 Wng |
H332 H413 |
ATP01 | |||
| 601-071-00-6 | 1-dimethoxymethyl-2-nitro-benzene | 1-dimetoximetil-2-nitro-benzol | 423-830-9 | 20627-73-0 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | |||
| 601-072-00-1 | reaction mass of: 1-(4-isopropylphenyl)-1-phenylethane; 1-(3-isopropylphenyl)-1-phenylethane; 1-(2-isopropylphenyl)-1-phenylethane | 1-(4-izopropilfenil)-1-feniletán; 1-(3-izopropilfenil)-1-feniletán; 1-(2-izopropilfenil)-1-feniletán keveréke |
430-690-2 | 52783-21-8 | Skin
Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
ATP01 | |||
| 601-073-00-7 | 1-bromo-3,5-difluorobenzene | 1-bróm-3,5-difluorbenzol | 416-710-2 | 461-96-1 | Flam.
Liq. 3 Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H302 H373 ** H315 H317 H400 H410 |
GHS02 GHS08 GHS07 GHS09 Wng |
H226 H302 H373 ** H315 H317 H410 |
CLP00 | |||
| 601-074-00-2 | reaction mass of: 4-(2,2,3-trimethylcyclopent-3-en-1-yl)-1-methyl-2-oxabicyclo[2.2.2]octane; 1-(2,2,3-trimethylcyclopent-3-en-1-yl)-5-methyl-6-oxabicyclo[3.2.1]octane; spiro[cyclohex-3-en-1-yl-[(4,5,6,6a-tetrahydro-3,6',6',6'a-tetramethyl)-1,3'(3'aH)-[2H]cyclopenta[b]furan]; spiro[cyclohex-3-en-1-yl-[4,5,6,6a-tetrahydro-4,6',6',6'a-tetramethyl)-1,3'(3'aH)-[2H]cyclopenta[b]]furan] | a
következő anyagok keveréke: 4-(2,2,3-trimetilciklopent-3-én-1-il)-1- metil-2-oxabiciklo[2.2.2]oktán; 1-(2,2,3-trimetilciklopent-3-én-1-il)-5-metil-6-oxabiciklo[3.2.1]oktán; spiro[ciklohex-3-én-1-il- [(4,5,6,6a-tetrahidro-3,6',6',6'a- tetrametil)-1,3'(3'aH)- [2H]ciklopenta[b]furán]; spiro[ciklohex-3-én-1-il- [4,5,6,6a-tetrahidro-4,6',6',6'a- tetrametil)-1,3'(3'aH)- [2H]ciklopenta[b]]furán] |
422-040-1 | Skin
Irrit. 2 Eye Irrit. 2 Aquatic Chronic 2 |
H315 H319 H411 |
GHS07 GHS09 Wng |
H319 H315 H411 |
CLP00 | ||||
| 601-075-00-8 | 4,4'-bis(N-carbamoyl-4-methylbenzenesulfonamide)diphenylmethane | 4,4'-bisz(N-karbamoil-4-metilbenzolszulfonamid)difenilmetán | 418-770-5 | 151882-81-4 | Carc.
2 |
H351 |
GHS08 Wng |
H351 |
ATP01 | |||
| 601-076-00-3 | ethynyl cyclopropane | etinil-ciklopropán | 425-430-1 | 6746-94-7 | Flam.
Liq. 2 Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H225 H315 H318 H412 |
GHS02 GHS05 Dgr |
H225 H315 H318 H412 |
ATP01 | |||
| 601-077-00-9 | reaction mass of: 1-heptyl-4-ethyl-2,6,7-trioxabicyclo[2.2.2]octane; 1-nonyl-4-ethyl-2,6,7-trioxabicyclo[2.2.2]octane | 1-heptil-4-etil-2,6,7-trioxabiciklo[2.2.2]oktán; 1-nonil-4-etil-2,6,7-trioxabiciklo[2.2.2]oktán keveréke |
426-510-7 | 196965-91-0 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
ATP01 | |||
| 601-078-00-4 | reaction mass of: 1,7-dimethyl-2-[(3-methylbicyclo[2.2.1]hept-2-yl)methyl]bicyclo[2.2.1]heptane; 2,3-dimethyl-2-[(3-methylbicyclo[2.2.1]hept-2-yl)methyl]bicyclo[2.2.1]heptane | 1,7-dimetil-2-[(3-metilbiciklo[2.2.1]hept-2-il)metil]biciklo[2.2.1]heptán; 2,3-dimetil-2-[(3-metilbiciklo[2.2.1]hept-2- il)metil]biciklo[2.2.1]heptán keveréke |
427-040-5 | - | Skin
Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
ATP01 | |||
| 601-079-00-X | reaction mass of: trans-trans-cyclohexadeca-1,9-diene; cis-trans-cyclohexadeca-1,9-diene | transz-transz-ciklohexadeka-1,9-dién; cisz-transz-ciklohexadeka-1,9-dién keveréke | 429-620-3 | - | Skin
Irrit. 2 Skin Sens. 1 Aquatic Chronic 4 |
H315 H317 H413 |
GHS07 Wng |
H315 H317 H413 |
ATP01 | |||
| 601-080-00-5 | reaction mass of: sec-butylphenyl(phenyl)methane, mixed isomers; 1-(sec-butylphenyl(phenyl)-2-phenylethane, mixed isomers; 1-(sec-butylphenyl-1-phenylethane, mixed isomers | szek-butilfenil(fenil)metán,
kevert izomerek; 1-(szek-butilfenil(fenil)-2-feniletán, kevert izomerek; 1-(szek-butilfenil-1-feniletán, kevert izomerek keveréke |
431-100-6 | - | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
ATP01 | |||
| 601-081-00-0 | cyclohexadeca-1,9-diene | ciklohexadeka-1,9-dién | 431-730-1 | 4277-06-9 | Skin
Irrit. 2 Skin Sens. 1 Aquatic Chronic 4 |
H315 H317 H413 |
GHS07 Wng |
H315 H317 H413 |
ATP01 | |||
| 601-082-00-6 | reaction mass of: endo-2-methyl-exo-3-methyl-exo-2-[(exo-3-methylbicyclo[2.2.1]hept-exo-2-yl)methyl]bicyclo[2.2.1]heptane; exo-2-methyl-exo-3-methyl-endo-2-[(endo-3-methylbicyclo[2.2.1]hept-exo-2-yl)methyl]bicyclo[2.2.1]heptane | endo-2-metil-exo-3-metil-exo-2-[(exo-3-metil
biciklo[2.2.1]hept-exo-2-il)metil]biciklo[2.2.1]heptán; exo-2-metil-exo-3-metil-endo-2-[(endo-3-metilbiciklo[2.2.1]hept-exo-2- yl)metil]biciklo[2.2.1]heptán keveréke |
434-420-4 | - | Skin
Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H400 H410 |
GHS05 GHS09 Dgr |
H315 H318 H410 |
ATP01 | |||
| 601-083-00-1 | 5-endo-hexyl-bicyclo[2.2.1]hept-2-ene | 5-endo-hexil-biciklo[2.2.1]hept-2-én | 435-000-3 | 22094-83-3 | Asp.
Tox. 1 Skin Irrit. 2 Aquatic Chronic 4 |
H304 H315 H413 |
GHS08 GHS07 Dgr |
H304 H315 H413 |
ATP01 | |||
| 601-084-00-7 | reaction mass of: 5-endo-butyl-bicyclo[2.2.1]hept-2-ene; 5-exo-butyl-bicyclo[2.2.1]hept-2-ene (80:20) | 5-endo-butil-
biciklo[2.2.1]hept-2-én; 5-exo-butil-biciklo[2.2.1]hept-2-én (80:20) keveréke |
435-180-3 | - | Asp.
Tox. 1 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H304 H315 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H304 H315 H410 |
ATP01 | |||
| 601-085-00-2 | isopentane; 2-methylbutane | izopentán; 2-metilbután |
201-142-8 | 78-78-4 | Flam.
Liq. 1 Asp. Tox. 1 STOT SE 3 Aquatic Chronic 2 |
H224 H304 H336 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H224 H304 H336 H411 |
EUH066 |
CLP00 | ||
| 601-087-00-3 | 2,4,4-trimethylpentene | 2,4,4,-trimetil-pentén | 246-690-9 | 25167-70-8 | Flam.
Liq. 2 Asp. Tox. 1 STOT SE 3 |
H225 H304 H336 |
GHS02 GHS07 GHS08 Dgr |
H225 H336 H304 |
D | ATP05 | ||
| 601-088-00-9 | 4-vinylcyclohexene | 4-vinil-ciklohexán | 202-848-9 | 100-40-3 | Carc.
2 |
H351 |
GHS08 Wng |
H351 |
ATP06 | |||
| 601-089-00-4 | muscalure; cis-tricos-9-ene | muszkalur; cisz-trikoz-9-én |
248-505-7 | 27519-02-4 | Skin
Sens. 1B |
H317 |
GHS07 Wng |
H317 |
ATP06 | |||
| 601-090-00-X | benzo[rst]pentaphene | #HIÁNYZIK | 205-877-5 | 189-55-9 | Carc.
1B Muta. 2 |
H350 H341 |
GHS08 Dgr |
H341 H350 |
ATP14 | |||
| 601-091-00-5 | dibenzo[b,def]chrysene; dibenzo[a,h]pyrene |
#HIÁNYZIK | 205-878-0 | 189-64-0 | Carc.
1B Muta. 2 |
H350 H341 |
GHS08 Dgr |
H341 H350 |
ATP14 | |||
| 601-092-00-0 | dibenzo[def,p]chrysene; dibenzo[a,l]pyrene | #HIÁNYZIK | 205-886-4 | 191-30-0 | Carc.
1B Muta. 2 |
H350 H341 |
GHS08 Dgr |
H341 H350 |
Carc.
1B; H350: C ≥ 0,001 % |
ATP15 | ||
| 602-001-00-7 | chloromethane; methyl chloride | klór-metán; metil-klorid |
200-817-4 | 74-87-3 | Flam.
Gas 1 Press. Gas Carc. 2 STOT RE 2 * |
H220 H351 H373 ** |
GHS02 GHS04 GHS08 Dgr |
H220 H351 H373 ** |
U | CLP00 | ||
| 602-002-00-2 | bromomethane; methylbromide | brómmetán; metil-bromid |
200-813-2 | 74-83-9 | Press.
Gas Muta. 2 Acute Tox. 3 * Acute Tox. 3 * STOT SE 3 STOT RE 2 * Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 Ozone 1 |
H341 H331 H301 H335 H373 H315 H319 H400 H420 |
GHS04 GHS06 GHS08 GHS09 Dgr |
H331 H301 H315 H319 H341 H335 H373 ** H400 H420 |
U | CLP00/ATP02 | ||
| 602-003-00-8 | dibromomethane | dibrómmetán | 200-824-2 | 74-95-3 | Acute
Tox. 4 * Aquatic Chronic 3 |
H332 H412 |
GHS07 Wng |
H332 H412 |
* |
CLP00 | ||
| 602-004-00-3 | dichloromethane; methylene chloride | diklór-metán; metilén-klorid |
200-838-9 | 75-09-2 | Carc.
2 |
H351 |
GHS08 Wng |
H351 |
CLP00 | |||
| 602-005-00-9 | methyl iodide; iodomethane | metil-jodid; jódmetán |
200-819-5 | 74-88-4 | Carc.
2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 |
H351 H331 H301 H312 H335 H315 |
GHS06 GHS08 Dgr |
H351 H312 H331 H301 H335 H315 |
CLP00 | |||
| 602-006-00-4 | chloroform; trichloromethane | kloroform; triklór-metán |
200-663-8 | 67-66-3 | Carc.
2 Repr. 2 Acute Tox. 3 Acute Tox. 4 STOT RE 1 Skin Irrit. 2 Eye Irrit. 2 |
H351 H361d H331 H302 H372 H315 H319 |
GHS06 GHS08 Dgr |
H302 H331 H315 H319 H351 H361d H372 |
CLP00/ATP05 | |||
| 602-007-00-X | bromoform; tribromomethane | bromoform; tribrómmetán |
200-854-6 | 75-25-2 | Acute
Tox. 3 * Acute Tox. 4 * Skin Irrit. 2 Eye Irrit. 2 Aquatic Chronic 2 |
H331 H302 H315 H319 H411 |
GHS06 GHS09 Dgr |
H331 H302 H319 H315 H411 |
CLP00/ATP01 | |||
| 602-008-00-5 | carbon tetrachloride; tetrachloromethane | szén-tetraklorid; tetraklór-metán |
200-262-8 | 56-23-5 | Carc.
2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Aquatic Chronic 3 Ozone 1 |
H351 H331 H311 H301 H372 ** H412 H420 |
GHS06 GHS08 Dgr |
H351 H331 H311 H301 H372 ** H412 H420 |
* STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: ,2 % ≤ C < 1 % |
CLP00/ATP02 | ||
| 602-009-00-0 | chloroethane | klóretán | 200-830-5 | 75-00-3 | Flam.
Gas 1 Press. Gas Carc. 2 Aquatic Chronic 3 |
H220 H351 H412 |
GHS02 GHS04 GHS08 Dgr |
H220 H351 H412 |
U | CLP00 | ||
| 602-010-00-6 | 1,2-dibromoethane | 1,2-dibrómetán | 203-444-5 | 106-93-4 | Carc.
1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Aquatic Chronic 2 |
H350 H331 H311 H301 H335 H315 H319 H411 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H311 H301 H319 H335 H315 H411 |
* |
CLP00 | ||
| 602-011-00-1 | 1,1-dichloroethane | 1,1-diklóretán | 200-863-5 | 75-34-3 | Flam.
Liq. 2 Acute Tox. 4 * STOT SE 3 Eye Irrit. 2 Aquatic Chronic 3 |
H225 H302 H335 H319 H412 |
GHS02 GHS07 Dgr |
H225 H302 H319 H335 H412 |
* |
CLP00 | ||
| 602-012-00-7 | 1,2-dichloroethane; ethylene dichloride | 1,2-diklór-etán; etilén-diklorid |
203-458-1 | 107-06-2 | Flam.
Liq. 2 Carc. 1B Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 |
H225 H350 H302 H335 H315 H319 |
GHS02 GHS08 GHS07 Dgr |
H225 H350 H302 H319 H335 H315 |
CLP00 | |||
| 602-013-00-2 | 1,1,1-trichloroethane; methyl chloroform | 1,1,1-triklór-etán; metil-kloroform |
200-756-3 | 71-55-6 | Acute
Tox. 4 * Ozone 1 |
H332 H420 |
GHS07 Wng |
H332 H420 |
F | CLP00/ATP02 | ||
| 602-014-00-8 | 1,1,2-trichloroethane | 1,1,2-triklór-etán | 201-166-9 | 79-00-5 | Carc.
2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H351 H332 H312 H302 |
GHS08 GHS07 Wng |
H351 H332 H312 H302 |
EUH066 |
* |
CLP00 | |
| 602-015-00-3 | 1,1,2,2-tetrachloroethane | 1,1,2,2-tetraklóretán | 201-197-8 | 79-34-5 | Acute
Tox. 1 Acute Tox. 2 * Aquatic Chronic 2 |
H310 H330 H411 |
GHS06 GHS09 Dgr |
H330 H310 H411 |
CLP00 | |||
| 602-016-00-9 | 1,1,2,2-tetrabromoethane | 1,1,2,2-tetrabrómetán | 201-191-5 | 79-27-6 | Acute
Tox. 2 * Eye Irrit. 2 Aquatic Chronic 3 |
H330 H319 H412 |
GHS06 Dgr |
H330 H319 H412 |
CLP00 | |||
| 602-017-00-4 | pentachloroethane | pentaklóretán | 200-925-1 | 76-01-7 | Carc.
2 STOT RE 1 Aquatic Chronic 2 |
H351 H372 ** H411 |
GHS08 GHS09 Dgr |
H351 H372 ** H411 |
STOT
RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,2 % ≤ C < 1 % |
CLP00 | ||
| 602-018-00-X | 1-chloropropane
[1] 2-chloropropane [2] |
1-klórpropán;
[1] 2-klórpropán [2] |
208-749-7
[1] 200-858-8 [2] |
540-54-5
[1] 75-29-6 [2] |
Flam.
Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H225 H332 H312 H302 |
GHS02 GHS07 Dgr |
H225 H332 H312 H302 |
C | CLP00 | ||
| 602-019-00-5 | 1-bromopropane; n-propyl bromide | 1-brómpropán; n-propil-bromid |
203-445-0 | 106-94-5 | Flam.
Liq. 2 Repr. 1B STOT SE 3 STOT SE 3 STOT RE 2 * Skin Irrit. 2 Eye Irrit. 2 |
H225 H360FD H335 H336 H373 ** H315 H319 |
GHS02 GHS08 GHS07 Dgr |
H225 H360FD H373 ** H319 H335 H315 H336 |
CLP00 | |||
| 602-020-00-0 | 1,2-dichloropropane; propylene dichloride | 1,2-diklórpropán; propilén-diklorid |
201-152-2 | 78-87-5 | Flam.
Liq. 2 Carc. 1B Acute Tox. 4 * Acute Tox. 4 * |
H225 H350 H332 H302 |
GHS02 GHS07 GHS08 Dgr |
H225 H332 H302 H350 |
CLP00/ATP09 | |||
| 602-021-00-6 | 1,2-dibromo-3-chloropropane | 1,2-dibróm-3-klórpropán | 202-479-3 | 96-12-8 | Carc.
1B Muta. 1B Repr. 1A Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 3 |
H350 H340 H360F *** H301 H373 ** H412 |
GHS06 GHS08 Dgr |
H350 H340 H360F *** H301 H373 ** H412 |
CLP00 | |||
| 602-022-00-1 | 1-chloropentane
[1] 2-chloropentane [2] 3-chloropentane [3] |
1-klórpentán;
[1] 2-klórpentán; [2] 3-klórpentán [3] |
208-846-4
[1] 210-885-7 [2] 210-467-4 [3] |
543-59-9
[1] 625-29-6 [2] 616-20-6 [3] |
Flam.
Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H225 H332 H312 H302 |
GHS02 GHS07 Dgr |
H225 H332 H312 H302 |
C | CLP00 | ||
| 602-023-00-7 | vinyl chloride; chloroethylene | vinil-klorid; klór-etilén |
200-831-0 | 75-01-4 | Flam.
Gas 1 Press. Gas Carc. 1A |
H220 H350 |
GHS02 GHS08 Dgr |
H220 H350 |
D U | CLP00 | ||
| 602-024-00-2 | bromoethylene | brómetilén | 209-800-6 | 593-60-2 | Flam.
Gas 1 Press. Gas Carc. 1B |
H220 H350 |
GHS02 GHS08 Dgr |
H220 H350 |
U | CLP00 | ||
| 602-025-00-8 | 1,1-dichloroethylene; vinylidene chloride | 1,1-diklóretilén; vinilidén-klorid |
200-864-0 | 75-35-4 | Flam.
Liq. 1 Carc. 2 Acute Tox. 4 * |
H224 H351 H332 |
GHS02 GHS08 GHS07 Dgr |
H224 H351 H332 |
* |
D | CLP00 | |
| 602-026-00-3 | 1,2-dichloroethylene
[1] cis-dichloroethylene [2] trans-dichloroethylene [3] |
1,2-diklóretilén;
[1] cisz-diklóretilén; [2] transz-diklóretilén[3] |
208-750-2
[1] 205-859-7 [2] 205-860-2 [3] |
540-59-0
[1] 156-59-2 [2] 156-60-5 [3] |
Flam.
Liq. 2 Acute Tox. 4 * Aquatic Chronic 3 |
H225 H332 H412 |
GHS02 GHS07 Dgr |
H225 H332 H412 |
* |
C | CLP00 | |
| 602-027-00-9 | trichloroethylene; trichloroethene | triklóretilén; triklóretén |
201-167-4 | 79-01-6 | Carc.
1B Muta. 2 STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Aquatic Chronic 3 |
H350 H341 H336 H315 H319 H412 |
GHS08 GHS07 Dgr |
H350 H341 H319 H315 H336 H412 |
CLP00 | |||
| 602-028-00-4 | tetrachloroethylene | tetraklóretilén | 204-825-9 | 127-18-4 | Carc.
2 Aquatic Chronic 2 |
H351 H411 |
GHS08 GHS09 Wng |
H351 H411 |
CLP00 | |||
| 602-029-00-X | 3-chloropropene; allyl chloride | 3-klórpropén; allil-klorid |
203-457-6 | 107-05-1 | Flam.
Liq. 2 Carc. 2 Muta. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 STOT RE 2 * Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 |
H225 H351 H341 H332 H312 H302 H335 H373 ** H315 H319 H400 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H351 H341 H332 H312 H302 H373 ** H319 H335 H315 H400 |
D | CLP00 | ||
| 602-030-00-5 | 1,3-dichloropropene
[1] (Z)-1,3-dichloropropene [2] |
1,3-diklórpropén;
[1] (Z)-1,3-diklórpropén [2] |
208-826-5
[1] 233-195-8 [2] |
542-75-6
[1] 10061-01-5 [2] |
Flam.
Liq. 3 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * Asp. Tox. 1 STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H311 H301 H332 H304 H335 H315 H319 H317 H400 H410 |
GHS02 GHS06 GHS08 GHS09 Dgr |
H226 H311 H301 H332 H304 H319 H335 H315 H317 H410 |
C D | CLP00/ATP01 | ||
| 602-031-00-0 | 1,1-dichloropropene | 1,1-diklórpropén | 209-253-3 | 563-58-6 | Flam.
Liq. 2 Acute Tox. 3 * Aquatic Chronic 3 |
H225 H301 H412 |
GHS02 GHS06 Dgr |
H225 H301 H412 |
CLP00 | |||
| 602-032-00-6 | 3-chloro-2-methylpropene | 3-klór-2-metilpropén | 209-251-2 | 563-47-3 | Flam.
Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H225 H332 H302 H314 H317 H411 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H225 H332 H302 H314 H317 H411 |
CLP00 | |||
| 602-033-00-1 | chlorobenzene | klór-benzol | 203-628-5 | 108-90-7 | Flam.
Liq. 3 Acute Tox. 4 Skin Irrit. 2 Aquatic Chronic 2 |
H226 H332 H315 H411 |
GHS02 GHS07 GHS09 Wng |
H226 H332 H315 H411 |
CLP00/ATP09 | |||
| 602-034-00-7 | 1,2-dichlorobenzene; o-dichlorobenzene | 1,2-diklórbenzol; o-diklórbenzol |
202-425-9 | 95-50-1 | Acute
Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H335 H315 H319 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H335 H315 H410 |
* |
CLP00 | ||
| 602-035-00-2 | 1,4-dichlorobenzene; p-dichlorobenzene | 1,4-diklórbenzol; p-diklórbenzol |
203-400-5 | 106-46-7 | Carc.
2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H319 H400 H410 |
GHS08 GHS09 Wng |
H351 H319 H410 |
CLP00 | |||
| 602-036-00-8 | chloroprene (stabilised); 2-chlorobuta-1,3-diene (stabilised) | kloroprén
(stabilizált); 2-klórbuta-1,3-dién (stabilizált) |
204-818-0 | 126-99-8 | Flam.
Liq. 2 Carc. 1B Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 STOT RE 2 * Skin Irrit. 2 Eye Irrit. 2 |
H225 H350 H332 H302 H335 H373 ** H315 H319 |
GHS02 GHS08 GHS07 Dgr |
H225 H350 H332 H302 H373 ** H319 H335 H315 |
D | CLP00 | ||
| 602-037-00-3 | α-chlorotoluene; benzyl chloride | α-klórtoluol; benzil-klorid |
202-853-6 | 100-44-7 | Carc.
1B Acute Tox. 3 * Acute Tox. 4 * STOT SE 3 STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 |
H350 H331 H302 H335 H373 ** H315 H318 |
GHS06 GHS08 GHS05 Dgr |
H350 H331 H302 H373 ** H335 H315 H318 |
CLP00 | |||
| 602-038-00-9 | α,α,α-trichlorotoluene; benzotrichloride | α,
α, α-triklórtoluol; benzotriklorid |
202-634-5 | 98-07-7 | Carc.
1B Acute Tox. 3 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 |
H350 H331 H302 H335 H315 H318 |
GHS06 GHS08 GHS05 Dgr |
H350 H331 H302 H335 H315 H318 |
CLP00 | |||
| 602-039-00-4 | polychlorobiphenyls; PCB | poliklórbifenilek; PCB |
215-648-1 | 1336-36-3 | STOT
RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H373
** H400 H410 |
GHS08 GHS09 Wng |
H373
** H410 |
STOT
RE 2; H373: C ≥ 0,005 % |
C | CLP00 | |
| 602-040-00-X | 2-chlorotoluene
[1] 3-chlorotoluene [2] 4-chlorotoluene [3] chlorotoluene [4] |
2-klórtoluol;
[1] 3-klórtoluol; [2] 4-klórtoluol;[3] klórtoluol [4] |
202-424-3
[1] 203-580-5 [2] 203-397-0 [3] 246-698-2 [4] |
95-49-8
[1] 108-41-8 [2] 106-43-4 [3] 25168-05-2 [4] |
Acute
Tox. 4 * Aquatic Chronic 2 |
H332 H411 |
GHS07 GHS09 Wng |
H332 H411 |
C | CLP00 | ||
| 602-041-00-5 | penthachloronaphthalene | pentaklórnaftalin | 215-320-8 | 1321-64-8 | Acute
Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H315 H319 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H319 H315 H410 |
C | CLP00 | ||
| 602-042-00-0 | 1,2,3,4,5,6-hexachlorcyclohexanes with the exception of those specified elsewhere in this Annex | 1,2,3,4,5,6-hexaklórciklohexánok (kivéve az e mellékletben külön szereplőket) | Carc.
2 Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H301 H312 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H301 H312 H410 |
A C | CLP00 | ||||
| 602-043-00-6 | lindane (ISO); γ-HCH or γ-BHC; γ-1,2,3,4,5,6-hexachlorocyclohexane | lindán
(ISO); γ-HCH vagy γ-BHC; γ-1,2,3,4,5,6-hexaklórciklohexán |
200-401-2 | 58-89-9 | Lact. Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H362 H301 H332 H312 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H301 H332 H312 H373 ** H362 H410 |
M=10 |
CLP00 | ||
| 602-044-00-1 | camphechlor (ISO); toxaphene | kamfeklór
(ISO); toxafén |
232-283-3 | 8001-35-2 | Carc.
2 Acute Tox. 3 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H301 H312 H335 H315 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H301 H312 H335 H315 H410 |
CLP00 | |||
| 602-045-00-7 | DDT (ISO); clofenotane (INN); dicophane; 1,1,1-trichloro-2,2-bis(4-chlorophenyl)ethane; dichlorodiphenyltrichloroethane | DDT
(ISO); klofenotán (INN); dikofán; 1,1,1-triklór-2,2-bisz(4-klórfenil)etán; diklordifeniltriklóretán |
200-024-3 | 50-29-3 | Carc.
2 Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H301 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H301 H372 ** H410 |
CLP00 | |||
| 602-046-00-2 | heptachlor (ISO); 1,4,5,6,7,8,8-heptachloro-3a,4,7,7a-tetrahydro-4,7-methanoindene | heptaklór
(ISO); 1,4,5,6,7,8,8-heptaklór-3a,4,7,7a-tetrahidro-4,7-metanoindén |
200-962-3 | 76-44-8 | Carc.
2 Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H311 H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H311 H301 H373 ** H410 |
CLP00 | |||
| 602-047-00-8 | chlordane (ISO); 1,2,4,5,6,7,8,8-octachloro-3a,4,7,7a-tetrahydro-4,7-methanoindan | klórdán
(ISO); 1,2,4,5,6,7,8,8-oktaklór-3a,4,7,7a-tetrahidro-4,7-metanoindán |
200-349-0 | 57-74-9 | Carc.
2 Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H312 H302 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H312 H302 H410 |
CLP00 | |||
| 602-048-00-3 | aldrin (ISO) | aldrin (ISO) | 206-215-8 | 309-00-2 | Carc.
2 Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H311 H301 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H311 H301 H372 ** H410 |
CLP00 | |||
| 602-049-00-9 | dieldrin (ISO) | dieldrin (ISO) | 200-484-5 | 60-57-1 | Carc.
2 Acute Tox. 1 Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H310 H301 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H310 H301 H372 ** H410 |
CLP00 | |||
| 602-050-00-4 | isodrin; (1α,4α,4aβ,5β,8β,8aβ)-1,2,3,4,10,10-hexachloro-1,4,4a,5,8,8a-hexahydro-1,4:5,8-dimethanonaphthalene | izodrin; (1α,4α,4aβ,5β,8β,8aβ)-1,2,3,4,10,10-hexaklór-1,4,4a,5,8,8a-hexahidro-1,4:5,8-dimetanonaftalin |
207-366-2 | 465-73-6 | Acute
Tox. 1 Acute Tox. 2 * Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H330 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H300 H410 |
M=100 |
CLP00/ATP01 | ||
| 602-051-00-X | endrin (ISO); 1,2,3,4,10,10-hexachloro-6,7-epoxy-1,4,4a,5,6,7,8,8a-octahydro-1,4:5,8-dimethanonaphthalene | endrin
(ISO); 1,2,3,4,10,10-hexaklór-6,7-epoxi-1,4,4a,5,6,7,8,8a-oktahidro-1,4:5,8-dimetanonaftalin |
200-775-7 | 72-20-8 | Acute
Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
CLP00 | |||
| 602-052-00-5 | endosulfan (ISO); 1,2,3,4,7,7-hexachloro-8,9,10-trinorborn-2-en-5,6-ylenedimethylene sulfite; 1,4,5,6,7,7-hexachloro-8,9,10-trinorborn-5-en-2,3-ylenedimethylene sulfite | endoszulfán
(ISO); 1,2,3,4,7,7-hexaklór-8,9,10-trinorborn-2-én-5,6-ilén-dimetilén-szulfit; 1,4,5,6,7,7-hexaklór-8,9,10-trinorborn-5-én-2,3-ilén-dimetilén-szulfit |
204-079-4 | 115-29-7 | Acute
Tox. 2 * Acute Tox. 2 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H312 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H312 H410 |
CLP00/ATP01 | |||
| 602-053-00-0 | isobenzan (ISO); 1,3,4,5,6,7,8,8-octachloro-1,3,3a,4,7,7a-hexahydro-4,7-methanoisobenzofuran | izobenzán
(ISO); 1,3,4,5,6,7,8,8-oktaklór-1,3,3a,4,7,7a-hexahidro-4,7-metanoizobenzofurán |
206-045-4 | 297-78-9 | Acute
Tox. 1 Acute Tox. 2 * Aquatic Acute 1 |
H310 H300 H400 |
GHS06 GHS09 Dgr |
H310 H300 H400 |
CLP00 | |||
| 602-054-00-6 | 3-iodpropene; allyl iodide | 3-jódpropén; allil-jodid |
209-130-4 | 556-56-9 | Flam.
Liq. 2 Skin Corr. 1B |
H225 H314 |
GHS02 GHS05 Dgr |
H225 H314 |
CLP00/ATP01 | |||
| 602-055-00-1 | bromoethane; ethyl bromide | bróm-etán; etil-bromid |
200-825-8 | 74-96-4 | Flam.
Liq. 2 Carc. 2 Acute Tox. 4 * Acute Tox. 4 * |
H225 H351 H332 H302 |
GHS02 GHS08 GHS07 Dgr |
H225 H351 H332 H302 |
CLP00 | |||
| 602-056-00-7 | α,α,α-trifluorotoluene; benzotrifluoride | α,
α, α-trifluortoluol; benzotrifluorid |
202-635-0 | 98-08-8 | Flam.
Liq. 2 Aquatic Chronic 2 |
H225 H411 |
GHS02 GHS09 Dgr |
H225 H411 |
CLP00 | |||
| 602-057-00-2 | α-bromotoluene; benzyl bromide | α-brómtoluol; benzil-bromid |
202-847-3 | 100-39-0 | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 |
H335 H315 H319 |
GHS07 Wng |
H319 H335 H315 |
CLP00 | |||
| 602-058-00-8 | α,α-dichlorotoluene; benzylidene chloride; benzal chloride | α,
α-diklórtoluol; benzilidén-klorid; benzálklorid |
202-709-2 | 98-87-3 | Carc.
2 Acute Tox. 3 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 |
H351 H331 H302 H335 H315 H318 |
GHS06 GHS08 GHS05 Dgr |
H351 H331 H302 H335 H315 H318 |
CLP00 | |||
| 602-059-00-3 | 1-chlorobutane; butyl chloride | 1-klórbután; butil-klorid |
203-696-6 | 109-69-3 | Flam.
Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
CLP00 | |||
| 602-060-00-9 | bromobenzene | brómbenzol | 203-623-8 | 108-86-1 | Flam.
Liq. 3 Skin Irrit. 2 Aquatic Chronic 2 |
H226 H315 H411 |
GHS02 GHS07 GHS09 Wng |
H226 H315 H411 |
CLP00 | |||
| 602-061-00-4 | hexafluoropropene; hexafluoropropylene | hexafluorpropén; hexafluorpropilén |
204-127-4 | 116-15-4 | Press.
Gas Acute Tox. 4 * STOT SE 3 |
H332 H335 |
GHS07 Wng |
H332 H335 |
U | CLP00 | ||
| 602-062-00-X | 1,2,3-trichloropropane | 1,2,3-triklórpropán | 202-486-1 | 96-18-4 | Carc.
1B Repr. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H350 H360F *** H332 H312 H302 |
GHS08 GHS07 Dgr |
H350 H360F *** H332 H312 H302 |
D | CLP00 | ||
| 602-063-00-5 | heptachlor epoxide; 2,3-epoxy-1,4,5,6,7,8,8-heptachloro-3a,4,7,7a-tetrahydro-4,7-methanoindane | heptaklór-epoxid; 2,3-epoxi-1,4,5,6,7,8,8- heptaklór-3a,4,7,7a-tetrahidro-4,7-metanoindán |
213-831-0 | 1024-57-3 | Carc.
2 Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H301 H373 ** H410 |
CLP00 | |||
| 602-064-00-0 | 1,3-dichloro-2-propanol | 1,3-diklórpropán-2-ol | 202-491-9 | 96-23-1 | Carc.
1B Acute Tox. 3 * Acute Tox. 4 * |
H350 H301 H312 |
GHS06 GHS08 Dgr |
H350 H301 H312 |
CLP00 | |||
| 602-065-00-6 | hexachlorobenzene | hexaklórbenzol | 204-273-9 | 118-74-1 | Carc.
1B STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H372 ** H400 H410 |
GHS08 GHS09 Dgr |
H350 H372 ** H410 |
CLP00 | |||
| 602-066-00-1 | tetrachloro-p-benzoquinone | tetraklór-p-benzokinon | 204-274-4 | 118-75-2 | Skin
Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H319 H400 H410 |
GHS07 GHS09 Wng |
H319 H315 H410 |
CLP00 | |||
| 602-067-00-7 | 1,3-dichlorbenzene | 1,3-diklórbenzol | 208-792-1 | 541-73-1 | Acute
Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
CLP00 | |||
| 602-068-00-2 | ethylene bis(trichloroacetate) | etilén-bisz(triklóracetát) | 219-732-9 | 2514-53-6 | Skin
Irrit. 2 |
H315 |
GHS07 Wng |
H315 |
CLP00 | |||
| 602-069-00-8 | dichloroacetylene | diklóracetilén | 7572-29-4 | Unst.
Expl. Carc. 2 STOT RE 2 * |
H200 H351 H373 ** |
GHS01 GHS08 Wng |
H200 H351 H373 ** |
CLP00 | ||||
| 602-070-00-3 | 3-chloro-4,5,α, α,α-pentafluorotoluene | 3-klór-4,5,α, α, α-pentafluortoluol | 401-930-3 | 77227-99-7 | Flam.
Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 |
H226 H332 H302 H400 |
GHS02 GHS07 GHS09 Wng |
H226 H332 H302 H400 |
CLP00 | |||
| 602-071-00-9 | bromobenzylbromotoluene, reaction mass of isomers | brómbenzilbrómtoluol, izomerkeverék | 402-210-1 | 99688-47-8 | STOT
RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373
** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H373
** H317 H410 |
CLP00 | |||
| 602-072-00-4 | dichloro [(dichlorophenyl)methyl]methylbenzene, reaction mass of isomers; (dichlorophenyl)(dichlorotolyl)methane, reaction mass of isomers (IUPAC) | diklór[(diklórfenil)metil]metilbenzol, izomerkeverék; (diklórfenil)(diklórtolil)metán, izomerkeverék (IUPAC) | 278-404-3 | 76253-60-6 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 602-073-00-X | 1,4-dichlorobut-2-ene | 1,4-diklórbut-2-én | 212-121-8 | 764-41-0 | Carc.
1B Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H330 H311 H301 H314 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H350 H330 H311 H301 H314 H410 |
Carc.
1B; H350: C ≥ 0,01 % STOT SE 3; H335: C ≥ 5 % |
CLP00 | ||
| 602-074-00-5 | pentachlorobenzene | pentaklórbenzol | 210-172-0 | 608-93-5 | Flam.
Sol. 1 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H228 H302 H400 H410 |
GHS02 GHS07 GHS09 Dgr |
H228 H302 H410 |
T | CLP00 | ||
| 602-075-00-0 | 4,4,5,5-tetrachloro-1,3-dioxolan-2-one | 4,4,5,5-tetraklór-1,3-dioxolán-2-on | 404-060-2 | 22432-68-4 | Acute
Tox. 2 * Acute Tox. 4 * Skin Corr. 1B |
H330 H302 H314 |
GHS06 GHS05 Dgr |
H330 H302 H314 |
CLP00 | |||
| 602-076-00-6 | 2,3,4-trichlorobut-1-ene | 2,3,4-triklórbut-1-én | 219-397-9 | 2431-50-7 | Carc.
2 Acute Tox. 3 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H331 H302 H335 H315 H319 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H331 H302 H319 H335 H315 H410 |
Carc.
2; H351: C ≥ 0,1 % |
CLP00/ATP01 | ||
| 602-077-00-1 | dodecachloropentacyclo[5.2.1.02,6.03,9.05,8]decane; mirex | dodekaklór-pentaciklo[5.2.1.02,6.03,9.05,8]dekán; mirex |
219-196-6 | 2385-85-5 | Carc.
2 Repr. 2 Lact. Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H361fd H362 H312 H302 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H361fd H362 H312 H302 H410 |
CLP00 | |||
| 602-078-00-7 | hexachlorocyclopentadiene | hexaklórciklopentadién | 201-029-3 | 77-47-4 | Acute
Tox. 2 * Acute Tox. 3 * Acute Tox. 4 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H330 H311 H302 H314 H400 H410 |
GHS06 GHS05 GHS09 Dgr |
H330 H311 H302 H314 H410 |
CLP00 | |||
| 602-079-00-2 | 2,3-dichloropropene; 2,3-dichloropropylene | 2,3-diklór-propén; 2,3-diklórpropilén |
201-153-8 | 78-88-6 | Flam.
Liq. 2 Muta. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H225 H341 H332 H312 H302 H335 H315 H318 H412 |
GHS02 GHS08 GHS05 GHS07 Dgr |
H225 H341 H332 H312 H302 H335 H315 H318 H412 |
CLP00 | |||
| 602-080-00-8 | alkanes, C10-13, chloro; chlorinated paraffins, C10-13 | alkánok,
C10-13, klór-; klórozott paraffinok, C10-13 |
287-476-5 | 85535-84-8 | Carc.
2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
EUH066 |
CLP00/ATP01 | ||
| 602-081-00-3 | 2-chloro-4,5-difluorobenzoic acid | 2-klór-4,5-difluorbenzoesav | 405-380-5 | Acute
Tox. 4 * Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 |
H312 H302 H318 H317 |
GHS05 GHS07 Dgr |
H312 H302 H318 H317 |
CLP00 | ||||
| 602-082-00-9 | 2,2,6,6-tetrakis(bromomethyl)-4-oxaheptane-1,7-diol | 2,2,6,6-tetrakisz(brómmetil)-4-oxaheptán-1,7-diol | 408-020-5 | 109678-33-3 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | |||
| 602-083-00-4 | diphenyl ether, pentabromo derivative pentabromodiphenyl ether | difenil-éter, pentabróm származék pentabrómdifenil-éter | 251-084-2 | 32534-81-9 | Lact. STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H362 H373 ** H400 H410 |
GHS08 GHS09 Wng |
H373
** H362 H410 |
CLP00 | |||
| 602-084-00-X | 1,1-dichloro-1-fluoroethane | 1,1-diklór-1-fluoretán | 404-080-1 | 1717-00-6 | Aquatic
Chronic 3 Ozone 1 |
H412 H420 |
GHS07 Wng |
H412 H420 |
CLP00/ATP02 | |||
| 602-085-00-5 | 2-bromopropane | 2-brómpropán | 200-855-1 | 75-26-3 | Flam.
Liq. 2 Repr. 1A STOT RE 2 * |
H225 H360F *** H373 ** |
GHS02 GHS08 Dgr |
H225 H360F *** H373 ** |
EUH066 |
CLP00 | ||
| 602-086-00-0 | trifluoroiodomethane; trifluoromethyl iodide | trifluorjódmetán; trifluormetil-jodid |
219-014-5 | 2314-97-8 | Muta.
2 |
H341 |
GHS08 Wng |
H341 |
CLP00 | |||
| 602-087-00-6 | 1,2,4-trichlorobenzene | 1,2,4-triklórbenzol | 204-428-0 | 120-82-1 | Acute
Tox. 4 * Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H315 H410 |
CLP00 | |||
| 602-088-00-1 | 2,3-dibromopropan-1-ol; 2,3-dibromo-1-propanol | 2,3-dibrómpropán-1-ol; 2,3-dibróm-1-propanol |
202-480-9 | 96-13-9 | Carc.
1B Repr. 2 Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 3 |
H350 H361f *** H311 H332 H302 H412 |
GHS08 GHS07 Dgr |
H350 H361f *** H311 H332 H302 H412 |
CLP00 | |||
| 602-089-00-7 | 4-bromo-2-chlorofluorobenzene | 4-bróm-2-klórfluorbenzol | 405-580-2 | 60811-21-4 | Acute
Tox. 4 * Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H315 H410 |
CLP00 | |||
| 602-090-00-2 | 1-allyl-3-chloro-4-fluorobenzene | 1-allil-3-klór-4-fluorbenzol | 406-630-6 | 121626-73-1 | Skin
Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
CLP00 | |||
| 602-091-00-8 | 1,3-dichloro-4-fluorobenzene | 1,3-diklór-4-fluorbenzol | 406-160-1 | 1435-48-9 | Acute
Tox. 4 * STOT RE 2 * Skin Irrit. 2 Aquatic Chronic 2 |
H302 H373 ** H315 H411 |
GHS08 GHS07 Wng |
H302 H373 ** H315 H411 |
CLP00 | |||
| 602-092-00-3 | 1-bromo-3,4,5-trifluorobenzene | 1-bróm-3,4,5-trifluorbenzol | 418-480-9 | 138526-69-9 | Flam.
Liq. 3 Carc. 2 Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 2 |
H226 H351 H315 H318 H411 |
GHS02 GHS08 GHS05 GHS09 Dgr |
H226 H351 H315 H318 H411 |
CLP00 | |||
| 602-093-00-9 | α, α,α,4-tetrachlorotoluene; p-chlorobenzotrichloride | α,
α, α,4-tetraklórtoluol; p-klórbenzotriklorid |
226-009-1 | 5216-25-1 | Carc.
1B Repr. 2 Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 STOT RE 1 Skin Irrit. 2 |
H350 H361f *** H312 H302 H335 H372 ** H315 |
GHS08 GHS07 Dgr |
H350 H361f *** H372 ** H312 H302 H335 H315 |
CLP00 | |||
| 602-094-00-4 | diphenylether; octabromo derivate | difeniléter; oktabróm-származék |
251-087-9 | 32536-52-0 | Repr.
1B |
H360Df |
GHS08 Dgr |
H360Df |
CLP00 | |||
| 602-095-00-X | alkanes, C14-17, chloro; chlorinated paraffins, C14-17 | alkánok,
C14-17, klór-; klórozott paraffinok, C14-17 |
287-477-0 | 85535-85-9 | Lact. Aquatic Acute 1 Aquatic Chronic 1 |
H362 H400 H410 |
GHS09 Wng |
H362 H410 |
EUH066 |
ATP01 | ||
| 602-096-00-5 | malachite
green hydrochloride [1] malachite green oxalate [2] |
malachitzöld-hidroklorid;
[1] malachitzöld-oxalát [2] |
209-322-8
[1] 219-441-7 [2] |
569-64-2
[1] 2437-29-8 [2] |
Repr.
2 Acute Tox. 4 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361d
*** H302 H318 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H361d
*** H302 H318 H410 |
CLP00 | |||
| 602-097-00-0 | 1-bromo-9-(4,4,5,5,5-pentafluoropentylthio)nonane | 1-bróm-9-(4,4,5,5,5-pentafluorpentiltio)nonán | 422-850-5 | 148757-89-5 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
CLP00 | |||
| 602-098-00-6 | 2-(3-bromophenoxy)tetrahydro-2H-pyran | 2-(3-brómfenoxi)tetrahidro-2H-pirán | 429-030-6 | 57999-49-2 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
ATP01 | |||
| 602-099-00-1 | 3-(4-fluorophenyl)-2-methylpropionylchloride | 3-(4-fluorfenil)-2-metilpropionil-klorid | 426-370-7 | - | Acute
Tox. 4 * Skin Corr. 1A Aquatic Chronic 3 |
H302 H314 H412 |
GHS05 GHS07 Dgr |
H314 H302 H412 |
EUH014 EUH029 |
ATP01 | ||
| 602-100-00-5 | reaction mass of: (R,R)-1,1,1,2,2,3,4,5,5,5-decafluoropentane; (S,S)-1,1,1,2,2,3,4,5,5,5-decafluoropentane | (R,
R)-1,1,1,2,2,3,4,5,5,5-dekafluor-pentán; (S, S)-1,1,1,2,2,3,4,5,5,5-dekafluor-pentán keveréke |
420-640-8 | - | Aquatic
Chronic 3 |
H412 |
- |
H412 |
ATP01 | |||
| 602-101-00-0 | 2-chloro-4-fluoro-5-nitrophenyl (isobutyl)carbonate | 2-klór-4-fluor-5-nitrofenil-(izobutil)karbonát | 427-020-6 | 141772-37-4 | STOT
RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373
** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H373
** H317 H410 |
ATP01 | |||
| 602-102-00-6 | 1,1,1,3,3-pentafluorobutane | 1,1,1,3,3-pentafluorbután | 430-250-1 | 406-58-6 | Flam.
Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
ATP01 | |||
| 602-103-00-1 | 1-(chlorophenylmethyl)-2-methylbenzene | 1-(klórfenilmetil)-2-metilbenzol | 431-450-1 | 41870-52-4 | Skin
Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
ATP01 | |||
| 602-104-00-7 | 1,1,2,2,3,3,4-heptafluorocyclopentane | 1,1,2,2,3,3,4-heptafluorciklopentán | 430-710-1 | 15290-77-4 | Aquatic
Chronic 3 |
H412 |
H412 |
ATP01 | ||||
| 602-105-00-2 | sodium 1,1,2,2,3,3,4,4,4-nonafluoro-1-butanesulfinate | nátrium 1,1,2,2,3,3,4,4,4-nonafluoro-1-butánszulfinát | 422-100-7 | 102061-82-5 | Eye
Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
ATP01 | |||
| 602-106-00-8 | 2-bromo-4,6-difluoroaniline | 2-bróm-4,6-difluoroanilin | 429-430-0 | 444-14-4 | Acute
Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
ATP01 | |||
| 602-107-00-3 | 3,3,4,4-tetrafluoro-4-iodo-1-butene | 3,3,4,4-tetrafluor-4-jód-1-butén | 439-500-2 | 33831-83-3 | Acute
Tox. 4 * Skin Irrit. 2 Aquatic Chronic 2 |
H302 H315 H411 |
GHS07 GHS09 Wng |
H302 H315 H411 |
ATP01 | |||
| 602-108-00-9 | (2,3,5,6-tetrafluorophenyl)methanol | (2,3,5,6-tetrafluorofenil)metanol | 443-840-7 | 4084-38-2 | Acute
Tox. 4 * Eye Irrit. 2 Skin Sens. 1 |
H302 H319 H317 |
GHS07 Wng |
H302 H319 H317 |
ATP01 | |||
| 602-109-00-4 | Hexabromocyclododecane
[1] 1,2,5,6,9,10-hexabromocyclododecane [2] |
hexabróm-ciklododekán
[1] 1,2,5,6,9,10-hexabróm-ciklododekán [2] |
247-148-4
[1] 221-695-9 [2] |
25637-99-4
[1] 3194-55-6 [2] |
Repr.
2 Lact. |
H361 H362 |
GHS08 Wng |
H361 H362 |
ATP03 | |||
| 603-001-00-X | methanol | metanol | 200-659-6 | 67-56-1 | Flam.
Liq. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT SE 1 |
H225 H331 H311 H301 H370 ** |
GHS02 GHS06 GHS08 Dgr |
H225 H331 H311 H301 H370 ** |
* STOT SE 1; H370: C ≥ 10 % STOT SE 2; H371: 3 % ≤ C < 10 % |
CLP00 | ||
| 603-002-00-5 | ethanol; ethyl alcohol | etanol; etil-alkohol |
200-578-6 | 64-17-5 | Flam.
Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
CLP00 | |||
| 603-003-00-0 | propan-1-ol; n-propanol | propán-1-ol; n-propanol |
200-746-9 | 71-23-8 | Flam.
Liq. 2 STOT SE 3 Eye Dam. 1 |
H225 H336 H318 |
GHS02 GHS05 GHS07 Dgr |
H225 H318 H336 |
CLP00 | |||
| 603-004-00-6 | butan-1-ol; n-butanol | bután-1-ol; n-butanol |
200-751-6 | 71-36-3 | Flam.
Liq. 3 Acute Tox. 4 * STOT SE 3 STOT SE 3 Skin Irrit. 2 Eye Dam. 1 |
H226 H302 H335 H336 H315 H318 |
GHS02 GHS05 GHS07 Dgr |
H226 H302 H335 H315 H318 H336 |
CLP00 | |||
| 603-005-00-1 | 2-methylpropan-2-ol; tert-butyl alcohol | 2-metilpropán-2-ol; terc-butil-alkohol |
200-889-7 | 75-65-0 | Flam.
Liq. 2 Acute Tox. 4 * STOT SE 3 Eye Irrit. 2 |
H225 H332 H335 H319 |
GHS02 GHS07 Dgr |
H225 H332 H319 H335 |
CLP00/ATP01 | |||
| 603-006-00-7 | pentanol isomers, with the exception fo those specified elsewhere in this Annex | pentanol izomerei (kivéve az e mellékletben külön szereplőket) | 250-378-8 | Flam.
Liq. 3 Acute Tox. 4 * STOT SE 3 |
H226 H332 H335 |
GHS02 GHS07 Wng |
H226 H332 H335 |
EUH066 |
C | CLP00 | ||
| 603-007-00-2 | 2-methylbutan-2-ol; tert-pentanol | 2-metilbután-2-ol; terc-pentanol |
200-908-9 | 75-85-4 | Flam.
Liq. 2 Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 |
H225 H332 H335 H315 |
GHS02 GHS07 Dgr |
H225 H332 H335 H315 |
CLP00 | |||
| 603-008-00-8 | 4-methylpentan-2-ol; methyl isobutyl carbinol | 4-metilpentán-2-ol; metil-izobutil-karbinol |
203-551-7 | 108-11-2 | Flam.
Liq. 3 STOT SE 3 |
H226 H335 |
GHS02 GHS07 Wng |
H226 H335 |
STOT
SE 3; H335: C ≥ 25 % |
CLP00 | ||
| 603-009-00-3 | cyclohexanol | ciklohexanol | 203-630-6 | 108-93-0 | Acute
Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 |
H332 H302 H335 H315 |
GHS07 Wng |
H332 H302 H335 H315 |
CLP00 | |||
| 603-010-00-9 | 2-methylcyclohexanol,
mixed isomers [1] cis-2-methylcyclohexanol [2] trans-2-methylcyclohexanol [3] |
2-metilciklohexanol,
kevert izomerek; [1] cisz-2-metilciklohexanol; [2] transz-2-metilciklohexanol [3] |
209-512-0
[1] 231-187-9 [2] 231-186-3 [3] |
583-59-5
[1] 7443-70-1 [2] 7443-52-9 [3] |
Acute
Tox. 4 * |
H332 |
GHS07 Wng |
H332 |
C | CLP00 | ||
| 603-011-00-4 | 2-methoxyethanol; ethylene glycol monomethyl ether | 2-metoxietanol; etilén-glikol-monometil-éter |
203-713-7 | 109-86-4 | Flam.
Liq. 3 Repr. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H226 H360FD H332 H312 H302 |
GHS02 GHS08 GHS07 Dgr |
H226 H360FD H332 H312 H302 |
CLP00 | |||
| 603-012-00-X | 2-ethoxyethanol; ethylene glycol monoethyl ether | 2-etoxi-etanol; etilén-glikol-monoetil-éter |
203-804-1 | 110-80-5 | Flam.
Liq. 3 Repr. 1B Acute Tox. 3 Acute Tox. 4 |
H226 H360FD H331 H302 |
GHS02 GHS08 GHS06 Dgr |
H226 H360FD H331 H302 |
CLP00/ATP03 | |||
| 603-013-00-5 | 2-isopropoxyethanol; ethylene glycol monoisopropyl ether | 2-izopropoxietanol; etilén-glikol-monoizopropil-éter |
203-685-6 | 109-59-1 | Acute
Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 |
H332 H312 H319 |
GHS07 Wng |
H332 H312 H319 |
CLP00 | |||
| 603-014-00-0 | 2-butoxyethanol; ethylene glycol monobutyl ether | 2-butoxietanol; etilén-glikol-monobutil-éter; butil-celloszolv |
203-905-0 | 111-76-2 | Acute
Tox. 4 * Acute Tox. 4 Skin Irrit. 2 Eye Irrit. 2 |
H332 H302 H315 H319 |
GHS07 Wng |
H332 H302 H315 H319 |
Oral:
ATE = 1200 mg/kg |
CLP00/ATP15 | ||
| 603-015-00-6 | allyl alcohol | allil-alkohol | 203-470-7 | 107-18-6 | Flam.
Liq. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 |
H225 H331 H311 H301 H335 H315 H319 H400 |
GHS02 GHS06 GHS09 Dgr |
H225 H331 H311 H301 H319 H335 H315 H400 |
CLP00 | |||
| 603-016-00-1 | 4-hydroxy-4-methylpentan-2-one; diacetone alcohol | 4-hidroxi-4-metilpentán-2-on; diaceton-alkohol |
204-626-7 | 123-42-2 | Eye
Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
Eye
Irrit. 2; H319: C ≥ 10 % |
CLP00 | ||
| 603-018-00-2 | furfuryl alcohol | furfuril-alkohol | 202-626-1 | 98-00-0 | Carc.
2 Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 STOT RE 2 * Eye Irrit. 2 |
H351 H331 H312 H302 H335 H373 ** H319 |
GHS06 GHS08 Dgr |
H351 H331 H312 H302 H373 ** H319 H335 |
CLP00/ATP01 | |||
| 603-019-00-8 | dimethyl ether | dimetil-éter | 204-065-8 | 115-10-6 | Flam.
Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
U | CLP00 | ||
| 603-020-00-3 | ethyl methyl ether | etil-metil-éter | 540-67-0 | Flam.
Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
U | CLP00 | |||
| 603-021-00-9 | methyl vinyl ether | metil-vinil-éter | 203-475-4 | 107-25-5 | Flam.
Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
D U | CLP00 | ||
| 603-022-00-4 | diethyl ether; ether | dietil-éter; éter |
200-467-2 | 60-29-7 | Flam.
Liq. 1 Acute Tox. 4 * STOT SE 3 |
H224 H302 H336 |
GHS02 GHS07 Dgr |
H224 H302 H336 |
EUH019 EUH066 |
CLP00 | ||
| 603-023-00-X | ethylene
oxide; oxirane |
etilén-oxid; oxirán |
200-849-9 | 75-21-8 | Flam.
Gas 1 Press. Gas Carc. 1B Muta. 1B Repr. 1B Acute Tox. 3 Acute Tox. 3 STOT SE 3 STOT SE 3 STOT RE 1 Skin Corr. 1 Eye Dam. 1 |
H220 H350 H340 H360Fd H331 H301 H335 H336 H372 (nervous system) H314 H318 |
GHS02 GHS05 GHS06 GHS08 Dgr |
H220 H331 H301 H314 H340 H350 H360Fd H335 H336 H372 (nervous system) |
Inhalation:
ATE = 700 ppmV (Gases) Oral: ATE = 100 mg/kg |
U | CLP00/ATP14 | |
| 603-024-00-5 | 1,4-dioxane | 1,4-dioxán | 204-661-8 | 123-91-1 | Flam.
Liq. 2 Carc. 2 STOT SE 3 Eye Irrit. 2 |
H225 H351 H335 H319 |
GHS02 GHS08 GHS07 Dgr |
H225 H351 H319 H335 |
EUH019 EUH066 |
D | CLP00 | |
| 603-025-00-0 | tetrahydrofuran | tetrahidrofurán | 203-726-8 | 109-99-9 | Flam.
Liq. 2 Carc. 2 STOT SE 3 Eye Irrit. 2 |
H225 H351 H335 H319 |
GHS02 GHS07 GHS08 Dgr |
H225 H351 H319 H335 |
EUH019 |
STOT
SE 3; H335: C ≥ 25 % Eye Irrit.2; H319: C ≥ 25 % |
CLP00/ATP03 | |
| 603-026-00-6 | 1-chloro-2,3-epoxypropane; epichlorhydrin | 1-klór-2,3-epoxipropán; epiklórhidrin |
203-439-8 | 106-89-8 | Flam.
Liq. 3 Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 |
H226 H350 H331 H311 H301 H314 H317 |
GHS02 GHS06 GHS08 GHS05 Dgr |
H226 H350 H331 H311 H301 H314 H317 |
* |
CLP00 | ||
| 603-027-00-1 | ethanediol; ethylene glycol | etán-diol; etilén-glikol |
203-473-3 | 107-21-1 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 603-028-00-7 | 2-chloroethanol; ethylene chlorohydrin | 2-klóretanol; etilén-klórhidrin |
203-459-7 | 107-07-3 | Acute
Tox. 1 Acute Tox. 2 * Acute Tox. 2 * |
H310 H330 H300 |
GHS06 Dgr |
H330 H310 H300 |
CLP00 | |||
| 603-029-00-2 | bis(2-chloroethyl) ether | bisz(2-klóretil)-éter | 203-870-1 | 111-44-4 | Carc.
2 Acute Tox. 1 Acute Tox. 2 * Acute Tox. 2 * |
H351 H310 H330 H300 |
GHS06 GHS08 Dgr |
H351 H330 H310 H300 |
CLP00/ATP01 | |||
| 603-030-00-8 | 2-aminoethanol; ethanolamine | 2-aminoetanol; etanolamin |
205-483-3 | 141-43-5 | Acute
Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H332 H312 H302 H314 |
GHS05 GHS07 Dgr |
H332 H312 H302 H314 |
STOT
SE 3; H335: C ≥ 5 % |
CLP00 | ||
| 603-031-00-3 | 1,2-dimethoxyethane; ethylene glycol dimethyl ether; EGDME | 1,2-dimetoxietán; etilén-glikol-dimetil-éter; EGDME |
203-794-9 | 110-71-4 | Flam.
Liq. 2 Repr. 1B Acute Tox. 4 * |
H225 H360FD H332 |
GHS02 GHS08 GHS07 Dgr |
H225 H360FD H332 |
EUH019 |
CLP00 | ||
| 603-032-00-9 | ethylene dinitrate; ethylene glycol dinitrate | etilén-dinitrát; etilén-glikol-dinitrát |
211-063-0 | 628-96-6 | Unst.
Expl. Acute Tox. 1 Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 |
H200 H310 H330 H300 H373 ** |
GHS01 GHS06 GHS08 Dgr |
H200 H330 H310 H300 H373 ** |
CLP00/ATP01 | |||
| 603-033-00-4 | oxydiethylene dinitrate; diethylene glycol dinitrate; digol dinitrate | oxidietilén-dinitrát; dietilén-glikol-dinitrát; digol-dinitrát |
211-745-8 | 693-21-0 | Acute
Tox. 1 Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 3 Unst. Expl |
H310 H330 H300 H373 ** H412 H200 |
GHS01 GHS06 GHS08 Dgr |
H200 H330 H310 H300 H373 ** H412 |
CLP00 | |||
| 603-033-01-1 | oxydiethylene dinitrate; diethylene glycol dinitrate; digol dinitrate; [>25 % phlegmatiser] | oxidietilén-dinitrát; dietilén-glikol-dinitrát; digol-dinitrát; [>25 % flegmatizálószer] |
211-745-8 | 693-21-0 | Expl.
1.1 Acute Tox. 1 Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 3 |
H201 H310 H330 H300 H373 ** H412 |
GHS01 GHS06 GHS08 Dgr |
H201 H330 H310 H300 H373 ** H412 |
CLP00 | |||
| 603-034-00-X | glycerol trinitrate; nitroglycerine | glicerin-trinitrát; nitroglicerin | 200-240-8 | 55-63-0 | Unst.
Expl. Acute Tox. 1 Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 2 |
H200 H310 H330 H300 H373 ** H411 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H200 H330 H310 H300 H373 ** H411 |
CLP00 | |||
| 603-034-01-7 | glycerol trinitrate; nitroglycerine; [>40 % phlegmatiser] | glicerin-trinitrát; nitroglicerin; [>40 % flegmatizálószer] | 200-240-8 | 55-63-0 | Expl.
1.1 Acute Tox. 1 Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 2 |
H201 H310 H330 H300 H373 ** H411 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H201 H330 H310 H300 H373 ** H411 |
CLP00 | |||
| 603-035-00-5 | pentaerythritol tetranitrate; P.E.T.N. | pentaeritritol-tetranitrát; pentaeritrit-tetranitrát; P.E.T.N. | 201-084-3 | 78-11-5 | Unst.
Expl. |
H200 |
GHS01 Dgr |
H200 |
CLP00 | |||
| 603-035-01-2 | pentaerythritol tetranitrate; pentaerythrite tetranitrate; P.E.T.N.; [>20 % phlegmatiser] | pentaeritritol-tetranitrát; pentaeritrit-tetranitrát; P.E.T.N.; [>20 % flegmatizálószer] | 201-084-3 | 78-11-5 | Expl.
1.1 |
H201 |
GHS01 Dgr |
H201 |
T | CLP00 | ||
| 603-036-00-0 | mannitol hexanitrate; nitromannite | mannitol-hexanitrát; nitromannit | 239-924-6 | 15825-70-4 | Unst.
Expl. |
H200 |
GHS01 Dgr |
H200 |
CLP00 | |||
| 603-036-01-8 | mannitol hexanitrate; nitromannite; [>40 % phlegmatiser] | mannitol-hexanitrát; nitromannit; [>40 % flegmatizálószer] | 239-924-6 | 15825-70-4 | Expl.
1.1 |
H201 |
GHS01 Dgr |
H201 |
CLP00 | |||
| 603-037-00-6 | cellulose nitrate; nitrocellulose | cellulóz-nitrát; nitrocellulóz | - | - | Expl.
1.1 |
H201 |
GHS01 Dgr |
H201 |
T | CLP00/ATP01 | ||
| 603-038-00-1 | allyl glycidyl ether; allyl 2,3-epoxypropyl ether; prop-2-en-1-yl 2,3-epoxypropyl ether | allil-glicidil-éter; allil-2,3-epoxipropil-éter; prop-2-én-1-il-2,3-epoxipropil-éter | 203-442-4 | 106-92-3 | Flam.
Liq. 3 Carc. 2 Muta. 2 Repr. 2 Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H226 H351 H341 H361f *** H332 H302 H335 H315 H318 H317 H412 |
GHS02 GHS08 GHS05 GHS07 Dgr |
H226 H351 H341 H361f *** H332 H302 H335 H315 H318 H317 H412 |
CLP00 | |||
| 603-039-00-7 | butyl glycidyl ether; butyl 2,3-epoxypropyl ether | butil-glicidil-éter; butil-2,3-epoxipropil-éter | 219-376-4 | 2426-08-6 | Flam.
Liq. 3 Carc. 2 Muta. 2 Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Sens. 1 Aquatic Chronic 3 |
H226 H351 H341 H332 H302 H335 H317 H412 |
GHS02 GHS08 GHS07 Wng |
H226 H351 H341 H332 H302 H335 H317 H412 |
CLP00 | |||
| 603-040-00-2 | sodium
methanolate; sodium methoxide [1] potassium methanolate; potassium methoxide [2] lithium methanolate; lithium methoxide [3] |
nátrium-metanolát; nátrium-metoxid; [1] kálium-metanolát; kálium-metoxid; [2] lítium-metanolát; lítium-metoxid [3] | 204-699-5
[1] 212-736-1 [2] 212-737-7 [3] |
124-41-4
[1] 865-33-8 [2] 865-34-9 [3] |
Self-heat.
1 Skin Corr. 1B |
H251 H314 |
GHS02 GHS05 Dgr |
H251 H314 |
EUH014 |
T | CLP00 | |
| 603-041-00-8 | potassium
ethanolate; potassium ethoxide [1] sodium ethanolate; sodium ethoxide [2] |
kálium-etanolát; kálium-etoxid; [1] nátrium-etanolát; nátrium-etoxid [2] | 213-029-0
[1] 205-487-5 [2] |
917-58-8
[1] 141-52-6 [2] |
Self-heat.
1 Skin Corr. 1B |
H251 H314 |
GHS02 GHS05 Dgr |
H251 H314 |
EUH014 |
T | CLP00 | |
| 603-042-00-3 | aluminium-tri-isopropoxide | alumínium-triizopropoxid | 209-090-8 | 555-31-7 | Flam.
Sol. 1 |
H228 |
GHS02 Dgr |
H228 |
T | CLP00 | ||
| 603-043-00-9 | triarimol (ISO); 2,4-dichloro-α-(pyrimidin-5-yl) benzhydryl alcohol | triarimol (ISO); 2,4-diklór-α-(pirimidin-5-il)benzhidril-alkohol | 26766-27-8 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | ||||
| 603-044-00-4 | dicofol (ISO); 2,2,2-trichloro-1,1-bis(4-chlorophenyl)ethanol | dikofol (ISO); 2,2,2-triklór-1,1-bisz(4-klórfenil)etanol | 204-082-0 | 115-32-2 | Acute
Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H315 H317 H410 |
CLP00 | |||
| 603-045-00-X | diisopropyl
ether [1] dipropyl ether [2] |
diizopropil-éter; [1] dipropil-éter [2] | 203-560-6
[1] 203-869-6 [2] |
108-20-3
[1] 111-43-3 [2] |
Flam.
Liq. 2 STOT SE 3 |
H225 H336 |
GHS02 GHS07 Dgr |
H225 H336 |
EUH019 EUH066 |
C | CLP00 | |
| 603-046-00-5 | bis(chloromethyl) ether; oxybis(chloromethane) | bisz(klórmetil)-éter; oxibisz(klórmetán) | 208-832-8 | 542-88-1 | Flam.
Liq. 2 Carc. 1A Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 4 * |
H225 H350 H330 H311 H302 |
GHS02 GHS06 GHS08 Dgr |
H225 H350 H330 H311 H302 |
Carc.
1A; H350: C ≥ 0,001 % |
CLP00/ATP01 | ||
| 603-047-00-0 | 2-dimethylaminoethanol; N,N-dimethylethanolamine | 2-dimetilaminoetanol;N,N-dimetiletanolamin | 203-542-8 | 108-01-0 | Flam.
Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H226 H332 H312 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H226 H332 H312 H302 H314 |
STOT
SE 3; H335: C ≥ 5 % |
CLP00 | ||
| 603-048-00-6 | 2-diethylaminoethanol; N,N-diethylethanolamine | 2-dietiletanolamin; N,N-dietiletanolamin | 202-845-2 | 100-37-8 | Flam.
Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H226 H332 H312 H302 H314 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H226 H332 H312 H302 H314 |
STOT
SE 3; H335: C ≥ 5 % |
CLP00 | ||
| 603-049-00-1 | chlorfenethol (ISO); 1,1-bis (4-chlorophenyl) ethanol | klórfenetol (ISO); 1,1-bisz(4-klórfenil)etanol | 201-246-3 | 80-06-8 | Acute
Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
CLP00 | |||
| 603-050-00-7 | 1-(2-Butoxypropoxy)propan-2-ol | 1-(2-butoxipropoxi)propán-2-ol | 246-011-6 | 24083-03-2 | Acute
Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
CLP00 | |||
| 603-051-00-2 | 2-ethylbutan-1-ol | 2-etilbután-1-ol | 202-621-4 | 97-95-0 | Acute
Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
CLP00 | |||
| 603-052-00-8 | 3-butoxypropan-2-ol; propylene glycol monobutyl ether | 3-butoxipropán-2-ol; propilén-glikol-monobutil-éter | 225-878-4 | 5131-66-8 | Skin
Irrit. 2 Eye Irrit. 2 |
H315 H319 |
GHS07 Wng |
H319 H315 |
CLP00 | |||
| 603-053-00-3 | 2-methylpentane-2,4-diol | 2-metilpentán-2,4-diol | 203-489-0 | 107-41-5 | Skin
Irrit. 2 Eye Irrit. 2 |
H315 H319 |
GHS07 Wng |
H319 H315 |
CLP00 | |||
| 603-054-00-9 | di-n-butyl ether; dibutyl ether | di-n-butil-éter; dibutil-éter | 205-575-3 | 142-96-1 | Flam.
Liq. 3 STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Aquatic Chronic 3 |
H226 H335 H315 H319 H412 |
GHS02 GHS07 Wng |
H226 H319 H335 H315 H412 |
STOT
SE 3; H335: C ≥ 10 % |
CLP00 | ||
| 603-055-00-4 | propylene oxide; 1,2-epoxypropane; methyloxirane | propilén-oxid; 1,2-epoxipropán; metiloxirán |
200-879-2 | 75-56-9 | Flam.
Liq. 1 Carc. 1B Muta. 1B Acute Tox. 3 Acute Tox. 3 Acute Tox. 4 STOT SE 3 Eye Irrit. 2 |
H224 H350 H340 H331 H311 H302 H335 H319 |
GHS02 GHS08 GHS06 Dgr |
H224 H331 H311 H302 H319 H340 H350 H335 |
CLP00/ATP09 | |||
| 603-056-00-X | [(p-tolyloxy)methyl]oxirane
[1] [(m-tolyloxy)methyl]oxirane [2] 2,3-epoxypropyl o-tolyl ether [3] [(tolyloxy)methyl]oxirane; cresyl glycidyl ether [4] |
[(p-toliloxi)metil]oxirán; [1] [(m-toliloxi)metil]oxirán; [2] 2,3-epoxipropil-o-toliléter; [3] [(toliloxi)metil]oxirán; krezil-glicidil-éter [4] | 218-574-8
[1] 218-575-3 [2] 218-645-3 [3] 247-711-4 [4] |
2186-24-5
[1] 2186-25-6 [2] 2210-79-9 [3] 26447-14-3 [4] |
Muta.
2 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H341 H315 H317 H411 |
GHS08 GHS07 GHS09 Wng |
H341 H315 H317 H411 |
C | CLP00 | ||
| 603-057-00-5 | benzyl alcohol | benzil-alkohol | 202-859-9 | 100-51-6 | Acute
Tox. 4 * Acute Tox. 4 * |
H332 H302 |
GHS07 Wng |
H332 H302 |
CLP00 | |||
| 603-058-00-0 | 1,3-propylene oxide | 1,3-propilén-oxid; 1,3-epoxipropán | 207-964-3 | 503-30-0 | Flam.
Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H225 H332 H312 H302 |
GHS02 GHS07 Dgr |
H225 H332 H312 H302 |
CLP00 | |||
| 603-059-00-6 | hexan-1-ol | hexán-1-ol | 203-852-3 | 111-27-3 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 603-060-00-1 | 2,2'-bioxirane; 1,2:3,4-diepoxybutane | 2,2'-bioxirán; 1,2:3,4-diepoxibután | 215-979-1 | 1464-53-5 | Carc.
1B Muta. 1B Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B |
H350 H340 H330 H311 H301 H314 |
GHS06 GHS08 GHS05 Dgr |
H350 H340 H330 H311 H301 H314 |
CLP00 | |||
| 603-061-00-7 | tetrahydro-2-furylmethanol; tetrahydrofurfuryl alcohol | tetrahidro-2-furilmetanol; tetrahidrofurfuril-alkohol | 202-625-6 | 97-99-4 | Repr.
1B Eye Irrit. 2 |
H360Df H319 |
GHS08
GHS07 Dgr |
H319 H360Df |
CLP00/ATP06 | |||
| 603-062-00-2 | tetrahydrofuran-2,5-diyldimethanol | tetrahidrofurán-2,5-diildimetanol | 203-239-0 | 104-80-3 | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 |
H335 H315 H319 |
GHS07 Wng |
H319 H335 H315 |
STOT
SE 3; H335: C ≥ 10 % |
CLP00 | ||
| 603-063-00-8 | 2,3-epoxypropan-1-ol; glycidol; oxiranemethanol | 2,3-epoxipropán-1-ol; glicidol; oxiránmetanol | 209-128-3 | 556-52-5 | Carc.
1B Muta. 2 Repr. 1B Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 |
H350 H341 H360F *** H331 H312 H302 H335 H315 H319 |
GHS06 GHS08 Dgr |
H350 H341 H360F *** H331 H312 H302 H319 H335 H315 |
CLP00 | |||
| 603-064-00-3 | 1-methoxy-2-propanol; monopropylene glycol methyl ether | 1-metoxi-2-propanol; monopropilén-glikol-metil-éter | 203-539-1 | 107-98-2 | Flam.
Liq. 3 STOT SE 3 |
H226 H336 |
GHS02 GHS07 Wng |
H226 H336 |
CLP00/ATP01 | |||
| 603-065-00-9 | m-bis(2,3-epoxypropoxy)benzene; resorcinol diglycidyl ether | rezorcin-diglicidil-éter; 1,3-bisz(2,3-epoxipropoxi)benzol | 202-987-5 | 101-90-6 | Carc.
1B Muta. 2 Acute Tox. 3 Acute Tox. 4 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H350 H341 H311 H302 H315 H319 H317 H412 |
GHS08 GHS06 Dgr |
H311 H302 H315 H319 H317 H341 H350 H412 |
Dermal:
ATE = 300 mg/kg Oral: ATE = 500 mg/kg |
CLP00/ATP15 | ||
| 603-066-00-4 | 1,2-epoxy-4-epoxyethylcyclohexane; 4-vinylcyclohexene diepoxide | 1,2-epoxi-4-epoxietilciklohexán; 4-vinilciklohexán-diepoxid | 203-437-7 | 106-87-6 | Carc.
2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H351 H331 H311 H301 |
GHS06 GHS08 Dgr |
H351 H331 H311 H301 |
* |
CLP00/ATP01 | ||
| 603-067-00-X | phenyl glycidyl ether; 2,3-epoxypropyl phenyl ether; 1,2-epoxy-3-phenoxypropane | fenil-glicidil-éter; 2,3-epoxipropil-fenil-éter; 1,2-epoxi-3-fenoxipropán | 204-557-2 | 122-60-1 | Carc.
1B Muta. 2 Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H350 H341 H332 H335 H315 H317 H412 |
GHS08 GHS07 Dgr |
H350 H341 H332 H335 H315 H317 H412 |
CLP00 | |||
| 603-068-00-5 | 2,3-epoxypropyl-2-ethylcyclohexyl ether; ethylcyclohexylglycidyl ether | 2,3-epoxipropil-2-etilciklohexil-éter; etilciklohexil-glicidil-éter | 130014-35-6 | Skin
Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H315 H319 H317 |
GHS07 Wng |
H319 H315 H317 |
CLP00 | ||||
| 603-069-00-0 | 2,4,6-tris(dimethylaminomethyl)phenol | 2,4,6-trisz(dimetilaminometil)fenol | 202-013-9 | 90-72-2 | Acute
Tox. 4 * Skin Irrit. 2 Eye Irrit. 2 |
H302 H315 H319 |
GHS07 Wng |
H302 H319 H315 |
CLP00 | |||
| 603-070-00-6 | 2-amino-2-methylpropanol | 2-amino-2-metilpropanol | 204-709-8 | 124-68-5 | Skin
Irrit. 2 Eye Irrit. 2 Aquatic Chronic 3 |
H315 H319 H412 |
GHS07 Wng |
H319 H315 H412 |
CLP00 | |||
| 603-071-00-1 | 2,2'-iminodiethanol; diethanolamine | 2,2’-iminodietanol; dietanolamin | 203-868-0 | 111-42-2 | Acute
Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 |
H302 H373 ** H315 H318 |
GHS08 GHS05 GHS07 Dgr |
H302 H373 ** H315 H318 |
CLP00 | |||
| 603-072-00-7 | 1,4-bis(2,3 epoxypropoxy)butane; butanedioldiglycidyl ether | 1,4-bisz(2,3-epoxipropoxi)bután; butándiol-diglicidil-éter | 219-371-7 | 2425-79-8 | Acute
Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H332 H312 H315 H319 H317 |
GHS07 Wng |
H332 H312 H319 H315 H317 |
CLP00 | |||
| 603-073-00-2 | bis-[4-(2,3-epoxipropoxi)phenyl]propane | bisz-[4-(2,3-epoxipropoxi)fenil]propán | 216-823-5 | 1675-54-3 | Skin
Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H315 H319 H317 |
GHS07 Wng |
H319 H315 H317 |
Eye
Irrit. 2; H319: C ≥ 5 % Skin Irrit. 2; H315: C ≥ 5 % |
CLP00 | ||
| 603-074-00-8 | reaction product: bisphenol-A-(epichlorhydrin); epoxy resin (number average molecular weight ≤ 700) | reakciótermék: biszfenol-A-(epiklórhidrin); epoxigyanta (átlagos molekulatömeg ≤ 700) | 500-033-5 | 25068-38-6 | Skin
Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H315 H319 H317 H411 |
GHS07 GHS09 Wng |
H319 H315 H317 H411 |
Eye
Irrit. 2; H319: C ≥ 5 % Skin Irrit. 2; H315: C ≥ 5 % |
CLP00 | ||
| 603-075-00-3 | chlormethyl methyl ether; chlorodimethyl ether | klórmetil-metil-éter; klórdimetil-éter | 203-480-1 | 107-30-2 | Flam.
Liq. 2 Carc. 1A Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H225 H350 H332 H312 H302 |
GHS02 GHS08 GHS07 Dgr |
H225 H350 H332 H312 H302 |
CLP00 | |||
| 603-076-00-9 | but-2-yne-1,4-diol; 2-butyne-1,4-diol | but-2-in-1,4-diol; 2-butin-1,4-diol | 203-788-6 | 110-65-6 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 |
H331 H301 H312 H373 ** H314 H317 |
GHS06 GHS05 GHS08 Dgr |
H314 H331 H301 H312 H373 ** H317 |
Skin
Corr. 1B; H314: C ≥ 50 % Skin Irrit. 2; H315: 25 % ≤ C < 50 % Eye Irrit. 2; H319: 25 % ≤ C < 50 % |
D | CLP00 | |
| 603-077-00-4 | 1-dimethylaminopropan-2-ol; dimepranol (INN) | 1-dimetilaminopropán-2-ol; dimepranol (INN) | 203-556-4 | 108-16-7 | Flam.
Liq. 3 Acute Tox. 4 * Skin Corr. 1B |
H226 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H226 H302 H314 |
CLP00 | |||
| 603-078-00-X | prop-2-yn-1-ol; propargyl alcohol | prop-2-in-1-ol; propargil-alkohol | 203-471-2 | 107-19-7 | Flam.
Liq. 3 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Aquatic Chronic 2 |
H226 H331 H311 H301 H314 H411 |
GHS02 GHS06 GHS05 GHS09 Dgr |
H226 H331 H311 H301 H314 H411 |
CLP00 | |||
| 603-079-00-5 | 2,2'-(methylimino)diethanol; N-methyldiethanolamine | 2,2’-(metilimino)dietanol; N-metildietanolamin | 203-312-7 | 105-59-9 | Eye
Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
CLP00 | |||
| 603-080-00-0 | 2-methylaminoethanol; N-methylethanolamine; N-methyl-2-ethanolamine; N-methyl-2-amino ethanol; 2-(methylamino)ethanol | 2-metilaminoetanol; N-metiletanolamin;N-metil-2-etanolamin; N-metil-2-aminoetanol; 2-(metilamino)etanol | 203-710-0 | 109-83-1 | Acute
Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
STOT
SE 3; H335: C ≥ 5 % |
CLP00 | ||
| 603-081-00-6 | 2,2'-thiodiethanol; thiodiglycol | 2,2’-tiodietanol; tiodiglikol | 203-874-3 | 111-48-8 | Eye
Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
CLP00 | |||
| 603-082-00-1 | 1-aminopropan-2-ol; isopropanolamine | 1-aminopropán-2-ol; izopropanolamin | 201-162-7 | 78-96-6 | Skin
Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
CLP00 | |||
| 603-083-00-7 | 1,1'-iminodipropan-2-ol; di-isopropanolamine | 1,1’-iminodipropán-2-ol; diizopropanolamin | 203-820-9 | 110-97-4 | Eye
Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
CLP00 | |||
| 603-084-00-2 | styrene oxide; (epoxyethyl)benzene; phenyloxirane | sztirol-oxid; (epoxietil)benzol; feniloxirán | 202-476-7 | 96-09-3 | Carc.
1B Acute Tox. 4 * Eye Irrit. 2 |
H350 H312 H319 |
GHS08 GHS07 Dgr |
H350 H312 H319 |
CLP00 | |||
| 603-085-00-8 | bronopol (INN); 2-bromo-2-nitropropane-1,3-diol | bronopol (INN); 2-bróm-2-nitropropán-1,3-diol | 200-143-0 | 52-51-7 | Acute
Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 |
H312 H302 H335 H315 H318 H400 |
GHS05 GHS07 GHS09 Dgr |
H312 H302 H335 H315 H318 H400 |
M=10 |
CLP00/ATP01 | ||
| 603-086-00-3 | ethirimol (ISO); 5-butyl-2-ethylamino-6-methylpyrimidin-4-ol | etirimol (ISO); 5-butil-2-etilamino-6-metilpirimidin-4-ol | 245-949-3 | 23947-60-6 | Acute
Tox. 4 * |
H312 |
GHS07 Wng |
H312 |
CLP00 | |||
| 603-087-00-9 | 2-ethylhexane-1,3-diol; octylene glycol; ethoexadiol | 2-etilhexán-1,3-diol; oktilén-glikol; etoexadiol | 202-377-9 | 94-96-2 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | |||
| 603-088-00-4 | 2-(octylthio)ethanol; 2-hydroxyethyl octyl sulphide | 2-(oktiltio)etanol; 2-hidroxietil-oktil-szulfid | 222-598-4 | 3547-33-9 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | |||
| 603-089-00-X | 7,7-dimethyl-3-oxa-6-azaoctan-1-ol | 7,7-dimetil-3-oxa-6-azaoktán-1-ol | 400-390-6 | Acute
Tox. 4 * Skin Corr. 1A |
H302 H314 |
GHS05 GHS07 Dgr |
H314 H302 |
CLP00 | ||||
| 603-090-00-5 | 2-(2-bromoethoxy)anisole | 2-(2-brómetoxi)anizol | 402-010-4 | 4463-59-6 | Acute
Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
CLP00 | |||
| 603-091-00-0 | exo-1-methyl-4-(1-methylethyl)-7-oxabicyclo[2.2.1]heptan-2-ol | exo-1-metil-4-(1-metiletil)-7-oxabiciklo[2.2.1]heptán-2-ol | 402-470-6 | 87172-89-2 | Acute
Tox. 4 * Eye Dam. 1 |
H302 H318 |
GHS05 GHS07 Dgr |
H302 H318 |
CLP00 | |||
| 603-092-00-6 | 2-methyl-4-phenylpentanol | 2-metil-4-fenilpentanol | 402-770-7 | 92585-24-5 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | |||
| 603-093-00-1 | cinmethylin (ISO); exo-(±)-1-methyl-2-(2-methylbenzyloxy)-4-isopropyl-7-oxabicyclo(2.2.1)heptane | cinmetilin (ISO); exo-(±)-1-metil-2-(2-metilbenziloxi)-4-izopropil- 7-oxabiciklo(2.2.1)heptán | 402-410-9 | 87818-31-3 | Acute
Tox. 4 * Aquatic Chronic 2 |
H332 H411 |
GHS07 GHS09 Dgr |
H332 H411 |
CLP00 | |||
| 603-094-00-7 | 1,3-bis(2,3-epoxypropoxy)-2,2-dimethylpropane | 1,3-bisz(2,3-epoxipropoxi)-2,2-dimetilpropán | 241-536-7 | 17557-23-2 | Skin
Irrit. 2 Skin Sens. 1 |
H315 H317 |
GHS07 Wng |
H315 H317 |
CLP00 | |||
| 603-095-00-2 | 2-(propyloxy)ethanol; EGPE | 2-(propiloxi)etanol; EGPE | 220-548-6 | 2807-30-9 | Acute
Tox. 4 * Eye Irrit. 2 |
H312 H319 |
GHS07 Wng |
H312 H319 |
CLP00 | |||
| 603-096-00-8 | 2-(2-butoxyethoxy)ethanol; diethylene glycol monobutyl ether | 2-(2-butoxietoxi)etanol; dietilén-glikol-monobutil-éter | 203-961-6 | 112-34-5 | Eye
Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
CLP00 | |||
| 603-097-00-3 | 1,1',1'-nitrilotripropan-2-ol; triisopropanolamine | 1,1’,1”-nitrilotripropán-2-ol; triizopropanolamin | 204-528-4 | 122-20-3 | Eye
Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
CLP00/ATP05 | |||
| 603-098-00-9 | 2-phenoxyethanol | 2-fenoxietanol | 204-589-7 | 122-99-6 | Acute
Tox. 4 * Eye Irrit. 2 |
H302 H319 |
GHS07 Wng |
H302 H319 |
CLP00 | |||
| 603-099-00-4 | 3-(N-methyl-N-(4-methylamino-3-nitrophenyl)amino)propane-1,2-diol hydrochloride | 3-(N-metil-N-(4-metilamino-3-nitrofenil)amino]propán-1,2-diol-hidroklorid | 403-440-5 | 93633-79-5 | Acute
Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
CLP00 | |||
| 603-100-00-8 | 1,2-dimethoxypropane | 1,2-dimetoxipropán | 404-630-0 | 7778-85-0 | Flam.
Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
EUH019 |
CLP00 | ||
| 603-101-00-3 | tetrahydro-2-isobutyl-4-methylpyran-4-ol, mixed isomers (cis and trans) | tetrahidro-2-izobutil-4-metilpirán-4-ol, kevert izomerek (cisz és transz) | 405-040-6 | Eye
Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
CLP00 | ||||
| 603-102-00-9 | 1,2-epoxybutane | 1,2-epoxi-bután | 203-438-2 | 106-88-7 | Flam.
Liq. 2 Carc. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 |
H225 H351 H332 H312 H302 H335 H315 H319 |
GHS02 GHS08 GHS07 Dgr |
H225 H302 H312 H332 H315 H319 H351 H335 |
CLP00/ATP07 | |||
| 603-103-00-4 | oxirane, mono[(C12-14-alkyloxy)methyl] derivs. | oxirán, mono[(C12-14-alkiloxi)metil] származékai | 271-846-8 | 68609-97-2 | Skin
Irrit. 2 Skin Sens. 1 |
H315 H317 |
GHS07 Wng |
H315 H317 |
CLP00 | |||
| 603-104-00-X | fenarimol (ISO); 2,4'-dichloro-α-(pyrimidin-5-yl)benzhydryl alcohol | fenarimol (ISO); 2,4'-diklór-α-(pirimidin-5-il)benzhidril-alkohol | 262-095-7 | 60168-88-9 | Repr.
2 Lact. Aquatic Chronic 2 |
H361fd H362 H411 |
GHS08 GHS09 Wng |
H361fd H362 H411 |
CLP00 | |||
| 603-105-00-5 | furan | furán | 203-727-3 | 110-00-9 | Flam.
Liq. 1 Carc. 1B Muta. 2 Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Aquatic Chronic 3 |
H224 H350 H341 H332 H302 H373 ** H315 H412 |
GHS02 GHS08 GHS07 Dgr |
H224 H350 H341 H332 H302 H373 ** H315 H412 |
EUH019 |
CLP00 | ||
| 603-106-00-0 | 2-methoxypropanol | 2-metoxipropanol | 216-455-5 | 1589-47-5 | Flam.
Liq. 3 Repr. 1B STOT SE 3 Skin Irrit. 2 Eye Dam. 1 |
H226 H360D *** H335 H315 H318 |
GHS02 GHS08 GHS05 GHS07 Dgr |
H226 H360D *** H335 H315 H318 |
CLP00 | |||
| 603-107-00-6 | 2-(2-methoxyethoxy)ethanol; diethylene glycol monomethyl ether | 2-(2-metoxietoxi)etanol; dietilén-glikol-monometil-éter | 203-906-6 | 111-77-3 | Repr.
2 |
H361d
*** |
GHS08 Wng |
H361d
*** |
CLP00 | |||
| 603-108-00-1 | 2-methylpropan-1-ol; iso-butanol | 2-metilpropán-1-ol; izobutanol | 201-148-0 | 78-83-1 | Flam.
Liq. 3 STOT SE 3 STOT SE 3 Skin Irrit. 2 Eye Dam. 1 |
H226 H335 H336 H315 H318 |
GHS02 GHS05 GHS07 Dgr |
H226 H335 H315 H318 H336 |
CLP00 | |||
| 603-109-00-7 | reaction mass of: 1-ethoxy-1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propane; 1-ethoxy-1,1,2,2,3,3,4,4,4-nonafluorobutane | 1-etoxi-1,1,2,3,3,3-hexafluor-2-(trifluormetil)propán; 1-etoxi-1,1,2,2,3,3,4,4,4-nonafluor-bután keveréke | 425-340-0 | - | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 603-110-00-2 | reaction mass of: cis-2-isobutyl-5-methyl 1,3-dioxane; trans-2-isobutyl-5-methyl 1,3-dioxane | cisz-2-izobutil-5-metil-1,3-dioxán; transz-2-izobutil-5-metil-1,3-dioxán keveréke | 426-130-1 | 166301-21-9 | Skin
Irrit. 2 Aquatic Chronic 3 |
H315 H412 |
GHS07 Wng |
H315 H412 |
ATP01 | |||
| 603-111-00-8 | reaction mass of: 1-(1,1-dimethylpropyl)-4-ethoxy-cis-cyclohexane; 1-(1,1-dimethylpropyl)-4-ethoxy-trans-cyclohexane | 1-(1,1-dimetilpropil)-4-etoxi-cisz-ciklohexán; 1-(1,1-dimetilpropil)-4-etoxi-transz-ciklohexán keveréke | 426-530-6 | - | Skin
Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
ATP01 | |||
| 603-112-00-3 | cyclopentyl 2-phenylethyl ether | ciklopentil-2-feniletil-éter | 428-340-9 | - | Skin
Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
ATP01 | |||
| 603-113-00-9 | 6-glycidyloxynapht-1-yl oxymethyloxirane | 6-glicidiloxinaft-1-il-oximetiloxirán | 429-960-2 | 27610-48-6 | Muta.
2 Acute Tox. 4 * Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H341 H312 H315 H317 H412 |
GHS08 GHS07 Wng |
H341 H312 H315 H317 H412 |
ATP01 | |||
| 603-114-00-4 | 9-(2-propenyloxy)tricyclo[5.2.1.0(2,6)]dec-3(or-4-)-ene | 9-(2-propeniloxi)triciklo[5.2.1.0(2,6)]dek-3(vagy-4-)-én | 430-830-2 | 26912-64-1 | Skin
Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
ATP01 | |||
| 603-115-00-X | reaction mass of: O,O',O''-(methylsilanetriyl)tris(4-methyl-2-pentanone oxime) (3 stereoisomers) | O,O',O''-(metilszilántriil)trisz(4-metil-2-pentanon-oxim) (három sztereoizomer) keveréke | 423-580-0 | - | STOT
RE 2 * Aquatic Chronic 4 |
H373
** H413 |
GHS08 Wng |
H373
** H413 |
ATP01 | |||
| 603-116-00-5 | (Z)-(2,4-difluorophenyl)piperidin-4-ylmethanone oxime monohydrochloride | (Z)-(2,4-difluorfenil)piperidin-4-il-metanon-oxim-monohidroklorid | 424-740-2 | 138271-16-6 | Acute
Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
ATP01 | |||
| 603-117-00-0 | propan-2-ol; isopropyl alcohol; isopropanol | propán-2-ol; izopropil-alkohol; izopropanol | 200-661-7 | 67-63-0 | Flam.
Liq. 2 STOT SE 3 Eye Irrit. 2 |
H225 H336 H319 |
GHS02 GHS07 Dgr |
H225 H319 H336 |
CLP00 | |||
| 603-118-00-6 | 6-dimethylaminohexan-1-ol | 6-dimetilaminohexán-1-ol | 404-680-3 | 1862-07-3 | Acute
Tox. 4 * Skin Corr. 1B Aquatic Chronic 3 |
H302 H314 H412 |
GHS05 GHS07 Dgr |
H302 H314 H412 |
CLP00 | |||
| 603-119-00-1 | 1,1'-(1,3-phenylenedioxy)bis(3-(2-(prop-2-enyl)phenoxy)propan-2-ol) | 1,1’-(1,3-feniléndioxi)bisz[3-(2-(prop-2-enil)fenoxi]propán-2-ol | 405-840-5 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
CLP00 | ||||
| 603-120-00-7 | 2-methyl-5-phenylpentanol | 2-metil-5-fenilpentanol | 405-890-8 | 25634-93-9 | Skin
Irrit. 2 Eye Irrit. 2 |
H315 H319 |
GHS07 Wng |
H319 H315 |
CLP00 | |||
| 603-121-00-2 | 4-[4-(1,3-dihydroxyprop-2-yl)phenylamino]-1,8-dihydroxy-5-nitroanthraquinone | 4-[4-(1,3-dihidroxiprop-2-il)fenilamino]-1,8-dihidroxi-5-nitroantrakinon | 406-057-1 | 114565-66-1 | Carc.
2 Skin Sens. 1 Aquatic Chronic 4 |
H351 H317 H413 |
GHS08 GHS07 Wng |
H351 H317 H413 |
CLP00 | |||
| 603-122-00-8 | sodium 2-ethylhexanolate | nátrium-2-etilhexanolát | 406-150-7 | 38411-13-1 | Flam.
Sol. 1 Skin Corr. 1B Aquatic Chronic 3 |
H228 H314 H412 |
GHS02 GHS05 Dgr |
H228 H314 H412 |
T | CLP00 | ||
| 603-123-00-3 | 4-methyl-8-methylenetricyclo[3.3.1.13,7]decan-2-ol | 4-metil-8-metiléntriciklo[3.3.1.13,7]dekán-2-ol | 406-330-5 | 122760-84-3 | Skin
Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H315 H317 H411 |
GHS07 GHS09 Wng |
H315 H317 H411 |
CLP00 | |||
| 603-124-00-9 | 1,4-bis[2-(vinyloxy)ethoxy]benzene | 1,4-bisz[2-(viniloxi)etoxi]benzol | 406-900-3 | 84563-49-5 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 603-125-00-4 | 2-(2,4-dichlorophenyl)-1-(1H-1,2,4-triazol-1-yl)pent-4-en-2-ol | 2-(2,4-diklórfenil)-1-(1H-1,2,4-triazol-1-il)pent-4-én-2-ol | 407-850-5 | 89544-40-1 | Acute
Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
CLP00 | |||
| 603-126-00-X | 2-((4-methyl-2-nitrophenyl)amino)ethanol | 2-[(4-metil-2-nitrofenil)amino]etanol | 408-090-7 | 100418-33-5 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Chronic 3 |
H302 H317 H412 |
GHS07 Wng |
H302 H317 H412 |
CLP00 | |||
| 603-127-00-5 | butan-2-ol
[1] (S)-butan-2-ol [2] (R)-butan-2-ol [3] (±)-butan-2-ol [4] |
bután-2-ol; [1](S)-bután-2-ol; [2] (R)-bután-2-ol; [3] (±)-bután-2-ol [4] | 201-158-5
[1] 224-168-1 [2] 238-967-8 [3] 240-029-8 [4] |
78-92-2
[1] 4221-99-2 [2] 14898-79-4 [3] 15892-23-6 [4] |
Flam.
Liq. 3 STOT SE 3 STOT SE 3 Eye Irrit. 2 |
H226 H335 H336 H319 |
GHS02 GHS07 Wng |
H226 H319 H335 H336 |
C | CLP00/ATP01 | ||
| 603-128-00-0 | 2-(phenylmethoxy)naphthalene | 2-(fenilmetoxi)naftalin | 405-490-3 | 613-62-7 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 603-129-00-6 | 1-tert-butoxypropan-2-ol | 1-terc-butoxipropán-2-ol | 406-180-0 | 57018-52-7 | Flam.
Liq. 3 Eye Dam. 1 |
H226 H318 |
GHS02 GHS05 Dgr |
H226 H318 |
CLP00 | |||
| 603-130-00-1 | reaction mass of isomers of: α-((dimethyl)biphenyl)-ω-hydroxypoly(oxyethylene) | α-((dimetil)bifenil)-ω-hidroxipoli(oxietilén) izomerek keveréke | 406-325-8 | Acute
Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
CLP00 | ||||
| 603-131-00-7 | reaction mass of: 1-deoxy-1-[methyl-(1-oxododecyl)amino]-D-glucitol; 1-deoxy-1-[methyl-(1-oxotetradecyl)amino]-D-glucitol (3:1) | 1-deoxi-1-[metil(1-oxododecil)amino]-D-glucitol; 1-deoxi-1-[metil(1-oxotetradecil)amino]-D-glucitol (3:1) keveréke | 407-290-1 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | ||||
| 603-132-00-2 | 2-hydroxymethyl-9-methyl-6-(1-methylethyl)-1,4-dioxaspiro[4.5]decane | 2-hidroximetil-9-metil-6-(1-metiletil)-1,4-dioxaspiro[4.5]dekán | 408-200-3 | 63187-91-7 | Skin
Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H315 H318 H412 |
GHS05 Dgr |
H315 H318 H412 |
CLP00 | |||
| 603-133-00-8 | reaction mass of: 3-[(4-amino-2-chloro-5-nitrophenyl)amino]-propane-1,2-diol; 3,3'-(2-chloro-5-nitro-1,4-phenylenediimino)bis(propan-1,2-diol) | 3-[(4-amino-2-klór-5-nitrofenil)amino]propán-1,2-diol; 3,3’-(2-klór-5-nitro-1,4-feniléndiimino)bisz(propán-1,2-diol) keveréke | 408-240-1 | Acute
Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
CLP00 | ||||
| 603-134-00-3 | reaction mass of substituted dodecyl and/or tetradecyl, diphenyl ethers. The substance is produced by the Friedel Crafts reaction. The catalyst is removed from the reaction product. Diphenyl ether is substituted by C1-C10 alkyl groups. The alkyl groups are bonded randomly between C1 and C6. Linear C12 and C14, 50/50 used. | Szubsztituált dodecil és/vagy tetradecil, difenil éterek keveréke. Friedel-Crafts reakcióval állítják elő. A katalizátort eltávolítják a reakciótermékből. A difenil-étert C1-C10 alkilcsoporttal szubsztituálják. Az alkilcsoportok véletlenszerűen kapcsolódnak C1 és C6 között. Lineáris C12 és C14 50/50 láncot használnak. | 410-450-3 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | |||||
| 603-135-00-9 | bis[[2,2',2''-nitrilotris-[ethanolato]]-1-N,O]-bis[2-(2-methoxyethoxy)ethoxy]-titanium | bisz[[2,2',2''-nitrilotrisz-[etanoláto]]-1-N, O]-bisz[2-(2-metoxietoxi)etoxi]-titán | 410-500-4 | Eye
Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
CLP00 | ||||
| 603-136-00-4 | 3-((4-(bis(2-hydroxyethyl)amino)-2-nitrophenyl)amino)-1-propanol | 3-((4-(bisz(2-hidroxietil)amino)-2-nitrofenil)amino)-1-propanol | 410-910-3 | 104226-19-9 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
CLP00 | |||
| 603-137-00-X | reaction mass of: 1-deoxy-1-[methyl-(1-oxohexadecyl)amino]-D-glucitol; 1-deoxy-1-[methyl-(1-oxooctadecyl)amino]-D-glucitol | 1-deoxi-1-[metil(1-oxohexadecil)amino]-D-glucitol; 1-deoxi-1-[metil(1-oxooktadecil)amino]-D-glucitol keveréke | 411-130-6 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | ||||
| 603-138-00-5 | 3-(2,2-dimethyl-3-hydroxypropyl)toluene; (alt.): 2,2-dimethyl-3-(3-methylphenyl)propanol | 3-(2,2-dimetil-3-hidroxipropil)toluol; (alt.): 2,2-dimetil-3-(3-metilfenil)propanol | 403-140-4 | 103694-68-4 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | ||||
| 603-139-00-0 | bis(2-methoxyethyl) ether | bisz(2-metoxietil)-éter | 203-924-4 | 111-96-6 | Flam.
Liq. 3 Repr. 1B |
H226 H360FD |
GHS02 GHS08 Dgr |
H226 H360FD |
EUH019 |
CLP00 | ||
| 603-140-00-6 | 2,2' -oxybisethanol; diethylene glycol | 2,2'-oxibiszetanol; dietilén-glikol | 203-872-2 | 111-46-6 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 603-141-00-1 | reaction mass of: dodecyloxy-1-methyl-1-[oxy-poly-(2-hydroxymethylethanoxy)]pentadecane; dodecyloxy-1-methyl-1-[oxy-poly-(2-hydroxymethylethanoxy)]heptadecane | dodeciloxi-1-metil-1-[oxi-poli(2-hidroximetiletanoxi)]pentadekán; dodeciloxi-1-metil-1-[oxi-poli(2-hidroximetiletanoxi)]heptadekán keveréke | 413-780-6 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | |||||
| 603-142-00-7 | 2-(2-(2-hydroxyethoxy)ethyl)-2-aza-bicyclo[2.2.1]heptane | 2-[2-(2-hidroxietoxi)etil]-2-azabiciklo[2.2.1]heptán | 407-360-1 | 116230-20-7 | Acute
Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 |
H312 H302 H373 ** H315 H318 |
GHS06 GHS08 GHS05 Dgr |
H312 H302 H373 ** H315 H318 |
CLP00 | |||
| 603-143-00-2 | R-2,3-epoxy-1-propanol | R-2,3-epoxi-1-propanol | 404-660-4 | 57044-25-4 | Self-react.
C **** Carc. 1B Muta. 2 Repr. 1B Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H242 H350 H341 H360F *** H331 H312 H302 H314 |
GHS02 GHS06 GHS08 GHS05 Dgr |
H242 H350 H341 H360F *** H331 H312 H302 H314 |
CLP00 | |||
| 603-144-00-8 | reaction mass of: 2,6,9-trimethyl-2,5,9-cyclododecatrien-1-ol; 6,9-dimethyl-2-methylen-5,9-cyclododecadien-1-ol | 2,6,9-trimetil-2,5,9-ciklododekatrién-1-ol; 6,9-dimetil-2-metilén-5,9-ciklododekadién-1-ol keveréke | 413-530-6 | 111850-00-1 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 603-145-00-3 | 2-isopropyl-2-(1-methylbutyl)-1,3-dimethoxypropane | 2-izopropil-2-(1-metilbutil)-1,3-dimetoxipropán | 406-970-5 | 129228-11-1 | Skin
Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
CLP00 | |||
| 603-146-00-9 | 2-[(2-[2-(dimethylamino)ethoxy]ethyl)methylamino]ethanol | 2-[(2-[2-(dimetilamino)etoxi]etil)metilamino]etanol | 406-080-7 | 83016-70-0 | Acute
Tox. 4 * Skin Corr. 1B Aquatic Chronic 3 |
H302 H314 H412 |
GHS05 GHS07 Dgr |
H302 H314 H412 |
CLP00 | |||
| 603-147-00-4 | (-)-trans-4-(4'-fluorophenyl)-3-hydroxymethyl-N-methylpiperidine | (-)-transz-4-(4’-fluorfenil)-3-hidroximetil-N-metilpiperidin | 406-030-4 | 105812-81-5 | Acute
Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
CLP00 | |||
| 603-148-00-X | 1,4-bis[(vinyloxy)methyl]cyclohexane | 1,4-bisz[(viniloxi)metil]ciklohexán | 413-370-7 | 17351-75-6 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | |||
| 603-149-00-5 | reaction mass of diastereoisomers of 1-(1-hydroxyethyl)-4-(1-methylethyl)cyclohexane | 1-(1-hidroxietil)-4-(1-metiletil)ciklohexán diasztereoizomerek keveréke | 407-640-3 | 63767-86-2 | Skin
Irrit. 2 Eye Irrit. 2 Aquatic Chronic 2 |
H315 H319 H411 |
GHS07 GHS09 Wng |
H319 H315 H411 |
CLP00 | |||
| 603-150-00-0 | (±) trans-3,3-dimethyl-5-(2,2,3-trimethyl-cyclopent-3-en-1-yl)-pent-4-en-2-ol | (±) transz-3,3-dimetil-5-(2,2,3-trimetilciklopent-3-én-1-il)pent-4-én-2-ol | 411-580-3 | 107898-54-4 | Skin
Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
CLP00 | |||
| 603-151-00-6 | (±)-2-(2,4-dichlorophenyl)-3-(1H-1,2,4-triazol-1-yl)propan-1-ol | (±)-2-(2,4-diklórfenil)-3-(1H-1,2,4-triazol-1-il)propán-1-ol | 413-570-4 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | |||||
| 603-152-00-1 | 2-(4-tert-butylphenyl)ethanol | 2-(4-terc-butilfenil)etanol | 410-020-5 | 5406-86-0 | Repr.
2 STOT RE 2 * Eye Dam. 1 Aquatic Chronic 2 |
H361f
*** H373 ** H318 H411 |
GHS08 GHS05 GHS09 Dgr |
H361f
*** H373 ** H318 H411 |
CLP00 | |||
| 603-153-00-7 | 3-((2-nitro-4-(trifluoromethyl)phenyl)amino)propane-1,2-diol | 3-[(2-nitro-4-(trifluormetil)fenil]amino]propán-1,2-diol | 410-010-0 | 104333-00-8 | Acute
Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
CLP00 | |||
| 603-154-00-2 | 1-[(2-tert-butyl)cyclohexyloxy]-2-butanol | 1-[(2-terc-butil)ciklohexiloxi]-2-butanol | 412-300-2 | 139504-68-0 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 603-156-00-3 | 2-(2,4-dichlorophenyl)-2-(2-propenyl)oxirane | 2-(2,4-diklórfenil)-2-(2-propenil)oxirán | 411-210-0 | 89544-48-9 | Skin
Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H315 H317 H410 |
CLP00 | |||
| 603-157-00-9 | 6,9-bis(hexadecyloxymethyl)-4,7-dioxanonane-1,2,9-triol | 6,9-bisz(hexadeciloximetil)-4,7-dioxanonán-1,2,9-triol | 411-450-6 | 143747-72-2 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 603-158-00-4 | reaction mass of 4 diastereoisomers of 2,7-dimethyl-10-(1-methylethyl)-1-oxaspiro[4.5]deca-3,6-diene | 2,7-dimetil-10-(1-metiletil)-1-oxaspiro[4.5]deka-3,6-dién 4 diasztereoizomerének keveréke | 412-460-3 | Skin
Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
CLP00 | ||||
| 603-159-00-X | 2-cyclododecylpropan-1-ol | 2-ciklododecilpropán-1-ol | 411-410-8 | 118562-73-5 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 603-160-00-5 | 1,2-diethoxypropane | 1,2-dietoxipropán | 412-180-1 | 10221-57-5 | Flam.
Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
EUH019 |
CLP00 | ||
| 603-161-00-0 | 1,3-diethoxypropane | 1,3-dietoxipropán | 413-140-6 | 3459-83-4 | Flam.
Liq. 3 |
H226 |
GHS02 Wng |
H226 |
CLP00 | |||
| 603-162-00-6 | α[2-[[[(2-hydroxyethyl)methylamino]acetyl]amino]propyl]-ω-(nonylphenoxy)poly[oxo(methyl-1,2-ethanediyl)] | α[2-[[[(2-hidroxietil)metilamino]acetil]amino]propil]-ω-(nonilfenoxi)poli[oxo(metil-1,2-etándiil)] | 413-420-8 | 144736-29-8 | Skin
Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H314 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H411 |
CLP00 | |||
| 603-163-00-1 | 2-phenyl-1,3-propanediol | 2-fenil-1,3-propándiol | 411-810-2 | 1570-95-2 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | |||
| 603-164-00-7 | 2-butyl-4-chloro-4,5-dihydro-5-hydroxymethyl-1-[2'-(2-triphenylmethyl-1,2,3,4-2H-tetrazol-5-yl)-1,1'-biphenyl-4-methyl]-1H-imidazole | 2-butil-4-klór-4,5-dihidro-5-hidroximetil-1-[2’-(2-trifenilmetil-1,2,3,4-2H-tetrazol-5-il)-1,1’-bifenil-4-metil]-1H-imidazol | 412-420-5 | 133909-99-6 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 603-165-00-2 | reaction mass of: 4-allyl-2,6-bis(2,3-epoxypropyl)phenol; 4-allyl-6-[3-[6-[3-[6-[3-(4-allyl-2,6-bis(2,3-epoxypropyl)phenoxy)-2-hydroxypropyl]-4-allyl-2-(2,3-epoxypropyl)phenoxy]-2-hydroxypropyl]-4-allyl-2-(2,3-epoxypropyl)phenoxy]-2-hydroxypropyl]-2-(2,3-epoxypropyl)phenol; 4-allyl-6-[3-(4-allyl-2,6-bis(2,3-epoxypropyl)phenoxy)-2-hydroxypropyl]-2-(2,3-epoxypropyl)phenol; 4-allyl-6-[3-[6-[3-(4-allyl-2,6-bis(2,3-epoxypropyl)phenoxy)-2-hydroxypropyl]-4-allyl-2-(2,3-epoxypropyl)phenoxy]-2-hydroxypropyl]-2-(2,3-epoxypropyl)phenol | a következő anyagok keveréke: 4-allil-2,6-bisz(2,3-epoxipropil)fenol; 4-allil-6-[3-(6-[3-[6-[3-[4-allil-2,6-bisz(2,3-epoxipropil)fenoxi]-2-hidroxipropil]-4-allil-2-(2,3-epoxipropil)fenoxi]-2-hidroxipropil]-4-allil-2-(2,3-epoxipropil)fenoxi]-2-hidroxipropil]-2-(2,3-epoxipropil)fenol; 4-allil-6-[3-[4-allil-2,6-bisz(2,3-epoxipropil)fenoxi]-2-hidroxipropil]-2-(2,3-epoxipropil)fenol; 4-allil-6-[3-[6-[3-[4-allil-2,6-bisz(2,3-epoxipropil)fenoxi]-2-hidroxipropil]-4-allil-2-(2,3-epoxipropil)fenoxi]-2-hidroxipropil]-2-(2,3-epoxipropil)fenol | 417-470-1 | Muta.
2 Skin Sens. 1 |
H341 H317 |
GHS08 GHS07 Wng |
H341 H317 |
CLP00 | ||||
| 603-166-00-8 | R-1-chloro-2,3-epoxypropane | R-1-klór-2,3-epoxipropán | 424-280-2 | 51594-55-9 | Flam.
Liq. 3 Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 |
H226 H350 H331 H311 H301 H314 H317 |
GHS02 GHS06 GHS08 GHS05 Dgr |
H226 H350 H331 H311 H301 H314 H317 |
CLP00 | |||
| 603-167-00-3 | 3,3',5,5'-tetra-tert-butylbiphenyl-2,2'-diol | 3,3’,5,5’-tetra-terc-butilbifenil-2,2’-diol | 407-920-5 | 6390-69-8 | Aquatic
Chronic 4 |
H413 |
GHS05 Dgr |
H413 |
CLP00 | |||
| 603-168-00-9 | 3-(2-ethylhexyloxy)propane-1,2-diol | 3-(2-etilhexiloxi)propán-1,2-diol | 408-080-2 | 70445-33-9 | Eye
Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
CLP00 | |||
| 603-169-00-4 | (±)-trans-4-(4-fluorophenyl)-3-hydroxymethyl-N-methylpiperidine | (±)-transz-4-(4-fluorfenil)-3-hidroximetil-N-metilpiperidin | 415-550-0 | 109887-53-8 | Acute
Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
CLP00 | |||
| 603-170-00-X | reaction mass of: 2-methyl-1-(6-methylbicyclo[2.2.1]hept-5-en-2-yl)pent-1-en-3-ol; 2-methyl-1-(1-methylbicyclo[2.2.1]hept-5-en-2-yl)-pent-1-en-3-ol; 2-methyl-1-(5-methylbicyclo[2.2.1]hept-5-en-2-yl)pent-1-en-3-ol | 2-metil-1-(6-metilbiciklo[2.2.1]hept-5-én-2-il)pent-1-én-3-ol; 2-metil-1-(1-metilbiciklo[2.2.1]hept-5-én-2-il)-pent-1-én-3-ol; 2-metil-1-(5-metilbiciklo[2.2.1]hept-5-én-2-il)pent-1-én-3-ol keveréke | 415-990-3 | 67739-11-1 | Eye
Irrit. 2 Aquatic Chronic 2 |
H319 H411 |
GHS07 GHS09 Wng |
H319 H411 |
CLP00 | |||
| 603-171-00-5 | 5-thiazolylmethanol | 5-tiazolilmetanol | 414-780-9 | 38585-74-9 | Eye
Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
CLP00 | |||
| 603-172-00-0 | mono-2-[2-(4-dibenzo[b,f][1,4]thiazepin-11-yl)piperazinium-1-yl]ethoxy)ethanol trans-butenedioate | mono-2-[2-(4-dibenzo[b, f][1,4]tiazepin-11-il)-piperazinium-1-il]etoxi)etanol-transzbutén-dioát | 415-180-1 | 773058-82-5 | Acute
Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
CLP00 | |||
| 603-173-00-6 | 4,4-dimethyl-3,5,8-trioxabicyclo[5.1.0]octane | 4,4-dimetil-3,5,8-trioxabiciklo[5.1.0]oktán | 421-750-9 | 57280-22-5 | Eye
Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
CLP00 | |||
| 603-174-00-1 | 4-cyclohexyl-2-methyl-2-butanol | 4-ciklohexil-2-metil-2-butanol | 420-630-3 | 83926-73-2 | Eye
Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
CLP00 | |||
| 603-175-00-7 | 2-(2-hexyloxyethoxy)ethanol; DEGHE; diethylene glycol monohexyl ether; 3,6-dioxa-1-dodecanol; hexyl carbitol; 3,6-dioxadodecan-1-ol | 2-(2-hexiloxietoxi)etanol; DEGHE; dietilén-glikol-monohexil-éter; 3,6-dioxa-1-dodekanol; hexil-karbitol; 3,6-dioxadodekán-1-ol | 203-988-3 | 112-59-4 | Acute
Tox. 4 * Eye Dam. 1 |
H312 H318 |
GHS05 GHS07 Dgr |
H312 H318 |
CLP00 | |||
| 603-176-00-2 | 1,2-bis(2-methoxyethoxy)ethane; TEGDME; triethylene glycol dimethyl ether; triglyme | 1,2-bisz(2-metoxietoxi)etán; TEGDME; trietilén-glikol-dimetil-éter; triglim | 203-977-3 | 112-49-2 | Repr.
1B |
H360Df |
GHS08 Dgr |
H360Df |
EUH019 |
CLP00 | ||
| 603-177-00-8 | 1-ethoxypropan-2-ol;
2PG1EE; 1-ethoxy-2-propanol; propylene glycol monoethyl ether [1] 2-ethoxy-1-methylethyl acetate; 2PG1EEA [2] |
1-etoxipropán-2-ol; 2PG1EE; 1-etoxi-2-propanol; propilén-glikol-monoetil-éter; [1] 2-etoxi-1-metiletil-acetát; 2PG1EEA [2] | 216-374-5
[1] 259-370-9 [2] |
1569-02-4
[1] 54839-24-6 [2] |
Flam.
Liq. 3 STOT SE 3 |
H226 H336 |
GHS02 GHS07 Wng |
H226 H336 |
CLP00 | |||
| 603-178-00-3 | 2-hexyloxyethanol; ethylene glycol monohexyl ether; n-hexylglycol | 2-hexiloxietanol; etilén-glikol-monohexil-éter; n-hexilglikol | 203-951-1 | 112-25-4 | Acute
Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
CLP00 | |||
| 603-179-00-9 | ergocalciferol (ISO); Vitamin D2 | ergokalciferol (ISO); D2-vitamin | 200-014-9 | 50-14-6 | Acute
Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 |
H330 H311 H301 H372 ** |
GHS06 GHS08 Dgr |
H330 H311 H301 H372 ** |
CLP00 | |||
| 603-180-00-4 | colecalciferol; cholecalciferol; Vitamin D3 |
kolekalciferol; D3-vitamin |
200-673-2 | 67-97-0 | Acute
Tox. 2 Acute Tox. 2 Acute Tox. 2 STOT RE 1 |
H330 H310 H300 H372 |
GHS06 GHS08 Dgr |
H330 H310 H300 H372 |
Inhalation:
ATE = 0.05 mg/L (dusts/mists) Dermal: ATE = 50 mg/kg Oral: ATE = 35 mg/kg STOT RE 1; H372: C ≥ 3 % STOT RE 2; H373: 0,3 % ≤ C < 3 % |
CLP00/ATP13 | ||
| 603-181-00-X | tert-butyl methyl ether; MTBE; 2-methoxy-2-methylpropane | terc-butil-metil-éter; MTBE; 2-metoxi-2-metilpropán | 216-653-1 | 1634-04-4 | Flam.
Liq. 2 Skin Irrit. 2 |
H225 H315 |
GHS02 GHS07 Dgr |
H225 H315 |
CLP00 | |||
| 603-182-00-5 | reaction product of: saturated, monounsaturated and multiple unsaturated long-chained partly estrified alcohols of vegetable origin (Brassica napus L., Brassica rapa L., Helianthus annuus L., Glycine hispida, Gossypium hirsutum L., Cocos nucifera L., Elaeis guineensis) with O,O-diisobutyldithiophosphate and 2-ethylhexylamine and hydrogen peroxide | telített, egyszeresen és többszörösen telítetlen, hosszú láncú, részben észterezett, növényi eredetű alkoholok (Brassica napus L., Brassica rapa L., Helianthus annuus L., Glycine hispida, Gossypium hirsutum L., Cocos nucifera L., Elaeis guineensis) és O, O-diizobutil-ditiofoszfát, 2-etil-hexil-amin és hidrogén-peroxid reakcióterméke | 428-630-5 | - | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
ATP01 | |||
| 603-183-00-0 | 2-[2-(2-butoxyethoxy)ethoxy]ethanol; TEGBE; triethylene glycol monobutyl ether; butoxytriethylene glycol | 2-[2-(2-butoxietoxi)etoxi]etanol; TEGBE; trietilén-glikol-monobutil-éter; butoxitrietilén-glikol | 205-592-6 | 143-22-6 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
Eye
Dam. 1; H318: C ≥ 30 % Eye Irrit. 2; H319: 20 % ≤ C < 30 % |
CLP00 | ||
| 603-184-00-6 | 2-(hydroxymethyl)-2-[[2-hydroxy-3-(isooctadecyloxy)propoxy]methyl]-1,3-propanediol | 2-(hidroximetil)-2-[[2-hidroxi-3-(izooktadeciloxi)propoxi]metil]-1,3-propándiol | 416-380-1 | 146925-83-9 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 603-185-00-1 | 2,4-dichloro-3-ethyl-6-nitrophenol | 2,4-diklór-3-etil-6-nitrofenol | 420-740-1 | 99817-36-4 | Acute
Tox. 3 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H318 H317 H400 H410 |
GHS06 GHS05 GHS09 Dgr |
H301 H318 H317 H410 |
CLP00 | |||
| 603-186-00-7 | trans-(5RS,6SR)-6-amino-2,2-dimethyl-1,3-dioxepan-5-ol | transz-(5RS,6SR)-6-amino-2,2-dimetil-1,3-dioxepán-5-ol | 419-050-3 | 79944-37-9 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 603-187-00-2 | 2-((4,6-bis(4-(2-(1-methylpyridinium-4-yl)vinyl)phenylamino)-1,3,5-triazin-2-yl)(2-hydroxyethyl)amino)ethanol dichloride | 2-((4,6-bisz(4-(2-(1-metilpiridinium-4-il)vinil)fenilamino)-1,3,5-triazin-2-il)(2-hidroxietil)amino)etanol-diklorid | 419-360-9 | 163661-77-6 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 603-188-00-8 | reaction mass of: 6,7-epoxy-1,2,3,4,5,6,7,8-octahydro-1,1,2,4,4,7-hexamethylnaphthalene; 7,8-epoxy-1,2,3,4,6,7,8,8a-octahydro-1,1,2,4,4,7-hexamethylnaphthalene | 6,7-epoxi-1,2,3,4,5,6,7,8-oktahidro-1,1,2,4,4,7-hexametil-naftalin; 7,8-epoxi-1,2,3,4,6,7,8,8a-oktahidro-1,1,2,4,4,7-hexametil-naftalin keveréke | 426-970-9 | - | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
ATP01 | |||
| 603-189-00-3 | reaction mass of complexes of: titanium, 2,2'-oxydiethanol, ammonium lactate, nitrilotris(2-propanol) and ethylene glycol | titán, 2,2’-oxidietanol, ammónium-laktát, nitrilotrisz(2-propanol) és etilén-glikol komplexek keveréke | 405-250-8 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | ||||
| 603-190-00-9 | 8,8-dimethyl-7-isopropyl-6,10-dioxaspiro[4.5]decane | 8,8-dimetil-7-izopropil-6,10-dioxaspiro[4,5]dekán | 424-030-2 | 62406-73-9 | Skin
Irrit. 2 Aquatic Chronic 3 |
H315 H412 |
GHS07 Wng |
H315 H412 |
ATP01 | |||
| 603-191-00-4 | 2-(4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl)-5-(3-((2-ethylhexyl)oxy)-2-hydroxypropoxy)phenol | 2-(4,6-bisz(2,4-dimetilfenil)-1,3,5-triazin-2-il)-5-(3-((2-etilhexil)oxi)-2-hidroxipropoxi)fenol | 419-740-4 | 137658-79-8 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 603-192-00-X | (E,E)-3,7,11-trimethyldodeca-1,4,6,10-tetraen-3-ol | (E,E)-3,7,11-trimetildodeka-1,4,6,10-tetraen-3-ol | 423-240-1 | 125474-34-2 | Skin
Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H410 |
ATP01 | |||
| 603-193-00-5 | disodium 9,10-anthracenedioxide | dinátrium-9,10-antracén-dioxid | 426-030-8 | 46492-07-3 | Skin
Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
ATP01 | |||
| 603-194-00-0 | 2-(2-aminoethylamino)ethanol; (AEEA) | 2-(2-aminoetilamino)etanol; (AEEA) | 203-867-5 | 111-41-1 | Repr.
1B Skin Corr. 1B Skin Sens. 1 |
H360Df H314 H317 |
GHS05 GHS08 GHS07 Dgr |
H314 H317 H360Df |
STOT
SE 3; H335: C ≥ 5 % |
ATP01/ATP01corr | ||
| 603-195-00-6 | 2-[4-(4-methoxyphenyl)-6-phenyl-1,3,5-triazin-2-yl]-phenol | 2-[4-(4-metoxifenil)-6-fenil-1,3,5-triazin-2-il]fenol | 430-810-3 | 154825-62-4 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | ||||
| 603-196-00-1 | 2-(7-ethyl-1H-indol-3-yl)ethanol | 2-(7-etil-1H-indol-3-il)etanol | 431-020-1 | 41340-36-7 | Acute
Tox. 4 * STOT RE 2 * Aquatic Chronic 2 |
H302 H373 ** H411 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H411 |
CLP00 | |||
| 603-197-00-7 | tebuconazole (ISO); 1-(4-chlorophenyl)-4,4-dimethyl-3-(1,2,4-triazol-1-ylmethyl)pentan-3-ol | tebukonazol (ISO); 1-(4-klór-fenil)-4,4-dimetil-3-(1,2,4-triazol-1-il-metil)pentán-3-ol | 403-640-2 | 107534-96-3 | Repr.
2 Acute Tox. 4 Aquatic Acute 1 Aquatic Chronic 1 |
H361d
*** H302 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H361d *** H410 |
M=1 M=10 |
CLP00/ATP07 | ||
| 603-199-00-8 | etoxazol (ISO); (RS)-5-tert-butyl-2-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenetole | etoxazol (ISO); (RS)-5-terc-butil-2-[2-(2,6-difluorfenil)-4,5-dihidro-1,3-oxazol-4-il]fenetol | 153233-91-1 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
M=100 |
CLP00 | |||
| 603-200-00-1 | 1-pentanol
[1] 3-pentanol [2] |
1-pentanol; [1] 3-pentanol [2] | 200-752-1
[1] 209-526-7 [2] |
71-41-0
[1] 584-02-1 [2] |
Flam.
Liq. 3 Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 |
H226 H332 H335 H315 |
GHS02 GHS07 Wng |
H226 H332 H335 H315 |
ATP01 | |||
| 603-201-00-7 | (E)-(7R,11R)-3,7,11,15-tetramethylhexadec-2-ene-1-ol | (E)-(7R,11R)-3,7,11,15-tetrametil-hexadec-2-én-1-ol | 416-120-5 | - | Skin
Irrit. 2 Aquatic Chronic 4 |
H315 H413 |
GHS07 Wng |
H315 H413 |
ATP01 | |||
| 603-202-00-2 | 4,4,5,5,5-pentafluoropentan-1-ol | 4,4,5,5,5-pentafluorpentán-1-ol | 421-360-9 | 148043-73-6 | Acute
Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
ATP01 | |||
| 603-203-00-8 | (1R,3S,7R,8R,10R,13R)-5,5,7,9,9,13-hexamethyl-4,6-dioxatetracyclo[6.5.1.01,10.03,7]tetradecane | (1R,3S,7R,8R,10R,13R)-5,5,7,9,9,13-hexametil-4,6-dioxa-tetraciklo([6.5.1.01,10.03,7]tetradekán | 427-580-1 | - | Skin
Irrit. 2 |
H315 |
GHS07 Wng |
H315 |
ATP01 | |||
| 603-204-00-3 | reaction mass of: 2,2'-(heptane-1,7-diyl)bis-1,3-dioxolane; 2,2'-(heptane-1,6-diyl)bis-1,3-dioxolane | 2,2'-(heptán-1,7-diil)bisz-1,3-dioxolán; 2,2'-(heptán-1,6-diil)bisz-1,3-dioxolán keveréke | 428-110-8 | - | Aquatic
Chronic 3 |
H412 |
- |
H412 |
ATP01 | |||
| 603-205-00-9 | (1S-cis)-4-(2-amino-6-chloro-9H-purin-9-yl)-2-cyclopentene-1-methanol hydrochloride | (1S-cisz)-4-(2-amino-6-klór-9H-purin-9-il)-2-ciklopentén-1-metanol-hidroklorid | 426-200-1 | 172015-79-1 | Acute
Tox. 4 * STOT RE 1 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H302 H372 ** H318 H317 H412 |
GHS05 GHS08 GHS07 Dgr |
H372
** H302 H318 H317 H412 |
ATP01 | |||
| 603-206-00-4 | 2,2-dichloro-1,3-benzodioxol | 2,2-diklór-1,3-benzodioxol | 426-850-6 | 2032-75-9 | Flam.
Liq. 3 Acute Tox. 4 * Skin Corr. 1A Skin Sens. 1 |
H226 H302 H314 H317 |
GHS02 GHS05 GHS07 Dgr |
H226 H314 H302 H317 |
EUH014 |
ATP01 | ||
| 603-207-00-X | 2-isobutyl-2-isopropyl-1,3-dimethoxypropane | 2-izobutil-2-izopropil-1,3-dimetoxipropán | 430-800-9 | 129228-21-3 | Skin
Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
ATP01 | |||
| 603-208-00-5 | 1,2-diethoxyethane | 1,2-dietoxietán | 211-076-1 | 629-14-1 | Flam.
Liq. 2 Repr. 1A Eye Irrit. 2 |
H225 H360Df H319 |
GHS02 GHS08 GHS07 Dgr |
H225 H360Df H319 |
EUH019 |
ATP01 | ||
| 603-209-00-0 | spinosad
(ISO) (reaction mass of spinosyn A and spinosyn D in ratios between 95:5 to
50:50); reaction mass of 50-95% of
(2R,3aS,5aR,5bS,9S,13S,14R,16aS,16bR)-2-(6-deoxy-2,3,4-tri-O-methyl-α-.sc.l.sc.-mannopyranosyloxy)-13-(4-dimethylamino-2,3,4,6-tetradeoxy-β-.sc.d.sc.-erythropyranosyloxy)-9-ethyl-2,3,3a,5a,5b,6,7,9,10,11,12,13,14,15,16a,16b-hexadecahydro-14-methyl-1H-8-oxacyclododeca[b]as-indacene-7,15-dione
and 50-5%
(2S,3aR,5aS,5bS,9S,13S,14R,16aS,16bS)-2-(6-deoxy-2,3,4-tri-O-methyl-α-.sc.l.sc.-mannopyranosyloxy)-13-(4-dimethylamino-2,3,4,6-tetradeoxy-β-.sc.d.sc.-erythropyranosyloxy)-9-ethyl-2,3,3a,5a,5b,6,7,9,10,11,12,13,14,15,16a,16b-hexadecahydro-4,14-dimethyl-1H-8-oxacyclododeca[b]as-indacene-7,15-dione
[1] spinosyn A [2] spinosyn D [3] |
spinozad (ISO) (spinozin A és spinozin D 95:5 – 50:50 arányú keveréke); 50-95 % (2R,3aS,5aR,5bS,9S,13S,14R,16aS,16bR)-2-(6-dezoxi-2,3,4-tri-O-metil-α-L-mannopiranoziloxi)-13-(4-dimetilamino-2,3,4,6-tetradezoxi-β-D-eritropiranoziloxi)-9-etil-2,3,3a,5a,5b,6,7,9,10,11,12,13,14,15,16a,16b-hexadekahidro-14-metil-1H-8-oxaciklododeka[b]asz-indacén-7,15-dion és 50-5 % (2S,3aR,5aS,5bS,9S,13S,14R,16aS,16bS)-2-(6-dezoxi-2,3,4-tri-O-metil-α-L-mannopiranoziloxi)-13-(4-dimetilamino-2,3,4,6-tetradezoxi-β-D-eritropiranoziloxi)-9-etil-2,3,3a,5a,5b,6,7,9,10,11,12,13,14,15,16a,16b-hexadekahidro-4,14-dimetil-1H-8-oxaciklododeka[b]asz-indacén-7,15-dion keveréke; [1] spinozin A; [2] spinozin D [3] | 131929-60-7
[2] 131929-63-0 [3] |
Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
M=10 |
ATP01 | |||
| 603-210-00-6 | 2,4-diethyl-1,5-pentanediol | 2,4-dietil-1,5-pentándiol | 429-310-8 | 57987-55-0 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 603-211-00-1 | 2,3-epoxypropyltrimethylammonium chloride ...%; glycidyl trimethylammonium chloride ...% | 2,3-epoxipropil-trimetilammónium-klorid …%; glicidil-trimetilammónium-klorid …% | 221-221-0 | 3033-77-0 | Carc.
1B Muta. 2 Repr. 2 Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H350 H341 H361f *** H312 H302 H373 ** H318 H317 H412 |
GHS05 GHS08 GHS07 Dgr |
H350 H341 H361f *** H312 H302 H373 ** H318 H317 H412 |
B | ATP01 | ||
| 603-212-00-7 | 1,3,4,6,7,8-hexahydro-4,6,6,7,8,8-hexamethylindeno[5,6-c]pyran; galaxolide; (HHCB) | 1,3,4,6,7,8-hexahidro-4,6,6,7,8,8-hexametilindeno[5,6-c]pirán; galaxolid; (HHCB) | 214-946-9 | 1222-05-5 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
ATP01 | |||
| 603-213-00-2 | 2-methoxy-2-methylbutane; tert-amyl methyl ether | 2-metoxi-2-metilbután;terc-amil-metil-éter | 213-611-4 | 994-05-8 | Flam.
Liq. 2 Acute Tox. 4 * STOT SE 3 |
H225 H302 H336 |
GHS02 GHS07 Dgr |
H225 H302 H336 |
ATP01 | |||
| 603-214-00-8 | 1,1-diisopropoxycyclohexane | 1,1-diizopropoxiciklohexán | 413-740-8 | 1132-95-2 | Skin
Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
ATP01 | |||
| 603-215-00-3 | 1-hydroxy-4-fluoro-1,4-diazoniabicyclo[2.2.2]octane bis(tetrafluoroborate) | 1-hidroxi-4-fluor-1,4-diazoniabiciklo[2.2.2]oktán-bisz(tetrafluorborát) | 418-330-2 | 162241-33-0 | Expl.
1.1 **** Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H201 H302 H373 ** H318 H317 H400 H410 |
GHS01 GHS05 GHS08 GHS07 GHS09 Dgr |
H201 H302 H373 ** H318 H317 H410 |
ATP01 | |||
| 603-216-00-9 | cis-1-amino-2,3-dihydro-1H-inden-2-ol | cisz-1-amino-2,3-dihidro-1H-indén-2-ol | 422-660-2 | 7480-35-5 | Eye
Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
ATP01 | |||
| 603-217-00-4 | 2,4,6-tri-tert-butylphenyl 2-butyl-2-ethyl-1,3-propanediolphosphite | 2,4,6-tri-terc-butilfenil-2-butil-2-etil-1,3-propándiol-foszfit | 423-560-1 | 161717-32-4 | Skin
Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
ATP01 | |||
| 603-220-00-0 | 1-{benzyl[2-(2-methoxyphenoxy)ethyl]amino}-3-(9H-carbazol-4-yloxy)propan-2-ol | 1-{benzil[2-(2-metoxifenoxi)etil]amino}-3-(9H-karbazol-4-iloxi)propán-2-ol | 432-890-5 | 72955-94-3 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 603-221-00-6 | 1-(2-amino-5-chlorophenyl)-2,2,2-trifluoro-1,1-ethanediol, hydrochloride; [containing < 0.1 % 4-chloroaniline (EC No 203-401-0)] | 1-(2-amino-5-klórfenil)-2,2,2-trifluor-1,1-etándiol, hidroklorid; [<0,1 % 4-klóranilint (EK-szám: 203-401-0) tartalmaz] | 433-580-2 | 214353-17-0 | Acute
Tox. 4 * Skin Corr. 1B Aquatic Chronic 2 |
H302 H314 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H411 |
ATP01 | |||
| 603-221-01-3 | 1-(2-amino-5-chlorophenyl)-2,2,2-trifluoro-1,1-ethanediol, hydrochloride; [containing ≥ 0.1 % 4-chloroaniline (EC No 203-401-0)] | 1-(2-amino-5-klórfenil)-2,2,2-trifluor-1,1-etándiol, hidroklorid; [≥0,1 % 4-klóranilint (EK-szám: 203-401-0) tartalmaz] | 433-580-2 | 214353-17-0 | Carc.
1B Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 2 |
H350 H302 H314 H411 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H350 H302 H314 H411 |
ATP01 | |||
| 603-222-00-1 | (2R,3S,4R,5R,7R,9R,10R,11S,12S,13R)-10-[(4-dimethylamino-3-hydroxy-6-methyltetrahydropyran-2-yl)oxy]-2-ethyl-3,4,12-trihydroxy-9-methoxy-3,5,7,9,11,13-hexamethyl-6,14-dioxo-1-oxacyclotetradecane | (2R,3S,4R,5R,7R,9R,10R,11S,12S,13R)10-[(4-dimetilamino-3-hidroxi-6-metiltetrahidropirán-2-il)oxi]-2-etil-3,4,12-trihidroxi-9-metoxi-3,5,7,9,11,13-hexametil-6,14-dioxo-1-oxaciklotetradekán | 433-820-6 | 118058-74-5 | Eye
Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
ATP01 | |||
| 603-223-00-7 | 2-cyclopentylidene cyclopentanol; 1,1'-bi(cyclopentyliden)-2-ol | 2-ciklopentilidén-ciklopentanol; 1,1'-bi(ciklopentilidén)-2-ol | 434-270-1 | 6261-30-9 | Skin
Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H315 H318 H412 |
GHS05 Dgr |
H315 H318 H412 |
ATP01 | |||
| 603-224-00-2 | 3-ethoxy-1,1,1,2,3,4,4,5,5,6,6,6-dodecafluoro-2-(trifluoromethyl)-hexane | 3-etoxi-1,1,1,2,3,4,4,5,5,6,6,6-dodekafluor-2-(trifluormetil)hexán | 435-790-1 | 297730-93-9 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 603-225-00-8 | erythromycin A9-oxime (E); (3R,4S,5S,6R,7R,9R,11R,12R,13S,14R)-4-((2,6-didesoxy-3-C-methyl-3-O-methyl-α-L-ribo-hexopiranosyl)oxy)-14-ethyl-7,12,13-trihydroxy-3,5,7,9,11,13-hexamethyl-6-((3,4,6-tridesoxy-3-dimethylamino-β-.sc.d.sc.-xylohexapiranosyl)oxy)oxacyclotetradecan-2-ona-10-oxime (E) | eritromicin A9-oxim (E); (3R,4S,5S,6R,7R,9R,11R,12R,13S,14R)-4-((2,6,-didezoxi-3-C-metil-3-O-metil-α-L-ribo-hexopiranozil)oxi)-14-etil-7,12,13-trihidroxi-3,5,7,9,11,13-hexametil-6-((3,4,6-tridezoxi-3-dimetilamino-β-D-xilohexapiranozil)oxi)oxaciklotetradekán-2-ona-10-oxim (E) | 437-070-0 | 13127-18-9 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
ATP01 | |||
| 603-226-00-3 | 4,4'(4-(4-methoxyphenyl)-1,3,5-triazin-2,4-diyl)bisbenzene-1,3-diol | 4,4'(4-(4-metoxifenil)-1,3,5-triazin-2,4-diil)biszbenzol-1,3-diol | 444-500-0 | 1440-00-2 | Aquatic
Chronic 3 |
H412 |
- |
H412 |
ATP01 | |||
| 603-227-00-9 | α-hydro-ω-[[[(1,1-dimethylethyl)dioxy]carbonyl]oxy]-poly[oxy(methyl-1,2-ethanediyl)] ether with 2,2-bis(hydroxymethyl)-1,3-propanediol (4:1); reaction product of: α-hydro-ω-((chlorocarbonyl)oxy)-poly(oxy(methyl-1,2-ethanediyl)) ether with 2,2-bis(hydroxymethyl)-1,3-propanediol with potassium 1,1-dimethylethylperoxalate | α-hidro-ω-[[[(1,1-dimetiletil)dioxi]karbonil]oxi]poli[oxi(metil-1,2-etándiil)]-éter 2,2-bisz(hidroximetil)-1,3-propándiollal (4:1); α-hidro-ω-((klórkarbonil)oxi)poli(oxi(metil-1,2-etándiil))-éter 2,2-bisz(hidroximetil)-1,3-propándiol és kálium-1,1-dimetiletil-peroxalát reakcióterméke | 445-060-2 | 203574-04-3 | **** Aquatic Acute 1 Aquatic Chronic 1 |
**** H400 H410 |
**** GHS09 Wng |
**** H410 |
ATP01 | |||
| 603-228-00-4 | (+/-)-(R*,R*)-6-fluoro-3,4-dihydro-2-oxiranyl-2H-1-benzopyran; 6-fluoro-2-(2-oxiranyl)chromane | (+/–)-(R*,R*)-6-fluor-3,4-dihidro-2-oxiranil-2H-1-benzopirán; 6-fluor-2-(2-oxiranil)kromán | 419-620-1 | - | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
ATP01 | |||
| 603-229-00-X | sodium (Z)-3-chloro-3-(4-chlorophenyl)-1-hydroxy-2-propene-1-sulfonate | nátrium-(Z)-3-klór-3-(4-klórfenil)-1-hidroxi-2-propén-1-szulfonát | 420-800-7 | - | Skin
Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H410 |
ATP01 | |||
| 603-230-00-5 | 2,6,6,7,8,8-hexamethyldecahydro-2H-indeno[4,5-b]furan | 2,6,6,7,8,8-hexametildekahidro-2H-indeno[4,5-b]furán | 440-030-5 | - | Skin
Irrit. 2 Eye Dam. 1 Aquatic Chronic 4 |
H315 H318 H413 |
GHS05 Dgr |
H315 H318 H413 |
ATP01 | |||
| 603-231-00-0 | (S)-1,1-diphenyl-1,2-propanediol | (S)-1,1-difenil-1,2-propándiol | 443-220-6 | - | Aquatic
Chronic 3 |
H412 |
- |
H412 |
ATP01 | |||
| 603-232-00-6 | 3,3,8,8,10,10-hexamethyl-9-[1-(4-oxiranylmethoxy-phenyl)-ethoxy]-1,5-dioxa-9-aza-spiro[5.5]undecane | 3,3,8,8,10,10-hexametil-9-[1-(4-oxiranilmetoxifenil)etoxi]-1,5-dioxa-9-aza-spiro[5.5]undekán | 444-420-6 | - | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 603-233-00-1 | reaction mass of: 4-(1,3a,4,6,7,7a-hexahydro-4,7-methanoinden-5-ylidene)-3-methylbutan-2-ol; 4-(3,3a,4,6,7,7a-hexahydro-4,7-methanoinden-5-ylidene)-3-methylbutan-2-ol; 1-(1,3a,4,6,7,7a-hexahydro-4,7-methanoinden-5-ylidene)pentan-3-ol; 1-(3,3a,4,6,7,7a-hexahydro-4,7-methanoinden-5-ylidene)pentan-3-ol; (E)-4-(3a,4,5,6,7,7a-hexahydro-1H-4,7-methanoinden-5-yl)-3-methylbut-3-en-2-ol; (E)-4-(3a,4,5,6,7,7a-hexahydro-3H-4,7-methanoinden-5-yl)-3-methylbut-3-en-2-ol | a következő anyagok keveréke: 4-(1,3a,4,6,7,7a-hexahidro-4,7-metanoindén-5-ilidén)-3-metilbután-2-ol; 4-(3,3a,4,6,7,7a-hexahidro-4,7-metanoindén-5-ilidén)-3-metilbután-2-ol; 1-(1,3a,4,6,7,7a-hexahidro-4,7-metanoindén-5-ilidén)pentán-3-ol; 1-(3,3a,4,6,7,7a-hexahidro-4,7-metanoindén-5-ilidén)pentán-3-ol; (E)-4-(3a,4,5,6,7,7a-hexahidro-1H-4,7-metanoindén-5-il)-3-metilbut-3-en-2-ol; (E)-4-(3a,4,5,6,7,7a-hexahidro-3H-4,7-metanoindén-5-il)-3-metilbut-3-en-2-ol | 444-430-0 | - | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
ATP01 | |||
| 603-234-00-7 | (1R,4R)-4-methoxy-2,2,7,7-tetramethyltricyclo(6.2.1.0(1,6))undec-5-ene | (1R, 4R)-4-metoxi-2,2,7,7-tetrametiltriciklo(6.2.1.0(1,6))undek-5-én | 444-480-3 | - | Skin
Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
ATP01 | |||
| 603-235-00-2 | linalool;
3,7-dimethyl-1,6-octadien-3-ol; dl-linalool [1] coriandrol; (S)-3,7-dimethyl-1,6-octadien-3-ol; d-linalool [2] licareol; (R)-3,7-dimethyl-1,6-octadien-3-ol; l-linalool [3] |
linalool;
3,7-dimetil-1,6-oktadién-3-ol; dl-linalool; [1] koriandrol; (S)-3,7-dimetil-1,6-oktadién-3-ol; d-linalool; [2] likareol; (R)-3,7-dimetil-1,6-oktadién-3-ol; l-linalool [3] |
201-134-4
[1] 204-810-7 [2] 204-811-2 [3] |
78-70-6
[1] 126-90-9 [2] 126-91-0 [3] |
Skin
Sens. 1B |
H317 |
GHS07 Wng |
H317 |
ATP10 | |||
| 603-236-00-8 | ethanol, 2,2'-iminobis-, N-(C13-15-branched and linear alkyl) derivs. | #HIÁNYZIK | 308-208-6 | 97925-95-6 | Repr.
1B |
H360D |
GHS08 Dgr |
H360D |
ATP14 | |||
| 603-237-00-3 | ipconazole (ISO); (1RS,2SR,5RS;1RS,2SR,5SR)-2-(4-chlorobenzyl)-5-isopropyl-1- (1H-1,2,4-triazol-1-ylmethyl)cyclopentanol | #HIÁNYZIK | 125225-28-7 | Repr.
1B Acute Tox. 4 STOT RE 2 Aquatic Chronic 1 |
H360D H302 H373 (eyes, skin, liver) H410 |
GHS08 GHS07 GHS09 Dgr |
H302 H360D H373 (eyes, skin, liver) H410 |
Oral:
ATE = 500 mg/kg M=100 |
ATP15 | |||
| 603-238-00-9 | bis(2-(2-methoxyethoxy)ethyl)ether; tetraglyme | #HIÁNYZIK | 205-594-7 | 143-24-8 | Repr.
1B |
H360FD |
GHS08 Dgr |
H360FD |
ATP15 | |||
| 603-239-00-4 | paclobutrazol (ISO); (2RS,3RS)-1-(4-chlorophenyl)-4,4-dimethyl- 2-(1H-1,2,4-triazol-1-yl)pentan-3-ol | #HIÁNYZIK | 76738-62-0 | Repr.
2 Acute Tox. 4 Acute Tox. 4 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H361d H332 H302 H319 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H332 H302 H319 H361d H410 |
Inhalation:
ATE = 3.13 mg/L (dusts/mists) Oral: ATE = 490 mg/kg M=10 M=10 |
ATP15 | |||
| 603-240-00-X | 2,2-bis(bromomethyl) propane-1,3-diol | #HIÁNYZIK | 221-967-7 | 3296-90-0 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H340 H350 |
ATP15 | |||
| 603-241-00-5 | geraniol; (2E)-3,7-dimethylocta-2,6-dien-1-ol | #HIÁNYZIK | 203-377-1 | 106-24-1 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
ATP15 | |||
| 604-001-00-2 | phenol; carbolic acid; monohydroxybenzene; phenylalcohol | fenol; karbolsav; monohidroxibenzol; fenilalkohol | 203-632-7 | 108-95-2 | Muta.
2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Skin Corr. 1B |
H341 H331 H311 H301 H373 ** H314 |
GHS06 GHS08 GHS05 Dgr |
H341 H331 H311 H301 H373 ** H314 |
* Skin Corr. 1B; H314: C ≥ 3 % Skin Irrit. 2; H315: 1 % ≤ C < 3 % Eye Irrit. 2; H319: 1 % ≤ C < 3 % |
CLP00 | ||
| 604-002-00-8 | pentachlorophenol | pentaklórfenol | 201-778-6 | 87-86-5 | Carc.
2 Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H330 H311 H301 H335 H315 H319 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H330 H311 H301 H319 H335 H315 H410 |
CLP00 | |||
| 604-003-00-3 | sodium
pentachlorophenolate [1] potassium pentachlorophenolate [2] |
nátrium-pentaklórfenolát; [1] kálium-pentaklórfenolát [2] | 205-025-2
[1] 231-911-3 [2] |
131-52-2
[1] 7778-73-6 [2] |
Carc.
2 Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H330 H311 H301 H335 H315 H319 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H330 H311 H301 H319 H335 H315 H410 |
CLP00 | |||
| 604-004-00-9 | m-cresol
[1] o-cresol [2] p-cresol [3] mix-cresol [4] |
m-krezol; [1] o-krezol; [2] p-krezol; [3] krezol izomerek keveréke [4] | 203-577-9
[1] 202-423-8 [2] 203-398-6 [3] 215-293-2 [4] |
108-39-4
[1] 95-48-7 [2] 106-44-5 [3] 1319-77-3 [4] |
Acute
Tox. 3 * Acute Tox. 3 * Skin Corr. 1B |
H311 H301 H314 |
GHS06 GHS05 Dgr |
H311 H301 H314 |
* |
C | CLP00 | |
| 604-005-00-4 | 1,4-dihydroxybenzene; hydroquinone; quinol | 1,4-dihidroxibenzol; hidrokinon; kinol | 204-617-8 | 123-31-9 | Carc.
2 Muta. 2 Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 |
H351 H341 H302 H318 H317 H400 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H351 H341 H302 H318 H317 H400 |
M=10 |
CLP00/ATP01 | ||
| 604-006-00-X | 3,4-xylenol
[1] 2,5-xylenol [2] 2,4-xylenol [3] 2,3-xylenol [4] 2,6-xylenol [5] xylenol [6] 2,4(or 2,5)-xylenol [7] |
3,4-xilenol; [1] 2,5-xilenol; [2] 2,4-xilenol; [3] 2,3-xilenol; [4] 2,6-xilenol; [5] xilenol; [6] 2,4(vagy 2,5)-xilenol [7] | 202-439-5
[1] 202-461-5 [2] 203-321-6 [3] 208-395-3 [4] 209-400-1 [5] 215-089-3 [6] 276-245-4 [7] |
95-65-8
[1] 95-87-4 [2] 105-67-9 [3] 526-75-0 [4] 576-26-1 [5] 1300-71-6 [6] 71975-58-1 [7] |
Acute
Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Aquatic Chronic 2 |
H311 H301 H314 H411 |
GHS06 GHS05 GHS09 Dgr |
H311 H301 H314 H411 |
C | CLP00 | ||
| 604-007-00-5 | 2-naphthol | 2-naftol | 205-182-7 | 135-19-3 | Acute
Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 |
H332 H302 H400 |
GHS07 GHS09 Wng |
H332 H302 H400 |
CLP00 | |||
| 604-008-00-0 | 2-chlorophenol
[1] 4-chlorophenol [2] 3-chlorophenol [3] chlorophenol [4] |
2-klórfenol; [1] 4-klórfenol; [2] 3-klórfenol; [3] klórfenol [4] | 202-433-2
[1] 203-402-6 [2] 203-582-6 [3] 246-691-4 [4] |
95-57-8
[1] 106-48-9 [2] 108-43-0 [3] 25167-80-0 [4] |
Acute
Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 2 |
H332 H312 H302 H411 |
GHS07 GHS09 Wng |
H332 H312 H302 H411 |
C | CLP00 | ||
| 604-009-00-6 | pyrogallol; 1,2,3-trihydroxybenzene | pirogallol; 1,2,3-trihidroxibenzol | 201-762-9 | 87-66-1 | Muta.
2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 3 |
H341 H332 H312 H302 H412 |
GHS08 GHS07 Wng |
H341 H332 H312 H302 H412 |
* |
CLP00 | ||
| 604-010-00-1 | resorcinol; 1,3-benzenediol | rezorcin; 1,3-benzoldiol | 203-585-2 | 108-46-3 | Acute
Tox. 4 * Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 |
H302 H315 H319 H400 |
GHS07 GHS09 Wng |
H302 H319 H315 H400 |
* |
CLP00 | ||
| 604-011-00-7 | 2,4-dichlorophenol | 2,4-diklórfenol | 204-429-6 | 120-83-2 | Acute
Tox. 3 * Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 2 |
H311 H302 H314 H411 |
GHS06 GHS05 GHS09 Dgr |
H311 H302 H314 H411 |
CLP00 | |||
| 604-012-00-2 | 4-chloro-o-cresol; 4-chloro-2-methyl phenol | 4-klór-o-krezol; 4-klór-2-metilfenol | 216-381-3 | 1570-64-5 | Acute
Tox. 3 * Skin Corr. 1A Aquatic Acute 1 |
H331 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H331 H314 H400 |
STOT
SE 3; H335: C ≥ 1 % |
CLP00 | ||
| 604-013-00-8 | 2,3,4,6-tetrachlorophenol | 2,3,4,6-tetraklórfenol | 200-402-8 | 58-90-2 | Acute
Tox. 3 * Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H315 H319 H400 H410 |
GHS06 GHS09 Dgr |
H301 H319 H315 H410 |
* Eye Irrit. 2; H319: C ≥ 5 % Skin Irrit. 2; H315: C ≥ 5 % |
CLP00 | ||
| 604-014-00-3 | chlorocresol; 4-chloro-m-cresol; 4-chloro-3-methylphenol |
klórkrezol; 4-klór-m-krezol; 4-klór-3-metilfenol |
200-431-6 | 59-50-7 | Acute
Tox. 4 STOT SE 3 Skin Corr. 1C Eye Dam. 1 Skin Sens. 1B Aquatic Acute 1 Aquatic Chronic 3 |
H302 H335 H314 H318 H317 H400 H412 |
GHS07 GHS05 GHS09 Dgr |
H302 H314 H317 H335 |
M=1 |
CLP00/ATP13 | ||
| 604-015-00-9 | 2,2'-methylenebis-(3,4,6-trichlorophenol); hexachlorophene | 2,2'-metilénbisz-(3,4,6-triklórfenol); hexaklorofén | 200-733-8 | 70-30-4 | Acute
Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
* |
CLP00 | ||
| 604-016-00-4 | 1,2-dihydroxybenzene; pyrocatechol |
1,2-dihidroxibenzol; pirokatechin |
204-427-5 | 120-80-9 | Carc.
1B Muta. 2 Acute Tox. 3 Acute Tox. 3 Skin Irrit. 2 Eye Irrit. 2 |
H350 H341 H311 H301 H315 H319 |
GHS08 GHS06 Dgr |
H311 H301 H315 H319 H341 H350 |
Dermal:
ATE = 600 mg/kg Oral: ATE = 300 mg/kg |
CLP00/ATP13 | ||
| 604-017-00-X | 2,4,5-trichlorophenol | 2,4,5-triklórfenol | 202-467-8 | 95-95-4 | Acute
Tox. 4 * Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H319 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H315 H410 |
* Eye Irrit. 2; H319: C ≥ 5 % Skin Irrit. 2; H315: C ≥ 5 % |
CLP00 | ||
| 604-018-00-5 | 2,4,6-trichlorophenol | 2,4,6-triklórfenol | 201-795-9 | 88-06-2 | Carc.
2 Acute Tox. 4 * Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H315 H319 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H319 H315 H410 |
CLP00 | |||
| 604-019-00-0 | dichlorophen (ISO) | diklórfen (ISO) | 202-567-1 | 97-23-4 | Acute
Tox. 4 * Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H410 |
CLP00 | |||
| 604-020-00-6 | 2-phenylphenol (ISO); biphenyl-2-ol; 2-hydroxybiphenyl | 2-fenilfenol (ISO); bifenil-2-ol; 2-hidroxibifenil; | 201-993-5 | 90-43-7 | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 |
H335 H315 H319 H400 |
GHS07 GHS09 Wng |
H319 H335 H315 H400 |
CLP00 | |||
| 604-021-00-1 | sodium 2-biphenylate; 2-phenylphenol, sodium salt | nátrium-2-bifenilát; 2-fenilfenol, nátriumsó | 205-055-6 | 132-27-4 | Acute
Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 |
H302 H335 H315 H318 H400 |
GHS05 GHS07 GHS09 Wng |
H302 H335 H315 H318 H400 |
CLP00 | |||
| 604-022-00-7 | 2,2-dimethyl-1,3-benzodioxol-4-ol | 2,2-dimetil-1,3-benzodioxol-4-ol | 400-900-7 | 22961-82-6 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | |||
| 604-023-00-2 | 2,4-dichloro-3-ethylphenol | 2,4-diklór-3-etilfenol | 401-060-4 | Skin
Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
CLP00 | ||||
| 604-024-00-8 | 4,4-isobutylethylidenediphenol | 4,4’-izobutiletilidéndifenol | 401-720-1 | 6807-17-6 | Repr.
1B Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H360F
*** H319 H400 H410 |
GHS08 GHS09 Dgr |
H360F
*** H319 H410 |
CLP00 | |||
| 604-025-00-3 | 2,5-bis(1,1-dimethylbutyl)hydroquinone | 2,5-bisz(1,1-dimetilbutil)hidrokinon | 400-220-0 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | ||||
| 604-026-00-9 | 2,2-spirobi(6-hydroxy-4,4,7-trimethylchromane) | 2,2’-spiro-bi(6-hidroxi-4,4,7-trimetilkromán) | 400-270-3 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | ||||
| 604-027-00-4 | 2-methyl-5-(1,1,3,3-tetramethylbutyl)hydroquinone | 2-metil-5-(1,1,3,3-tetrametilbutil)hidrokinon | 400-530-6 | Eye
Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H411 |
CLP00 | ||||
| 604-028-00-X | 4-amino-3-fluorophenol | 4-amino-3-fluorfenol | 402-230-0 | 399-95-1 | Carc.
1B Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H350 H302 H317 H411 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H317 H411 |
CLP00 | |||
| 604-029-00-5 | 1-naphtol | 1-naftol | 201-969-4 | 90-15-3 | Acute
Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 |
H312 H302 H335 H315 H318 |
GHS05 GHS07 Dgr |
H312 H302 H335 H315 H318 |
CLP00 | |||
| 604-030-00-0 | bisphenol A; 4,4’-isopropylidenediphenol | biszfenol
A; 4,4′-izopropilidén-difenol |
201-245-8 | 80-05-7 | Repr.
1B STOT SE 3 Eye Dam. 1 Skin Sens. 1 |
H360F H335 H318 H317 |
GHS08 GHS05 GHS07 Dgr |
H318 H317 H360F H335 |
CLP00/ATP09 | |||
| 604-031-00-6 | guaiacol | gvajakol | 201-964-7 | 90-05-1 | Acute
Tox. 4 * Skin Irrit. 2 Eye Irrit. 2 |
H302 H315 H319 |
GHS07 Wng |
H302 H319 H315 |
CLP00 | |||
| 604-032-00-1 | thymol | timol | 201-944-8 | 89-83-8 | Acute
Tox. 4 * Skin Corr. 1B Aquatic Chronic 2 |
H302 H314 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H411 |
CLP00 | |||
| 604-033-00-7 | isobutyl but-3-enoate | izobutil-but-3-enoát | 401-170-2 | 24342-03-8 | Flam.
Liq. 3 |
H226 |
GHS02 Wng |
H226 |
CLP00 | |||
| 604-034-00-2 | 4,4'-thiodi-o-cresol | 4,4’-tiodi-o-krezol | 403-330-7 | 24197-34-0 | Eye
Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
CLP00 | |||
| 604-035-00-8 | 4-nonylphenol, reaction products with formaldehyde and dodecane-1-thiol | 4-nonilfenol reakcióterméke formaldehiddel és dodekán-1-tiollal | 404-160-6 | Skin
Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
CLP00 | ||||
| 604-036-00-3 | 4,4'-oxybis(ethylenethio)diphenol | 4,4’-oxibisz(etiléntio)difenol | 404-590-4 | 90884-29-0 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | |||
| 604-037-00-9 | 3,5-xylenol; 3,5-dimethylphenol | 3,5-xilenol; 3,5-dimetilfenol | 203-606-5 | 108-68-9 | Acute
Tox. 3 * Acute Tox. 3 * Skin Corr. 1B |
H311 H301 H314 |
GHS06 GHS05 Dgr |
H311 H301 H314 |
CLP00 | |||
| 604-038-00-4 | 4-chloro-3,5-dimethylphenol
[1] chloroxylenol [2] |
4-klór-3,5-dimetilfenol; [1] klórxilenol [2] | 201-793-8
[1] 215-316-6 [2] |
88-04-0
[1] 1321-23-9 [2] |
Acute
Tox. 4 * Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H302 H315 H319 H317 |
GHS07 Wng |
H302 H319 H315 H317 |
CLP00 | |||
| 604-039-00-X | ethyl 2-[4-[(6-chlorobenzoxazol-2-yl)oxy]phenoxy]propionate; fenoxaprop-ethyl | etil-2[4-[(6-klórbenzoxazol-2-il)oxi]fenoxi]-propionát; fenoxaprop-etil | 266-362-9 | 66441-23-4 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
CLP00 | |||
| 604-040-00-5 | fomesafen (ISO); 5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-(methylsulphonyl)-2-nitrobenzamide | fomezafen (ISO); 5-[2-klór-4-(trifluormetil)fenoxi]-N-(metilszulfonil)-2-nitrobenzamid | 276-439-9 | 72178-02-0 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 604-041-00-0 | acifluorfen
(ISO); 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoic acid [1] sodium 5-[2-chloro-4-(trifluoromethyl) phenoxy]-2-nitrobenzoate; acifluorfen-sodium [2] |
acifluorfen (ISO); 5-[2-klór-4-(trifluormetil)fenoxi]-2-nitrobenzoesav [1] nátrium-5-[2-klór-4-(trifluormetil) fenoxi]-2-nitrobenzoát; acifluorfen-nátrium [2] | 256-634-5
[1] 263-560-7 [2] |
50594-66-6
[1] 62476-59-9 [2] |
Acute
Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H315 H318 H410 |
CLP00 | |||
| 604-042-00-6 | 4-nitrosophenol | 4-nitrozofenol | 203-251-6 | 104-91-6 | Muta.
2 Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H341 H302 H318 H411 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H341 H302 H318 H411 |
CLP00 | |||
| 604-043-00-1 | monobenzone; 4-hydroxyphenyl benzyl ether; hydroquinone monobenzyl ether | monobenzon; 4-hidroxifenil-benzil-éter; hidrokinon-monobenzil-éter | 203-083-3 | 103-16-2 | Eye
Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
CLP00 | |||
| 604-044-00-7 | mequinol; 4-methoxyphenol; hydroquinone monomethyl ether | mekvinol; 4-metoxifenol; hidrokinon-monometil-éter | 205-769-8 | 150-76-5 | Acute
Tox. 4 * Eye Irrit. 2 Skin Sens. 1 |
H302 H319 H317 |
GHS07 Wng |
H302 H319 H317 |
CLP00 | |||
| 604-045-00-2 | 2,3,5-trimethylhydroquinone | 2,3,5-trimetilhidrokinon | 211-838-3 | 700-13-0 | Acute
Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H335 H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H332 H335 H315 H318 H317 H410 |
CLP00 | |||
| 604-046-00-8 | 4-(4-isopropoxyphenylsulfonyl)phenol | 4-(4-izopropoxifenilszulfonil)fenol | 405-520-5 | 95235-30-6 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 604-047-00-3 | 4-(4-tolyloxy)biphenyl | 4-(4-toliloxi)bifenil | 405-730-7 | 51601-57-1 | STOT
RE 2 * Aquatic Chronic 4 |
H373
** H413 |
GHS08 Wng |
H373
** H413 |
CLP00 | |||
| 604-048-00-9 | 4,4',4''-(ethan-1,1,1-triyl)triphenol | 4,4',4''-(etán-1,1,1-triil)trifenol | 405-800-7 | 27955-94-8 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 604-049-00-4 | 4-4'-methylenebis(oxyethylenethio)diphenol | 4,4’-metilénbisz(oxietiléntio)difenol | 407-480-4 | 93589-69-6 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 604-051-00-5 | 3,5-bis((3,5-di-tert-butyl-4-hydroxy)benzyl)-2,4,6-trimethylphenol | 3,5-bisz((3,5-di-terc-butil-4-hidroxi)benzil)-2,4,6-trimetilfenol | 401-110-5 | 87113-78-8 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | ||||
| 604-052-00-0 | 2,2'-methylenebis(6-(2H-benzotriazol-2-yl)-4-(1,1,3,3-tetramethylbutyl)phenol) | 2,2’-metilénbisz(6-(2H-benzotriazol-2-il)-4-(1,1,3,3-tetrametilbutil)fenol) | 403-800-1 | 103597-45-1 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 604-053-00-6 | 2-methyl-4-(1,1-dimethylethyl)-6-(1-methyl-pentadecyl)-phenol | 2-metil-4-(1,1-dimetiletil)-6-(1-metilpentadecil)fenol | 410-760-9 | 157661-93-3 | Skin
Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H315 H317 H410 |
CLP00 | |||
| 604-054-00-1 | reaction mass of: 2-methoxy-4-(tetrahydro-4-methylene-2H-pyran-2-yl)-phenol; 4-(3,6-dihydro-4-methyl-2H-pyran-2-yl)-2-methoxyphenol | 2-metoxi-4-(tetrahidro-4-metilén-2H-pirán-2-il)fenol; 4-(3,6-dihidro-4-metil-2H-pirán-2-il)-2-metoxifenol keveréke | 412-020-0 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
CLP00 | ||||
| 604-055-00-7 | 2,2'-((3,3',5,5'-tetramethyl-(1,1'-biphenyl)-4,4'-diyl)-bis(oxymethylene))-bis-oxirane | 2,2'-((3,3',5,5'-tetrametil-(1,1'-bifenil)-4,4'-diil)-bisz(oximetilén))-bisz-oxirán | 413-900-7 | 85954-11-6 | Carc.
2 Skin Sens. 1 |
H351 H317 |
GHS08 GHS07 Wng |
H351 H317 |
CLP00/ATP01 | |||
| 604-056-00-2 | 2-(2-hydroxy-3,5-dinitroanilino)ethanol | 2-(2-hidroxi-3,5-dinitroanilino)etanol | 412-520-9 | 99610-72-7 | Flam.
Sol. 2 Repr. 2 Acute Tox. 4 * |
H228 H361f *** H302 |
GHS02 GHS07 GHS08 Dgr |
H228 H361f *** H302 |
CLP00 | |||
| 604-057-00-8 | reaction mass of: isomers of 2-(2H-benzotriazol-2-yl)-4-methyl-(n)-dodecylphenol; isomers of 2-(2H-benzotriazol-2-yl)-4-methyl-(n)-tetracosylphenol; isomers of 2-(2H-benzotriazol-2-yl)-4-methyl-5,6-didodecyl-phenol. n = 5 or 6 | a 2-(2H-benzotriazol-2-il)-4-metil-(n)-dodecilfenol izomereinek, a 2-(2H-benzotriazol-2-il)-4-metil-(n)-tetrakozilfenol izomereinek és a 2-(2H-benzotriazol-2-il)-4-metil-5,6-didodecilfenol izomereinek reakciótömege, n = 5 vagy 6 | 401-680-5 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00/ATP10 | |||||
| 604-058-00-3 | 1,2-bis(3-methylphenoxy)ethane | 1,2-bisz(3-metilfenoxi)etán | 402-730-9 | 54914-85-1 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 604-059-00-9 | 2-n-hexadecylhydroquinone | 2-n-hexadecilhidrokinon | 406-400-5 | STOT
RE 2 * Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 4 |
H373
** H315 H317 H413 |
GHS08 GHS07 Wng |
H373
** H315 H317 H413 |
CLP00 | ||||
| 604-060-00-4 | 9,9-bis(4-hydroxyphenyl)fluorene | 9,9-bisz(4-hidroxifenil)fluorén | 406-950-6 | 3236-71-3 | Skin
Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H319 H400 H410 |
GHS07 GHS09 Wng |
H319 H315 H410 |
CLP00 | |||
| 604-061-00-X | reaction mass of: 2-chloro-5-sec-tetradecylhydroquinones where sec-tetradecyl = 1-methyltridecyl; 1-ethyldodecyl; 1-propylundecyl; 1-butyldecyl; 1-pentylnonyl; 1-hexyloctyl | 2-klór-5-szek-tetradecilhidrokinonok, ahol szek-tetradecil= 1-metiltridecil; 1-etildodecil; 1-propilundecil; 1-butildecil; 1-pentilnonil; 1-hexiloktil keveréke | 407-740-7 | Skin
Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H315 H317 H412 |
GHS07 Wng |
H315 H317 H412 |
CLP00 | ||||
| 604-062-00-5 | 2,4-dimethyl-6-(1-methyl-pentadecyl)phenol | 2,4-dimetil-6-(1-metilpentadecil)fenol | 411-220-5 | Skin
Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H315 H317 H410 |
CLP00 | ||||
| 604-063-00-0 | 5,6-dihydroxyindole | 5,6-dihidroxiindol; | 412-130-9 | 3131-52-0 | Acute
Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
CLP00 | |||
| 604-064-00-6 | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-((hexyl)oxy)-phenol | 2-(4,6-difenil-1,3,5-triazin-2-il)-5-[(hexil)oxi]fenol | 411-380-6 | 147315-50-2 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 604-065-00-1 | 4,4',4''-(1-methylpropan-1-yl-3-ylidene)tris(2-cyclohexyl-5-methylphenol) | 4,4’,4”-(1-metilpropán-1-il-3-ilidén)trisz(2-ciklohexil-5-metilfenol) | 407-460-5 | 111850-25-0 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 604-066-00-7 | reaction mass of: phenol, 6-(1,1-dimethylethyl)-4-tetrapropyl-2-[(2-hydroxy-5-tetra-propylphenyl)methyl (C41-compound) and methane, 2,2'-bis[6-(1,1-dimethyl-ethyl)-1-hydroxy-4-tetrapropyl-phenyl)]- (C45-compound); 2,6-bis(1,1-dimethylethyl)-4-tetra-propyl-phenol and 2-(1,1-dimethylethyl)-4-tetrapropyl-phenol; 2,6-bis[(6-(1,1-dimethylethyl)-1-hydroxy-4-tetrapropylphenyl)methyl]-4-(tetrapropyl)phenol and 2-[(6-(1,1-dimethylethyl)-1-hydroxy-4-tetrapropylphenylmethyl]-6-[1-hydroxy-4-tetrapropylphenyl)methyl]-4-(tetrapropyl)phenol | a következő anyagok keveréke: fenol, 6-(1,1-dimetiletil)-4-tetrapropil-2-[(2-hidroxi-5- tetrapropilfenil)metil (C41-vegyület) és metán, 2,2’-bisz[6-(1,1-dimetiletil)-1-hidroxi-4-tetrapropilfenil)]-(C45-vegyület), 2,6-bisz(1,1-dimetiletil)-4-tetrapropilfenol és 2-(1,1-dimetiletil)-4-tetrapropilfenol; 2,6-bisz[(6-(1,1-dimetiletil)-1-hidroxi-4-tetrapropilfenil)metil]-4-(tetrapropil)fenol és 2-[(6-(1,1-dimetiletil)-1-hidroxi-4-tetrapropilfenilmetil]-6-[1-hidroxi-4-tetrapropilfenil)metil-4-(tetrapropil)fenol | 414-550-8 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | ||||
| 604-067-00-2 | reaction mass of: 2,2'-[[(2-hydroxyethyl)imino]bis(methylene)bis[4-dodecylphenol]; formaldehyde, oligomer with 4-dodecyl phenol and 2-aminoethanol(n = 2); formaldehyde, oligomer with 4-dodecyl phenol and 2-aminoethanol(n = 3, 4 and higher) | a következő anyagok keveréke: 2,2’-[[(2-hidroxietil)imino]bisz(metilén)bisz[4-dodecilfenol]; formaldehid 4-dodecilfenollal és 2-aminoetanollal (n = 2) képzett oligomere; formaldehid 4-dodecilfenollal és 2-aminoetanollal (n = 3, 4 vagy nagyobb) képzett oligomere | 414-520-4 | Skin
Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H400 H410 |
GHS05 GHS09 Dgr |
H315 H318 H410 |
CLP00 | ||||
| 604-068-00-8 | (±)-4-[2-[[3-(4-hydroxyphenyl)-1-methylpropyl]amino]-1-hydroxyethyl]phenol hydrochloride | (±)-4-[2-[[3-(4-hidroxifenil)-1-metilpropil]amino]-1-hidroxietil]fenol-hidroklorid | 415-170-5 | 90274-24-1 | Acute
Tox. 4 * Acute Tox. 4 * Skin Sens. 1 |
H332 H302 H317 |
GHS07 Wng |
H332 H302 H317 |
CLP00 | |||
| 604-069-00-3 | 2-(1-methylpropyl)-4-tert-butylphenol | 2-(1-metilpropil)-4-terc-butilfenol | 421-740-4 | 51390-14-8 | Skin
Corr. 1B Aquatic Chronic 2 |
H314 H411 |
GHS05 GHS09 Dgr |
H314 H411 |
CLP00 | |||
| 604-070-00-9 | triclosan; 2,4,4'-trichloro-2'-hydroxy-diphenyl-ether; 5-chloro-2-(2,4-dichlorophenoxy)phenol | triklozán; 2,4,4’-triklór-2’-hidroxidifenil-éter; 5-klór-2-(2,4-diklórfenoxi)fenol | 222-182-2 | 3380-34-5 | Skin
Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H319 H400 H410 |
GHS07 GHS09 Wng |
H319 H315 H410 |
M=100 |
CLP00 | ||
| 604-071-00-4 | 4,4'-(1-{4-[1-(4-hydroxyphenyl)-1-methylethyl]phenyl}ethylidene)diphenol | 4,4'-(1-{4-[1-(4-hidroxifenil)-1-metiletil]fenil}etilidén)difenol | 425-600-3 | 110726-28-8 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 604-072-00-X | 1,2-bis(phenoxymethyl)benzene | 1,2-bisz(fenoximetil)benzol | 428-620-0 | 10403-74-4 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
ATP01 | |||
| 604-073-00-5 | (E)-3-[1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol | (E)-3-[1-[4-[2-(dimetilamino)etoxi]fenil]-2-fenilbut-1-enil]fenol | 428-010-4 | 82413-20-5 | Carc.
2 Repr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H360F *** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H351 H360F *** H317 H410 |
ATP01 | |||
| 604-074-00-0 | tetrabromobisphenol-A; 2,2',6,6'-tetrabromo-4,4'-isopropylidenediphenol | tetrabróm-biszfenol-A; 2,2',6,6'-tetrabróm-4,4'-izopropilidéndifenol | 201-236-9 | 79-94-7 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
ATP01 | |||
| 604-075-00-6 | 4-(1,1,3,3-tetramethylbutyl)phenol; 4-tert-octylphenol | 4-(1,1,3,3-tetrametilbutil)fenol; 4-terc-oktilfenol | 205-426-2 | 140-66-9 | Skin
Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H400 H410 |
GHS05 GHS09 Dgr |
H315 H318 H410 |
M=10 |
ATP01 | ||
| 604-076-00-1 | phenolphthalein | fenolftalein | 201-004-7 | 77-09-8 | Carc.
1B Muta. 2 Repr. 2 |
H350 H341 H361f *** |
GHS08 Dgr |
H341 H350 H361f *** |
Carc.
1B; H350: C ≥ 1 % |
ATP01/ATP01corr | ||
| 604-077-00-7 | 2-benzotriazol-2-yl-4-methyl-6-(2-methylallyl)phenol | 2-benzotriazol-2-il-4-metil-6-(2-metilallil)fenol | 419-750-9 | 98809-58-6 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 604-079-00-8 | 4,4'-(1,3-phenylene-bis(1-methylethylidene))bis-phenol | 4,4'-(1,3-fenilén-bisz(1-metiletilidén))biszfenol | 428-970-4 | 13595-25-0 | Repr.
2 Skin Sens. 1 Aquatic Chronic 2 |
H361f
*** H317 H411 |
GHS08 GHS07 GHS09 Wng |
H317 H361f *** H411 |
ATP01/ATP01corr | |||
| 604-080-00-3 | 4-fluoro-3-trifluoromethylphenol | 4-fluor-3-trifluormetilfenol | 432-560-0 | 61721-07-1 | Acute
Tox. 4 * Skin Corr. 1A Skin Sens. 1 Aquatic Chronic 2 |
H332 H314 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H332 H314 H317 H411 |
ATP01 | |||
| 604-081-00-9 | 1,1-bis(4-hydroxyphenyl)-1-phenylethane | 1,1-bisz(4-hidroxifenil)-1-feniletán | 433-130-5 | 1571-75-1 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
ATP01 | |||
| 604-082-00-4 | 2-chloro-6-fluoro-phenol | 2-klór-6-fluorfenol | 433-890-8 | 2040-90-6 | Muta.
1B Repr. 2 Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H340 H361f *** H302 H314 H317 H411 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H340 H361f *** H302 H314 H317 H411 |
ATP01 | |||
| 604-083-00-X | 4,4'-sulfonylbisphenol, polymer with ammonium chloride(NH4Cl), pentachlorophosphorane and phenol | 4,4’-szulfonilbiszfenol polimere ammónium-kloriddal (NH4Cl), pentaklór-foszforánnal és fenollal | 439-270-3 | 260408-02-4 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 604-084-00-5 | 1-ethoxy-2,3-difluorobenzene | 1-etoxi-2,3-difluorbenzol | 441-000-4 | 121219-07-6 | Acute
Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
ATP01 | |||
| 604-087-00-1 | reaction mass of: 1,2-naphthoquinonediazide-5-sulfonylchloride (or sulfonic acid)monoester with 4,4'-(1-(4-(1-(4-hydroxyphenyl)-1-methylethyl)phenyl)ethylidene)bisphenol; 1,2-naphthoquinonediazide-5-sulfonylchloride (or sulfonic acid)diester with 4,4'-(1-(4-(1-(4-hydroxyphenyl)-1-methylethyl)phenyl)ethylidene)bisphenol; 1,2-naphthoquinonediazide-5-sulfonylchloride (or sulfonic acid)triester with 4,4'-(1-(4-(1-(4-hydroxyphenyl)-1-methylethyl)phenyl)ethylidene)bisphenol | a következő anyagok keveréke: 1,2-naftokinondiazid-5-szulfonil-klorid (vagy szulfonsav)monoészter 4,4'-(1-(4-(1-(4-hidroxifenil)-1-metiletil)fenil)etilidén)biszfenollal; 1,2-naftokinondiazid-5-szulfonil-klorid (vagy szulfonsav) diészter 4,4'-(1-(4-(1-(4-hidroxifenol)-1-metiletil)fenil)etilidén)biszfenollal; 1,2-naftokinondiazid-5-szulfonil-klorid (vagy szulfonsav)triészter 4,4'-(1-(4-(1-(4-hidroxifenol)-1-metiletil)fenil)etilidén)biszfenollal | 433-640-8 | - | Pyr.
Sol. 1 Aquatic Chronic 4 |
H250 H413 |
GHS02 Dgr |
H250 H413 |
EUH044 |
ATP01 | ||
| 604-089-00-2 | 2-methyl-5-tert-butylthiophenol | 2-metil-5-terc-butiltiofenol | 444-970-7 | - | Flam.
Liq. 3 Repr. 2 Asp. Tox. 1 STOT SE 3 STOT RE 2 * Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H361d *** H304 H336 H373 ** H315 H319 H317 H400 H410 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H226 H361d *** H373 ** H304 H319 H315 H317 H336 H410 |
ATP01 | |||
| 604-090-00-8 | 4-tert-butylphenol | 4-terc-butilfenol | 202-679-0 | 98-54-4 | Repr.
2 Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 1 |
H361f H315 H318 H410 |
GHS08 GHS05 GHS09 Dgr |
H315 H318 H361f H410 |
M=1 |
ATP06/ATP13 | ||
| 604-091-00-3 | etofenprox (ISO); 2-(4-ethoxyphenyl)-2-methylpropyl 3-phenoxybenzyl ether | etofénprox (ISO); 2-(4-etoxifenil)-2-metilpropil-3-fenoxibenzil-éter | 407-980-2 | 80844-07-1 | Lact. Aquatic Acute 1 Aquatic Chronic 1 |
H362 H400 H410 |
GHS09 Wng |
H362 H410 |
M=100 M=1000 |
ATP06 | ||
| 604-092-00-9 | phenol,
dodecyl-, branched [1] phenol, 2-dodecyl-, branched [2] phenol, 3-dodecyl-, branched [3] phenol, 4-dodecyl-, branched [4] phenol, (tetrapropenyl) derivatives [5] |
fenol,
dodecil-, elágazó; [1] fenol, 2-dodecil-, elágazó; [2] fenol, 3-dodecil-, elágazó; [3] fenol, 4-dodecil-, elágazó; [4] fenol, (tetrapropenil) származékok [5] |
310-154-3
[1] |
121158-58-5
[1] 210555-94-5 [4] 74499-35-7 [5] |
Repr.
1B Skin Corr. 1C Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360F H314 H318 H400 H410 |
GHS08 GHS05 GHS09 Dgr |
H314 H360F H410 |
M=10 M=10 |
ATP07/ATP09 | ||
| 604-093-00-4 | clorofene; chlorophene; 2-benzyl-4-chlorophenol |
klorofén; klorofén; 2-benzil-4-klórfenol |
204-385-8 | 120-32-1 | Carc.
2 Repr. 2 Acute Tox. 4 STOT RE 2 Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H361f H332 H373 (kidney) H315 H318 H317 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H332 H315 H318 H317 H351 H361f H373 (kidney) H410 |
M=1 M=100 |
ATP10 | ||
| 604-094-00-X | isoeugenol
[1] (E)-2-methoxy-4-(prop-1-enyl) phenol [2] (Z)-2-methoxy-4-(prop-1-enyl) phenol [3] |
izoeugenol;
[1] (E)-2-metoxi-4-(prop-1-enil)fenol; [2] (Z)-2-metoxi-4-(prop-1-enil)fenol [3] |
202-590-7
[1] 227-678-2 [2] 227-633-7 [3] |
97-54-1
[1] 5932-68-3 [2] 5912-86-7 [3] |
Skin
Sens. 1A |
H317 |
GHS07 Wng |
H317 |
Skin
Sens. 1A; H317: C ≥ 0,01 % |
ATP13 | ||
| 605-001-00-5 | formaldehyde …% | formaldehid …% | 200-001-8 | 50-00-0 | Carc.
1B Muta. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 |
H350 H341 H331 H311 H301 H314 H317 |
GHS08 GHS06 GHS05 Dgr |
H301 H311 H331 H314 H317 H341 H350 |
STOT
SE 3; H335: C ≥ 5 % Skin Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 5 % ≤ C < 25 % Eye Irrit. 2; H319: 5 % ≤ C < 25 % Skin Sens. 1; H317: C ≥ 0,2 % |
B D | CLP00/ATP06 | |
| 605-002-00-0 | 1,3,5-trioxan; trioxymethylene | 1,3,5-trioxán; trioximetilén | 203-812-5 | 110-88-3 | Flam.
Sol. 1 Repr. 2 STOT SE 3 |
H228 H361d *** H335 |
GHS02 GHS08 GHS07 Dgr |
H228 H361d *** H335 |
T | CLP00 | ||
| 605-003-00-6 | acetaldehyde; ethanal |
acetaldehid; etanal |
200-836-8 | 75-07-0 | Flam.
Liq. 1 Carc. 1B Muta. 2 STOT SE 3 Eye Irrit. 2 |
H224 H350 H341 H335 H319 |
GHS02 GHS08 GHS07 Dgr |
H224 H319 H341 H350 H335 |
CLP00/ATP13 | |||
| 605-004-00-1 | 2,4,6-trimethyl-1,3,5-trioxane; paraldehyde | 2,4,6-trimetil-1,3,5-trioxán; paraldehid | 204-639-8 | 123-63-7 | Flam.
Liq. 3 |
H226 |
GHS02 Wng |
H226 |
CLP00/ATP01 | |||
| 605-005-00-7 | metaldehyde (ISO); 2,4,6,8-tetramethyl- 1,3,5,7-tetraoxacyclooctane | 2,4,6,8-tetrametil-1,3,5,7-tetraoxaciklooktán; metaldehid | 203-600-2 | 108-62-3 | Flam.
Sol. 2 Repr. 2 Acute Tox. 3 Aquatic Chronic 3 |
H228 H361f H301 H412 |
GHS02 GHS06 GHS08 Dgr |
H228 H301 H361f H412 |
Oral:
ATE = 283 mg/kg |
CLP00/ATP14 | ||
| 605-006-00-2 | butyraldehyde | butiraldehid | 204-646-6 | 123-72-8 | Flam.
Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
CLP00 | |||
| 605-007-00-8 | 1,1-dimethoxyethane; dimethyl acetal | 1,1-dimetoxietán; dimetil-acetál | 208-589-8 | 534-15-6 | Flam.
Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
CLP00 | |||
| 605-008-00-3 | acrolein; prop-2-enal; acrylaldehyde | akrolein; prop-2-enal; akrilaldehid | 203-453-4 | 107-02-8 | Flam.
Liq. 2 Acute Tox. 1 Acute Tox. 2 Acute Tox. 3 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H225 H330 H300 H311 H314 H400 H410 |
GHS02 GHS06 GHS05 GHS09 Dgr |
H225 H300 H311 H330 H314 H410 |
EUH071 |
Skin
Corr. 1B; H314: C ≥ 0,1 % M=100 M=1 |
D | CLP00/ATP06 |
| 605-009-00-9 | crotonaldehyde;
2-butenal [1] (E)-2-butenal; (E)-crotonaldehyde [2] |
krotonaldehid; 2-butenal; [1] (E)-2-butenal; (E)-krotonaldehid [2] | 224-030-0
[1] 204-647-1 [2] |
4170-30-3
[1] 123-73-9 [2] |
Flam.
Liq. 2 Muta. 2 Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * STOT SE 3 STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 |
H225 H341 H330 H311 H301 H335 H373 ** H315 H318 H400 |
GHS02 GHS06 GHS08 GHS05 GHS09 Dgr |
H225 H341 H330 H311 H301 H373 ** H335 H315 H318 H400 |
CLP00 | |||
| 605-010-00-4 | 2-furaldehyde | 2-furaldehid | 202-627-7 | 98-01-1 | Carc.
2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 |
H351 H331 H301 H312 H335 H315 H319 |
GHS06 GHS08 Dgr |
H351 H331 H301 H312 H319 H335 H315 |
CLP00/ATP01 | |||
| 605-011-00-X | 2-chlorobenzaldehyde; o-chlorobenzaldehyde | 2-klórbenzaldehid;o-klórbenzaldehid | 201-956-3 | 89-98-5 | Skin
Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
CLP00 | |||
| 605-012-00-5 | benzaldehyde | benzaldehid | 202-860-4 | 100-52-7 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 605-013-00-0 | chloralose (INN); (R)-1,2-O-(2,2,2-trichloroethylidene)-α-D-glucofuranose; glucochloralose; anhydroglucochloral | klóralóz
(INN); (R)-1,2-O-(2,2,2-triklór-etilidén)-α-D-glükofuranóz; glükoklóralóz; anhidro-glükoklorál |
240-016-7 | 15879-93-3 | Acute
Tox. 3 Acute Tox. 4 * STOT SE 3 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H332 H336 H400 H410 |
GHS06 GHS09 Dgr |
H332 H301 H336 H410 |
M=10 M=10 |
C | CLP00/ATP09 | |
| 605-014-00-6 | chloral hydrate; 2,2,2-trichloroethane-1,1-diol | klorál-hidrát; 2,2,2-triklóretán-1,1-diol | 206-117-5 | 302-17-0 | Acute
Tox. 3 * Skin Irrit. 2 Eye Irrit. 2 |
H301 H315 H319 |
GHS06 Dgr |
H301 H319 H315 |
CLP00 | |||
| 605-015-00-1 | 1,1-diethoxyethane; acetal | 1,1-dietoxietán; acetál | 203-310-6 | 105-57-7 | Flam.
Liq. 2 Skin Irrit. 2 Eye Irrit. 2 |
H225 H315 H319 |
GHS02 GHS07 Dgr |
H225 H319 H315 |
CLP00 | |||
| 605-016-00-7 | glyoxal … %; ethandial … % | glioxál …%; etándiál …% | 203-474-9 | 107-22-2 | Muta.
2 Acute Tox. 4 * Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H341 H332 H315 H319 H317 |
GHS07 GHS08 Wng |
H341 H332 H319 H315 H317 |
* |
B | CLP00 | |
| 605-017-00-2 | 1,3-dioxolane | 1,3-dioxolán | 211-463-5 | 646-06-0 | Flam.
Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
CLP00 | |||
| 605-018-00-8 | propanal; propionaldehyde | propanal; propionaldehid | 204-623-0 | 123-38-6 | Flam.
Liq. 2 STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 |
H225 H335 H315 H319 |
GHS02 GHS07 Dgr |
H225 H319 H335 H315 |
CLP00 | |||
| 605-019-00-3 | citral | citral | 226-394-6 | 5392-40-5 | Skin
Irrit. 2 Skin Sens. 1 |
H315 H317 |
GHS07 Wng |
H315 H317 |
CLP00 | |||
| 605-020-00-9 | safrole; 5-allyl-1,3-benzodioxole | szafrol; 5-allil-1,3-benzodioxol | 202-345-4 | 94-59-7 | Carc.
1B Muta. 2 Acute Tox. 4 * |
H350 H341 H302 |
GHS08 GHS07 Dgr |
H350 H341 H302 |
CLP00 | |||
| 605-021-00-4 | formaldehyde, reaction products with butylphenol | formaldehid reakcióterméke butilfenollal | 294-145-9 | 91673-30-2 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 605-022-00-X | glutaral; glutaraldehyde; 1,5-pentanedial | glutaral;
glutáraldehid; 1,5-pentándial |
203-856-5 | 111-30-8 | Acute
Tox. 2 Acute Tox. 3 STOT SE 3 Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1A Aquatic Acute 1 Aquatic Chronic 2 |
H330 H301 H335 H314 H334 H317 H400 H411 |
GHS06 GHS05 GHS08 GHS09 Dgr |
H330 H301 H314 H334 H317 H335 H410 |
EUH071 |
STOT
SE 3; H335: ,5 % ≤ C < 5 % M=1 |
CLP00/ATP09 | |
| 605-023-00-5 | 5-chloro-2-(4-chlorophenoxy)phenol; [DCPP] | 5-klór-2-(4-klórfenoxi)fenol; [DCPP] |
429-290-0 | 3380-30-1 | Eye
Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
M=10 M=10 |
ATP01/ATP10 | ||
| 605-024-00-0 | 2-bromo-5-hydroxy-4-methoxybenzaldehyde | 2-bróm-5-hidroxi-4-metoxibenzaldehid | 426-540-0 | 2973-59-3 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
ATP01 | |||
| 605-025-00-6 | chloroacetaldehyde | klóracetaldehid | 203-472-8 | 107-20-0 | Carc.
2 Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Aquatic Acute 1 |
H351 H330 H311 H301 H314 H400 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H351 H330 H311 H301 H314 H400 |
STOT
SE 3; H335: C ≥ 5 % |
CLP00 | ||
| 605-026-00-1 | 2,5,7,7-tetramethyloctanal | 2,5,7,7-tetrametiloktanal | 405-690-0 | 114119-97-0 | Skin
Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H315 H317 H411 |
GHS07 GHS09 Wng |
H315 H317 H411 |
CLP00 | |||
| 605-027-00-7 | reaction mass of: 3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-indene-6-carboxaldehyde; 3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-indene-5-carboxaldehyde | 3a,4,5,6,7,7a-hexahidro-4,7-metano-1H-indén-6-karboxaldehid; 3a,4,5,6,7,7a-hexahidro-4,7-metano-1H-indén-5-karboxaldehid keveréke | 410-480-7 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | ||||
| 605-028-00-2 | β-methyl-3-(1-methylethyl)-benzenepropanal | β-metil-3-(1-metiletil)fenilpropanal | 412-050-4 | 125109-85-5 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 605-029-00-8 | 2-cyclohexylpropanal | 2-ciklohexilpropanal | 412-270-0 | 2109-22-0 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | |||
| 605-030-00-3 | 1-(p-methoxyphenyl)acetaldehyde oxime | 1-(p-metoxifenil)acetaldehid-oxim | 411-510-1 | 3353-51-3 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 605-031-00-9 | reaction mass of: 2,2-dimethoxyethanal [(this component is considered to be anhydrous in terms of identity, structure and composition. However, 2,2-dimethoxyethanal will exist in a hydrated form. 60 % anhydrous is equivalent to 70.4 % hydrate; water(Including free water and water in hydrated 2,2-dimethoxyethanal)] | a következő anyagok keveréke: 2,2-dimetoxietanal [(Ez a komponens azonossága, szerkezete és összetétele szempontjából vízmentesnek tekintendő. A 2,2-dimetoxietanal azonban hidratált formában van jelen. A 60 %-os vízmentes termék egyenértékű 70,4 % hidráttal); víz (beleértve a szabad vizet és a 2,2-dimetoxietanal hidrátban levő vizet)] | 421-890-0 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | ||||
| 605-032-00-4 | 3-[3-(4-fluorophenyl)-1-(1-methylethyl)-1H-indol-2-yl]-(E)-2-propenal | 3-[3-(4-fluorfenil)-1-(1-metiletil)-1H-indol-2-il]-(E)-2-propenál | 425-370-4 | 93957-50-7 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
ATP01 | |||
| 605-033-00-X | reaction mass of: 3,7,11-trimethyl-cis-6,10-dodecadienal; 3,7,11-trimethyl-trans-6,10-dodecadienal | 3,7,11-trimetil-cisz-6,10-dodekadienál; 3,7,11-trimetil-transz-6,10-dodekadienál keveréke | 425-910-9 | 32480-08-3 | Skin
Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
ATP01 | |||
| 605-034-00-5 | reaction mass of: (1RS,2RS,3SR,6RS,9SR)-9-methoxytricyclo[5.2.1.0(2,6)]decane-3-carbaldehyde; (1RS,2RS,3RS,6RS,8SR)-8-methoxytricyclo[5.2.1.0(2,6)]decane-3-carbaldehyde; (1RS,2RS,4SR,6RS,8SR)-8-methoxytricyclo[5.2.1.0(2,6)]decane-4-carbaldehyde | (1RS,2RS,3SR,6RS,9SR)-9-metoxitriciklo[5.2.1.0(2,6)]dekán-3-karbaldehid; (1RS,2RS,3RS,6RS,8SR)-8-metoxitriciklo[5.2.1.0(2,6)]dekán-3-karbaldehid (1RS,2RS,4SR,6RS,8SR)-8-metoxitriciklo[5.2.1.0(2,6)]dekán-4-karbaldehid keveréke | 429-860-9 | - | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
ATP01 | |||
| 605-035-00-0 | (E)-3-(4-(4-fluorophenyl)-5-methoxymethyl-2,6-bis(1-methoxymethyl)pyridin-3-yl)prop-2-enal | (E)-3-(4-(4-fluorfenil)-5-metoximetil-2,6-bisz(1-metoximetil)piridin-3-il)prop-2-enál | 426-330-9 | 177964-68-0 | Eye
Irrit. 2 Skin Sens. 1 Aquatic Chronic 4 |
H319 H317 H413 |
GHS07 Wng |
H319 H317 H413 |
ATP01 | |||
| 605-036-00-6 | 2-bromomalonaldehyde | 2-brómmalonaldehid | 430-470-6 | 2065-75-0 | Acute
Tox. 4 * Eye Dam. 1 |
H302 H318 |
GHS05 GHS07 Dgr |
H302 H318 |
ATP01 | |||
| 605-037-00-1 | trans-3-[2-(7-chloro-2-quinolinyl)vinyl]benzaldehyde; 3-[(E)-2-(7-chloro-2-quinolinyl)vinyl]benzaldehyde | transz-3-[2-(7-klór-2-kinolinil)vinil]benzaldehid; 3-[(E)-2-(7-klór-2-kinolinil)vinil]benzaldehid | 421-800-1 | 120578-03-2 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 605-038-00-7 | 3-methyl-5-phenylpentan-1-al | 3-metil-5-fenilpentán-1-al | 433-900-0 | 55066-49-4 | Acute
Tox. 4 * Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H302 H315 H317 H411 |
GHS07 GHS09 Wng |
H302 H315 H317 H411 |
ATP01 | |||
| 605-039-00-2 | 3,4-dihydroxy-5-nitrobenzaldehyde | 3,4-dihidroxi-5-nitrobenzaldehid | 441-810-8 | 116313-85-0 | Acute
Tox. 4 * Eye Dam. 1 Skin Sens. 1 |
H302 H318 H317 |
GHS05 GHS07 Dgr |
H302 H318 H317 |
ATP01 | |||
| 605-040-00-8 | hydroxyisohexyl
3-cyclohexene carboxaldehyde (INCI); reaction mass of
4-(4-hydroxy-4-methylpentyl)cyclohex-3-ene-1-carbaldehyde and
3-(4-hydroxy-4-methylpentyl)cyclohex-3-ene-1-carbaldehyde [1] 4-(4-hydroxy-4-methylpentyl)cyclohex-3-ene-1-carbaldehyde [2] 3-(4-hydroxy-4-methylpentyl)cyclohex-3-ene-1-carbaldehyde [3] |
hidroxiizohexil
3-ciklohexén karboxaldehid (INCI);
4-(4-hidroxi-4-metilpentil)ciklohex-3-én-1-karbaldehid és
3-(4-hidroxi-4-metilpentil)ciklohex-3-én-1-karbaldehid keveréke; [1] 4-(4-hidroxi-4-metilpentil)ciklohex-3-én-1-karbaldehid; [2] 3-(4-hidroxi-4-metilpentil)ciklohex-3-én-1-karbaldehid [3] |
250-863-4
[2] 257-187-9 [3] |
130066-44-3
[1] 31906-04-4 [2] 51414-25-6 [3] |
Skin
Sens. 1A |
H317 |
GHS07 Wng |
H317 |
ATP09 | |||
| 605-041-00-3 | 2-(4-tert-butylbenzyl) propionaldehyde | #HIÁNYZIK | 201-289-8 | 80-54-6 | Repr.
1B |
H360Fd |
GHS08 Dgr |
H360Fd |
ATP15 | |||
| 606-001-00-8 | acetone; propan-2-one; propanone | aceton; propan-2-on; propanon | 200-662-2 | 67-64-1 | Flam.
Liq. 2 STOT SE 3 Eye Irrit. 2 |
H225 H336 H319 |
GHS02 GHS07 Dgr |
H225 H319 H336 |
EUH066 |
CLP00 | ||
| 606-002-00-3 | butanone; ethyl methyl ketone | butanon; etil-metil-keton | 201-159-0 | 78-93-3 | Flam.
Liq. 2 STOT SE 3 Eye Irrit. 2 |
H225 H336 H319 |
GHS02 GHS07 Dgr |
H225 H319 H336 |
EUH066 |
CLP00 | ||
| 606-003-00-9 | heptan-3-one; butyl ethyl ketone | heptán-3-on; butil-etil-keton | 203-388-1 | 106-35-4 | Flam.
Liq. 3 Acute Tox. 4 * Eye Irrit. 2 |
H226 H332 H319 |
GHS02 GHS07 Wng |
H226 H332 H319 |
CLP00 | |||
| 606-004-00-4 | 4-methylpentan-2-one; isobutyl methyl ketone | 4-metilpentán-2-on; izobutil-metil-keton | 203-550-1 | 108-10-1 | Flam.
Liq. 2 Acute Tox. 4 * STOT SE 3 Eye Irrit. 2 |
H225 H332 H335 H319 |
GHS02 GHS07 Dgr |
H225 H332 H319 H335 |
EUH066 |
CLP00 | ||
| 606-005-00-X | 2,6-dimethylheptan-4-one; di-isobutyl ketone | 2,6-dimetilheptán-4-on; diizobutil-keton | 203-620-1 | 108-83-8 | Flam.
Liq. 3 STOT SE 3 |
H226 H335 |
GHS02 GHS07 Wng |
H226 H335 |
STOT
SE 3; H335: C ≥ 10 % |
CLP00 | ||
| 606-006-00-5 | pentan-3-one; diethyl ketone | pentán-3-on; dietil-keton | 202-490-3 | 96-22-0 | Flam.
Liq. 2 STOT SE 3 STOT SE 3 |
H225 H335 H336 |
GHS02 GHS07 Dgr |
H225 H335 H336 |
EUH066 |
CLP00 | ||
| 606-007-00-0 | 3-methylbutan-2-one; methyl isopropyl ketone | 3-metilbután-2-on; metil-izopropil-keton | 209-264-3 | 563-80-4 | Flam.
Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
CLP00 | |||
| 606-009-00-1 | 4-methylpent-3-en-2-one; mesityl oxide | 4-metilpent-3-én-2-on; mezitil-oxid | 205-502-5 | 141-79-7 | Flam.
Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H226 H332 H312 H302 |
GHS02 GHS07 Wng |
H226 H332 H312 H302 |
* |
CLP00 | ||
| 606-010-00-7 | cyclohexanone | ciklohexanon | 203-631-1 | 108-94-1 | Flam.
Liq. 3 Acute Tox. 4 * |
H226 H332 |
GHS02 GHS07 Wng |
H226 H332 |
CLP00 | |||
| 606-011-00-2 | 2-methylcyclohexanone | 2-metilciklohexanon | 209-513-6 | 583-60-8 | Flam.
Liq. 3 Acute Tox. 4 * |
H226 H332 |
GHS02 GHS07 Wng |
H226 H332 |
CLP00 | |||
| 606-012-00-8 | 3,5,5-trimethylcyclohex-2-enone; isophorone | 3,5,5-trimetilciklohex-2-enon; izoforon | 201-126-0 | 78-59-1 | Carc.
2 Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Eye Irrit. 2 |
H351 H312 H302 H335 H319 |
GHS08 GHS07 Wng |
H351 H312 H302 H319 H335 |
STOT
SE 3; H335: C ≥ 10 % |
CLP00 | ||
| 606-013-00-3 | p-benzoquinone; quinone | p-benzokinon; kinon | 203-405-2 | 106-51-4 | Acute
Tox. 3 * Acute Tox. 3 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 |
H331 H301 H335 H315 H319 H400 |
GHS06 GHS09 Dgr |
H331 H301 H319 H335 H315 H400 |
M=10 |
CLP00/ATP01 | ||
| 606-014-00-9 | chlorophacinone (ISO); 2-[(4-chlorophenyl)(phenyl)acetyl]-1H-indene-1,3(2H)-dione | klórfacinon
(ISO); 2-[(4-klór-fenil)(fenil)acetil]-1H-indén-1,3(2H)-dion |
223-003-0 | 3691-35-8 | Repr.
1B Acute Tox. 1 Acute Tox. 1 Acute Tox. 1 STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360D H330 H310 H300 H372 (blood) H400 H410 |
GHS08 GHS06 GHS09 Dgr |
H330 H310 H300 H360D H372 (blood) H410 |
Repr.
1B; H360D: C ≥ 0,003 % STOT RE 1; H372: C ≥ 0,1 % STOT RE 2; H373: 0,01 % ≤ C < 0,1 % M=1 M=1 |
CLP00/ATP09 | ||
| 606-016-00-X | pindone (ISO); 2-pivaloylindan-1,3-dione | pindon (ISO); 2-pivaloilindán-1,3-dion | 201-462-8 | 83-26-1 | Acute
Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H301 H372 ** H410 |
CLP00 | |||
| 606-017-00-5 | diketene; diketen | diketén | 211-617-1 | 674-82-8 | Flam.
Liq. 3 Acute Tox. 4 * |
H226 H332 |
GHS02 GHS07 Wng |
H226 H332 |
D | CLP00 | ||
| 606-018-00-0 | dichlone (ISO); 2,3-dichloro-1,4-naphthoquinone | diklon (ISO); 2,3-diklór-1,4-naftokinon | 204-210-5 | 117-80-6 | Acute
Tox. 4 * Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H319 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H315 H410 |
CLP00 | |||
| 606-019-00-6 | chlordecone (ISO); perchloropentacyclo[5,3,0,02,6,03,9,04,8]decan-5-one; decachloropentacyclo[5,2,1,02,6,03,9,05,8]decan-4-one | klórdekon (ISO); perklórpentaciklo[5,3,0,02,6,03,9,04,8]dekán-5-on; dekaklórpentaciklo[5,2,1,02,6,03,9,05,8]dekán-4-on | 205-601-3 | 143-50-0 | Carc.
2 Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H311 H301 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H311 H301 H410 |
CLP00 | |||
| 606-020-00-1 | 5-methylheptan-3-one | 5-metilheptán-3-on | 208-793-7 | 541-85-5 | Flam.
Liq. 3 STOT SE 3 Eye Irrit. 2 |
H226 H335 H319 |
GHS02 GHS07 Wng |
H226 H319 H335 |
STOT
SE 3; H335: C ≥ 10 % |
CLP00 | ||
| 606-021-00-7 | N-methyl-2-pyrrolidone; 1-methyl-2-pyrrolidone | N-metil-2-pirrolidon; 1-metil-2-pirrolidon | 212-828-1 | 872-50-4 | Repr.
1B STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 |
H360D
*** H335 H315 H319 |
GHS08 GHS07 Dgr |
H360D
*** H319 H335 H315 |
STOT
SE 3; H335: C ≥ 10 % |
CLP00/ATP09 | ||
| 606-022-00-2 | 1-phenyl-3-pyrazolidone | 1-fenil-3-pirazolidon | 202-155-1 | 92-43-3 | Acute
Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
CLP00 | |||
| 606-023-00-8 | 4-methoxy-4-methylpentan-2-one | 4-metoxi-4-metilpentán-2-on | 203-512-4 | 107-70-0 | Flam.
Liq. 3 Acute Tox. 4 * |
H226 H332 |
GHS02 GHS07 Wng |
H226 H332 |
CLP00 | |||
| 606-024-00-3 | heptan-2-one; methyl amyl ketone | heptán-2-on; metil-amil-keton | 203-767-1 | 110-43-0 | Flam.
Liq. 3 Acute Tox. 4 * Acute Tox. 4 * |
H226 H332 H302 |
GHS02 GHS07 Wng |
H226 H332 H302 |
CLP00 | |||
| 606-025-00-9 | cyclopentanone | ciklopentanon | 204-435-9 | 120-92-3 | Flam.
Liq. 3 Skin Irrit. 2 Eye Irrit. 2 |
H226 H315 H319 |
GHS02 GHS07 Wng |
H226 H319 H315 |
CLP00 | |||
| 606-026-00-4 | 5-methylhexan-2-one; isoamyl methyl ketone | 5-metilhexán-2-on; izoamil-metil-keton | 203-737-8 | 110-12-3 | Flam.
Liq. 3 Acute Tox. 4 * |
H226 H332 |
GHS02 GHS07 Wng |
H226 H332 |
CLP00 | |||
| 606-027-00-X | heptan-4-one; di-n-propyl ketone | heptán-4-on; di-n-propil-keton | 204-608-9 | 123-19-3 | Flam.
Liq. 3 Acute Tox. 4 * |
H226 H332 |
GHS02 GHS07 Wng |
H226 H332 |
CLP00 | |||
| 606-028-00-5 | 2,4-dimethylpentan-3-one; di-isopropyl ketone | 2,4-dimetilpentán-3-on; di-izopropil-keton | 209-294-7 | 565-80-0 | Flam.
Liq. 2 Acute Tox. 4 * |
H225 H332 |
GHS02 GHS07 Dgr |
H225 H332 |
CLP00 | |||
| 606-029-00-0 | pentane-2,4-dione; acetylacetone | pentán-2,4-dion; acetilaceton | 204-634-0 | 123-54-6 | Flam.
Liq. 3 Acute Tox. 4 * |
H226 H302 |
GHS02 GHS07 Wng |
H226 H302 |
CLP00 | |||
| 606-030-00-6 | hexan-2-one; methyl butyl ketone; butyl methyl ketone; methyl-n-butyl ketone | hexán-2-on; metil-butil-keton; butil-metil-keton; metil-n-butil-keton | 209-731-1 | 591-78-6 | Flam.
Liq. 3 Repr. 2 STOT SE 3 STOT RE 1 |
H226 H361f *** H336 H372 ** |
GHS02 GHS08 GHS07 Dgr |
H226 H361f *** H372 ** H336 |
CLP00 | |||
| 606-031-00-1 | 3-propanolide; 1,3-propiolactone | 3-propanolid; 1,3-propiolakton | 200-340-1 | 57-57-8 | Carc.
1B Acute Tox. 2 * Skin Irrit. 2 Eye Irrit. 2 |
H350 H330 H315 H319 |
GHS06 GHS08 Dgr |
H350 H330 H319 H315 |
CLP00 | |||
| 606-032-00-7 | hexachloroacetone | hexaklóraceton | 204-129-5 | 116-16-5 | Acute
Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
CLP00 | |||
| 606-033-00-2 | 2-(3,4-dichlorophenyl)-4-methyl-1,2,4-oxadiazolidinedione; methazole | 2-(3,4-diklórfenil)-4-metil-1,2,4-oxadiazolidindion; metazol | 243-761-6 | 20354-26-1 | Acute
Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Eye Irrit. 2 Aquatic Chronic 2 |
H312 H302 H315 H319 H411 |
GHS07 GHS09 Wng |
H312 H302 H319 H315 H411 |
CLP00 | |||
| 606-034-00-8 | metribuzin (ISO); 4-amino-6-tert-butyl-3-methylthio-1,2,4-triazin-5(4H)-one; 4-amino-4,5-dihydro-6-(1,1-dimethylethyl)-3-methylthio-1,2,4-triazin-5-one | metribuzin (ISO); 4-amino-6-terc-butil-3-metiltio-1,2,4-triazin-5(4H)-on; 4-amino-4,5-dihidro-6-(1,1-dimetiletil)-3-metiltio-1,2,4-triazin-5-on | 244-209-7 | 21087-64-9 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
M=10 |
CLP00/ATP01 | ||
| 606-035-00-3 | chloridazon (ISO); 5-amino-4-chloro-2-phenylpyridazine-3-(2H)-one; pyrazon | kloridazon (ISO);5-amino-4-klór-2-fenilpiridazin-3-(2H)-on; pirazon | 216-920-2 | 1698-60-8 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
CLP00 | |||
| 606-036-00-9 | quinomethionate; chinomethionat (ISO); 6-methyl-1,3-dithiolo(4,5-b)quinoxalin-2-one | kinometionát; kinometionát (ISO); 6-metil-1,3-ditiolo(4,5-b)kinoxalin-2-on | 219-455-3 | 2439-01-2 | Repr.
2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361f
*** H332 H312 H302 H373 ** H319 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361f
*** H332 H312 H302 H373 ** H319 H317 H410 |
CLP00 | |||
| 606-037-00-4 | triadimefon (ISO); 1-(4-chlorophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butanone | triadimefon (ISO); 1-(4-klórfenoxi)-3,3-dimetil-1-(1,2,4-triazol-1-il)butanon | 256-103-8 | 43121-43-3 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
CLP00 | |||
| 606-038-00-X | diphacinone (ISO); 2-diphenylacetylindan-1,3-dione | difacinon (ISO); 2-difenilacetilindán-1,3-dion | 201-434-5 | 82-66-6 | Acute
Tox. 2 * STOT RE 1 |
H300 H372 ** |
GHS06 GHS08 Dgr |
H300 H372 ** |
CLP00 | |||
| 606-039-00-5 | 5(or 6)-tert-butyl-2'-chloro-6'-ethylamino-3',7'-dimethylspiro(isobenzofuran-1(1H),9'-xanthene)-3-one | 5(vagy 6)-terc-butil-2’-klór-6’-etilamino-3’,7’-dimetilspiro(izobenzofurán-1(1H),9’-xantén)-3-on | 400-680-2 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H400 H410 |
GHS07 GHS09 Wng |
H332 H410 |
CLP00 | ||||
| 606-040-00-0 | (N-benzyl-N-ethyl)amino-3-hydroxyacetophenone hydrochloride | (N-benzil(-N-etil)amino-3’-hidroxiacetofenon-hidroklorid | 401-840-4 | 55845-90-4 | Eye
Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
CLP00 | |||
| 606-041-00-6 | 2-methyl-1-(4-methylthiophenyl)-2-morpholinopropan-1-one | 2-metil-1-(4-metiltiofenil)-2-morfolinopropán-1-on | 400-600-6 | 71868-10-5 | Repr.
1B Acute Tox. 4 * Aquatic Chronic 2 |
H360FD H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H302 H360FD H411 |
CLP00/ATP10 | |||
| 606-042-00-1 | acetophenone | acetofenon | 202-708-7 | 98-86-2 | Acute
Tox. 4 * Eye Irrit. 2 |
H302 H319 |
GHS07 Wng |
H302 H319 |
CLP00 | |||
| 606-043-00-7 | 2,4-di-tert-butylcyclohexanone | 2,4-di-terc-butilciklohexanon | 405-340-7 | 13019-04-0 | Skin
Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
CLP00 | |||
| 606-044-00-2 | 2,4,6-trimethylbenzophenone | 2,4,6-trimetilbenzofenon | 403-150-9 | 954-16-5 | Acute
Tox. 4 * Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H410 |
CLP00 | |||
| 606-045-00-8 | oxadiazon (ISO); 3-[2,4-dichloro-5-(1-methylethoxy)phenyl]-5-(1,1-dimethylethyl)-1,3,4-oxadiazol-2(3H)-one | oxadiazon (ISO); 3-[2,4-diklór-5-(1-metiletoxi)fenil]-5-(1,1-dimetiletil)-1,3,4-oxadiazol-2(3H)-on | 243-215-7 | 19666-30-9 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 606-046-00-3 | reaction mass of cis- and trans-cyclohexadec-8-en-1-one | cisz- és transz-ciklohexadec-8-én-1-on keveréke | 401-700-2 | 3100-36-5 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 606-047-00-9 | 2-benzyl-2-dimethylamino-4'-morpholinobutyrophenone | 2-benzil-2-dimetilamino-4′-morfolinobutirofenon | 404-360-3 | 119313-12-1 | Repr.
1B Aquatic Acute 1 Aquatic Chronic 1 |
H360D H400 H410 |
GHS08 GHS09 Dgr |
H360D H410 |
CLP00/ATP14 | |||
| 606-048-00-4 | 2'-anilino-3'-methyl-6'-dipentylaminospiro(isobenzofuran-1(1H),9'-xanthen)-3-one | 2’-anilino-3’-metil-6’-dipentilaminospiro-(izobenzofurán-1(1H),9’- xantén)-3-on | 406-480-1 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | |||||
| 606-049-00-X | 4-(trans-4-propylcyclohexyl)acetophenone | 4-(transz-4-propilciklohexil)acetofenon | 406-700-6 | 78531-61-0 | Skin
Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
CLP00 | |||
| 606-050-00-5 | 6-anilino-1-benzoyl-4-(4-tert-pentylphenoxy)naphto[1,2,3-de]quinoline-2,7-(3H)-dione | 6-anilino-1-benzoil-4-(4-terc-pentilfenoxi)naftol[1,2,3-de]kinolin-2,7-(3H)-dion | 412-480-2 | 72453-58-8 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 606-051-00-0 | 4-pentylcyclohexanone | 4-pentilciklohexanon | 406-670-4 | 61203-83-6 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 606-052-00-6 | 4-(N,N-dibutylamino)-2-hydroxy-2'-carboxybenzophenone | 4-(N,N-dibutilamino)-2-hidroxi-2'-karboxibenzofenon | 410-410-5 | 54574-82-2 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | ||||
| 606-053-00-1 | flurtamone (ISO); (RS)-5-methylamino-2-phenyl-4-(α, α,α-trifluoro-m-tolyl)furan-3(2H)-one | flurtamon (ISO); (RS)-5-metilamino-2-fenil-4-(α, α,α-trifluor-m-tolil)furán-3(2H)-on | 96525-23-4 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | ||||
| 606-054-00-7 | isoxaflutole (ISO); 5-cyclopropyl-1,2-oxazol-4-yl α,α,α-trifluoro-2-mesyl-p-tolyl ketone | izoxaflutol (ISO); 5-ciklopropil-1,2-oxazol-4-il-α, α,α-trifluor-2-mezil-p-tolil-keton | 141112-29-0 | Repr.
2 Aquatic Acute 1 Aquatic Chronic 1 |
H361d
*** H400 H410 |
GHS08 GHS09 Wng |
H361d
*** H410 |
M=10 M=100 |
CLP00/ATP07 | |||
| 606-055-00-2 | 1-(2,3-dihydro-1,3,3,6-tetramethyl-1-(1-methylethyl)-1H-inden-5-yl)ethanone | 1-(2,3-dihidro-1,3,3,6-tetrametil-1-(1-metiletil)-1H-indén-5-il)etanon | 411-180-9 | 92836-10-7 | Acute
Tox. 4 * STOT RE 2 * Aquatic Chronic 2 |
H302 H373 ** H411 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H411 |
CLP00 | |||
| 606-056-00-8 | 4-chloro-3',4'-dimethoxybenzophenone | 4-klór-3’,4’-dimetoxibenzofenon | 404-610-1 | 116412-83-0 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 606-057-00-3 | 4-propylcyclohexanone | 4-propilciklohexanon | 406-810-4 | 40649-36-3 | Skin
Irrit. 2 Aquatic Chronic 3 |
H315 H412 |
GHS07 Wng |
H315 H412 |
CLP00 | |||
| 606-058-00-9 | 4'-fluoro-2,2-dimethoxyacetophenone | 4'-fluor-2,2-dimetoxiacetofenon | 407-500-1 | 21983-80-2 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
CLP00 | |||
| 606-059-00-4 | 2,4-difluoro-α-(1H-1,2,4-triazol-1-yl)acetophenone hydrochloride | 2,4-difluor-α-(1H-1,2,4-triazol-1-il)acetofenon-hidroklorid | 412-390-3 | 86386-75-6 | Acute
Tox. 4 * Eye Dam. 1 Skin Sens. 1 |
H302 H318 H317 |
GHS05 GHS07 Dgr |
H302 H318 H317 |
CLP00 | |||
| 606-060-00-X | reaction mass of: trans-2,4-dimethyl-2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-naphthalene-2-yl)-1,3-dioxolane; cis-2,4-dimethyl-2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-naphthalene-2-yl)-1,3-dioxolane | transz-2,4-dimetil-2-(5,6,7,8-tetrahidro-5,5,8,8-tetrametilnaftalin-2-il)-1,3-dioxolán; cisz-2,4-dimetil-2-(5,6,7,8-tetrahidro-5,5,8,8-tetrametilnaftalin-2-il)-1,3-dioxolán keveréke | 412-950-7 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | ||||
| 606-061-00-5 | (3-chlorophenyl)-(4-methoxy-3-nitrophenyl)methanone | (3-klórfenil)-(4-metoxi-3-nitrofenil)metanon | 423-290-4 | 66938-41-8 | Muta.
2 Aquatic Acute 1 Aquatic Chronic 1 |
H341 H400 H410 |
GHS08 GHS09 Wng |
H341 H410 |
CLP00 | |||
| 606-062-00-0 | tetrahydrothiopyran-3-carboxaldehyde | tetrahidrotiopirán-3-karboxaldehid | 407-330-8 | 61571-06-0 | Repr.
1B Eye Dam. 1 Aquatic Chronic 3 |
H360D
*** H318 H412 |
GHS08 GHS05 Dgr |
H360D
*** H318 H412 |
CLP00 | |||
| 606-063-00-6 | (E)-3-(2-chlorophenyl)-2-(4-fluorophenyl)propenal | (E)-3-(2-klórfenil)-2-(4-fluorfenil)propenal | 410-980-5 | 112704-51-5 | Eye
Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
CLP00 | |||
| 606-064-00-1 | pregn-5-ene-3,20-dione bis(ethylene ketal) | pregn-5-én-3,20-dion-bisz(etilén-ketál) | 407-450-0 | 7093-55-2 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 606-065-00-7 | 1-(4-morpholinophenyl)butan-1-one | 1-(4-morfolinofenil)bután-1-on | 413-790-0 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | ||||
| 606-066-00-2 | (E)-5[(4-chlorophenyl)methylene]-2,2-dimethylcyclopentanone | (E)-5[(4-klórfenil)metilén]-2,2-dimetilciklopentanon | 410-440-9 | 164058-20-2 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 606-067-00-8 | reaction mass of: 1-(2,3,6,7,8,9-hexahydro-1,1-dimethyl-1H-benz(g)inden-4-yl)ethanone; 1-(2,3,5,6,7,8-hexahydro-1,1-dimethyl-1H-benz(f)inden-4-yl)ethanone; 1-(2,3,6,7,8,9-hexahydro-1,1-dimethyl-1H-benz(g)inden-5-yl)ethanone; 1-(2,3,6,7,8,9-hexahydro-3,3-dimethyl-1H-benz(g)inden-5-yl)ethanone | a következő anyagok keveréke: 1-(2,3,6,7,8,9-hexahidro-1,1-dimetil-1H-benz(g)indén-4-il)etanon; 1-(2,3,5,6,7,8-hexahidro-1,1-dimetil-1H-benz(f)indén-4-il)etanon; 1-(2,3,6,7,8,9-hexahidro-1,1-dimetil-1H-benz(g)indén-5-il)etanon; 1-(2,3,6,7,8,9-hexahidro-3,3-dimetil-1H-benz(g)indén-5-il)etanon | 414-870-8 | 96792-67-5 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 606-068-00-3 | 2,7,11-trimethyl-13-(2,6,6-trimethylcyclohex-1-en-1-yl)tridecahexaen-2,4,6,8,10,12-al | 2,7,11-trimetil-13-(2,6,6-trimetilciklohex-1-én-1-il)tridekahexán-2,4,6,8,10,12-al | 415-770-7 | 1638-05-7 | STOT
RE 2 * Skin Sens. 1 Aquatic Chronic 3 |
H373
** H317 H412 |
GHS08 GHS07 Wng |
H373
** H317 H412 |
CLP00 | |||
| 606-069-00-9 | spiro[1,3-dioxolane-2,5'-(4',4',8',8'-tetramethyl-hexahydro-3',9'-methanonaphthalene)] | spiro[1,3-dioxolán-2,5’-(4’,4’,8’,8’-tetrametilhexahidro-3’,9’-metanonaftalin)] | 415-460-1 | 154171-76-3 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 606-070-00-4 | butroxydim (ISO); 5-(3-butyryl-2,4,6-trimethylphenyl)-2-[1-(ethoxyimino)propyl]-3-hydroxycyclohex-2-en-1-one | butroxidim (ISO); 5-(3-butiril-2,4,6-trimetilfenil)-2-[1-(etoxiimino)propil]-3-hidroxiciklohex-2-én-1-on | 414-790-3 | 138164-12-2 | Repr.
2 Acute Tox. 4 * Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H361fd H302 H315 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361fd H302 H315 H410 |
CLP00 | |||
| 606-071-00-X | 17-spiro(5,5-dimethyl-1,3-dioxan-2-yl)androsta-1,4-diene-3-one | 17-spiro(5,5-dimetil-1,3-dioxán-2-il)androszta-1,4-dién-3-on | 421-050-3 | 13258-43-0 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 606-072-00-5 | 3-acetyl-1-phenyl-pyrrolidine-2,4-dione | 3-acetil-1-fenilpirrolidin-2,4-dion | 421-600-2 | 719-86-8 | STOT
RE 2 * Aquatic Chronic 2 |
H373
** H411 |
GHS08 GHS09 Wng |
H373
** H411 |
CLP00 | |||
| 606-073-00-0 | 4,4'-bis(dimethylamino)benzophenone; Michler's ketone | 4,4'-bisz(dimetilamino)benzofenon; Michler-féle keton | 202-027-5 | 90-94-8 | Carc.
1B Muta. 2 Eye Dam. 1 |
H350 H341 H318 |
GHS08 GHS05 Dgr |
H350 H341 H318 |
CLP00 | |||
| 606-074-00-6 | reaction mass of: (1R*,2S*)-2-acetyl-1,2,3,4,5,6,7,8-octahydro-1,2,8,8-tetramethylnaphthalene; (2R*,3S*)-2-acetyl-1,2,3,4,5,6,7,8-octahydro-2,3,8,8-tetramethylnaphthalene | (1R*, 2S*)-2-acetil-1,2,3,4,5,6,7,8-oktahidro-1,2,8,8-tetrametilnaftalin; (2R*,3S*)-2-acetil-1,2,3,4,5,6,7,8-oktahidro-2,3,8,8-tetrametilnaftalin keveréke | 425-570-1 | - | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
ATP01 | |||
| 606-075-00-1 | 1-benzyl-5-ethoxyimidazolidine-2,4-dione | 1-benzil-5-etoxiimidazolidin-2,4-dion | 417-340-4 | 65855-02-9 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 606-076-00-7 | 1-((2-quinolinyl-carbonyl)oxy)-2,5-pyrrolidinedione | 1-((2-kinolinilkarbonil)oxi)-2,5-pirrolidindion | 418-630-3 | 136465-99-1 | Eye
Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
CLP00 | |||
| 606-077-00-2 | (3S,4S)-3-hexyl-4-[(R)-2-hydroxytridecyl]-2-oxetanone | (3S,4S)-3-hexil-4-[(R)-2-hidroxitridecil]-2-oxetanon | 418-650-2 | 104872-06-2 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 606-078-00-8 | 1-octylazepin-2-one | 1-oktilazepin-2-on | 420-040-6 | 59227-88-2 | Skin
Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H314 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H411 |
CLP00 | |||
| 606-079-00-3 | 2-n-butyl-benzo[d]isothiazol-3-one | 2-n-butilbenzo[d]izotiazol-3-on | 420-590-7 | 4299-07-4 | Skin
Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H410 |
CLP00 | |||
| 606-081-00-4 | (3β, 5α, 6β)-3-(acetyloxy)-5-bromo-6-hydroxy-androstan-17-one | (3β, 5α, 6β)-3-(acetiloxi)-5-bróm-6-hidroxiandrosztán-17-on | 419-790-7 | 4229-69-0 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
CLP00 | |||
| 606-082-00-X | reaction mass of: butan-2-one oxime; syn-O,O'-di(butan-2-one oxime)diethoxysilane | bután-2-on-oxim; szin-O,O'-di(bután-2-on-oxim)dietoxiszilán keveréke | 406-930-7 | STOT
RE 1 Skin Sens. 1 Aquatic Chronic 3 |
H372
** H317 H412 |
GHS08 GHS07 Dgr |
H372
** H317 H412 |
CLP00 | ||||
| 606-083-00-5 | 2-chloro-5-sec-hexadecylhydroquinone | 2-klór-5-szek-hexadecilhidrokinon | 407-750-1 | 137193-60-3 | Skin
Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H315 H319 H317 H412 |
GHS07 Wng |
H319 H315 H317 H412 |
CLP00 | |||
| 606-084-00-0 | 1-(4-methoxy-5-benzofuranyl)-3-phenyl-1,3-propanedione | 1-(4-metoxi-5-benzofuranil)-3-fenil-1,3-propándion | 414-540-3 | 484-33-3 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 606-085-00-6 | (1R,4S)-2-azabicyclo[2.2.1]hept-5-en-3-one | (1R,4S)-2-azabiciklo[2.2.1]hept-5-én-3-on | 418-530-1 | 79200-56-9 | Acute
Tox. 4 * Eye Dam. 1 Skin Sens. 1 |
H302 H318 H317 |
GHS05 GHS07 Dgr |
H302 H318 H317 |
CLP00 | |||
| 606-086-00-1 | 1-(3,3-dimethylcyclohexyl)pent-4-en-1-one | 1-(3,3-dimetilciklohexil)pent-4-én-1-on | 422-330-8 | 56973-87-6 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 606-087-00-7 | 6-ethyl-5-fluoro-4(3H)-pyrimidone | 6-etil-5-fluor-4(3H)-pirimidon | 422-460-5 | 137234-87-8 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | |||
| 606-088-00-2 | 2,4,4,7-tetramethyl-6-octen-3-one | 2,4,4,7-tetrametil-6-oktén-3-on | 422-520-0 | 74338-72-0 | Skin
Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
CLP00 | |||
| 606-089-00-8 | reaction mass of: 1,4-diamino-2-chloro-3-phenoxyanthraquinone; 1,4-diamino-2,3-bis-phenoxyanthraquinone | 1,4-diamino-2-klór-3-fenoxiantrakinon; 1,4-diamino-2,3-bisz-fenoxiantrakinon keveréke | 423-220-2 | 12223-77-7 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 606-090-00-3 | 1-[3-[(dimethylamino)methyl]-4-hydroxyphenyl]ethanone | 1-[3-[(dimetilamino)metil]-4-hidroxifenil]etanon | 430-920-1 | 73096-98-7 | Acute
Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
ATP01 | |||
| 606-091-00-9 | 6-chloro-5-(2-chloroethyl)-1,3-dihydroindol-2-one | 6-klór-5-(2-klóretil)-1,3-dihidroindol-2-on | 421-320-0 | 118289-55-7 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 606-092-00-4 | reaction mass of: (E)-oxacyclohexadec-12-en-2-one; (E)-oxacyclohexadec-13-en-2-one; a) (Z)-oxacyclohexadec-(12)-en-2-one and b) (Z)-oxacyclohexadec-(13)-en-2-one | (E)-oxaciklohexadec-12-én-2-on; (E)-oxaciklohexadec-13-én-2-on; a) (Z)-oxaciklohexadec-(12)-én-2-on és b) (Z)-oxaciklohexadec-(13)-én-2-on keveréke | 422-320-3 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | ||||
| 606-093-00-X | 5-ethyl-2,4-dihydro-4-(2-phenoxyethyl)-3H-1,2,4-triazol-3-one | 5-etil-2,4-dihidro-4-(2-fenoxietil)-3H-1,2,4-triazol-3-on | 414-470-3 | 95885-13-5 | Acute
Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
ATP01 | |||
| 606-094-00-5 | N-[ethyl(3-methylbutyl)amino]-3-methyl-1-phenyl-spiro[[1]benzo-pyrano[2,3-c]pyrazole-4(1H),1'(3'H)-isobenzofuran]-3'-one | N-[etil(3-metilbutil)amino]-3-metil-1-fenil-spiro[[1]benzopirano[2,3-c]pirazol-4(1H),1'(3'H)-izo-benzofurán]-3'-on | 417-460-7 | - | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 606-095-00-0 | (R,S)-2-azabicyclo[2.2.1]hept-5-en-3-one | (R, S)-2-azabiciklo[2.2.1]hept-5-én-3-on | 421-830-3 | 49805-30-3 | Acute
Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
ATP01 | |||
| 606-096-00-6 | 3-(6-O-(6-desoxy-α-.sc.l.sc.-mannopyranosyl-O-(α-.sc.d.sc.-glucopyranosyl)-(β-.sc.d.sc.-glucopyranosyl)oxy)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-1-benzopyran-4-one | 3-(6-O-(6-dezoxi-α-L-mannopiranozil-O-(α-D-glükopiranozil)-(β-D-glükopiranozil)oxi)-2-(3,4-dihidroxifenil)-5,7-dihidroxi-4H-1-benzopirán-4-on | 424-170-4 | 130603-71-3 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
ATP01 | |||
| 606-097-00-1 | 2,2''-dihydroxy-4,4''-(2-hydroxy-propane-1,3-diyldioxy)dibenzophenone | 2,2''-dihidroxi-4,4''-(2-hidroxipropán-1,3-diildioxi)dibenzofenon | 424-210-0 | 23911-85-5 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 606-098-00-7 | 1-benzyl-5-(hexadecyloxy)-2,4-imidazolidinedione | 1-benzil-5-(hexadeciloxi)-2,4-imidazolidindion | 431-220-9 | 158574-65-3 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 606-099-00-2 | 5-methoxy-4'-(trifluoromethyl)valerophenone | 5-metoxi-4'-(trifluormetil)valerofenon | 425-000-1 | 61718-80-7 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
ATP01 | |||
| 606-100-00-6 | 2-butyryl-3-hydroxy-5-thiocyclohexan-3-yl-cyclohex-2-en-1-one | 2-butiril-3-hidroxi-5-tiociklohexán-3-il-ciklohex-2-én-1-on | 425-150-8 | 94723-86-1 | Repr.
1B Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 3 |
H360F
*** H302 H317 H412 |
GHS08 GHS07 Dgr |
H360F
*** H302 H317 H412 |
ATP01 | |||
| 606-101-00-1 | reaction mass of: 1,5-bis[(2-ethylhexyl)amino]-9,10-anthracenedione; 1-[(2-ethylhexyl)amino]-5-[3-[(2-ethylhexyl)oxy]propyl]amino-9,10-anthracenedione; 1,5-bis[3-[(2-ethylhexyl)oxy]propyl]amino-9,10-anthracenedione; 1-[(2-ethylhexyl)amino]-5-[(3-methoxypropyl)amino]-9,10-anthracene dione; 1-[3-[(2-ethylhexyl)oxy]propyl]amino-5-[(3-methoxypropyl)amino]-9,10-anthracenedione; 1,5-bis[(3-methyloxypropyl)amino]-9,10-anthracenedione | a következő anyagok keveréke: 1,5-bisz[(2-etilhexil)amino]-9,10-antracéndion; 1-[(2-etilhexil)amino]-5-[3-[(2-etilhexil)oxi]propil]amino-9,10-antracéndion; 1,5-bisz[3-[(2-etilhexil)oxi]propil]amino-9,10-antracéndion; 1-[(2-etilhexil)amino]-5-[3-metoxipropil)amino]-9,10-antracéndion; 1-[3-[(2-etilhexil)oxi]propil]amino-5-[(3-metoxipropil)amino]-9,10-antracéndion; 1,5-bisz[(3-metiloxipropil)amino]-9,10-antracéndion | 426-050-7 | 165038-51-7 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
ATP01 | |||
| 606-102-00-7 | 4-(3-triethoxysilylpropoxy)-2-hydroxybenzophenone | 4-(3-trietoxiszilil-propoxi)-2-hidroxibenzofenon | 431-490-8 | 79876-59-8 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
ATP01 | |||
| 606-103-00-2 | 1-(4-(trans-4-ethylcyclohexyl)phenyl)ethanone | 1-(4-(transz-4-etilciklohexil)fenil)etanon | 426-460-6 | - | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
ATP01 | |||
| 606-104-00-8 | 1-(4-(trans-4-pentylcyclohexyl)phenyl)ethanone | 1-(4-(transz-4-pentilciklohexil)fenil)etanon | 426-830-7 | 78531-59-6 | Skin
Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
ATP01 | |||
| 606-105-00-3 | 3,4,3',4'-tetraphenyl-1,1'-ethandiylbispyrol-2,5-dione | 3,4,3',4'-tetrafenil-1,1'-etándiilbiszpirol-2,5-dion | 431-500-0 | 226065-73-2 | Skin
Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
ATP01 | |||
| 606-106-00-9 | 1-(4-(trans-4-butylcyclohexyl)phenyl)ethanone | 1-(4-(transz-4-butilciklohexil)fenil)etanon | 427-320-7 | 83626-30-6 | Skin
Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
ATP01 | |||
| 606-107-00-4 | 8-azaspiro[4.5]decane-7,9-dione | 8-azaspiro[4.5]dekán-7,9-dion | 427-770-4 | 1075-89-4 | Acute
Tox. 3 * Aquatic Chronic 2 |
H301 H411 |
GHS06 GHS09 Dgr |
H301 H411 |
ATP01 | |||
| 606-108-00-X | 1,1,1,2,2,4,5,5,5-nonafluoro-4-(trifluoromethyl )-3-pentanone | 1,1,1,2,2,4,5,5,5-nonafluor-4-(trifluormetil)-3-pentanon | 436-710-6 | 756-13-8 | Aquatic
Chronic 3 |
H412 |
- |
H412 |
ATP01 | |||
| 606-109-00-5 | 2-(4-methyl-3-pentenyl)anthraquinone | 2-(4-metil-3-pentenil)antrakinon | 428-320-1 | 71308-16-2 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Chronic 4 |
H302 H317 H413 |
GHS07 Wng |
H302 H317 H413 |
ATP01/ATP01corr | |||
| 606-110-00-0 | 5-ethoxy-5H-furan-2-one | 5-etoxi-5H-furán-2-on | 428-330-4 | 2833-30-9 | Acute
Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 |
H312 H302 H373 ** H314 H317 |
GHS05 GHS08 GHS07 Dgr |
H314 H312 H302 H373 ** H317 |
ATP01 | |||
| 606-111-00-6 | 5-amino-6-methyl-1,3-dihydrobenzoimidazol-2-one | 5-amino-6-metil-1,3-dihidrobenzimidazol-2-on | 428-410-9 | 67014-36-2 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
ATP01 | |||
| 606-112-00-1 | (4aR*,8aR*)-4a,5,9,10,11,12-hexahydro-3-methoxy-11-methyl-6H-benzofuro[3a,3,2-ef][2]benzazepin-6-one | (4aR*,8aR*)-4a,5,9,10,11,12-hexahidro-3-metoxi-11-metil-6H-benzofuro[3a,3,2-ef][2]benzazepin-6-on | 428-690-2 | 1668-86-6 | Acute
Tox. 4 * Eye Irrit. 2 Aquatic Chronic 3 |
H302 H319 H412 |
GHS07 Wng |
H302 H319 H412 |
ATP01 | |||
| 606-113-00-7 | 1-[4-(4-benzoylphenylsulfanyl)phenyl]-2-methyl-2-(4-methylphenylsulfonyl)propan-1-one | 1-[4-(4-benzoilfenilszulfanil)fenil]-2-metil-2-(4-metilfenilszulfonil)propán-1-on | 429-040-0 | 272460-97-6 | Eye
Dam. 1 Aquatic Chronic 4 |
H318 H413 |
GHS05 Dgr |
H318 H413 |
ATP01/ATP01corr | |||
| 606-114-00-2 | 4,4',5,5',6,6',7,7'-octachloro-(2,2')biisoindolyl-1,1',3,3'-tetraone | 4,4',5,5',6,6',7,7'-oktaklór-(2,2')biizoindolil-1,1',3,3'-tetraon | 429-150-9 | 67887-47-2 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 606-115-00-8 | profoxydim (ISO); 2-{(EZ)-1-[(2RS)-2-(4-chlorophenoxy)propoxyimino]butyl}-3-hydroxy-5-(thian-3-yl)cyclohex-2-en-1-one | profoxidim (ISO); 2-{(EZ)-1-[(2RS)-2-(4-klórfenoxi)propoxiimino]butil}-3-hidroxi-5-(tian-3-il)ciklohex-2-én-1-on | - | 139001-49-3 | Carc.
2 Repr. 2 Skin Sens. 1 |
H351 H361d H317 |
GHS08 GHS07 Wng |
H351 H361d H317 |
ATP01 | |||
| 606-116-00-3 | tepraloxydim (ISO); (RS)-(EZ)-2-{1-[(2E)-3-chloroallyloxyimino]propyl}-3-hydroxy-5-perhydropyran-4-ylcyclohex-2-en-1-one | tepraloxidim (ISO); (RS)-(EZ)-2-{1-[(2E)-3-klóralliloxiimino]propil}-3-hidroxi-5-perhidropiran-4-ilciklohex-2-én-1-on | - | 149979-41-9 | Carc.
2 Repr. 2 |
H351 H361fd |
GHS08 Wng |
H351 H361fd |
ATP01 | |||
| 606-117-00-9 | 2,6-bis(1,1-dimethylethyl)-4-(phenylenemethylene)cyclohexa-2,5-dien-1-one | 2,6-bisz(1,1-dimetiletil)-4-(fenilénmetilén)ciklohexa-2,5-dién-1-on | 429-460-4 | 7078-98-0 | Skin
Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
ATP01 | |||
| 606-118-00-4 | N-(1,3-dimethylbutyl)-N'-(phenyl)-1,4-benzoquinonediimine | N-(1,3-dimetilbutil)-N'-(fenil)-1,4-benzokinondiimin | 429-640-2 | 52870-46-9 | Eye
Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H400 H410 |
GHS07 GHS09 Wng |
H319 H410 |
ATP01 | |||
| 606-119-00-X | (E)-3-methyl-5-cyclopentadecen-1-one | (E)-3-metil-5-ciklopentadecén-1-on | 429-900-5 | - | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
ATP01 | |||
| 606-120-00-5 | 2,5-dihydroxy-5-methyl-3-(morpholin-4-yl)-2-cyclopenten-1-one | 2,5-dihidroxi-5-metil-3-(morfolin-4-il)-2-ciklopentén-1-on | 430-170-5 | 114625-74-0 | Acute
Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
ATP01 | |||
| 606-121-00-0 | (+)-(1S,2S,3S,5R)-2,6,6-trimethylbicyclo[3.1.1]heptane-3-spiro-1'-(cyclohex-2'-en-4'-one) | (+)-(1S, 2S, 3S, 5R)-2,6,6-trimetilbiciklo[3.1.1]heptán-3-spiro-1'-(ciklohex-2'-én-4'-on) | 430-460-1 | 133636-82-5 | Skin
Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H410 |
ATP01 | |||
| 606-122-00-6 | 3-(2-bromopropionoyl)-4,4-dimethyl-1,3-oxazolan-2-one | 3-(2-brómpropionoil)-4,4-dimetil-1,3-oxazolán-2-on | 430-820-8 | 114341-88-7 | Acute
Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H315 H318 H317 H400 H410 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H302 H373 ** H315 H318 H317 H410 |
ATP01 | |||
| 606-123-00-1 | 4-hexadecyl-1-phenylpyrazolidin-3-one | 4-hexadecil-1-fenilpirazolidin-3-on | 430-840-7 | - | Skin
Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
ATP01 | |||
| 606-124-00-7 | 1-cyclopropyl-3-(2-methylthio-4-trifluoromethylphenyl)-1,3-propanedione | 1-ciklopropil-3-(2-metiltio-4-trifluormetilfenil)-1,3-propándion | 421-080-7 | 161462-35-7 | STOT
RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H373
** H400 H410 |
GHS08 GHS09 Wng |
H373
** H410 |
ATP01 | |||
| 606-125-00-2 | 1-benzylimidazolidine-2,4-dione | 1-benzilimidazolidin-2,4-dion | 421-340-1 | 6777-05-5 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
ATP01 | |||
| 606-126-00-8 | 1,4-bis(2,3-dihydroxypropylamino)anthraquinone | 1,4-bisz(2,3-dihidroxipropilamino)antrakinon | 421-470-7 | 99788-75-7 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
ATP01 | |||
| 606-128-00-9 | 2,2'-(1,3-phenylene)bis[5-chloro-1H-isoindole]-1,3(2H)-dione | 2,2’-(1,3-fenilén)bisz[5-klór-1H-izoindol]-1,3(2H)-dion | 422-650-8 | 148935-94-8 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 606-129-00-4 | 5-amino-[2S-di(methylphenyl)amino]-1,6-diphenyl-4Z-hexen-3-one; (2S,4Z)-5-amino-2-(dibenzylamino)-1,6-diphenylhex-4-en-3-one | 5-amino-[2S-di(metilfenil)amino]-1,6-difenil-4Z-hexén-3-on; (2S,4Z)-5-amino-2-(dibenzilamino)-1,6-difenilhex-4-én-3-on | 423-090-7 | 156732-13-7 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 606-130-00-X | 4-(1,4-dioxa-spiro[4.5]dec-8-yl)-cyclohexanone | 4-(1,4-dioxaspiro[4.5]dec-8-il)-ciklohexanon | 423-860-2 | 56309-94-5 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
ATP01 | |||
| 606-131-00-5 | cyclic 3-(1,2-ethanediylacetale)-estra-5(10),9(11)-diene-3,17-dione | ciklikus 3-(1,2-etándiil-acetál)-ösztra-5(10),9(11)-dién-3,17-dion | 427-230-8 | 5571-36-8 | Repr.
1B STOT RE 2 * Aquatic Chronic 2 |
H360F
*** H373 ** H411 |
GHS08 GHS09 Dgr |
H360F
*** H373 ** H411 |
ATP01 | |||
| 606-132-00-0 | (6β)-6,19-epoxyandrost-4-ene-3,17-dione | (6β)-6,19-epoxiandroszt-4-én-3,17-dion | 433-490-3 | 6563-83-3 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
ATP01 | |||
| 606-134-00-1 | androsta-1,4,9(11)-triene-3,17-dione | androszta-1,4,9(11)-trién-3,17-dion | 433-560-3 | 15375-21-0 | Repr.
2 |
H361f
*** |
GHS08 Wng |
H361f
*** |
ATP01 | |||
| 606-135-00-7 | cyclohexadecanone | ciklohexadekanon | 438-930-8 | 2550-52-9 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 606-136-00-2 | (3S,6R,9S,12R,15S,18R,21S,24R)-6,18-dibenzyl-3,9,15,21-tetraisobutyl-4,10,12,16,22,24-hexamethyl-1,7,13,19-tetraoxa-4,10,16,22-tetraazacyclo-tetracosane-2,5,8,11,14,17,20,23-octaone | (3S,6R,9S,12R,15S,18R,21S,24R)-6,18-dibenzil-3,9,15,21-tetra-izobutil-4,10,12,16,22,24-hexametil-1,7,13,19-tetraoxa-4,10,16,22-tetraazaciklotetrakozán-2,5,8,11,14,17,20,23-oktaon | 444-350-6 | 133413-70-4 | Eye
Irrit. 2 Aquatic Chronic 4 |
H319 H413 |
GHS07 Wng |
H319 H413 |
ATP01 | |||
| 606-137-00-8 | trans-7,7'-dimethyl-(4H,4H')-(2,2')bi[benzo[1,4]thiazinylidene]-3,3'-dione | transz-7,7'-dimetil-(4H,4H')-(2,2')bi[benzo[1,4]tiazinilidén]-3,3'-dion | 444-750-0 | 211387-26-7 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 606-138-00-3 | (2-butyl-5-nitrobenzofuran-3-yl)[4-(3-dibutylaminopropoxy)phenyl]methanone | (2-butil-5-nitrobenzofurán-3-il)[4-(3-dibutilaminopropoxi)fenil]metanon | 444-800-1 | 141645-23-0 | Flam.
Liq. 3 Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H302 H373 ** H315 H318 H317 H400 H410 |
GHS02 GHS05 GHS08 GHS07 GHS09 Dgr |
H226 H302 H373 ** H315 H318 H317 H410 |
M=10 |
ATP01/ATP01corr | ||
| 606-139-00-9 | (S)-4-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-one | (S)-4-(3,4-diklórfenil)-3,4-dihidro-2H-naftalin-1-on | 444-830-5 | 124379-29-9 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 606-140-00-4 | 2-hydroxy-1-(4-(4-(2-hydroxy-2-methylpropionyl)benzyl)phenyl)-2-methylpropan-1-one | 2-hidroxi-1-(4-(4-(2-hidroxi-2-metilpropionil)benzil)fenil)-2-metilpropán-1-on | 444-860-9 | 474510-57-1 | STOT
RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H373
** H400 H410 |
GHS08 GHS09 Wng |
H373
** H410 |
ATP01 | |||
| 606-141-00-X | sodium 3-(methoxycarbonyl)-4-oxo-3,4,5,6-tetrahydro-2-pyridinolate | nátrium-3-(metoxikarbonil)-4-oxo-3,4,5,6-tetrahidro-2-piridinolát | 418-410-7 | - | Eye
Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
ATP01 | |||
| 606-142-00-5 | reaction mass of: (1RS,2SR,7SR,8SR,E) 9 and 10-ethylidene-3-oxatricyclo[6.2.1.0(2,7)]undecan-4-one; (1RS,2SR,7SR,8SR,Z)-10-ethylidene-3-oxatricyclo[6.2.1.0(2,7)]undecan-4-one; (1RS,2SR,7SR,8SR,Z)-9-ethylidene-3-oxatricyclo[6.2.1.0(2,7)]undecan-4-one | a következő anyagok keveréke: (1RS,2SR,7SR,8SR, E) 9 és 10-etilidén-3-oxatriciklo[6.2.1.0(2,7)]undekán-4-on; (1RS,2SR,7SR,8SR, Z)-10-etilidén-3-oxatriciklo[6.2.1.0(2,7)]undekán-4-on; (1RS,2SR,7SR,8SR, Z)-9-etilidén-3-oxatriciklo[6.2.1.0(2,7)]undekán-4-on | 434-290-9 | - | Acute
Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
ATP01 | |||
| 606-143-00-0 | abamectin
(combination of avermectin B1a and avermectin B1b) (ISO) [1] avermectin B1a (purity ≥80 %) [2] |
abamektin (avermektin B1a és avermektin B1b elegye) (ISO) [1] avermektin B1a (tisztaság ≥80 %); [2] | _
[1] 265-610-3 [2] |
71751-41-2
[1] 65195-55-3 [2] |
Repr.
2 Acute Tox. 1 Acute Tox. 2 STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361d H330 H300 H372 (nervous system) H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H361d H300 H330 H372 (nervous system) H410 |
STOT
RE 1; H372: C ≥ 5 % STOT RE 2; H373: 0,5 % ≤C<5 % M=10000 |
ATP03 | ||
| 606-144-00-6 | acequinocyl (ISO); 3-dodecyl-1,4-dioxo-1,4-dihydronaphthalen-2-yl acetate | acekinocil (ISO); 3-dodecil-1,4-dioxo-1,4-dihidronaftalén-2-il acetát | — | 57960-19-7 | STOT
SE 1 STOT RE 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H370
(lung) (Inhalation) H373 (blood system) H317 H400 H410 |
GHS07 GHS08 GHS09 Dgr |
H317 H370 (lung) (Inhalation) H373 (blood system) H410 |
M=1000 |
ATP03 | ||
| 606-145-00-1 | sulcotrione (ISO); 2-[2-chloro-4-(methylsulfonyl)benzoyl]cyclohexane-1,3-dione | szulkotrion (ISO); 2-[2-klór-4-(metilszulfonil)benzoil]ciklohexán-1,3-dion | 99105-77-8 | Repr.
2 STOT RE 2 Skin Sens. 1A Aquatic Acute 1 Aquatic Chronic 1 |
H361d H373 (kidneys) H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H317 H361d H373 (kidneys) H410 |
M=1 M=10 |
ATP05 | |||
| 606-146-00-7 | tralkoxydim (ISO); 2-(N-ethoxypropanimidoyl)-3-hydroxy-5-mesitylcyclohex-2-en-1-one | tralkoxidim (ISO); 2-(N-etoxipropánimidoil)-3-hidroxi-5-mezitilciklohex-2-én-1-on | 87820-88-0 | Carc.
2 Acute Tox. 4 Aquatic Chronic 2 |
H351 H302 H411 |
GHS08 GHS07 GHS09 Wng |
H302 H351 H411 |
ATP06 | ||||
| 606-147-00-2 | cycloxydim (ISO); 2-(N-ethoxybutanimidoyl)-3-hydroxy-5-(tetrahydro-2H-thiopyran-3-yl)cyclohex-2-en-1-one | cikloxidim (ISO); 2-(N-etoxibutánimidoil)-3-hidroxi-5-(tetrahidro-2H-tiopirán-3-il)ciklohex-2-én-1-on | 405-230-9 | 101205-02-1 | Repr.
2 |
H361d |
GHS08 Wng |
H361d |
ATP06 | |||
| 606-148-00-8 | carvone
(ISO); 2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-one [1] d-carvone; (5S)-2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-one [2] l-carvone; (5R)-2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-one [3] |
karvon
(ISO); 2-metil-5-(prop-1-en-2-il)-ciklohex-2-en-1-on; [1] d-karvon; (5S)-2-metil-5-(prop-1-en-2-il)-ciklohex-2-en-1-on; [2] l-karvon; (5R)-2-metil-5-(prop-1-en-2-il)-ciklohex-2-en-1-on [3] |
202-759-5
[1] 218-827-2 [2] 229-352-5 [3] |
99-49-0
[1] 2244-16-8 [2] 6485-40-1 [3] |
Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
ATP07 | |||
| 606-149-00-3 | tembotrione (ISO); 2-{2-chloro-4-(methylsulfonyl)-3-[(2,2,2-trifluoroethoxy)methyl]benzoyl}cyclohexane-1,3-dione | tembotrion (ISO) 2-{2-klór-4-(metil-szulfonil)-3-[(2,2,2-trifluor-etoxi)metil]-benzoil}-ciklohexán-1,3-dion | 335104-84-2 | Repr.
2 STOT RE 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361d H373 (eyes, kidneys, liver) H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H317 H361d H373 (eyes, kidneys, liver) H410 |
M=100 M=10 |
ATP07 | |||
| 606-150-00-9 | clethodim (ISO); (5RS)-2-{(1EZ)-1-[(2E)-3-chloroallyloxyimino]propyl}-5-[(2RS)-2-(ethylthio)propyl]-3-hydroxycyclohex-2-en-1-one | kletodim (ISO); (5RS)-2-{(1EZ)-1-[(2E)-3-klóralliloxiimino]propil}-5-[(2RS)-2-(etiltio)propil]-3-hidroxiciklohex-2-én-1-on | 99129-21-2 | Acute
Tox. 4 Skin Sens. 1 Aquatic Chronic 3 |
H302 H317 H412 |
GHS07 Wng |
H302 H317 H412 |
EUH066 |
ATP10 | |||
| 606-151-00-4 | anthraquinone | antrakinon | 201-549-0 | 84-65-1 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
ATP10 | |||
| 607-001-00-0 | formic acid … % | hangyasav … % | 200-579-1 | 64-18-6 | Skin
Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
Skin
Corr. 1A; H314: C ≥ 90 % Skin Corr. 1B; H314: 10 % ≤ C < 90 % Skin Irrit. 2; H315: 2 % ≤ C < 10 % Eye Irrit. 2; H319: 2 % ≤ C < 10 % |
B | CLP00 | |
| 607-002-00-6 | acetic acid … % | ecetsav … % | 200-580-7 | 64-19-7 | Flam.
Liq. 3 Skin Corr. 1A |
H226 H314 |
GHS02 GHS05 Dgr |
H226 H314 |
Skin
Corr. 1A; H314: C ≥ 90 % Skin Corr. 1B; H314: 25 % ≤ C < 90 % Skin Irrit. 2; H315: 10 % ≤ C < 25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
B | CLP00 | |
| 607-003-00-1 | chloroacetic acid | klórecetsav | 201-178-4 | 79-11-8 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Aquatic Acute 1 |
H331 H311 H301 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H331 H311 H301 H314 H400 |
STOT
SE 3; H335: C ≥ 5 % |
CLP00/ATP01 | ||
| 607-004-00-7 | TCA (ISO); trichloroacetic acid | TCA (ISO); triklórecetsav | 200-927-2 | 76-03-9 | Skin
Corr. 1A Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
STOT
SE 3; H335: C ≥ 1 % |
CLP00 | ||
| 607-005-00-2 | TCA-sodium (ISO); sodium trichloroacetate | TCA-nátrium (ISO); nátrium-triklóracetát | 211-479-2 | 650-51-1 | STOT
SE 3 Aquatic Acute 1 Aquatic Chronic 1 |
H335 H400 H410 |
GHS07 GHS09 Wng |
H335 H410 |
CLP00 | |||
| 607-006-00-8 | oxalic acid | oxálsav | 205-634-3 | 144-62-7 | Acute
Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
* |
CLP00 | ||
| 607-007-00-3 | salts of oxalic acid with the exception of those specified elsewhere in this Annex | oxálsav sói (kivéve az e mellékletben külön szereplőket) | - | - | Acute
Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
* |
A | CLP00/ATP01 | |
| 607-008-00-9 | acetic anhydride | ecetsav-anhidrid | 203-564-8 | 108-24-7 | Flam.
Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H226 H332 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H226 H332 H302 H314 |
Skin
Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 5 % ≤ C < 25 % Eye Dam. 1; H318: 5 % ≤ C < 25 % Eye Irrit. 2; H319: 1 % ≤ C < 5 % STOT SE 3; H335: C ≥ 5 % |
CLP00 | ||
| 607-009-00-4 | phthalic anhydride | ftálsav-anhidrid | 201-607-5 | 85-44-9 | Acute
Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H302 H335 H315 H318 H334 H317 |
GHS08 GHS05 GHS07 Dgr |
H302 H335 H315 H318 H334 H317 |
CLP00 | |||
| 607-010-00-X | propionic anhydride | propionsav-anhidrid | 204-638-2 | 123-62-6 | Skin
Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
Skin
Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 10 % ≤ C < 25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
CLP00 | ||
| 607-011-00-5 | acetyl chloride | acetil-klorid | 200-865-6 | 75-36-5 | Flam.
Liq. 2 Skin Corr. 1B |
H225 H314 |
GHS02 GHS05 Dgr |
H225 H314 |
EUH014 |
CLP00 | ||
| 607-012-00-0 | benzoyl chloride | benzoil-klorid | 202-710-8 | 98-88-4 | Acute
Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 |
H332 H312 H302 H314 H317 |
GHS05 GHS07 Dgr |
H332 H312 H302 H314 H317 |
CLP00/ATP01 | |||
| 607-013-00-6 | dimethyl carbonate | dimetil-karbonát | 210-478-4 | 616-38-6 | Flam.
Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
CLP00 | |||
| 607-014-00-1 | methyl formate | metil-formiát | 203-481-7 | 107-31-3 | Flam.
Liq. 1 Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Eye Irrit. 2 |
H224 H332 H302 H335 H319 |
GHS02 GHS07 Dgr |
H224 H332 H302 H319 H335 |
CLP00 | |||
| 607-015-00-7 | ethyl formate | etil-formiát | 203-721-0 | 109-94-4 | Flam.
Liq. 2 Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Eye Irrit. 2 |
H225 H332 H302 H335 H319 |
GHS02 GHS07 Dgr |
H225 H332 H302 H319 H335 |
CLP00 | |||
| 607-016-00-2 | propyl
formate [1] isopropyl formate [2] |
propil-formiát; [1] izopropil-formiát [2] | 203-798-0
[1] 210-901-2 [2] |
110-74-7
[1] 625-55-8 [2] |
Flam.
Liq. 2 STOT SE 3 STOT SE 3 Eye Irrit. 2 |
H225 H335 H336 H319 |
GHS02 GHS07 Dgr |
H225 H319 H335 H336 |
C | CLP00 | ||
| 607-017-00-8 | butyl
formate [1] tert-butyl formate [2] isobutyl formate [3] |
butil-formiát; [1]terc-butil-formiát; [2] izobutil-formiát [3] | 209-772-5
[1] 212-105-0 [2] 208-818-1 [3] |
592-84-7
[1] 762-75-4 [2] 542-55-2 [3] |
Flam.
Liq. 2 STOT SE 3 Eye Irrit. 2 |
H225 H335 H319 |
GHS02 GHS07 Dgr |
H225 H319 H335 |
C | CLP00 | ||
| 607-018-00-3 | isopentyl
formate [1] pentyl formate [2] |
izopentil-formiát; [1] 2-metilbutil-formiát [2] | 203-769-2
[1] 252-343-2 [2] |
110-45-2
[1] 35073-27-9 [2] |
Flam.
Liq. 2 STOT SE 3 Eye Irrit. 2 |
H225 H335 H319 |
GHS02 GHS07 Dgr |
H225 H319 H335 |
C | CLP00 | ||
| 607-019-00-9 | methyl chloroformate | metil-klórformiát | 201-187-3 | 79-22-1 | Flam.
Liq. 2 Acute Tox. 2 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H225 H330 H312 H302 H314 |
GHS02 GHS06 GHS05 Dgr |
H225 H330 H312 H302 H314 |
CLP00 | |||
| 607-020-00-4 | ethyl chloroformate | etil-klórformiát | 208-778-5 | 541-41-3 | Flam.
Liq. 2 Acute Tox. 2 * Acute Tox. 4 * Skin Corr. 1B |
H225 H330 H302 H314 |
GHS02 GHS06 GHS05 Dgr |
H225 H330 H302 H314 |
CLP00 | |||
| 607-021-00-X | methyl acetate | metil-acetát | 201-185-2 | 79-20-9 | Flam.
Liq. 2 STOT SE 3 Eye Irrit. 2 |
H225 H336 H319 |
GHS02 GHS07 Dgr |
H225 H319 H336 |
EUH066 |
CLP00 | ||
| 607-022-00-5 | ethyl acetate | etil-acetát | 205-500-4 | 141-78-6 | Flam.
Liq. 2 STOT SE 3 Eye Irrit. 2 |
H225 H336 H319 |
GHS02 GHS07 Dgr |
H225 H319 H336 |
EUH066 |
CLP00 | ||
| 607-023-00-0 | vinyl acetate | vinil-acetát | 203-545-4 | 108-05-4 | Flam.
Liq. 2 Carc. 2 Acute Tox. 4 STOT SE 3 |
H225 H351 H332 H335 |
GHS02 GHS08 GHS07 Dgr |
H225 H332 H351 H335 |
D | CLP00/ATP05 | ||
| 607-024-00-6 | propyl
acetate [1] isopropyl acetate [2] |
propil-acetát; [1] izopropil-acetát [2] | 203-686-1
[1] 203-561-1 [2] |
109-60-4
[1] 108-21-4 [2] |
Flam.
Liq. 2 STOT SE 3 Eye Irrit. 2 |
H225 H336 H319 |
GHS02 GHS07 Dgr |
H225 H319 H336 |
EUH066 |
C | CLP00 | |
| 607-025-00-1 | n-butyl acetate | n-butil-acetát | 204-658-1 | 123-86-4 | Flam.
Liq. 3 STOT SE 3 |
H226 H336 |
GHS02 GHS07 Wng |
H226 H336 |
EUH066 |
CLP00 | ||
| 607-026-00-7 | sec-butyl
acetate [1] isobutyl acetate [2] tert-butyl acetate [3] |
szek-butil-acetát; [1] izobutil-acetát; [2] terc-butil-acetát [3] | 203-300-1
[1] 203-745-1 [2] 208-760-7 [3] |
105-46-4
[1] 110-19-0 [2] 540-88-5 [3] |
Flam.
Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
EUH066 |
C | CLP00 | |
| 607-027-00-2 | methyl propionate | metil-propionát | 209-060-4 | 554-12-1 | Flam.
Liq. 2 Acute Tox. 4 * |
H225 H332 |
GHS02 GHS07 Dgr |
H225 H332 |
CLP00 | |||
| 607-028-00-8 | ethyl propionate | etil-propionát | 203-291-4 | 105-37-3 | Flam.
Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
CLP00 | |||
| 607-029-00-3 | n-butyl
propionate [1] sec-butyl propionate [2] tert-butyl propionate [3] |
n-butil-propionát; [1] szek-butil-propionát; [2] izobutil-propionát [3] | 209-669-5
[1] 208-746-0 [3] |
590-01-2
[1] 591-34-4 [2] 540-42-1 [3] |
Flam.
Liq. 3 |
H226 |
GHS02 Wng |
H226 |
C | CLP00 | ||
| 607-030-00-9 | propyl propionate | propil-propionát | 203-389-7 | 106-36-5 | Flam.
Liq. 3 Acute Tox. 4 * |
H226 H332 |
GHS02 GHS07 Wng |
H226 H332 |
CLP00 | |||
| 607-031-00-4 | butyl butyrate | butil-butirát | 203-656-8 | 109-21-7 | Flam.
Liq. 3 |
H226 |
GHS02 Wng |
H226 |
C | CLP00 | ||
| 607-032-00-X | ethyl acrylate | etil-akrilát | 205-438-8 | 140-88-5 | Flam.
Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H225 H332 H312 H302 H335 H315 H319 H317 |
GHS02 GHS07 Dgr |
H225 H332 H312 H302 H319 H335 H315 H317 |
Skin
Irrit. 2; H315: C ≥ 5 % Eye Irrit. 2; H319: C ≥ 5 % STOT SE 3; H335: C ≥ 5 % |
D | CLP00 | |
| 607-033-00-5 | n-butyl methacrylate | n-butil-metakrilát | 202-615-1 | 97-88-1 | Flam.
Liq. 3 STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H226 H335 H315 H319 H317 |
GHS02 GHS07 Wng |
H226 H319 H335 H315 H317 |
D | CLP00 | ||
| 607-034-00-0 | methyl acrylate; methyl propenoate | metil-akrilát; metil-propenoát | 202-500-6 | 96-33-3 | Flam.
Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H225 H332 H312 H302 H335 H315 H319 H317 |
GHS02 GHS07 Dgr |
H225 H332 H312 H302 H319 H335 H315 H317 |
D | CLP00 | ||
| 607-035-00-6 | methyl methacrylate; methyl 2-methylprop-2-enoate; methyl 2-methylpropenoate | metil-metakrilát; metil-2-metilprop-2-enoát; metil-2-metilpropenoát | 201-297-1 | 80-62-6 | Flam.
Liq. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 |
H225 H335 H315 H317 |
GHS02 GHS07 Dgr |
H225 H335 H315 H317 |
D | CLP00 | ||
| 607-036-00-1 | 2-methoxyethyl acetate; methylglycol acetate | 2-metoxietil-acetát; metilglikol-acetát | 203-772-9 | 110-49-6 | Repr.
1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H360FD H332 H312 H302 |
GHS08 GHS07 Dgr |
H360FD H332 H312 H302 |
CLP00 | |||
| 607-037-00-7 | 2-ethoxyethyl acetate; ethylglycol acetate | 2-etoxietil-acetát; etilglikol-acetát | 203-839-2 | 111-15-9 | Flam.
Liq. 3 Repr. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H226 H360FD H332 H312 H302 |
GHS02 GHS08 GHS07 Dgr |
H226 H360FD H332 H312 H302 |
CLP00/ATP01 | |||
| 607-038-00-2 | 2-butoxyethyl acetate; butylglycol acetate | 2-butoxietil-acetát; butilglikol-acetát | 203-933-3 | 112-07-2 | Acute
Tox. 4 * Acute Tox. 4 * |
H332 H312 |
GHS07 Wng |
H332 H312 |
CLP00 | |||
| 607-039-00-8 | 2,4-D (ISO); 2,4-dichlorophenoxyacetic acid | 2,4-D (ISO); 2,4-diklórfenoxiecetsav | 202-361-1 | 94-75-7 | Acute
Tox. 4 * STOT SE 3 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H302 H335 H318 H317 H412 |
GHS05 GHS07 Dgr |
H302 H335 H318 H317 H412 |
CLP00 | |||
| 607-040-00-3 | salts of 2,4-D | 2,4-D sói | Acute
Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H302 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H317 H411 |
A | CLP00 | ||||
| 607-041-00-9 | 2,4,5-T (ISO); 2,4,5-trichlorophenoxy acetic acid | 2,4,5-T (ISO); 2,4,5-triklórfenoxiecetsav | 202-273-3 | 93-76-5 | Acute
Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H335 H315 H319 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H335 H315 H410 |
CLP00 | |||
| 607-042-00-4 | salts and esters of 2,4,5-T; salts and esters of 2,4,5-trichlorophenoxy acetic acid | 2,4,5-T sói és észterei; 2,4,5-triklórfenoxiecetsav sói és észterei | Acute
Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H335 H315 H319 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H335 H315 H410 |
A | CLP00 | ||||
| 607-043-00-X | dicamba (ISO); 2,5-dichloro-6-methoxybenzoic acid; 3,6-dichloro-2-methoxybenzoic acid | dikamba (ISO); 2,5-diklór-6-metoxibenzoesav; 3,6-diklór-2-metoxibenzoesav | 217-635-6 | 1918-00-9 | Acute
Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
CLP00 | |||
| 607-044-00-5 | 3,6-dichloro-o-anisic
acid, compound with dimethylamine (1:1) [1] potassium 3,6-dichloro-o-anisate [2] |
3,6-diklór-o-ánizssav és dimetilamin (1:1) vegyülete; [1] kálium-3,6-diklór-o-anizát [2] | 218-951-7
[1] 233-002-7 [2] |
2300-66-5
[1] 10007-85-9 [2] |
Eye
Irrit. 2 Aquatic Chronic 3 |
H319 H412 |
GHS07 Wng |
H319 H412 |
CLP00 | |||
| 607-045-00-0 | dichlorprop (ISO); 2-(2,4-dichlorophenoxy) propionic acid | diklórprop (ISO); 2-(2,4-diklórfenoxi)propionsav | 204-390-5 | 120-36-5 | Acute
Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 |
H312 H302 H315 H318 |
GHS05 GHS07 Dgr |
H312 H302 H315 H318 |
CLP00 | |||
| 607-046-00-6 | salts of dichlorprop | diklórprop sói | Acute
Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H332 H312 H302 |
GHS07 Wng |
H332 H312 H302 |
A | CLP00 | ||||
| 607-047-00-1 | fenoprop (ISO); 2-(2,4,5-trichlorophenoxy)propionic acid | fenoprop (ISO); 2-(2,4,5-triklórfenoxi)propionsav | 202-271-2 | 93-72-1 | Acute
Tox. 4 * Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H315 H410 |
CLP00 | |||
| 607-048-00-7 | salts of fenoprop; salts of 2-(2,4,5-trichlorophenoxy)propionic acid | fenoprop sói; 2-(2,4,5-triklórfenoxi)propionsav sói | Acute
Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
A | CLP00 | ||||
| 607-049-00-2 | mecoprop
(ISO); 2-(4-chloro-o-tolyloxy) propionic acid;
(RS)-2-(4-chloro-o-tolyloxy)propionic acid [1] 2-(4-chloro-2-methylphenoxy)propionic acid [2] |
mekoprop (ISO); 2-(4-klór-o-toliloxi)propionsav; (RS)-2-(4-klór-o-toliloxi)propionsav; [1] 2-(4-klór-2-metilfenoxi)propionsav [2] | 230-386-8
[1] 202-264-4 [2] |
7085-19-0
[1] |
Acute
Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H315 H318 H410 |
M=100 |
CLP00 | ||
| 607-050-00-8 | salts of mecoprop | mekoprop sói | Acute
Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H315 H318 H410 |
A | CLP00 | ||||
| 607-051-00-3 | MCPA (ISO); 4-chloro-o-tolyloxyacetic acid | MCPA (ISO); 4-klór-o-toliloxiecetsav | 202-360-6 | 94-74-6 | Acute
Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H315 H318 H410 |
CLP00/ATP01 | |||
| 607-052-00-9 | salts and esters of MCPA | MCPA sói és észterei | - | - | Acute
Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
A | CLP00/ATP01 | ||
| 607-053-00-4 | MCPB (ISO); 4-(4-chloro-o-tolyloxy) butyric acid | MCPB (ISO); 4-(4-klór-o-toliloxi)vajsav | 202-365-3 | 94-81-5 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 607-054-00-X | salts and esters of MCPB | MCPB sói és észterei | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
A | CLP00 | ||||
| 607-055-00-5 | endothal-sodium (ISO); disodium 7-oxabicyclo(2,2,1)heptane-2,3-dicarboxylate | endotal-nátrium (ISO); dinátrium-7-oxabiciklo(2,2,1)heptán-2,3-dikarboxilát | 204-959-8 | 129-67-9 | Acute
Tox. 3 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 |
H301 H312 H335 H315 H319 |
GHS06 Dgr |
H301 H312 H319 H335 H315 |
CLP00 | |||
| 607-056-00-0 | warfarin
(ISO); 4-hydroxy-3-(3-oxo-1-phenylbutyl)-2H-chromen-2-one [1] (S)-4-hydroxy-3-(3-oxo-1-phenylbutyl)-2-benzopyrone [2] (R)-4-hydroxy-3-(3-oxo-1-phenylbutyl)-2-benzopyrone [3] |
warfarin
(ISO); 4-hidroxi-3-(3-oxo-1-fenil-butil)-2H-kromén-2-on; [1] (S)-4-hidroxi-3-(3-oxo-1-fenil-butil)-2-benzopiron; [2] (R)-4-hidroxi-3-(3-oxo-1-fenil-butil)-2-benzopiron [3] |
201-377-6
[1] 226-907-3 [2] 226-908-9 [3] |
81-81-2
[1] 5543-57-7 [2] 5543-58-8 [3] |
Repr.
1A Acute Tox. 1 Acute Tox. 1 Acute Tox. 2 STOT RE 1 Aquatic Chronic 2 |
H360D H330 H310 H300 H372 (blood) H411 |
GHS08 GHS06 GHS09 Dgr |
H330 H310 H300 H360D H372 (blood) H411 |
Repr.
1A; H360D: C ≥ 0,003 % STOT RE 1; H372: C ≥ 0,5 % STOT RE 2; H373: ,05 % ≤ C < 0,5 % |
CLP00/ATP09 | ||
| 607-057-00-6 | coumachlor (ISO); 3-[1-(4-chlorophenyl)-3-oxobutyl]-4-hydroxycoumarin | kumaklór (ISO); 3-[1-(4-klórfenil)-3-oxobutil]-4-hidroxikumarin | 201-378-1 | 81-82-3 | STOT
RE 2 * Aquatic Chronic 3 |
H373
** H412 |
GHS08 Wng |
H373
** H412 |
CLP00 | |||
| 607-058-00-1 | coumafuryl (ISO); fumarin; (RS)-3-(1-(2-furyl)-3-oxobutyl)4-hydroxycoumarin; 4-hydroxy-3-[3-oxo-1-(2-furyl) butyl]coumarin | kumafuril (ISO); fumarin; (RS)-3-(1-(2-furil)-3-oxobutil)4-hidroxikumarin; 4-hidroxi-3-[3-oxo-1-(2-furil)butil]kumarin | 204-195-5 | 117-52-2 | Acute
Tox. 3 * STOT RE 1 Aquatic Chronic 3 |
H301 H372 ** H412 |
GHS06 GHS08 Dgr |
H301 H372 ** H412 |
CLP00 | |||
| 607-059-00-7 | coumatetralyl (ISO); 4-hydroxy-3-(1,2,3,4-tetrahydro-1-naphthyl)coumarin | kumatetralil (ISO); 4-hidroxi-3-(1,2,3,4-tetrahidro-1-naftil)kumarin | 227-424-0 | 5836-29-3 | Repr.
1B Acute Tox. 2 Acute Tox. 2 Acute Tox. 3 STOT RE 1 Aquatic Chronic 1 |
H360D H330 H300 H311 H372 (blood) H410 |
GHS08 GHS06 GHS09 Dgr |
H330 H311 H300 H360D H372 (blood) H410 |
Repr.
1B; H360D: C ≥ 0,003 % STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % M=10 |
CLP00/ATP09 | ||
| 607-060-00-2 | dicoumarol; 4,4'-dihydroxy-3,3'-methylenebis(2H-chromen-2-one) | dikumarol; 4,4’-dihidroxi-3,3’-metilénbisz(2H-kromén-2-on) | 200-632-9 | 66-76-2 | Acute
Tox. 4 * STOT RE 1 Aquatic Chronic 2 |
H302 H372 ** H411 |
GHS08 GHS07 GHS09 Dgr |
H372
** H302 H411 |
CLP00 | |||
| 607-061-00-8 | acrylic acid; prop-2-enoic acid | akrilsav; prop-2-énsav | 201-177-9 | 79-10-7 | Flam.
Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A Aquatic Acute 1 |
H226 H332 H312 H302 H314 H400 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H226 H332 H312 H302 H314 H400 |
STOT
SE 3; H335: C ≥ 1 % |
D | CLP00 | |
| 607-062-00-3 | n-butyl acrylate | n-butil-akrilát | 205-480-7 | 141-32-2 | Flam.
Liq. 3 STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H226 H335 H315 H319 H317 |
GHS02 GHS07 Wng |
H226 H319 H335 H315 H317 |
D | CLP00 | ||
| 607-063-00-9 | isobutyric acid | izovajsav | 201-195-7 | 79-31-2 | Acute
Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
CLP00 | |||
| 607-064-00-4 | benzyl chloroformate | benzil-klórformiát | 207-925-0 | 501-53-1 | Skin
Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
STOT
SE 3; H335: C ≥ 5 % |
CLP00 | ||
| 607-065-00-X | bromoacetic acid | brómecetsav | 201-175-8 | 79-08-3 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1A Skin Sens. 1 Aquatic Acute 1 |
H331 H311 H301 H314 H317 H400 |
GHS06 GHS05 GHS09 Dgr |
H331 H311 H301 H314 H317 H400 |
CLP00/ATP01 | |||
| 607-066-00-5 | dichloroacetic acid | diklórecetsav | 201-207-0 | 79-43-6 | Skin
Corr. 1A Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
CLP00 | |||
| 607-067-00-0 | dichloroacetyl chloride | diklóracetil-klorid | 201-199-9 | 79-36-7 | Skin
Corr. 1A Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
CLP00 | |||
| 607-068-00-6 | iodoacetic acid | jódecetsav | 200-590-1 | 64-69-7 | Acute
Tox. 3 * Skin Corr. 1A |
H301 H314 |
GHS06 GHS05 Dgr |
H301 H314 |
CLP00 | |||
| 607-069-00-1 | ethyl bromoacetate | etil-brómacetát | 203-290-9 | 105-36-2 | Acute
Tox. 1 Acute Tox. 2 * Acute Tox. 2 * |
H310 H330 H300 |
GHS06 Dgr |
H330 H310 H300 |
CLP00 | |||
| 607-070-00-7 | ethyl chloroacetate | etil-klóracetát | 203-294-0 | 105-39-5 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 |
H331 H311 H301 H400 |
GHS06 GHS09 Dgr |
H331 H311 H301 H400 |
CLP00 | |||
| 607-071-00-2 | ethyl methacrylate | etil-metakrilát | 202-597-5 | 97-63-2 | Flam.
Liq. 2 STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H225 H335 H315 H319 H317 |
GHS02 GHS07 Dgr |
H225 H319 H335 H315 H317 |
D | CLP00 | ||
| 607-072-00-8 | 2-hydroxyethyl acrylate | 2-hidroxietil-akrilát | 212-454-9 | 818-61-1 | Acute
Tox. 3 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 |
H311 H314 H317 H400 |
GHS06 GHS05 GHS09 Dgr |
H311 H314 H317 H400 |
* Skin Sens. 1; H317: C ≥ 0,2 % |
D | CLP00 | |
| 607-073-00-3 | 4-CPA (ISO); 4-chlorophenoxyacetic acid | 4-CPA (ISO); 4-klórfenoxiecetsav | 204-581-3 | 122-88-3 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 607-074-00-9 | chlorfenac (ISO); 2,3,6-trichlorophenylacetic acid | klórfenak (ISO); 2,3,6-triklórfenilecetsav | 201-599-3 | 85-34-7 | Acute
Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
CLP00 | |||
| 607-075-00-4 | chlorfenprop-methyl; methyl 2-chloro-3-(4-chlorophenyl)propionate | klórfenprop-metil; metil-2-klór-3-(4-klórfenil)propionát | 238-413-5 | 14437-17-3 | Acute
Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
CLP00 | |||
| 607-076-00-X | dodine (ISO); dodecylguanidinium acetate | dodin (ISO); dodecilguanidinium-acetát | 219-459-5 | 2439-10-3 | Acute
Tox. 4 * Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H319 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H315 H410 |
CLP00 | |||
| 607-077-00-5 | erbon (ISO); 2-(2,4,5-trichlorophenoxy)ethyl 2,2-dichloropropionate | erbon (ISO); 2-(2,4,5-triklórfenoxi)etil-2,2-diklórpropionát | 136-25-4 | Acute
Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
CLP00 | ||||
| 607-078-00-0 | fluenetil (ISO); 2-fluoroethyl biphenyl-4-ylacetate | fluenetil (ISO); 2-fluoretilbifenil-4-ilacetát | 4301-50-2 | Acute
Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
CLP00 | ||||
| 607-079-00-6 | kelevan (ISO); ethyl 5-(perchloro-5-hydroxypentacyclo[5,3,0,02,6,03,9,04,8]decan-5-yl)-4-oxopentanoate; ethyl 5-(1,2,3,5,6,7,8,9,10,10-decachloro-4-hydroxypentacyclo(5,2,1,02,6,03,9,05,8)dec-4-yl)-4-oxovalerate | kelevan (ISO); etil-5-(perklór-5-hidroxipentaciklo[5,3,0,02,6,03,9,04,8]dekán-5-il)-4-oxopentanoát; etil-5-(1,2,3,5,6,7,8,9,10,10-dekaklór-4-hidroxipentaciklo(5,2,1,02,6,03,9,05,8)dec-4-il)-4-oxovalerát | 4234-79-1 | Acute
Tox. 3 * Acute Tox. 4 * Aquatic Chronic 2 |
H311 H302 H411 |
GHS06 GHS09 Dgr |
H311 H302 H411 |
CLP00 | ||||
| 607-080-00-1 | chloroacetyl chloride | klóracetil-klorid | 201-171-6 | 79-04-9 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Skin Corr. 1A Aquatic Acute 1 |
H331 H311 H301 H372 ** H314 H400 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H331 H311 H301 H372 ** H314 H400 |
EUH014 EUH029 |
CLP00 | ||
| 607-081-00-7 | fluoroacetic acid | fluorecetsav | 205-631-7 | 144-49-0 | Acute
Tox. 2 * Aquatic Acute 1 |
H300 H400 |
GHS06 GHS09 Dgr |
H300 H400 |
CLP00 | |||
| 607-082-00-2 | fluoroacetates, soluble | fluor-acetátok (oldhatók) | Acute
Tox. 2 * Aquatic Acute 1 |
H300 H400 |
GHS06 GHS09 Dgr |
H300 H400 |
A | CLP00 | ||||
| 607-083-00-8 | 2,4-DB (ISO); 4-(2,4-dichlorophenoxy)butyric acid | 2,4-DB (ISO); 4-(2,4-diklórfenoxi)butánsav | 202-366-9 | 94-82-6 | Acute
Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
CLP00 | |||
| 607-084-00-3 | salts of 2,4-DB | 2,4-DB sói | Acute
Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
A | CLP00 | ||||
| 607-085-00-9 | benzyl benzoate | benzil-benzoát | 204-402-9 | 120-51-4 | Acute
Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
CLP00/ATP01 | |||
| 607-086-00-4 | diallyl phthalate | diallil-ftalát | 205-016-3 | 131-17-9 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | |||
| 607-088-00-5 | methacrylic acid; 2-methylpropenoic acid | metakrilsav; 2-metilpropénsav | 201-204-4 | 79-41-4 | Acute
Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
STOT
SE 3; H335: C ≥ 1 % |
D | CLP00 | |
| 607-089-00-0 | propionic acid … % | propionsav … % | 201-176-3 | 79-09-4 | Skin
Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
STOT
SE 3; H335: C ≥ 10 % Skin Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 10 % ≤ C < 25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
B | CLP00 | |
| 607-090-00-6 | thioglycolic acid | tioglikolsav, merkaptoecetsav | 200-677-4 | 68-11-1 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B |
H331 H311 H301 H314 |
GHS06 GHS05 Dgr |
H331 H311 H301 H314 |
* |
CLP00 | ||
| 607-091-00-1 | trifluoroacetic acid . . . % | trifluorecetsav . . . % | 200-929-3 | 76-05-1 | Acute
Tox. 4 * Skin Corr. 1A Aquatic Chronic 3 |
H332 H314 H412 |
GHS05 GHS07 Dgr |
H332 H314 H412 |
* |
B | CLP00 | |
| 607-092-00-7 | methyl
lactate [1] methyl (±)-lactate [2] methyl (R)-lactate [3] methyl (S)-(-)-lactate [4] |
metil-laktát; [1] (±)-metil-laktát; [2] (R)-metil-laktát; [3] (S)-(-)-metil-laktát [4] | 208-930-0
[1] 218-449-8 [2] 241-420-6 [3] 248-704-9 [4] |
547-64-8
[1] 2155-30-8 [2] 17392-83-5 [3] 27871-49-4 [4] |
Flam.
Liq. 3 STOT SE 3 Eye Irrit. 2 |
H226 H335 H319 |
GHS02 GHS07 Wng |
H226 H319 H335 |
C | CLP00 | ||
| 607-093-00-2 | propionyl chloride | propionil-klorid | 201-170-0 | 79-03-8 | Flam.
Liq. 2 Skin Corr. 1B |
H225 H314 |
GHS02 GHS05 Dgr |
H225 H314 |
EUH014 |
B D | CLP00 | |
| 607-094-00-8 | peracetic acid . . . % | perecetsav . . . % | 201-186-8 | 79-21-0 | Flam.
Liq. 3 Org. Perox. D **** Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A Aquatic Acute 1 |
H226 H242 H332 H312 H302 H314 H400 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H226 H242 H332 H312 H302 H314 H400 |
* STOT SE 3; H335: C ≥ 1 % |
B D | CLP00 | |
| 607-095-00-3 | maleic acid | maleinsav | 203-742-5 | 110-16-7 | Acute
Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H302 H335 H315 H319 H317 |
GHS07 Wng |
H302 H319 H335 H315 H317 |
Skin
Sens. 1; H317: C ≥ 0,1 % |
CLP00/ATP01 | ||
| 607-096-00-9 | maleic anhydride | maleinsav-anhidrid | 203-571-6 | 108-31-6 | Acute
Tox. 4 STOT RE 1 Skin Corr. 1B Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1A |
H302 H372 (respiratory system, inhalation) H314 H318 H334 H317 |
GHS07 GHS08 GHS05 Dgr |
H302 H314 H334 H317 H372 (respiratory system) (inhalation) |
EUH071 |
Skin
Sens. 1A; H317: C ≥ 0,001 % |
CLP00/ATP13 | |
| 607-097-00-4 | benzene-1,2,4-tricarboxylic acid 1,2-anhydride; trimellitic anhydride | benzol-1,2,4-trikarbonsav-1,2-anhidrid; trimellit-anhidrid | 209-008-0 | 552-30-7 | STOT
SE 3 Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H335 H318 H334 H317 |
GHS08 GHS05 GHS07 Dgr |
H335 H318 H334 H317 |
CLP00 | |||
| 607-098-00-X | benzene-1,2:4,5-tetracarboxylic dianhydride; benzene-1,2:4,5-tetracarboxylic dianhydride; pyromellitic dianhydride | benzol-1,2:4,5-tetrakarbonsav-dianhidrid; benzol-1,2:4,5-tetrakarbonsav-dianhidrid; piromellit-dianhidrid | 201-898-9 | 89-32-7 | Eye
Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H318 H334 H317 |
GHS08 GHS05 Dgr |
H318 H334 H317 |
CLP00 | |||
| 607-099-00-5 | 1,2,3,6-tetrahydrophthalic
anhydride [1] cis-1,2,3,6-tetrahydrophthalic anhydride [2] 3,4,5,6-tetrahydrophthalic anhydride [3] tetrahydrophthalic anhydride [4] |
1,2,3,6-tetrahidroftálsav-anhidrid; [1] cisz-1,2,3,6-tetrahidroftálsav-anhidrid; [2] 3,4,5,6-tetrahidroftálsav-anhidrid; [3] tetrahidroftálsav-anhidrid [4] | 201-605-4
[1] 213-308-7 [2] 219-374-3 [3] 247-570-9 [4] |
85-43-8
[1] 935-79-5 [2] 2426-02-0 [3] 26266-63-7 [4] |
Eye
Dam. 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H334 H317 H412 |
GHS08 GHS05 Dgr |
H318 H334 H317 H412 |
C | CLP00 | ||
| 607-100-00-9 | benzophenone-3,3',4,4'-tetracarboxylic dianhydride; 4,4'-carbonyldi(phthalic anhydride) | benzofenon-3,3’,4,4’-tetrakarbonsav-dianhidrid; 4,4'-karbonildi(ftálsav-anhidrid) | 219-348-1 | 2421-28-5 | STOT
SE 3 Eye Irrit. 2 |
H335 H319 |
GHS07 Wng |
H319 H335 |
Eye
Irrit. 2; H319: C ≥ 1 % STOT SE 3; H335: C ≥ 1 % |
CLP00 | ||
| 607-101-00-4 | 1,4,5,6,7,7-hexachlorobicyclo [2,2,1]hept-5-ene-2,3-dicarboxylic anhydride chlorendic anhydride | 1,4,5,6,7,7-hexaklórbiciklo[2,2,1]hept-5-én-2,3-dikarbonsav-anhidrid, klorendik-anhidrid; 1,4,5,6,7,7-hexaklór-8,9,10-trinorborn-5-én-2,3-dikarbonsav-anhidrid | 204-077-3 | 115-27-5 | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 |
H335 H315 H319 |
GHS07 Wng |
H319 H335 H315 |
Skin
Irrit. 2; H315: C ≥ 1 % Eye Irrit. 2; H319: C ≥ 1 % STOT SE 3; H335: C ≥ 1 % |
CLP00 | ||
| 607-102-00-X | cyclohexane-1,2-dicarboxylic
anhydride [1] cis-cyclohexane-1,2-dicarboxylic anhydride [2] trans-cyclohexane-1,2-dicarboxylic anhydride [3] |
ciklohexán-1,2-dikarbonsav-anhidrid; [1] cisz-ciklohexán-1,2-dikarbonsav-anhidrid; [2] transz-ciklohexán-1,2-dikarbonsav-anhidrid [3] | 201-604-9
[1] 236-086-3 [2] 238-009-9 [3] |
85-42-7
[1] 13149-00-3 [2] 14166-21-3 [3] |
Eye
Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H318 H334 H317 |
GHS08 GHS05 Dgr |
H318 H334 H317 |
C | CLP00 | ||
| 607-103-00-5 | succinic anhydride | borostyánkősav-anhidrid | 203-570-0 | 108-30-5 | Acute
Tox. 4 Skin Corr. 1 Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H302 H314 H318 H334 H317 |
GHS07 GHS05 GHS08 Dgr |
H302 H314 H334 H317 |
EUH071 |
CLP00/ATP13 | ||
| 607-104-00-0 | cyclopentane-1,2,3,4-tetracarboxylic dianhydride | ciklopentán-1,2,3,4-tetrakarbonsav-dianhidrid | 227-964-7 | 6053-68-5 | STOT
SE 3 Eye Irrit. 2 |
H335 H319 |
GHS07 Wng |
H319 H335 |
Eye
Irrit. 2; H319: C ≥ 1 % STOT SE 3; H335: C ≥ 1 % |
CLP00 | ||
| 607-105-00-6 | 8,9,10-trinorborn-5-ene-2,3-dicarboxylic
anhydride [1] 1,2,3,6-tetrahydro-3,6-methanophthalic anhydride [2] (1α,2α,3β,6β)-1,2,3,6-tetrahydro-3,6-methanophthalic anhydride [3] |
8,9,10-trinorborn-5-én-2,3-dikarbonsav-anhidrid; [1] 1,2,3,6-tetrahidro-3,6-metanoftálsav-anhidrid; [2] (1α,2α,3β,6β)-1,2,3,6-tetrahidro-3,6-metanoftálsav-anhidrid [3] | 204-957-7
[1] 212-557-9 [2] 220-384-5 [3] |
129-64-6
[1] 826-62-0 [2] 2746-19-2 [3] |
Eye
Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H318 H334 H317 |
GHS08 GHS05 Dgr |
H318 H334 H317 |
C | CLP00 | ||
| 607-106-00-1 | 8,9-dinorborn-5-ene-2,3-dicarboxylic anhydride | 8,9-dinorborn-5-én-2,3-dikarbonsav-anhidrid | 123748-85-6 | Acute
Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Resp. Sens. 1 |
H302 H335 H315 H319 H334 |
GHS08 GHS07 Dgr |
H302 H319 H335 H315 H334 |
STOT
SE 3; H335: C ≥ 10 % |
C | CLP00 | ||
| 607-107-00-7 | 2-ethylhexyl acrylate | 2-etilhexil-akrilát | 203-080-7 | 103-11-7 | STOT
SE 3 Skin Irrit. 2 Skin Sens. 1 |
H335 H315 H317 |
GHS07 Wng |
H335 H315 H317 |
D | CLP00 | ||
| 607-108-00-2 | 2-hydroxy-1-methylethylacrylate
[1] 2-hydroxypropylacrylate [2] acrylic acid, monoester with propane-1,2-diol [3] |
2-hidroxi-1-metiletil-akrilát; [1] 2-hidroxipropil-akrilát; [2] akrilsav monoésztere propán-1,2-diollal [3] | 220-852-9
[1] 213-663-8 [2] 247-118-0 [3] |
2918-23-2
[1] 999-61-1 [2] 25584-83-2 [3] |
Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 |
H331 H311 H301 H314 H317 |
GHS06 GHS05 Dgr |
H331 H311 H301 H314 H317 |
* Skin Sens. 1; H317: C ≥ 0,2 % |
C D | CLP00 | |
| 607-109-00-8 | hexamethylene diacrylate; hexane-1,6-diol diacrylate | hexametilén-diakrilát; hexán-1,6-diol-diakrilát | 235-921-9 | 13048-33-4 | Skin
Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H315 H319 H317 |
GHS07 Wng |
H319 H315 H317 |
D | CLP00 | ||
| 607-110-00-3 | pentaerythritol triacrylate | pentaeritritol-triakrilát | 222-540-8 | 3524-68-3 | Skin
Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H315 H319 H317 |
GHS07 Wng |
H319 H315 H317 |
D | CLP00 | ||
| 607-111-00-9 | 2,2-bis(acryloyloxymethyl)butyl acrylate; trimethylolpropane triacrylate | 2,2-bisz(akriloiloximetil)butil-akrilát; trimetilolpropán-triakrilát | 239-701-3 | 15625-89-5 | Skin
Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H315 H319 H317 |
GHS07 Wng |
H319 H315 H317 |
D | CLP00 | ||
| 607-112-00-4 | 2,2-dimethyltrimethylene diacrylate; neopentyl glycol diacrylate | 2,2-dimetiltrimetilén-diakrilát; neopentil-glikol-diakrilát | 218-741-5 | 2223-82-7 | Acute
Tox. 3 * Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H311 H315 H319 H317 |
GHS06 Dgr |
H311 H319 H315 H317 |
* |
D | CLP00 | |
| 607-113-00-X | isobutyl methacrylate | izobutil-metakrilát | 202-613-0 | 97-86-9 | Flam.
Liq. 3 STOT SE 3 Skin Irrit. 2 Skin Sens. 1B |
H226 H335 H315 H317 |
GHS02 GHS07 Wng |
H226 H315 H317 H335 |
D | CLP00/ATP13 | ||
| 607-114-00-5 | ethylene dimethacrylate | etilén-dimetil-akrilát | 202-617-2 | 97-90-5 | STOT
SE 3 Skin Sens. 1 |
H335 H317 |
GHS07 Wng |
H335 H317 |
STOT
SE 3; H335: C ≥ 10 % |
D | CLP00 | |
| 607-115-00-0 | isobutyl acrylate | izobutil-akrilát | 203-417-8 | 106-63-8 | Flam.
Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Skin Sens. 1 |
H226 H332 H312 H315 H317 |
GHS02 GHS07 Wng |
H226 H332 H312 H315 H317 |
D | CLP00 | ||
| 607-116-00-6 | cyclohexyl acrylate | ciklohexil-akrilát | 221-319-3 | 3066-71-5 | STOT
SE 3 Skin Irrit. 2 Aquatic Chronic 2 |
H335 H315 H411 |
GHS07 GHS09 Wng |
H335 H315 H411 |
STOT
SE 3; H335: C ≥ 10 % |
D | CLP00 | |
| 607-117-00-1 | 2,3-epoxypropyl acrylate; glycidyl acrylate | 2,3-epoxipropil-akrilát; glicidil-akrilát | 203-440-3 | 106-90-1 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 |
H331 H311 H301 H314 H317 |
GHS06 GHS05 Dgr |
H331 H311 H301 H314 H317 |
* Skin Sens. 1; H317: C ≥ 0,2 % |
D | CLP00 | |
| 607-118-00-7 | 1-methyltrimethylene diacrylate; 1,3-butylene glycol diacrylate | 1-metiltrimetilén-diakrilát; 1,3-butilénglikol-diakrilát | 243-105-9 | 19485-03-1 | Acute
Tox. 4 * Skin Corr. 1B Skin Sens. 1 |
H312 H314 H317 |
GHS05 GHS07 Dgr |
H312 H314 H317 |
D | CLP00 | ||
| 607-119-00-2 | tetramethylene diacrylate; 1,4-butyleneglycol diacrylate | tetrametilén-diakrilát; 1,4-butilénglikol-diakrilát | 213-979-6 | 1070-70-8 | Acute
Tox. 4 * Skin Corr. 1B Skin Sens. 1 |
H312 H314 H317 |
GHS05 GHS07 Dgr |
H312 H314 H317 |
D | CLP00 | ||
| 607-120-00-8 | 2,2'-oxydiethyl diacrylate; diethylene glycol diacrylate | 2,2-oxidietil-diakrilát; dietilén-glikol-diakrilát | 223-791-6 | 4074-88-8 | Acute
Tox. 3 * Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H311 H315 H319 H317 |
GHS06 Dgr |
H311 H319 H315 H317 |
* Skin Sens. 1; H317: C ≥ 0,2 % |
D | CLP00 | |
| 607-121-00-3 | 8,9,10-trinorborn-2-yl acrylate | 8,9,10-trinorborn-2-il-akrilát; 2-norbornil-akrilát | 10027-06-2 | Acute
Tox. 4 * Skin Irrit. 2 Skin Sens. 1 |
H312 H315 H317 |
GHS07 Wng |
H312 H315 H317 |
D | CLP00 | |||
| 607-122-00-9 | pentaerythritol tetraacrylate | pentaeritritol-tetraakrilát | 225-644-1 | 4986-89-4 | Skin
Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H315 H319 H317 |
GHS07 Wng |
H319 H315 H317 |
D | CLP00 | ||
| 607-123-00-4 | 2,3-epoxypropyl methacrylate; glycidyl methacrylate | 2,3-epoxipropil-
metakrilát; glicidil-metakrilát |
203-441-9 | 106-91-2 | Carc.
1B Muta. 2 Repr. 1B Acute Tox. 3 Acute Tox. 4 STOT SE 3 STOT RE 1 Skin Corr. 1C Eye Dam. 1 Skin Sens. 1 |
H350 H341 H360F H311 H302 H335 H372 (respiratory tract) (Inhalation) H314 H318 H317 |
GHS08 GHS06 GHS05 Dgr |
H311 H302 H314 H317 H341 H350 H360F H335 H372 (respiratory tract) (Inhalation) |
D | CLP00/ATP10 | ||
| 607-124-00-X | 2-hydroxyethyl methacrylate | 2-hidroxietil-metakrilát | 212-782-2 | 868-77-9 | Skin
Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H315 H319 H317 |
GHS07 Wng |
H319 H315 H317 |
D | CLP00 | ||
| 607-125-00-5 | 2-hydroxypropyl
methacrylate [1] 3-hydroxypropyl methacrylate [2] |
2-hidroxipropil-metakrilát; [1] 3 -hidroxipropil-metakrilát [2 | 213-090-3
[1] 220-426-2 [2] |
923-26-2
[1] 2761-09-3 [2] |
Eye
Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
C D | CLP00 | ||
| 607-126-00-0 | 2,2'-(ethylenedioxy)diethyl diacrylate; triethylene glycol diacrylate | 2,2'-(etiléndioxi)dietil-diakrilát; trietilén-glikol-diakrilát | 216-853-9 | 1680-21-3 | Skin
Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H315 H319 H317 |
GHS07 Wng |
H319 H315 H317 |
D | CLP00 | ||
| 607-127-00-6 | 2-diethylaminoethyl methacrylate | 2-(dietilamino)etil-metakrilát | 203-275-7 | 105-16-8 | Acute
Tox. 4 * Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H332 H315 H319 H317 |
GHS07 Wng |
H332 H319 H315 H317 |
D | CLP00 | ||
| 607-128-00-1 | 2-tert-butylaminoethyl methacrylate | 2-(terc-butilamino)etil-metakrilát | 223-228-4 | 3775-90-4 | Skin
Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H315 H319 H317 |
GHS07 Wng |
H319 H315 H317 |
D | CLP00 | ||
| 607-129-00-7 | ethyl
lactate; ethyl DL-lactate [1] ethyl (S)-2-hydroxypropionate; ethyl L-lactate; ethyl-(S)-lactate [2] |
etil-laktát; etil-DL-laktát; [1] etil-(S)-2-hidroxipropionát; etil-L-laktát; etil-(S)-laktát [2] | 202-598-0
[1] 211-694-1 [2] |
97-64-3
[1] 687-47-8 [2] |
Flam.
Liq. 3 STOT SE 3 Eye Dam. 1 |
H226 H335 H318 |
GHS02 GHS05 GHS07 Dgr |
H226 H335 H318 |
C | CLP00 | ||
| 607-130-00-2 | pentyl
acetate [1] isopentyl acetate [2] 1-methylbutyl acetate [3] 2-methylbutyl acetat [4] 2(or 3)-methylbutyl acetate [5] |
pentil-acetát; [1] izopentil-acetát; [2] 1-metilbutil-acetát; [3] 2-metilbutil-acetát; [4] 2(vagy 3)-metilbutil-acetát [5] | 211-047-3
[1] 204-662-3 [2] 210-946-8 [3] 210-843-8 [4] 282-263-3 [5] |
628-63-7
[1] 123-92-2 [2] 626-38-0 [3] 624-41-9 [4] 84145-37-9 [5] |
Flam.
Liq. 3 |
H226 |
GHS02 Wng |
H226 |
EUH066 |
C | CLP00 | |
| 607-131-00-8 | isopentyl
propionate [1] pentyl propionate [2] 2-methylbutyl propionate [3] |
izopentil-propionát; [1] pentil-propionát; [2] 2-metilbutil-propionát [3] | 203-322-1
[1] 210-852-7 [2] 219-449-0 [3] |
105-68-0
[1] 624-54-4 [2] 2438-20-2 [3] |
Flam.
Liq. 3 |
H226 |
GHS02 Wng |
H226 |
C | CLP00 | ||
| 607-132-00-3 | 2-dimethylaminoethyl methacrylate | 2-dimetilaminoetil-metakrilát | 220-688-8 | 2867-47-2 | Acute
Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H312 H302 H315 H319 H317 |
GHS07 Wng |
H312 H302 H319 H315 H317 |
D | CLP00 | ||
| 607-133-00-9 | monoalkyl or monoaryl or monoalkylaryl esters of acrylic acid with the exception of those specified elsewhere in this Annex | akrilsav monoalkil-, monoaril- vagy monoalkilaril-észterei, kivéve az e mellékletben külön szereplőket | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 Aquatic Chronic 2 |
H335 H315 H319 H411 |
GHS07 GHS09 Wng |
H319 H335 H315 H411 |
STOT
SE 3; H335: C ≥ 10 % |
A | CLP00 | |||
| 607-134-00-4 | monoalkyl or monoaryl or monoalkyaryl esters of methacrylic acid with the exception of those specified elsewhere in this Annex | metakrilsav monoalkil-, monoaril- vagy monoalkilaril-észterei, kivéve az e mellékletben külön szereplőket | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 |
H335 H315 H319 |
GHS07 Wng |
H319 H335 H315 |
STOT
SE 3; H335: C ≥ 10 % |
A | CLP00 | |||
| 607-135-00-X | butyric acid | vajsav | 203-532-3 | 107-92-6 | Skin
Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
CLP00 | |||
| 607-136-00-5 | butyryl chloride | butiril-klorid | 205-498-5 | 141-75-3 | Flam.
Liq. 2 Skin Corr. 1B |
H225 H314 |
GHS02 GHS05 Dgr |
H225 H314 |
CLP00 | |||
| 607-137-00-0 | methyl acetoacetate | metil-acetoacetát | 203-299-8 | 105-45-3 | Eye
Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
CLP00 | |||
| 607-138-00-6 | butyl chloroformate; chloroformic acid butyl ester | butil-klórformiát; klórhangyasav-butil-észter | 209-750-5 | 592-34-7 | Flam.
Liq. 3 Acute Tox. 3 * Skin Corr. 1B |
H226 H331 H314 |
GHS02 GHS06 GHS05 Dgr |
H226 H331 H314 |
CLP00 | |||
| 607-139-00-1 | 2-chloropropionic acid | 2-klórpropionsav | 209-952-3 | 598-78-7 | Acute
Tox. 4 * Skin Corr. 1A |
H302 H314 |
GHS05 GHS07 Dgr |
H302 H314 |
CLP00 | |||
| 607-140-00-7 | isobutyryl chloride | izobutiril-klorid | 201-194-1 | 79-30-1 | Flam.
Liq. 2 Skin Corr. 1A |
H225 H314 |
GHS02 GHS05 Dgr |
H225 H314 |
CLP00 | |||
| 607-141-00-2 | oxydiethylene bis(chloroformate) | oxidietilén-bisz(klórformiát) | 203-430-9 | 106-75-2 | Acute
Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 2 |
H302 H315 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H315 H318 H411 |
CLP00 | |||
| 607-142-00-8 | propyl chloroformate; chloroformic acid propylester; n-propyl chloroformate | propil-klórformiát; klórhangyasav-propil-észter; n-propil-klórformiát | 203-687-7 | 109-61-5 | Flam.
Liq. 2 Acute Tox. 3 * Skin Corr. 1B |
H225 H331 H314 |
GHS02 GHS06 GHS05 Dgr |
H225 H331 H314 |
CLP00/ATP01 | |||
| 607-143-00-3 | valeric acid | valeriánsav | 203-677-2 | 109-52-4 | Skin
Corr. 1B Aquatic Chronic 3 |
H314 H412 |
GHS05 Dgr |
H314 H412 |
CLP00 | |||
| 607-144-00-9 | adipic acid | adipinsav | 204-673-3 | 124-04-9 | Eye
Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
CLP00 | |||
| 607-145-00-4 | methanesulphonic acid | metánszulfonsav | 200-898-6 | 75-75-2 | Skin
Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
CLP00 | |||
| 607-146-00-X | fumaric acid | fumársav | 203-743-0 | 110-17-8 | Eye
Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
CLP00 | |||
| 607-147-00-5 | oxalic acid diethylester; diethyl oxalate | oxálsav-dietil-észter; dietil-oxalát | 202-464-1 | 95-92-1 | Acute
Tox. 4 * Eye Irrit. 2 |
H302 H319 |
GHS07 Wng |
H302 H319 |
CLP00 | |||
| 607-148-00-0 | guanidinium chloride; guanadine hydrochloride | guanidínium-klorid; guanidin-hidroklorid | 200-002-3 | 50-01-1 | Acute
Tox. 4 * Skin Irrit. 2 Eye Irrit. 2 |
H302 H315 H319 |
GHS07 Wng |
H302 H319 H315 |
CLP00 | |||
| 607-149-00-6 | urethane (INN); ethyl carbamate | uretán (INN); etil-karbamát | 200-123-1 | 51-79-6 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 607-150-00-1 | endothal (ISO); 7-oxabicyclo(2,2,1)heptane-2,3-dicarboxylic acid | endotál (ISO), 7-oxabiciklo(2,2,1)heptán-2,3-dikarbonsav | 205-660-5 | 145-73-3 | Acute
Tox. 3 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 |
H301 H312 H335 H315 H319 |
GHS06 Dgr |
H301 H312 H319 H335 H315 |
CLP00 | |||
| 607-151-00-7 | propargite (ISO); 2-(4-tert-butylphenoxy) cyclohexyl prop-2-ynyl sulphite | propargit (ISO); 2-(4-terc-butilfenoxi)ciklohexilprop-2-inil-szulfit | 219-006-1 | 2312-35-8 | Carc.
2 Acute Tox. 3 * Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H331 H315 H318 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H351 H331 H315 H318 H410 |
M=10 |
CLP00 | ||
| 607-152-00-2 | 2,3,6-TBA (ISO); 2,3,6-trichlorobenzoic acid | 2,3,6-TBA (ISO); 2,3,6-triklórbenzoesav | 200-026-4 | 50-31-7 | Acute
Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
CLP00 | |||
| 607-153-00-8 | benazolin (ISO); 4-chloro-2,3-dihydro-2-oxo-1,3-benzothiazol-3-ylacetic acid | benazolin (ISO); 4-klór-2,3-dihidro-2-oxo-1,3-benzotiazol-3-ilecetsav | 223-297-0 | 3813-05-6 | Skin
Irrit. 2 Eye Irrit. 2 Aquatic Chronic 3 |
H315 H319 H412 |
GHS07 Wng |
H319 H315 H412 |
CLP00 | |||
| 607-154-00-3 | ethyl N-benzoyl-N-(3,4-dichlorophenyl)-DL-alaninate; benzoylprop-ethyl (ISO) | etil-N-benzoil-N-(3,4-diklórfenil)-DL-alaninát; benzoilpropetil (ISO) | 244-845-5 | 22212-55-1 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | |||
| 607-155-00-9 | 3-(3-amino-5-(1-methylguanidino)-1-oxopentylamino-6-(4-amino-2-oxo-2,3-dihydro-pyrimidin-1-yl)-2,3-dihydro-(6H)-pyran-2-carboxylic acid; blasticidin-s | 3-(3-amino-5-(1-metilguanidino)-1-oxopentilamino-6-(4-amino-2-oxo-2,3-dihidropirimidin-1-il)-2,3-dihidro-6H-pirán-2-karbonsav; blaszticidin-s | 2079-00-7 | Acute
Tox. 2 * |
H300 |
GHS06 Dgr |
H300 |
CLP00 | ||||
| 607-156-00-4 | chlorfenson (ISO); 4-chlorophenyl 4-chlorobenzenesulfonate | klórfenzon (ISO);4-klórfenil-4-klórbenzolszulfonát | 201-270-4 | 80-33-1 | Acute
Tox. 4 * Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H315 H410 |
CLP00 | |||
| 607-157-00-X | difenacoum (ISO); 3-(3-biphenyl-4-yl-1,2,3,4-tetrahydro-1-naphthyl)-4-hydroxycoumarin | difenakum (ISO); 3-(3-bifenil-4-il-1,2,3,4-tetrahidro-1-naftil)-4-hidroxikumarin | 259-978-4 | 56073-07-5 | Repr.
1B Acute Tox. 1 Acute Tox. 1 Acute Tox. 1 STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360D H330 H310 H300 H372 (blood) H400 H410 |
GHS08 GHS06 GHS09 Dgr |
H330 H310 H300 H360D H372 (blood) H410 |
Repr.
1B; H360D: C ≥ 0,003 % STOT RE 1; H372: C ≥ 0,02 % STOT RE 2; H373: 0,002 % ≤ C < 0,02 % M=10 M=10 |
CLP00/ATP09 | ||
| 607-158-00-5 | sodium salt of chloroacetic acid; sodium chloroacetate | klórecetsav nátriumsója; nátrium-klóracetát | 223-498-3 | 3926-62-3 | Acute
Tox. 3 * Skin Irrit. 2 Aquatic Acute 1 |
H301 H315 H400 |
GHS06 GHS09 Dgr |
H301 H315 H400 |
CLP00 | |||
| 607-159-00-0 | chlorobenzilate (ISO); ethyl 2,2-di(4-chlorophenyl)-2-hydroxyacetate; ethyl 4,4'-dichlorobenzilate | klórbenzilát (ISO); etil-2,2-di(4-klórfenil)-2-hidroxiacetát; etil-4,4'-diklórbenzilát | 208-110-2 | 510-15-6 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | |||
| 607-160-00-6 | isobutyl 2-(4-(4-chlorophenoxy)phenoxy)propionate; clofop-isobutyl (ISO) | izobutil-2-[4-(4-klórfenoxi)fenoxi]-propionát; klofop-izobutil (ISO) | 51337-71-4 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | ||||
| 607-161-00-1 | diethanolamine salt of 4-CPA | 4-CPA dietanolamin-sója; 4-klórfenoxiecetsav dietanolamin-sója | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||||
| 607-162-00-7 | dalapon;
2,2-dichloropropionic acid [1] dalapon-sodium; sodium 2,2-dichloropropionate [2] |
dalapon; 2,2-diklórpropionsav; [1] dalapon-nátrium; nátrium-2,2-diklórpropionát [2] | 200-923-0
[1] 204-828-5 [2] |
75-99-0
[1] 127-20-8 [2] |
Skin
Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H315 H318 H412 |
GHS05 Dgr |
H315 H318 H412 |
CLP00/ATP01 | |||
| 607-163-00-2 | 3-acetyl-6-methyl-2H-pyran-2,4(3H)-dione; dehydracetic acid | 3-acetil-6-metil-2H-pirán-2,4(3H)-dion; dehidrecetsav | 208-293-9 | 520-45-6 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 607-164-00-8 | sodium 1-(3,4-dihydro-6-methyl-2,4-dioxo-2H-pyran-3-ylidene)ethonolate; sodium dehydracetate | nátrium-1-(3,4-dihidro-6-metil-2,4-dioxo 2H-pirán-3-ilidén)-etanolát; nátrium-dehidracetát | 224-580-1 | 4418-26-2 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 607-165-00-3 | diclofop-methyl (ISO); methyl 2-(4-(2,4-dichlorophenoxy)phenoxy)propionate; methyl (RS)-2-[4-(2,4-dichlorophenoxy)phenoxy]propionate | diklofop-metil (ISO); metil-2-[4-(2,4-diklórfenoxi)fenoxi]-propionát; metil-(RS)-2-[4-(2,4-diklórfenoxi)fenoxi]-propionát | 257-141-8 | 51338-27-3 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
CLP00 | |||
| 607-166-00-9 | medinoterb acetate (ISO); 6-tert-butyl-3-methyl-2,4-dinitrophenyl acetate | medinoterb-acetát (ISO); 6-terc-butil-3-metil-2,4-dinitrofenil-acetát | 219-634-6 | 2487-01-6 | Acute
Tox. 3 * Acute Tox. 4 * |
H301 H312 |
GHS06 Dgr |
H301 H312 |
CLP00 | |||
| 607-167-00-4 | sodium 3-chloroacrylate | nátrium-3-klórakrilát | 4312-97-4 | Acute
Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
CLP00 | ||||
| 607-168-00-X | dipropyl 6,7-methylenedioxy-1,2,3,4-tetrahydro-3-methylnaphthalene-1,2-dicarboxylate; propylisome | dipropil-6,7-metiléndioxi-1,2,3,4-tetrahidro-3-metilnaftalin-1,2-dikarboxilát; propilizom | 83-59-0 | Acute
Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H302 H400 H410 |
GHS06 GHS09 Dgr |
H311 H302 H410 |
CLP00 | ||||
| 607-169-00-5 | sodium fluoroacetate | nátrium-fluoracetát | 200-548-2 | 62-74-8 | Acute
Tox. 1 Acute Tox. 2 * Acute Tox. 2 * Aquatic Acute 1 |
H310 H330 H300 H400 |
GHS06 GHS09 Dgr |
H330 H310 H300 H400 |
CLP00 | |||
| 607-170-00-0 | bis(1,2,3-trithiacyclohexyldimethylammonium) oxalate; thiocyclam-oxalate | bisz(1,2,3-tritiaciklohexildimetilammónium)-oxalát; tiociklam-oxalát | 250-859-2 | 31895-22-4 | Acute
Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
CLP00 | |||
| 607-172-00-1 | brodifacoum (ISO); 4-hydroxy-3-(3-(4'-bromo-4-biphenylyl)-1,2,3,4-tetrahydro-1-naphthyl)coumarin | brodifakum
(ISO); 4-hidroxi-3-(3-(4′-bróm-4-bifenilil)-1,2,3,4-tetrahidro-1-naftil)kumarin |
259-980-5 | 56073-10-0 | Repr.
1A Acute Tox. 1 Acute Tox. 1 Acute Tox. 1 STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360D H330 H310 H300 H372 (blood) H400 H410 |
GHS08 GHS06 GHS09 Dgr |
H330 H310 H300 H360D H372 (blood) H410 |
Repr.
1A; H360D: C ≥ 0,003 % STOT RE 1; H372: C ≥ 0,02 % STOT RE 2; H373: 0,002 % ≤ C < 0,02 % M=10 M=10 |
CLP00/ATP09 | ||
| 607-173-00-7 | dimethyl (3-methyl-4-(5-nitro-3-ethoxycarbonyl-2-thienyl)azo)phenylnitrilodipropionate | dimetil-[3-metil-4(5-nitro-3-etoxikarbonil-2-tienil)azo]fenilnitrilo-dipropionát | 400-460-6 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
CLP00 | ||||
| 607-174-00-2 | reaction mass of dodecyl 3-(2,2,4,4-tetramethyl-21-oxo-7-oxa-3,20-diazadispiro(5,1,11,2)henicosan-20-yl)propionate and tetradecyl 3-(2,2,4,4-tetramethyl-21-oxo-7-oxa-3,20-diazadispiro(5,1,11,2)henicosan-20-yl)propionate | dodecil-3-(2,2,4,4-tetrametil-21-oxo-7-oxa-3,20-diazadispiro[5.1.11.2]henikozán-20-il)-propionát és tetradecil-3-(2,2,4,4-tetrametil-21-oxo-7-oxa-3,20-diazadispiro[5.1.11.2]henikozán-20-il)-propionát keveréke | 400-580-9 | Skin
Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
CLP00 | ||||
| 607-175-00-8 | methyl 2-(2-nitrobenzylidene)acetoacetate | metil-2-(2-nitrobenzilidén)acetoacetát | 400-650-9 | 39562-27-1 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | |||
| 607-176-00-3 | reaction mass of α-3-(3-(2H-benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl)propionyl-ω-hydroxypoly(oxyethylene) and α-3-(3-(2H-benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl)propionyl-ω-3-(3-(2H-benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl)propionyloxypoly(oxyethylene) | α-3-[3-(2H-benzotriazol-2-il)-5-terc-butil-4-hidroxifenil]propionil-ω-hidroxipoli(oxietilén) és α-3-[3-(2H-benzotriazol-2-il)-5-terc-butil-4-hidroxifenil]propionil-ω-3-[3-(2H-benzotriazol-2-il)-5-terc-butil-4-hidroxifenil]propioniloxipoli(oxietilén) keveréke | 400-830-7 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | ||||
| 607-177-00-9 | tribenuron-methyl (ISO); methyl 2-[N-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-N-methylcarbamoylsulfamoyl]benzoate | tribenuron
metil (ISO);
2-[4-metoxi-6-metil-1,3,5-triazin-2-il(metil)karbamoilszulfamoil]benzoesav-
metil -észter; metil-2-(3-(4-metoxi-6-metil-1,3,5-triazin-2-il)-3- metilureidoszulfonil]benzoát |
401-190-1 | 101200-48-0 | STOT
RE 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H317 H373 H410 |
M=100 M=100 |
CLP00/ATP15 | ||
| 607-178-00-4 | methyl α-((4,6-dimethoxypyrimidin-2-yl)ureidosulphonyl)-o-toluate | metil-α-[(4,6-dimetoxipirimidin-2-il)ureidoszulfonil]-o-toluát | 401-340-6 | 83055-99-6 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | |||
| 607-179-00-X | (benzothiazol-2-ylthio)succinic acid | (benzotiazol-2-iltio)borostyánkősav | 401-450-4 | 95154-01-1 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 607-180-00-5 | potassium 2-hydroxycarbazole-1-carboxylate | kálium-2-hidroxikarbazol-1-karboxilát | 401-630-2 | 96566-70-0 | Acute
Tox. 4 * STOT SE 3 Eye Irrit. 2 Aquatic Chronic 3 |
H302 H335 H319 H412 |
GHS07 Wng |
H302 H319 H335 H412 |
CLP00 | |||
| 607-181-00-0 | 3,5-dichloro-2,4-difluorobenzoyl fluoride | 3,5-diklór-2,4-difluorbenzoil-fluorid | 401-800-6 | 101513-70-6 | Acute
Tox. 3 * Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H331 H302 H314 H317 H412 |
GHS06 GHS05 Dgr |
H331 H314 H302 H317 H412 |
EUH029 |
CLP00 | ||
| 607-182-00-6 | methyl 3-sulphamoyl-2-thenoate | metil-3-szulfamoil-2-tenoát | 402-050-2 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | ||||
| 607-183-00-1 | zinc 2-hydroxy-5-C13-18alkylbenzoate | cink-2-hidroxi-5-C13-18-alkil-benzoát | 402-280-3 | Skin
Irrit. 2 Eye Irrit. 2 Aquatic Chronic 2 |
H315 H319 H411 |
GHS07 GHS09 Wng |
H319 H315 H411 |
CLP00 | ||||
| 607-184-00-7 | S-(3-trimethoxysilyl)propyl 19-isocyanato-11-(6-isocyanatohexyl)-10,12-dioxo-2,9,11,13-tetraazanonadecanethioate | S-(3-trimetoxiszilil)propil-19-izocianáto-11-(6-izocianátohexil)-10,12-dioxo-2,9,11,13-tetraazanonadekán-tioát | 402-290-8 | 85702-90-5 | Flam.
Liq. 3 Resp. Sens. 1 Skin Sens. 1 |
H226 H334 H317 |
GHS02 GHS08 Dgr |
H226 H334 H317 |
CLP00 | |||
| 607-185-00-2 | ethyl trans-3-dimethylaminoacrylate | etil-transz-3-dimetilamino-akrilát | 402-650-4 | 1117-37-9 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 607-186-00-8 | quinclorac (ISO); 3,7-dichloroquinoline-8-carboxylic acid | kvinklorak (ISO); 3,7-diklórkinolin-8-karbonsav | 402-780-1 | 84087-01-4 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 607-187-00-3 | bis(2,2,6,6-tetramethyl-4-piperidyl) succinate | bisz(2,2,6,6-tetrametil-4-piperidil)-szukcinát | 402-940-0 | 62782-03-0 | Eye
Irrit. 2 Aquatic Chronic 3 |
H319 H412 |
GHS07 Wng |
H319 H412 |
CLP00 | |||
| 607-188-00-9 | hydrogen sodium N-carboxylatoethyl-N-octadec-9-enylmaleamate | nátrium-hidrogén-N-karboxilátoetil-N-oktadec-9-enil-maleamát | 402-970-4 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | ||||
| 607-189-00-4 | trimethylenediaminetetraacetic acid | trimetiléndiamintetraecetsav | 400-400-9 | 1939-36-2 | Acute
Tox. 4 * Eye Dam. 1 |
H302 H318 |
GHS05 GHS07 Dgr |
H302 H318 |
CLP00/ATP01 | |||
| 607-190-00-X | methyl acrylamidomethoxyacetate (containing ≥ 0,1 % acrylamid) | metil-akrilamidometoxiacetát (tartalmaz ≥0,1 % akrilamidot) | 401-890-7 | 77402-03-0 | Carc.
1B Muta. 1B Acute Tox. 4 * Eye Irrit. 2 |
H350 H340 H302 H319 |
GHS08 GHS07 Dgr |
H350 H340 H302 H319 |
CLP00 | |||
| 607-191-00-5 | isobutyl 3,4-epoxybutyrate | izobutil-3,4-epoxibutirát | 401-920-9 | 100181-71-3 | Skin
Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H315 H317 H410 |
CLP00 | |||
| 607-192-00-0 | disodium N-carboxymethyl-N-(2-(2-hydroxyethoxy)ethyl)glycinate | dinátrium-N-karboximetil-N-[2-(2-hidroxietoxi)etil]-glicinát | 402-360-8 | 92511-22-3 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | |||
| 607-194-00-1 | propylene carbonate | propilén-karbonát | 203-572-1 | 108-32-7 | Eye
Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
CLP00 | |||
| 607-195-00-7 | 2-methoxy-1-methylethyl acetate | 2-metoxi-1-metiletil-acetát | 203-603-9 | 108-65-6 | Flam.
Liq. 3 |
H226 |
GHS02 Wng |
H226 |
CLP00/ATP01 | |||
| 607-196-00-2 | heptanoic acid | heptánsav | 203-838-7 | 111-14-8 | Skin
Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
CLP00 | |||
| 607-197-00-8 | nonanoic acid | nonánsav | 203-931-2 | 112-05-0 | Skin
Irrit. 2 Eye Irrit. 2 Aquatic Chronic 3 |
H315 H319 H412 |
GHS07 Wng |
H315 H319 H412 |
CLP00/ATP07 | |||
| 607-198-00-3 | propyl 3,4,5-trihydroxybenzoate | propil-3,4,5-trihidroxi-benzoát | 204-498-2 | 121-79-9 | Acute
Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
CLP00 | |||
| 607-199-00-9 | octyl 3,4,5-trihydroxybenzoate | oktil-3,4,5-trihidroxi-benzoát | 213-853-0 | 1034-01-1 | Acute
Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
CLP00 | |||
| 607-200-00-2 | dodecyl 3,4,5-trihydroxybenzoate | dodecil-3,4,5-trihidroxibenzoát | 214-620-6 | 1166-52-5 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 607-201-00-8 | thiocarbonyl chloride | tiokarbonil-klorid | 207-341-6 | 463-71-8 | Acute
Tox. 3 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 |
H331 H302 H335 H315 H319 |
GHS06 Dgr |
H331 H302 H319 H335 H315 |
CLP00 | |||
| 607-203-00-9 | 2-ethylhexyl[[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methyl]thio]acetate | 2-etilhexil-[[[3,5-bisz(1,1-dimetiletil-4-hidroxifenil]metil]tio]acetát | 279-452-8 | 80387-97-9 | Repr.
1B Skin Sens. 1 Aquatic Chronic 3 |
H360D
*** H317 H412 |
GHS08 GHS07 Dgr |
H360D
*** H317 H412 |
CLP00 | |||
| 607-204-00-4 | (chlorophenyl)(chlorotolyl)methane, mixed isomers | (klórfenil)(klórtolil)metán, kevert izomerek | 400-140-6 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | ||||
| 607-205-00-X | methyl chloroacetate | metil-klóracetát | 202-501-1 | 96-34-4 | Flam.
Liq. 3 Acute Tox. 3 * Acute Tox. 3 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 |
H226 H331 H301 H335 H315 H318 |
GHS02 GHS06 GHS05 Dgr |
H226 H331 H301 H335 H315 H318 |
CLP00 | |||
| 607-206-00-5 | isopropyl chloroacetate | izopropil-klóracetát | 203-301-7 | 105-48-6 | Flam.
Liq. 3 Acute Tox. 3 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 |
H226 H301 H335 H315 H319 |
GHS02 GHS06 Dgr |
H226 H301 H319 H335 H315 |
CLP00 | |||
| 607-207-00-0 | haloxyfop-etotyl (ISO); 2-ethoxyethyl 2-(4-(3-chloro-5-trifluoromethyl-2-pyridyloxy)phenoxy)propionate; haloxyfop-(2-ethoxyethyl) | haloxifop-etotil (ISO); 2-etoxietil-2-[4-(3-klór-5-trifluormetil-2-piridiloxi)fenoxi]propionát; haloxifop-(2-etoxietil) | 402-560-5 | 87237-48-7 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | |||
| 607-208-00-6 | 4,8,12-trimethyltrideca-3,7,11-trienoic acid, mixed isomers | 4,8,12-trimetiltrideka-3,7,11-triénsav (kevert izomerek) | 403-000-2 | 91853-67-7 | Skin
Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
CLP00 | |||
| 607-209-00-1 | reaction mass of O,O'-diisopropyl (pentathio)dithioformate and O,O'-diisopropyl (trithio)dithioformate and O,O'-diisopropyl (tetrathio)dithioformate | O, O’-diizopropil(pentatio)ditioformiát, O, O’-diizopropil(tetraritio)ditioformiát és O, O’-diizopropil(tetratio)ditioformiát keveréke | 403-030-6 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
CLP00 | ||||
| 607-210-00-7 | methyl acrylamidoglycolate (containing ≥ 0,1 % acrylamide) | metil-akrilamidoglikolát (≥0,1 % akrilamidot tartalmaz) | 403-230-3 | 77402-05-2 | Carc.
1B Muta. 1B Skin Corr. 1B Skin Sens. 1 |
H350 H340 H314 H317 |
GHS08 GHS05 GHS07 Dgr |
H350 H340 H314 H317 |
CLP00 | |||
| 607-211-00-2 | methyl 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propionate | metil-3-(3-terc-butil-4-hidroxi-5-metilfenil)propionát | 403-270-1 | 6386-39-6 | Acute
Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
CLP00 | |||
| 607-212-00-8 | poly(oxypropylenecarbonyl-co-oxy(ethylethylene)carbonyl), containing 27 % hydroxyvalerate | poli[oxipropilénkarbonil-ko-oxi(etiletilén)karbonil], 27 % hidroxi-valerátot tartalmaz | 403-300-3 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | ||||
| 607-213-00-3 | ethyl 3,3-bis(tert-pentylperoxy)butyrate | etil-3,3-bisz(terc-pentilperoxi)butirát | 403-320-2 | 67567-23-1 | Flam.
Liq. 3 Org. Perox. D **** Aquatic Chronic 2 |
H226 H242 H411 |
GHS02 GHS09 Dgr |
H242 H226 H411 |
CLP00/ATP01 | |||
| 607-214-00-9 | N,N-hydrazinodiacetic acid | N, N-hidrazindiecetsav | 403-510-5 | 19247-05-3 | Acute
Tox. 3 * STOT RE 2 * Skin Sens. 1 Aquatic Chronic 3 |
H301 H373 ** H317 H412 |
GHS06 GHS08 Dgr |
H301 H373 ** H317 H412 |
CLP00 | |||
| 607-215-00-4 | 3-(3-tert-butyl-4-hydroxyphenyl)propionic acid | 3-(3-terc-butil-4-hidroxifenil)propionsav | 403-920-4 | 107551-67-7 | Acute
Tox. 4 * Eye Irrit. 2 |
H302 H319 |
GHS07 Wng |
H302 H319 |
CLP00 | |||
| 607-216-00-X | glutamic acid, reaction products with N-(C12-14-alkyl)propylenediamine | glutaminsav reakciótermékei N-(C12-14-alkil)propilén-diaminnal | 403-950-8 | - | Acute
Tox. 2 * Acute Tox. 4 * Skin Corr. 1B Aquatic Acute 1 |
H330 H302 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H330 H302 H314 H400 |
CLP00/ATP01 | |||
| 607-217-00-5 | 2-ethoxyethyl 2-(4-(2,6-dihydro-2,6-dioxo-7-phenyl-1,5-dioxaindacen-3-yl)phenoxy)acetate | 2-etoxietil-2-[4-(2,6-dihidro-2,6-dioxo-7-fenil-1,5-dioxaindacén-3- il)fenoxi]acetát | 403-960-2 | Skin
Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
CLP00 | ||||
| 607-218-00-0 | dichlorprop-P (ISO); (+)-R-2-(2,4-dichlorophenoxy)propionic acid | diklórprop-P (ISO); (+)-R-2-(2,4-diklórfenoxi)propionsav | 403-980-1 | 15165-67-0 | Acute
Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H302 H315 H318 H317 |
GHS05 GHS07 Dgr |
H302 H315 H318 H317 |
CLP00 | |||
| 607-219-00-6 | bis(2-ethylhexyl) dithiodiacetate | bisz(2-etilhexil)ditiodiacetát | 404-510-8 | 62268-47-7 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
CLP00 | |||
| 607-221-00-7 | 6-docosyloxy-1-hydroxy-4-(1-(4-hydroxy-3-methylphenanthren-1-yl)-3-oxo-2-oxaphenalen-1-yl)naphthalene-2-carboxylic acid | 6-dokoziloxi-1-hidroxi-4-[1-(4-hidroxi-3-metilfenantrén-1-il)-3-oxo-2-oxafenalen-1-il]naftalin-2-karbonsav | 404-550-6 | Skin
Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
CLP00 | ||||
| 607-222-00-2 | 6-(2,3-dimethylmaleimido)hexyl methacrylate | 6-(2,3-dimetilmaleimido)hexil-metakrilát | 404-870-6 | 63740-41-0 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | |||
| 607-223-00-8 | transfluthrin (ISO); 2,3,5,6-tetrafluorobenzyl trans-2-(2,2-dichlorovinyl)-3,3-dimethylcyclopropanecarboxylate | transzflutrin (ISO); 2,3,5,6-tetrafluorbenzil-transz-2-(2,2-diklórvinil)- 3,3-dimetilciklopropán-karboxilát | 405-060-5 | 118712-89-3 | Skin
Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
CLP00 | |||
| 607-224-00-3 | methyl 2-(3-nitrobenzylidene)acetoacetate | metil-2-(3-nitrobenzilidén)acetoacetát | 405-270-7 | 39562-17-9 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
CLP00 | |||
| 607-225-00-9 | 3-azidosulfonylbenzoic acid | 3-azidoszulfonilbenzoesav | 405-310-3 | 15980-11-7 | STOT
RE 2 * Eye Dam. 1 Skin Sens. 1 Self-React. C **** |
H373
** H318 H317 H241 |
GHS02 GHS08 GHS05 GHS07 Dgr |
H241 H373 ** H318 H317 |
CLP00 | |||
| 607-226-00-4 | reaction mass of 2-acryloyloxyethyl hydrogen cyclohexane-1,2-dicarboxylate and 2-methacryloyloxyethyl hydrogen cyclohexane-1,2-dicarboxylate | 2-akriloiloxietil-hidrogén-ciklohexán-1,2-dikarboxilát és 2-metakriloiloxietil-hidrogén-ciklohexán-1,2-dikarboxilát keveréke | 405-360-6 | Skin
Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H315 H318 H317 H412 |
GHS05 GHS07 Dgr |
H315 H318 H317 H412 |
CLP00 | ||||
| 607-227-00-X | potassium 2-amino-2-methylpropionate octahydrate | kálium-2-amino-2-metilpropionát-oktahidrát | 405-560-3 | 120447-91-8 | Acute
Tox. 4 * Skin Corr. 1A |
H302 H314 |
GHS05 GHS07 Dgr |
H302 H314 |
CLP00 | |||
| 607-228-00-5 | bis(2-methoxyethyl) phthalate | bisz(2-metoxietil)-ftalát | 204-212-6 | 117-82-8 | Repr.
1B |
H360Df |
GHS08 Dgr |
H360Df |
CLP00 | |||
| 607-229-00-0 | diethylcarbamoyl chloride | dietilkarbamoil-klorid | 201-798-5 | 88-10-8 | Carc.
2 Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 |
H351 H332 H302 H335 H315 H319 |
GHS08 GHS07 Wng |
H351 H332 H302 H319 H335 H315 |
CLP00 | |||
| 607-230-00-6 | 2-ethylhexanoic acid | 2-etilhexánsav | 205-743-6 | 149-57-5 | Repr.
2 |
H361d
*** |
GHS08 Wng |
H361d
*** |
CLP00 | |||
| 607-231-00-1 | clopyralid (ISO); 3,6-dichloropyridine-2-carboxylic acid | klopiralid (ISO); 3,6-diklórpiridin-2-karbonsav | 216-935-4 | 1702-17-6 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00/ATP01 | |||
| 607-232-00-7 | pyridate (ISO); O-(6-chloro-3-phenylpyridazin-4-yl) S-octyl thiocarbonate | piridát (ISO); O-(6-klór-3-fenilpiridazin-4-il)-S-oktil-tiokarbonát | 259-686-7 | 55512-33-9 | Acute
Tox. 4 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H315 H317 H410 |
Oral:
ATE = 500 mg/kg M=1 M=10 |
CLP00/ATP14 | ||
| 607-233-00-2 | hexyl acrylate | hexil-akrilát | 219-698-5 | 2499-95-8 | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H335 H315 H319 H317 H411 |
GHS07 GHS09 Wng |
H319 H335 H315 H317 H411 |
CLP00 | |||
| 607-234-00-8 | flurenol (ISO); 9-hydroxy-9H-fluorene-9-carboxylic acid | flurenol (ISO); 9-hidroxi-9H-fluorén-9-karbonsav | 207-397-1 | 467-69-6 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 607-235-00-3 | mecrilate; methyl 2-cyanoacrylate | mekrilát; metil-2-cianoakrilát | 205-275-2 | 137-05-3 | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 |
H335 H315 H319 |
GHS07 Wng |
H319 H335 H315 |
STOT
SE 3; H335: C ≥ 10 % |
CLP00 | ||
| 607-236-00-9 | ethyl 2-cyanoacrylate | etil - 2-cianoakrilát | 230-391-5 | 7085-85-0 | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 |
H335 H315 H319 |
GHS07 Wng |
H319 H335 H315 |
STOT
SE 3; H335: C ≥ 10 % |
CLP00 | ||
| 607-237-00-4 | benzyl 2-chloro-4-(trifluoromethyl)thiazole-5-carboxylate; flurazole | benzil-2-klór-4-(trifluormetil)tiazol-5-karboxilát; flurazol | 276-942-3 | 72850-64-7 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 607-238-00-X | tau-fluvalinate (ISO); cyano-(3-phenoxyphenyl)methyl N-[2-chloro-4-(trifluoromethyl)phenyl]-D-valinate | tau-fluvalinát (ISO); ciano-(3-fenoxifenil)metil-N-[2-klór-4-(trifluorometil)fenil]-D-valinát | 102851-06-9 | Acute
Tox. 4 * Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H315 H410 |
CLP00 | ||||
| 607-239-00-5 | fenpropathrin (ISO); α-cyano-3-phenoxybenzyl 2,2,3,3-tetramethylcyclopropanecarboxylate | fenpropatrin (ISO); α-ciano-3-fenoxibenzil-2,2,3,3-tetrametilciklopropán-karboxilát | 254-485-0 | 39515-41-8 | Acute
Tox. 2 * Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H330 H301 H312 H410 |
CLP00 | |||
| 607-240-00-0 | cis-1,2,3,6-tetrahydro-4-methylphthalic
anhydride [1] 1,2,3,6-tetrahydro-4-methylphthalic anhydride [2] 1,2,3,6-tetrahydro-3-methylphthalic anhydride [3] tetrahydromethylphthalic anhydride [4] 1,2,3,6-tetrahydromethylphthalic anhydride [5] tetrahydro-4-methylphthalic anhydride [6] 2,3,5,6-tetrahydro-2-methylphthalic anhydride [7] |
cisz-1,2,3,6-tetrahidro-4-metilftálsav-anhidrid; [1] 1,2,3,6-tetrahidro-4-metilftálsav-anhidrid; [2] 1,2,3,6-tetrahidro-3-metilftálsav-anhidrid; [3] tetrahidrometilftálsav-anhidrid; [4] 1,2,3,6-tetrahidrometilftálsav-anhidrid; [5] tetrahidro-4-metilftálsav-anhidrid; [6] 2,3,5,6-tetrahidro-2-metilftálsav-anhidrid [7] | 216-906-6
[1] 222-323-8 [2] 226-247-6 [3] 234-290-7 [4] 247-830-1 [5] 251-823-9 [6] 255-853-3 [7] |
1694-82-2
[1] 3425-89-6 [2] 5333-84-6 [3] 11070-44-3 [4] 26590-20-5 [5] 34090-76-1 [6] 42498-58-8 [7] |
Eye
Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H318 H334 H317 |
GHS08 GHS05 Dgr |
H318 H334 H317 |
C | CLP00 | ||
| 607-241-00-6 | hexahydro-4-methylphthalic
anhydride [1] hexahydromethylphthalic anhydride [2] hexahydro-1-methylphthalic anhydride [3] hexahydro-3-methylphthalic anhydride [4] |
hexahidro-4-metilftálsav-anhidrid; [1] hexahidrometilftálsav-anhidrid; [2] hexahidro-1-metilftálsav-anhidrid; [3] hexahidro-3-metilftálsav-anhidrid [4] | 243-072-0
[1] 247-094-1 [2] 256-356-4 [3] 260-566-1 [4] |
19438-60-9
[1] 25550-51-0 [2] 48122-14-1 [3] 57110-29-9 [4] |
Eye
Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H318 H334 H317 |
GHS08 GHS05 Dgr |
H318 H334 H317 |
C | CLP00 | ||
| 607-242-00-1 | tetrachlorophthalic anhydride | tetraklórftálsav-anhidrid | 204-171-4 | 117-08-8 | Eye
Dam. 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H334 H317 H400 H410 |
GHS08 GHS05 GHS09 Dgr |
H318 H334 H317 H410 |
CLP00 | |||
| 607-243-00-7 | sodium
3,6-dichloro-o-anisate [1] 3,6-dichloro-o-anisic acid, compound with 2,2'-iminodiethanol (1:1) [2] 3,6-dichloro-o-anisic acid, compound with 2-aminoethanol (1:1) [3] |
nátrium-3,6-diklór-o-anizát; [1] 3,6-diklór-o-ánizssav (1:1) elegye 2,2'-iminodietanollal; [2]3,6-diklór-o-ánizssav (1:1) elegye 2-aminoetanollal [3] | 217-846-3
[1] 246-590-5 [2] 258-527-9 [3] |
1982-69-0
[1] 25059-78-3 [2] 53404-28-7 [3] |
Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | ||||
| 607-244-00-2 | isooctyl acrylate | izooktil-akrilát | 249-707-8 | 29590-42-9 | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H335 H315 H319 H400 H410 |
GHS07 GHS09 Wng |
H319 H335 H315 H410 |
STOT
SE 3; H335: C ≥ 10 % |
CLP00 | ||
| 607-245-00-8 | tert-butyl acrylate | terc-butil-akrilát | 216-768-7 | 1663-39-4 | Flam.
Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H225 H332 H312 H302 H335 H315 H317 H411 |
GHS02 GHS07 GHS09 Dgr |
H225 H302 H312 H332 H315 H317 H335 H411 |
D | CLP00/ATP01corr | ||
| 607-246-00-3 | allyl methacrylate; 2-methyl-2-propenoic acid 2-propenyl ester | allil-metakrilát; 2-metil-2-propénsav-2-propenil-észter | 202-473-0 | 96-05-9 | Flam.
Liq. 3 Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 |
H226 H331 H312 H302 H400 |
GHS02 GHS06 GHS09 Dgr |
H226 H331 H312 H302 H400 |
CLP00 | |||
| 607-247-00-9 | dodecyl methacrylate | dodecil-metakrilát | 205-570-6 | 142-90-5 | STOT
SE 3 |
H335 |
GHS07 Wng |
H335 |
STOT
SE 3; H335: C ≥ 10 % |
CLP00/ATP14 | ||
| 607-248-00-4 | naptalam-sodium (ISO); sodium N-naphth-1-ylphthalamate | naftalam-nátrium (ISO); nátrium-N-naft-1-ilftalamát | 205-073-4 | 132-67-2 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 607-249-00-X | (1-methyl-1,2-ethanediyl)bis[oxy(methyl-2,1-ethanediyl)] diacrylate | (1-metil-1,2-etándiil)bisz[oxi(metil-2,1-etándiil)]diakrilát | 256-032-2 | 42978-66-5 | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H335 H315 H319 H317 H411 |
GHS07 GHS09 Wng |
H319 H335 H315 H317 H411 |
STOT
SE 3; H335: C ≥ 10 % |
CLP00 | ||
| 607-250-00-5 | 4H-3,1-benzoxazine-2,4(1H)-dione | 4H-3,1-benzoxazin-2,4(1H)-dion | 204-255-0 | 118-48-9 | Eye
Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
CLP00 | |||
| 607-251-00-0 | 2-methoxypropyl acetate | 2-metoxipropil-acetát | 274-724-2 | 70657-70-4 | Flam.
Liq. 3 Repr. 1B STOT SE 3 |
H226 H360D *** H335 |
GHS02 GHS08 GHS07 Dgr |
H226 H360D *** H335 |
CLP00 | |||
| 607-252-00-6 | lambda-cyhalothrin (ISO); reaction mass of (S)-α-cyano-3-phenoxybenzyl(Z)-(1R)-cis-3-(2-chloro-3,3,3-trifluoropropenyl)-2,2-dimethylcyclopropanecarboxylate and (R)-α-cyano-3-phenoxybenzyl (Z)-(1S)-cis-3-(2-chloro-3,3,3-trifluoropropenyl)-2,2-dimethylcyclopropanecarboxylate (1:1) | lambda-cihalotrin (ISO); a következő anyagok keveréke: (S)-α-ciano-3-fenoxibenzil-(Z)-(1R)-cisz-3-(2-klór-3,3,3-trifluorpropenil)-2,2-dimetilciklopropán-karboxilát; (R)-α-ciano-3-fenoxibenzil-(Z)-(1S)-cisz-3-(2-klór-3,3,3-trifluorpropenil)-2,2-dimetilciklopropán-karboxilát (1:1) | 415-130-7 | 91465-08-6 | Acute
Tox. 2 * Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H330 H301 H312 H410 |
M=10000 |
CLP00/ATP01 | ||
| 607-253-00-1 | cyfluthrin (ISO); α-cyano-4-fluoro-3-phenoxybenzyl-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate | ciflutrin (ISO); α-ciano-4-fluor-3-fenoxibenzil-3-(2,2-diklórvinil)-2,2- dimetilciklopropán-karboxilát | 269-855-7 | 68359-37-5 | Acute
Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H331 H400 H410 |
GHS06 GHS09 Dgr |
H300 H331 H410 |
M=1000 |
CLP00/ATP01 | ||
| 607-254-00-7 | α-cyano-4-fluoro-3-phenoxybenzyl-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate; beta-cyfluthrin | α-ciano-4-fluor-3-fenoxibenzil-3-(2,2-diklórvinil)-2,2- dimetilciklopropán-karboxilát; béta-ciflutrin | 269-855-7 | 68359-37-5 | Acute
Tox. 2 * Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H410 |
CLP00 | |||
| 607-255-00-2 | fluroxypyr (ISO); 4-amino-3,5-dichloro-6-fluoro-2-pyridyloxyacetic acid | fluroxipir (ISO); 4-amino-3,5-diklór-6-fluor-2-piridiloxiecetsav | 69377-81-7 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | |||||
| 607-256-00-8 | azoxystrobin (ISO); methyl (E)-2-{2-[6-(2-cyanophenoxy)pyrimidin-4-yloxy]phenyl}-3-methoxyacrylate | azoxisztrobin (ISO); metil-(E)-2-{2-[6-(2-cianofenoxi)pirimidin-4-iloxi]fenil}-3-metoxiakrilát | 131860-33-8 | Acute
Tox. 3 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H400 H410 |
GHS06 GHS09 Dgr |
H331 H410 |
Inhalation:
ATE = 0.7 mg/L (dusts/mists) M=10 M=10 |
CLP00/ATP15 | |||
| 607-257-00-3 | isopropyl propionate | izopropil-propionát | 211-300-8 | 637-78-5 | Flam.
Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
CLP00 | |||
| 607-258-00-9 | dodecyl 3-(2-(3-benzyl-4-ethoxy-2,5-dioxoimidazolidin-1-yl)-3-(4-methoxybenzoyl)acetamido)-4-chlorobenzoate | dodecil-3-[2-(3-benzil-4-etoxi-2,5-dioxoimidazolidin-1-il)-3-(4-metoxibenzoil)acetamido]-4-klórbenzoát | 403-990-6 | 70950-45-7 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 607-259-00-4 | methyl 2R,3S-(-)-3-(4-methoxyphenyl)oxiranecarboxylate | metil-2R,3S-(-)-3-(4-metoxifenil)oxiránkarboxilát | 404-130-2 | 105560-93-8 | Eye
Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
CLP00 | |||
| 607-260-00-X | ethyl 2-(3-nitrobenzylidene)acetoacetate | etil-2-(3-nitrobenzilidén)acetoacetát | 404-490-0 | 39562-16-8 | Eye
Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
CLP00 | |||
| 607-261-00-5 | iso(C10-C14)alkyl (3,5-di-tert-butyl-4-hydroxyphenyl)methylthioacetate | izo(C10-C14)alkil-(3,5-di-terc-butil-4-hidroxifenil)metil-tioacetát | 404-800-4 | 118832-72-7 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 607-262-00-0 | 7-chloro-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxoquinoline-3-carboxylic acid | 7-klór-1-ciklopropil-6-fluor-1,4-dihidro-4-oxokinolin-3-karbonsav | 405-050-0 | 86393-33-1 | Acute
Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
CLP00 | |||
| 607-263-00-6 | potassium iron(III) 1,3-propanediamine-N,N,N',N'-tetraacetate hemihydrate | kálium-vas(III)-1,3-propándiamin-N, N,N’,N’-tetraacetát-hemihidrát | 405-680-6 | Self-heat.
2 **** Aquatic Chronic 2 |
H252 H411 |
GHS02 GHS09 Wng |
H252 H411 |
CLP00 | ||||
| 607-264-00-1 | 2-chloro-4-(methylsulfonyl)benzoic acid | 2-klór-4-(metilszulfonil)benzoesav | 406-520-8 | 53250-83-2 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | |||
| 607-265-00-7 | ethyl-2-chloro-2,2-diphenylacetate | etil-2-klór-2,2-difenilacetát | 406-580-5 | 52460-86-3 | Skin
Irrit. 2 Aquatic Chronic 3 |
H315 H412 |
GHS07 Wng |
H315 H412 |
CLP00 | |||
| 607-266-00-2 | reaction mass of: hydroxyaluminium bis[2-hydroxy-3,5-di-tert-butylbenzoate]; 3,5-di-tert-butyl-salicylic acid | hidroxi-alumínium-bisz[2-hidroxi-3,5-di-terc-butilbenzoát]; 3,5-di-terc-butilszalicilsav keveréke | 406-890-0 | 130296-87-6 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | |||
| 607-267-00-8 | tert-butyl (5S,6R,7R)-3-bromomethyl-5,8-dioxo-7-(2-(2-phenylacetamido)-5-thia-1-azabicyclo[4.2.0] oct-2-ene-2-carboxylate | terc-butil-(5S,6R,7R)-3-brómmetil-5,8-dioxo-7-(2-(2-fenilacetamido)-5-tia-1-azabiciklo[4.2.0]okt-2-én-2-karboxilát | 407-620-4 | 33610-13-8 | Resp.
Sens. 1 Skin Sens. 1 Aquatic Chronic 3 |
H334 H317 H412 |
GHS08 Dgr |
H334 H317 H412 |
CLP00 | |||
| 607-268-00-3 | 2-methylpropyl (R)-2-hydroxypropanoate | 2-metilpropil-(R)-2-hidroxipropanoát | 407-770-0 | 61597-96-4 | Eye
Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
CLP00 | |||
| 607-269-00-9 | (R)-2-(4-hydroxyphenoxy)propanoic acid | (R)-2-(4-hidroxifenoxi)propionsav | 407-960-3 | 94050-90-5 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | |||
| 607-270-00-4 | 3,9-bis(2-(3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propionyloxy-1,1-dimethylethyl)-2,4,8,10- tetraoxaspiro[5.5]undecane | 3,9-bisz[2-[3-(3-terc-butil-4-hidroxi-5-metilfenil)propioniloxi-1,1-dimetiletil]-2,4,8,10-tetraoxaspiro[5.5]undekán] | 410-730-5 | 90498-90-1 | Acute
Tox. 4 * |
H312 |
GHS07 Wng |
H312 |
CLP00 | |||
| 607-271-00-X | 2-isopropyl-5-methylcyclohexyloxycarbonyloxy-2-hydroxypropane | 2-izopropil-5-metilciklohexiloxikarboniloxi-2-hidroxipropán | 417-420-9 | 156324-82-2 | Eye
Irrit. 2 Aquatic Chronic 2 |
H319 H411 |
GHS07 GHS09 Wng |
H319 H411 |
CLP00 | |||
| 607-272-00-5 | fluroxypyr-meptyl
(ISO); methylheptyl, O-(4-amino-3,5-dichloro-6-fluoro-2-pyridyloxy) acetate
[1] fluroxypyr-butometyl (ISO); 2-butoxy-1-methylethyl, O-(4-amino-3,5-dichloro-6-fluoro-2-pyridyloxy) acetate [2] |
fluroxipir-meptil (ISO); metilheptil-O-(4-amino-3,5-diklór-6-fluor-2-piridiloxi)acetát; [1] fluroxipir-butometil (ISO); 2-butoxi-1-metiletil-O-(4-amino-3,5-diklór-6-fluor-2-piridiloxi)acetát [2] | 279-752-9
[1] |
81406-37-3
[1] 154486-27-8 [2] |
Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 607-273-00-0 | ammonium 7-(2,6-dimethyl-8-(2,2-dimethylbutyryloxy)-1,2,6,7,8,8a-hexahydro-1-naphthyl)-3,5-dihydroxyheptanoate | ammónium-7-(2,6-dimetil-8-(2,2-dimetilbutiriloxi)-1,2,6,7,8,8a-hexahidro-1-naftil)-3,5-dihidroxiheptanoát | 404-520-2 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | |||||
| 607-274-00-6 | 2-(N-benzyl-N-methylamino)ethyl 3-amino-2-butenoate | 2-(N-benzil-N-metilamino)etil-3-amino-2-butenoát | 405-350-1 | 54527-73-0 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | |||
| 607-275-00-1 | sodium benzoyloxybenzene-4-sulfonate | nátrium-benzoiloxibenzo(-4-szulfonát) | 405-450-5 | 66531-87-1 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 607-276-00-7 | bis[(1-methylimidazol)-(2-ethyl-hexanoate)], zinc complex | bisz[(1-metilimidazol)-(2-etilhexanoát)], cink komplex | 405-635-0 | Skin
Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H400 H410 |
GHS05 GHS09 Dgr |
H315 H318 H410 |
CLP00 | ||||
| 607-277-00-2 | reaction mass of: 2-(hexylthio)ethylamine hydrochloride; sodium propionate | 2-(hexiltio)etilamin-hidroklorid; nátrium-propionát keveréke | 405-720-2 | Acute
Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H302 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H317 H411 |
CLP00 | ||||
| 607-278-00-8 | reaction mass of isomers of: sodium phenethylnaphthalenesulfonate; sodium naphthylethylbenzenesulfonate | a következő anyagok izomereinek keveréke: nátrium-fenetilnaftalin-szulfonát; nátrium-naftiletilbenzil-szulfonát | 405-760-0 | Eye
Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
CLP00 | ||||
| 607-279-00-3 | reaction mass of n-octadecylaminodiethyl bis(hydrogen maleate); n-octadecylaminodiethyl hydrogen maleate hydrogenphthalate | a következő anygagok keveréke: n-oktadecilaminodietil-bisz(hidrogén-maleát); n-oktadecilaminodietil-hidrogén-maleát-hidrogén-ftalát | 405-960-8 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | ||||
| 607-280-00-9 | sodium 4-chloro-1-hydroxybutane-1-sulfonate | nátrium-4-klór-1-hidroxibután-1-szulfonát | 406-190-5 | 54322-20-2 | Acute
Tox. 4 * Eye Irrit. 2 Skin Sens. 1 |
H302 H319 H317 |
GHS07 Wng |
H302 H319 H317 |
CLP00 | |||
| 607-281-00-4 | reaction mass of branched and linear C7-C9 alkyl 3-[3-(2H-benzotriazol-2-yl)-5-(1,1-dimethylethyl)-4-hydroxyphenyl]propionates | elágazó és lineáris láncú C7-C9 alkil-3-[3-(2H-benzotriazol-2-il)-5-(1,1-dimetiletil)-4-hidroxifenil]propionátok keveréke | 407-000-3 | 127519-17-9 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 607-282-00-X | 2-acetoxymethyl-4-benzyloxybut-1-yl acetate | 2-acetoximetil-4-benziloxibut-1-il-acetát | 407-140-5 | 131266-10-9 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | ||||
| 607-283-00-5 | E-ethyl-4-oxo-4-phenylcrotonate | E-etil-4-oxo-4-fenil-krotonát | 408-040-4 | 15121-89-8 | Acute
Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H312 H302 H315 H318 H317 H410 |
CLP00 | |||
| 607-284-00-0 | reaction mass of: sodium 3,3'-(1,4-phenylenebis(carbonylimino-3,1-propanediylimino))bis(10-amino-6,13-dichloro-4,11-triphenodioxazinedisulfonate); lithium 3,3'-(1,4-phenylenebis-(carbonylimino-3,1-propanediyl-imino))bis(10-amino-6,13-dichloro)-4,11-triphenodioxazinedisulfonate (9:1) | nátrium-3,3’-(1,4-fenilénbisz(karbonilimino-3,1-propándiilimino))bisz(10-amino-6,13-diklór)-4,11-trifenodioxazin-diszulfonát); lítium-3,3’-(1,4-fenilénbisz(karbonilimino-3,1-propándiilimino))bisz(10-amino-6,13-diklór)-4,11-trifenodioxazin-diszulfonát (9:1) keveréke | 410-040-4 | 136213-76-8 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 607-285-00-6 | reaction mass of: 7-(((3-aminophenyl)sulfonyl)amino)-naphthalene-1,3-disulfonic acid; sodium 7-(((3-aminophenyl)sulfonyl)amino)-naphthalene-1,3-disulfonate; potassium 7-(((3-aminophenyl)sulfonyl)amino)-naphthalene-1,3-disulfonate | 7-(((3-aminofenil)szulfonil)amino)-naftalin-1,3-diszulfonsav; nátrium-7-(((3-aminofenil)szulfonil)amino)-naftalin-1,3-diszulfonát; kálium-7-(((3-aminofenil)szulfonil)amino)-naftalin-1,3-diszulfonát keveréke | 410-065-0 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
CLP00 | |||||
| 607-286-00-1 | reaction mass of: sodium/potassium 7-[[[3-[[4-((2-hydroxy-naphthyl)azo)phenyl]azo]phenyl]sulfonyl]amino]-naphthalene-1,3-disulfonate | nátrium/kálium-7-[[[3-[[4-((2-hidroxinaftil) azo)fenil]azo]fenil]szulfonil]amino]-naftalin-1,3-diszulfonát keveréke | 410-070-8 | 141880-36-6 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
CLP00 | |||
| 607-287-00-7 | O'-methyl O-(1-methyl-2-methacryloyloxy-ethyl)-1,2,3,6-tetrahydrophthalate | O’-metil-O-(1-metil-2-metakriloiloxietil)-1,2,3,6-tetrahidroftalát | 410-140-8 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | |||||
| 607-288-00-2 | Tetrasodium (c-(3-(1-(3-(e-6-dichloro-5-cyanopyrimidin-f-yl(methyl)amino)propyl)-1,6-dihydro-2-hydroxy-4-methyl-6-oxo-3-pyridylazo)-4-sulfonatophenylsulfamoyl)phthalocyanine-a,b,d-trisulfonato(6-))nickelato II, where a is 1 or 2 or 3 or 4,b is 8 or 9 or 10 or 11,c is 15 or 16 or 17 or 18, d is 22 or 23 or 24 or 25 and where e and f together are 2 and 4 or 4 and 2 respectively | tetranátrium-[c-[3-[1-[3-[e-6-diklór-5-cianopirimidin-f-il(metil)amino]propil]-1,6-dihidro-2-hidroxi-4-metil-6-oxo-3-piridilazo]-4-szulfonátofenilszulfamoil]ftalocianin-a, b,d-triszulfonáto(6-)]-nikkel II, ahol a=1 vagy 2 vagy 3 vagy 4, b=8 vagy 9 vagy 10 vagy 11, c=15 vagy 16 vagy 17 vagy 18, d=22 vagy 23 vagy 24 vagy 25, és ahol e és f =2 és 4 vagy 4 és 2 | 410-160-7 | 148732-74-5 | Eye
Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H319 H317 H412 |
GHS07 Wng |
H319 H317 H412 |
CLP00 | |||
| 607-289-00-8 | 3-(3-(4-(2,4-bis(1,1-dimethylpropyl)phenoxy)butylaminocarbonyl-4-hydroxy-1-naphthalenyl)thio)propanoic acid | 3-(3-(4-(2,4-bisz(1,1-dimetilpropil)fenoxi)butilaminokarbonil-4- hidroxi-1-naftalenil)tio)propánsav | 410-370-9 | 105488-33-3 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 607-290-00-3 | reaction mass (ratio not known) of: ammonium 1-C14-C18-alkyloxycarbonyl-2-(3-allyloxy-2-hydroxypropoxycarbonyl)ethane-1-sulfonate; ammonium 2-C14-C18-alkyloxycarbonyl-1-(3-allyloxy-2-hydroxypropoxycarbonyl)ethane-1-sulfonate | a következő anyagok (nem ismert arányú) keveréke: ammónium-1-C14-C18-alkiloxikarbonil-2-(3-alliloxi-2-hidroxipropoxikarbonil)etán-1-szulfonát; ammónium-2-C14-C18-alkiloxikarbonil-1-(3-alliloxi-2-hidroxipropoxikarbonil)etán-1-szulfonát | 410-540-2 | Skin
Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H315 H317 H410 |
CLP00 | ||||
| 607-291-00-9 | dodecyl-ω-(C5/C6-cycloalkyl)alkyl carboxylate | dodecil-ω-(C5/C6-cikloalkil)alkil-karboxilát | 410-630-1 | 104051-92-5 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 607-292-00-4 | reaction mass of: [1-(methoxymethyl)-2-(C12-alkoxy)-ethoxy]acetic acid; [1-(methoxymethyl)-2-(C14-alkoxy)-ethoxy]acetic acid | [1-(metoximetil)-2-(C12-alkoxi)-etoxi]ecetsav; [1-(metoximetil)-2-(C 14 -alkoxi)-etoxi]ecetsav keveréke | 410-640-6 | Skin
Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H400 H410 |
GHS05 GHS09 Dgr |
H315 H318 H410 |
CLP00 | ||||
| 607-293-00-X | reaction mass of: N-aminoethylpiperazonium mono-2,4,6-trimethylnonyldiphenyl ether di-sulfonate; N-aminoethylpiperazonium di-2,4,6-trimethylnonyldiphenyl ether di-sulfonate | N-aminoetilpiperazónium-mono-2,4,6-trimetilnonildifenil-éter-diszulfonát; N-aminoetilpiperazónium-di-2,4,6-trimetilnonildifenil-éter-diszulfonát keveréke | 410-650-0 | Eye
Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H411 |
CLP00 | ||||
| 607-294-00-5 | sodium 2-benzoyloxy-1-hydroxyethane-sulfonate | nátrium-2-benzoiloxi-1-hidroxietán-szulfonát | 410-680-4 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | ||||
| 607-295-00-0 | reaction mass of: tetrasodium phosphonoethane-1,2-dicarboxylate; hexasodium phosphonobutane-1,2,3,4-tetracarboxylate | tetranátrium-foszfonoetán-1,2-dikarboxilát; hexanátrium-foszfonobután-1,2,3,4-tetrakarboxilát keveréke | 410-800-5 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | ||||
| 607-296-00-6 | reaction mass of: pentaerythriol tetraesters with heptanoic acid and 2-ethylhexanoic acid | pentaeritriol-tetraészterek keveréke heptánsavval és 2-etilhexánsavval | 410-830-9 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | |||||
| 607-297-00-1 | (E-E)-3,3'-(1,4-phenylenedimethylidene)bis(2-oxobornane-10-sulfonic acid) | (E-E)-3,3'-(1,4-feniléndimetilidén)bisz(2-oxobornán-10-szulfonsav) | 410-960-6 | 92761-26-7 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | |||
| 607-298-00-7 | 2-(trimethylammonium)ethoxycarboxybenzene-4-sulfonate | 2-(trimetilammónium)etoxikarboxibenzol-4-szulfonát | 411-010-3 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | ||||
| 607-299-00-2 | methyl 3-(acetylthio)-2-methyl-propanoate | metil-3-(acetiltio)-2-metil-propanoát | 411-040-7 | 97101-46-7 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
CLP00 | |||
| 607-300-00-6 | trisodium [2-(5-chloro-2,6-difluoropyrimidin-4-ylamino)-5-(b-sulfamoyl-c, d-sulfonatophthalocyanin-a-yl-K4,N29,N30,N31,N32-sulfonylamino)benzoato(5-)]cuprate(II) where a = 1,2,3,4 b = 8,9,10,11 c = 15,16,17,18 d = 22,23,24,25 | trinátrium-[2-(5-klór-2,6-difluorpirimidin-4-ilamino)-5-(b-szulfamoil-c, d-szulfonátoftalocianin-a-il-K4,N29,N30,N31,N32-szulfonilamino)benzoáto(5-)]-kuprát(II), ahol a= 1,2,3,4 b = 8,9,10,11 c= 15,16,17,18 d= 22,23,24,25 | 411-430-7 | Eye
Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
CLP00 | ||||
| 607-301-00-1 | reaction mass of: dodecanoic acid; poly(1-7)lactate esters of dodecanoic acid | dodekánsav; dodekánsav-poli(1-7)laktát-észterek keveréke | 411-860-5 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | ||||
| 607-302-00-7 | reaction mass of: tetradecanoic acid; poly(1-7)lactate esters of tetradecanoic acid | tetradekánsav; tetradekánsav-poli(1-7)laktát-észterek keveréke | 411-910-6 | Skin
Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H315 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H411 |
CLP00 | ||||
| 607-303-00-2 | 1-cyclopropyl-6,7-difluoro-1,4-dihydro-4-oxoquinoline-3-carboxylic acid | 1-ciklopropil-6,7-difluor-1,4-dihidro-4-oxokinolin-3-karbonsav | 413-760-7 | 93107-30-3 | Repr.
2 Aquatic Chronic 3 |
H361f
*** H412 |
GHS08 Wng |
H361f
*** H412 |
CLP00 | |||
| 607-304-00-8 | fluazifop-butyl (ISO); butyl (RS)-2-[4-(5-trifluoromethyl-2-pyridyloxy)phenoxy]propionate | fluazifop-butil (ISO); butil-(RS)-2-[4-(5-trifuormetil-2-piridiloxi)fenoxi]propionát | 274-125-6 | 69806-50-4 | Repr.
1B Aquatic Acute 1 Aquatic Chronic 1 |
H360D
*** H400 H410 |
GHS08 GHS09 Dgr |
H360D
*** H410 |
CLP00 | |||
| 607-305-00-3 | fluazifop-P-butyl (ISO); butyl (R)-2-[4-(5-trifluoromethyl-2-pyridyloxy)phenoxy]propionate | fluazifop-P-butil (ISO); butil-(R)-2-[4-(5-trifuormetil-2-piridiloxi)fenoxi]propionát | 79241-46-6 | Repr.
2 Aquatic Acute 1 Aquatic Chronic 1 |
H361d
*** H400 H410 |
GHS08 GHS09 Wng |
H361d
*** H410 |
CLP00 | ||||
| 607-306-00-9 | chlozolinate (ISO); ethyl (RS)-3-(3,5-dichlorophenyl)-5-methyl-2,4-dioxo-oxazolidine-5-carboxylate | klozolinát (ISO); etil-(RS)-3-(3,5-diklórfenil)-5-metil-2,4-dioxooxazolidin-5-karboxilát | 282-714-4 | 84332-86-5 | Carc.
2 Aquatic Chronic 2 |
H351 H411 |
GHS08 GHS09 Wng |
H351 H411 |
CLP00 | |||
| 607-307-00-4 | vinclozolin (ISO); N-3,5-dichlorophenyl-5-methyl-5-vinyl-1,3-oxazolidine-2,4-dione | vinklozolin (ISO); N-3,5-diklórfenil-5-metil-5-vinil-1,3-oxazolidin-2,4-dion | 256-599-6 | 50471-44-8 | Carc.
2 Repr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H351 H360FD H317 H411 |
GHS08 GHS07 GHS09 Dgr |
H351 H360FD H317 H411 |
CLP00 | |||
| 607-308-00-X | esters of 2,4-D | 2,4-D észterei; 2,4-diklórfenoxiecetsav észterei | Acute
Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
A | CLP00 | ||||
| 607-309-00-5 | carfentrazone-ethyl (ISO); ethyl (RS)-2-chloro-3-[2-chloro-4-fluoro-5-[4-difluoromethyl-4,5-dihydro-3-methyl-5-oxo-1H-1,2,4-triazol-1-yl]phenyl]propionate | karfentrazon-etil (ISO); etil-(RS)-2-klór-3-[2-klór-4-fluor-5-(4-difluormetil-4,5-dihidro-3-metil-5-oxo-1H-1,2,4-triazol-1-il)fenil]propionát | 128639-02-1 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | ||||
| 607-310-00-0 | kresoxim-methyl (ISO); methyl (E)-2-methoxyimino-[2-(o-tolyloxymethyl)phenyl]acetate | krezoxim-metil (ISO); metil-(E)-2-metoxiimino-[2-(o-toliloximetil)fenil]acetát | 143390-89-0 | Carc.
2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
CLP00 | ||||
| 607-311-00-6 | benazolin-ethyl; ethyl 4-chloro-2-oxo-2H-benzothiazole-3-acetate | benazolin-etil; etil-4-klór-2-oxo-2H-benzotiazol-3-acetát | 246-591-0 | 25059-80-7 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 607-312-00-1 | methoxyacetic acid | metoxiecetsav; | 210-894-6 | 625-45-6 | Repr.
1B Acute Tox. 4 * Skin Corr. 1B |
H360FD H302 H314 |
GHS08 GHS05 GHS07 Dgr |
H360FD H302 H314 |
STOT
SE 3; H335: C ≥ 5 % |
CLP00 | ||
| 607-313-00-7 | neodecanoyl chloride | neodekanoil-klorid | 254-875-0 | 40292-82-8 | Acute
Tox. 2 * Acute Tox. 4 * Skin Corr. 1B |
H330 H302 H314 |
GHS06 GHS06 Dgr |
H330 H302 H314 |
STOT
SE 3; H335: C ≥ 5 % |
CLP00 | ||
| 607-314-00-2 | ethofumesate (ISO); (RS)-2-ethoxy-2,3-dihydro-3,3-dimethylbenzofuran-5-yl methanesulfonate | etofumezát (ISO); (±)-2-etoxi-2,3-dihidro-3,3-dimetilbenzofurán-5-il-metánszulfonát | 247-525-3 | 26225-79-6 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
M=1 M=1 |
CLP00/ATP15 | ||
| 607-315-00-8 | glyphosate (ISO); N-(phosphonomethyl)glycine | glifozát (ISO); N-(foszfonometil)glicin | 213-997-4 | 1071-83-6 | Eye
Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
CLP00 | |||
| 607-316-00-3 | glyphosate-trimesium; glyphosate-trimethylsulfonium | glifozát-trimezium; glifozát-trimetilszulfónium | 81591-81-3 | Acute
Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
CLP00 | ||||
| 607-317-00-9 | bis(2-ethylhexyl) phthalate; di-(2-ethylhexyl) phthalate; DEHP | bisz(2-etilhexil)ftalát; di(2-etilhexil)ftalát; DEHP | 204-211-0 | 117-81-7 | Repr.
1B |
H360FD |
GHS08 Dgr |
H360FD |
CLP00 | |||
| 607-318-00-4 | dibutyl phthalate; DBP | dibutil-ftalát; DBP | 201-557-4 | 84-74-2 | Repr.
1B Aquatic Acute 1 |
H360Df H400 |
GHS08 GHS09 Dgr |
H360Df H400 |
CLP00 | |||
| 607-319-00-X | deltamethrin (ISO); (S)-α-cyano-3-phenoxybenzyl (1R, 3R)-3-(2,2-dibromovinyl)-2,2-dimethylcyclopropanecarboxylate | deltametrin (ISO); (S)-α-ciano-3-fenoxibenzil-(1R, 3R)-3-(2,2-dibrómvinil)-2,2-dimetilciklopropán-karboxilát | 258-256-6 | 52918-63-5 | Acute
Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H410 |
M=1000000 |
CLP00/ATP01 | ||
| 607-320-00-5 | bis[4-(ethenyloxy)butyl] 1,3-benzenedicarboxylate | bisz[4-(eteniloxi)butil]-1,3-feniléndikarboxilát | 413-930-0 | 130066-57-8 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
CLP00 | |||
| 607-321-00-0 | (S)-methyl-2-chloropropionate | (S)-metil-2-klórpropionát | 412-470-8 | 73246-45-4 | Flam.
Liq. 3 STOT RE 2 * Eye Irrit. 2 |
H226 H373 ** H319 |
GHS02 GHS08 Wng |
H226 H373 ** H319 |
CLP00 | |||
| 607-322-00-6 | 4-(4,4-dimethyl-3-oxo-pyrazolidin-1-yl)-benzoic acid | 4-(4,4-dimetil-3-oxopirazolidin-1-il)benzoesav | 413-120-7 | 107144-30-9 | Acute
Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
CLP00 | |||
| 607-323-00-1 | 2-(1-(2-hydroxy-3,5-di-tert-pentyl-phenyl)ethyl)-4,6-di-tert-pentylphenyl acrylate | 2-[1-(2-hidroxi-3,5-di-terc-pentilfenil)etil]-4,6-di-terc-pentilfenil-akrilát | 413-850-6 | 123968-25-2 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 607-324-00-7 | reaction mass of: N,N-di(hydrogenated alkyl C14-C18)phtalamic acid; dihydrogenated alkyl (C14-C18)amine | N, N-di(hidrogénezett C14-C18-alkil)ftálamidsav; dihidrogénezett alkil-(C14-C18)amin keveréke | 413-800-3 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | |||||
| 607-325-00-2 | (S)-2-chloropropionic acid | (S)-2-klórpropionsav | 411-150-5 | 29617-66-1 | Acute
Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
CLP00 | |||
| 607-326-00-8 | reaction mass of: isobutyl hydrogen 2-(α-2,4,6-trimethylnon-2-enyl)succinate; isobutyl hydrogen 2-(ß-2,4,6-trimetyhylnon-2-enyl)succinate | izobutil-hidrogén-2-(α-2,4,6-trimetilnon-2-enil)szukcinát; izobutil-hidrogén-2-(β-2,4,6-trimetilnon-2-enil)szukcinát keveréke | 410-720-0 | 141847-13-4 | Eye
Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
CLP00 | |||
| 607-327-00-3 | 2-(2-iodoethyl)-1,3-propanediol diacetate | 2-(2-jódetil)-1,3-propándiol-diacetát | 411-780-0 | 127047-77-2 | Acute
Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
CLP00 | |||
| 607-328-00-9 | methyl 4-bromomethyl-3-methoxybenzoate | metil-4-brómmetil-3-metoxibenzoát | 410-310-1 | 70264-94-7 | Skin
Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H410 |
CLP00 | |||
| 607-329-00-4 | reaction mass of: sodium 2-(C12-18-n-alkyl)amino-1,4-butandioate; sodium 2-octadecenyl-amino-1,4-butandioate | nátrium-2-(C12-18-n-alkil)amino-1,4-butándioát; nátrium-2-oktadecenilamino-1,4-butándioát keveréke | 411-250-9 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | ||||
| 607-330-00-X | (S)-2,3-dihydro-1H-indole-2-carboxylic acid | (S)-2,3-dihidro-1H-indol-2-karbonsav | 410-860-2 | 79815-20-6 | Repr.
2 STOT RE 2 * Skin Sens. 1 |
H361f
*** H373 ** H317 |
GHS08 GHS07 Wng |
H361f
*** H373 ** H317 |
CLP00 | |||
| 607-332-00-0 | cyclopentyl chloroformate | ciklopentil-klórformiát | 411-460-0 | 50715-28-1 | Flam.
Liq. 3 Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 |
H226 H331 H302 H373 ** H318 H317 |
GHS02 GHS06 GHS08 GHS05 Dgr |
H226 H331 H302 H373 ** H318 H317 |
CLP00 | |||
| 607-333-00-6 | reaction mass of: dodecyl N-(2,2,6,6-tetramethylpiperidin-4-yl)-β-alaninate; tetradecyl N-(2,2,6,6-tetramethylpiperidin-4-yl)-β-alaninate | dodecil N-(2,2,6,6-tetrametilpiperidin-4-il)-β-alaninát; tetradecil-N-(2,2,6,6-tetrametilpiperidin-4-il)-β-alaninát keveréke | 405-670-1 | Acute
Tox. 4 * STOT RE 2 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H314 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H302 H373 ** H314 H410 |
CLP00 | ||||
| 607-334-00-1 | ethyl 1-ethyl-6,7,8-trifluoro-1,4-dihydro-4-oxoquinoline-3-carboxylate | etil-1-etil-6,7,8-trifluor-1,4-dihidro-4-oxokinolin-3-karboxilát | 405-880-3 | 100501-62-0 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
CLP00 | |||
| 607-335-00-7 | methyl (R)-2-(4-(3-chloro-5-trifluoromethyl-2-pyridyloxy)phenoxy)propionate | metil-(R)-2-[4-(3-klór-5-trifluormetil-2-piridiloxi)fenoxi]propionát | 406-250-0 | 72619-32-0 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | |||
| 607-336-00-2 | 4-methyl-8-methylenetricyclo[3.3.1.13,7]dec-2-yl acetate | 4-metil-8-metiléntriciklo[3.3.1.13,7]dec-2-ilacetát | 406-560-6 | 122760-85-4 | Skin
Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H315 H317 H411 |
GHS07 GHS09 Wng |
H315 H317 H411 |
CLP00 | |||
| 607-337-00-8 | di-tert-(C12-14)-alkylammonium 2-benzothiazolylthiosuccinate | di-terc-(C12-C14)alkilammónium-2-benzotiazoliltio-szukcinát | 406-052-4 | 125078-60-6 | Flam.
Liq. 3 Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 2 |
H226 H302 H315 H318 H411 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H226 H302 H315 H318 H411 |
CLP00 | |||
| 607-338-00-3 | 2-methylpropyl 2-hydroxy-2-methylbut-3-enoate | 2-metilpropil-2-hidroxi-2-metilbut-3-enoát | 406-235-9 | 72531-53-4 | Skin
Irrit. 2 Eye Irrit. 2 |
H315 H319 |
GHS07 Wng |
H319 H315 |
CLP00 | |||
| 607-339-00-9 | 2,3,4,5-tetrachlorobenzoylchloride | 2,3,4,5-tetraklórbenzoil-klorid | 406-760-3 | 42221-52-3 | Acute
Tox. 4 * Skin Corr. 1B Skin Sens. 1 |
H302 H314 H317 |
GHS05 GHS07 Dgr |
H302 H314 H317 |
CLP00 | |||
| 607-340-00-4 | 1,3-bis(4-benzoyl-3-hydroxyphenoxy)prop-2-yl acetate | 1,3-bisz(4-benzoil-3-hidroxifenoxi)prop-2-il acetát | 406-990-4 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | ||||
| 607-341-00-X | (9S)-9-amino-9-deoxyerythromycin | (9S)-9-amino-9-deoxieritromicin | 406-790-7 | 26116-56-3 | Eye
Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
CLP00 | |||
| 607-342-00-5 | 4-chlorobutyl veratrate | 4-klórbutil-veratrát | 410-950-1 | 69788-75-6 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | |||
| 607-343-00-0 | 4,7-methanooctahydro-1H-indene-diyldimethyl bis(2-carboxybenzoate) | 4,7-metanooktahidro-1H-indéndiildimetil-bisz(2-karboxibenzoát) | 407-410-2 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | |||||
| 607-344-00-6 | reaction mass of: 3-(N-(3-dimethylaminopropyl)-(C4-8)perfluoroalkylsulfonamido)propionic acid; N-[dimethyl-3-(C4-8-perfluoroalkylsulfonamido)propylammonium propionate; 3-(N-(3-dimethyl-propylammonium)-(C4-8)perfluoroalkylsulfonamido)propionic acid propionate | 3-[N-(3-dimetilaminopropil)-(C4-8)perfluoralkilszulfonamido]propionsav; N-[dimetil-3-(C4-8-perfluoralkilszulfonamido)]propilammónium-propionát; 3-[N-(3-dimetilpropilammónium)-(C4-8)perfluoralkilszulfonamido]propionsav-propionát keveréke | 407-810-7 | STOT
RE 2 * |
H373
** |
GHS08 Wng |
H373
** |
CLP00 | ||||
| 607-345-00-1 | potassium 2-(2,4-dichlorophenoxy)-(R)-propionate | kálium-2-(2,4-diklórfenoxi)-(R)-propionát | 413-580-9 | 113963-87-4 | Acute
Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H302 H315 H318 H317 |
GHS05 GHS07 Dgr |
H302 H315 H318 H317 |
CLP00 | |||
| 607-346-00-7 | 3-icosyl-4-henicosylidene-2-oxetanone | 3-ikozil-4-henikozilidén-2-oxetanon | 401-210-9 | 83708-14-9 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 607-347-00-2 | sodium (R)-2-(2,4-dichlorophenoxy)propionate | nátrium-(R)-2-(2,4-diklórfenoxi)propionát | 413-340-3 | 119299-10-4 | Acute
Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H302 H315 H318 H317 |
GHS05 GHS07 Dgr |
H302 H315 H318 H317 |
CLP00 | |||
| 607-348-00-8 | magnesium bis((R)-2-(2,4-dichlorophenoxy)propionate) | magnézium-bisz[(R)-2-(2,4-diklórfenoxi)propionát] | 413-360-2 | Acute
Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H302 H315 H318 H317 |
GHS05 GHS07 Dgr |
H302 H315 H318 H317 |
CLP00 | ||||
| 607-349-00-3 | mono-(tetrapropylammonium) hydrogen 2,2'-dithiobisbenzoate | mono-(tetrapropilammónium)-hidrogén-2,2’-ditiobiszbenzoát | 411-270-8 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | |||||
| 607-350-00-9 | bis(4-(1,2-bis(ethoxycarbonyl)ethylamino)-3-methylcyclohexyl)methane | bisz[4-[1,2-bisz(etoxikarbonil)etilamino]-3-metilciklohexil]metán | 412-060-9 | 136210-32-7 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
CLP00 | |||
| 607-351-00-4 | methyl O-(4-amino-3,5-dichloro-6-fluoropyridin-2-yloxy)acetate | metil-O-(4-amino-3,5-diklór-6-fluorpiridin-2-iloxi)acetát | 407-550-4 | 69184-17-4 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 607-352-00-X | 4,4'-oxydiphthalic anhydride | 4,4’-oxidiftálsav-anhidrid | 412-830-4 | 1823-59-2 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | ||||
| 607-353-00-5 | reaction mass of: ethyl exo-tricyclo[5.2.1.02,6]decane-endo-2-carboxylate; ethyl endo-tricyclo[5.2.1.02,6]decane-exo-2-carboxylate | etil-exo-triciklo[5.2.1.02,6]dekán-endo-2-karboxilát; etil-endo-triciklo[5.2.1.02,6]dekán-exo-2-karboxilát keveréke | 407-520-0 | 80657-64-3 | Skin
Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
CLP00 | |||
| 607-354-00-0 | ethyl 2-cyclohexylpropionate | etil-2-ciklohexilpropionát | 412-280-5 | 2511-00-4 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 607-355-00-6 | p-tolyl 4-chlorobenzoate | p-tolil-4-klórbenzoát | 411-530-0 | 15024-10-9 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
CLP00 | |||
| 607-356-00-1 | ethyl trans-2,2,6-trimethylcyclohexanecarboxylate | etil-transz-2,2,6-trimetoxiciklohexánkarboxilát | 412-540-8 | Skin
Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
CLP00 | ||||
| 607-357-00-7 | reaction mass of: trans-4-acetoxy-4-methyl-2-propyl-tetrahydro-2H-pyran; cis-4-acetoxy-4-methyl-2-propyl-tetrahydro-2H-pyran | transz-4-acetoxi-4-metil-2-propil-tetrahidro-2H-pirán; cisz-4-acetoxi-4-metil-2-propil-tetrahidro-2H-pirán keveréke | 412-450-9 | 131766-73-9 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 607-358-00-2 | (1S,3S,5R,6R)-(4-nitrophenylmethyl)-1-dioxo-6-phenylacetamido-penam-3-carboxylate | (1S,3S,5R,6R)-(4-nitrofenilmetil)-1-dioxo-6-fenilacetamido-penam-3-karboxilát | 412-670-5 | 54275-93-3 | Resp.
Sens. 1 |
H334 |
GHS08 Dgr |
H334 |
CLP00 | |||
| 607-359-00-8 | (1S,4R,6R,7R)-(4-nitrophenylmethyl)3-methylene-1-oxo-7-phenylacetamido-cepham-4-carboxylateido-penam-3-carboxylate | (1S,4R,6R,7R)-(4-nitrofenilmetil)-3-metilén-1-oxo-7-fenilacetamido-cefam-4-karboxilátido-penam-3-karboxilát | 412-800-0 | 76109-32-5 | Resp.
Sens. 1 |
H334 |
GHS08 Dgr |
H334 |
CLP00 | |||
| 607-360-00-3 | sodium 3-acetoacetylamino-4-methoxytolyl-6-sulfonate | nátrium-3-acetoacetilamino-4-metoxitolil-6-szulfonát | 411-680-7 | 133167-77-8 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 607-361-00-9 | methyl (R)-2-(4-hydroxyphenoxy)propionate | metil-(R)-2-(4-hidroxifenoxi)propionát | 411-950-4 | 96562-58-2 | Eye
Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
CLP00 | |||
| 607-362-00-4 | reaction mass of: (3-methoxy)propylammonium/[tris-(2-hydroxyethyl)]ammonium 2-(2-(bis(2-hydroxyethyl)amino)ethoxycarbonylmethyl)hexadec-4-enoate; (3-methoxy)propylammonium/[tris-(2-hydroxyethyl)]ammonium 2-(2-(bis(2-hydroxyethyl)amino)ethoxycarbonylmethyl)tetradec-4-enoate; (3-methoxy)propylammonium/[tris-(2-hydroxyethyl)]ammonium 2-(3-methoxypropylcarbamoylmethyl)hexadec-4-enoate; (3-methoxy)propylammonium/[tris-(2-hydroxyethyl)]ammonium 2-(3-methoxypropylcarbamoylmethyl)tetradec-4-enoate | a következő anyagok keveréke: (3-metoxi)propilammónium/[trisz-(2-hidroxietil)]ammónium-2-[2-[bisz(2-hidroxietil)amino]etoxikarbonilmetil]hexadec-4-enoát; (3-metoxi)propilammónium/[trisz-(2-hidroxietil)]ammónium-2-[2-[bisz(2-hidroxietil)amino]etoxikarbonilmetil]tetradec-4-enoát; (3-metoxi)propilammónium/[trisz-(2-hidroxietil)]ammónium-2-(3-metoxipropilkarbamoilmetil)hexadec-4-enoát; (3-metoxi)propilammónium/[trisz-(2-hidroxietil)]ammónium-2-(3-metoxipropilkarbamoilmetil)tetradec-4-enoát | 413-500-2 | Skin
Irrit. 2 Eye Dam. 1 Aquatic Chronic 2 |
H315 H318 H411 |
GHS05 GHS09 Dgr |
H315 H318 H411 |
CLP00 | ||||
| 607-363-00-X | methyl-3-methoxyacrylate | metil-3-metoxiakrilát | 412-900-4 | 5788-17-0 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 607-364-00-5 | 3-phenyl-7-[4-(tetrahydrofurfuryloxy)phenyl]-1,5-dioxa-s-indacen-2,6-dione | 3-fenil-7-[4-(tetrahidrofurfuriloxi)fenil]-1,5-dioxa-s-indacén-2,6-dion | 413-330-9 | 134724-55-3 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 607-365-00-0 | 2-(2-amino-1,3-thiazol-4-yl)-(Z)-2-methoxyiminoacetyl chloride hydrochloride | 2-(2-amino-1,3-tiazol-4-il)-(Z)-2-metoxiiminoacetil-klorid-hidroklorid | 410-620-7 | 119154-86-8 | Acute
Tox. 4 * Skin Corr. 1B Skin Sens. 1 |
H302 H314 H317 |
GHS05 GHS07 Dgr |
H302 H314 H317 |
CLP00 | |||
| 607-366-00-6 | 3,5-dimethylbenzoyl chloride | 3,5-dimetilbenzoil-klorid | 413-010-9 | 6613-44-1 | Skin
Corr. 1B Skin Sens. 1 |
H314 H317 |
GHS05 GHS07 Dgr |
H314 H317 |
CLP00 | |||
| 607-367-00-1 | potassium bis(N-carboxymethyl)-N-methyl-glycinato-(2-)N,O,O,N)-ferrate-(1-) monohydrate | kálium-bisz(N-karboximetil)-N-metilglicináto-(2-)N, O,O, N)-vas-(1-)monohidrát | 411-640-9 | 153352-59-1 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 607-368-00-7 | 1-(N,N-dimethylcarbamoyl)-3-tert-butyl-5-carbethoxymethylthio-1H-1,2,4-triazole | 1-(N,N-dimetilkarbamoil)-3-terc-butil-5-karbetoximetiltio-1H-1,2,4-triazol | 411-650-3 | 110895-43-7 | Acute
Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H410 |
CLP00 | |||
| 607-369-00-2 | reaction mass of: trans-(2R)-5-acetoxy-1,3-oxathiolane-2-carboxylic acid; cis-(2R)-5-acetoxy-1,3-oxathiolane-2-carboxylic acid | transz-(2R)-5-acetoxi-1,3-oxatiolán-2-karbonsav; cisz-(2R)-5-acetoxi-1,3-oxatiolán-2-karbonsav keveréke | 411-660-8 | 147027-04-1 | Acute
Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H302 H315 H318 H317 |
GHS05 GHS07 Dgr |
H302 H315 H318 H317 |
CLP00 | |||
| 607-370-00-8 | 2-[[2-(acetyloxy)-3-(1,1-dimethyl-ethyl)-5-methylphenyl]methyl]-6-(1,1-dimethylethyl)-4-methylphenol | 2-[[2-(acetiloxi)-3-(1,1-dimetiletil)-5-metilfenil]metil]-6-(1,1- dimetiletil)-4-metilfenol | 412-210-3 | 41620-33-1 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 607-371-00-3 | 3-ethyl 5-methyl 4-(2-chlorophenyl)-1,4-dihydro-2-[2-(1,3-dihydro-1,3-dioxo-(2H)isoindol-2-yl)-ethoxymethyl]-6-methyl-3,5-pyridinedicarboxylate | 3-etil-5-metil-4-(2-klórfenil)-1,4-dihidro-2-[2-(1,3-dihidro-1,3-dioxo-(2)izoindol-2-il)-etoximetil]-6-metil-3,5-piridindikarboxilát | 413-410-3 | 88150-62-3 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 607-372-00-9 | ethoxylated bis phenol A di-(norbornene carboxylate) | biszfenol-A-di(norbornén-karboxilát); etoxilált | 412-410-0 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | |||||
| 607-373-00-4 | quizalofop-P-tefuryl (ISO); (+/-) tetrahydrofurfuryl (R)-2-[4-(6-chloroquinoxalin-2-yloxy)phenyloxy]propionate | kizalofop-P-tefuril (ISO); (±) tetrahidrofurfuril-(R)-2-[4-(6-klórkinoxalin-2-iloxi)feniloxi]-propionát | 414-200-4 | 200509-41-7 | Carc.
2 Repr. 2 Acute Tox. 4 STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H361fd H302 H373 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H351 H361fd H373 H410 |
M=1 M=1 |
CLP00/ATP13 | ||
| 607-374-00-X | 5-amino-2,4,6-triiodo-1,3-benzenedicarbonyldichloride | 5-amino-2,4,6-trijód-1,3-benzoldikarbonil-diklorid | 417-220-1 | 37441-29-5 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | |||
| 607-375-00-5 | flocoumafen (ISO); reaction mass of: cis-4-hydroxy-3-(1,2,3,4-tetrahydro-3-(4-(4-trifluoromethylbenzyloxy)phenyl)-1-naphthyl)coumarin and trans-4-hydroxy-3-(1,2,3,4-tetrahydro-3-(4-(4-trifluoromethylbenzyloxy)phenyl)-1-naphthyl)coumarin | flokumafen (ISO); cisz-4-hidroxi-3-(1,2,3,4-tetrahidro-3-(4-(4-trifluormetilbenziloxi)fenil)-1-naftil)kumarin és transz-4-hidroxi-3-(1,2,3,4-tetrahidro-3-(4-(4-trifluormetilbenziloxi)fenil)-1-naftil)kumarin keveréke | 421-960-0 | 90035-08-8 | Repr.
1B Acute Tox. 1 Acute Tox. 1 Acute Tox. 1 STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360D H330 H310 H300 H372 (blood) H400 H410 |
GHS08 GHS06 GHS09 Dgr |
H330 H310 H300 H360D H372 (blood) H410 |
Repr.
1B; H360D: C ≥ 0,003 % STOT RE 1; H372: C ≥ 0,05 % STOT RE 2; H373: 0,005 % ≤ C < 0,05 % M=10 M=10 |
CLP00/ATP09 | ||
| 607-376-00-0 | benzyl 2,4-dibromobutanoate | benzil-2,4-dibrómbutanoát | 420-710-8 | 23085-60-1 | Repr.
2 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361f
*** H315 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361f
*** H315 H317 H410 |
CLP00 | |||
| 607-377-00-6 | trans-4-cyclohexyl-L-proline monohydrochloride | transz-4-ciklohexil-L-prolin-monohidroklorid | 419-160-1 | 90657-55-9 | Repr.
2 Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H361f
*** H302 H315 H318 H317 |
GHS08 GHS05 GHS07 Dgr |
H361f
*** H302 H315 H318 H317 |
CLP00 | |||
| 607-378-00-1 | ammonium (Z)-α-methoxyimino-2-furylacetate | ammónium-(Z)-α-metoxiimino-2-furilacetát | 405-990-1 | 97148-39-5 | Flam.
Sol. 2 |
H228 |
GHS02 Dgr |
H228 |
T | CLP00 | ||
| 607-379-00-7 | reaction mass of: 2-[N-(2-hydroxyethyl)stearamido]ethyl stearate; sodium [bis[2-(stearoyloxy)ethyl]amino]methylsulfonate; sodium [bis(2-hydroxyethyl)amino]methylsulfonate; N,N-bis(2-hydroxyethyl)stearamide | 2-[N-(2-hidroxietil)sztearamido]etil-sztearát; nátrium-[bisz[2-(sztearoiloxi)etil]amino]metilszulfonát; nátrium-[bisz(2-hidroxietil)amino]metilszulfonát; N, N-bisz(2-hidroxietil)sztearamid keveréke | 401-230-8 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | |||||
| 607-380-00-2 | reaction mass of: ammonium-1,2-bis(hexyloxycarbonyl)ethanesulfonate; ammonium-1-hexyloxycarbonyl-2-octyloxycarbonylethanesulfonate; ammonium-2-hexyloxycarbonyl-1-octyloxycarbonylethanesulfonate | ammónium-1,2-bisz(hexiloxikarbonil)etánszulfonát; ammónium-1-hexiloxikarbonil-2-oktiloxikarboniletánszulfonát; ammónium-2-hexiloxikarbonil-1-oktiloxikarboniletánszulfonát keveréke | 407-320-3 | Skin
Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H315 H318 H412 |
GHS05 Dgr |
H315 H318 H412 |
CLP00 | ||||
| 607-381-00-8 | reaction mass of triesters of 2,2-bis(hydroxymethyl)butanol with C7-alkanoic acids and 2-ethylhexanoic acid | 2,2-bisz(hidroximetil)butanol C7-alkánsavakkal és 2-etilhexánsavval képzett triésztereinek keveréke | 413-710-4 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | |||||
| 607-382-00-3 | 2-((4-amino-2-nitrophenyl)amino)benzoic acid | 2-((4-amino-2-nitrofenil)amino)benzoesav | 411-260-3 | 117907-43-4 | Eye
Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
CLP00 | |||
| 607-383-00-9 | reaction mass of: 2,2,6,6-tetramethylpiperidin-4-yl-hexadecanoate; 2,2,6,6-tetramethylpiperidin-4-yl-octadecanoate | 2,2,6,6-tetrametilpiperidin-4-il-hexadekanoát; 2,2,6,6-tetrametilpiperidin-4-il-oktadekanoát keveréke | 415-430-8 | 86403-32-9 | Eye
Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H410 |
CLP00 | |||
| 607-384-00-4 | reaction mass of: esters of C14-C15 branched alcohols with 3,5-di-t-butyl-4-hydroxyphenyl propionic acid; C15 branched and linear alkyl 3,5-bis(1,1-dimethylethyl)-4-hydroxybenzenepropanoate; C13 branched and linear alkyl 3,5-bis(1,1-dimethylethyl)-4-hydroxybenzenepropanoate | a következő anyagok keveréke: C14-C15 elágazó láncú alkoholok 3,5-diterc-butil-4-hidroxifenilpropionsavval; C15 elágazó és egyenesláncú alkil-3,5-bisz(1,1-dimetiletil)-4-hidroxibenzol-propanoáttal; C13 elágazó és egyenesláncú alkil-3,5-bisz(1,1-dimetiletil)-4-hidroxibenzol-propanoáttal képzett észterei | 413-750-2 | 171090-93-0 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 607-385-00-X | Copolymer of vinyl-alcohol and vinyl acetate partially acetilized with 4-(2-(4-formylphenyl)ethenyl)-1-methylpyridinium methylsulfate | vinil-alkohol és vinil-acetát kopolimer, részlegesen acetilezve 4-(2-(4-formilfenil)etenil)-1-metil-piridinium-metilszulfáttal | 414-590-6 | 125229-74-5 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 607-386-00-5 | reaction mass of: tetradecanoic acid (42.5-47.5 %); poly(1-7)lactate esters of tetradecanoic acid (52.5-57.5 %) | tetradekánsav (42,5–47,5 %); tetradekánsav-poli(1-7)laktát-észterek (52,5–57,5 %) keveréke | 412-580-6 | 174591-51-6 | Skin
Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H410 |
CLP00 | |||
| 607-387-00-0 | reaction mass of: dodecanoic acid (35-40 %); poly(1-7)lactate esters of dodecanoic acid (60-65 %) | dodekánsav (35–40 %); dodekánsav-poli(1-7)laktát-észterek (60–65 %) keveréke | 412-590-0 | 58856-63-6 | Skin
Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H410 |
CLP00 | |||
| 607-388-00-6 | 4-ethylamino-3-nitrobenzoic acid | 4-etilamino-3-nitrobenzoesav | 412-090-2 | 2788-74-1 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Chronic 3 |
H302 H317 H412 |
GHS07 Wng |
H302 H317 H412 |
CLP00 | |||
| 607-389-00-1 | trisodium N,N-bis(carboxymethyl)-3-amino-2-hydroxypropionate | trinátrium-N, N-bisz(karboximetil)-3-amino-2-hidroxipropionát | 414-130-4 | 119710-96-2 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 607-390-00-7 | 1,2,3,4-tetrahydro-6-nitro-quinoxaline | 1,2,3,4-tetrahidro-6-nitrokinoxalin | 414-270-6 | 41959-35-7 | Acute
Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
CLP00 | |||
| 607-391-00-2 | dimethylcyclopropane-1,1-dicarboxylate | dimetilciklopropán-1,1-dikarboxilát | 414-240-2 | 6914-71-2 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | ||||
| 607-392-00-8 | 2-phenoxyethyl 4-((5-cyano-1,6-dihydro-2-hydroxy-1,4-dimethyl-6-oxo-3-pyridinyl)azo)benzoate | 2-fenoxietil-4-((5-ciano-1,6-dihidro-2-hidroxi-1,4-dimetil-6-oxo-3-piridinil)azo)benzoát | 414-260-1 | 88938-37-8 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 607-393-00-3 | 3-(cis-1-propenyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | 3-(cisz-1-propenil)-7-amino-8-oxo-5-tia-1-azabiciklo[4.2.0]okt-2-én-2-karbonsav | 415-750-8 | 106447-44-3 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 607-394-00-9 | 5-methylpyrazine-2-carboxylic acid | 5-metilpirazin-2-karbonsav | 413-260-9 | 5521-55-1 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | |||
| 607-395-00-4 | reaction mass of: sodium 1-tridecyl-4-allyl-(2 or 3)-sulfobutanedioate; sodium 1-dodecyl-4-allyl-(2 or 3)-sulfobutanedioate | nátrium-1-tridecil-4-allil-(2 vagy 3)-szulfobutándioát; nátrium-1-dodecil-4-allil-(2 vagy 3)-szulfobutándioát keveréke | 410-230-7 | Skin
Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H314 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H411 |
CLP00 | ||||
| 607-396-00-X | bis(1,2,2,6,6-pentamethyl-4-piperidinyl) 2-(4-methoxybenzylidene)malonate | bisz(1,2,2,6,6-pentametil-4-piperidinil)-2-(4-metoxibenzilidén)malonát | 414-840-4 | 147783-69-5 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 607-397-00-5 | reaction mass of: Ca salicylates (branched C10-14 and C18-30 alkylated); Ca phenates (branched C10-14 and C18-30 alkylated); Ca sulfurised phenates (branched C10-14 and C18-30 alkylated) | Ca-szalicilátok (elágazó C10-14- és C18-30-alkilezett); Ca-fenátok (elágazó C10-14- és C18-30-alkilezett); Ca-kénnel kezelt fenátok (elágazó C10-14- és C18-30-alkilezett) keveréke | 415-930-6 | - | Repr.
2 Skin Sens. 1 |
H361f
*** H317 |
GHS08 GHS07 Wng |
H361f
*** H317 |
CLP00/ATP01 | |||
| 607-398-00-0 | ethyl N-(5-chloro-3-(4-(diethylamino)-2-methylphenylimino)-4-methyl-6-oxo-1,4-cyclohexadienyl)carbamate | etil-N-(5-klór-3-(4-(dietilamino)-2-metilfenilimino)-4-metil-6-oxo-1,4-ciklohexadienil)karbamát | 414-820-5 | 125630-94-6 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 607-399-00-6 | 2,2-dimethyl 3-methyl-3-butenyl propanoate | 2,2-dimetil-3-metil-3-butenil-propanoát | 415-610-6 | 104468-21-5 | Skin
Irrit. 2 Aquatic Chronic 3 |
H315 H412 |
GHS07 Wng |
H315 H412 |
CLP00 | |||
| 607-400-00-X | methyl 3-[[(dibutylamino)thioxomethyl]thio]propanoate | metil-3-[[(dibutilamino)tioxometil]tio]propanoát | 414-400-1 | 32750-89-3 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 607-401-00-5 | ethyl 3-hydroxy-5-oxo-3-cyclohexene-1-carboxylate | etil-3-hidroxi-5-oxo-3-ciklohexén-1-karboxilát | 414-450-4 | 88805-65-6 | Skin
Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H315 H318 H317 |
GHS05 GHS07 Dgr |
H315 H318 H317 |
CLP00 | |||
| 607-402-00-0 | methyl N-(phenoxycarbonyl)-L-valinate | metil-N-(fenoxikarbonil)-L-valinát | 414-500-5 | 153441-77-1 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | ||||
| 607-403-00-6 | reaction mass of: bis(1S,2S,4S)-(1-benzyl-4-tert-butoxycarboxamido-2-hydroxy-5-phenyl)pentylammonium succinate; isopropyl alcohol | bisz(1S,2S,4S)-(1-benzil-4-terc-butoxikarboxamido-2-hidroxi-5-fenil)-pentilammónium-szukcinát; izopropil-alkohol keveréke | 414-810-0 | STOT
RE 2 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373
** H318 H400 H410 |
GHS08 GHS05 GHS09 Dgr |
H373
** H318 H410 |
CLP00 | ||||
| 607-404-00-1 | reaction mass of: ((Z)-3,7-dimethyl-2,6-octadienyl)oxycarbonylpropanoic acid; di-((E)-3,7-dimethyl-2,6-octadienyl) butandioate; di-((Z)-3,7-dimethyl-2,6-octadienyl) butandioate; (Z)-3,7-dimethyl-2,6-octadienyl butandioate; ((E)-3,7-dimethyl-2,6-octadienyl)oxycarbonylpropanoic acid | ((Z)-3,7-dimetil-2,6-oktadienil)oxikarbonilpropánsav; di-((E)-3,7-dimetil-2,6-oktadienil)-butándioát; di-((Z)-3,7-dimetil-2,6-oktadienil)-butándioát; (Z)-3,7-dimetil-2,6-oktadienil-butándioát; ((E)-3,7-dimetil-2,6-oktadienil)-oxikarbonilpropánsav keveréke | 415-190-4 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | ||||
| 607-405-00-7 | 2-hexyldecyl-p-hydroxybenzoate | 2-hexildecil-p-hidroxibenzoát | 415-380-7 | 148348-12-3 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 607-406-00-2 | potassium 2,5-dichlorobenzoate | kálium-2,5-diklórbenzoát | 415-700-5 | 184637-62-5 | Acute
Tox. 4 * Eye Dam. 1 |
H302 H318 |
GHS05 GHS07 Dgr |
H302 H318 |
CLP00 | |||
| 607-407-00-8 | ethyl 2-carboxy-3-(2-thienyl)propionate | etil-2-karboxi-3-(2-tienil)propionát | 415-680-8 | 143468-96-6 | Skin
Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H315 H318 H317 |
GHS05 GHS07 Dgr |
H315 H318 H317 |
CLP00 | |||
| 607-408-00-3 | potassium N-(4-fluorophenyl)glycinate | kálium-N-(4-fluorfenil)glicinát | 415-710-1 | 184637-63-6 | STOT
RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H373
** H318 H317 H412 |
GHS08 GHS05 GHS07 Dgr |
H373
** H318 H317 H412 |
CLP00 | |||
| 607-409-00-9 | reaction mass of: (3R)-[1S-(1α, 2α, 6β-((2S)-2-methyl-1-oxo-butoxy)-8aγ)hexahydro-2,6-dimethyl-1-naphthalene]-3,5-dihydroxyheptanoic acid; inert biomass from Aspergillus terreus | (3R)-[1S-(1α,2α, 6β-((2S)-2-metil-1-oxo-butoxi)-8aγ)hexahidro-2,6-dimetil-1-naftalin]-3,5-dihidroxiheptánsav; Aspergillus terreusból származó inert biomassza keveréke | 415-840-7 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
CLP00 | ||||
| 607-410-00-4 | mono[2-(dimethylamino)ethyl]monohydrogen-2-(hexadec-2-enyl)butanedioate and/or mono[2-(dimethylamino)ethyl]monohydrogen-3-(hexadec-2-enyl)butanedioate | mono[2-(dimetilamino)etil]-monohidrogén-2-(hexadec-2-enil)butándioát és/vagy mono[2-(dimetilamino)etil]-monohidrogén-3-(hexadec-2-enil)butándioát | 415-880-5 | 779343-34-9 | Skin
Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H410 |
CLP00 | |||
| 607-411-00-X | oxiranemethanol, 4-methylbenzene-sulfonate, (S)- | oxiránmetanol, 4-metilbenzol-szulfonát, (S)- | 417-210-7 | 70987-78-9 | Carc.
1B Muta. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H350 H341 H318 H317 H411 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H350 H341 H318 H317 H411 |
CLP00 | |||
| 607-412-00-5 | ethyl 2-(1-cyanocyclohexyl)acetate | etil-2-(1-cianociklohexil)acetát | 415-970-4 | 133481-10-4 | Acute
Tox. 4 * STOT RE 2 * Aquatic Chronic 3 |
H302 H373 ** H412 |
GHS08 GHS07 Wng |
H302 H373 ** H412 |
CLP00 | |||
| 607-413-00-0 | trans-4-phenyl-L-proline | transz-4-fenil-L-prolin | 416-020-1 | 96314-26-0 | Repr.
2 Skin Sens. 1 |
H361f
*** H317 |
GHS08 GHS07 Wng |
H361f
*** H317 |
CLP00 | |||
| 607-415-00-1 | poly-(methyl methacrylate)-co-(butylmethacrylate)-co-(4-acryloxybutyl-isopropenyl-α, α-dimethylbenzyl carbamate)-co-(maleicanhydride) | poli-(metil-metakrilát)-ko-(butil-metakrilát)-ko-(4-akriloxibutilizopropenil-α, α-dimetilbenzil-karbamát)-ko-(maleinsav-anhidrid) | 419-590-1 | Flam.
Sol. 1 Skin Sens. 1 |
H228 H317 |
GHS02 GHS07 Dgr |
H228 H317 |
T | CLP00 | |||
| 607-416-00-7 | 4-(2-carboxymethylthio)ethoxy-1-hydroxy-5-isobutyloxycarbonylamino-N-(3-dodecyloxypropyl)-2-naphthamide | 4-(2-karboximetiltio)etoxi-1-hidroxi-5-izobutiloxikarbonilamino-N-(3-dodeciloxipropil)-2-naftilamid | 420-730-7 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | ||||
| 607-417-00-2 | 3-chloropropyl chloroformiate | 3-klórpropil-klórformiát | 425-770-9 | 628-11-5 | Acute
Tox. 3 * Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H331 H302 H373 ** H315 H318 H317 |
GHS06 GHS05 GHS08 Dgr |
H331 H302 H373 ** H315 H318 H317 |
ATP01 | |||
| 607-418-00-8 | 2-ethylhexyl 4-aminobenzoate | 2-etilhexil-4-aminobenzoát | 420-170-3 | 26218-04-2 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 607-419-00-3 | (3'-carboxymethyl-5-(2-(3-ethyl-3H-benzothiazol-2-ylidene)-1-methyl-ethylidene)-4,4'-dioxo-2'-thioxo-(2,5')bithiazolidinyliden-3-yl)-acetic acid | (3’-karboximetil-5-(2-(3-etil-3H-benzotiazol-2-ilidén)-1-metiletilidén)-4,4’-dioxo-2’-tioxo-(2,5’)bitiazolidinilidén-3-il)ecetsav | 422-240-9 | 166596-68-5 | Eye
Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
CLP00 | |||
| 607-420-00-9 | 2,2-bis(hydroxymethyl)butanoic acid | 2,2-bisz(hidroximetil)vajsav | 424-090-1 | 10097-02-6 | Eye
Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
CLP00 | |||
| 607-421-00-4 | cypermethrin cis/trans +/- 40/60; (RS)-α-cyano-3-phenoxybenzyl (1RS,3RS;1RS,3SR)-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate | cipermetrin cisz/transz +/-40/60; (RS)-α-ciano-3-fenoxibenzil-(1RS,3RS;1RS,3SR)-3-(2,2-diklórvinil)-2,2-dimetilciklopropánkarboxilát | 257-842-9 | 52315-07-8 | Acute
Tox. 4 * Acute Tox. 4 * STOT SE 3 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H335 H400 H410 |
GHS07 GHS09 Wng |
H332 H302 H335 H410 |
CLP00 | |||
| 607-422-00-X | α-cypermethrin (ISO); racemate comprising (R)-α-cyano-3-phenoxybenzyl (1S,3S)-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate; (S)-α-cyano-3-phenoxybenzyl (1R,3R)-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate | α-cipermetrin (ISO); (R)-α-ciano-3-fenoxibenzil-(1S,3S)-3-(2,2-diklórvinil)-2,2-dimetilciklopropánkarboxilátot és (S)-α-ciano-3-fenoxibenzil-(1R,3R)-3-(2,2-diklórvinil)-2,2-dimetilciklopropánkarboxilátot tartalmazó racém elegy | 257-842-9 | 67375-30-8 | Acute
Tox. 3 * STOT SE 3 STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H335 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H301 H373 ** H335 H410 |
M=1000 |
CLP00/ATP01 | ||
| 607-423-00-5 | esters of mecoprop and of mecoprop-P | mekoprop és mekoprop-P észterei | Acute
Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
A | CLP00 | ||||
| 607-424-00-0 | trifloxystrobin (ISO); (E,E)-α-methoxyimino-{}{2-[[[[1-[3-(trifluoromethyl)phenyl]ethylidene]amino]oxy]methyl]benzeneacetic acid methyl ester | trifloxisztrobin (ISO); (E, E)-α-metoxiimino-{2-[[[[1-[3-(trifluormetil)fenil]etilidén]amino]oxi]metil]fenilecetsav-metilészter | 141517-21-7 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
CLP00 | ||||
| 607-425-00-6 | metalaxyl (ISO); methyl-N-(2,6-dimethylphenyl)-N-(methoxyacetyl)-DL-alaninate | metalaxil (ISO); metil-N-(2,6-dimetilfenil)-N-(metoxiacetil)-DL-alaninát | 260-979-7 | 57837-19-1 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Chronic 3 |
H302 H317 H412 |
GHS07 Wng |
H302 H317 H412 |
CLP00 | |||
| 607-426-00-1 | 1,2-benzenedicarboxylic
acid, dipentylester, branched and linear [1] n-pentyl-isopentylphthalate [2] di-n-pentyl phthalate [3] diisopentylphthalate [4] |
1,2-benzoldikarbonsav, dipentilészter, elágazó és egyenesláncú; [1] n-pentil-izopentil-ftalát; [2] di-n-pentil-ftalát; [3] diizopentil-ftalát [4] | 284-032-2
[1] 205-017-9 [3] 210-088-4 [4] |
84777-06-0
[1] 131-18-0 [3] 605-50-5 [4] |
Repr.
1B Aquatic Acute 1 |
H360FD H400 |
GHS08 GHS09 Dgr |
H360FD H400 |
CLP00 | |||
| 607-427-00-7 | bromoxynil heptanoate (ISO); 2,6-dibromo-4-cyanophenyl heptanoate | bromoxinil-heptanoát (ISO); 2,6-dibróm-4-cianofenil-heptanoát | 260-300-4 | 56634-95-8 | Repr.
2 Acute Tox. 4 * Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361d
*** H332 H302 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361d
*** H332 H302 H317 H410 |
CLP00 | |||
| 607-428-00-2 | tetrasodium ethylene diamine tetraacetate | tetranátrium-etilén-diamin-tetraacetát | 200-573-9 | 64-02-8 | Acute
Tox. 4 * Eye Dam. 1 |
H302 H318 |
GHS05 GHS07 Dgr |
H302 H318 |
ATP01 | |||
| 607-429-00-8 | edetic acid; (EDTA) | edetiksav; (EDTA) | 200-449-4 | 60-00-4 | Eye
Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
ATP01 | |||
| 607-430-00-3 | BBP; benzyl butyl phthalate | BBP, benzil-butil-ftalát | 201-622-7 | 85-68-7 | Repr.
1B Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H400 H410 |
GHS08 GHS09 Dgr |
H360Df H410 |
CLP00 | |||
| 607-431-00-9 | prallethrin (ISO); ETOC; 2-methyl-4-oxo-3-(prop-2-ynyl)cyclopent-2-en-1-yl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate | pralletrin (ISO); ETOC; 2-metil-4-oxo-3-(prop-2-inil)ciklopent-2-én-1-il-2,2-dimetil-3-(2-metilprop-1-enil)ciklopropánkarboxilát | 245-387-9 | 23031-36-9 | Acute
Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H302 H400 H410 |
GHS06 GHS09 Dgr |
H331 H302 H410 |
CLP00 | |||
| 607-432-00-4 | S-metolachlor;
reaction mass of
(S)-2-chloro-N-(2-ethyl-6-methyl-phenyl)-N-(2-methoxy-1-methyl-ethyl)-acetamide
(80-100 %) [1] (R)-2-chloro-N-(2-ethyl-6-methyl-phenyl)-N-(2-methoxy-1-methyl-ethyl)-acetamide (0-20 %) [2] |
S-metolaklór; a következő anyagok keveréke: (S)-2-klór-N-(2-etil-6-metilfenil)-N-(2-metoxi-1-metiletil)-acetamid (80–100 %); [1] (R)-2-klór-N-(2-etil-6-metilfenil)-N-(2-metoxi-1-metiletil)-acetamid (0–20 %) [2] | 87392-12-9
[1] 178961-20-1 [2] |
Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
CLP00 | ||||
| 607-433-00-X | cypermethrin cis/trans +/- 80/20; (RS)-α-cyano-3-phenoxybenzyl (1RS; 3RS; 1RS, 3SR)-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate | cipermetrin cisz/transz +/-80/20;(RS)-α-ciano-3-fenoxibenzil(1RS,3RS;1RS,3SR)-3-(2,2-diklórvinil)-2,2-dimetilciklopropánkarboxilát | 257-842-9 | 52315-07-8 | Acute
Tox. 4 * STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H335 H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H335 H315 H317 H410 |
CLP00 | |||
| 607-434-00-5 | mecoprop-P [1] and its salts; (R)-2-(4-chloro-2-methylphenoxy)propionic acid | mekoprop-P [1] és sói; (R)-2-(4-klór-2-metilfenoxi)propionsav | 240-539-0 | 16484-77-8 | Acute
Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
CLP00 | |||
| 607-435-00-0 | 2S-isopropyl-5R-methyl-1R-cyclohexyl 2,2-dihydroxyacetate | 2S-izopropil-5R-metil-1R-ciklohexil-2,2-dihidroxiacetát | 416-810-6 | 111969-64-3 | STOT
RE 2 * Eye Dam. 1 Aquatic Chronic 2 |
H373
** H318 H411 |
GHS08 GHS05 GHS09 Dgr |
H373
** H318 H411 |
CLP00 | |||
| 607-436-00-6 | 2-hydroxy-3-(2-ethyl-4-methylimidazoyl)propyl neodecanoate | 2-hidroxi-3-(2-etil-4-metilimidazoil)propil-neodekanoát | 417-350-9 | Skin
Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H400 H410 |
GHS05 GHS09 Dgr |
H315 H318 H410 |
CLP00 | ||||
| 607-437-00-1 | 3-(4-aminophenyl)-2-cyano-2-propenoic acid | 3-(4-aminofenil)-2-ciano-2-propénsav | 417-480-6 | 252977-62-1 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 607-438-00-7 | methyl-2-[(aminosulfonyl)methyl]benzoate | metil-2-[(aminoszulfonil)metil]benzoát | 419-010-5 | 112941-26-1 | Acute
Tox. 4 * Eye Irrit. 2 |
H302 H319 |
GHS07 Wng |
H302 H319 |
CLP00 | |||
| 607-439-00-2 | methyl tetrahydro-2-furancarboxylate | metil-tetrahidro-2-furán-karboxilát | 420-670-1 | 37443-42-8 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | |||
| 607-440-00-8 | methyl 2-aminosulfonyl-6-(trifluoromethyl)pyridine-3-c arboxylate | metil-2-aminoszulfonil-6-(trifluormetil)piridin-3-karboxilát | 421-220-7 | 144740-59-0 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | |||
| 607-441-00-3 | 3-[3-(2-dodecyloxy-5-methylphenylcarbamoyl)-4-hydroxy-1-naphthylthio]propionic acid | 3-[3-(2-dodeciloxi-5-metil-fenilkarbamoil)-4-hidroxi-1-naftiltio]propionsav | 421-490-6 | 167684-63-1 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 607-442-00-9 | benzyl [hydroxy-(4-phenylbutyl)phosphinyl] acetate | benzil[hidroxi-(4-fenilbutil)foszfinil]acetát | 416-050-5 | 87460-09-1 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | |||
| 607-444-00-X | reaction mass of: cis-1,4-dimethylcyclohexyl dibenzoate; trans-1,4-dimethylcyclohexyl dibenzoate | cisz-1,4-dimetilciklohexil-dibenzoát; transz-1,4-dimetilciklohexil-dibenzoát keveréke | 416-230-3 | 35541-81-2 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 607-445-00-5 | Iron (III) tris(4-methylbenzenesulfonate) | vas(III)-trisz(4-metilbenzolszulfonát) | 420-960-8 | 77214-82-5 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | |||
| 607-446-00-0 | methyl 2-[4-(2-chloro-4-nitrophenylazo)-3-(1-oxopropyl)amino]phenylaminopropionate | metil-2-[4-(2-klór-4-nitrofenilazo)-3-(1-oxopropil)amino]fenilaminopropionát | 416-240-8 | 155522-12-6 | Skin
Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
CLP00 | |||
| 607-447-00-6 | sodium 4-[4-(4-hydroxyphenylazo)phenylamino]-3-nitrobenzenesulfonate | nátrium-4-[4-(4-hidroxifenilazo)fenilamino]-3-nitrobenzolszulfonát | 416-370-5 | 156738-27-1 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
CLP00 | |||
| 607-448-00-1 | 2,3,5,6-tetrafluorobenzoic acid | 2,3,5,6-tetrafluorbenzoesav | 416-800-1 | 652-18-6 | Skin
Irrit. 2 Eye Dam. 1 |
H315 H318 |
GHS05 Dgr |
H315 H318 |
CLP00 | |||
| 607-449-00-7 | reaction mass of: 4,4',4''-[(2,4,6-trioxo-1,3,5(2H,4H,6H)-triazine-1,3,5-triyl)tris[methylene(3,5,5-trimethyl-3,1-cyclohexanediyl)iminocarbonyloxy-2,1-ethanediyl(ethyl)amino]]trisbenzenediazoniumtri[bis(2-methylpropyl)naphthalenesulfonate]; 4,4',4'',4'''-[[5,5'-[carbonylbis[imino(1,5,5-trimethyl-3,1-cyclohexanediyl)methylene]]-2,4,6-trioxo-1,3,5(2H,4H,6H)-triazine-1,1',3,3'-tetrayl]tetrakis[methylene(3,5,5-trimethyl-3,1-cyclohexanediyl)iminocarbonyloxy-2,1-ethanediyl(ethyl)amino]]tetrakisbenzenediazoniumtetra[bis(2-methylpropyl)naphthalenesulfonate] | a következő anyagok keveréke: 4,4’,4”-[(2,4,6-trioxo-1,3,5(2H,4H,6H)-triazin-1,3,5-triil)trisz[metilén(3,5,5-trimetil-3,1-ciklohexándiil)iminokarboniloxi-2,1-etándiil(etil)amino]]triszbenzoldiazóniumtri[bisz(2-metilpropil)-naftalinszulfonát]; 4,4’,4”,4”’-[[5,5’-[karbonilbisz[imino(1,5,5-trimetil-3,1-ciklohexándiil)metilén]]-2,4,6-trioxo-1,3,5(2H,4H,6H)-triazin-1,1’,3,3’-tetrail]tetrakisz[metilén(3,5,5-trimetil-3,1-ciklohexándiil)iminokarboniloxi-2,1-etándiil(etil)amino]]tetrakiszbenzoldiazónium-tetra[bisz(2-metilpropil)naftalinszulfonát] | 417-080-1 | Self-react.
D **** Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H242 H317 H400 H410 |
GHS02 GHS07 GHS09 Dgr |
H242 H317 H410 |
CLP00 | ||||
| 607-450-00-2 | 2-mercaptobenzothiazolyl-(Z)-(2-aminothiazol-4-yl)-2-(tert-butoxycarbonyl) isopropoxyiminoacetate | 2-merkaptobenzotiazolil-(Z)-(2-aminotiazol-4-il-2-(terc-butoxikarbonil)izopropoxiimino-acetát | 419-040-9 | 89604-92-2 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 607-451-00-8 | 4-[4-amino-5-hydroxy-3-(4-(2-sulfoxyethylsulfonyl)phenylazo)-2,7-disulfonapht-6-ylazo]-6-[3-(4-amino-5-hydroxy-3-(4-(2-sulfoxyethylsulfonyl)phenylazo)-2,7-disulfonapht-6-ylazo]phenylcarbonylamino]benzenesulfonic acid, sodium salt | 4-[4-amino-5-hidroxi-3-(4-(2-szulfoxietilszulfonil)fenilazo)-2,7-diszulfonaft-6-ilazo]-6-[3-(4-amino-5-hidroxi-3-(4-(2-szulfoxietilszulfonil)fenilazo)-2,7-diszulfonaft-6-ilazo]fenilkarbonilamino]benzolszulfonsav, nátriumsó | 417-640-5 | 161935-19-9 | Eye
Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
CLP00 | |||
| 607-453-00-9 | 4-benzyl-2,6-dihydroxy-4-aza-heptylene bis(2,2-dimethyloctanoate) | 4-benzil-2,6-dihidroxi-4-azaheptilénbisz(2,2-dimetiloktanoát) | 418-100-1 | 172964-15-7 | Skin
Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
CLP00 | |||
| 607-454-00-4 | reaction mass of: trans-2-(1-methylethyl)-1,3-dioxane-5-carboxylic acid; cis-2-(1-methylethyl)-1,3-dioxane-5-carboxylic acid | transz-2-(1-metiletil)-1,3-dioxán-5-karbonsav; cisz-2-(1-metiletil)-1,3-dioxán-5-karbonsav keveréke | 418-170-3 | 116193-72-7 | Eye
Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
CLP00 | |||
| 607-455-00-X | 1-amino-4-(3-[4-chloro-6-(2,5-di-sulfophenylamino)-1,3,5-triazin-2-ylamino]-2,2-dimethyl-propylamino)-anthraquinone-2-sulfonic acid, sodium/lithiumsalt | 1-amino-4-(3-[4-klór-6-(2,5-diszulfofenilamino)-1,3,5-triazin-2-ilamino]-2,2-dimetil-propilamino)antrakinon-2-szulfonsav, nátrium-/lítiumsó | 419-520-8 | 172890-93-6 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 607-456-00-5 | 3-amino-4-chlorobenzoic acid, hexadecyl ester | 3-amino-4-klórbenzoesav-hexadecil-észter | 419-700-6 | 143269-74-3 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 607-457-00-0 | tetrasodium dihydrogen 1,1''-dihydroxy-8,8''-[p-phenylbis(imino-{}{6-[4-(2-aminoethyl)piperazin-1-yl]}}-1,3,5-triazine-4,2-diyl-imino)]bis(2,2'-azonaphthalene-1',3,6-trisulfonate) | tetranátrium-dihidrogén-1,1”-dihidroxi-8,8”-[p-fenilbisz(imino-{6-[4-(2-aminoetil)piperazin-1-il]}-1,3,5-triazin-4,2-diil-imino)]bisz(2,2’-azonaftalin-1’,3,6-triszulfonát) | 420-350-1 | 172277-97-3 | Eye
Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
CLP00 | |||
| 607-458-00-6 | reaction mass of: 2-ethyl-[2,6-dibromo-4-[1-[3,5-dibromo-4-(2-hydroxyethoxy)phenyl]-1-methylethyl]phenoxy]propenoate; 2,2'-diethyl-[4,4'-bis(2,6-dibromophenoxy)-1-methylethylidene] dipropenoate; 2,2'-[(1-methylethylidene)bis[[2,6-dibromo-4,1-phenylene)oxy]ethanol]] | 2-etil-(2,6-dibróm-4-[1-[3,5-dibróm-4-(2-hidroxietoxi)fenil]-1-metiletil]fenoxi]-propenoát; 2,2’-dietil-[4,4’-bisz(2,6-dibrómofenoxi)-1-metiletilidén]-dipropenoát; 2,2’-[(1-metiletilidén)bisz[[2,6-dibróm-4,1-fenilén)oxi]etanol]] keveréke | 420-850-1 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | ||||
| 607-459-00-1 | isopentyl 4-{}{2-[5-cyano-1,2,3,6-tetrahydro-1-(2-isopropoxyethoxy-carbonylmethyl)-4-methyl-2,6-dioxo-3-pyridylidene]hydrazino}}benzoate | izopentil-4-{2-(5-ciano-1,2,3,6-tetrahidro-1-(2-izopropoxietoxikarbonilmetil)-4-metil-2,6-dioxo-3-piridilidén]hidrazino}benzoát | 418-930-4 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | |||||
| 607-460-00-7 | 3-tridecyloxy-propyl-ammonium 9-octadecenoate | 3-trideciloxi-propilammónium-9-oktadecenoát | 418-990-1 | 778577-53-0 | STOT
RE 2 * Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H373
** H315 H319 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H373
** H319 H315 H410 |
CLP00 | |||
| 607-461-00-2 | reaction mass of: pentasodium 2-{}{4-{}{3-methyl-4-[6-sulfonato-4-(2-sulfonato-phenylazo)-naphthalen-1-ylazo]-phenylamino}}-6-[3-(2-sulfato-ethanesulfonyl)-phenylamino]-1,3,5-triazin-2-ylamino}}-benzene-1,4-disulfonate; pentasodium 2-{}{4-{}{3-methyl-4-[7-sulfonato-4-(2-sulfonato-phenylazo)-naphthalen-1-ylazo]-phenylamino}}-6-[3-(2-sulfato-ethanesulfonyl)-phenylamino]-1,3,5-triazin-2-ylamino}}-benzene-1,4-disulfonate | a következő anyagok keveréke: pentanátrium-2-{4-{3-metil-4-[6-szulfonáto-4-(2-szulfonátofenilazo)naftalin-1-ilazo]fenilamino}-6-[3-(2-szulfátoetánszulfonil)fenilamino]-1,3,5-triazin-2-ilamino}benzol-1,4-diszulfonát; pentanátrium-2-{4-{3-metil-4-[7-szulfonáto-4-(2-szulfonátofenilazo)naftalin-1-ilazo]fenilamino}-6-[3-(2-szulfátoetánszulfonil)fenilamino]-1,3,5-triazin-2-ilamino}benzol-1,4-diszulfonát | 421-160-1 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | |||||
| 607-462-00-8 | reaction mass of: 1-hexyl acetate; 2-methyl-1-pentyl acetate; 3-methyl-1-pentyl acetate; 4-methyl-1-pentyl acetate; other mixed linear and branched C6-alkyl acetates | 1-hexil-acetát; 2-metil-1-pentilacetát; 3-metil-1-pentilacetát; 4-metil-1-pentilacetát; más kevert egyenesláncú és elágazó C6-alkil-acetátok keveréke | 421-230-1 | 88230-35-7 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 607-463-00-3 | 3-(phenothiazin-10-yl)propionic acid | 3-(fenotiazin-10-il)propionsav | 421-260-5 | 362-03-8 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 607-464-00-9 | reaction mass of: 7-chloro-1-ethyl-6-fluoro-1,4-dihydro-4-oxo-quinoline-3-carboxylic acid; 5-chloro-1-ethyl-6-fluoro-1,4-dihydro-4-oxo-quinoline-3-carboxylic acid | 7-klór-1-etil-6-fluor-1,4-dihidro-4-oxokinolin-3-karbonsav; 5-klór-1-etil-6-fluor-1,4-dihidro-4-oxokinolin-3-karbonsav keveréke | 421-280-4 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | |||||
| 607-465-00-4 | tris(2-hydroxyethyl)ammonium 7-{}{4-[4-(2-cyanoamino-4-hydroxy-6-oxidopyrimidin-5-ylazo)benzamido]-2-ethoxy-phenylazo}}naphthalene-1,3-disulfonate | trisz(2-hidroxietil)ammónium-7-{4-[4-(2-cianoamino-4-hidroxi-6-oxidopirimidin-5-ilazo)benzamido]-2-etoxifenilazo}naftalin-1,3-diszulfonát | 421-440-3 | 778583-04-3 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | ||||
| 607-466-00-X | reaction mass of: phenyl 1-(1-[2-chloro-5-(hexadecyloxycarbonyl)phenylcarbamoyl]-3,3-dimethyl-2-oxobutyl)-1H-2,3,3a,7a-tetrahydrobenzotriazole-5-carboxylate; phenyl 2-(1-(2-chloro-5-(hexadecyloxycarbonyl)phenylcarbamoyl)-3,3-dimethyl-2-oxobutyl)-1H-2,3,3a,7a-tetrahydrobenzotriazole-5-carboxylate; phenyl 3-(1-(2-chloro-5-(hexadecyloxycarbonyl)phenylcarbamoyl)-3,3-dimethyl-2-oxobutyl)-1H-2,3,3a,7a-tetrahydrobenzotriazole-5-carboxylate | a következő anyagok keveréke: fenil-1-(1-[2-klór-5-(hexadeciloxikarbonil)fenilkarbamoil]-3,3-dimetil-2-oxobutil)-1H-2,3,3a,7a-tetrahidrobenzotriazol-5-karboxilát; fenil-2-(1-(2-klór-5-(hexadeciloxikarbonil)fenilkarbamoil)-3,3-dimetil-2-oxobutil)-1H-2,3,3a,7a-tetrahidrobenzotriazol-5-karboxilát; fenil-3-(1-(2-klór-5-(hexadeciloxikarbonil)fenilkarbamoil)-3,3-dimetil-2-oxobutil)-1H-2,3,3a,7a-tetrahidrobenzotriazol-5-karboxilát | 421-480-1 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | ||||
| 607-467-00-5 | 1,1,3,3-tetrabutyl-1,3-ditinoxydicaprylate | 1,1,3,3-tetrabutil-1,3-diónoxidikaprilát | 419-430-9 | 56533-00-7 | Acute
Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H373 ** H314 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H312 H302 H373 ** H314 H410 |
CLP00 | |||
| 607-468-00-0 | reaction mass of: monosodium 4-((4-(5-sulfonato-2-methoxyphenylamino)-6-chloro-1,3,5-triazine-2-yl)amino)-2-((1,4-dimethyl-6-oxido-2-oxo-5-sulfonatomethyl-1,2-dihydropyridine-3-yl)azo)benzenesulfonate; disodium 4-((4-(5-sulfonato-2-methoxyphenylamino)-6-chloro-1,3,5-triazine-2-yl)amino)-2-((1,4-dimethyl-6-oxido-2-oxo-5-sulfonatomethyl-1,2-dihydropyridine-3-yl)azo)benzenesulfonate; trisodium 4-((4-(5-sulfonato-2-methoxyphenylamino)-6-chloro-1,3,5-triazine-2-yl)amino)-2-((1,4-dimethyl-6-oxido-2-oxo-5-sulfonatomethyl-1,2-dihydropyridine-3-yl)azo)benzenesulfonate; tetrasodium 4-((4-(5-sulfonato-2-methoxyphenylamino)-6-chloro-1,3,5-triazine-2-yl)amino)-2-((1,4-dimethyl-6-oxido-2-oxo-5-sulfonatomethyl-1,2-dihydropyridine-3-yl)azo)benzenesulfonate | a következő anyagok keveréke: mononátrium-4-((4-(5-szulfonáto-2-metoxifenilamino)-6-klór-1,3,5-triazin-2-il)amino)-2-((1,4-dimetil-6-oxido-2-oxo-5-szulfonátometil-1,2-dihidropiridin-3-il)azo)benzolszulfonát; dinátrium-4-((4-(5-szulfonáto-2-metoxifenilamino)-6-klór-1,3,5-triazin-2-il)amino)-2-((1,4-dimetil-6-oxido-2-oxo-5-szulfonátometil-1,2-dihidropiridin-3-il)azo)benzolszulfonát; trinátrium-4-((4-(5-szulfonáto-2-metoxifenilamino)-6-klór-1,3,5-triazin-2-il)amino)-2-((1,4-dimetil-6-oxido-2-oxo-5-szulfonátometil-1,2-dihidropiridin-3-il)azo)benzolszulfonát; tetranátrium-4-((4-(5-szulfonáto-2-metoxifenilamino)-6-klór-1,3,5-triazin-2-il)amino)-2-((1,4-dimetil-6-oxido-2-oxo-5-szulfonátometil-1,2-dihidropiridin-3-il)azo)benzolszulfonát | 419-450-8 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | ||||
| 607-469-00-6 | disodium 7-((4,6-bis(3-diethylaminopropylamino)-1,3,5-triazine-2-yl)amino)-4-hydroxy-3-(4-(4-sulfonatophenylazo)phenylazo)-2-naphthalene sulfonate | dinátrium-7-((4,6-bisz(3-dietilaminopropilamino)-1,3,5-triazin-2-il)amino)4-hidroxi-3-(4-(4-szulfonátofenilazo)fenilazo)-2-naftalinszulfonát | 419-460-2 | 120029-06-3 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | ||||
| 607-470-00-1 | potassium sodium 6,13-dichloro-3,10-bis{}{2-[4-[3-(2-hydroxysulphonyloxyethanesulfonyl)phenylamino]-6-(2,5-disulfonatophenylamino)-1,3,5-triazin-2-ylamino]ethylamino}}benzo[5,6][1,4]oxazino[2,3-b]phenoxazine-4,11-disulfonate | kálium-nátrium-6,13-diklór-3,10-bisz{4-[3-[2-(2-hidroxiszulfoniloxietánszulfonil)fenilamino]-6-(2,5-diszulfonátofenilamino)-1,3,5-triazin-2-ilamino]etilamino}benzo[5,6][1,4]oxazino[2,3-b]fenoxazin-4,11-diszulfonát | 414-100-0 | 154336-20-6 | Eye
Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
CLP00 | |||
| 607-471-00-7 | 1,6-bis((dibenzylthiocarbamoyl)disulfanyl)hexane | 1,6-bisz((dibenziltiokarbamoil)diszulfanil)hexán | 429-280-6 | 151900-44-6 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 607-473-00-8 | pentaerythritol, dipentaerythritol, fatty acids, C6-10, mixed esters with adipic acid, heptanoic acid and isostearic acid | pentaeritritol, dipentaeritritol, zsírsavak, C6-10, vegyes észterek adipinsavval, heptánsavval és izosztearinsavval | 426-590-3 | 187412-41-5 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
ATP01 | |||
| 607-474-00-3 | (4-(4-(4-dimethylaminobenzyliden-1-yl)-3-methyl-5-oxo-2-pyrazolin-1-yl)benzoic acid | (4-(4-(4-dimetilaminobenzilidén-1-il)-3-metil-5-oxo-2-pirazolin-1-il)benzoesav | 410-430-4 | 117573-89-4 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 607-475-00-9 | reaction mass of: tetrasodium 7-(4-[4-chloro-6-[methyl-(3-sulfonatophenyl)amino]-1,3,5-triazin-2-ylamino]-2-ureidophenylazo)naphthalene-1,3,6-trisulfonate; tetrasodium 7-(4-[4-chloro-6-[methyl-(4-sulfonatophenyl)amino]-1,3,5-triazin-2-ylamino]-2-ureidophenylazo)naphthalene-1,3,6-trisulfonate (1:1) | tetranátrium-7-(4-[4-klór-6-[metil-(3-szulfonátofenil)amino]-1,3,5-triazin-2-ilamino]-2-ureidofenilazo)naftalin-1,3,6-triszulfonát; tetranátrium-7-(4-[4-klór-6-[metil-(4-szulfonátofenil)amino]-1,3,5-triazin-2-ilamino]-2-ureidofenilazo)naftalin-1,3,6-triszulfonát (1:1) keveréke | 412-940-2 | 148878-18-6 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 607-476-00-4 | trisodium N,N-bis(carboxymethyl)-β-alanine | trinátrium-N, N-bisz(karboximetil)-β-alanin | 414-070-9 | 129050-62-0 | Skin
Corr. 1B Aquatic Chronic 3 |
H314 H412 |
GHS05 Dgr |
H314 H412 |
CLP00 | |||
| 607-477-00-X | (1α5α6α)-6-nitro-3-benzyl-3-azabicyclo[3.1.0]hexane methanesulfonate salt | (1α5α6α)-6-nitro-3-benzil-3-azabiciklo[3.1.0]hexán metánszulfonát só | 426-740-8 | - | Acute
Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
ATP01 | |||
| 607-478-00-5 | tetramethylammonium hydrogen phthalate | tetrametilammónium-hidrogén-ftalát | 416-900-5 | 79723-02-7 | Acute
Tox. 3 * STOT RE 2 * Aquatic Acute 1 |
H301 H373 ** H400 |
GHS06 GHS08 GHS09 Dgr |
H301 H373 ** H400 |
CLP00 | |||
| 607-479-00-0 | hexadecyl 4-chloro-3-[2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-4,4-dimethyl-3-oxopentamido]benzoate | hexadecil-4-klór-3-[2-(5,5-dimetil-2,4-dioxo-1,3-oxazolidin-3-il)-4,4-dimetil-3-oxopentamido]benzoát | 418-550-9 | 168689-49-4 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 607-480-00-6 | 1,2-benzenedicarboxylic acid; di-C7-11-branched and linear alkylesters | 1,2-benzoldikarbonsav; di-C7-11 elágazó és egyenesláncú alkil-észterei | 271-084-6 | 68515-42-4 | Repr.
1B |
H360Df |
GHS08 Dgr |
H360Df |
CLP00 | |||
| 607-481-00-1 | reaction mass of: trihexyl citrate; dihexyloctyl citrate; dioctylhexyl citrate; dihexyldecyl citrate | trihexil-citrát; dihexiloktil-citrát; dioktilhexil-citrát; dihexildecil-citrát keveréke | 430-290-8 | - | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 607-482-00-7 | N-[1-(S)-ethoxycarbonyl-3-phenylpropyl]-.sc.l.sc.-alanyl-N-carboxyanhydride | N-[1-(S)-etoxikarbonil-3-fenilpropil]-L-alanil-N-karbonsav-anhidrid | 430-360-8 | 84793-24-8 | Eye
Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
ATP01 | |||
| 607-483-00-2 | 1,2-benzenedicarboxylic acid; di-C6-8-branched alkylesters, C7-rich | 1,2-benzoldikarbonsav; di-C6-8 elágazó és egyenesláncú alkil-észterei, C7-ben gazdag | 276-158-1 | 71888-89-6 | Repr.
1B |
H360D
*** |
GHS08 Dgr |
H360D
*** |
ATP01 | |||
| 607-484-00-8 | ethyl 2-{[3-acetylamino-4-(6-bromo-2-methyl-1,3-dioxo-2,3-dihydro-1H-isoindol-5-ylazo)phenyl]ethylamino}propionate | etil-2-{[3-acetilamino-4-(6-bróm-2-metil-1,3-dioxo-2,3-dihidro-1H-izoindol-5-ilazo)fenil]etilamino}propionát | 430-480-0 | 221452-67-1 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 607-485-00-3 | (3S-trans)-phenyl-3-[(1,3-benzodioxol-5-yloxy)methyl]-4-(4-fluorophenyl)-1-piperidinecarboxylate | (3S-transz)-fenil-3-[(1,3-benzodioxol-5-iloxi)metil]-4-(4-fluorfenil)-1-piperidinkarboxilát | 430-510-2 | - | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 607-486-00-9 | potassium sodium 5'-(6-chloro-4-(2-(2-vinylsulfonylethoxy)ethylamino)-1,3,5-triazin-2-ylamino)-4'-hydroxy-2,3'-azodinaphthalene-1,2',5,7'-disulfonate | kálium-nátrium-5'-(6-klór-4-(2-(2-vinilszulfoniletoxi)etilamino)-1,3,5-triazin-2-il-amino)-4'-hidroxi-2,3'-azodinaftalin-1,2',5,7'-diszulfonát | 402-110-8 | 110081-40-8 | Aquatic
Chronic 3 |
H412 |
- |
H412 |
ATP01 | |||
| 607-487-00-4 | reaction mass of: disodium 4-(3-ethoxycarbonyl-4-(5-(3-ethoxycarbonyl-5-hydroxy-1-(4-sulfonatophenyl)pyrazol-4-yl)penta-2,4-dienylidene)-4,5-dihydro-5-oxopyrazol-1-yl)benzenesulfonate; trisodium 4-(3-ethoxycarbonyl-4-(5-(3-ethoxycarbonyl-5-oxido-1-(4-sulfonatophenyl)pyrazol-4-yl)penta-2,4-dienylidene)-4,5-dihydro-5-oxopyrazol-1-yl)benzenesulfonate | dinátrium-4-(3-etoxikarbonil-4-(5-(3-etoxikarbonil-5-hidroxi-1-(4-szulfonátofenil)pirazol-4-il)penta-2,4-dienilidén)-4,5-dihidro-5-oxopirazol-1-il)benzolszulfonát; trinátrium-4-(3-etoxikarbonil-4-(5-(3-etoxikarbonil-5-oxido-1-(4-szulfonátofenil)pirazol-4-il)penta-2,4-dienilidén)-4,5-dihidro-5-oxopirazol-1-il)benzolszulfonát keveréke | 402-660-9 | Repr.
1B Aquatic Chronic 3 |
H360D
*** H412 |
GHS08 Dgr |
H360D
*** H412 |
CLP00 | ||||
| 607-488-00-X | ethyl (2-acetylamino-5-fluoro-4-isothiocyanatophenoxy)acetate | etil-(2-acetilamino-5-fluor-4-izotiocianátofenoxi)acetát | 414-210-9 | 147379-38-2 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 607-489-00-5 | reaction mass of: 2-ethylhexyl linolenate, linoleate and oleate; 2-ethylhexyl epoxyoleate; 2-ethylhexyl diepoxylinoleate; 2-ethylhexyl triepoxylinolenate | 2-etilhexil-linolenát, -linoleát és -oleát; 2-etilhexil-epoxioleát; 2-etilhexil-diepoxilinoleát; 2-etilhexil-triepoxilinolenát keveréke | 414-890-7 | 71302-79-9 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 607-490-00-0 | N-[2-hydroxy-3-(C12-16-alkyloxy)propyl]-N-methyl glycinate | N-[2-hidroxi-3-(C12-16-alkiloxi)propil]-N-metilglicinát | 415-060-7 | Eye
Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
CLP00 | ||||
| 607-491-00-6 | reaction mass of: diester of 4,4'-methylenebis[2-(2-hydroxy-5-methylbenzyl)-3,6-dimethylphenol] and 6-diazo-5,6-dihydro-5-oxonaphthalene-1-sulfonic acid (1:2); triester of 4,4'-methylenebis[2-(2-hydroxy-5-methylbenzyl)-3,6-dimethylphenol] and 6-diazo-5,6-dihydro-5-oxonaphthalene-1-sulfonic acid (1:3) | 4,4'-metilénbisz[2-(2-hidroxi-5-metilbenzil)-3,6-dimetilfenol] és 6-diazo-5,6-dihidro-5-oxonaftalin-1-szulfonsav (1:2) diészter; 4,4'-metilénbisz[2-(2-hidroxi-5-metilbenzil)-3,6-dimetilfenol] és 6-diazo-5,6-dihidro-5-oxonaftalin-1-szulfonsav (1:3) triészter keveréke | 427-140-9 | - | Carc.
2 |
H351 |
GHS08 Wng |
H351 |
ATP01 | |||
| 607-492-00-1 | 2-(1-(3',3'-dimethyl-1'-cyclohexyl)ethoxy)-2-methyl propyl propanoate | 2-(1-(3’,3’-dimetil-1’-ciklohexil)etoxi)-2-metilpropil-propanoát | 415-490-5 | 141773-73-1 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 607-493-00-7 | methyl (3aR,4R,7aR)-2-methyl-4-(1S,2R,3-triacetoxypropyl)-3a,7a-dihydro-4H-pyrano[3,4-d]oxazole-6-carboxylate | metil-(3aR,4R,7aR)-2-metil-4-(1S,2R,3-triacetoxipropil)-3a,7a-dihidro-4H-pirano[3,4-d]oxazol-6-karboxilát | 415-670-3 | 78850-37-0 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | |||
| 607-494-00-2 | bis(2-ethylhexyl)octylphosphonate | bisz(2-etilhexil)oktil-foszfonát | 417-170-0 | 52894-02-7 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 607-495-00-8 | sodium 4-sulfophenyl-6-((1-oxononyl)amino)hexanoate | nátrium-4-szulfofenil-6-((1-oxononil)amino)hexanoát | 417-550-6 | 168151-92-6 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 607-496-00-3 | 2,2'-methylenebis(4,6-di-tert-butyl-phenyl)-2-ethylhexyl phosphite | 2,2’-metilénbisz(4,6-di-terc-butilfenil)-2-etilhexil-foszfit | 418-310-3 | 126050-54-2 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 607-497-00-9 | cerium oxide isostearate | cérium-oxid-izosztearát | 419-760-3 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | |||||
| 607-498-00-4 | (E)-3,7-dimethyl-2,6-octadienylhexadecanoate | (E)-3,7-dimetil-2,6-oktadienil-hexadekanoát | 421-370-3 | 3681-73-0 | Skin
Irrit. 2 Aquatic Chronic 4 |
H315 H413 |
GHS07 Wng |
H315 H413 |
CLP00 | |||
| 607-499-00-X | bis(dimethyl-(2-hydroxyethyl)ammonium) 1,2-ethanediyl-bis(2-hexadecenylsuccinate) | bisz(dimetil-(2-hidroxietil)ammónium)-1,2-etándiil-bisz(2-hexadecenil-szukcinát) | 421-660-1 | Eye
Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H411 |
CLP00 | ||||
| 607-500-00-3 | calcium 2,2,bis[(5-tetrapropylene-2-hydroxy)phenyl]ethanoate | kálcium-2,2,bisz[(5-tetrapropilén-2-hidroxi)fenil]etanoát | 421-670-4 | Skin
Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
CLP00 | ||||
| 607-501-00-9 | reaction mass of: triphenylthiophosphate and tertiary butylated phenyl derivatives | trifenil-tiofoszfát és tercier butilezett fenilszármazékok keveréke | 421-820-9 | 192268-65-8 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 607-502-00-4 | (N-benzyl-N,N,N-tributyl)ammonium 4-dodecylbenzenesulfonate | (N-benzil-N, N,N-tributil)ammónium-4-dodecilbenzolszulfonát | 422-200-0 | 178277-55-9 | Acute
Tox. 4 * Skin Corr. 1B Aquatic Chronic 2 |
H302 H314 H411 |
GHS05 GHS07 GHS09 Dgr |
H314 H302 H411 |
CLP00 | |||
| 607-503-00-X | 2,4,6-tri-n-propyl-2,4,6-trioxo-1,3,5,2,4,6-trioxatriphosphorinane | 2,4,6-tri-n-propil-2,4,6-trioxo-1,3,5,2,4,6-trioxatrifoszforinán | 422-210-5 | 68957-94-8 | Skin
Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
CLP00 | |||
| 607-504-00-5 | diammonium 1-hydroxy-2-(4-(4-carboxyphenylazo)-2,5-dimethoxyphenylazo)-7-amino-3-naphthalenesulfonate | diammónium-1-hidroxi-2-(4-(4-karboxifenilazo)-2,5-dimetoxifenilazo)-7-amino-3-naftalinszulfonát | 422-670-7 | Repr.
2 Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H361f H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H301 H361f H373 ** H410 |
ATP01/ATP01corr | ||||
| 607-505-00-0 | pentasodium 7-(4-(4-(5-amino-4-sulfonato-2-(4-((2-(sulfonato-ethoxy)sulfonyl)phenylazo)phenylamino)-6-chloro-1,3,5-triazin-2-yl)amino-2-ureidophenylazo)naphtalene-1,3,6-trisulfonate | pentanátrium-7-(4-(4-(5-amino-4-szulfonáto-2-(4-((2-(szulfonátoetoxi)szulfonil)fenilazo)fenilamino)-6-klór-1,3,5-triazin-2-il)amino-2-ureidofenilazo)naftalin-1,3,6-triszulfonát | 422-930-1 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | |||||
| 607-506-00-6 | reaction mass of: strontium (4-chloro-2-((4,5-dihydro-3-methyl-5-oxo-1-(3-sulfonatophenyl)-1H-pyrazol-4-yl)azo)-5-methyl)benzenesulfonate; disodium (4-chloro-2-((4,5-dihydro-3-methyl-5-oxo-1-(3-sulfonatophenyl)-1H-pyrazol-4-yl)azo)-5-methyl)benzenesulfonate | stroncium-(4-klór-2-((4,5-dihidro-3-metil-5-oxo-1-(3-szulfonátofenil)-1H-pirazol-4-il)azo)-5-metil)benzolszulfonát; dinátrium-(4-klór-2-((4,5-dihidro-3-metil-5-oxo-1-(3-szulfonátofenil)-1H-pirazol-4-il)azo)-5-metil)benzolszulfonát keveréke | 422-970-8 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | ||||
| 607-507-00-1 | potassium,sodium 2,4-diamino-3-[4-(2-sulfonatoethoxysulfonyl)phenylazo]-5-[4-(2-sulfonatoethoxysulfonyl)-2-sulfonatophenylazo]-benzenesulfonate | kálium, nátrium-2,4-diamino-3-[4-(2-szulfonátoetoxiszulfonil)fenilazo]-5-[4-(2-szulfonátoetoxiszulfonil)-2-szulfonátofenilazo]benzolszulfonát | 422-980-2 | 187026-95-5 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | |||
| 607-508-00-7 | disodium 3,3'-[iminobis[sulfonyl-4,1-phenylene-(5-hydroxy-3-methylpyrazole-1,4-diyl)azo-4,1-phenylenesulfonylimino-(4-amino-6-hydroxypyrimidine-2,5-diyl)azo-4,1-phenylenesulfonylimino(4-amino-6-hydroxypyrimidine-2,5-diyl)azo]bis(benzenesulfonate)] | dinátrium-3,3’-(iminobisz[szulfonil-4,1-fenilén-(5-hidroxi-3-metilpirazol-1,4-diil)azo-4,1-fenilénszulfonilimino-(4-amino-6-hidroxipirimidin-2,5-diil)azo-4,1-fenilénszulfonilimino(4-amino-6-hidroxipirimidin-2,5-diil)azo]bisz(benzolszulfonát)] | 423-110-4 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | ||||
| 607-509-00-2 | 2-phenoxyethyl 4-aminobenzoate | 2-fenoxietil-4-aminobenzoát | 430-880-5 | 88938-23-2 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
ATP01 | |||
| 607-510-00-8 | (2S,5R)-6,6-dibromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid 4,4-dioxide | (2S,5R)-6,6-dibróm-3,3-dimetil-7-oxo-4-tia-1-azabiciklo[3.2.0]heptán-2-karbonsav-4,4-dioxid | 427-200-4 | 76646-91-8 | Acute
Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H302 H315 H318 H317 |
GHS05 GHS07 Dgr |
H302 H315 H318 H317 |
ATP01 | |||
| 607-511-00-3 | reaction mass of: 4-[(3-decyloxypropyl)(3-isobutoxy-1-isobutoxycarbonyl-3-oxopropyl)amino]-4-oxobutyric acid; 4-[(3-isobutoxy-1-isobutoxycarbonyl-3-oxopropyl)(3-octyloxypropyl)amino]-4-oxobutyric acid | 4-[(3-deciloxipropil)(3-izobutoxi-1-izobutoxikarbonil-3-oxopropil)amino]-4-oxobutánsav; 4-[(3-izobutoxi-1-izobutoxikarbonil-3-oxopropil)(3-oktiloxipropil)amino]-4-oxobutánsav keveréke | 423-750-4 | - | Eye
Irrit. 2 Aquatic Chronic 2 |
H319 H411 |
GHS07 GHS09 Wng |
H319 H411 |
ATP01 | |||
| 607-512-00-9 | trisodium 2,4-diamino-3,5-bis-[4-(2-sulfonatoethoxy)sulfonyl)phenylazo]benzenesulfonate | trinátrium-2,4-diamino-3,5-bisz[4-(2-szulfonátoetoxi)szulfonil)fenilazo]benzolszulfonát | 423-970-0 | 182926-43-8 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | ||||
| 607-513-00-4 | reaction mass of: Trisodium 4-benzoylamino-6-(6-ethenesulfonyl-1-sulfato-naphthalen-2-ylazo)-5-hydroxynaphthalene-2,7-disulfonate; 5-(benzoylamino)-4-hydroxy-3-((1-sulfo-6-((2-(sulfooxy)ethyl)sulfonyl)-2-naphthyl)azo)naphthalene-2,7-disulfonic acid sodium salt; 5-(benzoylamino)-4-hydroxy-3-((1-sulfo-6-((2-(sulfooxy)ethyl)sulfonyl)-2-naphthyl)azo)naphthalene-2,7-disulfonic acid | trinátrium-4-benzoilamino-6-(6-eténszulfonil-1-szulfátonaftalin-2-ilazo)-5-hidroxinaftalin-2,7-diszulfonát; 5-(benzoilamino)-4-hidroxi-3-((1-szulfo-6-((2-(szulfooxi)etil)szulfonil)-2-naftil)azo)naftalin-2,7-diszulfonsav-nátriumsó; 5-(benzoilamino)-4-hidroxi-3-((1-szulfo-6-((2-(szulfooxi)etil)szulfonil)-2-naftil)azo)naftalin-2,7-diszulfonsav keveréke | 423-200-3 | Eye
Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
CLP00 | ||||
| 607-514-00-X | potassium N-(1-methoxy-1-oxobut-2-en-3-yl)valinate | kálium-N-(1-metoxi-1-oxobut-2-én-3-il)valinát | 427-240-2 | 134841-35-3 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
ATP01 | |||
| 607-515-00-5 | reaction mass of: disodium hexyldiphenyl ether disulphonate; disodium dihexyldiphenyl ether disulphonate | dinátrium-hexildifenil-éter-diszulfonát; dinátrium-dihexildifenil-éter-diszulfonát keveréke | 429-650-7 | 147732-60-3 | Eye
Irrit. 2 Aquatic Chronic 2 |
H319 H411 |
GHS07 GHS09 Wng |
H319 H411 |
CLP00 | |||
| 607-516-00-0 | N,N'-bis(trifluoroacetyl)-S,S'-bis L-homocysteine | N, N’-bisz(trifluoracetil)-S, S’-bisz-L-homocisztein | 429-670-6 | 105996-54-1 | Eye
Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
CLP00 | |||
| 607-517-00-6 | (S)-α-(acetylthio)benzenepropanoic acid | (S)-α-(acetiltio)benzolpropánsav | 430-300-0 | 76932-17-7 | Acute
Tox. 4 * Eye Dam. 1 Skin Sens. 1 |
H302 H318 H317 |
GHS05 GHS07 Dgr |
H302 H318 H317 |
CLP00 | |||
| 607-518-00-1 | 3-oxoandrost-4-ene-17-ß-carboxylic acid | 3-oxoandroszt-4-én-17-β-karbonsav | 414-990-0 | 302-97-6 | Repr.
2 Aquatic Chronic 4 |
H361f H413 |
GHS08 Wng |
H361f H413 |
ATP01/ATP01corr | |||
| 607-519-00-7 | poly-[((4-((4-ethyl-ethylene)amino)phenyl)-((4-(ethyl-(2-oxyethylene)amino)phenyl)methinyl)cyclohexa-2,5-dienylidene)-N-ethyl-N-(2-hydroxyethyl)ammonium acetate] | poli-[((4-((4-etiletilén)amino)fenil)-((4-(etil-(2-oxietilén)amino)fenil)metinil)ciklohexa-2,5-dienilidén)-N-etil-N-(2-hidroxietil)ammónium-acetát] | 427-280-0 | 176429-27-9 | STOT
SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H335 H315 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H335 H315 H318 H410 |
ATP01 | |||
| 607-520-00-2 | reaction mass of: sodium 4,5-dihydro-2-[(propionato)(C6-18)alkyl]-3H-imidazolium-N-ethylphosphate; disodium 4,5-dihydro-2-[(dipropionato)(C6-18)alkyl]-3H-imidazolium-N-ethylphosphate | nátrium-4,5-dihidro-2-[(propionáto)(C6-18)alkil]-3H-imidazolium-N-etil-foszfát; dinátrium-4,5-dihidro-2-[(dipropionáto)(C6-18)alkil]-3H-imidazolium-N-etil-foszfát keveréke | 427-740-0 | - | Eye
Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
ATP01 | |||
| 607-521-00-8 | tetraethyl N,N'-(methylenedicyclohexane-4,1-diyl)bis-.sc.dl.sc.-aspartate | tetraetil-N, N'-(metiléndiciklohexán-4,1-diil)bisz-DL-aszpartát | 429-270-1 | 136210-30-5 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
ATP01 | |||
| 607-522-00-3 | sodium salt of the polymer of: sodium 2-methyl-buta-1,3-diene-1-sulfonate with acrylic acid and 2-hydroxyethyl-2-methylacrylate | nátrium-2-metil-buta-1,3-dién-1-szulfonát akrilsavval és 2-hidroxi-etil-2-metilakriláttal alkotott polimerének nátriumsója | 429-720-7 | 184246-86-4 | Aquatic
Chronic 3 |
H412 |
- |
H412 |
ATP01 | |||
| 607-523-00-9 | reaction mass of mono to tetra(lithium and/or sodium)3-amino-10-[4-(4-amino-3-sulfonatoanilino)-6-[methyl-(2-sulfonatoethyl)amino]-1,3,5-triazin-2-ylamino]-6-13-dichlorobenzo[1,2-B:4,5-B']di[1,4]benzoxazine-4,11-disulfonate; mono to tetra(lithium and/or sodium)3-amino-10-[4,6-bis(4-amino-3-sulfonatoanilino)-1,3,5-triazin-2-ylamino]-6-13-dichlorobenzo[1,2-B:4,5-B']di[1,4]benzoxazine-4,11-disulfonate; mono to penta(lithium and/or sodium)10,10´-diamino-6,6',13,13´-tetrachloro-3,3'-[6-[methyl-(2-sulfonatoethyl)amino]-1,3,5-triazin-2,4-diyldiimino]bis[benzo[1,2-B:4,5-B']di[1,4]benzoxazine-4,11-disulfonate; mono to hepta(lithium and/or sodium)10-amino-6,6',13,13'-tetrachloro-10´[4-(4-amino-3-sulfonatoanilino)-[6-methyl-(2-sulfonatoethyl)amino]-1,3,5-triazin-2,4-diimino]bis[benzo[1,2-B:4,5-B']di[1,4]benzoxazine-4,11-disulfonate; mono to hepta(lithium and/or sodium)10,10'-diamino-6,6',3,3'[(2-sulfonato)-1,4-phenylenediiminobis[6-methyl-(2-sulfonatoethyl)amino]-1,3,5-triazin-2,4-diyldiimino]bis[benzo[1,2-B:4,5-B']di[1,4]benzoxazine-4,11-disulfonate | a következő anyagok keveréke: mono, di, tri és tetra(lítium és/vagy nátrium)3-amino-10-[4-(4-amino-3-szulfonátoanilino)-6-[metil-(2-szulfonátoetil)amino]-1,3,5-triazin-2-il-amino]-6-13-diklórbenzo[1,2-B:4,5-B']di[1,4]benzoxazin-4,11-diszulfonát; mono, di, tri és tetra(lítium és/vagy nátrium)3-amino-10-[4,6-bisz(4-amino-3-szulfonátoanilino)-1,3,5-triazin-2-il-amino]-6-13-diklórbenzo[1,2-B:4,5-B']di[1,4]benzoxazin-4,11-diszulfonát; mono, di, tri, tetra és penta(lítium és/vagy nátrium)10,10'-diamino-6,6',13,13'-tetraklór-3,3'-[6-[metil-(2-szulfonátoetil)amino]-1,3,5-triazin-2,4-diildiimino]bisz[benzo[1,2-B:4,5-B']di[1,4]benzoxazin-4,11-diszulfonát; mono, di, tri, tetra, penta, hexa és hepta(lítium és/vagy nátrium)10-amino-6,6', 13,13'-tetraklór-10'[4-(4-amino-3-szulfonátoanilino)-[6-metil-(2-szulfonátoetil)amino]-1,3,5-triazin-2,4-diimino]bisz[benzo[1,2-B:4,5-B']di[1,4]benzoxazin-4,11-diszulfonát; mono, di, tri, tetra, penta, hexa és hepta(lítium és/vagy nátrium)10,10'-6,6',3,3'[(2-szulfonáto)-1,4-feniléndiiminobisz[6-metil-(2-szulfonátoetil)amino]-1,3,5-triazin-2,4-diildiimino]bisz[benzo[1,2-B:4,5-B']di[1,4]benzoxazin-4,11-diszulfonát | 430-200-7 | - | Eye
Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
ATP01 | |||
| 607-524-00-4 | tall oil 2-[(tetrahydro-2H-pyran-2-yl) thio]ethyl esters | tallolaj 2-[(tetrahidro-2H-pirán-2-il)tio]etil-észterek | 430-310-5 | - | Aquatic
Chronic 4 |
H413 |
H413 |
ATP01 | ||||
| 607-525-00-X | (Z)-2-methoxymino-2-[2-(tritylamino)thiazol-4-yl]acetic acid | (Z)-2-metoximino-2-[2-(tritilamino)tiazol-4-il]ecetsav | 431-520-1 | 64485-90-1 | Flam.
Sol. 1 **** Carc. 2 Aquatic Chronic 3 |
H228 H351 H412 |
GHS02 GHS08 Dgr |
H228 H351 H412 |
ATP01 | |||
| 607-526-00-5 | cartap (ISO); 1,3-bis(carbamoylthio)-2-(dimethylamino)propane | kartap (ISO); 1,3-bisz(karbamoiltio)-2-(dimetilamino)propán | 15263-53-3 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | ||||
| 607-527-00-0 | reaction mass of: 1-(1'H,1'H,2'H,2'H-tridecafluorooctyl)-12-(1''H,1''H,2''H,2''H-tridecafluorooctyl)dodecanedioate; 1-(1'H,1'H,2'H,2'H-tridecafluorooctyl)-12-(1''H,1''H,2''H,2''H-heptdecafluorodecyl)dodecanedioate; 1-(1'H,1'H,2'H,2'H-tridecafluorooctyl)-12-(1''H,1''H,2''H,2''H-heneicosafluorododecyl)dodecanedioate; 1-(1'H,1'H,2'H,2'H-tridecafluorooctyl)-12-(1''H,1''H,2''H,2''H-pentacosafluorotetradecyl)dodecanedioate; 1-(1'H,1'H,2'H,2'H-heptadecafluorodecyl)-12-(1''H,1''H,2''H,2''H-heptadecafluorodecyl)dodecanedioate; 1-(1'H,1'H,2'H,2'H-heptadecafluorodecyl)-12-(1''H,1''H,2''H,2''H-heneicosafluorododecyl)dodecanedioate | a következő anyagok keveréke: 1-(1’H,1’H,2’H,2’H-tridekafluoroktil)-12-(1”H,1”H,2”H,2”H- tridekafluoroktil)dodekándioát; 1-(1’H,1’H,2’H,2’H-tridekafluoroktil)-12-(1”H,1”H,2”H,2”H-heptadekafluordecil)-dodekándioát; 1-(1’H,1’H,2’H,2’H-tridekafluoroktil)-12-(1”H,1”H,2”H,2”H-heneikozafluordodecil)-dodekándioát; 1-(1’H,1’H,2’H,2’H-tridekafluoroktil)-12-(1”H,1”H,2”H,2”H-pentakozafluortetradecil)-dodekándioát; 1-(1’H,1’H,2’H,2’H-heptadekafluordecil)-12-(1”H,1”H,2”H,2”H-heptadekafluordecil)-dodekándioát; 1-(1’H,1’H,2’H,2’H-heptadekafluordecil)-12-(1”H,1”H,2”H,2”H-heneikozafluordodecil)-dodekándioát | 423-180-6 | STOT
RE 2 * |
H373
** |
GHS08 Wng |
H373
** |
CLP00 | ||||
| 607-528-00-6 | (S)-3-methyl-2-(2-oxotetrahydropyrimidine-1-yl)butyric acid | (S)-3-metil-2-(2-oxotetrahidropirimidin-1-il)butánsav | 430-900-2 | 192725-50-1 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 607-529-00-1 | benzyl cis-4-ammonium-4'-toluenesulfonato-1-cyclohexanecarboxylate | benzil-cisz-4-ammónium-4'-toluolszulfonáto-1-ciklohexánkarboxilát | 426-070-6 | 67299-45-0 | Aquatic
Chronic 3 |
H412 |
- |
H412 |
ATP01 | |||
| 607-530-00-7 | reaction mass of isomers of: C7-9-alkyl 3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionate | a következő anyagok izomereinek keveréke: C7-9-alkil-3-(3,5-di-terc-butil-4-hidroxifenil)propionát | 406-040-9 | 125643-61-0 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 607-531-00-2 | methyl 3-amino-4,6-dibromo-2-methyl-benzoate | metil-3-amino-4,6-dibróm-2-metil-benzoát | 425-190-6 | 119916-05-1 | STOT
RE 2 * Aquatic Chronic 2 |
H373
** H411 |
GHS08 GHS09 Wng |
H373
** H411 |
ATP01 | |||
| 607-532-00-8 | (S)-1-[2-tert-butoxycarbonyl-3-(2-methoxyethoxy)propyl]-1-cyclopentanecarboxylic acid, cyclohexylamine salt | (S)-1-[2-transz-butoxikarbonil-3-(2-metoxietoxi)propil]-1-ciklopentán-karbonsav, ciklohexil-amin só | 425-510-4 | 167944-94-7 | Aquatic
Chronic 3 |
H412 |
- |
H412 |
ATP01 | |||
| 607-533-00-3 | pentasodium monohydrogen 6-chloro-3,10-bis[2-[4-chloro-6-(2,4-disulfophenylamino)-1,3,5-triazin-2-yl-amino]ethylamino]-13-ethylbenzo[5.6][1.4]oxazino[2,3-b]phenoxazine-4,11-disulfonate | pentanátrium-monohidrogén-6-klór-3,10-bisz[2-[4-klór-6-(2,4-diszulfofenilamino)-1,3,5-triazin-2-ilamino]etilamino]-13-etilbenzo[5.6][1.4]oxazino[2,3-b]fenoxazin-4,11-diszulfonát | 414-910-4 | - | Eye
Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
ATP01 | |||
| 607-534-00-9 | ethyl 2-(3-benzoylphenyl)propanoate | etil-2-(3-benzoilfenil)propanoát | 414-920-9 | 60658-04-0 | Acute
Tox. 3 * STOT RE 1 Skin Sens. 1 Aquatic Chronic 2 |
H301 H372 ** H317 H411 |
GHS06 GHS08 GHS09 Dgr |
H301 H372 ** H317 H411 |
ATP01 | |||
| 607-535-00-4 | potassium 4-iodo-2-sulfonato-benzoic acid | kálium-4-jód-2-szulfonáto-benzoesav | 426-620-5 | - | Eye
Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
ATP01 | |||
| 607-536-00-X | (2,6-xylyloxy) acetic acid | (2,6-xililoxi)ecetsav | 430-910-7 | 13335-71-2 | Acute
Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
ATP01 | |||
| 607-537-00-5 | isopropylammonium 2-(3-benzoylphenyl)propionate | izopropil-ammónium-2-(3-benzoilfenil)propionát | 417-970-1 | - | Acute
Tox. 3 * Acute Tox. 4 * STOT RE 1 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H312 H372 ** H318 H400 H410 |
GHS06 GHS05 GHS08 GHS09 Dgr |
H301 H312 H372 ** H318 H410 |
ATP01 | |||
| 607-539-00-6 | propyl((4-(5-oxo-3-propylisoxazolidin-4-ylidenmethin)phenyl)propoxycarbonylmethyleneamino)acetate | propil((4-(5-oxo-3-propilizoxazolidin-4-ilidénmetin)fenil)propoxikarbonilmetilénamino)acetát | 431-000-2 | 198705-81-6 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 607-540-00-1 | 1-(mercaptomethyl)cyclopropylacetic acid | 1-(merkaptometil)ciklopropilecetsav | 420-240-3 | 162515-68-6 | Acute
Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H312 H302 H314 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H314 H312 H302 H317 H411 |
ATP01 | |||
| 607-541-00-7 | [(1-methyl-1,2-ethanediyl)bis[nitrilobis(methylene)]]tetrakis(phosphonic acid) | [(1-metil-1,2-etándiil)bisz[nitrilobisz(metilén)]]tetrakisz(foszfonsav) | 421-940-1 | 28698-31-9 | Eye
Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
ATP01 | |||
| 607-542-00-2 | methyl 2-(4-butanesulfonamidophenoxy)tetradecanoate | metil-2-(4-butánszulfonamidofenoxi)tetradekanoát | 422-110-1 | - | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
ATP01 | |||
| 607-543-00-8 | poly-[((4-((4-(ethyl-ethylene)amino)phenyl)-(4-(ethyl-(2-oxyethylene)amino)phenyl)methinyl)-3-methylcyclohexa-2,5-dienylidene)-N-ethyl-N-(2-hydroxyethyl)ammonium acetate] | poli-[((4-((4-(etiletilén)amino)fenil)-(4-(etil-(2-oxietilén)amino)fenil)metinil)-3-metilciklohexa-2,5-dienilidén)-N-etil-N-(2-hidroxietil)ammónium-acetát] | 427-480-8 | 176429-22-4 | STOT
SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H335 H315 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H335 H315 H318 H410 |
ATP01 | |||
| 607-544-00-3 | ethyl 6,8-difluoro-1-(formylmethylamino)-1,4-dihydro-7-(4-methyl)piperazin-1-yl)-4-oxo-quinoline-3-carboxylate | etil-6,8-difluor-1-(formilmetilamino)-1,4-dihidro-7-(4-metil)piperazin-1-il)-4-oxokinolin-3-karboxilát | 427-490-2 | 158585-86-5 | Aquatic
Chronic 3 |
H412 |
- |
H412 |
ATP01 | |||
| 607-545-00-9 | 1,2-dimethyl-3-(1-methylethenyl)cyclopentyl acetate | 1,2-dimetil-3-(1-metiletenil)ciklopentil-acetát | 424-070-0 | 94346-09-5 | Skin
Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
ATP01 | |||
| 607-546-00-4 | reaction mass of: methyl {[5-acetylamino-4-(2-chloro-4-nitrophenylazo)phenyl]methoxycarbonylmethylamino}acetate; methyl {[5-acetylamino-4-(2-chloro-4-nitrophenylazo)phenyl]ethoxycarbonylmethylamino}acetate | metil-{[5-acetilamino-4-(2-klór-4-nitrofenilazo)fenil]metoxikarbonilmetilamino}acetát; metil-{[5-acetilamino-4-(2-klór-4-nitrofenilazo)fenil]etoxikarbonilmetilamino}acetát keveréke | 424-290-7 | 188070-47-5 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
ATP01 | |||
| 607-547-00-X | 18-methylnonadecyl 2,2-dimethylpropanoate | 18-metilnonadecil-2,2–dimetilpropanoát | 424-370-1 | 125496-22-2 | Skin
Irrit. 2 Skin Sens. 1 Aquatic Chronic 4 |
H315 H317 H413 |
GHS07 Wng |
H315 H317 H413 |
ATP01/ATP01corr | |||
| 607-548-00-5 | 1-(2,4-dichlorophenyl)-2-(1H-imidazol-1-yl)ethanone methanesulfonate | 1-(2,4-diklórfenil)-2-(1H-imidazol-1-il)etanon-metánszulfonát | 431-010-7 | 154486-26-7 | Acute
Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
ATP01 | |||
| 607-549-00-0 | methyl (E)-2((3-(1,3-benzodioxol-5-yl)-2-methyl-1-propenyl)amino)benzoate | metil-(E)-2((3-(1,3-benzodioxol-5-il)-2-metil-1-propenil)amino)benzoát | 424-430-7 | 125778-19-0 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
ATP01 | |||
| 607-550-00-6 | 2-amino-4-bromo-5-chlorobenzoic acid | 2-amino-4-bróm-5-klórbenzoesav | 424-700-4 | Eye
Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
ATP01/ATP01corr | ||||
| 607-551-00-1 | tetrabutylammonium 2-amino-6-iodopurinate | tetrabutilammónium-2-amino-6-jódpurinát | 424-710-9 | 156126-48-6 | Acute
Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H312 H302 H373 ** H315 H318 H317 H411 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H312 H302 H373 ** H315 H318 H317 H411 |
ATP01 | |||
| 607-552-00-7 | hexadecyl 3-amino-4-isopropoxybenzoate | hexadecil-3-amino-4-izopropoxibenzoát | 424-830-1 | - | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 607-553-00-2 | 7-amino-4-hydroxy-2-naphthalenesulfonic acid, coupled with 5 (or 8) -amino-8 (or 5)-[[4-[[4-[[4-amino-6(or 7)-sulfo-1-naphthyl]azo]phenyl]amino]-3-sulfophenyl]azo]-2-naphthalenesulfonic acid and 4-hydroxy-7-(phenylamino)-2-naphthalenesulfonic acid, sodium salt | 7-amino-4-hidroxi-2-naftalinszulfonsav, 5(vagy 8)-amino-8(vagy 5)-[[4-[[4-[[4-amino-6(vagy 7)-szulfo-1-naftil]azo]fenil]amino]-3-szulfofenil]azo]-2-naftalinszulfonsav és 4-hidroxi-7-(fenilamino)-2-naftalinszulfonsav nátriumsójával együtt | 424-850-0 | - | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 607-554-00-8 | 2,4-diamino-5-[4-[(2-sulfoxyl ethyl)sulfonyl]phenylazo]benzenesulfonic acid | 2,4-diamino-5-[4-[(2-szulfoxiletil)szulfonil]fenilazo]benzolszulfonsav | 424-870-1 | 27624-67-5 | Expl.
1.1 Eye Dam. 1 Aquatic Chronic 3 |
H201 H318 H412 |
GHS01 GHS05 Dgr |
H201 H318 H412 |
ATP01 | |||
| 607-555-00-3 | 1,1,3,3-tetramethylbutylperoxypivalate | 1,1,3,3-tetrametilbutilperoxipivalát | 424-980-8 | 22288-41-1 | Flam.
Liq. 2 Org. Perox. D Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H225 H242 H315 H317 H411 |
GHS02 GHS07 GHS09 Dgr |
H225 H242 H315 H317 H411 |
ATP01 | |||
| 607-556-00-9 | 2-acetoxymethylene-4-acetylphenylacetate | 2-acetoximetilén-4-acetilfenilacetát | 425-160-2 | 24085-06-1 | Acute
Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H318 H317 H400 H410 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H302 H373 ** H318 H317 H410 |
ATP01 | |||
| 607-557-00-4 | salt of: (1S-cis)-1-amino-2,3-dihydro-1H-inden-2-ol and [R-[R*R*]]-2,3-dihydroxybutanedioic acid | a következő anyagok sója: (1S-cisz)-1-amino-2,3-dihidro-1H-indén-2-ol és [R-[R*R*]]-2,3-dihidroxibutándionsav | 425-210-3 | 169939-84-8 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
ATP01 | |||
| 607-558-00-X | 2S-isopropyl-5R-methyl-1R-cyclohexyl (2R,5S)-5-(4-amino-2-oxo-2H-pyrimidin-1-yl)-[1.3]-oxathiolane-2-carboxylate | 2S-izopropil-5R-metil-1R-ciklohexil (2R, 5S)-5-(4-amino-2-oxo-2H-pirimidin-1-il)-[1.3]-oxatiolán-2-karboxilát | 425-250-1 | 147027-10-9 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
ATP01 | |||
| 607-559-00-5 | coconut oil, reaction products with glycerol esters of 3,5-bis(1,1-dimethylethyl)-4-hydroxybenzenepropanoic acid | kókuszolaj, 3,5-bisz(1,1-dimetiletil)-4-hidroxibenzolpropionsav glicerin-észtereivel képzett reakciótermékei | 425-400-6 | 179986-09-5 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 607-560-00-0 | (R,S)-2-butyloctanedioic acid | (R, S)-2-butiloktándisav | 431-210-4 | 50905-10-7 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 607-561-00-6 | sodium 4-hydroxy-3-(N'-(2-(2-hydroxyethylenesulfonyl)ethylene)ureido)-5-nitrobenzenesulfonate | nátrium-4-hidroxi-3-(N'-(2-(2-hidroxietilénszulfonil)etilén)ureido)-5-nitrobenzolszulfonát | 425-460-3 | - | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
ATP01 | |||
| 607-562-00-1 | reaction mass of: (2R,3R)-3-(2-ethoxyphenoxy)-2-hydroxy-3-phenylpropylammonium methanesulfonate; (2S,3S)-3-(2-ethoxyphenoxy)-2-hydroxy-3-phenylpropylammonium methanesulfonate | (2R,3R)-3-(2-etoxifenoxi)-2-hidroxi-3-fenilpropilammónium–metánszulfonát; (2S,3S)-3-(2-etoxifenoxi)-2-hidroxi-3-fenilpropilammónium–metánszulfonát keveréke | 425-530-3 | 98769-75-6 | Acute
Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
ATP01 | |||
| 607-563-00-7 | 5,7-dichloro-4-hydroxyquinoline-3-carboxylic acid | 5,7-diklór-4-hidroxikinolin-3-karbonsav | 431-250-2 | 171850-30-9 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
ATP01 | |||
| 607-564-00-2 | 1,6-hexanediammonium, sodium 5-sulfato-1,3-benzenedicarboxylate | 1,6-hexándiammónium, nátrium-5-szulfáto-1,3-benzoldikarboxilát | 425-730-0 | 51178-75-7 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
ATP01 | |||
| 607-565-00-8 | 3-ethyl 5-methyl 2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-1,4-dihydro-6-methyl-3,5-pyridinedicarboxylate | 3-etil-5-metil-2-(2-aminoetoximetil)-4-(2-klórfenil)-1,4-dihidro-6-metil-3,5-piridindikarboxilát | 425-820-1 | 88150-42-9 | Acute
Tox. 3 * STOT RE 2 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H373 ** H318 H400 H410 |
GHS06 GHS05 GHS08 GHS09 Dgr |
H301 H373 ** H318 H410 |
ATP01 | |||
| 607-566-00-3 | reaction mass of: dodecylphenyl dodecylhydroxybenzenecarboxylate; bis(dodecylphenyl)dodecyl hydroxybenzenedicarboxylate | dodecilfenil-dodecilhidroxibenzol-karboxilát; bisz(dodecilfenil)dodecilhidroxibenzol-dikarboxilát keveréke | 426-140-6 | - | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 607-567-00-9 | potassium 3-iodo-6-methylbenzenesulfonate | kálium-3-jód-6-metilbenzolszulfonát | 426-300-5 | - | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 607-568-00-4 | potassium 2-chloro-3-(benzyloxy)propionate | kálium-2-klór-3-(benziloxi)propionát | 426-350-8 | 138666-92-9 | Acute
Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 |
H302 H373 ** H318 H317 |
GHS05 GHS08 GHS07 Dgr |
H302 H373 ** H318 H317 |
ATP01 | |||
| 607-569-00-X | reaction mass of: sodium 2-amino-4-(2,6-difluoropyrimidin-4-ylamino)benzenesulfonate; sodium 2-amino-4-(4,6-difluoropyrimidin-4-ylamino)benzenesulfonate | nátrium-2-amino-4-(2,6-difluorpirimidin-4-ilamino)benzolszulfonát; nátrium-2-amino-4-(4,6-difluorpirimidin-4-ilamino)benzolszulfonát keveréke | 426-470-0 | - | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
ATP01 | |||
| 607-570-00-5 | sodium (6R-trans)-7-amino-8-oxo-3-[[[1-(sulfomethyl)-1H-tetrazol-5-yl]thio]methyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate monohydrate | nátrium-(6R-transz)-7-amino-8-oxo-3-[[[1-(szulfometil)-1H-tetrazol-5-il]tio]metil]-5-tia-1-azabiciklo[4.2.0]okt-2-én-2-karboxilát-monohidrát | 426-520-1 | 71420-85-4 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
ATP01 | |||
| 607-571-00-0 | 2-cyclopentene-1-acetic acid, 3-hydroxy-2-pentyl-, methyl ester acetate | 2-ciklopentén-1-ecetsav, 3-hidroxi-2-pentil-, metil-észter-acetát | 431-400-7 | 57374-49-9 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
ATP01 | |||
| 607-572-00-6 | diethyl thiophosphoryl (Z)-(2-aminothiazol-4-yl)methoxyimino acetate | dietil-tiofoszforil-(Z)-(2-aminotiazol-4-il)metoxiimino-acetát | 426-790-0 | 162208-27-7 | Acute
Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H373 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H312 H302 H373 ** H317 H410 |
ATP01 | |||
| 607-573-00-1 | reaction mass of: disodium 7-(2,4-difluoropyrimidin-6-ylamino)-4-hydroxy-3-(4-methoxy-2-sulfonatophenylazo)naphthalene-2-sulfonate; disodium 7-(4,6-difluoropyrimidin-2-ylamino)-4-hydroxy-3-(4-methoxy-2-sulfonatophenylazo)naphthalene-2-sulfonate | dinátrium-7-(2,4-difluorpirimidin-6-ilamino)-4-hidroxi-3-(4-metoxi-2-szulfonátofenilazo)naftalin-2-szulfonát; dinátrium-7-(4,6-difluorpirimidin-2-ilamino)-4-hidroxi-3-(4-metoxi-2-szulfonátofenilazo)naftalin-2-szulfonát keveréke | 426-840-1 | - | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 607-574-00-7 | [1R-(1-α,2β,5α)]-mono[5-methyl-2-(1-methylethyl)cyclohexyl]butanedioate | [1R-(1-α,2β,5α)]-mono[5-metil-2-(1-metiletil)ciklohexil]butándioát | 426-890-4 | 77341-67-4 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 607-575-00-2 | 4-(5-(5-[1-(4-carboxyphenyl)hexahydro-2,4,6-trioxopyrimidin-5-ylidene]penta-1,3-dienyl)-1,2,3,4-tetrahydro-6-hydroxy-2,4-dioxopyrimidin-1-yl)benzoic acid-triethylamine salt | 4-(5-(5-[1-(4-karboxifenil)hexahidro-2,4,6-trioxopirimidin-5-ilidén]penta-1,3-dienil)-1,2,3,4-tetrahidro-6-hidroxi-2,4-dioxo-pirimidin-1-il)benzoesav trietil-amin só | 426-900-7 | - | STOT
SE 3 Aquatic Chronic 3 |
H335 H412 |
GHS07 Wng |
H335 H412 |
ATP01 | |||
| 607-576-00-8 | branched, octyl 3-[3,5-di(tert-butyl)-4-hydroxyphenyl]propanoate | elágazó láncú, oktil-3-[3,5-di(terc-butil)-4-hidroxifenil]propanoát | 427-030-0 | - | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
ATP01 | |||
| 607-577-00-3 | (2R*,3S*)-2-(2,4-difluorophenyl)-3-(5-fluoro-4-pyrimidinyl)-1-(1H-1,2,4-triazol-1-yl)butan-2-ol (1R)-10-camphorsulfonate | (2R*,3S*)-2-(2,4-difluorfenil)-3-(5-fluor-4-pirimidinil)-1-(1H-1,2,4-triazol-1-il)bután-2-ol-(1R)-10-kámforszulfonát | 427-100-0 | - | Acute
Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H302 H318 H317 H412 |
GHS05 GHS07 Dgr |
H302 H318 H317 H412 |
ATP01 | |||
| 607-578-00-9 | ethyl 4-((4-diethylamino-2-methylphenyl)imino)-4,5-dihydro-1-isopropyl-5-oxo-1H-pyrazole-3-carboxylate | etil-4-((4-dietilamino-2-metilfenil)imino)-4,5-dihidro-1-izopropil-5-oxo-1H-pirazol-3-karboxilát | 427-110-5 | - | Acute
Tox. 4 * STOT RE 2 * Aquatic Chronic 4 |
H302 H373 ** H413 |
GHS08 GHS07 Wng |
H302 H373 ** H413 |
ATP01 | |||
| 607-579-00-4 | diethyl[(p-ethoxyanilino)methylene]malonate | dietil[(p-etoxianilino)metilén]malonát | 431-430-0 | 103976-28-9 | Acute
Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
ATP01 | |||
| 607-580-00-X | ethyl 7-chloro-1-(2,4-difluorophenyl)-6-fluoro-1,4-dihydro-4-oxo-1,8-naphthyridine-3-carboxylate | etil-7-klór-1-(2,4-difluorfenil)-6-fluor-1,4-dihidro-4-oxo-1,8-naftiridin-3-karboxilát | 422-360-1 | 100491-29-0 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
ATP01 | |||
| 607-581-00-5 | ethyl 2-ethoxy-4-carboxymethylbenzoate | etil-2-etoxi-4-karboximetilbenzoát | 427-630-2 | 99469-99-5 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 607-582-00-0 | reaction mass of: tetrasodium 7-(4-(4-fluoro-6-(4-(2-sulfonatoethylsulfonyl)phenylamino)-1,3,5-triazin-2-ylamino)-2-ureidophenylazo)naphthalene-1,3,6-trisulfonate; tetrasodium 7-(4-(4-hydroxy-6-(4-(2-sulfonatoethylsulfonyl)phenylamino)-1,3,5-triazin-2-ylamino)-2-ureidophenylazo)naphthalene-1,3,6-trisulfonate | tetranátrium-7-(4-(4-fluor-6-(4-(2-szulfonátoetilszulfonil)fenil-amino)-1,3,5-triazin-2-ilamino)-2-ureidofenilazo)naftalin-1,3,6-triszulfonát; tetranátrium-7-(4-(4-hidroxi-6-(4-(2-szulfonátoetilszulfonil)fenil-amino)-1,3,5-triazin-2-ilamino)-2-ureidofenilazo)naftalin-1,3,6-triszulfonát keveréke | 427-650-1 | - | Aquatic
Chronic 3 |
H412 |
- |
H412 |
ATP01 | |||
| 607-583-00-6 | 4-amino-3-[[4-[[2-(sulfooxy)ethyl]sulfonyl]phenyl]azo]-1-naphthalene sulfonic acid | 4-amino-3-[[4-[[2-(szulfooxi)etil]szulfonil]fenil]azo]-1-naftalin-szulfonsav | 427-680-5 | 188907-52-0 | Eye
Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
ATP01 | |||
| 607-584-00-1 | trisodium 3-[2-acetylamino-4-[4-chloro-6-[4-(2-sulfonatoxyethylsulfonyl)phenylamino]-1,3,5-triazine-2-ylamino]phenylazo]naphthalene-1,5-disulfonate | trinátrium-3-[2-acetilamino-4-[4-klór-6-[4-(2-szulfonátoxietil-szulfonil)fenilamino]-1,3,5-triazin-2-ilamino]fenilazo]naftalin-1,5-diszulfonát | 427-710-7 | 215612-56-9 | Eye
Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
ATP01 | |||
| 607-585-00-7 | strontium 2-[(2-hydroxy-6-sulfonato-1-naphthyl)azo]naphthalene-1-sulfonate | stroncium-2-[(2-hidroxi-6-szulfonáto-1-naftil)azo]naftalin-1-szulfonát | 427-930-3 | - | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
ATP01 | |||
| 607-586-00-2 | dodecyl 3-amino-4-chlorobenzoate | dodecil-3-amino-4-klórbenzoát | 428-020-9 | 6195-20-6 | Skin
Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
ATP01 | |||
| 607-587-00-8 | ethyl cis-4-[4-[[2-(2,4-dichlorophenyl)-2-(1H-imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazine-1-carboxylate | etil-cisz-4-[4-[[2-(2,4-diklórfenil)-2-(1H-imidazol-1-ilmetil)-1,3-dioxolán-4-il]metoxi]fenil]piperazin-1-karboxilát | 428-030-3 | 67914-69-6 | Acute
Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H410 |
ATP01 | |||
| 607-588-00-3 | reaction mass of: 2-ethylhexyl 2,3,4,5-tetrabromobenzoate; bis(2-ethylhexyl) 3,4,5,6-tetrabromophthalate | 2-etilhexil-2,3,4,5-tetrabrómbenzoát; bisz(2-etil-hexil)-3,4,5,6-tetrabrómftalát keveréke | 428-050-2 | - | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
ATP01 | |||
| 607-589-00-9 | tetrakis(1,2,2,6,6-pentamethyl-4-piperidyl)-1,2,3,4-butanetetracarboxylate | tetrakisz(1,2,2,6,6-pentametil-4-piperidil)-1,2,3,4-butántetrakarboxilát | 428-070-1 | 91788-83-9 | Acute
Tox. 4 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H372 ** H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H372
** H302 H410 |
ATP01 | |||
| 607-590-00-4 | hexadecyl 3-[2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-4,4-dimethyl-3-oxovaleramido]-4-isopropoxybenzoate | hexadecil-3-[2-(5,5-dimetil-2,4-dioxo-1,3-oxazolidin-3-il)-4,4-dimetil-3-oxovaleramido]-4-izopropoxibenzoát | 428-140-1 | 210706-50-6 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 607-591-00-X | reaction mass of: trisodium 5-(4-fluoro-6-morpholin-4-yl-1,3,5-triazin-2-ylamino)-4-hydroxy-3-(4-(2-sulfooxyethanesulfonyl)phenylazo)naphthalene-2,7-disulfonate; disodium 3-(4-ethenesulfonylphenylazo)-5-(4-fluoro-6-morpholin-4-yl-1,3,5-triazin-2-ylamino)-4-hydroxynaphthalene-2,7-disulfonate | trinátrium-5-(4-fluor-6-morfolin-4-il-1,3,5-triazin-2-ilamino)-4-hidroxi-3-(4-(2-szulfooxietánszulfonil)fenilazo)naftalin-2,7-diszulfonát; dinátrium-3-(4-eténszulfonilfenilazo)-5-(4-fluor-6-morfolin-4-il-1,3,5-triazin-2-ilamino)-4-hidroxinaftalin-2,7-diszulfonát keveréke | 428-400-4 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01/ATP01corr | ||||
| 607-592-00-5 | di(C9-11-alkyl) cyclohexane-1,4-dicarboxylate | di(C9-11-alkil)-ciklohexán-1,4-dikarboxilát | 428-870-0 | - | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 607-593-00-0 | 4-(2-methylacryloyloxy)phenyl 4-allyloxybenzoate | 4-(2-metilakriloiloxi)fenil-4-alliloxibenzoát | 429-000-2 | 159235-16-2 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
ATP01 | |||
| 607-594-00-6 | ethyl (1S,5R,6S)-5-(1-ethylpropoxy)-7-oxabicyclo[4.1.0]hept-3-ene-3-carboxylate | etil-(1S,5R,6S)-5-(1-etilpropoxi)-7-oxabiciklo[4.1.0]hept-3-én-3-karboxilát | 429-020-1 | 204254-96-6 | STOT
RE 2 * Skin Sens. 1 |
H373
** H317 |
GHS08 GHS07 Wng |
H373
** H317 |
ATP01 | |||
| 607-595-00-1 | N-amidino-N-methylglycine-2-oxopropionate | N-amidino-N-metilglicin-2-oxopropionát | 429-120-5 | 208535-04-0 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 607-596-00-7 | ethyl 2-(4-phenoxyphenyl)lactate | etil-2-(4-fenoxifenil)laktát | 429-220-9 | 132584-17-9 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
ATP01 | |||
| 607-597-00-2 | tetrasodium 4,4'-bis{4-[4-(2-hydroxyethylamino)-6-(4-sulfonatoanilino)-1,3,5-triazin-2-ylamino]phenylazo}stilbene-2,2'-disulfonate | tetranátrium-4,4'-bisz{4-[4-(2-hidroxietilamino)-6-(4-szulfonátoanilino)-1,3,5-triazin-2-ilamino]fenilazo}sztilbén-2,2'-diszulfonát | 429-230-3 | - | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 607-598-00-8 | trisodium 3-amino-4-[4-[4-(2-(2-ethenylsulfonylethoxy)ethylamino)-6-fluoro-1,3,5-triazine-2-ylamino]-2-sulfophenylazo]-5-hydroxynaphthalene-2,7-disulfonate | trinátrium-3-amino-4-[4-[4-(2-(2-etenilszulfoniletoxi)etilamino)-6-fluor-1,3,5-triazin-2-ilamino]-2-szulfofenilazo]-5-hidroxinaftalin-2,7-diszulfonát | 429-240-8 | 212652-59-0 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 607-599-00-3 | 1,1-dimethylpropyl 3,5,5-trimethylperoxyhexanoate | 1,1-dimetil-propil-3,5,5-trimetilperoxihexanoát | 431-610-9 | 68860-54-8 | Org.
Perox. D Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H242 H317 H400 H410 |
GHS02 GHS07 GHS09 Dgr |
H242 H317 H410 |
ATP01 | |||
| 607-600-00-7 | (1S,1'R)-[1-(3',3'-dimethyl-1'-cyclohexyl)ethoxycarbonyl]methyl propanoate | (1S,1'R)-[1-(3',3'-dimetil-1'-ciklohexil)etoxikarbonil]metil-propanoát | 431-700-8 | - | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
ATP01 | |||
| 607-601-00-2 | 1,4-dihydroxy-2,2,6,6-tetramethyl piperidinium-2-hydroxy-1,2,3-propanetricarboxylate | 1,4-dihidroxi-2,2,6,6-tetrametil-piperidinium-2-hidroxi-1,2,3-propántrikarboxilát | 429-370-5 | 220410-74-2 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
ATP01 | |||
| 607-602-00-8 | ethyl (3-cyanomethyl-3,4-dihydro-4-oxophthalazin-1-yl)acetate | etil-(3-cianometil-3,4-dihidro-4-oxoftalazin-1-il)acetát | 429-680-0 | 122665-86-5 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
ATP01 | |||
| 607-603-00-3 | lithium sodium 4,4',4''-(nitrilotris(ethane-2,1-diylimino(6-chloro-1,3,5-triazine-4,2-diyl)imino))tris(5-hydroxy-6-(1-sulfonaphthalene-2-ylazo)-2,7-naphthalene)disulfonate | lítium-nátrium-4,4',4''-(nitrilotrisz(etán-2,1-diilimino(6-klór-1,3,5-triazin-4,2-diil)imino))trisz(5-hidroxi-6-(1-szulfonaftalin-2-ilazo)-2,7-naftalin)diszulfonát | 429-730-1 | 193562-37-7 | Eye
Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
ATP01 | |||
| 607-604-00-9 | guanidinium benzoate | guanidinium-benzoát | 429-820-0 | 26739-54-8 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
ATP01 | |||
| 607-605-00-4 | methyl 4-iodo-2-(3-(4-methoxy-6-methyl-1,3,5-triazine-2-yl)ureidosulfonyl)benzoate | metil-4-jód-2-(3-(4-metoxi-6-metil-1,3,5-triazin-2-il)-ureidoszulfonil)benzoát | 429-890-2 | 144550-06-1 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
ATP01 | |||
| 607-606-00-X | (Z)-2-(2-t-butoxycarbonylamino-4-thiazolyl)pent-2-enoic acid | (Z)-2-(2-t-butoxikarbonilamino-4-tiazolil)pent-2-énsav | 430-100-3 | 86978-24-7 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
ATP01 | |||
| 607-607-00-5 | reaction mass of: calcium bis(C10-14 branched alkyl salicylate); calcium bis(C18-30-alkyl salicylate); calcium C10-14 branched alkylsalicylato-C18-30-alkyl salicylate; calcium bis (C10-14 branched alkyl phenolate); calcium bis (C18-30-alkyl phenolate); calcium C10-14 branched alkylphenolato-C18-30-alkyl phenolate; C10-14 branched alkyl phenol; C18-30-alkyl phenol | kálcium-bisz(C10-14 elágazó láncú alkil-szalicilát); kálcium-bisz(C18-30-alkil-szalicilát); kálcium-C10-14 elágazó láncú alkil-szaliciláto-C18-30-alkil-szalicilát; kálcium-bisz(C10-14 elágazó alkil-fenolát); kálcium-bisz(C18-30-alkil-fenolát); kálcium-C10-14 elágazó alkil-fenoláto-C18-30-alkil-fenolát; C10-14 elágazó alkil-fenol; C18-30-alkil-fenol keveréke | 430-180-1 | - | Skin
Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
ATP01 | |||
| 607-608-00-0 | pentapotassium 2-(4-{5-[1-(2,5-disulfophenyl)-4,5-dihydro-3-methylcarbamoyl-5-oxopyrazol-4-ylidene]-3-(2-pyrrolidinone-1-yl)-1,3-pentadienyl}-3-methylcarbamoyl-5-oxopyrazol-1-yl)benzene-1,4-disulfonate | pentakálium-2-(4-{5-[1-(2,5-diszulfofenil)-4,5-dihidro-3-metilkarbamoil-5-oxopirazol-4-ilidén]-3-(2-pirrolidinon-1-il)-1,3-pentadienil}-3-metilkarbamoil-5-oxopirazol-1-il)benzol-1,4-diszulfonát | 430-210-1 | - | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
ATP01 | |||
| 607-609-00-6 | ethyl (3R)-4-cyano-3-hydroxybutanoate | etil-(3R)-4-ciano-3-hidroxibutanoát | 430-220-6 | 141942-85-0 | Eye
Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
ATP01 | |||
| 607-610-00-1 | trisodium 4-hydroxy-6-(sulfonatomethylamino)-5-(2-(2-sulfatoethylsulfonyl)phenylazo)naphthalene-2-sulfonate | trinátrium-4-hidroxi-6-(szulfonátometilamino)-5-(2-(2-szulfátoetil-szulfonil)fenilazo)naftalin-2-szulfonát | 430-280-3 | - | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
ATP01 | |||
| 607-611-00-7 | methyl 3-amino-2,2,3-trimethylbutyrate | metil-3-amino-2,2,3-trimetilbutirát | 431-720-7 | 90886-53-6 | Acute
Tox. 4 * Skin Corr. 1B Aquatic Chronic 3 |
H302 H314 H412 |
GHS05 GHS07 Dgr |
H314 H302 H412 |
ATP01 | |||
| 607-612-00-2 | reaction mass of: 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-octanesulfonic acid; ammonium 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-octanesulfonate | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridekafluor-1-oktánszulfonsav; ammónium-3,3,4,4,5,5,6,6,7,7,8,8,8-tridekafluor-1-oktánszulfonát keveréke | 432-190-1 | 182176-52-9 | Acute
Tox. 4 * STOT RE 2 * Eye Dam. 1 |
H302 H373 ** H318 |
GHS05 GHS08 GHS07 Dgr |
H302 H373 ** H318 |
ATP01 | |||
| 607-613-00-8 | reaction mass of: succinic acidmonopersuccinic aciddipersuccinic acidmonomethyl ester of succinic acidmonomethyl ester of persuccinic aciddimethyl succinate glutaric acidmonoperglutaric aciddiperglutaric acidmonomethyl ester of glutaric acidmonomethyl ester of perglutaric aciddimethyl glutarate adipic acidmonoperadipic aciddiperadipic acidmonomethyl ester of adipic acidmonomethyl ester of peradipic aciddimethyl adipatehydrogen peroxidemethanolwater | a következő anyagok keveréke: borostyánkősav; monoperborostyánkősav; diperborostyánkősav; borostyánkősav-monometil-észter; perborostyánkősav-monometil-észter; dimetil-szukcinát; glutársav; monoperglutársav; diperglutársav; glutársav-monometil-észter; perglutársav-monometil-észter; dimetil-glutarát; adipinsav; monoperadipinsav; diperadipinsav; adipinsav-monometil-észter; peradipinsav-monometil-észter; dimetil-adipát; hidrogén-peroxid; metanol; víz | 432-790-1 | Acute
Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT SE 2 Skin Corr. 1B |
H332 H312 H302 H371 H314 |
GHS07 GHS05 GHS08 Dgr |
H302 H312 H332 H314 H371 |
ATP01/ATP05 | ||||
| 607-614-00-3 | 2-(10-oxo-10H-9-oxa-10-phosphaphenanthren-10-ylmethyl)succinic acid | 2-(10-oxo-10H-9-oxa-10-foszfafenantrén-10-ilmetil)borostyánkősav | 426-480-5 | 63562-33-4 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
ATP01 | |||
| 607-615-00-9 | reaction product of thioglycerol and mercaptoacetic acid consisting mainly of 3-mercapto-1,2-bismercaptoacetoxypropane and oligomers of this substance | tioglicerin és merkaptoecetsav reakcióterméke, amely főként 3-merkapto-1,2-biszmerkaptoacetoxipropánból és ennek oligomereiból áll | 431-120-5 | - | Acute
Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 |
H331 H302 H319 H317 |
GHS06 Dgr |
H331 H302 H319 H317 |
ATP01 | |||
| 607-616-00-4 | 2,4-dichloro-5-fluorobenzoylchloride | 2,4-diklór-5-trifluorbenzoilklorid | 428-390-1 | 86393-34-2 | STOT
SE 3 Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H335 H315 H318 H317 H412 |
GHS05 GHS07 Dgr |
H335 H315 H318 H317 H412 |
ATP01 | |||
| 607-617-00-X | bis(2-ethylhexyl)-4,5-epoxycyclohexane-1,2-dicarboxylate | bisz(2-etilhexil)-4,5-epoxiciklohexán-1,2-dikarboxilát | 430-700-5 | 10138-36-0 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
ATP01 | |||
| 607-618-00-5 | menadione sodium bisulfite; 2-naphthalenesulfonic acid,1,2,3,4-tetrahydro-2-methyl-1,4-dioxo-, sodium salt | menadion-nátrium-biszulfit; 2-naftalinszulfonsav, 1,2,3,4-tetrahidro-2-metil-1,4-dioxo-, nátriumsó | 204-987-0 | 130-37-0 | Skin
Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H319 H400 H410 |
GHS07 GHS09 Wng |
H319 H315 H410 |
ATP01 | |||
| 607-619-00-0 | menadione nicotinamide bisulfite; 1,2,3,4-tetrahydro-2-methyl-1,4-dioxonaphthalene-2-sulfonic acid, compound with nicotin-3-amide (1:1) | menadion-nikotinamid-biszulfit; 1,2,3,4-tetrahidro-2-metil-1,4-dioxonaftalin-2-szulfonsav vegyülete nikotin-3-amiddal (1:1) | 277-543-7 | 73581-79-0 | Skin
Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H319 H400 H410 |
GHS07 GHS09 Wng |
H319 H315 H410 |
ATP01 | |||
| 607-620-00-6 | trisodium nitrilotriacetate | trinátrium-nitrilotriacetát | 225-768-6 | 5064-31-3 | Carc.
2 Acute Tox. 4 * Eye Irrit. 2 |
H351 H302 H319 |
GHS08 GHS07 Wng |
H351 H302 H319 |
Carc.
2; H351: C ≥ 5 % |
ATP01 | ||
| 607-621-00-1 | milbemectin (ISO); [reaction mass of milbemycin A3 (CAS No 51596-10-2) and milbemycin A4 (CAS No 51596-11-3) (30:70)] | milbemektin (ISO); [A3 milbemicin (CAS-szám: 51596-10-2) és A4 milbemicin (CAS-szám: 51596-11-3) (30:70) keveréke] | - | - | Acute
Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H302 H410 |
M=100 |
ATP01 | ||
| 607-622-00-7 | 2-ethylhexyl-2-ethylhexanoate | 2-etilhexil-2-etilhexanoát | 231-057-1 | 7425-14-1 | Repr.
2 |
H361d
*** |
GHS08 Wng |
H361d
*** |
ATP01 | |||
| 607-623-00-2 | diisobutyl phthalate | diizo-butil-ftalát | 201-553-2 | 84-69-5 | Repr.
1B |
H360Df |
GHS08 Dgr |
H360Df |
ATP01/ATP09 | |||
| 607-624-00-8 | perfluorooctane
sulfonic acid; heptadecafluorooctane-1-sulfonic acid [1] potassium perfluorooctanesulfonate; potassium heptadecafluorooctane-1-sulfonate [2] diethanolamine perfluorooctane sulfonate [3] ammonium perfluorooctane sulfonate; ammonium heptadecafluorooctanesulfonate [4] lithium perfluorooctane sulfonate; lithium heptadecafluorooctanesulfonate [5] |
perfluoroktánszulfonsav; heptadekafluoroktán-1-szulfonsav; [1] kálium-perfluoroktánszulfonát; kálium-heptadekafluoroktán-1-szulfonát; [2] dietanolamin-perfluoroktánszulfonát; [3]ammónium-perfluoroktánszulfonát; ammónium-heptadekafluoroktánszulfonát; [4] lítium-perfluoroktánszulfonát; lítium-heptadekafluoroktánszulfonát [5] | 217-179-8
[1] 220-527-1 [2] 274-460-8 [3] 249-415-0 [4] 249-644-6 [5] |
1763-23-1
[1] 2795-39-3 [2] 70225-14-8 [3] 29081-56-9 [4] 29457-72-5 [5] |
Carc.
2 Repr. 1B Lact. Acute Tox. 4 * Acute Tox. 4 * STOT RE 1 Aquatic Chronic 2 |
H351 H360D *** H362 H332 H302 H372 ** H411 |
GHS08 GHS07 GHS09 Dgr |
H351 H360D *** H372 ** H332 H302 H362 H411 |
ATP01 | |||
| 607-625-00-3 | clodinafop-propargyl (ISO) | klodinafop-propargil (ISO) | - | 105512-06-9 | Acute
Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H317 H410 |
Skin
Sens. 1; H317: C ≥ 0,001 % M=1 |
ATP01 | ||
| 607-626-00-9 | ethyl 1-(2,4-dichlorophenyl)-5-(trichloromethyl)-1H-1,2,4-triazole-3-carboxylate | etil-1-(2,4-diklórfenil)-5-(triklórmetil)-1H-1,2,4-triazol-3-karboxilát | 401-290-5 | 103112-35-2 | Carc.
1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H400 H410 |
GHS08 GHS09 Dgr |
H350 H410 |
ATP01 | |||
| 607-627-00-4 | [(4S,5S)-4-benzyl-2-oxo-5-oxazolidinyl]methyl 4-nitrobenzenesulfonate | [(4S,5S)-4-benzil-2-oxo-5-oxazolidinil]metil-4-nitrobenzolszulfonát | 416-360-0 | 162221-28-5 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
ATP01 | |||
| 607-628-00-X | 4-oxo-4-(p-tolyl)butyric acid adduct with 4-ethylmorpholine | 4-oxo-4-(p-tolil)butánsav addukt 4-etilmorfolinnal | 419-240-6 | 171054-89-0 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 607-629-00-5 | [[2-methyl-1-(1-oxopropoxy)propoxy](4-phenylbutyl)phosphinyl] acetic acid | [[2-metil-1-(1-oxopropoxi)propoxi](4-fenilbutil)foszfinil]ecetsav | 419-270-1 | 123599-82-6 | Eye
Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
ATP01 | |||
| 607-630-00-0 | acrylic acid, 3-(trimethoxysilyl)propyl ester | akrilsav, 3-(trimetoxiszilil)propil-észter | 419-560-6 | 4369-14-6 | Acute
Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H332 H314 H317 H412 |
GHS05 GHS07 Dgr |
H332 H314 H317 H412 |
ATP01 | |||
| 607-631-00-6 | reaction mass of: 2-(2-((oxo(phenyl)acetyl)oxy)ethoxy)ethyl oxo(phenyl)acetate; (2-(2-hydroxyethoxy)ethyl) oxo(phenyl)acetate | 2-(2-((oxo(fenil)acetil)oxi)etoxi)etiloxo(fenil)-acetát; (2-(2-hidroxietoxi)etil)oxo(fenil)acetát keveréke | 442-300-8 | - | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
ATP01 | |||
| 607-632-00-1 | N-[3-(2,4-di-(1,1-dimethyl-propyl)phenoxy)-propyl]-1-hydroxy-5-(2-methylpropyl-oxycarbonylamino)-naphthamide | N-[3-(2,4-di(1,1-dimetilpropil)fenoxi)propil]-1-hidroxi-5-(2-metilpropiloxikarbonilamino)-naftamid | 420-210-1 | 111244-14-5 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 607-633-00-7 | trisodium 5-{[4-chloro-6-(1-naphthylamino)-1,3,5-triazin-2-yl]amino}-4-hydroxy-3-[(E)-(4-methoxy-2-sulfonatophenyl)diazenyl]-2,7-naphthalenedisulfonate | trinátrium 5-{[4-klór-6-(1-naftilamino)-1,3,5-triazin-2-il]amino}-4-hidroxi-3-[(E)-(4-metoxi-2-szulfonátofenil)diazenil]-2,7-naftalindiszulfonát | 440-480-2 | 341026-59-3 | Eye
Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
ATP01 | |||
| 607-634-00-2 | (S)-(-)-2-acetoxypropionylchloride; (1S)-2-chloro-1-methyl-2-oxoethyl acetate | (S)-(-)-2-acetoxipropionil-klorid; (1S)-2-klór-1-metil-2-oxoetil-acetát | 420-610-4 | 36394-75-9 | Acute
Tox. 4 * Skin Corr. 1B Skin Sens. 1 |
H302 H314 H317 |
GHS05 GHS07 Dgr |
H302 H314 H317 |
ATP01 | |||
| 607-635-00-8 | trisodium N-(3-propionato)-.sc.l.sc.-aspartate | trinátrium-N-(3-propionáto)-L-aszpartát | 422-090-4 | 172737-80-3 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 607-636-00-3 | 1-bromo-2-methylpropyl propionate | 1-bróm-2-metilpropil- propionát | 422-900-6 | 158894-67-8 | Flam.
Liq. 3 Carc. 2 Skin Corr. 1B Skin Sens. 1 |
H226 H351 H314 H317 |
GHS02 GHS05 GHS08 GHS07 Dgr |
H226 H351 H314 H317 |
ATP01 | |||
| 607-637-00-9 | disodium 8-amino-5-{4-[2-(sulfonatoethoxy)sulfonyl]phenylazo}naphthalene-2-sulfonate | dinátrium-8-amino-5-{4-[2-(szulfonátoetoxi)szulfonil]fenilazo}naftalin-2-szulfonát | 423-730-5 | 250688-43-8 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 607-638-00-4 | 2-hydroxybenzoic acid 2-butyloctyl ester | 2-hidroxibenzoesav 2-butiloktil észter | 431-090-3 | 190085-41-7 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 607-639-00-X | 2-(2-oxo-5-(1,1,3,3-tetramethylbutyl)-2,3-dihydro-1-benzofuran-3-yl)-4-(1,1,3,3-tetramethylbutyl)phenyl acetate | 2-(2-oxo-5-(1,1,3,3-tetrametilbutil)-2,3-dihidro-1-benzofurán-3-il)-4-(1,1,3,3-tetrametilbutil)fenil-acetát | 431-770-1 | 216698-07-6 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 607-641-00-0 | 2-(formylamino)-3-thiophenecarboxylic acid; 2-formamido-3-thiophenecarboxylic acid | 2-(formilamino)-3-tiofénkarbonsav; 2-formamido-3-tiofénkarbonsav | 431-930-9 | 43028-69-9 | Acute
Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
ATP01 | |||
| 607-642-00-6 | 3,6,9-trithiaundecamethylene-1,11-dimethacrylate | 3,6,9-tritiaundekametilén-1,11-dimetakrilát | 432-210-7 | 141631-22-3 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
ATP01 | |||
| 607-643-00-1 | dimethyl (2S)-2-hydroxysuccinate | dimetil-(2S)-2-hidroxiszukcinát | 432-310-0 | 617-55-0 | Flam.
Liq. 3 Eye Dam. 1 Skin Sens. 1 |
H226 H318 H317 |
GHS02 GHS05 GHS07 Dgr |
H226 H318 H317 |
ATP01 | |||
| 607-644-00-7 | methyl 2,2-dimethyl-6-methylenecyclohexanecarboxylate | metil-2,2-dimetil-6-metilénciklohexánkarboxilát | 432-350-9 | 81752-87-6 | Skin
Irrit. 2 |
H315 |
GHS07 Wng |
H315 |
ATP01 | |||
| 607-645-00-2 | tetrasodium 2-(4-fluoro-6-(methyl-(2-(sulfatoethylsulfonyl)ethyl)amino)-1,3,5-triazin-2-ylamino)-5-hydroxy-6-(4-methyl-2-sulfonatophenylazo)naphthalene-1,7-disulfonate | tetranátrium-2-(4-fluor-6-(metil-(2-(szulfátoetilszulfonil)etil)amino)-1,3,5-triazin-2-ilamino)-5-hidroxi-6-(4-metil-2-szulfonátofenilazo)naftalin-1,7-diszulfonát | 432-550-6 | 243858-01-7 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 607-646-00-8 | .sc.d.sc.-erythro-hexanoic acid 2,4-dideoxy-3,5-O-(1-methylethylidene)-1,1-dimethylethylester; tert-butyl 2-[(4R,6S)-6-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate | D-eritro-hexánsav 2,4-dideoxi-3,5-O-(1-metiletilidén)-1,1-dimetil-etilészter; terc-butil-2-[(4R,6S)-6-(hidroximetil)-2,2-dimetil-1,3-dioxán-4-il]acetát | 432-960-5 | 124655-09-0 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
ATP01 | |||
| 607-647-00-3 | 5-acetoxy-2-(R,S)butyryloxymethyl-1,3-oxathiolane | 5-acetoxi-2-(R, S)butiriloximetil-1,3-oxatiolán | 433-530-1 | 143446-73-5 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Acute 1 |
H302 H317 H400 |
GHS07 GHS09 Wng |
H302 H317 H400 |
ATP01 | |||
| 607-649-00-4 | [3-(chlorocarbonyl)-2-methylphenyl]acetate | [3-(klórkarbonil)-2-metilfenil]acetát | 433-690-0 | 167678-46-8 | Skin
Corr. 1A Skin Sens. 1 |
H314 H317 |
GHS05 GHS07 Dgr |
H314 H317 |
ATP01 | |||
| 607-650-00-X | 2-methyl-1,5-pentanediamine-1,3-benzenedicarboxylate | 2-metil-1,5-pentándiamin-1,3-benzoldikarboxilát | 433-910-5 | 145153-52-2 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
ATP01 | |||
| 607-651-00-5 | sodium 2-(nonanoyloxy)benzenesulfonate | nátrium-2-(nonanoiloxi)benzolszulfonát | 434-360-9 | 91125-43-8 | Eye
Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
ATP01 | |||
| 607-652-00-0 | ethyl N2-dodecanoyl-.sc.l.sc.-argininate hydrochloride | etil-N2-dodekanoil-L-argininát hidroklorid | 434-630-6 | 60372-77-2 | Eye
Dam. 1 Aquatic Acute 1 |
H318 H400 |
GHS05 GHS09 Dgr |
H318 H400 |
ATP01 | |||
| 607-653-00-6 | tetrakis(bis(2-hydroxyethyl)methylammonium) 3-(4-(7-acetylamino-1-hydroxy-3-sulfonatonaphthalen-2-ylazo)-5-methoxy-2-sulfonatophenylazo)-7-(4-amino-3-sulfonatophenylamino)-4-hydroxynaphthalene-2-sulfonate | tetrakisz(bisz(2-hidroxietil)metilammónium)-3-(4-(7-acetilamino-1-hidroxi-3-szulfonátonaftalin-2-ilazo)-5-metoxi-2-szulfonátofenilazo)-7-(4-amino-3-szulfonátofenilamino)-4-hidroxinaftalin-2-szulfonát | 434-840-8 | 225786-91-4 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
ATP01 | |||
| 607-654-00-1 | (S)-3-hydroxy-γ-butyrolactone | (S)-3-hidroxi-γ-butirolakton | 434-990-4 | 7331-52-4 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
ATP01 | |||
| 607-655-00-7 | ethyl 6,8-dichlorooctanoate | etil 6,8-diklóroktanoát | 435-080-1 | 1070-64-0 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
ATP01 | |||
| 607-656-00-2 | sodium salt of 4-amino-3,6-bis[[5-[[4-chloro-6-[(2-methyl-4-sulfophenyl)amino]-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]azo]-5-hydroxy-2,7-naphthalenedisulfonic acid | 4-amino-3,6-bisz[[5-[[4-klór-6-[(2-metil-4-szulfofenil)amino]-1,3,5-triazin-2-il]amino]-2-szulfofenil]azo]-5-hidroxi-2,7-naftalindiszulfonsav nátriumsója | 435-350-7 | 141250-43-3 | Eye
Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
ATP01 | |||
| 607-657-00-8 | pentasodium 7-(4-(4-(3-(2-sulfatoethanesulfonyl)phenylamino)-6-(4-(2-sulfatoethanesulfonyl)phenylamino)-1,3,5-triazin-2-ylamino)-2-ureidophenylazo)naphthalene-1,3,6-trisulfonate | pentanátrium 7-(4-(4-(3-(2-szulfátoetánszulfonil)fenilamino)-6-(4-(2-szulfátoetánszulfonil)fenilamino)-1,3,5-triazin-2-ilamino)-2-ureidofenilazo)naftalin-1,3,6-triszulfonát | 436-920-8 | 172399-10-9 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 607-658-00-3 | 3,10-diamino-6,13-dichloro-2-((6-(((4-(1,1-dimethylethyl)phenyl)sulfonyl)amino)-2-naphthalenyl)sulfonyl)-4,11-triphenodioxazinedisulfonic acid, lithium potassium sodium salt | 3,10-diamino-6,13-diklór-2-((6-(((4-(1,1-dimetiletil)fenil)szulfonil)amino)-2-naftil)szulfonil)-4,11-trifenodioxazin-diszulfonsav, lítium- kálium- nátriumsó | 440-770-9 | 371921-63-0 | Eye
Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
ATP01 | |||
| 607-659-00-9 | pentasodium N-[5-[[4-[[3-[(aminocarbonyl)amino]-4-[(3,6,8-trisulfonatonaphthalen-2-yl)azo]phenyl]amino]-6-chloro-1,3,5-triazin-2-yl]amino]-2-sulfonato-4-[[4-[[-2-(oxysulfonato)ethyl] sulfonyl]phenyl]azo]phenyl]-3-aminopropanoic acid | pentanátrium-N-[5-[[4-[[3-[(aminokarbonil)amino]-4-[(3,6,8-triszulfonátonaftalin-2-il)azo]fenil]amino]-6-klór-1,3,5-triazin-2-il]amino]-2-szulfonáto-4-[[4-[[-2-(oxiszulfonáto)etil] szulfonil]fenil]azo]fenil]-3-aminopropánsav | 442-030-0 | 321912-47-4 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 607-660-00-4 | 2-{4-[4-[4-fluoro-6-(2-(2-vinylsulfonylethoxy)ethylamino)-1,3,5-triazin-2-ylamino]phenylazo]phenylazo}naphthalene-4,6,8-trisulfonate, trisodium salt | 2-{4-[4-[4-fluor-6-(2-(2-vinilszulfoniletoxi)etilamino)-1,3,5-triazin-2-ilamino]fenilazofenilazo}naftalin-4,6,8-triszulfonát, trinátriumsó | 442-230-8 | 321679-52-1 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 607-661-00-X | 1,1-dimethylethyl 4'-(bromomethyl)biphenyl-2-carboxylate | 1,1-dimetiletil 4'-(brómmetil)bifenil-2-karboxilát | 442-850-9 | 114772-40-6 | Skin
Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
ATP01 | |||
| 607-662-00-5 | methyl 2-(acetylamino)-3-chloropropionate | metil-2-(acetilamino)-3-klórpropionát | 442-860-3 | 87333-22-0 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
ATP01 | |||
| 607-663-00-0 | bis(2-ethylhexyl) naphthalene-2,6-dicarboxylate | bisz(2-etilhexil)-naftalin-2,6-dikarboxilát | 442-980-6 | 127474-91-3 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 607-664-00-6 | methyl 2-chlorosulfonyl-4-(methanesulfonylaminomethyl) benzoate | metil-2-klórszulfonil-4-(metánszulfonilaminometil)-benzoát | 443-120-2 | 393509-79-0 | Eye
Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
ATP01 | |||
| 607-665-00-1 | trans-methyl-2-ethyl-but-2-enoate | transz-metil-2-etil-but-2-enoát | 443-150-6 | 101226-85-1 | Flam.
Liq. 3 |
H226 |
GHS02 Wng |
H226 |
ATP01 | |||
| 607-666-00-7 | (2S)-5-(benzyloxy)-2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-5-oxopentanoic acid | (2S)-5-(benziloxi)-2-(1,3-dioxo-1,3-dihidro-2H-izoindol-2-il)-5-oxopentánsav | 443-560-5 | 88784-33-2 | Eye
Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
ATP01 | |||
| 607-667-00-2 | chloro-1-ethylcyclohexyl carbonate | klór-1-etilciklohexil-karbonát | 444-950-8 | 99464-83-2 | Muta.
2 Skin Sens. 1 |
H341 H317 |
GHS08 GHS07 Wng |
H341 H317 |
ATP01 | |||
| 607-668-00-8 | trans-2-isopropyl-5-carboxy-1,3-dioxane | transz-2-izopropil-5-karboxi-1,3-dioxán | 445-770-2 | 42031-28-7 | Eye
Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
ATP01 | |||
| 607-669-00-3 | methyl (9-acetoxy-3,8,10-triethyl-7,8,10-trimethyl-1,5-dioxa-9-aza-spiro[5.5]undec-3-yl)octadecanoate | metil-(9-acetoxi-3,8,10-trietil-7,8,10-trimetil-1,5-dioxa-9-aza-spiro[5.5]undec-3-il)oktadekanoát | 445-990-9 | 376588-17-9 | Skin
Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
ATP01 | |||
| 607-670-00-9 | dibutyl-3-(4-(5-ammonio-2-butyl)benzofuran-3-yl)carbonyl)phenoxy)propyl ammonium oxalate; (5-amino-2-butylbenzofuran-3-yl) [4-(3-dibutylaminopropoxy)phenyl]methanone, dioxalate | dibutil-3-(4-(5-ammónio-2-butil)benzofurán-3-il)karbonil)fenoxi)propil-ammónium-oxalát; (5-amino-2-butilbenzofurán-3-il)[4-(3-dibutilaminopropoxi)fenil]metanon, dioxalát | 448-700-9 | 500791-70-8 | STOT
RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373
** H318 H317 H400 H410 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H373
** H318 H317 H410 |
M=10 |
ATP01 | ||
| 607-671-00-4 | diethyl 1,4-cyclohexanedicarboxylate | dietil-1,4-ciklohexándikarboxilát | 417-310-0 | 72903-27-6 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
ATP01 | |||
| 607-672-00-X | reaction mass of: 2-hydroxy-3-(methacryloyloxy)propyl (2-benzoyl)benzoate; 1-hydroxymethyl-2-(methacryloyloxy)ethyl (2-benzoyl)benzoate; x-hydroxy-y-(methacryloyloxy)propyl(or -ethyl) (2-benzoyl)benzoate | 2-hidroxi-3-(metakriloiloxi)propil-(2-benzoil)-benzoát; 1-hidroximetil-2-(metakriloiloxi)etil-(2-benzoil)-benzoát; x-hidroxi-y-(metakriloiloxi)propil(vagy etil)-(2-benzoil)-benzoát keveréke | 419-000-0 | - | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
ATP01 | |||
| 607-673-00-5 | 1-ethyl-5,6,7,8-tetrahydroquinolinium tosylate | 1-etil-5,6,7,8-tetrahidrokinolinium-tozilát | 419-570-0 | - | Acute
Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
ATP01 | |||
| 607-675-00-6 | reaction mass of: cis-9-octadecenedioic acid; cis-9-cis-12-octadecadienedioic acid; hexadecanedioic acid; octadecanedioic acid | cisz-9-oktadecéndisav; cisz-9-cisz-12-oktadekadiéndisav; hexadekándisav; oktadekándisav keveréke | 422-260-8 | - | Eye
Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
ATP01 | |||
| 607-676-00-1 | reaction mass of: 2-methylnonanedioic acid; 2,4-dimethyl-4-methoxycarbonylundecanedioic acid; 2,4,6-trimethyl-4,6-dimethoxycarbonyltridecanedioic acid; 8,9-dimethyl-8,9-dimethoxycarbonylhexadecanedioic acid | 2-metilnonándisav; 2,4-dimetil-4-metoxikarbonilundekándisav; 2,4,6-trimetil-4,6-dimetoxikarboniltridekándisav; 8,9-dimetil-8,9-dimetoxikarbonilhexadekándisav keveréke | 423-670-1 | - | Eye
Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
ATP01 | |||
| 607-677-00-7 | 2,5-dioxopyrrolidin-1-yl N-{[methyl[[2-(1-methylethyl)-4-thiazolyl]methyl]amino]carbonyl}-.sc.l.sc.-valinate | 2,5-dioxopirrolidin-1-il-N-{[metil[[2-(1-metiletil)-4-tiazolil]metil]amino]karbonil}-L-valinát | 424-660-8 | - | STOT
RE 2 * Eye Dam. 1 Skin Sens. 1 |
H373
** H318 H317 |
GHS05 GHS08 GHS07 Dgr |
H373
** H318 H317 |
ATP01 | |||
| 607-678-00-2 | reaction mass of: ethyl (2R,3R)-3-isopropylbicyclo[2.2.1]hept-5-ene-2-carboxylate; ethyl (2S,3S)-3-isopropylbicyclo[2.2.1]hept-5-ene-2-carboxylate | etil-(2R,3R)-3-izopropilbiciklo[2.2.1]hept-5-én-2-karboxilát; etil-(2S,3S)-3-izopropilbiciklo[2.2.1]hept-5-én-2-karboxilát keveréke | 427-090-8 | - | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
ATP01 | |||
| 607-679-00-8 | reaction mass of: 3-{5-[3-(4-{1,6-dihydro-2-hydroxy-4-methyl-1-[3-(methylammonio)propyl]-6-oxo-3-pyridylazo}benzamido)phenylazo]-1,2-dihydro-6-hydroxy-4-methyl-2-oxo-1-pyridyl}propyl(methyl)ammonium di(acetate); 3-{5-[4-(3-{1,6-dihydro-2-hydroxy-4-methyl-1-[3-(methylammonio)propyl]-6-oxo-3-pyridylazo}benzamido]phenylazo]-1,2-dihydro-6-hydroxy-4-methyl-2-oxo-1-pyridyl}propyl(dimethyl)ammonium di(acetate); 3-{5-[3-(4-{1-[3-(dimethylammonio)propyl]-1,6-dihydro-2-hydroxy-4-methyl-6-oxo-3-pyridylazo}benzamido)phenylazo]-1,2-dihydro-6-hydroxy-4-methyl-2-oxo-1-pyridyl}propyl(dimethyl)ammonium di(acetate) | a következő anyagok keveréke: 3-{5-[3-(4-{1,6-dihidro-2-hidroxi-4-metil-1-[3-(metil-ammónio)propil]-6-oxo-3-piridilazo[}benzamido)fenilazo]-1,2-dihidro-6-hidroxi-4-metil-2-oxo-1-piridil}propil(metil)ammónium-di(acetát); 3-{5-[4-(3-{1,6-dihidro-2-hidroxi-4-metil-1-[3-(metil-ammónio)propil]-6-oxo-3-piridilazo}benzamido]fenilazo-1,2-dihidro-6-hidroxi-4-metil-2-oxo-1-piridil}propil(dimetil)ammónium-di(acetát); 3-{5-[3-(4-{1-[3-(dimetil-ammónio)propil]-1,6-dihidro-2-hidroxi-4-metil-6-oxo-3-piridilazo}benzamido)fenilazo]-1,2-dihidro-6-hidroxi-4-metil-2-oxo-1-piridil}propil(dimetil)ammónium-di(acetát) | 431-440-5 | - | Eye
Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
ATP01 | |||
| 607-680-00-3 | tert-butyl(6-{2-[4-(4-fluorophenyl)-6-isopropyl-2-[methyl(methylsulfonyl)amino]pyrimidin-5-yl]vinyl}(4S,6S)-2,2-dimethyl[1,3]dioxan-4-yl)acetate | terc-butil(6-{2-[4-(4-fluorfenil)-6-izopropil-2-[metil(metilszulfonil)amino]pirimidin-5-ilvinil}(4S,6S)-2,2-dimetil[1,3]dioxán-4-il)acetát | 432-810-9 | - | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 607-681-00-9 | reaction mass of: 9-nonyl-10-octyl-19-carbonyloxyhexadecylnonadecanoic acid; 9-nonyl-10-octyl-19-carbonyloxyoctadecylnonadecanoic acid; dihexadecyl 9-nonyl-10-octylnonadecandioate; 1-octadecyl,19-hexadecyl 9-nonyl-10-octylnonadecandioate; dioctadecyl 9-nonyl-10-octylnonadecandioate | a következő anyagok keveréke: 9-nonil-10-oktil-19-karboniloxihexadecilnonadekánsav; 9-nonil-10-oktil-19-karboniloxioktadecilnonadekánsav; dihexadecil-9-nonil-10-oktilnonadekándioát; 1-oktadecil-19-hexadecil-9-nonil-10-oktilnonadekándioát; dioktadecil-9-nonil-10-oktilnonadekándioát | 432-910-2 | - | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 607-682-00-4 | complex reaction mass of Chinese gum rosin post reacted with acrylic acid | akrilsavval reagált kínai gumigyanta komplex keveréke | 434-230-1 | 144413-22-9 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 607-683-00-X | reaction mass of: methyl 3-((1E)-2-methylprop-1-enyl)-2,2-dimethylcyclopropanecarboxylate; methyl 3-((1Z)-2-methylprop-1-enyl)-2,2-dimethylcyclopropanecarboxylate (20:80) | metil-3-((1E)-2-metilprop-1-enil)-2,2-dimetilciklopropánkarboxilát; metil-3-((1Z)-2-metilprop-1-enil)-2,2-dimetilciklopropánkarboxilát (20:80) keveréke | 435-450-0 | - | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
ATP01 | |||
| 607-684-00-5 | alkenes, C12-14, hydroformylation products, distn. residues, C-(hydrogen sulfobutanedioates), disodium salts | alkének, C12-14, hidroformilezés termékei, desztillációs maradékok, C-(hidrogén-szulfobutándioátok), dinátrium sók | 435-660-2 | 243662-67-1 | Skin
Irrit. 2 Skin Sens. 1 |
H315 H317 |
GHS07 Wng |
H315 H317 |
ATP01 | |||
| 607-685-00-0 | ammonium 2-cocoyloxyethanesulfonate | ammónium-2-kokoiloxietán-szulfonát | 441-050-7 | - | Skin
Irrit. 2 Eye Dam. 1 |
H315 H318 |
GHS05 Dgr |
H315 H318 |
ATP01 | |||
| 607-686-00-6 | 6,6'-bis(diazo-5,5',6,6'-tetrahydro-5,5'-dioxo)[methylene-bis(5-(6-diazo-5,6-dihydro-5-oxo-1-naphthylsulphonyloxy)-6-methyl-2-phenylene]di(naphthalene-1-sulfonate) | 6,6'-bisz(diazo-5,5',6,6'-tetrahidro-5,5'-dioxo)[metilén-bisz(5-(6-diazo-5,6-dihidro-5-oxo-1-naftilszulfoniloxi)-6-metil-2-fenilén]di(naftalin-1-szulfonát) | 441-550-5 | - | Self-react.
C **** Carc. 2 |
H242 H351 |
GHS02 GHS08 Dgr |
H242 H351 |
ATP01 | |||
| 607-687-00-1 | reaction mass of: 2-{3,6-bis-[(2-ethylphenyl)-methylamino]-xanthylium-9-yl}-benzenesulfonate (2-10%); 2-{3,6-bis-[(2,3-dimethylphenyl)-methylamino]-xanthylium-9-yl}-benzenesulfonate (2-10%); 2-{3,6-bis-[(2,4-dimethylphenyl)-methylamino]-xanthylium-9-yl}-benzenesulfonate (2-10%); 2-{3,6-bis-[(2,5-dimethylphenyl)-methylamino]-xanthylium-9-yl}-benzenesulfonate (2-10%); 2-{3-[(2,3-dimethylphenyl)-methylamino]-6-[(2-ethylphenyl)-methylamino]-xanthylium-9-yl}-benzenesulfonate (7-20%); 2-{3-[(2,4-dimethylphenyl)-methylamino]-6-[(2-ethylphenyl)-methylamino]-xanthylium-9-yl}-benzenesulfonate (7-20%); 2-{3-[(2,5-dimethylphenyl)-methylamino]-6-[(2-ethylphenyl)-methylamino]-xanthylium-9-yl}-benzenesulfonate (7-20%); 2-{3-[(2,3-dimethylphenyl)-methylamino]-6-[(2,4-dimethylphenyl)-methylamino]-xanthylium-9-yl}-benzenesulfonate (7-20%); 2-{3-[(2,3-dimethylphenyl)-methylamino]-6-[(2,5-dimethylphenyl)-methylamino]-xanthylium-9-yl}-benzenesulfonate (7-20%); 2-{3-[(2,4-dimethylphenyl)-methylamino]-6-[(2,5-dimethylphenyl)-methylamino]-xanthylium-9-yl}-benzenesulfonate (7-20%) | a következő anyagok keveréke: 2-{3,6-bisz-[(2-etilfenil)-metilamino]-xantilium-9-il[}-benzolszulfonát (2-10 %); 2-{3,6-bisz-[(2,3-dimetilfenil)-metilamino]-xantilium-9-il}-benzolszulfonát (2-10 %); 2-{3,6-bisz-[(2,4-dimetilfenil)-metilamino]-xantilium-9-il}-benzolszulfonát (2-10 %); 2-{3,6-bisz-[(2,5-dimetilfenil)-metilamino]-xantilium-9-il}-benzolszulfonát (2-10 %); 2-{3-[(2,3-dimetilfenil)-metilamino]-6-[(2-etilfenil)-metilamino]-xantilium-9-il}-benzolszulfonát (7-20 %); 2-{3-[(2,4-dimetilfenil)-metilamino]-6-[(2-etilfenil)-metilamino]-xantilium-9-il}-benzolszulfonát (7-20 %); 2-{3-[(2,5-dimetil-fenil)-metilamino]-6-[(2-etilfenil)-metilamino]-xantilium-9-il}-benzolszulfonát (7-20 %); 2-{3-[(2,3-dimetilfenil)-metilamino]-6-[(2,4-dimetilfenil)-metilamino]-xantilium-9-il}-benzolszulfonát (7-20 %); 2-{3-[(2,3-dimetilfenil)-metilamino]-6-[(2,5-dimetilfenil)-metilamino]-xantilium-9-il}-benzolszulfonát (7-20 %); 2-{3-[(2,4-dimetil-fenil)-metilamino]-6-[(2,5-dimetilfenil)-metilamino]-xantilium-9-il}-benzolszulfonát (7-20 %) | 442-800-6 | - | Skin
Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
ATP01 | |||
| 607-688-00-7 | (R)-1-cyclohexa-1,4-dienyl-1-methoxycarbonyl-methylammoniumchloride | (R)-1-ciklohexa-1,4-dienil-1-metoxikarbonilmetilammónium-klorid | 444-320-2 | - | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
ATP01 | |||
| 607-689-00-2 | reaction mass of: methyl 1,4-dimethylcyclohexanecarboxylate ("para-isomer" including cis- and trans- isomers); methyl 1,3-dimethylcyclohexanecarboxylate ("meta-isomer" including cis- and trans-isomers) | metil-1,4-dimetilciklohexánkarboxilát (cisz- és transz-izomereket tartalmazó „para-izomer”); metil-1,3-dimetilciklohexánkarboxilát (cisz- és transz-izomereket tartalmazó „meta-izomer”) keveréke | 444-920-4 | - | Aquatic
Chronic 3 |
H412 |
- |
H412 |
ATP01 | |||
| 607-690-00-8 | dimethyl[2S,2S']-6,6,6'6'-tetramethoxy-2,2'-[N,N'-bis(trifluoracetyl)-S,S'-bi(L-homocysteinyl) diimino]dihexanoate | dimetil[2S, 2S']-6,6,6'6'-tetrametoxi-2,2'-[N,N'-bisz(trifluoracetil)-S, S'-bi(L-homociszteinil)diimino]dihexanoát | 432-860-1 | 255387-46-3 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
ATP01 | |||
| 607-691-00-3 | magnesium salts, fatty acids, C16-18 and C18 unsaturated, branched and linear | magnéziumsók, zsírsavak, C16-18 és C18 telítetlen, elágazó és egyenes láncú | 448-690-6 | - | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 607-692-00-9 | zinc salts, fatty acids, C16-18 and C18 unsaturated, branched and linear | cinksók, zsírsavak, C16-18 és C18 telítetlen, elágazó és egyenes láncú | 446-470-4 | - | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 607-694-00-X | ethyl 5,5-diphenyl-2-isoxazoline-3-carboxylate | etil-5,5-difenil-2-izoxazolin-3-karboxilát | 443-870-0 | 163520-33-0 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
ATP01 | |||
| 607-696-00-0 | pentyl formate | pentil-formiát | 211-340-6 | 638-49-3 | Flam.
Liq. 3 STOT SE 3 Eye Irrit. 2 |
H226 H335 H319 |
GHS02 GHS07 Dgr |
H226 H319 H335 |
C | CLP00 | ||
| 607-697-00-6 | tert-butyl propionate | terc-butil-propionát | 20487-40-5 | Flam.
Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
C | CLP00 | |||
| 607-698-00-1 | 4-tert-butylbenzoic acid | 4-terc-butilbenzoesav | 202-696-3 | 98-73-7 | Repr.
1B Acute Tox. 4 STOT RE 1 |
H360F H302 H372 |
GHS07 GHS08 Dgr |
H360F H372 H302 |
ATP03 | |||
| 607-699-00-7 | bifenthrin (ISO); (2-methylbiphenyl-3-yl)methyl rel-(1R,3R)-3-[(1Z)-2-chloro-3,3,3-trifluoroprop-1-en-1-yl]-2,2-dimethylcyclopropanecarboxylate | bifentrin (ISO); (2-metilbifenil-3-il)metilrel-(1R,3R)-3-[(1Z)-2-klór-3,3,3-trifluorprop-1-en-1-il]-2,2-dimetilciklopropánkarboxilát | 82657-04-3 | Carc.
2 Acute Tox. 2 Acute Tox. 3 STOT RE 1 Skin Sens. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H351 H300 H331 H372 (nervous system) H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H300 H331 H317 H351 H372 (nervous system) H410 |
M=10000 M=100000 |
ATP05 | |||
| 607-700-00-0 | indoxacarb
(ISO); methyl
(4aS)-7-chloro-2-{(methoxycarbonyl)[4-(trifluoromethoxy)phenyl]carbamoyl}-2,5-dihydroindeno[1,2-e][1,3,4]oxadiazine-4a(3H)-carboxylate
[1] reaction mass of (S)- Indoxacarb and (R)- Indoxacarb 75:25; methyl 7-chloro-2-{(methoxycarbonyl)[4-(trifluoromethoxy)phenyl]carbamoyl}-2,5-dihydroindeno[1,2-e][1,3,4]oxadiazine-4a(3H)-carboxylate [2] |
indoxakarb
(ISO);
metil-(4aS)-7-klór-2-{(metoxikarbonil)[4-(trifluormetoxi)fenil]karbamoil}-2,5-dihidroindeno[1,2-e][1,3,4]oxadiazin-4a(3H)-karboxilát
[1] (S)-indoxakarb és (R)-indoxakarb 75:25 arányú keveréke; metil-7-klór-2-{(metoxikarbonil)[4-(trifluormetoxi)fenil]karbamoil}-2,5-dihidroindeno[1,2-e][1,3,4]oxadiazin-4a(3H)-karboxilát [2] |
173584-44-6
[1] 144171-61-9 [2] |
Acute
Tox. 3 Acute Tox. 4 STOT RE 1 Skin Sens. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H301 H332 H372 (blood, nervous system, heart) H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H301 H332 H317 H372 (blood, nervous system, heart) H410 |
M=1 M=1 |
ATP05 | |||
| 607-702-00-1 | dihexyl phthalate | dihexil-ftalát | 201-559-5 | 84-75-3 | Repr.
1B |
H360FD |
GHS08 Dgr |
H360FD |
ATP05 | |||
| 607-703-00-7 | ammoniumpentadeca- fluorooctanoate | ammónium-pentadekafluoroktanoát | 223-320-4 | 3825-26-1 | Carc.
2 Repr. 1B Lact. Acute Tox. 4 Acute Tox. 4 STOT RE 1 Eye Dam. 1 |
H351 H360D H362 H332 H302 H372 (liver) H318 |
GHS08 GHS07 GHS05 Dgr |
H302 H332 H318 H351 H360D H362 H372 (liver) |
ATP05 | |||
| 607-704-00-2 | perfluorooctanoic acid | perfluoroktánsav | 206-397-9 | 335-67-1 | Carc.
2 Repr. 1B Lact. Acute Tox. 4 Acute Tox. 4 STOT RE 1 Eye Dam. 1 |
H351 H360D H362 H332 H302 H372 (liver) H318 |
GHS08 GHS07 GHS05 Dgr |
H302 H332 H318 H351 H360D H362 H372 (liver) |
ATP05 | |||
| 607-705-00-8 | benzoic acid | benzoesav | 200-618-2 | 65-85-0 | STOT
RE 1 Skin Irrit. 2 Eye Dam. 1 |
H372
(lungs) (Inhalation) H315 H318 |
GHS08 GHS05 Dgr |
H315 H318 H372 (lungs) (Inhalation) |
ATP06 | |||
| 607-706-00-3 | methyl 2,5-dichlorobenzoate | metil-2,5-diklórbenzoát | 220-815-7 | 2905-69-3 | Acute
Tox. 4 STOT SE 3 Aquatic Chronic 2 |
H302 H336 H411 |
GHS07 GHS09 Wng |
H302 H336 H411 |
ATP06 | |||
| 607-707-00-9 | fenoxaprop-P-ethyl (ISO); ethyl (2R)-2-{4-[(6-chloro-1,3-benzoxazol-2-yl)oxy]phenoxy}propanoate | fenoxaprop-P-etil (ISO); etil (2R)-2-{4-[(6-klór-1,3-benzoxazol-2-il)-oxi]-fenoxi}-propanoát | 71283-80-2 | STOT
RE 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373
(kidneys) H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H317 H373 (kidneys) H410 |
M=1 M=1 |
ATP07 | |||
| 607-708-00-4 | octanoic acid | oktánsav; kálisó-kaprilsav | 204-677-5 | 124-07-2 | Skin
Corr. 1C Aquatic Chronic 3 |
H314 H412 |
GHS05 Dgr |
H314 H412 |
ATP07 | |||
| 607-709-00-X | decanoic acid | dekánsav | 206-376-4 | 334-48-5 | Skin
Irrit. 2 Eye Irrit. 2 Aquatic Chronic 3 |
H315 H319 H412 |
GHS07 Wng |
H315 H319 H412 |
ATP07 | |||
| 607-710-00-5 | 1,2-benzenedicarboxylic acid, dihexyl ester, branched and linear | 1,2-benzol-dikarboxilsav, dihexil-észter, elágazó és lineáris; diizohexil-ftalát (DIHP) | 271-093-5 | 68515-50-4 | Repr.
1B |
H360FD |
GHS08 Dgr |
H360FD |
ATP07 | |||
| 607-711-00-0 | spirotetramat (ISO); (5s,8s)-3-(2,5-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4,5]dec-3-en-4-yl ethyl carbonate | spirotetramát (ISO); (5s,8s)-3-(2,5-dimetil-fenil)-8-metoxi-2-oxo-1-azaspiro[4,5]dec-3-en-4-il-etil-karbonát | 203313-25-1 | Repr.
2 STOT SE 3 Eye Irrit. 2 Skin Sens. 1A Aquatic Acute 1 Aquatic Chronic 1 |
H361fd H335 H319 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H319 H317 H361fd H335 H410 |
M=1 M=1 |
ATP07 | |||
| 607-712-00-6 | dodemorph acetate; 4-cyclododecyl-2,6-dimethylmorpholin-4-ium acetate | dodemorf-acetát; 4-ciklododecil-2,6-dimetil-morfolin-4-ium-acetát | 250-778-2 | 31717-87-0 | Repr.
2 STOT RE 2 Skin Corr. 1C Skin Sens. 1A Aquatic Chronic 1 |
H361d H373 (liver) H314 H317 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H314 H317 H361d H373 (liver) H410 |
EUH071 |
M=1 |
ATP07 | |
| 607-713-00-1 | fenpyroximate (ISO); tert-butyl 4-[({(E)-[(1,3-dimethyl-5-phenoxy-1H-pyrazol-4-yl)methylene]amino}oxy)methyl]benzoate | fenpiroximát (ISO); terc-butil-4-[({(E)-[(1,3-dimetil-5-fenoxi-1H-pirazol-4-il)-metilén]amino}oxi)metil]benzoát | 134098-61-6 | Acute
Tox. 2 Acute Tox. 3 Skin Sens. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H330 H301 H317 H400 H410 |
GHS06 GHS09 Dgr |
H301 H330 H317 H410 |
M=100 M=1000 |
ATP07 | |||
| 607-714-00-7 | triflusulfuron-methyl; methyl 2-({[4-(dimethylamino)-6-(2,2,2- trifluoroethoxy)-1,3,5-triazin-2- yl]carbamoyl}sulfamoyl)-3- methylbenzoate | trifluszulfuron-metil; metil-2-({[4-(dimetil-amino)-6-(2,2,2-trifluor-etoxi)-1,3,5-triazin-2-il]karbamoil}szulfamoil)-3-metil-benzoát | 126535-15-7 | Carc.
2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
M=100 M=10 |
CLP00/ATP07 | |||
| 607-715-00-2 | bifenazate (ISO); isopropyl 2-(4-methoxybiphenyl-3-yl)hydrazinecarboxylate | bifenazát (ISO); izopropil-2-(4-metoxi-bifenil-3-il)hidrazin-karboxilát | 442-820-5 | 149877-41-8 | STOT
RE 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H317 H373 H410 |
M=1 M=1 |
ATP07 | ||
| 607-716-00-8 | bromadiolone (ISO); 3-[3-(4′-bromobiphenyl-4-yl)-3-hydroxy-1-phenylpropyl]-4-hydroxy-2H-chromen-2-one | bromadiolon (ISO); 3-[3-(4′-bromobifenil-4-il)-3-hidroxi-1-fenilpropil]-4-hidroxi-2H-kromén-2-on | 249-205-9 | 28772-56-7 | Repr.
1B Acute Tox. 1 Acute Tox. 1 Acute Tox. 1 STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360D H330 H310 H300 H372 (blood) H400 H410 |
GHS08 GHS06 GHS09 Dgr |
H330 H310 H300 H360D H372 (blood) H410 |
Repr.
1B; H360D: C ≥ 0,003 % STOT RE 1; H372: C ≥ 0,005 % STOT RE 2; H373: 0,0005 % ≤ C < 0,005 % M=1 M=1 |
ATP09 | ||
| 607-717-00-3 | difethialone
(ISO); 3-[3-(4′-bromobiphenyl-4-yl)-1,2,3,4-tetrahydronaphthalen-1-yl]-4-hydroxy-2H-1-benzothiopyran-2-one |
difetialon
(ISO); 3-[3-(4′-bromobifenil-4-il)-1,2,3,4-tetrahidronaftalin-1-il]-4-hidroxi-2H-1-benzotiopirán-2-on |
104653-34-1 | Repr.
1B Acute Tox. 1 Acute Tox. 1 Acute Tox. 1 STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360D H330 H310 H300 H372 (blood) H400 H410 |
GHS08 GHS06 GHS09 Dgr |
H330 H310 H300 H360D H372 (blood) H410 |
EUH070 |
Repr.
1B; H360D: C ≥ 0,003 % STOT RE 1; H372: C ≥ 0,02 % STOT RE 2; H373: 0,002 % ≤ C < 0,02 % M=100 M=100 |
ATP09 | ||
| 607-718-00-9 | perfluorononan-1-oic
acid [1] perfluorononan-1-oic acid sodium salt [2] perfluorononan-1-oic acid ammonium salt [3] |
perfluornonán-1-oik sav [1], valamint nátrium [2] és ammónium [3] sói | 206-801-3
[1] |
375-95-1
[1] 21049-39-8 [2] 4149-60-4 [3] |
Carc.
2 Repr. 1B Lact. Acute Tox. 4 Acute Tox. 4 STOT RE 1 Eye Dam. 1 |
H351 H360Df H362 H332 H302 H372 (liver, thymus, spleen) H318 |
GHS08 GHS07 GHS05 Dgr |
H332 H302 H318 H351 H360Df H362 H372 (liver, thymus, spleen) |
ATP09 | |||
| 607-719-00-4 | dicyclohexyl phthalate | diciklohexil-ftalát | 201-545-9 | 84-61-7 | Repr.
1B Skin Sens. 1 |
H360D H317 |
GHS08 GHS07 Dgr |
H317 H360D |
ATP09 | |||
| 607-720-00-X | nonadecafluorodecanoic
acid [1] ammonium nonadecafluorodecanoate [2] sodium nonadecafluorodecanoate [3] |
nonadekafluordekán
sav; [1] ammónium-nonadekafluordekanoát; [2] nátrium-nonadekafluordekanoát [3] |
206-400-3
[1] 221-470-5 [2] |
335-76-2
[1] 3108-42-7 [2] 3830-45-3 [3] |
Carc.
2 Repr. 1B Lact. |
H351 H360Df H362 |
GHS08 Dgr |
H351 H360Df H362 |
ATP10 | |||
| 607-721-00-5 | N,N′-methylenedimorpholine; N,N′-methylenebismorpholine; [formaldehyde released from N,N′-methylenebismorpholine]; [MBM] |
N,N′-metiléndimorfolin; N,N′-metilénbiszmorfolin; (N,N′-metilénbiszmorfolinból felszabaduló formaldehid); [MBM] |
227-062-3 | 5625-90-1 | Carc.
1B Muta. 2 Acute Tox. 4 Acute Tox. 4 Acute Tox. 4 STOT RE 2 Skin Corr. 1B Eye Dam. 1 Skin Sens. 1 |
H350 H341 H332 H312 H302 H373 (gastrointestinal tract, respiratory tract) H314 H318 H317 |
GHS08 GHS07 GHS05 Dgr |
H332 H312 H302 H314 H317 H341 H350 H373 (gastrointestinal tract, respiratory tract) |
EUH071 |
8 9 | ATP10 | |
| 607-722-00-0 | 2,3,5,6-tetrafluoro-4-(methoxymethyl)benzyl
(Z)-(1R,3R)-3-(2-cyanoprop-1-enyl)-2,2-dimethylcyclopropanecarboxylate; epsilon-momfluorothrin |
2,3,5,6-tetrafluor-4-(metoximetil)benzil
(Z)-(1R,3R)-3-(2-ciánprop-1-enil)-2,2-dimetilciklopropánkarboxilát; epszilon-momfluortrin |
1065124-65-3 | Acute
Tox. 4 STOT SE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H371 (nervous system) H400 H410 |
GHS07 GHS08 GHS09 Wng |
H302 H371 (nervous system) H410 |
M=100 M=100 |
ATP10 | |||
| 607-723-00-6 | tefluthrin
(ISO); 2,3,5,6-tetrafluoro-4-methylbenzyl (1RS,3RS)-3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropanecarboxylate |
teflutrin
(ISO); 2,3,5,6-tetrafluor-4-metilbenzil (1RS,3RS)-3-[(Z)-2-klór-3,3,3-trifluorprop-1-enil]-2,2-dimetilciklopropánkarboxilát |
79538-32-2 | Acute
Tox. 1 Acute Tox. 2 Acute Tox. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H300 H410 |
M=10000 M=10000 |
ATP10 | |||
| 607-724-00-1 | 2,3,5,6-tetrafluoro-4-(methoxymethyl)benzyl
(1R,3R)-2,2-dimethyl-3-[(1Z)-prop-1-en-1-yl] cyclopropanecarboxylate; epsilon-metofluthrin |
2,3,5,6-tetrafluor-4-(metoximetil)benzil-(1R,3R)-2,2-dimetil-3-[(1Z)-prop-1-en-1-il]ciklopropánkarboxilát; epszilon-metoflutrin | 240494-71-7 | Acute
Tox. 3 Acute Tox. 4 STOT SE 1 STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H332 H370 (nervous system) H373 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H332 H301 H370 (nervous system) H373 H410 |
M=100 M=100 |
ATP13 | |||
| 607-725-00-7 | isopropyl
(2E,4E,7S)-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate; S-methoprene |
izopropil-(2E,4E,7S)-11-metoxi-3,7,11-trimetil-dodeka-2,4-dienoát; S-metoprén | 65733-16-6 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
M=1 M=1 |
ATP13 | |||
| 607-726-00-2 | pinoxaden
(ISO); 8-(2,6-diethyl-4-methylphenyl)-7-oxo-1,2,4,5-tetrahydro-7H-pyrazolo[1,2-d][1,4,5]oxadiazepin-9-yl 2,2-dimethylpropanoate |
pinoxadén
(ISO); 8-(2,6-dietil-4-metilfenil)-7-oxo-1,2,4,5-tetrahidro-7H-pirazolo[1,2-d][1,4,5]oxadiazepin-9-il-2,2-dimetilpropanoát |
243973-20-8 | Repr.
2 Acute Tox. 4 Acute Tox. 4 STOT SE 3 Eye Irrit. 2 Skin Sens. 1A Aquatic Acute 1 Aquatic Chronic 3 |
H361d H332 H302 H335 H319 H317 H400 H412 |
GHS08 GHS07 GHS09 Wng |
H332 H302 H319 H317 H361d H335 H410 |
Inhalation:
ATE = 4.63 mg/L (dusts/mists) Oral: ATE = 500 mg/kg M=1 |
ATP13 | |||
| 607-727-00-8 | tetramethrin
(ISO); (1,3-dioxo-1,3,4,5,6,7-hexahydro-2H-isoindol-2-yl)methyl 2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropanecarboxylate |
tetrametrin
(ISO); (1,3-dioxo-1,3,4,5,6,7-hexahidro-2H-izoindol-2-il)metil-2,2-dimetil-3-(2-metilprop-1-en-1-il)-ciklopropánkarboxilát |
231-711-6 | 7696-12-0 | Carc.
2 Acute Tox. 4 STOT SE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H371 (nervous system) (Inhalation) H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H351 H371 (nervous system) (Inhalation) H410 |
M=100 M=100 |
ATP13 | ||
| 607-728-00-3 | (1,3,4,5,6,7-hexahydro-1,3-dioxo-2H-isoindol-2-yl)methyl (1R-trans)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate | (1,3,4,5,6,7-hexahidro-1,3-dioxo-2H-izoindol-2-il)metil-(1R-transz)-2,2-dimetil-3-(2-metilprop-1-enil)-ciklopropánkarboxilát | 214-619-0 | 1166-46-7 | Carc.
2 Acute Tox. 4 STOT SE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H371 (nervous system) (Inhalation) H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H351 H371 (nervous system) (Inhalation) H410 |
M=100 M=100 |
ATP13 | ||
| 607-729-00-9 | mesosulfuron-methyl
(ISO); methyl 2-[(4,6-dimethoxypyrimidin-2-ylcarbamoyl)sulfamoyl]-α-(methanesulfonamido)-p-toluate; |
mezoszulfuron-metil
(ISO); metil-2-[(4,6-dimetoxipirimidin-2-ilkarbamoil)szulfamoil]-α-(metánszulfonamido)-p-toluát; |
208465-21-8 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
M=100 M=100 |
ATP13 | |||
| 607-730-00-4 | spirodiclofen
(ISO); 3-(2,4-dichlorophenyl)-2-oxo-1-oxaspiro[4.5]dec-3-en-4-yl 2,2-dimethylbutyrate |
spirodiklofen
(ISO); 3-(2,4-diklór-fenil)-2-oxo-1-oxaspiro[4.5]dec-3-én-4-il-2,2-dimetilbutirát |
148477-71-8 | Carc.
1B Repr. 2 STOT RE 2 Skin Sens. 1B Aquatic Chronic 1 |
H350 H361f H373 H317 H410 |
GHS08 GHS07 GHS09 Dgr |
H317 H350 H361f H373 H410 |
M=10 |
ATP13 | |||
| 607-731-00-X | sodium methyl [(4-aminophenyl)sulphonyl]carbamate; sodium methyl (EZ)-sulfanilylcarbonimidate; asulam-sodium | nátrium-metil-[(4-aminofenil)szulfonil]karbamát; nátrium-metil-(EZ)-szulfanilil-karbonimidát; aszulam-nátrium | 218-953-8 | 2302-17-2 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
M=1 M=1 |
ATP13 | ||
| 607-732-00-5 | salicylic acid | szalicilsav | 200-712-3 | 69-72-7 | Repr.
2 Acute Tox. 4 Eye Dam. 1 |
H361d H302 H318 |
GHS08 GHS07 GHS05 Dgr |
H302 H318 H361d |
ATP13 | |||
| 607-733-00-0 | cyflumetofen
(ISO); 2-methoxyethyl (RS)-2-(4- tert-butylphenyl)-2-cyano-3-oxo-3-(α,α,α-trifluoro-o-tolyl)propionate |
#HIÁNYZIK | 400882-07-7 | Carc.
2 Skin Sens. 1A |
H351 H317 |
GHS07 GHS08 Wng |
H317 H351 |
ATP14 | ||||
| 607-734-00-6 | pentapotassium 2,2’,2’’,2’’’,2’’’’-(ethane-1,2-diylnitrilo)pentaacetate | #HIÁNYZIK | 404-290-3 | 7216-95-7 | Acute
Tox. 4 STOT RE 2 Eye Irrit. 2 |
H332 H373 (Inhalation) H319 |
GHS07 GHS08 Dgr |
H332 H319 H373 (Inhalation) |
Inhalation:
ATE = 1.5 mg/L (dusts/mists) |
ATP14 | ||
| 607-735-00-1 | N-carboxymethyliminobis(ethylenenitrilo)tetra(acetic acid) | #HIÁNYZIK | 200-652-8 | 67-43-6 | Acute
Tox. 4 STOT RE 2 Eye Irrit. 2 |
H332 H373 (Inhalation) H319 |
GHS07 GHS08 Dgr |
H332 H319 H373 (Inhalation) |
Inhalation:
ATE = 1.5 mg/L (dusts/mists) |
ATP14 | ||
| 607-736-00-7 | pentasodium (carboxylatomethyl)iminobis(ethylenenitrilo)tetraacetate | #HIÁNYZIK | 205-391-3 | 140-01-2 | Acute
Tox. 4 STOT RE 2 |
H332 H373 (Inhalation) |
GHS07 GHS08 Dgr |
H332 H373 (Inhalation) |
Inhalation:
ATE = 1.5 mg/L (dusts/mists) |
ATP14 | ||
| 607-737-00-2 | diisohexyl phthalate | #HIÁNYZIK | 276-090-2 | 71850-09-4 | Repr.
1B |
H360FD |
GHS08 Dgr |
H360FD |
ATP14 | |||
| 607-738-00-8 | MCPA-thioethyl (ISO); S-ethyl (4-chloro-2- methylphenoxy)ethanethioate; S-ethyl 4- chloro-o-tolyloxythioacetate | #HIÁNYZIK | 246-831-4 | 25319-90-8 | Acute
Tox. 4 STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 (liver) H400 H410 |
GHS07 GHS08 GHS09 Wng |
H302 H373 (liver) H410 |
Oral:
ATE = 450 mg/kg M=10 M=10 |
ATP15 | ||
| 607-740-00-9 | diisooctyl phthalate | #HIÁNYZIK | 248-523-5 | 27554-26-3 | Repr.
1B |
H360FD |
GHS08 Dgr |
H360FD |
ATP15 | |||
| 607-741-00-4 | 4-{[(6-chloropyridin-3-yl)methyl](2,2-difluoroethyl)amino}furan-2(5H)-one; flupyradifurone | #HIÁNYZIK | 951659-40-8 | Acute
Tox. 4 STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 (muscle) H400 H410 |
GHS07 GHS08 GHS09 Wng |
H302 H373 (muscle) H410 |
Oral:
ATE = 500 mg/kg M=10 M=10 |
ATP15 | |||
| 607-742-00-X | thiencarbazone-methyl (ISO); methyl 4-[(4,5-dihydro-3-methoxy-4- methyl-5-oxo-1H-1,2,4-triazol-1-yl)carbonylsulfamoyl]-5- methylthiophene-3- carboxylate | #HIÁNYZIK | 317815-83-1 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
M=1000 M=1000 |
ATP15 | |||
| 607-743-00-5 | L-(+)-lactic acid; (2S)-2-hydroxypropanoic acid | #HIÁNYZIK | 201-196-2 | 79-33-4 | Skin
Corr. 1C Eye Dam. 1 |
H314 H318 |
GHS05 Dgr |
H314 |
EUH071 |
ATP15 | ||
| 607-744-00-0 | 2-methoxyethyl acrylate | #HIÁNYZIK | 221-499-3 | 3121-61-7 | Flam.
Liq. 3 Muta. 2 Repr. 1B Acute Tox. 3 Acute Tox. 4 Skin Corr. 1C Eye Dam. 1 Skin Sens. 1 |
H226 H341 H360FD H331 H302 H314 H318 H317 |
GHS02 GHS05 GHS06 GHS08 Dgr |
H226 H331 H302 H314 H317 H341 H360FD |
EUH071 |
Inhalation:
ATE = 2.7 mg/L (Vapours) Oral: ATE = 404 mg/kg |
ATP15 | |
| 607-745-00-6 | glyoxylic acid ...% | #HIÁNYZIK | 206-058-5 | 298-12-4 | Eye
Dam. 1 Skin Sens. 1B |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
B | ATP15 | ||
| 607-746-00-1 | sodium N-(hydroxymethyl)glycinate; [formaldehyde released from sodium N-(hydroxymethyl)glycinate] | #HIÁNYZIK | 274-357-8 | 70161-44-3 | Carc.
1B Muta. 2 Acute Tox. 4 Acute Tox. 4 STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H350 H341 H332 H302 H335 H315 H319 H317 |
GHS08 GHS07 Dgr |
H332 H302 H315 H319 H317 H341 H350 H335 |
Inhalation:
ATE = 3 mg/L (dusts/mists) Oral: ATE = 1100 mg/kg |
8 9 | ATP15 | |
| 608-001-00-3 | acetonitrile; cyanomethane | acetonitril; cianometán | 200-835-2 | 75-05-8 | Flam.
Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 |
H225 H332 H312 H302 H319 |
GHS02 GHS07 Dgr |
H225 H332 H312 H302 H319 |
CLP00 | |||
| 608-002-00-9 | trichloroacetonitrile | triklóracetonitril | 208-885-7 | 545-06-2 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Chronic 2 |
H331 H311 H301 H411 |
GHS06 GHS09 Dgr |
H331 H311 H301 H411 |
CLP00 | |||
| 608-003-00-4 | acrylonitrile | akrilnitril | 203-466-5 | 107-13-1 | Flam.
Liq. 2 Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H225 H350 H331 H311 H301 H335 H315 H318 H317 H411 |
GHS02 GHS06 GHS08 GHS05 GHS09 Dgr |
H225 H350 H331 H311 H301 H335 H315 H318 H317 H411 |
* |
D | CLP00 | |
| 608-004-00-X | 2-hydroxy-2-methylpropionitrile; 2-cyanopropan-2-ol; acetone cyanohydrin | 2-hidroxi-2-metilpropionitril; 2-cianopropán-2-ol; aceton-ciánhidrin | 200-909-4 | 75-86-5 | Acute
Tox. 1 Acute Tox. 2 * Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H330 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H300 H410 |
CLP00 | |||
| 608-005-00-5 | n-butyronitrile | n-butironitril | 203-700-6 | 109-74-0 | Flam.
Liq. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H225 H331 H311 H301 |
GHS02 GHS06 Dgr |
H225 H331 H311 H301 |
CLP00/ATP01 | |||
| 608-006-00-0 | bromoxynil (ISO); 3,5-dibromo-4-hydroxybenzonitrile; bromoxynil phenol | bromoxinil (ISO); 3,5-dibróm-4-hidroxibenzonitril; bromoxinilfenol | 216-882-7 | 1689-84-5 | Repr.
2 Acute Tox. 2 * Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361d
*** H330 H301 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H361d
*** H330 H301 H317 H410 |
M=10 |
CLP00 | ||
| 608-007-00-6 | ioxynil (ISO); 4-hydroxy-3,5-diiodobenzonitrile | ioxinil (ISO); 4-hidroxi-3,5-dijódbenzonitril | 216-881-1 | 1689-83-4 | Repr.
2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H361d
*** H331 H301 H312 H373 ** H319 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H361d
*** H331 H301 H312 H373 ** H319 H410 |
M=10 |
CLP00 | ||
| 608-008-00-1 | chloroacetonitrile | klóracetonitril | 203-467-0 | 107-14-2 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Chronic 2 |
H331 H311 H301 H411 |
GHS06 GHS09 Dgr |
H331 H311 H301 H411 |
CLP00 | |||
| 608-009-00-7 | malononitrile | malonsav-dinitril | 203-703-2 | 109-77-3 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H410 |
CLP00 | |||
| 608-010-00-2 | methacrylonitrile; 2-methyl-2-propene nitrile | metakrilnitril; 2-metil-2-propénnitril | 204-817-5 | 126-98-7 | Flam.
Liq. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Sens. 1 |
H225 H331 H311 H301 H317 |
GHS02 GHS06 Dgr |
H225 H331 H311 H301 H317 |
* Skin Sens. 1; H317: C ≥ 0,2 % |
D | CLP00 | |
| 608-011-00-8 | oxalonitrile; cyanogen | oxalonitril; cianogén | 207-306-5 | 460-19-5 | Flam.
Gas 1 Press. Gas Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H220 H331 H400 H410 |
GHS02 GHS04 GHS06 GHS09 Dgr |
H220 H331 H410 |
U | CLP00/ATP01corr | ||
| 608-012-00-3 | benzonitrile | benzonitril | 202-855-7 | 100-47-0 | Acute
Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
CLP00 | |||
| 608-013-00-9 | 2-chlorobenzonitrile | 2-klórbenzonitril | 212-836-5 | 873-32-5 | Acute
Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 |
H312 H302 H319 |
GHS07 Wng |
H312 H302 H319 |
CLP00 | |||
| 608-014-00-4 | chlorothalonil (ISO); tetrachloroisophthalonitrile | klórtalonil (ISO); tetraklórizoftalonitril | 217-588-1 | 1897-45-6 | Carc.
2 Acute Tox. 2 * STOT SE 3 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H330 H335 H318 H317 H400 H410 |
GHS06 GHS05 GHS08 GHS09 Dgr |
H351 H330 H335 H318 H317 H410 |
M=10 |
CLP00/ATP01 | ||
| 608-015-00-X | dichlobenil (ISO); 2,6-dichlorobenzonitrile | diklobenil (ISO);2,6-diklórbenzonitril | 214-787-5 | 1194-65-6 | Acute
Tox. 4 * Aquatic Chronic 2 |
H312 H411 |
GHS07 GHS09 Wng |
H312 H411 |
CLP00 | |||
| 608-016-00-5 | 1,4-Dicyano-2,3,5,6-tetra-chloro-benzene | 1,4-diciano-2,3,5,6-tetraklórbenzol | 401-550-8 | 1897-41-2 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
CLP00 | |||
| 608-017-00-0 | bromoxynil octanoate (ISO); 2,6-dibromo-4-cyanophenyl octanoate | bromoxinil-oktanoát (ISO); 2,6-dibróm-4-cianofenil-oktanoát | 216-885-3 | 1689-99-2 | Repr.
2 Acute Tox. 3 * Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361d
*** H331 H302 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H361d
*** H331 H302 H317 H410 |
M=10 |
CLP00 | ||
| 608-018-00-6 | ioxynil octanoate (ISO); 4-cyano-2,6-diiodophenyl octanoate | ioxinil-oktanoát (ISO); 4-ciano-2,6-dijódfenil-oktanoát | 223-375-4 | 3861-47-0 | Repr.
2 Acute Tox. 3 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361d
*** H301 H319 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H361d
*** H301 H319 H317 H410 |
M=10 |
CLP00 | ||
| 608-019-00-1 | 2,2'-dimethyl-2,2'-azodipropiononitrile; ADZN | 2,2'-dimetil-2,2'-azodipropiononitril; ADZN | 201-132-3 | 78-67-1 | Self-react.
C Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 3 |
H242 H332 H302 H412 |
GHS02 GHS07 Dgr |
H242 H332 H302 H412 |
T | CLP00 | ||
| 608-020-00-7 | diphenoxymethylenecyanamide | difenoximetilénciánamid | 427-300-8 | 79463-77-7 | Eye
Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
ATP01 | |||
| 608-021-00-2 | 3-(2-(diaminomethyleneamino)thiazol-4-ylmethylthio)propionitrile | 3-(2-(diaminometilénamino)tiazol-4-ilmetiltio)propionitril | 403-710-2 | 76823-93-3 | Acute
Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
CLP00 | |||
| 608-022-00-8 | 3,7-dimethyloctanenitrile | 3,7-dimetiloktánnitril | 403-620-3 | 40188-41-8 | Skin
Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H315 H317 H411 |
GHS07 GHS09 Wng |
H315 H317 H411 |
CLP00 | |||
| 608-023-00-3 | fenbuconazole (ISO); 4-(4-chlorophenyl)-2-phenyl-2-[(1H-1,2,4-triazol-1-yl)methyl]butanenitrile | fenbukonazol (ISO); 4-(4-klórfenil)-2-fenil-2-[(1H-1,2,4-triazol-1-il)metil]butánnitril | 406-140-2 | 114369-43-6 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 608-024-00-9 | 2-(4-(N-butyl-N-phenethylamino)phenyl)ethylene-1,1,2-tricarbonitrile | 2-(4-(N-butil-N-fenetilamino)fenil)etilén-1,1,2-trikarbonitril | 407-650-8 | 97460-76-9 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 608-025-00-4 | 2-nitro-4,5-bis(benzyloxy)phenylacetonitrile | 2-nitro-4,5-bisz(benziloxi)fenilacetonitril | 410-970-0 | 117568-27-1 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 608-026-00-X | 3-cyano-3,5,5-trimethylcyclohexanone | 3-ciano-3,5,5-trimetilciklohexanon | 411-490-4 | 7027-11-4 | Acute
Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Chronic 3 |
H302 H373 ** H317 H412 |
GHS08 GHS07 Wng |
H302 H373 ** H317 H412 |
CLP00 | |||
| 608-027-00-5 | reaction mass of: 3-(4-ethylphenyl)-2,2-dimethylpropanenitrile; 3-(2-ethylphenyl)-2,2-dimethylpropanenitrile; 3-(3-ethylphenyl)-2,2-dimethylpropanenitrile | 3-(4-etilfenil)-2,2-dimetilpropánnitril; 3-(2-etilfenil)-2,2-dimetilpropánnitril; 3-(3-etilfenil)-2,2-dimetilpropánnitril keveréke | 412-660-0 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | ||||
| 608-028-00-0 | 4-(2-cyano-3-phenylamino-acryloyloxymethyl)-cyclohexyl-methyl 2-cyano-3-phenylamino)-acrylate | 4-(2-ciano-3-fenilamino)akriloiloximetil-ciklohexilmetil(2-ciano-3-fenilamino)-akrilát | 413-510-7 | 147374-67-2 | STOT
RE 2 * Skin Sens. 1 Aquatic Chronic 2 |
H373
** H317 H411 |
GHS08 GHS09 Wng |
H373
** H317 H411 |
CLP00 | |||
| 608-029-00-6 | 1,2-dihydro-6-hydroxy-4-methyl-1-[3-(1-methylethoxy)propyl]-2-oxo-3-pyridinecarbonitrile | 1,2-dihidro-6-hidroxi-4-metil-1-[3-(1-metiletoxi)propil]-2-oxo-3-piridinkarbonitril | 411-990-2 | 68612-94-2 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 608-030-00-1 | N-acetyl-N-[5-cyano-3-(2-dibutylamino-4-phenylthyazol-5-yl-methylene)-4-methyl-2,6-dioxo-1,2,3,6-tetrahydropyridin-1-yl]benzamide | N-acetil-N-[5-ciano-3-(2-dibutilamino-4-feniltiazol-5-ilmetilén)-4-metil-2,6-dioxo-1,2,3,6-tetrahidropiridin-1-il]benzamid | 412-340-0 | 147741-93-3 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 608-031-00-7 | 2-benzyl-2-methyl-3-butenitrile | 2-benzil-2-metil-3-buténnitril | 407-870-4 | 97384-48-0 | Acute
Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
CLP00 | |||
| 608-032-00-2 | acetamiprid (ISO); (E)-N1-[(6-chloro-3-pyridyl)methyl]-N2-cyano-N1-methylacetamidine | acetamiprid
(ISO); (E)-N 1-[(6-klór-3-piridil)metil]-N 2-ciano-N 1-metil-acetamidin |
- | 135410-20-7 | Acute
Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
ATP01 | |||
| 608-033-00-8 | N-butyl-3-(2-chloro-4-nitrophenylhydrazono)-1-cyano-2-methylprop-1-ene-1,3-dicarboximide | N-butil-3-(2-klór-4-nitrofenilhidrazono)-1-ciano-2-metilprop-1-én-1,3-dikarboximid | 407-970-8 | 75511-91-0 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
CLP00 | |||
| 608-034-00-3 | chlorfenapyr (ISO); 4-bromo-2-(4-chlorophenyl)-1-ethoxymethyl-5-trifluoromethylpyrrole-3-carbonitrile | klórfenapir
(ISO); 4-bróm-2-(4-klórfenil)-1-etoximetil-5-trifluormetilpirrol-3-karbonitril |
- | 122453-73-0 | Acute
Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H302 H400 H410 |
GHS06 GHS09 Dgr |
H331 H302 H410 |
M=100 |
CLP00/ATP01 | ||
| 608-035-00-9 | (±)-α-[(2-acetyl-5-methylphenyl)-amino]-2,6-dichlorobenzene-aceto-nitrile | (±)-α-[(2-acetil-5-metilfenil)amino]-2,6-diklórbenzol-acetonitril | 419-290-9 | Skin
Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
CLP00 | ||||
| 608-036-00-4 | 3-(2-{}{4-[2-(4-cyanophenyl)vinyl]phenyl}}vinyl)benzonitrile | 3-(2-{4-[2-(4-cianofenil)vinil]fenil}vinil)benzonitril | 419-060-8 | 79026-02-1 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 608-037-00-X | reaction mass of: (E)-2,12-tridecadiennitrile; (E)-3,12-tridecadiennitrile; (Z)-3,12-tridecadiennitrile | (E)-2,12-tridekadiénnitril; (E)-3,12-tridekadiénnitril; (Z)-3,12-tridekadiénnitril keveréke | 422-190-8 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | ||||
| 608-038-00-5 | 2,2,4-trimethyl-4-phenyl-butane-nitrile | 2,2,4-trimetil-4-fenilbutánnitril | 422-580-8 | 75490-39-0 | Acute
Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
CLP00 | |||
| 608-039-00-0 | 2-phenylhexanenitrile | 2-fenilhexánnitril | 423-460-8 | 3508-98-3 | Acute
Tox. 4 Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
Oral:
ATE = 500 mg/kg |
CLP00/ATP14 | ||
| 608-040-00-6 | 4,4'-dithiobis(5-amino-1-(2,6-dichloro-4-(trifluoromethyl)phenyl)-1H-pyrazole-3-carbonitrile) | 4,4’-ditiobisz(5-amino-1-(2,6-diklór-4-(trifluormetil)fenil)-1H-pirazol-3-karbonitril) | 423-490-1 | 130755-46-3 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 608-041-00-1 | 4'-((2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-ene-3-yl)methyl)(1,1'-biphenyl)-2-carbonitrile | 4’-((2-butil-4-oxo-1,3-diazaspiro[4,4]non-1-én-3-il)metil)(1,1’-bifenil)-2-karbonitril | 423-500-4 | 138401-24-8 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 608-042-00-7 | (S)-2,2-diphenyl-2-(3-pyrrolidinyl)acetonitrile hydrobromide | (S)-2,2-difenil-2-(3-pirrolidinil)acetonitril-hidrobromid | 421-810-4 | 194602-27-2 | Acute
Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H302 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H317 H411 |
ATP01 | |||
| 608-043-00-2 | 3-(cis-3-hexenyloxy)propanenitril | 3-(cisz-3-hexeniloxi)propánnitril | 415-220-6 | 142653-61-0 | Acute
Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H302 H400 H410 |
GHS06 GHS09 Dgr |
H331 H302 H410 |
CLP00 | |||
| 608-044-00-8 | 2-cyclohexylidene-2-phenylacetonitrile | 2-ciklohexilidén-2-fenilacetonitril | 423-740-1 | 10461-98-0 | Acute
Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
ATP01 | |||
| 608-046-00-9 | 5-(4-chloro-2-nitro-phenylazo)-1,2-dihydro-6-hydroxy-1,4-dimethyl-2-oxo-pyridine-3-carbonitrile | 5-(4-klór-2-nitrofenilazo)-1,2-dihidro-6-hidroxi-1,4-dimetil-2-oxopiridin-3-karbonitril | 425-310-7 | 77889-90-8 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 608-047-00-4 | 2-piperidin-1-yl-benzonitrile | 2-piperidin-1-il-benzonitril | 427-330-1 | 72752-52-4 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
ATP01 | |||
| 608-048-00-X | 1-(3-cyclopentyloxy-4-methoxyphenyl)-4-oxo-cyclohexanecarbonitrile | 1-(3-ciklopentiloxi-4-metoxifenil)-4-oxociklohexán-karbonitril | 427-450-4 | 152630-47-2 | Acute
Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H373 ** H317 H411 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H317 H411 |
ATP01 | |||
| 608-049-00-5 | 2-(4-(4-(butyl-(1-methylhexyl)amino)phenyl)-3-cyano-5-oxo-1,5-dihydropyrrol-2-ylidene)propandinitrile | 2-(4-(4-(butil-(1-metilhexil)amino)fenil)-3-ciano-5-oxo-1,5-dihidropirrol-2-ilidén)propándinitril | 429-180-2 | 157362-53-3 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
ATP01 | |||
| 608-050-00-0 | reaction mass of: 5-(2-cyano-4-nitrophenylazo)-2-(2-(2-hydroxyethoxy)ethylamino)-4-methyl-6-phenylaminonicotinonitrile; 5-(2-cyano-4-nitrophenylazo)-6-(2-(2-hydroxyethoxy)ethylamino)-4-methyl-2-phenylaminonicotinonitrile | 5-(2-ciano-4-nitrofenilazo)-2-(2-(2-hidroxietoxi)etilamino)-4-metil-6-fenilaminonikotinonitril; 5-(2-ciano-4-nitrofenilazo)-6-(2-(2-hidroxietoxi)etilamino)-4-metil-2-fenilaminonikotinonitril keveréke |
429-760-5 | - | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 608-051-00-6 | (R)-4-(4-dimethylamino-1-(4-fluorophenyl)-1-hydroxybutyl)-3-(hydroxymethyl)benzonitrile | (R)-4-(4-dimetilamino-1-(4-fluorfenil)-1-hidroxibutil)-3-(hidroximetil)benzonitril | 430-760-2 | 219861-18-4 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
ATP01 | |||
| 608-052-00-1 | (S)-4-(4-dimethylamino-1-(4-fluorophenyl)-1-hydroxybutyl)-3-(hydroxymethyl)benzonitrile | (S)-4-(4-dimetilamino-1-(4-fluorfenil)-1-hidroxibutil)-3-(hidroximetil)benzonitril | 430-770-7 | 128173-52-4 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
ATP01 | |||
| 608-053-00-7 | (R,S)-4-(4-dimethylamino-1-(4-fluorophenyl)-1-hydroxybutyl)-3-(hydroxymethyl)benzonitrile | (R,S)-4-(4-dimetilamino-1-(4-fluorfenil)-1-hidroxibutil)-3-(hidroximetil)benzonitril | 430-780-1 | 103146-25-4 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
ATP01 | |||
| 608-054-00-2 | (R,S)-4-(4-dimethylamino-1-(4-fluorophenyl)-1-hydroxybutyl)-3-(hydroxymethyl)benzonitrile hemisulfate | (R,S)-4-(4-dimetilamino-1-(4-fluorfenil)-1-hidroxibutil)-3-(hidroximetil)benzonitril-hemiszulfát | 430-790-6 | - | Acute
Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H302 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H317 H411 |
ATP01 | |||
| 608-055-00-8 | fipronil (ISO); (±)-5-amino-1-(2,6-dichloro-α,α,α-trifluoro-para-tolyl)-4-trifluoromethylsulfinyl-pyrazole-3-carbonitrile | fipronil
(ISO); (±)-5-amino-1-(2,6-diklór-α,α,α-trifluor-para-tolil)-4-trifluormetilszulfinil-pirazol-3-karbonitril |
424-610-5 | 120068-37-3 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H372 * H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H331 H311 H301 H372 * H410 |
M=1000 M=10000 |
ATP01/ATP10 | ||
| 608-056-00-3 | N-methyl-N-cyanomethylmorpholiniummethylsulfate | N-metil-N-cianometilmorfolinium-metilszulfát | 429-340-1 | - | Acute
Tox. 4 * Eye Dam. 1 |
H302 H318 |
GHS05 GHS07 Dgr |
H302 H318 |
ATP01 | |||
| 608-057-00-9 | 4-(cyanomethyl)-4-methylmorpholin-4-ium hydrogen sulfate | 4-cianometil-4-metilmorfolin-4-ium-hidrogénszulfát | 431-200-1 | 208538-34-5 | Acute
Tox. 4 * Eye Dam. 1 Skin Sens. 1 |
H302 H318 H317 |
GHS05 GHS07 Dgr |
H302 H318 H317 |
ATP01/ATP01corr | |||
| 608-058-00-4 | esfenvalerate (ISO); (S)-a-cyano-3-phenoxybenzyl-(S)-2-(4-chlorophenyl)-3-methylbutyrate | eszfenvalerát
(ISO); (S)-α-ciano-3-fenoxibenzil-(S)-2-(4-klórfenil)-3-metilbutirát |
66230-04-4 | Acute
Tox. 3 * Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H317 H400 H410 |
GHS06 GHS09 Dgr |
H301 H331 H317 H410 |
M=10000 |
CLP00/ATP01corr | |||
| 608-059-00-X | 5-amino-1-(2,6-dichloro-4-(trifluoromethyl)phenyl)-1H-pyrazole-3-carbonitrile | 5-amino-1-(2,6-diklór-4-(trifluormetil)fenil)-1H-pirazol-3-karbonitril | 421-240-6 | 120068-79-3 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
ATP01 | |||
| 608-060-00-5 | 5-methyl-2-[(2-nitrophenyl)amino]-3-thiophenecarbonitrile | 5-metil-2-[(2-nitrofenil)amino]-3-tiofénkarbonitril | 421-300-1 | 138564-59-7 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
ATP01 | |||
| 608-062-00-6 | 2-fluoro-4-hydroxybenzonitrile | 2-fluor-4-hidroxibenzonitril | 422-810-7 | 82380-18-5 | Acute
Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
ATP01 | |||
| 608-063-00-1 | (S)-α-hydroxy-3-phenoxy-benzeneacetonitrile | (S)-α-hidroxi-3-fenoxi-benzolacetonitril | 441-070-6 | 61826-76-4 | Acute
Tox. 3 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H318 H317 H400 H410 |
GHS06 GHS05 GHS09 Dgr |
H301 H318 H317 H410 |
ATP01 | |||
| 608-064-00-7 | cyanomethyltrimethylammoniummethylsulfate | cianometiltrimetilammónium-metilszulfát | 433-720-2 | - | Aquatic
Chronic 3 |
H412 |
- |
H412 |
ATP01 | |||
| 608-065-00-2 | salts of bromoxynil with the exception of those specified elsewhere in this Annex | bromoxinil sói (kivéve az e mellékletben külön szereplőket) | Repr.
2 Acute Tox. 2 * Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361d
*** H330 H301 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H361d
*** H330 H301 H317 H410 |
M=10 |
A | CLP00 | |||
| 608-066-00-8 | salts of ioxynil with the exception of those specified elsewhere in this Annex | ioxinil sói (kivéve az e mellékletben külön szereplőket) | Repr.
2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H361d
*** H331 H301 H312 H373 ** H319 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H361d
*** H331 H301 H312 H373 ** H319 H410 |
M=10 |
A | CLP00 | |||
| 608-067-00-3 | 3,7-dimethylocta-2,6-dienenitrile | 3,7-dimetilokta-2,6-diénnitril | 225-918-0 | 5146-66-7 | Muta.
1B |
H340 |
GHS08 Dgr |
H340 |
ATP09 | |||
| 608-068-00-9 | flutianil
(ISO); (2Z)-{[2-fluoro-5-(trifluoromethyl)phenyl]thio}[3-(2-methoxyphenyl)-1,3-thiazolidin-2-ylidene]acetonitrile |
flutianil
(ISO); (2Z)-{[2-fluor-5-(trifluormetil)fenil]tio}[3-(2-metoxifenil)-1,3-tiazolidin-2-ilidén]acetonitril |
958647-10-4 | Aquatic
Chronic 1 |
H410 |
GHS09 Wng |
H410 |
M=100 |
ATP13 | |||
| 608-069-00-4 | fludioxonil (ISO); 4-(2,2-difluoro-1,3-benzodioxol-4-yl)-1H-pyrrole-3-carbonitrile | #HIÁNYZIK | 131341-86-1 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
M=1 M=10 |
ATP14 | |||
| 609-001-00-6 | 1-nitropropane | 1-nitropropán | 203-544-9 | 108-03-2 | Flam.
Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H226 H332 H312 H302 |
GHS02 GHS07 Wng |
H226 H332 H312 H302 |
* |
CLP00 | ||
| 609-002-00-1 | 2-nitropropane | 2-nitropropán | 201-209-1 | 79-46-9 | Flam.
Liq. 3 Carc. 1B Acute Tox. 4 * Acute Tox. 4 * |
H226 H350 H332 H302 |
GHS02 GHS08 GHS07 Dgr |
H226 H350 H332 H302 |
CLP00 | |||
| 609-003-00-7 | nitrobenzene | nitrobenzol | 202-716-0 | 98-95-3 | Carc.
2 Repr. 1B Acute Tox. 3 Acute Tox. 3 Acute Tox. 3 STOT RE 1 Aquatic Chronic 3 |
H351 H360F H331 H311 H301 H372 (blood) H412 |
GHS06 GHS08 Dgr |
H331 H311 H301 H351 H360F H372 H412 |
CLP00/ATP05 | |||
| 609-004-00-2 | dinitrobenzene
[1] 1,4-dinitrobenzene [2] 1,3-dinitrobenzene [3] 1,2-dinitrobenzene [4] |
dinitrobenzol;
[1] 1,4-dinitrobenzol; [2] 1,3-dinitrobenzol; [3] 1,2-dinitrobenzol; [4] |
246-673-6
[1] 202-833-7 [2] 202-776-8 [3] 208-431-8 [4] |
25154-54-5
[1] 100-25-4 [2] 99-65-0 [3] 528-29-0 [4] |
Acute
Tox. 1 Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H330 H300 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H310 H300 H373 ** H410 |
CLP00 | |||
| 609-005-00-8 | 1,3,5-trinitrobenzene | 1,3,5-trinitrobenzol | 202-752-7 | 99-35-4 | Expl.
1.1 Acute Tox. 1 Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H201 H310 H330 H300 H373 ** H400 H410 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H201 H330 H310 H300 H373 ** H410 |
CLP00/ATP01 | |||
| 609-006-00-3 | 4-nitrotoluene | 4-nitrotoluol | 202-808-0 | 99-99-0 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 2 |
H331 H311 H301 H373 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H331 H311 H301 H373 ** H411 |
CLP00 | |||
| 609-007-00-9 | 2,4-dinitrotoluene
[1] dinitrotoluene [2] |
2,4-dinitrotoluol;
[1] dinitrotoluol [2] |
204-450-0
[1] 246-836-1 [2] |
121-14-2
[1] 25321-14-6 [2] |
Carc.
1B Muta. 2 Repr. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H341 H361f *** H331 H311 H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H341 H361f *** H331 H311 H301 H373 ** H410 |
CLP00/ATP01 | |||
| 609-008-00-4 | 2,4,6-trinitrotoluene; TNT | 2,4,6-trinitrotoluol; (TNT) | 204-289-6 | 118-96-7 | Expl.
1.1 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 2 |
H201 H331 H311 H301 H373 ** H411 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H201 H331 H311 H301 H373 ** H411 |
CLP00 | |||
| 609-009-00-X | 2,4,6-trinitrophenol; picric acid | 2,4,6-trinitrofenol; pikrinsav |
201-865-9 | 88-89-1 | Expl.
1.1 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H201 H331 H311 H301 |
GHS01 GHS06 Dgr |
H201 H331 H311 H301 |
CLP00/ATP01 | |||
| 609-010-00-5 | salts of picric acid | pikrinsav sói | Unst.
Expl. Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H200 H331 H311 H301 |
GHS01 GHS06 Dgr |
H200 H331 H311 H301 |
T | CLP00 | ||||
| 609-011-00-0 | 2,4,6-trinitroanisole | 2,4,6-trinitroanizol | 606-35-9 | Expl.
1.1 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 2 |
H201 H332 H312 H302 H411 |
GHS01 GHS07 GHS09 Wng |
H201 H332 H312 H302 H411 |
CLP00 | ||||
| 609-012-00-6 | 2,4,6-trinitro-m-cresol | 2,4,6-trinitro-m-krezol | 210-027-1 | 602-99-3 | Expl.
1.1 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H201 H332 H312 H302 |
GHS01 GHS07 Wng |
H201 H332 H312 H302 |
CLP00 | |||
| 609-013-00-1 | 2,4,6-trinitro-m-xylene | 2,4,6-trinitro-m-xilol | 211-187-5 | 632-92-8 | Expl.
1.1 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * |
H201 H332 H312 H302 H373 ** |
GHS01 GHS08 GHS07 Wng |
H201 H332 H312 H302 H373 ** |
CLP00 | |||
| 609-015-00-2 | 4-nitrophenol; p-nitrophenol | 4-nitrofenol; p-nitrofenol |
202-811-7 | 100-02-7 | Acute
Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * |
H332 H312 H302 H373 ** |
GHS08 GHS07 Wng |
H332 H312 H302 H373 ** |
CLP00 | |||
| 609-016-00-8 | dinitrophenol
(reaction mass of isomers) [1] 2,4(or 2,6)-dinitrophenol [2] |
dinitrofenol
(izomerkeverék); [1] 2,4(vagy 2,6)-dinitrofenol [2] |
247-096-2
[1] 275-732-9 [2] |
25550-58-7
[1] 71629-74-8 [2] |
Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H331 H311 H301 H373 ** H410 |
CLP00 | |||
| 609-018-00-9 | 2,4,6-trinitroresorcinol; styphnic acid | 2,4,6-trinitrorezorcin; sztifninsav |
201-436-6 | 82-71-3 | Expl.
1.1 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H201 H332 H312 H302 |
GHS01 GHS07 Dgr |
H201 H332 H312 H302 |
CLP00/ATP01 | |||
| 609-019-00-4 | lead 2,4,6-trinitro-m-phenylene dioxide; lead 2,4,6-trinitroresorcinoxide; lead styphnate | ólom-2,4,6-trinitro-m-fenilén-dioxid;
ólom-2,4,6-trinitrorezorcinoxid; ólom-sztifnát |
239-290-0 | 15245-44-0 | Repr.
1A Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 Unst. Expl |
H360Df H332 H302 H373 ** H400 H410 H200 |
GHS01 GHS08 GHS07 GHS09 Dgr |
H200 H360Df H332 H302 H373 ** H410 |
1 | CLP00 | ||
| 609-019-01-1 | lead 2,4,6-trinitro-m-phenylene dioxide; lead 2,4,6-trinitroresorcinoxide; lead styphnate (≥ 20 % phlegmatiser) | ólom-2,4,6-trinitro-m-fenilén-dioxid; ólom-2,4,6-trinitrorezorcinoxid; ólom-sztifnát (≥20 % flegmatizálószer) |
239-290-0 | 15245-44-0 | Expl.
1.1 Repr. 1A Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H201 H360Df H332 H302 H373 ** H400 H410 |
GHS01 GHS08 GHS07 GHS09 Dgr |
H201 H360Df H332 H302 H373 ** H410 |
1 | CLP00 | ||
| 609-020-00-X | DNOC (ISO); 4,6-dinitro-o-cresol | DNOC
(ISO); 4,6-dinitro-o-krezol |
208-601-1 | 534-52-1 | Muta.
2 Acute Tox. 1 Acute Tox. 2 * Acute Tox. 2 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H341 H310 H330 H300 H315 H318 H317 H400 H410 |
GHS06 GHS08 GHS05 GHS07 GHS09 Dgr |
H341 H330 H310 H300 H315 H318 H317 H410 |
EUH044 |
CLP00 | ||
| 609-021-00-5 | sodium
salt of DNOC; sodium 4,6-dinitro-o-cresolate [1] potassium salt of DNOC; potassium 4,6-dinitro-o-cresolate [2] |
DNOC
nátriumsója; nátrium-4,6-dinitro-o-krezolát; [1] DNOC káliumsója; kálium-4,6-dinitro-o-krezolát [2] |
219-007-7
[1] |
2312-76-7
[1] 5787-96-2 [2] |
Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H331 H311 H301 H373 ** H410 |
CLP00 | |||
| 609-022-00-0 | ammonium salt of DNOC; ammonium 4,6-dinitro-o-tolyl oxide | DNOC ammóniumsója; ammónium-4,6-dinitro-o-tolil-oxid | 221-037-0 | 2980-64-5 | Acute
Tox. 1 Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H330 H300 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H310 H300 H373 ** H410 |
CLP00 | |||
| 609-023-00-6 | dinocap (ISO); (RS)-2,6-dinitro-4-octylphenyl crotonates and (RS)-2,4-dinitro-6-octylphenyl crotonates in which “octyl” is a reaction mass of 1-methylheptyl, 1-ethylhexyl and 1-propylpentyl groups | dinokap
(ISO); (RS)-2,6-dinitro-4-oktilfenil-krotonátok és (RS)-2,4-dinitro-6-oktilfenil-krotonátok, ahol az „oktil” az 1-metilheptil, 1-etilhexil és 1-propilpentil csoportok keveréke |
254-408-0 | 39300-45-3 | Repr.
1B Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360D
*** H332 H302 H373 ** H315 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H360D
*** H332 H302 H373 ** H315 H317 H410 |
M=100 |
CLP00/ATP01 | ||
| 609-024-00-1 | binapacryl (ISO); 2-sec-butyl-4,6-dinitrophenyl-3-methylcrotonate | binapakril
(ISO); 2-szek-butil-4,6-dinitrofenil-3-metilkrotonát |
207-612-9 | 485-31-4 | Repr.
1B Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H360D
*** H312 H302 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H360D
*** H312 H302 H410 |
CLP00 | |||
| 609-025-00-7 | dinoseb (ISO); 6-sec-butyl-2,4-dinitrophenol | dinoszeb
(ISO); 6-szek-butil-2,4-dinitrofenol |
201-861-7 | 88-85-7 | Repr.
1B Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H311 H301 H319 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H360Df H311 H301 H319 H410 |
EUH044 |
CLP00 | ||
| 609-026-00-2 | salts and esters of dinoseb, with the exception of those specified elsewhere in this Annex | dinoszeb sói és észterei, kivéve az e mellékletben külön szereplőket | Repr.
1B Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H311 H301 H319 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H360Df H311 H301 H319 H410 |
EUH044 |
A | CLP00 | |||
| 609-027-00-8 | dinocton; reaction mass of isomers: methyl 2-octyl-4,6-dinitrophenyl carbonate, methyl 4-octyl-2,6-dinitrophenyl carbonate | dinokton; a következő izomerek keveréke: metil-2-oktil-4,6-dinitrofenil-karbonát és metil-4-oktil-2,6-dinitrofenil-karbonát |
63919-26-6 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | ||||
| 609-028-00-3 | dinex (ISO); 2-cyclohexyl-4,6-dinitrophenol | dinex
(ISO); 2-ciklohexil-4,6-dinitrofenol |
205-042-5 | 131-89-5 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H410 |
CLP00 | |||
| 609-029-00-9 | salts and esters of dinex | dinex sói és észterei | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H410 |
A | CLP00 | ||||
| 609-030-00-4 | dinoterb (ISO); 2-tert-butyl-4,6-dinitrophenol | dinoterb
(ISO); 2-terc-butil-4,6-dinitrofenol |
215-813-8 | 1420-07-1 | Repr.
1B Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H360D
*** H300 H311 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H360D
*** H300 H311 H410 |
EUH044 |
CLP00 | ||
| 609-031-00-X | salts and esters of dinoterb | dinoterb sói és észterei | Repr.
1B Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H360D
*** H300 H311 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H360D
*** H300 H311 H410 |
A | CLP00 | ||||
| 609-032-00-5 | bromofenoxim (ISO); 3,5-dibromo-4-hydroxybenzaldehyde-O-(2,4-dinitrophenyl)-oxime | bromofenoxim
(ISO); 3,5-dibróm-4-hidroxibenzaldehid-O-(2,4-dinitrofenil)-oxim |
236-129-6 | 13181-17-4 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | |||
| 609-033-00-0 | dinosam (ISO); 2-(1-methylbutyl)-4,6-dinitrophenol | dinoszam
(ISO); 2-(1-metilbutil)-4,6-dinitrofenol |
4097-36-3 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H410 |
CLP00 | ||||
| 609-034-00-6 | salts and esters of dinosam | dinoszam sói és észterei | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H410 |
A | CLP00 | ||||
| 609-035-00-1 | nitroethane | nitroetán | 201-188-9 | 79-24-3 | Flam.
Liq. 3 Acute Tox. 4 * Acute Tox. 4 * |
H226 H332 H302 |
GHS02 GHS07 Wng |
H226 H332 H302 |
* |
CLP00 | ||
| 609-036-00-7 | nitromethane | nitrometán | 200-876-6 | 75-52-5 | Flam.
Liq. 3 Acute Tox. 4 * |
H226 H302 |
GHS02 GHS07 Wng |
H226 H302 |
* |
CLP00 | ||
| 609-037-00-2 | 5-nitroacenaphthene | 5-nitro-acenaftén | 210-025-0 | 602-87-9 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 609-038-00-8 | 2-nitronaphthalene | 2-nitronaftalin | 209-474-5 | 581-89-5 | Carc.
1B Aquatic Chronic 2 |
H350 H411 |
GHS08 GHS09 Dgr |
H350 H411 |
CLP00 | |||
| 609-039-00-3 | 4-nitrobiphenyl | 4-nitrobifenil | 202-204-7 | 92-93-3 | Carc.
1B Aquatic Chronic 2 |
H350 H411 |
GHS08 GHS09 Dgr |
H350 H411 |
CLP00 | |||
| 609-040-00-9 | nitrofen (ISO); 2,4-dichlorophenyl 4-nitrophenyl ether | nitrofen
(ISO); 2,4-diklórfenil-4-nitrofenil-éter |
217-406-0 | 1836-75-5 | Carc.
1B Repr. 1B Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H360D *** H302 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H360D *** H302 H410 |
CLP00 | |||
| 609-041-00-4 | 2,4-dinitrophenol | 2,4-dinitrofenol | 200-087-7 | 51-28-5 | Acute
Tox. 2 Acute Tox. 3 * Acute Tox. 3 STOT RE 1 Aquatic Acute 1 |
H300 H331 H311 H372 H400 |
GHS06 GHS08 GHS09 Dgr |
H331 H311 H300 H372 H400 |
Oral:
ATE = 30 mg/kg Dermal: ATE = 300 mg/kg |
CLP00/ATP15 | ||
| 609-042-00-X | pendimethalin (ISO); N-(1-ethylpropyl)-2,6-dinitro-3,4-xylidine | pendimetalin
(ISO); N-(1-etilpropil)-2,6-dinitro-3,4-xilidin |
254-938-2 | 40487-42-1 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
CLP00 | |||
| 609-043-00-5 | quintozene (ISO); pentachloronitrobenzene | kvintozen
(ISO); pentaklórnitrobenzol |
201-435-0 | 82-68-8 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
CLP00 | |||
| 609-044-00-0 | tecnazene (ISO); 1,2,4,5-tetrachloro-3-nitrobenzene | teknazen
(ISO); 1,2,4,5-tetraklór-3-nitrobenzol |
204-178-2 | 117-18-0 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
CLP00 | |||
| 609-045-00-6 | reaction mass of: 4,6-dinitro-2-(3-octyl)phenyl methyl carbonate and 4,6-dinitro-2-(4-octyl)phenyl methyl carbonate; dinocton-6 | 4,6-dinitro-2-(3-oktil)fenilmetil-karbonát és 4,6-dinitro-2-(4-oktil)fenilmetil-karbonát keveréke; dinokton-6 | 8069-76-9 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | ||||
| 609-046-00-1 | trifluralin (ISO) (containing < 0.5 ppm NPDA); α,α,α-trifluoro-2,6-dinitro-N,N-dipropyl-p-toluidine (containing < 0.5 ppm NPDA); 2,6-dinitro-N,N-dipropyl-4-trifluoromethylaniline (containing < 0.5 ppm NPDA); N,N-dipropyl-2,6-dinitro-4-trifluoromethylaniline (containing < 0.5 ppm NPDA) | trifluralin
(ISO) (<0,5 ppm NPDA tartalommal); α, α,α-trifluor-2,6-dinitro-N, N-dipropil-p-toluidin (<0,5 ppm NPDA tartalommal); 2,6-dinitro-N, N-dipropil-4-trifluormetilanilin (<0,5 ppm NPDA tartalommal); N, N-dipropil-2,6-dinitro-4-trifluormetilanilin (<0,5 ppm NPDA tartalommal) |
216-428-8 | 1582-09-8 | Carc.
2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H317 H410 |
M=10 |
CLP00/ATP01 | ||
| 609-047-00-7 | 2-nitroanisole | 2-nitroanizol | 202-052-1 | 91-23-6 | Carc.
1B Acute Tox. 4 * |
H350 H302 |
GHS08 GHS07 Dgr |
H350 H302 |
CLP00 | |||
| 609-048-00-2 | sodium 3-nitrobenzenesulphonate | nátrium-3-nitrobenzolszulfonát | 204-857-3 | 127-68-4 | Eye
Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
CLP00 | |||
| 609-049-00-8 | 2,6-dinitrotoluene | 2,6-dinitrotoluol | 210-106-0 | 606-20-2 | Carc.
1B Muta. 2 Repr. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 3 |
H350 H341 H361f *** H331 H311 H301 H373 ** H412 |
GHS06 GHS08 Dgr |
H350 H341 H361f *** H331 H311 H301 H373 ** H412 |
CLP00 | |||
| 609-050-00-3 | 2,3-dinitrotoluene | 2,3-dinitrotoluol | 210-013-5 | 602-01-7 | Carc.
1B Muta. 2 Repr. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H341 H361f *** H331 H311 H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H341 H361f *** H331 H311 H301 H373 ** H410 |
CLP00 | |||
| 609-051-00-9 | 3,4-dinitrotoluene | 3,4-dinitrotoluol | 210-222-1 | 610-39-9 | Carc.
1B Muta. 2 Repr. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 2 |
H350 H341 H361f *** H331 H311 H301 H373 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H350 H341 H361f *** H331 H311 H301 H373 ** H411 |
CLP00 | |||
| 609-052-00-4 | 3,5-dinitrotoluene | 3,5-dinitrotoluol | 210-566-2 | 618-85-9 | Carc.
1B Muta. 2 Repr. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 3 |
H350 H341 H361f *** H331 H311 H301 H373 ** H412 |
GHS06 GHS08 Dgr |
H350 H341 H361f *** H331 H311 H301 H373 ** H412 |
CLP00 | |||
| 609-053-00-X | hydrazine-trinitromethane | hidrazin-trinitrometán | 414-850-9 | Expl.
1.1 **** Self-react. A Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Skin Sens. 1 |
H201 H240 H350 H331 H301 H317 |
GHS01 GHS06 GHS08 Dgr |
H201 H240 H350 H331 H301 H317 |
CLP00 | ||||
| 609-054-00-5 | 2,3-dinitrophenol
[1] 2,5-dinitrophenol [2] 2,6-dinitrophenol [3] 3,4-dinitrophenol [4] salts of dinitrophenol [5] |
2,3-dinitrofenol;
[1] 2,5-dinitrofenol; [2] 2,6-dinitrofenol; [3] 3,4-dinitrofenol; [4] dinitrofenol sói [5] |
200-628-7
[1] 206-348-1 [2] 209-357-9 [3] 209-415-3 [4] |
66-56-8
[1] 329-71-5 [2] 573-56-8 [3] 577-71-9 [4] |
Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 2 |
H331 H311 H301 H373 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H331 H311 H301 H373 ** H411 |
CLP00 | |||
| 609-055-00-0 | 2,5-dinitrotoluene | 2,5-dinitrotoluol | 210-581-4 | 619-15-8 | Carc.
1B Muta. 2 Repr. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 2 |
H350 H341 H361f *** H331 H311 H301 H373 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H350 H341 H361f *** H331 H311 H301 H373 ** H411 |
CLP00 | |||
| 609-056-00-6 | 2,2-dibromo-2-nitroethanol | 2,2-dibróm-2-nitroetanol | 412-380-9 | 69094-18-4 | Expl.
1.1 Carc. 2 Acute Tox. 4 * STOT RE 2 * Skin Corr. 1A Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H201 H351 H302 H373 ** H314 H317 H400 H410 |
GHS01 GHS08 GHS05 GHS07 GHS09 Dgr |
H201 H351 H302 H373 ** H314 H317 H410 |
* STOT SE 3; H335: C ≥ 1 % |
T | CLP00 | |
| 609-057-00-1 | 3-chloro-2,4-difluoronitrobenzene | 3-klór-2,4-difluornitrobenzol | 411-980-8 | 3847-58-3 | Acute
Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H317 H410 |
CLP00 | |||
| 609-058-00-7 | 2-nitro-2-phenyl-1,3-propanediol | 2-nitro-2-fenilpropán-1,3-diol | 410-360-4 | 5428-02-4 | Acute
Tox. 4 * Acute Tox. 4 * STOT RE 1 Skin Sens. 1 Aquatic Chronic 2 |
H312 H302 H372 ** H317 H411 |
GHS08 GHS07 GHS09 Dgr |
H372
** H312 H302 H317 H411 |
EUH070 |
CLP00 | ||
| 609-059-00-2 | 2-chloro-6-(ethylamino)-4-nitrophenol | 2-klór-6-(etilamino)-4-nitrofenol | 411-440-1 | 131657-78-8 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
CLP00 | |||
| 609-060-00-8 | 4-[(3-hydroxypropyl)amino]-3-nitrophenol | 4-[(3-hidroxipropil)amino]-3-nitrofenol | 406-305-9 | 92952-81-3 | Skin
Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
CLP00 | |||
| 609-061-00-3 | (E,Z)-4-chlorophenyl(cyclopropyl)ketone O-(4-nitrophenylmethyl)oxime | (E, Z)-4-klórfenil-ciklopropil-keton-O-(4-nitrofenilmetil)oxim | 406-100-4 | 94097-88-8 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
CLP00 | |||
| 609-062-00-9 | 2-bromo-2-nitropropanol | 2-bróm-2-nitropropanol | 407-030-7 | 24403-04-1 | Acute
Tox. 3 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H311 H302 H373 ** H314 H317 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H311 H302 H373 ** H314 H317 H410 |
CLP00 | |||
| 609-063-00-4 | 2-[(4-chloro-2-nitrophenyl)amino]ethanol | 2-[(4-klór-2-nitrofenil)amino]etanol | 413-280-8 | 59320-13-7 | Acute
Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
CLP00 | |||
| 609-064-00-X | mesotrione (ISO); 2-[4-(methylsulfonyl)-2-nitrobenzoyl]-1,3-cyclohexanedione | mezotrion
(ISO); 2-[4-(metilszulfonil)-2-nitrobenzoil]-1,3-ciklohexándion |
104206-82-8 | Repr.
2 STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H361d H373 (eyes, nervous system) H400 H410 |
GHS08 GHS09 Wng |
H361d H373 (eyes, nervous system) H410 |
M=10 M=10 |
CLP00/ATP15 | |||
| 609-065-00-5 | 2-nitrotoluene | 2-nitrotoluol | 201-853-3 | 88-72-2 | Carc.
1B Muta. 1B Repr. 2 Acute Tox. 4 * Aquatic Chronic 2 |
H350 H340 H361f *** H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H350 H340 H361f *** H302 H411 |
CLP00 | |||
| 609-067-00-6 | sodium and potassium 4-(3-aminopropylamino)-2,6-bis[3-(4-methoxy-2-sulfophenylazo)-4-hydroxy-2-sulfo-7-naphthylamino]-1,3,5-triazine | nátrium- és kálium-4-(3-aminopropilamino)-2,6-bisz[3-(4-metoxi-2-szulfofenilazo)-4-hidroxi-2-szulfo-7-naftilamino]-1,3,5-triazin | 416-280-6 | 156769-97-0 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 609-068-00-1 | musk xylene; 5-tert-butyl-2,4,6-trinitro-m-xylene | pézsma
xilol; 5-terc-butil-2,4,6-trinitro-m-xilol |
201-329-4 | 81-15-2 | Expl.
1.1 Carc. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H201 H351 H400 H410 |
GHS01 GHS08 GHS09 Wng |
H201 H351 H410 |
T | CLP00 | ||
| 609-069-00-7 | musk ketone; 3,5-dinitro-2,6-dimethyl-4-tert-butylacetophenone; 4'-tert-butyl-2',6'-dimethyl-3',5'-dinitroacetophenone | pézsma
keton; 3,5-dinitro-2,6-dimetil-4-terc-butilacetofenon; 4'-terc-butil-2',6'-dimetil-3', 5'-dinitroacetofenon |
201-328-9 | 81-14-1 | Carc.
2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
ATP01 | |||
| 609-070-00-2 | 1,4-dichloro-2-(1,1,2,3,3,3-hexafluoropropoxy)-5-nitrobenzene | 1,4-diklór-2-(1,1,2,3,3,3-hexafluorpropoxi)-5-nitrobenzol | 415-580-4 | 130841-23-5 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
CLP00 | |||
| 609-071-00-8 | reaction mass of: 2-methylsulfanyl-4,6-bis-(2-hydroxy-4-methoxy-phenyl)-1,3,5-triazine; 2-(4,6-bis-methylsulfanyl-1,3,5-triazin-2-yl)-5-methoxy-phenol | 2-metilszulfanil-4,6-bisz(2-hidroxi-4-metoxifenil)-1,3,5-triazin; 2-(4,6-biszmetilszulfanil-1,3,5-triazin-2-il)-5-metoxifenol keveréke |
423-520-3 | 156137-33-6 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 609-072-00-3 | 4-mesyl-2-nitrotoluene | 4-mezil-2-nitrotoluol | 430-550-0 | 1671-49-4 | Repr.
2 Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 3 |
H361f
*** H302 H317 H412 |
GHS08 GHS07 Wng |
H302 H317 H361f *** H412 |
ATP01/ATP01corr | |||
| 609-073-00-9 | lithium potassium sodium N,N''-bis{6-[7-[4-(4-chloro-1,3,5-triazin-2-yl)amino-4-(2-ureidophenylazo)]naphthalene-1,3,6-trisulfonato]}-N'-(2-aminoethyl)piperazine | lítium-, kálium-, nátrium-N,N''-bisz{6-[7-[4-(4-klór-1,3,5-triazin-2-il)amino-4-(2-ureidofenilazo)]naftalin-1,3,6-triszulfonáto}-N'-(2-aminoetil)piperazin | 427-850-9 | - | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
ATP01 | |||
| 610-001-00-3 | trichloronitromethane; chloropicrin | triklórnitrometán; klórpikrin |
200-930-9 | 76-06-2 | Acute
Tox. 2 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 |
H330 H302 H335 H315 H319 |
GHS06 Dgr |
H330 H302 H319 H335 H315 |
CLP00 | |||
| 610-002-00-9 | 1,1-dichloro-1-nitroethane | 1,1-diklór-1-nitroetán | 209-854-0 | 594-72-9 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
CLP00 | |||
| 610-003-00-4 | chlorodinitrobenzene | klór-dinitrobenzol | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H331 H311 H301 H373 ** H410 |
C | CLP00 | ||||
| 610-004-00-X | 2-chloro-1,3,5-trinitrobenzene | 2-klór-1,3,5-trinitrobenzol | 201-864-3 | 88-88-0 | Expl.
1.1 Acute Tox. 1 Acute Tox. 2 * Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H201 H310 H330 H300 H400 H410 |
GHS01 GHS06 GHS09 Dgr |
H201 H330 H310 H300 H410 |
CLP00 | |||
| 610-005-00-5 | 1-chloro-4-nitrobenzene | 1-klór-4-nitrobenzol | 202-809-6 | 100-00-5 | Carc.
2 Muta. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 2 |
H351 H341 H331 H311 H301 H373 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H351 H341 H331 H311 H301 H373 ** H411 |
CLP00 | |||
| 610-006-00-0 | chloronitroanilines with the exception of those specified elsewhere in this Annex | klórnitroanilinek (kivéve az e mellékletben külön szereplőket) | Acute
Tox. 1 Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 2 |
H310 H330 H300 H373 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H330 H310 H300 H373 ** H411 |
A C | CLP00 | ||||
| 610-007-00-6 | 1-chloro-1-nitropropane | 1-klór-1-nitropropán | 209-990-0 | 600-25-9 | Acute
Tox. 4 * Acute Tox. 4 * |
H332 H302 |
GHS07 Wng |
H332 H302 |
* |
CLP00 | ||
| 610-008-00-1 | 2,6-dichloro-4-nitroanisole | 2,6-diklór-4-nitroanizol | 403-350-6 | 17742-69-7 | Acute
Tox. 3 * Aquatic Chronic 2 |
H301 H411 |
GHS06 GHS09 Dgr |
H301 H411 |
CLP00 | |||
| 610-009-00-7 | 2-chloro-4-nitroaniline | 2-klór-4-nitroanilin | 204-502-2 | 121-87-9 | Acute
Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
CLP00 | |||
| 610-010-00-2 | 2-bromo-1-(2-furyl)-2-nitroethylene | 2-bróm-1-(2-furil)-2-nitroetilén | 406-110-9 | 35950-52-8 | Acute
Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H314 H317 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H302 H373 ** H314 H317 H410 |
CLP00 | |||
| 611-001-00-6 | azobenzene | azobenzol | 203-102-5 | 103-33-3 | Carc.
1B Muta. 2 Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H341 H332 H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H341 H332 H302 H373 ** H410 |
CLP00 | |||
| 611-002-00-1 | azoxybenzene | azoxibenzol | 207-802-1 | 495-48-7 | Acute
Tox. 4 * Acute Tox. 4 * |
H332 H302 |
GHS07 Wng |
H332 H302 |
CLP00 | |||
| 611-003-00-7 | fenaminosulf (ISO); sodium 4-dimethylaminobenzenediazosulphonate | fenaminoszulf
(ISO); nátrium-4-dimetilaminobenzoldiazoszulfonát |
205-419-4 | 140-56-7 | Acute
Tox. 3 * Acute Tox. 4 * Aquatic Chronic 3 |
H301 H312 H412 |
GHS06 Dgr |
H301 H312 H412 |
CLP00 | |||
| 611-004-00-2 | methyl-ONN-azoxymethyl acetate; methyl azoxy methyl acetate | metil-ONN-azoximetil-acetát; metil-azoximetil-acetát |
209-765-7 | 592-62-1 | Carc.
1B Repr. 1B |
H350 H360D *** |
GHS08 Dgr |
H350 H360D *** |
CLP00 | |||
| 611-005-00-8 | disodium {}{5-[(4'-((2,6-hydroxy-3-((2-hydroxy-5-sulphophenyl)azo)phenyl)azo)(1,1'-biphenyl)-4-yl)azo]salicylato(4-)}}cuprate(2-); CI Direct Brown 95 | dinátrium{5-[[4’-[[2,6-dihidroxi-3-[(2-hidroxi-5-szulfofenil)azo]fenil]azo][1,1’-bifenil]-4-il]azo]szaliciláto(4-)}-kuprát(2-); CI Direct Brown 95 |
240-221-1 | 16071-86-6 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 611-006-00-3 | 4-o-tolylazo-o-toluidine; 4-amino-2',3-dimethylazobenzene; fast garnet GBC base; AAT; o-aminoazotoluene | 4-o-tolilazo-o-toluidin; 4-amino-2’,3-dimetilazobenzol; fast garnet GBC base; AAT; o-aminoazotoluol |
202-591-2 | 97-56-3 | Carc.
1B Skin Sens. 1 |
H350 H317 |
GHS08 Dgr |
H350 H317 |
CLP00 | |||
| 611-007-00-9 | tricyclazole (ISO); 5-methyl-1,2,4-triazolo(3,4-b)benzo-1,3-thiazole | triciklazol
(ISO); 5-metil-1,2,4-triazolo[3,4-b]benzo-1,3-tiazol |
255-559-5 | 41814-78-2 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 611-008-00-4 | 4-aminoazobenzene; 4-phenylazoaniline | 4-aminoazobenzol; 4-fenilazoanilin |
200-453-6 | 60-09-3 | Carc.
1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H400 H410 |
GHS08 GHS09 Dgr |
H350 H410 |
CLP00 | |||
| 611-009-00-X | sodium (1-(5-(4-(4-anilino-3-sulphophenylazo)-2-methyl-5-methylsulphonamidophenylazo)-4-hydroxy-2-oxido-3-(phenylazo)phenylazo)-5-nitro-4-sulphonato-2-naphtholato)iron(II) | nátrium-[1-[5-[4-(4-anilino-3-szulfonilfenilazo)-2-metil-5-metilszulfonamidofenilazo]4-hidroxi-2-oxido-3-(fenilazo)fenilazo]-5-nitro-4-szulfonáto-2-naftoláto]-vas(II) | 401-220-3 | Acute
Tox. 4 * Aquatic Chronic 3 |
H332 H412 |
GHS07 Wng |
H332 H412 |
CLP00 | ||||
| 611-010-00-5 | 2'-(2-cyano-4,6-dinitrophenylazo)-5'-(N,N-dipropylamino)propionanilide | 2’-(2-ciano-4,6-dinitrofenilazo-5’-(N, N-dipropilamino)propionanilid | 403-010-7 | 106359-94-8 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
CLP00 | |||
| 611-011-00-0 | N,N,N',N'-tetramethyl-3,3'-(propylenebis(iminocarbonyl-4,1-phenylenazo(1,6-dihydro-2-hydroxy-4-methyl-6-oxopyridine-3,1-diyl)))di(propylammonium) dilactate | N, N,N’,N’-tetrametil-3,3’-[propilénbisz[iminokarbonil-4,1-fenilazo(1,6-dihidro-2-hidroxi-4-metil-6-oxopiridin-3,1-diil)]]di(propilammónium)-dilaktát | 403-340-1 | Eye
Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
CLP00 | ||||
| 611-012-00-6 | reaction mass of 2,2-iminodiethanol 6-methyl-2-(4-(2,4,6-triaminopyrimidin-5-ylazo)phenyl)benzothiazole-7-sulfonate and 2-methylaminoethanol 6-methyl-2-(4-(2,4,6-triaminopyrimidin-5-ylazo)phenyl)benzothiazole-7-sulfonate and N,N-diethylpropane-1,3-diamine 6-methyl-2-(4-(2,4,6-triaminopyrimidin-5-ylazo)phenyl)benzothiazole-7-sulfonate | 2,2-iminodietanol-6-metil-2-[4-(2,4,6-triaminopirimidin-5-ilazo)fenil]benzotiazol-7-szulfonát és 2-metilaminoetanol-6-metil-2-[4-(2,4,6-triaminopirimidin-5-ilazo)fenil]benzotiazol-7-szulfonát és N, N-dietilpropán-1,3-diamin-6-metil-2-[4-(2,4,6-triaminopirimidin-5-ilazo)fenil]benzotiazol-7-szulfonát keveréke | 403-410-1 | 114565-65-0 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 611-013-00-1 | trilithium-1-hydroxy-7-(3-sulfonatoanilino)-2-(3-methyl-4-(2-methoxy-4-(3-sulfonatophenylazo)phenylazo)phenylazo)naphthalene-3-sulfonate | trilítium-1-hidroxi-7-(3-szulfonátoanilino)-2-(3-metil-4-(2-metoxi-4-(3-szulfonátofenilazo)fenilazo)fenilazo)naftalin-3-szulfonát | 403-650-7 | 117409-78-6 | Expl.
1.3 **** Aquatic Chronic 2 |
H203 H411 |
GHS01 GHS09 Dgr |
H203 H411 |
CLP00 | |||
| 611-014-00-7 | (tetrasodium 1-(4-(3-acetamido-4-(4'-nitro-2,2'-disulfonatostilben-4-ylazo)anilino)-6-(2,5-disulfonatoanilino)-1,3,5-triazin-2-yl)-3-carboxypyridinium) hydroxide | [tetranátrium-1-[4-[3-acetamido-4-(4’-nitro-2,2’-diszulfonátosztilbén-4-ilazo)anilino]-6-(2,5-diszulfonátoanilino)-1,3,5-triazin-2-il]-3-karboxipiridinium]-hidroxid | 404-250-5 | 115099-55-3 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 611-015-00-2 | tetrasodium 4-amino-5-hydroxy-6-(4-(2-(2-(sulfonatooxy)ethylsulfonyl)ethylcarbamoyl)phenylazo)-3-(4-(2-(sulfonatooxy)ethylsulfonyl)phenylazo)naphthalene-2,7-disulfonate | tetranátrium-4-amino-5-hidroxi-6-[4-[2-[2-(szulfonátooxi)etilszulfonil]etilkarbamoil]fenilazo-3-[4-[2-(szulfonátooxi)etilszulfonil]fenilazo]naftalin-2,7-diszulfonát | 404-320-5 | 116889-78-2 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 611-016-00-8 | reaction mass of 1,1'-((dihydroxyphenylene)bis(azo-3,1-phenylenazo(1-(3-dimethylaminopropyl)-1,2-dihydro-6-hydroxy-4-methyl-2-oxopyridine-5,3-diyl)))dipyridinium dichloride dihydrochloride, mixed isomers and 1-(1-(3-dimethylaminopropyl)-5-(3-((4-(1-(3-dimethylaminopropyl)-1,6-dihydro-2-hydroxy-4-methyl-6-oxo-5-pyridinio-3-pyridylazo)phenylazo)-2,4(or2,6 or3,5)-dihydroxyphenylazo)phenylazo)-1,2-dihydro-6-hydroxy-4-methyl-2-oxo-3-pyridyl)pyridinium dichloride | 1,1’-[(dihidroxifenilén)bisz(azo-3,1-fenilénazo(1-(3-dimetilaminopropil)-1,2-dihidro-6-hidroxi-4-metil-2-oxopiridin-5,3-diil)))dipiridinium-diklorid-dihidroklorid kevert izomerek és 1-(1-(3-dimetilaminopropil)-5-(3-((4-(1-(3-dimetilaminopropil)-1,6-dihidro-2-hidroxi-4-metil-6-oxo-5-piridinio-3-piridilazo)fenilazo)-2,4(vagy 2,6 vagy 3,5)-dihidroxifenilazo)fenilazo)-1,2-dihidro-6-hidroxi-4-metil-2-oxo-3-piridil)piridinium-diklorid keveréke | 404-540-1 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | ||||
| 611-017-00-3 | 2-(4-(diethylaminopropylcarbamoyl)phenylazo)-3-oxo-N-(2,3-dihydro-2-oxobenzimidazol-5-yl)butyramide | 2-[4-(dietilaminopropilkarbamoil)fenilazo]-3-oxo-N-(2,3-dihidro-2-oxobenzimidazol-5-il)butiramid | 404-910-2 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | ||||
| 611-018-00-9 | tetraammonium 5-(4-(7-amino-1-hydroxy-3-sulfonato-2-naphthylazo)-6-sulfonato-1-naphthylazo)isophthalate | tetraammónium-5-[4-(7-amino-1-hidroxi-3-szulfonáto-2-naftilazo)-6-szulfonáto-1-naftilazo]izoftalát | 405-130-5 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | ||||
| 611-019-00-4 | tetralithium 6-amino-4-hydroxy-3-(7-sulfonato-4-(4-sulfonatophenylazo)-1-naphthylazo)naphthalene-2,7-disulfonate | tetralítium-6-amino-4-hidroxi-3-[7-szulfonáto-4-(4- szulfonátofenilazo)-1-naftilazo]naftalin-2,7-diszulfonát | 405-150-4 | 106028-58-4 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 611-020-00-X | tetrakis(tetramethylammonium) 6-amino-4-hydroxy-3-(7-sulfonato-4-(4-sulfonatophenylazo)-1-naphthylazo)naphthalene-2,7-disulfonate | tetrakisz(tetrametilammónium)- 6-amino-4-hidroxi-3-[7-szulfonáto-4-(4-szulfonátofenilazo)-1-naftilazo]naftalin-2,7-diszulfonát |
405-170-3 | 116340-05-7 | Acute
Tox. 3 * Skin Sens. 1 Aquatic Chronic 3 |
H301 H317 H412 |
GHS06 Dgr |
H301 H317 H412 |
CLP00 | |||
| 611-021-00-5 | 2-(4-(4-cyano-3-methylisothiazol-5-ylazo)-N-ethyl-3-methylanilino)ethyl acetate | 2-[4-(4-ciano-3-metilizotiazol-5-ilazo)-N-etil-3-metilanilino]etil-acetát | 405-480-9 | Acute
Tox. 4 * STOT RE 2 * Skin Irrit. 2 Aquatic Chronic 4 |
H302 H373 ** H315 H413 |
GHS08 GHS07 Wng |
H302 H373 ** H315 H413 |
CLP00 | ||||
| 611-022-00-0 | 4-dimethylaminobenzenediazonium 3-carboxy-4-hydroxybenzenesulfonate | 4-dimetilaminobenzoldiazónium-3-karboxi-4-hidroxibenzolszulfonát | 404-980-4 | Self-react.
C Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H242 H331 H301 H312 H373 ** H318 H317 H400 H410 |
GHS02 GHS06 GHS08 GHS05 GHS09 Dgr |
H242 H331 H301 H312 H373 ** H318 H317 H410 |
T | CLP00 | |||
| 611-023-00-6 | disodium 7-(4,6-dichloro-1,3,5-triazin-2-ylamino)-4-hydroxy-3-(4-(2-(sulfonatooxy)ethylsulfonyl)phenylazo) naphthalene-2-sulfonate | dinátrium-7-(4,6-diklór-1,3,5-triazin-2-ilamino)-4-hidroxi-3-[4-[2-(szulfonátooxi)etilszulfonil]fenilazo]naftalin-2-szulfonát | 404-600-7 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | ||||
| 611-024-00-1 | Benzidine based azo dyes; 4,4'-diarylazobiphenyl dyes, with the exception of those specified elsewhere in this Annex | benzidin
bázisú azoszínezékek; 4,4’-diarilazobifenil festékek (kivéve az e mellékletben külön szereplőket) |
Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
A | CLP00 | ||||
| 611-025-00-7 | disodium 4-amino-3-[[4'-[(2,4-diaminophenyl)azo][1,1'-biphenyl]-4-yl]azo]-5-hydroxy-6-(phenylazo)naphtalene-2,7-disulphonate; C.I. Direct Black 38 | dinátrium-4-amino-3-[[-4’-[(2,4-diaminofenil)azo][1,1’-bifenil]-4-il]azo]-5-hidroxi-6-(fenilazo)naftalin-2,7-diszulfonát; C.I. Direct Black 38 |
217-710-3 | 1937-37-7 | Carc.
1B Repr. 2 |
H350 H361d *** |
GHS08 Dgr |
H350 H361d *** |
CLP00 | |||
| 611-026-00-2 | tetrasodium 3,3'-[[1,1'-biphenyl]-4,4'-diylbis(azo)]bis[5-amino-4-hydroxynaphthalene-2,7-disulphonate]; C.I. Direct Blue 6 | tetranátrium-3,3’-[[1,1’-bifenil]-4,4’-diilbisz(azo)]bisz[5-amino-4-hidroxinaftalin-2,7-diszulfonát]; C.I. Direct Blue 6 |
220-012-1 | 2602-46-2 | Carc.
1B Repr. 2 |
H350 H361d *** |
GHS08 Dgr |
H350 H361d *** |
CLP00 | |||
| 611-027-00-8 | disodium 3,3'-[[1,1'-biphenyl]-4,4'-diylbis(azo)]bis(4-aminonaphthalene-1-sulphonate); C.I. Direct Red 28 | dinátrium-3,3’-[[1,1’-bifenil]-4,4’-diilbisz(azo)]bisz(4-aminonaftalin-1-szulfonát); C.I. Direct Red 28 |
209-358-4 | 573-58-0 | Carc.
1B Repr. 2 |
H350 H361d *** |
GHS08 Dgr |
H350 H361d *** |
CLP00 | |||
| 611-028-00-3 | C,C'-azodi(formamide) | C,C'-azodi(formamid) | 204-650-8 | 123-77-3 | Resp.
Sens. 1 |
H334 |
GHS08 Dgr |
H334 |
G | CLP00/ATP01corr | ||
| 611-029-00-9 | o-dianisidine based azo dyes; 4,4'-diarylazo-3,3'-dimethoxybiphenyl dyes with the exception of those mentioned elsewhere in this Annex | o-dianizidin
alapú azo-festékek; 4,4’-diarilazo-3,3’-dimetoxibifenil festékek (kivéve az e mellékletben külön szereplőket) |
Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
A | CLP00 | ||||
| 611-030-00-4 | o-tolidine based dyes; 4,4'-diarylazo-3,3'-dimethylbiphenyl dyes, with the exception of those mentioned elsewhere in this Annex | o-tolidin
alapú azo-festékek; 4,4’-diarilazo-3,3’-dimetilbifenil festékek (kivéve az e mellékletben külön szereplőket) |
Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
A | CLP00 | ||||
| 611-031-00-X | 4,4'-(4-iminocyclohexa-2,5-dienylidenemethylene)dianiline hydrochloride; C.I. Basic Red 9 | 4,4’-(4-iminociklohexa-2,5-dienilidénmetilén)dianilin-hidroklorid; C.I. Basic Red 9 |
209-321-2 | 569-61-9 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 611-032-00-5 | 1,4,5,8-tetraaminoanthraquinone; C.I. Disperse Blue 1 | 1,4,5,8-tetraaminoantrakinon; C.I. Disperse Blue 1 |
219-603-7 | 2475-45-8 | Carc.
1B Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H350 H315 H318 H317 |
GHS08 GHS05 GHS07 Dgr |
H350 H315 H318 H317 |
CLP00 | |||
| 611-033-00-0 | hexasodium [4,4''-azoxybis(2,2'-disulfonatostilbene-4,4'-diylazo)]-bis[5'-sulfonatobenzene-2,2'- diolato-O(2),O(2),N(1)]-copper(II) | hexanátrium-(4,4”-azoxibisz(2,2’-diszulfonátosztilbén-4,4’-diilazo)]-bisz[5’-szulfonátofenil-2,2’-dioláto-O(2),O(2),N(1)]-réz(II) | 400-020-3 | 82027-60-9 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 611-034-00-6 | N-(5-(bis(2-methoxyethyl)amino)-2-((5-nitro-2,1-benzisothiazol-3-yl)azo)phenylacetamide | N-[5-bisz(2-metoxietil)amino]-2-[(5-nitro-2,1-benzizotiazol-3-il)azo]fenilacetamid | 402-430-8 | 105076-77-5 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 611-035-00-1 | tetralithium 6-amino-4-hydroxy-3-[7-sulfonato-4-(5-sulfonato-2-naphthylazo)-1-naphthylazo]naphthalene-2,7-disulfonate | tetralítium-6-amino-4-hidroxi-3-[7-szulfonáto-4-(5-szulfonáto-2-naftilazo)-1-naftilazo]naftalin-2,7-diszulfonát | 403-660-1 | 107246-80-0 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00/ATP01 | |||
| 611-036-00-7 | 2-(4-(5,6(or 6,7)-dichloro-1,3-benzothiazol-2-ylazo)-N-methyl-m-toluidino)ethyl acetate | 2-[4-(5,6-(vagy 6,7)-diklór-1,3-benzotiazol-2-ilazo)-N-metil-m-toluidino]etil-acetát | 405-440-0 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | ||||
| 611-037-00-2 | 3(or 5)-(4-(N-benzyl-N-ethylamino)-2-methylphenylazo)-1,4-dimethyl-1,2,4-triazolium methylsulphate | 3(vagy 5)-[4-(N-benzil-N-etilamino)-2-metilfenilazo]1,4-dimetil-1,2,4-triazolium-metilszulfát | 406-055-0 | 124584-00-5 | Acute
Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H302 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H317 H411 |
CLP00 | |||
| 611-038-00-8 | trisodium 1-hydroxynaphthalene-2-azo-4'(5',5''-dimethylbiphenyl)-4''-azo(4''-phenylsulfonyloxybenzene)- 2',2'',4-trisulfonate | trinátrium-1-hidroxinaftalin-2-azo-4'(5',5''-dimetilbifenil)-4''-azo(4''-fenilszulfoniloxibenzol)-2',2'',4-triszulfonát | 406-820-9 | Eye
Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
CLP00 | ||||
| 611-039-00-3 | 7-[((4,6-dichloro-1,3,5-triazin-2-yl)amino)-4-hydroxy-3-(4-((2-sulfoxy)ethyl)sulfonyl)phenylazo]naphthalene-2-sulfonic acid | 7-{[(4,6-diklór-1,3,5-triazin-2-il)amino]-4-hidroxi-3-[4-[(2-szulfoxi)etil]szulfonil]fenilazo}naftalin-2-szulfonát | 407-050-6 | 117715-57-8 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 611-040-00-9 | 3-(5-acetylamino-4-(4-[4,6-bis(3-diethylaminopropylamino)-1,3,5-triazin-2-ylamino]phenylazo)-2-(2-methoxyethoxy)phenylazo)-6-amino-4-hydroxy-2-naphthalenesulfonic acid | 3-[5-acetilamino-4-[4-[4,6-bisz(3-dietilaminopropilamino)-1,3,5-triazin-2-ilamino]fenilazo]-2-(2-metoxietoxi)fenilazo]-6-amino-4-hidroxi-2-naftalinszulfonsav | 407-670-7 | 115099-58-6 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 611-041-00-4 | 2-[[4[[4,6-bis[[3-(diethylamino)propyl]amino]-1,3,5-triazine-2-yl]amino]phenyl]azo]-N-(2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)-3-oxobutanamide | 2-[[4-[[4,6-bisz-[[3-(dietilamino)propil]amino]-1,3,5-triazin-2-il]amino]fenil]azo]-N-(2,3-dihidro-2-oxo-1H-benzimidazol-5-il)-3-oxobutánamid | 407-680-1 | 98809-11-1 | Eye
Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H411 |
CLP00 | |||
| 611-042-00-X | trisodium 5-amino-3-[5-(2-bromoacryloylamino)-2-sulfonatophenylazo]-4-hydroxy-6-(4-vinylsulfonylphenylazo)naphthalene-2,7-disulfonate | trinátrium-5-amino-3-[5-(2-brómakriloilamino)-2-szulfonátofenilazo]-4-hidroxi-6-(4-vinilszulfonilfenilazo)naftalin-2,7-diszulfonát | 411-770-6 | 136213-71-3 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | ||||
| 611-043-00-5 | reaction mass of: trisodium N(1')-N(2):N(1''')-N(2'')-η-6-[2-amino-4-(or 6)-hydroxy-(or 4-amino-2-hydroxy)phenylazo]-6''-(1-carbaniloyl-2-hydroxyprop-1-enylazo)-5',5'''-disulfamoyl-3,3''-disulfonatobis(naphthalene-2,1'-azobenzene-1,2'-diolato-O(1),O(2'))-chromate; trisodium N(1')-N(2):N(1''')-N(2'')-η-6,6''-bis(1-carbaniloyl-2-hydroxyprop-1-enylazo)-5',5'''-disulfamoyl-3,3''-disulfonatobis(naphthalene-2,1'azobenzene-1,2'-diolato-O(1),O(2'))-chromate; trisodium N(1')-N(2):N(1''')-N(2'')-η-6,6''-bis[2-amino-4-(or 6)-hydroxy-(or 4-amino-2-hydroxy)phenylazo]5',5'''-disulfamoyl-3,3''-disulfonatobis(naphthalene-2,1'azobenzene-1,2'-diolato-O(1),O(2'))-chromate (2:1:1) | a
következő anyagok keveréke:
trinátrium-N(1’)-N(2):N(1’”)-N(2”)-η-6-[2-amino-4-(vagy 6)-hidroxi-(vagy
4-amino-2-hidroxi)fenilazo]-6”-(1-karbaniloil-2-hidroxiprop-1-enilazo)-5’,5”’-diszulfamoil-3,3”-diszulfonátobisz(naftalin-2,1’-azobenzol-1,2’-dioláto-O(1),O(2’)-kromát; trinátrium N(1’)-N(2):N(1”’)-N(2”)-η-6,6”-bisz(1-karbaniloil-2-hidroxiprop-1-enilazo)-5’,5”’-diszulfamoil-3,3”-diszulfonátobisz(naftalin-2,1’-azobenzol-1,2’-dioláto-O(1),O(2’))-kromát; trinátrium-N(1’)-N(2):N(1’”)-N(2”)-η-6,6’’-[2-amino-4-(vagy 6)-hidroxi-(vagy 4-amino-2-hidroxi)fenilazo]5’,5’’’-diszulfamoil-3,3’’-diszulfonátobisz(naftalin-2,1’-azobenzol-1,2’-dioláto-O(1),O(2’)-kromát (2:1:1) |
402-850-1 | Eye
Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
CLP00 | ||||
| 611-044-00-0 | reaction mass of: tert-alkyl(C12-C14)ammonium bis[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]-chromate(1-); tert-alkyl(C12-C14)ammonium bis[1-[(2-hydroxy-4-nitrophenyl)azo]-2-naphthalenolato(2-)]-chromate(1-); tert-alkyl(C12-C14)ammonium bis[1-[[5-(1,1-dimethylpropyl)-2-hydroxy-3-nitrophenyl]azo]-2-naphthalenolato(2-)]-chromate(1-); tert-alkyl(C12-C14)ammonium [[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]-[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]]-chromate(1-); tert-alkyl(C12-C14)ammonium [[1-[[5-(1,1-dimethylpropyl)-2-hydroxy-3-nitrophenyl]azo]-2-naphthalenolato(2-)]-[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]]-chromate(1-); tert-alkyl(C12-C14)ammonium ((1-(4(or 5)-nitro-2-oxidophenylazo)-2-naphtholato)(1-(3-nitro-2-oxido-5-pentylphenylazo)-2-naphtholato))chromate(1-) | a
következő anyagok
keveréke: terc-alkil(C12-C14)ammónium-bisz[1-[(2-hidroxi-5-nitrofenil)azo]-2-naftalinoláto(2-)]-kromát(1-); terc-alkil(C12-C14)ammónium-bisz[1-[(2-hidroxi-4-nitrofenil)azo]-2-naftalinoláto(2-)]-kromát(1-); terc-alkil(C12-C14)ammónium-bisz[1-[[5-(1,1-dimetilpropil)-2-hidroxi-3-nitrofenil]azo]-2-naftalinoláto(2-)]-kromát(1-); terc-alkil(C12-C14)ammónium-[[1-[(2-hidroxi-5-nitrofenil)azo]-2-naftalinoláto(2-)]-[1-[(2-hidroxi-5-nitrofenil)azo]-2-naftalinoláto(2-)]]-kromát(1-); terc-alkil(C12-C14)ammónium-[[1-[[5-(1,1-dimetilpropil)-2-hidroxi-3-nitrofenil]azo]-2-naftalinoláto(2-)]-[1-[(2-hidroxi-5-nitrofenil)azo]-2-naftalinoláto(2-)]]-kromát(1-); terc-alkil(C12-C14)ammónium-((1-(4(vagy 5)-nitro-2-oxidofenilazo)-2-naftoláto)(1-(3-nitro-2-oxido-5-pentilfenilazo)-2-naftoláto))kromát(1-) |
403-720-7 | 117527-94-3 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 611-045-00-6 | 2-[4-[N-(4-acetoxybutyl)-N-ethyl]amino-2-methylphenylazo]-3-acetyl-5-nitrothiophene | 2-[4-[N-(4-acetoxibutil)-N-etil]amino-2-metilfenilazo]-3-acetil-5-nitrotiofén | 404-830-8 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | |||||
| 611-046-00-1 | 4,4'-diamino-2-methylazobenzene | 4,4’-diamino-2-metilazobenzol | 407-590-2 | 43151-99-1 | Acute
Tox. 3 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H373 ** H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H301 H373 ** H317 H410 |
CLP00 | |||
| 611-047-00-7 | reaction mass of: 2-[[4-[N-ethyl-N-(2-acetoxyethyl)amino]phenyl]azo]-5,6-dichlorobenzothiazole; 2-[[4-[N-ethyl-N-(2-acetoxyethyl)amino]phenyl]azo]-6,7-dichlorobenzothiazole (1:1) | 2-[[4-[N-etil-N-(2-acetoxietil)amino]fenil]azo]-5,6-diklórbenzotiazol; 2-[[4-[N-etil-N-(2-acetoxietil)amino]fenil]azo]-6,7-diklórbenzotiazol (1:1) keveréke | 407-890-3 | 111381-11-4 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 611-048-00-2 | reaction mass of: 2-[[4-[bis(2-acetoxyethyl)amino]phenyl]azo]-5,6-dichlorobenzothiazole; 2-[[4-[bis(2-acetoxyethyl)amino]phenyl]azo]-6,7-dichlorobenzothiazole (1:1) | 2-[[4-[bisz(2-acetoxietil)amino]fenil]azo]-5,6-diklórbenzotiazol; 2-[[4-[bisz(2-acetoxietil)amino]fenil]azo]-6,7-diklórbenzotiazol (1:1) keveréke | 407-900-6 | 111381-12-5 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 611-049-00-8 | reaction mass of 7-[4-(3-diethylaminopropylamino)-6-(3-diethylammoniopropylamino)-1,3,5-triazin-2-ylamino]-4-hydroxy-3-(4-phenylazophenylazo)-naphthalene-2-sulfonate, acetic acid, lactic acid (2:1:1) | 7-[4-(3-dietilaminopropilamino)-6-(3-dietilammóniopropilamino)-1,3,5-triazin-2-ilamino]-4-hidroxi-3-(4-fenilazofenilazo)-naftalin-2-szulfonát; ecetsav; tejsav (2:1:1) keveréke | 408-000-6 | 118658-98-3 | STOT
RE 2 * Skin Sens. 1 Aquatic Chronic 3 |
H373
** H317 H412 |
GHS08 Wng |
H373
** H317 H412 |
CLP00 | |||
| 611-050-00-3 | reaction mass of: pentasodium 7-amino-3-[[4-[[4-[[4-[[4-[(6-amino-1-hydroxy-3-sulfonato-2-naphthyl)azo]-7-sulfonato-1-naphthyl]azo]phenyl]amino]-3-sulfonatophenyl]azo]-6-sulfonato-1-naphthyl]azo]-4-hydroxynaphthalen-2-sulfonate; pentasodium 7-amino-8-[4-[4-[4-[4-(2-amino-5-hydroxy-7-sulfonato-naphthalen-1-ylazo)-7-sulfonatonaphthalen-1-ylazo]-phenylamino]-3-sulfonato-phenylazo]-6-sulfonato-naphthalen-1-ylazo]-4-hydroxy-naphthalene-2-sulfonate; pentasodium 7-amino-8-[4-[4-[4-[4-(6-amino-1-hydroxy-3-sulfonato-naphthalen-1-ylazo)-7-sulfonatonaphthalen-1-ylazo]-phenylamino]-3-sulfonato-phenylazo]-6-sulfonato-naphthalen-1-ylazo]-4-hydroxy-naphthalene-2-sulfonate; tetrasodium 7-amino-4-hydroxy-3-[4-[4-[4-(4-hydroxy-7-sulfonato-naphthalen-1-ylazo)-2-sulfonato-phenylamino]phenylazo]-6-sulfonato-naphthalen-1-ylazo]naphthalene-2-sulfonate; tetrasodium 7-amino-4-hydroxy-3-[4-[4-[4-(4-amino-7-sulfonato-naphthalen-1-ylazo)-2-sulfonato-phenylamino]phenylazo]-6-sulfonato-naphthalen-1-ylazo]naphthalene-2-sulfonate | a
következő anyagok keveréke:
pentanátrium-7-amino-3-[[4-[[4-[[4-[[4-[(6-amino-1-hidroxi-3-szulfonáto-2-naftil)azo]-7-szulfonáto-1-naftil]azo]fenil]amino]-3-szulfonátofenil]azo]-6-szulfonáto-1-naftil]azo]-4-hidroxinaftalin-2-szulfonát; pentanátrium-7-amino-8-[4-[4-[4-[4-(2-amino-5-hidroxi-7-szulfonátonaftalin-1-il-azo)-7-szulfonátonaftalin-1-il-azo]-fenilamino]-3-szulfonátofenilazo]-6-szulfonátonaftalin-1-il-azo]-4-hidroxinaftalin-2-szulfonát; pentanátrium-7-amino-8-[4-[4-[4-[4-(6-amino-1-hidroxi-3-szulfonátonaftalin-1-il-azo)-7-szulfonátonaftalin-1-il-azo]-fenilamino]-3-szulfonátofenilazo]-6-szulfonátonaftalin-1-il-azo]-4-hidroxinaftalin-2-szulfonát; tetranátrium-7-amino-4-hidroxi-3-[4-[4-[4-(4-hidroxi-7-szulfonátonaftalin-1-il-azo)-2-szulfonátofenilamino]fenilazo]-6-szulfonátonaftalin-1-il-azo]naftalin-2-szulfonát; tetranátrium-7-amino-4-hidroxi-3-[4-[4-[4-(4-amino-7-szulfonátonaftalin-1-il-azo)-2-szulfonátofenilamino]fenilazo]-6-szulfonátonaftalin-1-il-azo]naftalin-2-szulfonát |
415-350-3 | - | Eye
Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
ATP01 | |||
| 611-051-00-9 | 2-(4-(N-ethyl-N-(2-hydroxy)ethyl)amino-2-methylphenyl)azo-6-methoxy-3-methyl-benzothiazolium chloride | 2-(4-(N-etil-N-(2-hidroxi)etil)amino-2-metilfenil)azo-6-metoxi-3-metil-benzotiazolium-klorid | 411-110-7 | 136213-74-6 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 611-052-00-4 | monosodium aqua-[5-[[2,4-dihydroxy-5-[(2-hydroxy-3,5-dinitrophenyl)azo]phenyl]azo]-2-naphthalensulfonate], iron complex | mononátrium-akva-[5-[[2,4-dihidroxi-5-[(2-hidroxi-3,5-dinitrofenil) azo]fenil]azo]-2-naftalinszulfonát], vas komplex | 400-720-9 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | |||||
| 611-053-00-X | 2,2'-azobis[2-methylpropionamidine] dihydrochloride | 2,2’-azobisz(2-metilpropionamidin)-dihidroklorid | 221-070-0 | 2997-92-4 | Acute
Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
CLP00 | |||
| 611-055-00-0 | C.I. Disperse Yellow 3; N-[4-[(2-hydroxy-5-methylphenyl)azo]phenyl]acetamide | C.I.
Disperse Yellow 3; N-[4-[(2-hidroxi-5-metilfenil)azo]fenil]acetamid |
220-600-8 | 2832-40-8 | Carc.
2 Skin Sens. 1 |
H351 H317 |
GHS08 GHS07 Wng |
H351 H317 |
CLP00 | |||
| 611-056-00-6 | C.I. Solvent Yellow 14; 1-phenylazo-2-naphthol | C.I.
Solvent Yellow 14; 1-fenilazo-2-naftol |
212-668-2 | 842-07-9 | Carc.
2 Muta. 2 Skin Sens. 1 Aquatic Chronic 4 |
H351 H341 H317 H413 |
GHS08 GHS07 Wng |
H351 H341 H317 H413 |
CLP00 | |||
| 611-057-00-1 | 6-hydroxy-1-(3-isopropoxypropyl)-4-methyl-2-oxo-5-[4-(phenylazo)phenylazo]-1,2-dihydro-3-pyridinecarbonitrile | 6-hidroxi-1-(3-izopropoxipropil)-4-metil-2-oxo-5-[4-(fenilazo)fenilazo]-1,2-dihidro-3-piridinkarbonitril | 400-340-3 | 85136-74-9 | Carc.
1B Aquatic Chronic 4 |
H350 H413 |
GHS08 Wng |
H350 H413 |
CLP00 | |||
| 611-058-00-7 | (6-(4-hydroxy-3-(2-methoxyphenylazo)-2-sulfonato-7-naphthylamino)-1,3,5-triazin-2,4-diyl)bis[(amino-1-methylethyl)ammonium] formate | [6-(4-hidroxi-3-(2-metoxifenilazo)-2-szulfonáto-7-naftilamino]-1,3,5-triazin-2,4-diil]bisz[(amino-1-metiletil)ammónium]-formiát | 402-060-7 | 108225-03-2 | Carc.
1B Eye Dam. 1 Aquatic Chronic 2 |
H350 H318 H411 |
GHS08 GHS05 GHS09 Dgr |
H350 H318 H411 |
CLP00 | |||
| 611-059-00-2 | octasodium 2-(6-(4-chloro-6-(3-(N-methyl-N-(4-chloro-6-(3,5-disulfonato-2-naphthylazo)-1-hydroxy-6-naphthylamino)-1,3,5-triazin-2-yl)aminomethyl)phenylamino)-1,3,5-triazin-2-ylamino)-3,5-disulfonato-1-hydroxy-2-naphthylazo)naphthalene-1,5-disulfonate | oktanátrium-2-[6-[4-klór-6-[3-[N-metil-N-[4-klór-6-(3,5-diszulfonáto-2-naftilazo)-1-hidroxi-6-naftilamino]-1,3,5-triazin-2-il]aminometil]fenilamino]-1,3,5-triazin-2-ilamino]-3,5-diszulfonáto-1-hidroxi-2-naftilazo]naftalin-1,5-diszulfonát | 412-960-1 | 148878-21-1 | Eye
Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
CLP00 | |||
| 611-060-00-8 | reaction mass of: sodium 5-[8-[4-[4-[4-[7-(3,5-dicarboxylatophenylazo)-8-hydroxy-3,6-disulfonatonaphthalen-1-ylamino]-6-hydroxy-1,3,5-triazin-2-yl]-2,5-dimethylpiperazin-1-yl]-6-hydroxy-1,3,5-triazin-2-ylamino]-1-hydroxy-3,6-disulfonatonaphthalen-2-ylazo]-isophthalate; ammonium 5-[8-[4-[4-[4-[7-(3,5-dicarboxylatophenylazo)-8-hydroxy-3,6-disulfonatonaphthalen-1-ylamino]-6-hydroxy-1,3,5-triazin-2-yl]-2,5-dimethylpiperazin-1-yl]-6-hydroxy-1,3,5-triazin-2-ylamino]-1-hydroxy-3,6-disulfonatonaphthalen-2-ylazo]-isophthalate; 5-[8-[4-[4-[4-[7-(3,5-dicarboxylatophenylazo)-8-hydroxy-3,6-disulfonatonaphthalen-1-ylamino]-6-hydroxy-1,3,5-triazin-2-yl]-2,5-dimethylpiperazin-1-yl]-6-hydroxy-1,3,5-triazin-2-ylamino]-1-hydroxy-3,6-disulfonaphthalen-2-ylazo]-isophthalic acid | a
következő anyagok keveréke:
nátrium-5-[8-[4-[4-[4-[7-(3,5-dikarboxilátofenilazo)-8-hidroxi-3,6-diszulfonátonaftalin-1-ilamino]-6-hidroxi-1,3,5-triazin-2-il]-2,5-dimetilpiperazin-1-il]-6-hidroxi-1,3,5-triazin-2-ilamino]-1-hidroxi-3,6-diszulfonátonaftalin-2-ilazo]izoftalát; ammónium-5-[8-[4-[4-[4-[7-(3,5-dikarboxilátofenilazo)-8-hidroxi-3,6-diszulfonátonatfalin-1-ilamino]-6-hidroxi-1,3,5-triazin-2-il]-2,5-dimetilpiperazin-1-il]-6-hidroxi-1,3,5-triazin-2-ilamino]-1-hidroxi-3,6-diszulfonátonaftalin-2-ilazo]izoftalát; 5-[8-[4-[4-[4-[7-(3,5-dikarboxilátofenilazo)-8-hidroxi-3,6-diszulfonátonaftalin-1-ilamino]-6-hidroxi-1,3,5-triazin-2-il]-2,5-dimetilpiperazin-1-il]-6-hidroxi-1,3,5-triazin-2-ilamino]-1-hidroxi-3,6-diszulfonátonaftalin-2-ilazo]izoftálsav |
413-180-4 | 187285-15-0 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | |||
| 611-061-00-3 | disodium 5-[5-[4-(5-chloro-2,6-difluoropyrimidin-4-ylamino)benzamido]-2-sulfonatophenylazo]-1-ethyl-6-hydroxy-4-methyl-2-oxo-3-pyridylmethylsulfonate | dinátrium-5-[5-[4-(5-klór-2,6-difluorpirimidin-4-ilamino)benzamido]-2-szulfonátofenilazo]-1-etil-6-hidroxi-4-metil-2-oxo-3-piridilmetilszulfonát | 412-530-3 | Eye
Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
CLP00 | ||||
| 611-062-00-9 | octasodium 2-(8-(4-chloro-6-(3-((4-chloro-6-(3,6-disulfonato-2-(1,5-disulfonatonaphthalen-2-ylazo)-1-hydroxynaphthalen-8-ylamino)-1,3,5-triazin-2-yl)aminomethyl)phenylamino)-1,3,5-triazin-2-ylamino)-3,6-disulfonato-1-hydroxynaphthalen-2-ylazo)naphthalene-1,5-disulfonate | oktanátrium-2-(8-(4-klór-6-(3- ((4-klór-6-(3,6-diszulfonáto-2-(1,5-diszulfonátonaftalin-2-ilazo)-1-hidroxinaftalin-8-ilamino)-1,3,5-triazin-2-il)aminometil)fenilamino)-1,3,5-triazin-2-ilamino)-3,6-diszulfonáto-1-hidroxinaftalin-2-ilazo)naftalin-1,5-diszulfonát | 413-550-5 | Skin
Irrit. 2 Eye Dam. 1 |
H315 H318 |
GHS05 Dgr |
H315 H318 |
CLP00 | ||||
| 611-063-00-4 | trisodium [4'-(8-acetylamino-3,6-disulfonato-2-naphthylazo)-4''-(6-benzoylamino-3-sulfonato-2-naphthylazo)-biphenyl-1,3',3'',1'''-tetraolato-O,O',O'',O''']copper(II) | trinátrium-[4’-(8-acetilamino-3,6-diszulfonáto-2-naftilazo)-4’’-(6-benzoilamino-3-szulfonáto-2-naftilazo)bifenil-1,3’,3’’,1’’’-tetraolátoO,O’,O’’,O’’’]-réz(II) | 413-590-3 | 164058-22-4 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 611-064-00-X | 4-(3,4-dichlorophenylazo)-2,6-di-sec-butyl-phenol | 4-(3,4-diklórfenilazo)-2,6-di-szek-butilfenol | 410-600-8 | 124719-26-2 | STOT
RE 2 * Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H373
** H315 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H373
** H315 H410 |
CLP00 | |||
| 611-065-00-5 | 4-(4-nitrophenylazo)-2,6-di-sec-butyl-phenol | 4-(4-nitrofenilazo)-2,6-di-szek-butilfenol | 410-610-2 | 111850-24-9 | STOT
RE 2 * Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373
** H315 H319 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H373
** H319 H315 H317 H410 |
CLP00 | |||
| 611-066-00-0 | tetrasodium 5-[4-chloro-6-(N-ethyl-anilino)-1,3,5-triazin-2-ylamino]-4-hydroxy-3-(1,5-disulfonatonaphthalen-2-ylazo)-naphthalene-2,7-disulfonate | tetranátrium-5-[4-klór-6-(N-etilanilino)-1,3,5-triazin-2-ilamino]-4-hidroxi-3-(1,5-diszulfonátonaftalin-2-ilazo)-naftalin-2,7-diszulfonát | 411-540-5 | 130201-57-9 | Eye
Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H411 |
CLP00 | |||
| 611-067-00-6 | reaction mass of: bis(tris(2-(2-hydroxy(1-methyl)ethoxy)ethyl)ammonium) 7-anilino-4-hydroxy-3-(2-methoxy-5-methyl-4-(4-sulfonatophenylazo)phenylazo)naphthalene-2-sulfonate; bis(tris(2-(2-hydroxy(2-methyl)ethoxy)ethyl)ammonium) 7-anilino-4-hydroxy-3-(2-methoxy-5-methyl-4-(4-sulfonatophenylazo)phenylazo)naphthalene-2-sulfonate | bisz(trisz(2-(2-hidroxi(1-metil)etoxi)etil)ammónium)-7-anilino-4-hidroxi-3-(2-metoxi-5-metil-4-(4-szulfonátofenilazo)fenilazo)naftalin-2-szulfonát; bisz(trisz(2-(2-hidroxi(2-metil)etoxi)etil)ammónium)-7-anilino-4-hidroxi-3-(2-metoxi-5-metil-4-(4-szulfonátofenilazo)fenilazo)naftalin-2-szulfonát keveréke |
406-910-8 | - | Acute
Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
CLP00/ATP01 | |||
| 611-068-00-1 | tetrasodium 4-amino-3,6-bis(5-[4-chloro-6-(2-hydroxyethylamino)-1,3,5-triazin-2-ylamino]-2-sulfonatophenylazo)-5-hydroxynaphthalene-2,7-disulfonate | tetranátrium-4-amino-3,6-bisz[5-[4-klór-6-(2-hidroxietilamino)-1,3,5-triazin-2-ilamino]-2-szulfonátofenilazo)-5-hidroxinaftalin-2,7-diszulfonát | 400-690-7 | 85665-98-1 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 611-069-00-7 | N,N-di-[poly(oxyethylene)-co-poly(oxypropylene)]-4-[(3,5-dicyano-4-methyl-2-thienyl)azo)]-3-methylaniline | N,N-di[poli(oxietilén)-ko-poli(oxipropilén)]-4-[(3,5-diciano-4-metil-2-tienil)azo]-3-metilanilin | 413-380-1 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | ||||
| 611-070-00-2 | reaction mass of: disodium (6-(4-anisidino)-3-sulfonato-2-(3,5-dinitro-2-oxidophenylazo)-1-naphtholato)(1-(5-chloro-2-oxidophenylazo)-2-naphtholato)chromate(1-); trisodium bis(5-(4-anisidino)-3-sulfonato-2-(3,5-dinitro-2-oxidophenylazo)-1-naphtholato)chromate(1-) | dinátrium-(6-(4-anizidino)-3-szulfonáto-2-(3,5-dinitro-2-oxidofenilazo)-1-naftoláto)(1-(5-klór-2-oxidofenilazo)-2-naftoláto)kromát(1-); trinátrium-bisz(5-(4-anizidino)-3-szulfonáto-2-(3,5-dinitro-2-oxidofenilazo)-1-naftoláto)kromát(1-) keveréke |
405-665-4 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
CLP00 | ||||
| 611-071-00-8 | tris(tetramethylammonium) 5-hydroxy-1-(4-sulphonatophenyl)-4-(4-sulphonatophenylazo)pyrazole-3-carboxylate | trisz(tetrametilammónium)-5-hidroxi-1-(4-szulfonátofenil)-4-(4-szulfonátofenilazo)pirazol-3-karboxilát | 406-073-9 | 131013-81-5 | Acute
Tox. 3 * Aquatic Chronic 3 |
H301 H412 |
GHS06 Dgr |
H301 H412 |
CLP00 | |||
| 611-072-00-3 | 2,4-bis[2,2'-[2-(N,N-dimethylamino)ethyloxycarbonyl]phenylazo]-1,3-dihydroxybenzene, dihydrochloride | 2,4-bisz[2,2’-[2-(N, N-dimetilamino)etiloxikarbonil]fenilazo]-1,3-dihidroxibenzol, dihidroklorid | 407-010-8 | 118208-02-9 | Acute
Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
CLP00 | |||
| 611-073-00-9 | dimethyl 3,3'-(N-(4-(4-bromo-2,6-dicyanophenylazo)-3-hydroxyphenyl)imino)dipropionate | dimetil-3,3’-[N-[4-(4-bróm-2,6-dicianofenilazo)-3-hidroxifenil]imino]dipropionát | 407-310-9 | 122630-55-1 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 611-074-00-4 | reaction mass of: sodium/potassium (3-(4-(5-(5-chloro-2,6-difluoropyrimidin-4-ylamino)-2-methoxy-3-sulfonatophenylazo)-2-oxidophenylazo)-2,5,7-trisulfonato-4-naphtholato)copper(II); sodium/potassium (3-(4-(5-(5-chloro-4,6-difluoropyrimidin-2-ylamino)-2-methoxy-3-sulfonatophenylazo)-2-oxidophenylazo)-2,5,7-trisulfonato-4-naphtholato)copper(II) | nátrium-kálium-[3-[4-[5-(5-klór-2,6-difluorpirimidin-4-ilamino)-2-metoxi-3-szulfonátofenilazo]2-oxidofenilazo]-2,5,7-triszulfonáto-4-naftoláto]-réz(II); nátrium-kálium-[3-[4-[5-(5-klór-4,6-difluorpirimidin-2-ilamino)-2-metoxi-3-szulfonátofenilazo]-2-oxidofenilazo]-2,5,7-triszulfonáto-4-naftoláto]-réz(II) keveréke |
407-100-7 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | ||||
| 611-075-00-X | reaction mass of: tris(3,5,5-trimethylhexylammonium) 4-amino-3-(4-(4-(2-amino-4-hydroxyphenylazo)anilino)-3-sulfonatophenylazo)-5,6-dihydro-5-oxo-6-phenylhydrazononaphthalene-2,7-disulfonate; tris(3,5,5-trimethylhexylammonium) 4-amino-3-(4-(4-(4-amino-2-hydroxyphenylazo)anilino)-3-sulfonatophenylazo)-5,6-dihydro-5-oxo-6-phenylhydrazononaphthalene-2,7-disulfonate (2:1) | trisz(3,5,5-trimetilhexilammónium)-4-amino-3-[4-[4-(2-amino-4-hidroxifenilazo)anilino]-3-szulfonátofenilazo]-5,6-dihidro-5-oxo-6-fenilhidrazononaftalin-2,7-diszulfonát; trisz(3,5,5-trimetilhexilammónium)-4-amino-3-[4-[4-(4-amino-2-hidroxifenilazo)anilino]-3-szulfonátofenilazo]-5,6-dihidro-5-oxo-6-fenilhidrazononaftalin-2,7-diszulfonát (2:1) keveréke |
406-000-0 | Eye
Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
CLP00 | ||||
| 611-076-00-5 | 3-(2,6-dichloro-4-nitrophenylazo)-1-methyl-2-phenylindole | 3-(2,6-diklór-4-nitrofenilazo)-1-metil-2-fenilindol | 406-280-4 | 117584-16-4 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 611-077-00-0 | dilithium disodium (5,5'-diamino-(μ-4,4'-dihydroxy-1:2-κ-2,O4,O4',-3,3'-[3,3'-dihydroxy-1:2-κ-2-O3,O3'-biphenyl-4,4'-ylenebisazo-1:2-(N3,N4-η:N3',N4'-η)]-dinaphthalene-2,7-disulfonato(8)))dicuprate(2-) | dilítium-dinátrium-[5,5’-diamino-[μ-4,4’-dihidroxi-1:2-κ-2,O4,O4’,-3,3’-[3,3’-dihidroxi-1:2-κ-2-O3,O3’-bifenil-4,4’-ilénbiszazo-1:2-(N3,N4-η:N3’,N4’-η)]dinaftalin-2,7-diszulfonáto(8)]]-dikuprát(2-) | 407-230-4 | 126637-70-5 | Acute
Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
CLP00 | |||
| 611-078-00-6 | (2,2'-(3,3'-dioxidobiphenyl-4,4'-diyldiazo)bis(6-(4-(3-(diethylamino)propylamino)-6-(3-(diethylammonio)propylamino)-1,3,5-triazin-2-ylamino)-3-sulfonato-1-naphtholato))dicopper(II) acetate lactate | [2,2’-(3,3’-dioxidobifenil-4,4’-diildiazo)bisz[6-[4-[3-(dietilamino)propilamino]-6-[3-(dietilammónio)propilamino]-1,3,5-triazin-2-ilamino]-3-szulfonáto-1-naftoláto]]diréz(II)-acetát-laktát | 407-240-9 | 159604-94-1 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | |||
| 611-079-00-1 | disodium 7-[4-chloro-6-(N-ethyl-o-toluidino)-1,3,5-triazin-2-ylamino]-4-hydroxy-3-(4-methoxy-2-sulfonatophenylazo)-2-naphthalenesulfonate | dinátrium-7-[4-klór-6-(N-etil-o-toluidino)-1,3,5-triazin-2-ilamino]-4-hidroxi-3-(4-metoxi-2-szulfonátofenilazo)-2-naftalinszulfonát | 410-390-8 | 147703-64-8 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | |||
| 611-080-00-7 | sodium 3-(2-acetamido-4-(4-(2-hydroxybutoxy)phenylazo)phenylazo)benzenesulfonate | nátrium-3-[2-acetamido-4-[4-(2-hidroxibutoxi)fenilazo]fenilazo]benzolszulfonát | 410-150-2 | 147703-65-9 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 611-081-00-2 | tetrasodium [7-(2,5-dihydroxy-KO2-7-sulfonato-6-[4-(2,5,6-trichloro-pyrimidin-4-ylamino)phenylazo]-(N1,N7-N)-1-naphthylazo)-8-hydroxy-KO8-naphthalene-1,3,5-trisulfonato(6-)]cuprate(II) | tetranátrium-[7-[2,5-dihidroxi-KO2-7-szulfonáto-6-[4-(2,5,6-triklórpirimidin-4-ilamino)fenilazo]-(N1,N7-N)-1-naftilazo]-8-hidroxi-KO8-naftalin-1,3,5-triszulfonáto(6-)]-kuprát(II) | 411-470-5 | 141048-13-7 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
CLP00 | |||
| 611-082-00-8 | reaction mass of: pentasodium bis(1-(3(or 5)-(4-anilino-3-sulfonatophenylazo)-4-hydroxy-2-oxidophenylazo)-6-nitro-4-sulfonato-2-naphtholato)ferrate(1-); pentasodium [(1-(3-(4-anilino-3-sulfonatophenylazo)-4-hydroxy-2-oxidophenylazo)-6-nitro-4-sulfonato-2-naphtholato)-(5-(4-anilino-3-sulfonatophenylazo)-4-hydroxy-2-oxidophenylazo)-6-nitro-4-sulfonato-2-naphtholato]ferrate(1-) | pentanátrium-bisz[1-[3(vagy 5)-(4-anilino-3-szulfonátofenilazo)-4-hidroxi-2-oxidofenilazo]-6-nitro-4-szulfonáto-2-naftoláto]-ferrát(1-); pentanátrium-[[1-[3-(4-anilino-3-szulfonátofenilazo)-4-hidroxi-2-oxidofenilazo]-6-nitro-4-szulfonáto-2-naftoláto]-[5-(4-anilino-3-szulfonátofenilazo)-4-hidroxi-2-oxidofenilazo]-6-nitro-4-szulfonáto-2-naftoláto]-ferrát(1-) keveréke | 407-570-3 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | ||||
| 611-083-00-3 | reaction mass of: 2-[N-ethyl-4-[(5,6-dichlorobenzothiazol-2-yl)azo]-m-toludino]ethyl acetate; 2-[N-ethyl-4-[(6,7-dichlorobenzothiazol-2-yl)azo]-m-toludino]ethyl acetate (1:1) | 2-[N-etil-4-[(5,6-diklórbenzotiazol-2-il)azo]-m-toluidino]etil-acetát; 2-[N-etil-4-[(6,7-diklórbenzotiazol-2-il)azo]-m-toluidino]etil-acetát (1:1) keveréke |
411-560-4 | STOT
RE 1 Skin Sens. 1 Aquatic Chronic 2 |
H372
** H317 H411 |
GHS08 GHS07 GHS09 Dgr |
H372
** H317 H411 |
CLP00 | ||||
| 611-085-00-4 | reaction mass of: 3-cyano-5-(2-cyano-4-nitro-phenylazo)-2-(2-hydroxy-ethylamino)-4-methyl-6-[3-(2-phenoxyethoxy)propylamino]pyridine; 3-cyano-5-(2-cyano-4-nitro-phenylazo)-6-(2-hydroxy-ethylamino)-4-methyl-2-[3-(2-phenoxyethoxy)propylamino]pyridine; 3-cyano-5-(2-cyano-4-nitro-phenylazo)-2-amino-4-methyl-6-[3-(3-hydroxypropoxy)propylamino]pyridine; 3-cyano-5-(2-cyano-4-nitro-phenylazo)-6-amino-4-methyl-2-[3-(3-methoxypropoxy)propylamino]pyridine | a
következő anyagok keveréke:
3-ciano-5-(2-ciano-4-nitrofenilazo)-2-(2-hidroxietilamino)-4-metil-6-[3-(2-fenoxietoxi)propilamino]piridin; 3-ciano-5-(2-ciano-4-nitrofenilazo)-6-(2-hidroxietilamino)-4-metil-2-[3-(2-fenoxietoxi)propilamino]piridin; 3-ciano-5-(2-ciano-4-nitrofenilazo)-2-amino-4-metil-6-[3-(3-hidroxipropoxi)propilamino]piridin; 3-ciano-5-(2-ciano-4-nitrofenilazo)-6-amino-4-metil-2-[3-(3-metoxipropoxi)propilamino]piridin |
411-880-4 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | ||||
| 611-086-00-X | monolithium 5-[[2,4-dihydroxy-5-[(2-hydroxy-3,5-dinitrophenyl)azo]phenyl]azo]-2-naphthalenesulfonate], iron complex, monohydrate | monolítium-[5-[[2,4-dihidroxi-5-[(2-hidroxi-3,5-dinitrofenil)azo]fenil]azo]-2-naftalinszulfonát]-vas
komplex, monohidrát |
411-360-7 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | |||||
| 611-087-00-5 | reaction mass of: 3-((5-cyano-1,6-dihydro-1,4-dimethyl-2-hydroxyl-6-oxo-3-pyridinyl)azo)-benzoyloxy-2-phenoxyethane; 3-((5-cyano-1,6-dihydro-1,4-dimethyl-2-hydroxy-6-oxo-3-pyridinyl)azo)-benzoyloxy-2-ethyloxy-2-(ethylphenol) | 3-[(5-ciano-1,6-dihidro-1,4-dimetil-2-hidroxil-6-oxo-3-piridinil)azo]-benzoiloxi-2-fenoxietán; 3-[(5-ciano-1,6-dihidro-1,4-dimetil-2-hidroxil-6-oxo-3-piridinil)azo]-benzoiloxi-2-etiloxi-2-etilfenol keveréke |
411-710-9 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | |||||
| 611-088-00-0 | reaction mass of: trilithium 4-amino-3-((4-((4-((2-amino-4-hydroxyphenyl)azo)phenyl)amino)-3-sulfophenyl)azo)-5-hydroxy-6-(phenylazo)naphthalene-2,7-disulfonate; trilithium 4-amino-3-((4-((4-((4-amino-2-hydroxyphenyl)azo)phenyl)amino)-3-sulfophenyl)azo)-5-hydroxy-6-(phenylazo)naphthalene-2,7-disulfonate | trilítium-4-amino-3-[[4-[(4-[(2-amino-4-hidroxifenil)azo]fenil]amino]-3-szulfofenil]azo]-5-hidroxi-6-(fenilazo)naftalin-2,7-diszulfonát; trilítium-4-amino-3-[[4-[[4-[(4-amino-2-hidroxifenil)azo]fenil)amino]-3-szulfofenil]azo]-5-hidroxi-6-(fenilazo)naftalin-2,7-diszulfonát keveréke |
411-890-9 | Acute
Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
CLP00 | ||||
| 611-089-00-6 | 2-((4-(ethyl-(2-hydroxyethyl)amino)-2-methylphenyl)azo)-6-methoxy-3-methyl-benzothiazolium methylsulfate | 2-[(4-etil-(2-hidroxietil)amino)-2-metilfenil]azo]-6-metoxi-3-metilbenzotiazolium-metilszulfát | 411-100-2 | 136213-73-5 | STOT
RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373
** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H373
** H317 H410 |
CLP00 | |||
| 611-090-00-1 | 2,5-dibutoxy-4-(morpholin-4-yl)benzenediazonium 4-methylbenzenesulfonate | 2,5-dibutoxi-4-(morfolin-4-il)benzoldiazónium-4-metilbenzolszulfonát | 413-290-2 | 93672-52-7 | Self-react.
C Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H242 H302 H318 H317 H412 |
GHS02 GHS05 GHS07 Dgr |
H242 H302 H318 H317 H412 |
T | CLP00 | ||
| 611-091-00-7 | sodium (1.0-1.95)/lithium (0.05-1) 5-((5-((5-chloro-6-fluoro-pyrimidin-4-yl)amino)-2-sulfonatophenyl)azo)-1,2-dihydro-6-hydroxy-1,4-dimethyl-2-oxo-3-pyridinemethylsulfonate | nátrium (1,0-1,95)/lítium (0,051)-5-[[5-[(5-klór-6-fluorpirimidin-4-il)amino]-2-szulfonátofenil]azo]-1,2-dihidro-6-hidroxi-1,4-dimetil-2-oxo-3-piridinmetilszulfonát | 413-470-0 | 134595-59-8 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 611-092-00-2 | tert-(dodecyl/tetradecyl)-ammonium bis(3-(4-((5-(1,1-dimethyl-propyl)-2-hydroxy-3-nitrophenyl)azo)-3-methyl-5-hydroxy-(1H)pyrazol-1-yl)benzenesulfonamidato)chromate | terc-dodecil/tetradecil)-ammónium-bisz[3-[4-[[5-(1,1-dimetilpropil)-2-hidroxi-3-nitrofenil]azo]-3-metil-5-hidroxi-(1H) pirazol-1-il]benzolszulfonamidáto]-kromát | 413-210-6 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | ||||
| 611-093-00-8 | sodium 2-(4-(4-fluoro-6-(2-sulfo-ethylamino)-[1,3,5]triazin-2-ylamino)-2-ureido-phenylazo)-5-(4-sulfophenylazo)benzene-1-sulfonate | nátrium-2-[4-[4-fluor-6-(2-szulfoetilamino)-1,3,5-triazin-2-ilamino]-2-ureidofenilazo]-5-(4-szulfofenilazo)benzol-1-szulfonát | 410-770-3 | 146177-84-6 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 611-094-00-3 | reaction mass of: 2-[2-acetylamino-4-[N,N-bis[2-ethoxy-carbonyloxy)ethyl]amino]phenylazo]-5,6-dichloro-1,3-benzothiazole; 2-[2-acetylamino-4-[N,N-bis[2-ethoxy-carbonyloxy)ethyl]amino]phenylazo]-6,7-dichloro-1,3-benzotriazole (1:1) | 2-[2-acetilamino-4-[N,
N-bisz[(2-etoxi-karboniloxi)etil]amino]fenilazo]-5,6-diklór-1,3-benzotiazol; 2-[2-acetilamino-4-[N, N-bisz[(2-etoxi-karboniloxi)etil]amino]fenilazo)-6,7-diklór-1,3-benzotriazol (1:1) keveréke |
411-600-0 | 143145-93-1 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 611-095-00-9 | hexasodium 1,1'-[(1-amino-8-hydroxy-3,6-disulfonate-2,7-naphthalenediyl)bis(azo(4-sulfonate-1,3-phenyl)imino[6-[(4-chloro-3-sulfonatophenyl)amino]-1,3,5-triazin-2,4-diyl]]]bis[3-carboxypyridinium] dihydroxide | hexanátrium-1,1’-[(1-amino-8-hidroxi-3,6-diszulfonát-2,7-naftalindiil)bisz[azo(4-szulfonát-1,3-fenil)imino[6-[(4-klór-3-szulfonátofenil)amino]-1,3,5-triazin-2,4-diil]]]bisz(3-karboxipiridinium)-dihidroxid | 412-240-7 | 89797-03-5 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 611-096-00-4 | methyl N-[3-acetylamino)-4-(2-cyano-4-nitrophenylazo)phenyl]-N-[(1-methoxy)acetyl]glycinate | metil-N-[3-acetilamino)-4-(2-ciano-4-nitrofenilazo)fenil]-N-[(1-metoxi)acetil]-glicinát | 413-040-2 | 149850-30-6 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 611-097-00-X | reaction mass of iron complexes of: 1,3-dihydroxy-4-[(5-phenylaminosulfonyl)-2-hydroxyphenylazo]-n-(5-amino-sulfonyl-2-hydroxyphenylazo)benzene and: 1,3-dihydroxy-4-[(5-phenylaminosulfonyl)-2-hydroxyphenylazo]-n-[4-(4-nitro-2-sulfophenylamino)phenylazo]benzene (n=2,5,6) | 1,3-dihidroxi-4-[(5-fenilaminoszulfonil)-2-hidroxifenilazo]-n-(5-aminoszulfonil-2-hidroxifenilazo)benzol és 1,3-dihidroxi-4-[(5-fenilaminoszulfonil)-2-hidroxifenilazo]-n-[4-(4-nitro-2-szulfofenilamino)fenilazo]benzol (n = 2,5,6) izomerek vas komplexeinek keveréke | 414-150-3 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | ||||
| 611-098-00-5 | tetrakis(tetramethylammonium)3,3'-(6-(2-hydroxyethylamino)1,3,5-triazine-2,4-diylbisimino(2-methyl-4,1-phenyleneazo))bisnaphthalene-1,5-disulfonate | tetrakisz(tetrametilammónium)-3,3’-[6-(2-hidroxietilamino)-1,3,5-triazin-2,4-diilbiszimino(2-metil-4,1-fenilénazo)]bisznaftalin-1,5-diszulfonát | 405-950-3 | 131013-83-7 | Acute
Tox. 3 * Aquatic Chronic 3 |
H301 H412 |
GHS06 Dgr |
H301 H412 |
CLP00 | |||
| 611-099-00-0 | (methylenebis(4,1-phenylenazo(1-(3-(dimethylamino)propyl)-1,2-dihydro-6-hydroxy-4-methyl-2-oxopyridine-5,3-diyl)))-1,1'-dipyridinium dichloride dihydrochloride | (metilénbisz(4,1-fenilénazo(1-(3-(dimetilamino)propil)-1,2-dihidro-6-hidroxi-4-metil-2-oxopiridin-5,3-di-il)))-1,1'-dipiridinium-diklorid-dihidroklorid | 401-500-5 | 118658-99-4 | Carc.
1B Aquatic Chronic 2 |
H350 H411 |
GHS08 GHS09 Dgr |
H350 H411 |
CLP00 | |||
| 611-100-00-4 | potassium sodium 3,3'-(3(or4)-methyl-1,2-phenylenebis(imino(6-chloro)-1,3,5-triazine-4,2-diylimino(2-acetamido-5-methoxy)-4,1-phenylenazo)dinaphthalene-1,5-disulfonate | kálium, nátrium-3,3’-(3(vagy 4)-metil-1,2-fenilénbisz(imino(6-klór)-1,3,5-triazin-4,2-diilimino(2-acetamido-5-metoxi)-4,1-fenilenazo)dinaftalin-1,5-diszulfonát | 403-810-6 | 140876-13-7 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | |||
| 611-101-00-X | 2'-(4-chloro-3-cyano-5-formyl-2-thienyl)azo-5'-diethylaminoacetanilide | 2’-(4-klór-3-ciano-5-formil-2-tienil)azo-5’-dietilaminoacetanilid | 405-200-5 | 104366-25-8 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 611-102-00-5 | reaction product of: C.I. Leuco Sulfur Black 1 and reaction mass of: disodium-4-{4-[8-amino-1-hydroxy-7-(4-sulfamoylphenylazo)-3,6-disulfonato-2-naphthylazo]phenylsulfonylamino}benzendiazoniumchlorid; disodium-4-{4-[2,6-dihydroxy-3-(8-hydroxy-3,6-disulfonato-1-naphthylazo)phenylazo]phenylsulfonylamino}benzen-diazoniumchlorid | A következők reakcióterméke: C.I. Leuco Sulfur Black 1 és az alábbiakból álló keverék: dinátrium-4-{4-[8-amino-1-hidroxi-7-(4-szulfamoilfenilazo)-3,6-diszulfonáto-2-naftilazo]fenilszulfonilamino}benzoldiazónium-klorid; dinátrium-4-{4-[2,6-dihidroxi-3-(8-hidroxi-3,6-diszulfonáto-1-naftilazo)fenilazo]fenilszulfonilamino}benzoldiazónium-klorid | 424-500-7 | - | Aquatic
Chronic 3 |
H412 |
- |
H412 |
ATP01 | |||
| 611-103-00-0 | trisodium (1-(3-carboxylato-2-oxido-5-sulfonatophenylazo)-5-hydroxy-7-sulfonatonaphthalen-2-amido)nickel(II) | trinátrium-(1-(3-karboxiláto-2-oxido-5-szulfonátofenilazo)-5-hidroxi-7-szulfonátonaftalin-2-amido)-nikkel(II) | 407-110-1 | Eye
Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H411 |
CLP00 | ||||
| 611-104-00-6 | reaction mass of: trisodium (2,4(or 2,6 or 4,6)-bis(3,5-dinitro-2-oxidophenylazo)-5-hydroxyphenolato)(2(or 4or 6)-(3,5-dinitro-2-oxidophenylazo)-5-hydroxy-4(or 2or 6)-(4-(4-nitro-2-sulfonatoanilino)phenylazo)phenolato)ferrate(1-); trisodium bis(2,4(or 2,6 or 4,6)-bis(3,5-dinitro-2-oxidophenylazo)-5-hydroxyphenolato)ferrate(1-); trisodium (2,4(or 2,6 or 4,6)-bis(3,5-dinitro-2-oxidophenylazo)-5-hydroxyphenolato)(2(or 4 or 6)-(3,5-dinitro-2-oxidophenylazo)-5-hydroxy-4(or 2 or 6)-(4-nitro-2-sulfonatophenylazo)phenolato)ferrate(1-); trisodium (2,4(or 2,6 or 4,6)-bis(3,5-dinitro-2-oxidophenylazo)-5-hydroxyphenolato)(2(or 4 or 6)-(3,5-dinitro-2-oxidophenylazo)-5-hydroxy-4(or 2 or 6)-(3-sulfonatophenylazo)phenolato)ferrate(1-); disodium 3,3'-(2,4-dihydroxy-1,3(or 1,5 or 3,5)-phenylenediazo)dibenzenesulfonate | a
következő anyagok keveréke: trinátrium-(2,4(vagy 2,6 vagy
4,6)-bisz(3,5-dinitro-2-oxidofenilazo)-5-hidroxifenoláto)(2(vagy 4 vagy
6)-(3,5-dinitro-2-oxidofenilazo)-5-hidroxi-4(vagy 2 vagy
6)-(4-(4-nitro-2-szulfonátoanilino)fenilazo)fenoláto)-ferrát(1-); trinátrium-bisz(2,4(vagy 2,6 vagy 4,6)-bisz(3,5-dinitro-2-oxidofenilazo)-5-hidroxifenoláto)-ferrát(1-); trinátrium-(2,4(vagy 2,6 vagy 4,6)-bisz(3,5-dinitro-2-oxidofenilazo)-5-hidroxifenoláto)(2(vagy 4 vagy 6)-(3,5-dinitro-2-oxidofenilazo)-5-hidroxi-4(vagy 2 vagy 6)-(4-nitro-2-szulfonátofenilazo)fenoláto)-ferrát(1-); trinátrium-(2,4(vagy 2,6 vagy 4,6)-bisz(3,5-dinitro-2-oxidofenilazo)-5-hidroxifenoláto)(2(vagy 4 vagy 6)-(3,5-dinitro-2-oxidofenilazo)-5-hidroxi-4(vagy 2 vagy 6)-(3-szulfonátofenilazo)fenoláto)-ferrát(1-); dinátrium-3,3’-(2,4-dihidroxi-1,3(vagy 1,5 vagy 3,5)-feniléndiazo)dibenzolszulfonát |
406-870-1 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | ||||
| 611-105-00-1 | sodium 4-(4-chloro-6-(N-ethylanilino)-1,3,5-triazin-2-ylamino)-2-(1-(2-chlorophenyl)-5-hydroxy-3-methyl-1H-pyrazol-4-ylazo)benzenesulfonate | nátrium-4-(4-klór-6-(N-etilanilino)-1,3,5-triazin-2-ilamino)2-(1-(2-klórfenil)-5-hidroxi-3-metil-1H-pirazol-4-ilazo)-benzolszulfonát | 407-800-2 | 136213-75-7 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | |||
| 611-106-00-7 | hexasodium 4,4'-dihydroxy-3,3'-bis[2-sulfonato-4-(4-sulfonatophenylazo)phenylazo]-7,7'[p-phenylenebis[imino(6-chloro-1,3,5-triazine-4,2-diyl)imino]]dinaphthalene-2-sulfonate | hexanátrium-4,4’-dihidroxi-3,3’-bisz[2-szulfonáto-4-(4-szulfonátofenilazo)fenilazo]-7,7’[p-fenilénbisz[imino(6-klór-1,3,5-triazin-4,2-diil)imino]]dinaftalin-2-szulfonát | 410-180-6 | 157627-99-1 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | |||
| 611-107-00-2 | potassium sodium 4-(4-chloro-6-(3,6-disulfonato-7-(5,8-disulfonato-naphthalen-2-ylazo)-8-hydroxy-naphthalen-1-ylamino)-1,3,5-triazin-2-ylamino)-5-hydroxy-6-(4-(2-sulfatoethanesulfonyl)-phenylazo)-naphthalene-1,7-disulfonate | kálium, nátrium-4-(4-klór-6-(3,6-diszulfonáto-7-(5,8-diszulfonátonaftalin-2-ilazo)-8-hidroxinaftalin-1-ilamino)-1,3,5-triazin-2-ilamino)-5-hidroxi-6-(4-(2-szulfátoetánszulfonil)fenilazo)naftalin-1,7-diszulfonát | 412-490-7 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | ||||
| 611-108-00-8 | disodium 5-((4-((4-chloro-3-sulfonatophenyl)azo)-1-naphthyl)azo)-8-(phenylamino)-1-naphthalenesulfonate | dinátrium-5-((4-((4-klór-3-szulfonátofenil)azo)-1-naftil)azo)-8-(fenilamino)-1-naftalinszulfonát | 413-600-6 | 6527-62-4 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | ||||
| 611-109-00-3 | Reaction products of: copper(II) sulfate and tetrasodium 2,4-bis[6-(2-methoxy-5-sulfonatophenylazo)-5-hydroxy-7-sulfonato-2-naphthylamino]-6-(2-hydroxyethylamino)-1,3,5-triazine (2:1) | réz(II)-szulfát és tetranátrium-2,4-bisz[6-(2-metoxi-5-szulfonátofenilazo)-5-hidroxi-7-szulfonáto-2-naftilamino]-6-(2-hidroxietilamino)-1,3,5-triazin (2:1 arányú) reakciótermékei | 407-710-3 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | ||||
| 611-110-00-9 | tetra-sodium/lithium 4,4'-bis-(8-amino-3,6-disulfonato-1-naphthol-2-ylazo)-3-methylazobenzene | tetranátrium/-lítium-4,4’-bisz-(8-amino-3,6-diszulfonáto-1-naftol-2-ilazo)-3-metilazobenzol | 408-210-8 | 124605-82-9 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | |||
| 611-111-00-4 | disodium 2-[[4-(2-chloroethylsulfonyl)phenyl]-[(2-hydroxy-5-sulfo-3-[3-[2-(2-(sulfooxy)ethylsulfonyl)ethylazo]-4-sulfobenzoato(3-)cuprate(1-) | dinátrium-2-[[4-(2-klóretilszulfonil)fenil]-[(2-hidroxi-5-szulfo-3-[3-[2-(2-(szulfoxi)etilszulfonil)etilazo]-4-szulfobenzoáto(3-)-kuprát(1-) | 414-230-8 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | ||||
| 611-112-00-X | tetrasodium 4-hydroxy-5-[4-[3-(2-sulfatoethanesulfonyl)phenylamino]-6-morpholin-4-yl-1,3,5-triazin-2-ylamino]-3-(1-sulfonatonaphthalen-2-ylazo)naphthalene-2,7-disulfonate | tetranátrium-4-hidroxi-5-[4-[3-(2-szulfátoetánszulfonil)fenilamino]-6-morfolin-4-il-1,3,5-triazin-2-ilamino]-3-(1-szulfonátonaftalin-2-ilazo)naftalin-2,7-diszulfonát | 413-070-6 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | ||||
| 611-113-00-5 | lithium sodium (2-(((5-((2,5-dichlorophenyl)azo)-2-hydroxyphenyl)methylene)amino)benzoato(2-))(2-((4,5-dihydro-3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-yl)azo)-5-sulfobenzoato(3-)) chromate(2-) | lítium, nátrium-(2-(((5-((2,5-diklórfenil)azo)-2-hidroxifenil)metilén)amino)benzoáto(2-))(2-((4,5-dihidro-3-metil-5-oxo-1-fenil-1H-pirazol-4-il)azo)-5-szulfobenzoáto(3-))-kromát(2-) | 414-280-0 | 149626-00-6 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 611-114-00-0 | lithium sodium (4-((5-chloro-2-hydroxyphenyl)azo)-2,4-dihydro-5-methyl-3H-pyrazol-3-onato(2-))(3-((4,5-dihydro-3-methyl-1-(4-methylphenyl)-5-oxo-1H-pyrazol-4-yl)azo)-4-hydroxy-5-nitrobenzenesulfonato(3-)) chromate(2-) | lítium, nátrium-(4-((5-klór-2-hidroxifenil)azo)-2,4-dihidro-5-metil-3H-pirazol-3-onáto(2-))(3-((4,5-dihidro-3-metil-1-(4-metilfenil)-5-oxo-1H-pirazol-4-il)azo)-4-hidroxi-5-nitrobenzolszulfonáto(3-))-kromát(2-) | 414-250-7 | 149564-66-9 | Acute
Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
CLP00 | |||
| 611-115-00-6 | trilithium bis(4-((4-(diethylamino)-2-hydroxyphenyl)azo)-3-hydroxy-1-naphthalenesulfonato(3-))chromate(3-) | trilítium-bisz(4-((4-(dietilamino)-2-hidroxifenil)azo)-3-hidroxi-1-naftalinszulfonáto(3-))-kromát(3-) | 414-290-5 | 149564-65-8 | Acute
Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
CLP00 | |||
| 611-116-00-1 | reaction mass of: trisodium 5-{}{4-chloro-6-[2-(2,6-dichloro-5-cyanopyrimidin-4-ylamino)-propylamino]-1,3,5-triazin-2-ylamino}}-4-hydroxy-3-(1-sulfonatonaphthalene-2-ylazo)-naphthalene-2,7-disulfonate; trisodium 5-{}{4-chloro-6-[2-(2,6-dichloro-5-cyanopyrimidin-4-ylamino)-1-methyl-ethylamino]-1,3,5-triazin-2-ylamino}}-4-hydroxy-3-(1-sulfonatonaphthalene-2-ylazo)-naphthalene-2,7-disulfonate; trisodium 5-{}{4-chloro-6-[2-(4,6-dichloro-5-cyanopyrimidin-2-ylamino)-propylamino]-1,3,5-triazin-2-ylamino}}-4-hydroxy-3-(1-sulfonatonaphthalen-2-ylazo)-naphthalene-2,7-disulfonate; trisodium 5-{}{4-chloro-6-[2-(4,6-dichloro-5-cyanopyrimidin-2-ylamino)-1-methyl-ethylamino]-1,3,5-triazin-2-ylamino}}-4-hydroxy-3-(1-sulfonatonaphthalen-2-ylazo)-naphthalene-2,7-disulfonate | a
következő anyagok keveréke:
trinátrium-5-(4-klór-6-[2-(2,6-diklór-5-cianopirimidin-4-ilamino)-propilamino)-1,3,5-triazin-2-ilamino)-4-hidroxi-3-(1-szulfonátonaftalin-2-ilazo)naftalin-2,7-diszulfonát; trinátrium-5-{4-klór-6-[2-(2,6-diklór-5-cianopirimidin-4-ilamino)-1-metiletilamino]-1,3,5-triazin-2-ilamino}-4-hidroxi-3-(1-szulfonátonaftalin-2-ilazo)naftalin-2,7-diszulfonát; trinátrium-5-(4-klór-6-[2-(4,6-diklór-5-cianopirimidin-2-ilamino)-propilamino)-1,3,5-triazin-2-ilamino)-4-hidroxi-3-(1-szulfonátonaftalin-2-ilazo)naftalin-2,7-diszulfonát; trinátrium-5-{4-klór-6-[2-(4,6-diklór-5-cianopirimidin-2-ilamino)-1-metiletilamino]-1,3,5-triazin-2-ilamino}-4-hidroxi-3-(1-szulfonátonaftalin-2-ilazo)naftalin-2,7-diszulfonát |
414-620-8 | Eye
Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
CLP00 | ||||
| 611-117-00-7 | 1,3-bis{}{6-fluoro-4-[1,5-disulfo-4-(3-aminocarbonyl-1-ethyl-6-hydroxy-4-methyl-pyrid-2-on-5-ylazo)-phenyl-2-ylamino]-1,3,5-triazin-2-ylamino}}propane lithium-, sodium salt | 1,3-bisz{6-fluor-4-[1,5-diszulfo-4-(3-aminokarbonil-1-etil-6-hidroxi-4-metilpirid-2-on-5-ilazo)fenil-2-ilamino]-1,3,5-triazin-2-ilamino}propán, lítium- és nátriumsó | 415-100-3 | 149850-29-3 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 611-118-00-2 | sodium 1,2-bis[4-[4-{}{4-(4-sulfophenylazo)-2-sulfophenylazo}}-2-ureido-phenyl-amino]-6-fluoro-1,3,5-triazin-2-ylamino]-propane, sodium salt | nátrium-1,2-bisz[4-[4-{4-(4-szulfofenilazo)-2-szulfofenilazo}-2-ureidofenilamino]-6-fluor-1,3,5-triazin-2-ilamino]propán, nátriumsó | 413-990-8 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | ||||
| 611-119-00-8 | tetrasodium 4-[4-chloro-6-(4-methyl-2-sulfophenylamino)-1,3,5-triazin-2-ylamino]-6-(4,5-dimethyl-2-sulfophenylazo)-5-hydroxynaphthalene-2,7-disulfonate | tetranátrium-4-[4-klór-6-(4-metil-2-szulfofenilamino)-1,3,5-triazin-2-ilamino]-6-(4,5-dimetil-2-szulfofenilazo)-5-hidroxinaftalin-2,7-diszulfonát | 415-400-4 | 148878-22-2 | Eye
Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
CLP00 | |||
| 611-120-00-3 | 5-{}{4-[5-amino-2-[4-(2-sulfoxyethylsulfonyl)phenylazo]-4-sulfo-phenylamino]-6-chloro-1,3,5-triazin-2-ylamino}}-4-hydroxy-3-(1-sulfo-naphthalen-2-ylazo)-naphthalene-2,7-disulfonicacid sodium salt | 5-{4-[5-amino-2-[4-(2-szulfoxietilszulfonil)fenilazo]-4-szulfofenilamino]-6-klór-1,3,5-triazin-2-ilamino}-4-hidroxi-3-(1-szulfonaftalin-2-ilazo)naftalin-2,7-diszulfonsav, nátriumsó | 418-340-7 | 157707-94-3 | Eye
Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
CLP00 | |||
| 611-121-00-9 | Main component 6 (isomer): asym. 1:2 Cr(III)-complex of: A: 3-hydroxy-4-(2-hydroxy-naphthalene-1-ylazo)naphthalene-1-sulfonic acid, Na-salt and B: 1-[2-hydroxy-5-(4-methoxy-phenylazo)phenylazo]naphthalene-2-ol; Main component 8 (isomer): asym. 1:2 Cr-complex of: A: 3-hydroxy-4-(2-hydroxy-naphthalene-1-ylazo)-naphthalene-1-sulfonic acid, Na-salt and B: 1-[2-hydroxy-5-(4-methoxy-phenylazo)-phenylazo]-naphthalene-2-ol | 6.
főkomponens (izomer): a következők aszim. 1:2 Cr(III)-komplexe: A:
3-hidroxi-4-(2-hidroxinaftalin-1-ilazo)naftalin-1-szulfonsav, Na-só és B:
1-[2-hidroxi-5-(4-metoxifenilazo)fenilazo]naftalin-2-ol; 8. főkomponens (izomer): a következők aszim. 1:2 Cr(III)-komplexe: A: 3-hidroxi-4-(2-hidroxinaftalin-1-ilazo)naftalin-1-szulfonsav, Na-só és B: 1-[2-hidroxi-5-(4-metoxifenilazo)fenilazo]naftalin-2-ol |
417-280-9 | 30785-74-1 | Eye
Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
CLP00 | |||
| 611-122-00-4 | hexasodium (di[N-(3-(4-[5-(5-amino-3-methyl-1-phenylpyrazol-4-yl-azo)-2,4-disulfo-anilino]-6-chloro-1,3,5-triazin-2-ylamino)phenyl)-sulfamoyl](di-sulfo)-phthalocyaninato)nickel | hexanátrium-(di[N-(3-(4-[5-(5-amino-3-metil-1-fenilpirazol-4-ilazo)-2,4-diszulfoanilino]-6-klór-1,3,5-triazin-2-ilamino)fenil)-szulfamoil](diszulfo)-ftalocianináto)-nikkel | 417-250-5 | 151436-99-6 | Eye
Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
CLP00 | |||
| 611-123-00-X | 3-(2,4-bis(4-((5-(4,6-bis(2-aminopropylamino)-1,3,5-triazin-2-ylamino)-4-hydroxy-2,7-disulfonaphthalen-3-yl)azo)phenylamino)-1,3,5-triazin-6-ylamino)propyldiethylammonium lactate | 3-(2,4-bisz(4-((5-(4,6-bisz(2-aminopropilamino)-1,3,5-triazin-2-ilamino)-4-hidroxi-2,7-diszulfonaftalin-3-il)azo)fenilamino)-1,3,5-triazin-6-ilamino)-propildietilammónium-laktát | 424-310-4 | 178452-66-9 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | |||
| 611-124-00-5 | reaction mass of: pentasodium 5-amino-3-(5-{}{4-chloro-6-[4-(2-sulfoxyethoxysulfonato)phenylamino]-1,3,5-triazin-2-ylamino}}-2-sulfonatophenylazo)-6-[5-(2,3-dibromopropionylamino)-2-sulfonatophenylazo]-4-hydroxynaphthalene-2,7-disulfonate; pentasodium 5-amino-6-[5-(2-bromoacryloylamino)-2-sulfonatophenylazo]-3-(5-{}{4-chloro-6-[4-(2-sulfoxyethoxysulfonato)phenylamino]-1,3,5-triazin-2-ylamino}}-2-sulfonatophenylazo)-4-hydroxynaphthalene-2,7-disulfonate; tetrasodium 5-amino-3-[5-{}{4-chloro-6-[4-(vinylsulfonyl)phenylamino]-1,3,5-triazin-2-ylamino}}-2-sulfonatophenylazo]-6-[5-(2,3-dibromopropionylamino)-2-sulfonatophenylazo]-4-hydroxynaphthalene-2,7-disulfonate | a
következő anyagok keveréke:
pentanátrium-5-amino-3-(5-{4-klór-6-[4-(2-szulfoxietoxiszulfonáto)fenilamino]-1,3,5-triazin-2-ilamino}-2-szulfonátofenilazo)-6-[5-(2,3-dibrómpropionilamino)-2-szulfonátofenilazo]-4-hidroxinaftalin-2,7-diszulfonát; pentanátrium-5-amino-6-[5-(2-brómakriloilamino)-2-szulfonátofenilazo]-3-(5-{4-klór-6-(4-(2-szulfoxietoxiszulfonáto)fenilamino]-1,3,5-triazin-2-ilamino}-2-szulfonátofenilazo)-4-hidroxinaftalin-2,7-diszulfonát; tetranátrium-5-amino-3-(5-{4-klór-6-[4-(vinilszulfonil)fenilamino]-1,3,5-triazin-2-ilamino}-2-szulfonátofenilazo]-6-[5-(2,3-dibrómpropionilamino)-2-szulfonátofenilazo]-4-hidroxinaftalin-2,7-diszulfonát |
424-320-9 | Eye
Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
CLP00 | ||||
| 611-125-00-0 | reaction mass of: Disodium 6-[3-carboxy-4,5-dihydro-5-oxo-4-sulfonatophenyl)pyrazolin-4-yl-azo]-3-[2-oxido-4-(ethensulfonyl)-5-methoxyphenylazo]-4-oxidonaphthalene-2-sulfonate copper (II) complex; Disodium 6-[3-carboxy-4,5-dihydro-5-oxo-4-sulfonatophenyl)pyrazolin-4-yl-azo]-3-[2-oxido-4-(2-hydroxyethylsulfonyl)-5-methoxyphenylazo]-4-oxidonaphthalene-2-sulfonate copper (II) complex | a
következő anyagok keveréke:
dinátrium-6-[3-karboxi-4,5-dihidro-5-oxo-4-szulfonátofenil)pirazolin-4-il-azo]-3-[2-oxido-4-(eténszulfonil)-5-metoxifenilazo]-4-oxidonaftalin-2-szulfonát-réz(II)
komplex; dinátrium-6-(3-karboxi-4,5-dihidro-5-oxo-4-szulfonátofenil)pirazolin-4-il-azo]-3-[2-oxido-4-(2-hidroxietilszulfonil)-5-metoxifenilazo]-4-oxidonaftalin-2-szulfonát-réz(II) komplex |
423-940-7 | Eye
Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
CLP00 | ||||
| 611-126-00-6 | 2,6-bis-(2-(4-(4-amino-phenylamino)-phenylazo)-1,3-dimethyl-3H-imidazolium)-4-dimethylamino-1,3,5-triazine, dichloride | 2,6-bisz-(2-(4-(4-aminofenilamino)fenilazo)-1,3-dimetil-3H-imidazolium)-4-dimetilamino-1,3,5-triazin, diklorid | 424-120-1 | 174514-06-8 | Eye
Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
CLP00 | |||
| 611-127-00-1 | pentasodium 4-amino-6-(5-(4-(2-ethyl-phenylamino)-6-(2-sulfatoethanesulfonyl)-1,3,5-triazin-2-ylamino)-2-sulfonatophenylazo)-5-hydroxy-3-(4-(2-sulfatoethanesulfonyl)phenylazo)naphthalene-2,7-disulfonate | pentanátrium-4-amino-6-(5-(4-(2-etilfenilamino)-6-(2-szulfátoetánszulfonil)-1,3,5-triazin-2-ilamino)-2-szulfonátofenilazo)-5-hidroxi-3-(4-(2-szulfátoetánszulfonil)fenilazo)naftalin-2,7-diszulfonát | 423-790-2 | Eye
Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
G | CLP00 | |||
| 611-128-00-7 | N,N'-bis{}{6-chloro-4-[6-(4-vinylsulfonylphenylazo)-2,7-disulfonicacid-5-hydroxynapht-4-ylamino]-1,3,5-triazin-2-yl}}-N-(2-hydroxyethyl)ethane-1,2-diamine, sodium salt | N,N'-bisz{6-klór-4-[6-(4-vinilszulfonilfenilazo)-2,7-diszulfonsav-5-hidroxinaftalin-4-ilamino]-1,3,5-triazin-2-il}-N-(2-hidroxietil)etán-1,2-diamin, nátriumsó | 419-500-9 | 171599-85-2 | Eye
Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
CLP00 | |||
| 611-129-00-2 | reaction mass of: 5-[(4-[(7-amino-1-hydroxy-3-sulfo-2-naphthyl)azo]-2,5-diethoxyphenyl)azo]-2-[(3-phosphonophenyl)azo]benzoic acid; 5-[(4-[(7-amino-1-hydroxy-3-sulfo-2-naphthyl)azo]-2,5-diethoxyphenyl)azo]-3-[(3-phosphonophenyl)azo]benzoic acid | 5-[(4-[(7-amino-1-hidroxi-3-szulfo-2-naftil)azo]-2,5-dietoxifenil)azo]-2-[(3-foszfonofenil)azo]benzoesav; 5-[(4-[(7-amino-1-hidroxi-3-szulfo-2-naftil)azo]-2,5-dietoxifenil)azo]-3-[(3-foszfonofenil)azo]benzoesav keveréke |
418-230-9 | 163879-69-4 | Expl.
1.3 **** Repr. 2 STOT RE 2 * Skin Sens. 1 Aquatic Chronic 2 |
H203 H361f *** H373 ** H317 H411 |
GHS01 GHS08 GHS07 GHS09 Dgr |
H203 H361f *** H373 ** H317 H411 |
CLP00 | |||
| 611-130-00-8 | tetra-ammonium 2-[6-[7-(2-carboxylato-phenylazo)-8-hydroxy-3,6-disulfonato-1-naphthylamino]-4-hydroxy-1,3,5-triazin-2-ylamino]benzoate | tetraammónium-2-[6-[7-(2-karboxilátofenilazo)-8-hidroxi-3,6-diszulfonáto-1-naftilamino]-4-hidroxi-1,3,5-triazin-2-ilamino]benzoát | 418-520-5 | 183130-96-3 | Eye
Irrit. 2 Aquatic Chronic 3 |
H319 H412 |
GHS07 Wng |
H319 H412 |
CLP00/ATP01 | |||
| 611-131-00-3 | 2-[2-hydroxy-3-(2-chlorophenyl)carbamoyl-1-naphthylazo]-7-[2-hydroxy-3-(3-methylphenyl)carbamoyl-1-naphthylazo]fluoren-9-one | 2-[2-hidroxi-3-(2-klórfenil)karbamoil-1-naftilazo]-7-[2-hidroxi-3-(3-metilfenil)karbamoil-1-naftilazo]fluorén-9-on | 420-580-2 | 151798-26-4 | Repr.
1B Aquatic Chronic 4 |
H360D
*** H413 |
GHS08 Dgr |
H360D
*** H413 |
CLP00 | |||
| 611-132-00-9 | pentasodium bis{}{7-[4-(1-butyl-5-cyano-1,2-dihydro-2-hydroxy-4-methyl-6-oxo-3-pyridylazo)phenylsulfonylamino]-5'-nitro-3,3'-disulfonatonaphthalene-2-azobenzene-1,2'-diolato}} chromate (III) | pentanátrium-bisz{7-[4-(1-butil-5-ciano-1,2-dihidro-2-hidroxi-4-metil-6-oxo-3-piridilazo)fenilszulfonilamino]-5’-nitro-3,3’-diszulfonátonaftalin-2-azobenzol-1,2’-dioláto}-kromát(III) | 419-210-2 | 178452-71-6 | Eye
Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
CLP00 | |||
| 611-133-00-4 | Product by process iron complex of azo dyestuffs obtained by coupling a mixture of diazotized 2-amino-1-hydroxybenzene-4-sulfanilide and 2-amino-1-hydroxybenzene-4-sulfonamide with resorcin, the obtained mixture being subsequently submitted to a second coupling reaction with a mixture of diazotized 3-aminobenzene-1-sulfonic acid (metanilic acid) and 4'-amino-4-nitro-1,1'-diphenylamine-2-sulfonic acid and metallization with ferric chloride, sodium salt | diazotált 2-amino-1-hidroxibenzol-4-szulfanilid és 2-amino-1-hidroxibenzol-4-szulfonamid keverékének rezorcinnal történő összekapcsolásával, majd a keverék diazotált 3-aminobenzol-1-szulfonsavval (metanilsav) és 4’-amino-4-nitro-1,1’-difenilamin-2-szulfonsavval történő összekapcsolásával és vas-kloriddal történő fémesítésével előállított azofestékek vaskomplexének feldolgozási terméke, nátriumsó | 419-260-5 | Eye
Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
CLP00 | ||||
| 611-134-00-X | trisodium 2-{}{α[2-hydroxy-3-[4-chloro-6-[4-(2,3-dibromopropionylamino)-2-sulfonatophenylamino]-1,3,5-triazin-2-ylamino]-5-sulfonatophenylazo]-benzylidenehydrazino}}-4-sulfonatobenzoate, copper complex | trinátrium-2-{α-[2-hidroxi-3-[4-klór-6-[4-(2,3-dibrómpropionilamino)-2-szulfonátofenilamino]-1,3,5-triazin-2-ilamino]-5-szulfonátofenilazo]benzilidénhidrazino}-4-szulfonáto-benzoát, réz komplex | 423-770-3 | Eye
Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
CLP00 | ||||
| 611-135-00-5 | Reaction product of: 2-[[4-amino-2-ureidophenylazo]-5-[(2-(sulfooxy)ethyl)sulfonyl]]benzenesulfonic acid with 2,4,6-trifluoropyrimidine and partial hydrolysis to the corresponding vinylsulfonyl derivative,mixed potassium/sodium salt | 2-[[4-amino-2-ureidofenilazo]-5-[(2-(szulfoxi)etil)szulfonil]]benzolszulfonsav és 2,4,6-trifluorpirimidin reakciója után a megfelelő vinilszulfonil-származékká részlegesen elhidrolizált termék, kevert kálium/nátriumsó | 424-250-9 | Eye
Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
CLP00 | ||||
| 611-136-00-0 | 2-{}{4-(2-ammoniopropylamino)-6-[4-hydroxy-3-(5-methyl-2-methoxy-4-sulfamoylphenylazo)-2-sulfonatonaphth-7-ylamino]-1,3,5-triazin-2-ylamino}}-2-aminopropyl formate | 2-{4-(2-ammóniopropilamino)-6-[4-hidroxi-3-(5-metil-2-metoxi-4-szulfamoilfenilazo)-2-szulfonátonaft-7-ilamino]-1,3,5-triazin-2-ilamino}-2-aminopropil-formiát | 424-260-3 | Repr.
2 Eye Dam. 1 Aquatic Chronic 2 |
H361f
*** H318 H411 |
GHS05 GHS08 GHS09 Dgr |
H361f
*** H318 H411 |
CLP00 | ||||
| 611-137-00-6 | 6-tert-butyl-7-chloro-3-tridecyl-7,7a-dihydro-1H-pyrazolo[5,1-c]-1,2,4-triazole | 6-terc-butil-7-klór-3-tridecil-7,7a-dihidro-1H-pirazolo[5,1-c]-1,2,4-triazol | 419-870-1 | 159038-16-1 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 611-138-00-1 | 2-(4-aminophenyl)-6-tert-butyl-1H-pyrazolo[1,5-b][1,2,4]triazole | 2-(4-aminofenil)-6-terc-butil-1H-pirazolo[1,5-b][1,2,4]triazol | 415-910-7 | 152828-25-6 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | |||
| 611-139-00-7 | reaction product of: C.I. Leuco Sulfur Black 1 with (3-chloro-2-hydroxypropyl)trimethylammonium chloride | C.I. Leuco Sulphur Black 1 és (3-klór-2-hidroxipropil)trimetilammónium-klorid reakcióterméke | 424-510-1 | - | Eye
Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
ATP01 | |||
| 611-140-00-2 | azafenidin (ISO); 2-(2,4-dichloro-5-prop-2-ynyloxyphenyl)-5,6,7,8-tetrahydro-1,2,4-triazolo[4,3-a]pyridin-3(2H)-one | azafenidin
(ISO); 2-(2,4-diklór-5-prop-2-iniloxifenil)-5,6,7,8-tetrahidro-1,2,4-triazolo[4,3-a]piridin-3(2H)-on |
68049-83-2 | Repr.
1B STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H373 ** H400 H410 |
GHS08 GHS09 Dgr |
H360Df H373 ** H410 |
M=1000 |
CLP00 | |||
| 611-141-00-8 | 5-(4-[4-[4-(3,5-dicarboxy-phenyl-azo)phenylamino]-6-morpholin-4-yl-1,3,5-triazin-2-ylamino]phenylazo)isophthalic acid, mixed monosodium and diammonium salt | 5-(4-[4-[4-(3,5-dikarboxi-fenilazo)fenilamino]-6-morfolin-4-il-1,3,5-triazin-2-ilamino]fenilazo)izoftálsav, vegyes mononátrium- és diammónium-só | 414-410-6 | - | Eye
Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
ATP01 | |||
| 611-142-00-3 | product-by-process definition polyazodyestuff obtained by coupling 4-[4-(1-amino-8-hydroxy-3,6-disulfo-2-naphthylazo)phenylsulfonylamino]benzenediazonium with reaction mass of 4-carboxybenzenediazonium and diphenylamine-3-sulfo-4,4'-bisdiazonium, and further coupling of the obtained compounds with reaction mass of naphth-2-ol and 3-aminophenol, sodium salts; sodium chloride | előállítási
módszerével meghatározott termék: poliazo-festékanyag, melynek előállítása
4-[4-(1-amino-8-hidroxi-3,6-diszulfo-2-naftilazo)fenilszulfonilamino]
benzoldiazónium 4-karboxi-benzoldiazóniumhoz és
difenilamin-3-szulfo-4,4'-bisz-diazóniumhoz való kapcsolásával, majd a
keletkező vegyületeknek 2-naftol és 3-aminofenol nátriumsóihoz kapcsolásával
történik; nátrium-klorid |
425-740-5 | - | Eye
Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
ATP01 | |||
| 611-143-00-9 | reaction mass of: trisodium 2-(2-[α-(2-carboxylato-κ-O-4-sulfonatophenylazo)benzylidene]hydrazino-κ-N')-6-(2,6-difluoropyrimidin-4-ylamino)-4-sulfonatophenolatocuprate (II); trisodium 2-(2-[α-(2-carboxylato-κ-O-4-sulfonatophenylazo)benzylidene]hydrazino-κ-N')-6-(4,6-difluoropyrimidin-2-ylamino)-4-sulfonatophenolatocuprate (II) | trinátrium-2-(2-[α-(2-karboxiláto-κ-O-4-szulfonátofenilazo)benzilidén]hidrazino-κ-N')-6-(2,6-difluorpirimidin-4-il-amino)-4-szulfonátofenoláto-kuprát(II); trinátrium-2-(2-[α-(2-karboxiláto-κ-O-4-szulfonátofenilazo)benzilidén]hidrazino-κ-N')-6-(4,6-difluorpirimidin-4-il-amino)-2-szulfonátofenoláto-kuprát(II) keveréke |
428-260-4 | - | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 611-144-00-4 | reaction mass of: 7-amino-3,8-bis-[4-(2-sulfoxyethylsulfonyl)phenylazo]-4-hydroxynaphthalene-2-sulfonic acid, Na/K salt; 7-amino-3-[4-(2-sulfoxyethylsulfonyl)phenylazo]-4-hydroxy-8-[4-(2-sulfoxyethylsulfonyl)-2-sulfophenylazo]naphthalene-2-sulfonic acid, Na/K salt; 7-amino-8-[4-(2-sulfoxyethylsulfonyl)-phenylazo]-4-hydroxy-3-[4-(2-sulfoxyethylsulfonyl)-2-sulfophenylazo]naphthalene-2-sulfonic acid, Na/K salt; 7-amino-3,8-bis-[4-(2-sulfoxyethylsulfonyl)-2-sulfophenylazo]-4-hydroxynaphthalene-2-sulfonic acid, Na/K salt | a
következő anyagok keveréke: 7-amino-3,8-bisz[4-(2-szulfoxietilszulfonil)fenilazo]-4-hidroxinaftalin-2-szulfonsav Na/K sói; 7-amino-3-[4-(2-szulfoxietiszulfonil)fenilazo]-4-hidroxi-8-[4-(2-szulfoxietilszulfonil)-2-szulfofenilazo]naftalin-2-szulfonsav Na/K sói; 7-amino-8-[4-(2-szulfoxietiszulfonil)fenilazo]-4-hidroxi-3-[4-(2-szulfoxietilszulfonil)-2-szulfofenilazo]naftalin-2-szulfonsav Na/K sói; 7-amino-3,8-bisz-[4-(2-szulfoxietilszulfonil)-2-szulfofenilazo]-4-hidroxinaftalin-2-szulfonsav Na/K sói |
429-070-4 | 214362-06-8 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 611-145-00-X | reaction mass of: tetrasodium 3-(1,5-disulfonatonaphthalene-2-ylazo)-4-hydroxy-7-{4-chloro-6-[4-(2-sulfoxyethylsulfonyl)phenylamino]-1,3,5-triazine-2-ylamino}naphthalene-2-sulfonate; 3-(2,5-disulfophenylazo)-4-hydroxy-7-{4-chloro-6-[4-(2-sulfoxyethylsulfonyl)phenylamino]-1,3,5-triazine-2-ylamino}naphthalene-2-sulfonic acid, sodium salt | tetranátrium-3-(1,5-diszulfonátonaftalin-2-ilazo)-4-hidroxi-7-{4-klór-6-[4-(2-szulfoxietilszulfonil)fenilamino]-1,3,5-triazin-2-ilamino}naftalin-2-szulfonát; 3-(2,5-diszulfofenilazo)-4-hidroxi-7-{4-klór-6-[4-(2-szulfoxietilszulfonil)fenilamino{-1,3,5-triazin-2-ilamino}naftalin-2-szulfonsav, nátriumsó keveréke |
429-440-5 | - | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 611-146-00-5 | reaction mass of: pentasodium 3-(4-(4-(7-(2,4-diamino-5-sulfonato-3-(4-sulfonatophenylazo)phenylazo)-1-hydroxy-3-sulfonatonaphthalen-2-ylazo)-2-sulfonatophenylamino)phenylazo)-4-hydroxy-6-(2-oxo-1-phenylcarbamoylpropylazo)naphthalene-2-sulfonate; pentasodium 6-((2,4-diamino-5-sulfonatophenyl)azo)-3-((4-((4-((7-((2,4-diamino-5-sulfonatophenyl)azo)-1-hydroxy-3-sulfonatonaphthalen-2-yl)azo)phenyl)amino)-2-sulfonatophenyl)azo)-4-hydroxynaphthalene-2-sulfonate; pentasodium 6-((2,4-diamino-5-sulfonato-3-((4-sulfonatophenyl)azo)phenyl)azo)-3-((4-((4-((1,7-dihydroxy-3-sulfonatonaphthalen-2-yl)azo)-2-sulfonatophenyl)amino)phenyl)azo)-4-hydroxynaphthalene-2-sulfonate; hexasodium 6-((2,4-diamino-5-sulfonatophenyl)azo)-3-((4-((4-((7-((2,4-diamino-5-sulfonato-3-((4-sulfonatophenyl)azo)phenyl)azo)-1-hydroxy-3-sulfonatonaphthalen-2-yl)azo)-2-sulfonatophenyl)amino)phenyl)azo)-4-hydroxynaphthalene-2-sulfonate | a
következő anyagok keveréke:
pentanátrium-3-(4-(4-(7-(2,4-diamino-5-szulfonáto-3-(4-szulfonátofenilazo)fenilazo)-1-hidroxi-3-szulfonátonaftalin-2-ilazo)-2-szulfonátofenilamino)fenilazo)-4-hidroxi-6-(2-oxo-1-fenilkarbamoilpropilazo)naftalin-2-szulfonát; pentanátrium-6-((2,4-diamino-5-szulfonátofenil)azo)-3-((4-((4-((7-((2,4-diamino-5-szulfonátofenil)azo)-1-hidroxi-3-szulfonátonaftalin-2-il)azo)fenil)amino)-2-szulfonátofenil)azo)-4-hidroxinaftalin-2-szulfonát; pentanátrium-6-((2,4-diamino-5-szulfonáto-3-((4-szulfonátofenil)azo)fenil)azo)-3-((4-((4-((1,7-dihidroxi-3-szulfonátonaftalin-2-il)azo)-2-szulfonátofenil)amino)fenil)azo)-4-hidroxinaftalin-2-szulfonát; hexanátrium-6-((2,4-diamino-5-szulfonátofenil)azo)-3-((4-((4-((7-((2,4-diamino-5-szulfonáto-3-((4-szulfonátofenil)azo)fenil)azo)-1-hidroxi-3-szulfonátonaftalin-2-il)azo)-2-szulfonátofenil)amino)fenil)azo)-4-hidroxinaftalin-2-szulfonát |
430-070-1 | - | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
ATP01 | |||
| 611-147-00-0 | sodium, potassium, lithium 5-amino-3,6-bis(5-(4-chloro-6-(methyl-(2-methylaminoacetyl)amino)-1,3,5-triazin-2-ylamino)-2-sulfonatophenylazo)-4-hydroxynaphthalene-2,7-disulfonate | nátrium-, kálium-, lítium-5-amino-3,6-bisz(5-(4-klór-6-(metil-(2-metilaminoacetil)amino)-1,3,5-triazin-2-ilamino)-2-szulfonátofenilazo)-4-hidroxinaftalin-2,7-diszulfonát | 430-090-0 | 205764-96-1 | Eye
Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
ATP01 | |||
| 611-148-00-6 | reaction mass of: 2-(3-(2,6-dichloro-4-nitrophenylazo)carbazol-9-yl)ethanol; 2-(2-(3-(2,6-dichloro-4-nitro-phenylazo)-carbazol-9-yl)-ethoxy)ethanol; 3-(2,6-dichloro-4-nitrophenylazo)carbazol | 2-(3-(2,6-diklór-4-nitrofenilazo)karbazol-9-il)etanol; 2-(2-(3-(2,6-diklór-4-nitrofenilazo)karbazol-9-il)etoxi)etanol; 3-(2,6-diklór-4-nitrofenilazo)karbazol keveréke |
429-590-1 | - | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
ATP01 | |||
| 611-149-00-1 | 2-(2-chloroacetoxy)ethyl 3-((4-(2,5-dichloro-4-fluorosulfonylphenylazo)-3-methylphenyl)ethylamino)propionate | 2-(2-klóracetoxi)etil-3-((4-(2,5-diklór-4-fluorszulfonilfenilazo)-3-metilfenil)etilamino)propionát | 427-570-7 | 193486-83-8 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
ATP01 | |||
| 611-150-00-7 | tetralithium 2-[6-[7-[2-(carboxylato)phenylazo]-8-hydroxy-3,6-disulfonato-1-naphthylamino]-4-hydroxy-1,3,5-triazine-2-ylamino]benzoate | tetralítium-2-[6-[7-[2-(karboxiláto)fenilazo]-8-hidroxi-3,6-diszulfonáto-1-naftilamino]-4-hidroxi-1,3,5-triazin-2-il-amino]benzoát | 440-460-3 | - | Eye
Irrit. 2 Aquatic Chronic 3 |
H319 H412 |
GHS07 Wng |
H319 H412 |
ATP01 | |||
| 611-151-00-2 | chrysoidine; 4-(phenylazo)benzene-1,3-diamine | krizoidin; 4-(fenilazo)benzol-1,3-diamin |
207-803-7 | 495-54-5 | Muta.
2 Acute Tox. 4 * Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H341 H302 H315 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H341 H302 H315 H410 |
ATP01 | |||
| 611-152-00-8 | chrysoidine
monohydrochloride; 4-phenylazophenylene-1,3-diamine monohydrochloride
[1] chrysoidine monoacetate; 4-(phenylazo)benzene-1,3-diamine monoacetate [2] chrysoidine acetate; 4-(phenylazo)benzene-1,3-diamine acetate [3] chrysoidine-p-dodecylbenzenesulfonate; dodecylbenzenesulfonic acid, compound with 4-(phenylazo)benzene-1,3-diamine (1:1) [4] chrysoidine dihydrochloride; 4-(phenylazo)benzene-1,3-diamine dihydrochloride [5] chrysoidine sulfate; bis[4-(phenylazo)benzene-1,3-diamine] sulfate [6] |
krizoidin-monohidroklorid; 4-fenilazofenilén-1,3-diamin-monohidroklorid; [1] krizoidin-monoacetát; 4-(fenilazo)benzol-1,3-diamin-monoacetát; [2] krizoidin-acetát; 4-(fenilazo)benzol-1,3-diamin-acetát; [3] krizoidin-p-dodecilbenzolszulfonát; dodecilbenzolszulfonsav és 4-(fenilazo)benzol-1,3-diamin (1:1) vegyülete; [4] krizoidin-dihidroklorid; 4-(fenilazo)benzol-1,3-diamin-dihidroklorid; [5] krizoidin-szulfát; bisz[4-(fenilazo)benzol-1,3-diamin]-szulfát [6] |
208-545-8
[1] 278-290-5 [2] 279-116-0 [3] 264-409-8 [4] 281-549-5 [5] 282-432-1 [6] |
532-82-1
[1] 75660-25-2 [2] 79234-33-6 [3] 63681-54-9 [4] 83968-67-6 [5] 84196-22-5 [6] |
Muta.
2 Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H341 H302 H315 H318 H400 H410 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H341 H302 H315 H318 H410 |
ATP01 | |||
| 611-153-00-3 | chrysoidine
C10-14-alkyl derivatives; benzenesulfonic acid, mono-C10-14-alkyl
derivatives, compounds with 4-(phenylazo)-1,3-benzenediamine [1] chrysoidine compound with dibutylnaphthalene sulfonic acid; dibutylnaphthalenesulfonic acid, compound with 4-(phenylazo)benzene-1,3-diamine (1:1) [2] |
krizoidin
C10-14-alkil származékok; benzolszulfonsav, mono-C10-14-alkil származékok, 4-(fenilazo)-1,3-benzoldiaminnal alkotott vegyületei; [1] krizoidin és dibutilnaftalinszulfonsav vegyülete; dibutilnaftalinszulfonsav, 4-(fenilazo)benzol-1,3-diaminnal alkotott (1:1) vegyülete [2] |
286-946-7
[1] 304-236-8 [2] |
85407-90-5
[1] 94247-67-3 [2] |
Muta.
2 Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 |
H341 H302 H315 H318 |
GHS05 GHS08 GHS07 Dgr |
H341 H302 H315 H318 |
ATP01 | |||
| 611-154-00-9 | trisodium 5-benzamido-4-hydroxy-3-(4-methyl-2-sulfonatophenylazo)naphthalene-2,7-disulfonate | trinátrium 5-benzamido-4-hidroxi-3-(4-metil-2-szulfonátofenilazo)naftalin-2,7-diszulfonát | 403-670-6 | 92408-46-3 | Aquatic
Chronic 3 |
H412 |
- |
H412 |
ATP01 | |||
| 611-155-00-4 | 4,4'-oxybis(benzenesulfonylazide) | 4,4′-oxibisz(benzolszulfonilazid) | 431-850-4 | 7456-68-0 | Expl.
1.1 **** STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H201 H373 ** H400 H410 |
GHS01 GHS08 GHS09 Dgr |
H201 H373 ** H410 |
ATP01 | |||
| 611-156-00-X | triammonium 4-[4-[7-(4-carboxylatoanilino)-1-hydroxy-3-sulfonato-2-naphthylazo]-2,5-dimethoxyphenylazo]benzoate | triammónium-4-[4-[7-(4-karboxilátoanilino)-1-hidroxi-3-szulfonáto-2-naftilazo]-2,5-dimetoxifenilazo]benzoát | 432-270-4 | 221354-37-6 | Repr.
2 STOT RE 2 * Aquatic Chronic 2 |
H361f
*** H373 ** H411 |
GHS08 GHS09 Wng |
H361f
*** H373 ** H411 |
ATP01 | |||
| 611-157-00-5 | benzenesulfonic acid, 3,3'-(methylenebis((dihydroxyphenylene)azo))bis-, potassium sodium salt; potassium sodium 3-[(E)-(6-{3,4-dihydroxy-2-[(Z)-(3-sulfonatophenyl)diazenyl]benzyl}-2,3-dihydroxyphenyl)diazenyl]benzenesulfonate | benzolszulfonsav,
3,3'-(metilénbisz((dihidroxifenilén)azo))-bisz-, kálium/nátriumsó; kálium/nátrium-3-[(E)-(6-{3,4-dihidroxi-2-}(Z)-(3-szulfonátofenil)diazenil]benzil}-2,3-dihidroxifenil)diazenil]benzolszulfonát |
432-590-4 | 243869-48-9 | Eye
Irrit. 2 Aquatic Chronic 3 |
H319 H412 |
GHS07 Wng |
H319 H412 |
ATP01 | |||
| 611-158-00-0 | reaction product of: 2,3,4,2',3',4'-hexahydroxy-5,5'-diacethyl-diphenylmethane and 6-diazo-5,6-dihydro-5-oxo-1-naphthalenesulfonylchloride and 3-diazo-3,4-dihydro-6-methoxy-4-oxo-1-naphthalenesulfonylchloride | 2,3,4,2',3',4'-hexahidroxi-5,5'-diacetildifenilmetán és 6-diazo-5,6-dihidro-5-oxo-1-naftalinszulfonil-klorid és 3-diazo-3,4-dihidro-6-metoxi-4-oxo-1-naftalinszulfonil-klorid reakcióterméke | 421-520-8 | - | **** Aquatic Chronic 4 |
**** H413 |
**** |
**** H413 |
ATP01 | |||
| 611-159-00-6 | disodium 4-amino-6-((4-((4-(2,4-diaminophenyl)azo)phenylsulfamoyl)phenyl)azo)-5-hydroxy-3-((4-nitrophenyl)azo)naphthalene-2,7-disulfonate | dinátrium-4-amino-6-((4-((4-(2,4-diaminofenil)azo)fenilszulfamoil)fenil)azo)-5-hidroxi-3-((4-nitrofenil)azo)naftalin-2,7-diszulfonát | 421-880-6 | - | Eye
Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
ATP01 | |||
| 611-160-00-1 | reaction mass of: 1,1,1-tris(phenyl-4'-(3''-diazo-3'',4''-dihydro-4''-oxo-naphthalene-1''-sulfonato)ethane; 1,1,1-tris(phenyl-4'-(6''-diazo-5'',6''-dihydro-5''-oxo-naphthalene-1''-sulfonato)ethane; reaction product of 1,1,1-tris(p-hydroxyphenyl)ethane with 6-diazo-5,6-dihydro-5-oxo-1-naphthylsulfonylchloride and 3-diazo-3,4-dihydro-4-oxo-1-naphthylsulfonylchloride (2:1); reaction product of 1,1,1-tris(p-hydroxyphenyl)ethane with 6-diazo-5,6-dihydro-5-oxo-1-naphthylsulfonylchloride and 3-diazo-3,4-dihydro-4-oxo-1-naphthylsulfonylchloride (1:2) | a
következő anyagok keveréke: 1,1,1-trisz(fenil-4'-(3''-diazo-3'',4''-dihidro-4''-oxonaftalin-1''-szulfonáto)etán; 1,1,1-trisz(fenil-4'-(6''-diazo-5'', 6''-dihidro-5''-oxonaftalin-1''-szulfonáto)etán; 1,1,1-trisz(p-hidroxifenil)etán 6-diazo-5,6-dihidro-5-oxo-1-naftilszulfonil-kloriddal és 3-diazo-3,4-dihidro-4-oxo-1-naftilszulfonil-kloriddal képzett (2:1) reakcióterméke; 1,1,1-trisz(p-hidroxifenil)etán 6-diazo-5,6-dihidro-5-oxo-1-naftilszulfonil-kloriddal és 3-diazo-3,4-dihidro-4-oxo-1-naftilszulfonil-kloriddal képzett (1:2) reakcióterméke |
422-760-6 | - | **** Aquatic Chronic 4 |
**** H413 |
**** |
**** H413 |
ATP01 | |||
| 611-161-00-7 | trisodium [1,2'-(2-(8-amino-3,5-disulfonatonaphthalene)azo)-(4'-nitrobenzene)diolato-O,O,N][(Z)-2,2-((phenylcarbamoylprop-1'-enyl)azo)-5-sulfamoylbenzene)diolato-O,O,N]chromate(III) | trinátrium-[1,2'-(2-(8-amino-3,5-diszulfonátonaftalin)azo)-(4'-nitrobenzol)dioláto-O, O,N][(Z)-2,2-((fenilkarbamoilprop-1'-enil)azo)-5-szulfamoilbenzol)dioláto-O, O,N]-kromát(III) | 423-100-1 | - | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 611-162-00-2 | 2,4-bis(((2-(dimethylammonio)ethyloxy)carbonyl)phen-2-ylazo)benzene-1,3-diolbis(methanesulfonate) | 2,4-bisz(((2-(dimetilammónio)etiloxi)karbonil)fen-2-ilazo)-1,3-diolbisz(metánszulfonát) | 429-600-4 | - | Acute
Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
ATP01 | |||
| 611-163-00-8 | 2,4-bis(((2-(dimethylammonio)ethyloxy)carbonyl)phen-2-ylazo)benzene-1,3-diol sulfate | 2,4-bisz(((2-(dimetilammónio)etiloxi)karbonil)fen-2-ilazo)benzol-1,3-diol-szulfát | 429-610-9 | - | Acute
Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
ATP01 | |||
| 611-164-00-3 | reaction mass of: 2,2’-dimethyl-2,2’-azobutanenitrile; 2-methylpentanenitrile-2-azo-2’-(2’-methylpropanenitrile); 2,2’-dimethyl-2,2’-azoheptanenitrile; 2-methylheptanenitrile-2-azo-2’-(2’-methylpropanenitrile); 2-methylheptanenitrile-2-azo-2’-(2’-methylbutanenitrile) | a
következő anyagok keveréke: 2,2'-dimetil-2,2'-azobutánnitril; 2-metilpentánnitril-2-azo-2′-(2′-metilpropánnitril); 2,2′-dimetil-2,2′-azoheptánnitril; 2-metilheptánnitril-2-azo-2′-(2′-metilpropánnitril); 2-metilheptánnitril-2-azo-2′-(2′-metilbutánnitril) |
429-710-2 | Self-react.
D Acute Tox. 4 * Aquatic Chronic 2 |
H242 H302 H411 |
GHS02 GHS07 GHS09 Dgr |
H242 H302 H411 |
ATP01/ATP01corr | ||||
| 611-165-00-9 | reaction mass of: tetrasodium 4-amino-6-(5-(2,6-difluoropyrimidin-4-ylamino)-2-sulfonatophenylazo)-5-hydroxy-3-(4-(sulfatoethylsulfonyl)phenylazo)naphthalene-2,7-disulfonate; tetrasodium 4-amino-6-(5-(4,6-difluoropyrimidin-2-ylamino)-2-sulfonatophenylazo)-5-hydroxy-3-(4-(2-sulfatoethylsulfonyl)phenylazo)naphthalene-2,7-disulfonate | tetranátrium-4-amino-6-(5-(2,6-difluorpirimidin-4-ilamino)-2-szulfonátofenilazo)-5-hidroxi-3-(4-(szulfátoetilszulfonil)fenilazo)naftalin-2,7-diszulfonát; tetranátrium-4-amino-6-(5-(4,6-difluorpirimidin-2-ilamino)-2-szulfonátofenilazo)-5-hidroxi-3-(4-(2-szulfátoetilszulfonil)fenilazo)naftalin-2,7-diszulfonát keveréke |
431-830-5 | - | Aquatic
Chronic 3 |
H412 |
- |
H412 |
ATP01 | |||
| 611-166-00-4 | reaction mass of: pentasodium 4-amino-5-hydroxy-3-{(E)-4-[2-(sulfonatooxy)ethylsulfonyl]phenylazo}-6-{(E)-2-sulfonato-4-[2-(sulfonatooxy)ethylsulfonyl]phenylazo}naphthalene-2,7-disulfonate; tetrasodium 4-amino-5-hydroxy-3-{(E)-4-[2-(sulfonatooxy)ethylsulfonyl]phenylazo}-6-[(E)-2-sulfonato-4-(vinylsulfonyl)phenylazo]naphthalene-2,7-disulfonate; tetrasodium 4-amino-5-hydroxy-6-{(E)-2-sulfonato-4-[2-(sulfonatooxy)ethylsulfonyl]phenylazo}-3-[(E)-4-(vinylsulfonyl)phenylazo]naphthalene-2,7-disulfonate | pentanátrium-4-amino-5-hidroxi-3-{(E)-4-[2-(szulfonátooxi)etilszulfonil]fenilazo}-6-{(E)-2-szulfonáto-4-[2-(szulfonátooxi)etilszulfonil]fenilazo}naftalin-2,7-diszulfonát; tetranátrium-4-amino-5-hidroxi-3-{(E)-4-[2-(szulfonáto-oxi)etilszulfonil]fenilazo}-6-[(E)-2-szulfonáto-4-(vinilszulfonil)fenilazo]naftalin-2,7-diszulfonát; tetranátrium-4-amino-5-hidroxi-6-(E)-2-szulfonáto-4-}2-(szulfonátooxi)etilszulfonil]fenilazo}-3-[(E)-4-(vinilszulfonil)fenilazo]naftalin-2,7-diszulfonát keveréke |
432-100-9 | - | Eye
Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
ATP01 | |||
| 611-167-00-X | sodium bis[tris(2-hydroxyethyl)ammonium][6-anilino-4'-(4,8-disulfonato-2-naphthylazo)-5'-methyl-3-sulfonatonaphthalene-2-azobenzene-1,2'-diolato]cuprate(II) | nátrium-bisz[trisz(2-hidroxietil)ammónium][6-anilino-4'-(4,8-diszulfonáto-2-naftilazo)-5'-metil-3-szulfonátonaftalin-2-azobenzol-1,2'-dioláto]kuprát(II) | 435-240-9 | - | Aquatic
Chronic 3 |
H412 |
- |
H412 |
ATP01 | |||
| 611-168-00-5 | reaction mass of: 3-[[4-chloro-6-[[7-[(1,5-disulfo-2-naphthalenyl)azo]-8-hydroxy-3,6-disulfo-1-naphthalenyl]amino]-1,3,5-triazin-2-yl]amino]-5-[[4-chloro-6-[[8-hydroxy-3,6-disulfo-7-[(2-sulfophenyl)azo]-1-naphthalenyl]amino]-1,3,5-triazin-2-yl]amino]benzoic acid; 3,5-bis[[4-chloro-6-[[7-[(1,5-disulfo-2-naphthalenyl)azo]-8-hydroxy-3,6-disulfo-1-naphthalenyl]amino]-1,3,5-triazin-2-yl]amino]benzoic acid | 3-[[4-klór-6-[[7-[(1,5-diszulfo-2-naftalenil)azo]-8-hidroxi-3,6-diszulfo-1-naftalenil]amino]-1,3,5-triazin-2-il]amino]-5-[[4-klór-6-[[8-hidroxi-3,6-diszulfo-7-[(2-szulfofenil)azo]-1-naftalenil]amino]-1,3,5-triazin-2-il]amino]benzoesav; 3,5-bisz[[4-klór-6-[[7-[(1,5-diszulfo-2-naftalenil)azo]-8-hidroxi-3,6-diszulfo-1-naftalenil]amino]-1,3,5-triazin-2-il]amino]benzoesav keveréke |
435-440-6 | - | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 611-169-00-0 | sodium 5-(2-carboxyphenylazo)-6-hydroxynaphthalene-2-sulfonate | nátrium-5-(2-karboxifenilazo)-6-hidroxinaftalin-2-szulfonát | 435-800-2 | - | Aquatic
Chronic 3 |
H412 |
- |
H412 |
ATP01 | |||
| 611-170-00-6 | reaction mass of: trisodium 2-((1-(2-hydroxy-κ-O-5-(2-sulfonatoethansulfonyl)phenylazo-κ-N2)-1-phenylmethyl)azo-κ-N1)-4-sulfonatobenzoate(5-)-κ-O)cuprate(II); disodium 2-((1-(5-ethenesulfonyl-2-hydroxy-κ-O-phenylazo-κ-N2)-1-phenylmethyl)azo-κ-N1)-4-sulfonatobenzoate-κ-O-(5-))cuprate(II) | trinátrium-2-((1-(2-hidroxi-κ-O-5-(2-szulfonátoetánszulfonil)fenilazo-κ-N 2)-1-fenilmetil)azo-κ-N 1)4-szulfonátobenzoát(5-)-κ-O)kuprát(II); dinátrium-2-((1-(5-eténszulfonil-2-hidroxi-κ-O-fenilazo-κ-N 2)-1-fenilmetil)azo-κ-N 1)-4-szulfonátobenzoát-κ-O-(5-))kuprát(II) keveréke |
435-880-9 | - | Aquatic
Chronic 3 |
H412 |
- |
H412 |
ATP01 | |||
| 611-171-00-1 | reaction mass of: trisodium 3-(5-(2,6-difluoropyrimidin-4-ylamino)-2-sulfonatophenylazo)-5-(4-fluoro-6-morpholin-4-yl-1,3,5-triazin-2-ylamino)-4-hydroxy-2,7-naphthalenedisulfonate; trisodium 3-(5-(4,6-difluoropyrimidin-2-ylamino)-2-sulfonatophenylazo)-5-(4-fluoro-6-morpholin-4-yl-1,3,5-triazin-2-ylamino)-4-hydroxy-2,7-naphthalenedisulfonate | trinátrium-3-(5-(2,6-difluorpirimidin-4-ilamino)-2-szulfonátofenilazo)-5-(4-fluor-6-morfolin-4-il-1,3,5-triazin-2-ilamino)-4-hidroxi-2,7-naftalindiszulfonát; trinátrium-3-(5-(4,6-difluorpirimidin-2-ilamino)-2-szulfonátofenilazo)-5-(4-fluor-6-morfolin-4-il-1,3,5-triazin-2-ilamino)-4-hidroxi-2,7-naftalindiszulfonát keveréke |
436-890-6 | - | Eye
Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
ATP01 | |||
| 611-172-00-7 | reaction mass of: triammonium 6-amino-3-((2,5-diethoxy-4-(3-phosphonophenyl)azo)phenyl)azo-4-hydroxy-2-naphthalenesulfonate; diammonium 3-((4-((7-amino-1-hydroxy-3-sulfo-naphthalen-2-yl)azo)-2,5-diethoxyphenyl)azo)benzoate | triammónium-6-amino-3-((2,5-dietoxi-4-(3-foszfonofenil)azo)fenil)azo-4-hidroxi-2-naftalinszulfonát; diammónium-3-((4-((7-amino-1-hidroxi-3-szulfonaftalin-2-il)azo)-2,5-dietoxifenil)azo)benzoát keveréke |
438-310-7 | - | Self-react.
C **** Repr. 2 Acute Tox. 4 * STOT RE 2 * Aquatic Chronic 3 |
H242 H361f *** H302 H373 ** H412 |
GHS02 GHS08 GHS07 Dgr |
H242 H361f *** H302 H373 ** H412 |
ATP01 | |||
| 611-173-00-2 | reaction mass of: 3-[3-carbamoyl-5-(5-{4-chloro-6-[4-(2-sulfonatooxyethylsulfonyl)anilino]-1,3,5-triazin-2-ylamino}-2-sulfonatophenylazo)-1,2-dihydro-6-hydroxy-4-methyl-2-oxo-1-pyridyl]propanoic acid, trisodium salt; 3-[3-carbamoyl-5-(5-{4-chloro-6-[4-(vinylsulfonyl)anilino]-1,3,5-triazin-2-ylamino}-2-sulfonatophenylazo)-1,2-dihydro-6-hydroxy-4-methyl-2-oxo-1-pyridyl]propanoic acid, disodium salt | 3-[3-karbamoil-5-(5-{4-klór-6-[4-(2-szulfonátooxietilszulfonil)anilino]-1,3,5-triazin-2-ilamino}-2-szulfonátofenilazo)-1,2-dihidro-6-hidroxi-4-metil-2-oxo-1-piridil]propánsav,
trinátriumsó; 3-[3-karbamoil-5-(5-{4-klór-6-[4-(vinilszulfonil)anilino]-1,3,5-triazin-2-ilamino}-2-szulfonátofenilazo)-1,2-dihidro-6-hidroxi-4-metil-2-oxo-1-piridil]propánsav, dinátriumsó keveréke |
440-510-4 | - | Eye
Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
ATP01 | |||
| 611-174-00-8 | reaction mass of: 3-[5-(4-ethenesulfonylbutyrylamino)-2-sulfophenylazo]-5-{4-chloro-[6-(4-(3-amino-5-hydroxy-2,7-disulfonaphthalene-4-ylazo)-3-sulfophenylamino]-1,3,5-triazin-2-ylamino}-4-hydroxynaphthalene-2,7-disulfonic acid, sodium salt; 3-[5-(4-(2-chloroethanesulfonyl)butyrylamino)-2-sulfophenylazo]-5-{4-chloro-[6-(4-(3-amino-5-hydroxy-2,7-disulfonaphthalene-4-ylazo)-3-sulfophenylamino]-1,3,5-triazin-2-ylamino}-4-hydroxynaphthalene-2,7-disulfonic acid, sodium salt | 3-[5-(4-eténszulfonilbutirilamino)-2-szulfofenilazo]-5-4-klór-[6-(4-(3-amino-5-hidroxi-2,7-diszulfonaftalin-4-ilazo)-3-szulfofenilamino]-1,3,5-triazin-2-ilamino[-4-hidroxinaftalin-2,7-diszulfonsav,
nátriumsó; 3-[5-(4-(2-klóretánszulfonil)butirilamino)-2-szulfofenilazo]-5-4-klór-[6-(4-(3-amino-5-hidroxi-2,7-diszulfonaftalin-4-ilazo)-3-szulfofenilamino]-1,3,5-triazin-2-ilamino}-4-hidroxinaftalin-2,7-diszulfonsav, nátriumsó keveréke |
442-290-5 | 457624-86-1 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 611-175-00-3 | reaction mass of: trisodium 5-{4-chloro-6-[N-ethyl-(3-(2-sulfonatooxy)ethylsulfonyl)anilino]-1,3,5-triazin-2-ylamino}-4-hydroxy-3-[4-(vinylsulfonyl)phenylazo]naphthalene-2,7-disulfonate; trisodium 5-{4-chloro-6-[N-ethyl-3-(vinylsulfonyl)anilino]-1,3,5-triazin-2-ylamino}-4-hydroxy-3-[4-(2-(sulfonatooxy)ethylsulfonyl)phenylazo]naphthalene-2,7-disulfonate; disodium 5-{4-chloro-6-[N-ethyl-3-(vinylsulfonyl)anilino]-1,3,5-triazin-2-ylamino}-4-hydroxy-3-[(4-vinylsulfonyl)phenylazo]naphthalene-2,7-disulfonate; tetrasodium 5-{4-chloro-6-[N-ethyl-3-(2-(sulfonatooxy)ethylsulfonyl)anilino]-1,3,5-triazin-2-ylamino}-3-[4-(2-(sulfonatooxy)ethylsulfonyl)phenylazo]-4-hydroxynaphthalene-2,7-disulfonate | a
következő anyagok keveréke:
trinátrium-5-{4-klór-6-[N-etil-(3-(2-szulfonátooxi)-etilszulfonil)anilino]-1,3,5-triazin-2-ilamino}-4-hidroxi-3-[4-(vinilszulfonil)fenilazo{naftalin-2,7-diszulfonát;
trinátrium-5-{4-klór-6-[N-etil-3-(vinilszulfonil)anilino]-1,3,5-triazin-2-ilamino}-4-hidroxi-3-[4-(2-(szulfonátooxi)etilszulfonil)fenilazo]naftalin-2,7-diszulfonát; dinátrium-5-4-klór-6-[N-etil-3-(vinilszulfonil)anilino]-1,3,5-triazin-2-ilamino}-4-hidroxi-3-[(4-vinilszulfonil)fenilazo]naftalin-2,7-diszulfonát; tetranátrium-5-4-klór-6-[N-etil-3-(2-(szulfonátooxi)etilszulfonil)anilino]-1,3,5-triazin-2-ilamino}-3-[4-(2-(szulfonátooxi)etil-szulfonil)fenilazo]-4-hidroxinaftalin-2,7-diszulfonát |
444-050-5 | - | Eye
Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
ATP01 | |||
| 611-176-00-9 | 2,6-bis(2,3,4-trihydroxybenzyl)-p-cresol ester with 6-diazo-5,6-dihydro-5-oxo-1-naphthalenesulfonate | 2,6-bisz(2,3,4-trihidroxibenzil)-p-krezol észtere 6-diazo-5,6-dihidro-5-oxo-1-naftalinszulfonáttal | 444-250-2 | - | Self-react.
C **** Aquatic Chronic 2 |
H242 H411 |
GHS02 GHS09 Dgr |
H242 H411 |
ATP01 | |||
| 611-177-00-4 | reaction mass of: pentasodium bis[6-anilino-3,5'-disulfonatonaphthalene-2-azobenzene-1,2'-diolato]cobaltate(III); tetrasodium [6-anilino-3,5'-disulfonatonaphthalene-2-azobenzene-1,2'-diolato][6-anilino-5'-sulfamoyl-3-sulfonatonaphthalene-2-azobenzene-1,2'-diolato]cobaltate(III); trisodium bis[6-anilino-5'-sulfamoyl-3-sulfonatonaphthalene-2-azobenzene-1,2'-diolato]cobaltate(III) | pentanátrium-bisz[6-anilino-3,5'-diszulfonátonaftalin-2-azobenzol-1,2'-dioláto]-kobaltát(III); tetranátrium-[6-anilino-3,5'-diszulfonátonaftalin-2-azobenzol-1,2'-dioláto][6-anilino-5'-szulfamoil-3-szulfonátonaftalin-2-azobenzol-1,2'-dioláto]-kobaltát(III); trinátrium-bisz[6-anilino-5'-szulfamoil-3-szulfonátonaftalin-2-azobenzol-1,2'-dioláto]-kobaltát(III) keveréke |
444-290-0 | 508202-43-5 | Eye
Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
ATP01 | |||
| 611-178-00-X | reaction mass of: pentasodium 4-amino-5-hydroxy-3-{(E)-4-[2-(sulfonatooxy)ethylsulfonyl]phenylazo}-6-{(E)-2-sulfonato-4-[2-(sulfonatooxy)ethylsulfonyl]phenylazo}naphthalene-2,7-disulfonate; tetrasodium 4-amino-5-hydroxy-3-{(E)-4-[2-(sulfonatooxy)ethylsulfonyl]phenylazo}-6-[(E)-2-sulfonato-4-(vinylsulfonyl)phenylazo]naphthalene-2,7-disulfonate; tetrasodium 4-amino-5-hydroxy-6-[(E)-2-sulfonato-4-[2-(sulfonatooxy)ethylsulfonyl]phenylazo}-3-[(E)-4-(vinylsulfonyl)phenylazo]naphthalene-2,7-disulfonate; trisodium 4-amino-5-hydroxy-3-[(E)-4-(vinylsulfonyl)phenylazo]-6-[(E)-2-sulfonato-4-(vinylsulfonyl)phenylazo]naphthalene-2,7-disulfonate; trisodium 4-amino-5-hydroxy-3-[(2-hydroxyethylsulfonyl)-phenylazo]-6-[(E)-2-sulfonato-4-(vinylsulfonyl)phenylazo]naphthalene-2,7-disulfonate; trisodium 4-amino-5-hydroxy-3-[(E)-4-(vinylsulfonyl)phenylazo]-6-[-2-sulfonato-4-(2-hydroxyethylsulfonyl)phenylazo]naphthalene-2,7-disulfonate | a következő anyagok keveréke: pentanátrium 4-amino-5-hidroxi-3-{(E)-4-[2-(szulfonátooxi)etilszulfonil]fenilazo}-6-{(E)-2-szulfonáto-4-[2-(szulfonátooxi)etilszulfonil]fenilazo}naftalin-2,7-diszulfonát; tetranátrium-4-amino-5-hidroxi-3-{(E)-4-[2-(szulfonátooxi)etilszulfonil]fenilazo}-6-[(E)-2-szulfonáto-4-(vinilszulfonil)fenilazo]naftalin-2,7-diszulfonát; tetranátrium-4-amino-5-hidroxi-6-{(E)-2-szulfonáto-4-[2-(szulfonátooxi)etilszulfonil]fenilazo}-3-[(E)-4-(vinilszulfonil)fenilazo]naftalin-2,7-diszulfonát; trinátrium-4-amino-5-hidroxi-3-[(E)-4-(vinilszulfonil)fenilazo]-6-[(E)-2-szulfonáto-4-(vinilszulfonil)fenilazo]naftalin-2,7-diszulfonát; trinátrium-4-amino-5-hidroxi-3-[(2-hidroxietilszulfonil)fenilazo]-6-[(E)-2-szulfonáto-4-(vinilszulfonil)fenilazo]naftalin-2,7-diszulfonát; trinátrium-4-amino-5-hidroxi-3-[(E)-4-(vinilszulfonil)fenilazo]-6-[-2-szulfonáto-4-(2-hidroxietilszulfonil)fenilazo]naftalin-2,7-diszulfonát | 445-280-9 | - | Eye
Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
ATP01 | |||
| 611-179-00-5 | reaction mass of: pentasodium 2-[[8-[[4-chloro-6-[[4-(2-sulfonato ethylsulfonyl)]phenyl]amino]-1,3,5-triazin-2-yl]amino-1- hydroxy-3,6-disulfonato-2-naphthalenyl]azo]naphthalene-1,5-disulfonate; 2-[[8-[[4-chloro-6-[[4-[[2-ethenyl]sulfonyl]phenyl]amino]-1,3,5-triazin-2-yl]amino]-1-hydroxy-3,6-disulfonato-2-naphthalenyl]azo]naphthalene-1,5-disulfonate | pentanátrium-2-[[8-[[4-klór-6-[[4-(2-szulfonát-etilszulfonil)]fenil]amino]-1,3,5-triazin-2-il]amino-1-hidroxi-3,6-diszulfonáto-2-naftalinil]azo]naftalin-1,5-diszulfonát; 2-[[8-[[4-klór-6-[[4-[[2-etenil]szulfonil]fenil]amino]-1,3,5-triazin-2-il]amino]-1-hidroxi-3,6-diszulfonáto-2-naftalinil]azo]naftalin-1,5-diszulfonát keveréke |
450-010-8 | - | Eye
Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
ATP01 | |||
| 611-180-00-0 | iron, complexes with diazotised 4-aminobenzenesulfonamide,diazotised 3-aminobenzenesulfonic acid, diazotised 3-amino-4-hydroxybenzenesulfonamide,diazotised 3-amino-4-hydroxy-N-phenylbenzenesulfonamide, diazotised 5-amino-2-(phenylamino)benzenesulfonic acid and resorcinol, sodium salts | vas, komplexek diazotált 4-aminobenzolszulfonamiddal, diazotált 3-aminobenzolszulfonsavval, diazotált 3-amino-4-hidroxibenzolszulfonamiddal, diazotált 3-amino-4-hidroxi-N-fenilbenzolszulfonamiddal, diazotált 5-amino-2-(fenilamino)benzolszulfonsavval és rezorcinnal, nátriumsók | 417-850-7 | - | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
ATP01 | |||
| 611-181-00-6 | potassium (oxido-NNO-azoxy)cyclohexane; cyclohexylhydroxydiazene 1-oxide, potassium salt; [K-HDO] | #HIÁNYZIK | 66603-10-9 | Flam.
Sol. 1 Acute Tox. 3 STOT RE 2 Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 2 |
H228 H301 H373 (liver) H315 H318 H411 |
GHS02 GHS06 GHS08 GHS05 GHS09 Dgr |
H228 H301 H315 H318 H373 (liver) H411 |
Oral:
ATE = 136 mg/kg |
ATP15 | |||
| 612-001-00-9 | mono-methylamine
[1] di-methylamine [2] tri-methylamine [3] |
monometilamin;
[1] dimetilamin; [2] trimetilamin [3] |
200-820-0
[1] 204-697-4 [2] 200-875-0 [3] |
74-89-5
[1] 124-40-3 [2] 75-50-3 [3] |
Flam.
Gas 1 Press. Gas Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 |
H220 H332 H335 H315 H318 |
GHS02 GHS04 GHS05 GHS07 Dgr |
H220 H332 H335 H315 H318 |
* Skin Irrit. 2; H315: C ≥ 5 % Eye Dam. 1; H318: C ≥ 5 % Eye Irrit. 2; H319: 0,5 % ≤ C < 5 % STOT SE 3; H335: C ≥ 5 % |
5 U | CLP00 | |
| 612-001-01-6 | mono-methylamine
... % [1] di-methylamine ... % [2] tri-methylamine ... % [3] |
monometilamin
… %; [1] dimetilamin … %; [2] trimetilamin … % [3] |
200-820-0
[1] 204-697-4 [2] 200-875-0 [3] |
74-89-5
[1] 124-40-3 [2] 75-50-3 [3] |
Flam.
Liq. 1 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H224 H332 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H224 H332 H302 H314 |
* STOT SE 3; H335: C ≥ 5 % |
B | CLP00 | |
| 612-002-00-4 | ethylamine | etilamin | 200-834-7 | 75-04-7 | Flam.
Gas 1 Press. Gas STOT SE 3 Eye Irrit. 2 |
H220 H335 H319 |
GHS02 GHS04 GHS07 Dgr |
H220 H319 H335 |
U | CLP00 | ||
| 612-003-00-X | diethylamine | dietilamin | 203-716-3 | 109-89-7 | Flam.
Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H225 H332 H312 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H225 H332 H312 H302 H314 |
STOT
SE 3; H335: C ≥ 1 % |
CLP00 | ||
| 612-004-00-5 | triethylamine | trietilamin | 204-469-4 | 121-44-8 | Flam.
Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H225 H332 H312 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H225 H332 H312 H302 H314 |
STOT
SE 3; H335: C ≥ 1 % |
CLP00 | ||
| 612-005-00-0 | butylamine | butilamin | 203-699-2 | 109-73-9 | Flam.
Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H225 H332 H312 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H225 H332 H312 H302 H314 |
STOT
SE 3; H335: C ≥ 1 % |
CLP00 | ||
| 612-006-00-6 | ethylenediamine; 1,2-diaminoethane | etiléndiamin; 1,2-diaminoetán |
203-468-6 | 107-15-3 | Flam.
Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 |
H226 H312 H302 H314 H334 H317 |
GHS02 GHS08 GHS05 GHS07 Dgr |
H226 H312 H302 H314 H334 H317 |
CLP00 | |||
| 612-007-00-1 | 2-aminopropane; isopropylamine | 2-aminopropán; izopropilamin |
200-860-9 | 75-31-0 | Flam.
Liq. 1 STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 |
H224 H335 H315 H319 |
GHS02 GHS07 Dgr |
H224 H319 H335 H315 |
CLP00 | |||
| 612-008-00-7 | aniline | anilin | 200-539-3 | 62-53-3 | Carc.
2 Muta. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 |
H351 H341 H331 H311 H301 H372 ** H318 H317 H400 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H351 H341 H331 H311 H301 H372 ** H318 H317 H400 |
* STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,2 % ≤ C < 1 % |
CLP00 | ||
| 612-009-00-2 | salts of aniline | anilin sói | Carc.
2 Muta. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 |
H351 H341 H331 H311 H301 H372 ** H318 H317 H400 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H351 H341 H331 H311 H301 H372 ** H318 H317 H400 |
* STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,2 % ≤ C < 1 % |
A | CLP00 | |||
| 612-010-00-8 | chloroanilines, with exception of those specified elsewhere in this Annex | klóranilinek (kivéve az e mellékletben külön szereplőket) | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H331 H311 H301 H373 ** H410 |
C | CLP00 | ||||
| 612-011-00-3 | 4-nitrosoaniline | 4-nitrozoanilin | 211-535-6 | 659-49-4 | Acute
Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H332 H312 H302 |
GHS07 Wng |
H332 H312 H302 |
CLP00 | |||
| 612-012-00-9 | o-nitroaniline
[1] m-nitroaniline [2] p-nitroaniline [3] |
o-nitroanilin; [1] m-nitroanilin; [2] p-nitroanilin [3] | 201-855-4
[1] 202-729-1 [2] 202-810-1 [3] |
88-74-4
[1] 99-09-2 [2] 100-01-6 [3] |
Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 3 |
H331 H311 H301 H373 ** H412 |
GHS06 GHS08 Dgr |
H331 H311 H301 H373 ** H412 |
C | CLP00 | ||
| 612-013-00-4 | 3-aminobenzene sulphonic acid; metanilic acid | 3-aminobenzolszulfonsav; metanilsav |
204-473-6 | 121-47-1 | Acute
Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H332 H312 H302 |
GHS07 Wng |
H332 H312 H302 |
CLP00 | |||
| 612-014-00-X | sulphanilic acid; 4-aminobenzenesulphonic acid | szulfanilsav; 4-aminobenzolszulfonsav |
204-482-5 | 121-57-3 | Skin
Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H315 H319 H317 |
GHS07 Wng |
H319 H315 H317 |
CLP00 | |||
| 612-015-00-5 | N-methylaniline | N-metilanilin | 202-870-9 | 100-61-8 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H331 H311 H301 H373 ** H410 |
CLP00 | |||
| 612-016-00-0 | N,N-dimethylaniline | N,N-dimetilanilin | 204-493-5 | 121-69-7 | Carc.
2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Chronic 2 |
H351 H331 H311 H301 H411 |
GHS06 GHS08 GHS09 Dgr |
H351 H331 H311 H301 H411 |
CLP00 | |||
| 612-017-00-6 | N-methyl-N-2,4,6-tetranitroaniline; tetryl | N-metil-N-2,4,6-tetranitroanilin; tetril | 207-531-9 | 479-45-8 | Expl.
1.1 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 |
H201 H331 H311 H301 H373 ** |
GHS01 GHS06 GHS08 Dgr |
H201 H331 H311 H301 H373 ** |
CLP00/ATP01 | |||
| 612-018-00-1 | bis(2,4,6-trinitrophenyl)amine; hexyl | bisz(2,4,6-trinitrofenil)amin; hexil |
205-037-8 | 131-73-7 | Expl.
1.1 Acute Tox. 1 Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 Aquatic Chronic 2 |
H201 H310 H330 H300 H373 ** H411 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H201 H330 H310 H300 H373 ** H411 |
CLP00/ATP01 | |||
| 612-019-00-7 | dipicrylamine, ammonium salt | dipikrilamin ammóniumsója | 220-639-0 | 2844-92-0 | Expl.
1.1 Acute Tox. 1 Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 Aquatic Chronic 2 |
H201 H310 H330 H300 H373 ** H411 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H201 H330 H310 H300 H373 ** H411 |
CLP00/ATP01 | |||
| 612-020-00-2 | 1-naphthylamine | 1-naftilamin | 205-138-7 | 134-32-7 | Acute
Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
CLP00 | |||
| 612-022-00-3 | 2-naphthylamine | 2-naftilamin | 202-080-4 | 91-59-8 | Carc.
1A Acute Tox. 4 * Aquatic Chronic 2 |
H350 H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H411 |
Carc.
1A; H350: C ≥ 0,01 % |
CLP00 | ||
| 612-023-00-9 | phenylhydrazine
[1] phenylhydrazinium chloride [2] phenylhydrazine hydrochloride [3] phenylhydrazinium sulphate (2:1) [4] |
fenilhidrazin;
[1] fenilhidrazinium-klorid; [2] fenilhidrazin-hidroklorid; [3] fenilhidrazinium-szulfát (2:1) [4] |
202-873-5
[1] 200-444-7 [2] 248-259-0 [3] 257-622-2 [4] |
100-63-0
[1] 59-88-1 [2] 27140-08-5 [3] 52033-74-6 [4] |
Carc.
1B Muta. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 |
H350 H341 H331 H311 H301 H372 ** H315 H319 H317 H400 |
GHS06 GHS08 GHS09 Dgr |
H350 H341 H331 H311 H301 H372 ** H319 H315 H317 H400 |
CLP00 | |||
| 612-024-00-4 | m-toluidine; 3-aminotoluene | m-toluidin; 3-aminotoluol |
203-583-1 | 108-44-1 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 |
H331 H311 H301 H373 ** H400 |
GHS06 GHS08 GHS09 Dgr |
H331 H311 H301 H373 ** H400 |
CLP00 | |||
| 612-025-00-X | nitrotoluidines, with the exception of those specified elsewhere in this Annex | nitrotoluidinok (kivéve az e mellékletben külön szereplőket) | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 2 |
H331 H311 H301 H373 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H331 H311 H301 H373 ** H411 |
C | CLP00 | ||||
| 612-026-00-5 | diphenylamine | difenilamin | 204-539-4 | 122-39-4 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H331 H311 H301 H373 ** H410 |
CLP00 | |||
| 612-027-00-0 | xylidines with the exception of those specified elsewhere in this Annex; dimethyl anilines with the exception of those specified elsewhere in this Annex | xilidinek
(kivéve az e mellékletben külön szereplőket) dimetilanilinek (kivéve az e mellékletben külön szereplőket) |
Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 2 |
H331 H311 H301 H373 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H331 H311 H301 H373 ** H411 |
C | CLP00 | ||||
| 612-028-00-6 | p-phenylenediamine | p-feniléndiamin | 203-404-7 | 106-50-3 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H319 H317 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H319 H317 H410 |
CLP00 | |||
| 612-029-00-1 | benzene-1,4-diamine dihydrochloride; p-phenylenediamine dihydrochloride | benzol-1,4-diamin-dihidroklorid; p-feniléndiamin-dihidroklorid |
210-834-9 | 624-18-0 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H319 H317 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H319 H317 H410 |
CLP00 | |||
| 612-030-00-7 | 2-methyl-p-phenylenediamine
sulphate [1] 2-methyl-p-phenylenediamine sulphate [2] |
2-metil-p-feniléndiamin-szulfát [1] | 210-431-8
[1] 228-871-4 [2] |
615-50-9
[1] 6369-59-1 [2] |
Acute
Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H301 H332 H312 H317 H411 |
GHS06 GHS09 Dgr |
H301 H332 H312 H317 H411 |
CLP00 | |||
| 612-031-00-2 | N,N-dimethylbenzene-1,3-diamine
[1] 4-amino-N,N-dimethylaniline; 3-amino-N,N'-dimethylaniline [2] |
N,N-dimetilbenzol-1,3-diamin;
[1] 4-amino-N,N-dimetilanilin; 3-amino-N,N-dimetilanilin [2] |
220-623-3
[1] 202-807-5 [2] |
2836-04-6
[1] 99-98-9 [2] |
Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
C | CLP00 | ||
| 612-032-00-8 | N,N,N',N'-tetramethyl-p-phenylenediamine | N, N,N’,N’-tetrametil-p-feniléndiamin | 202-831-6 | 100-22-1 | Acute
Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H332 H312 H302 |
GHS07 Wng |
H332 H312 H302 |
CLP00 | |||
| 612-033-00-3 | 2-aminophenol | 2-aminofenol | 202-431-1 | 95-55-6 | Muta.
2 Acute Tox. 4 * Acute Tox. 4 * |
H341 H332 H302 |
GHS08 GHS07 Wng |
H341 H332 H302 |
CLP00 | |||
| 612-034-00-9 | 2-amino-4,6-dinitrophenol; picramic acid | 2-amino-4,6-dinitrofenol; pikraminsav |
202-544-6 | 96-91-3 | Expl.
1.1 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 3 |
H201 H332 H312 H302 H412 |
GHS01 GHS07 Dgr |
H201 H332 H312 H302 H412 |
CLP00/ATP01 | |||
| 612-034-01-6 | 2-amino-4,6-dinitrophenol; picramic acid; [≥ 20 % water] | 2-amino-4,6-dinitrofenol; pikraminsav; [≥ 20 % víz] |
202-544-6 | 96-91-3 | Acute
Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 3 |
H332 H312 H302 H412 |
GHS07 Wng |
H332 H312 H302 H412 |
G | CLP00 | ||
| 612-035-00-4 | 2-methoxyaniline; o-anisidine | 2-metoxianilin; o-anizidin |
201-963-1 | 90-04-0 | Carc.
1B Muta. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H350 H341 H331 H311 H301 |
GHS06 GHS08 Dgr |
H350 H341 H331 H311 H301 |
CLP00 | |||
| 612-036-00-X | 3,3'-dimethoxybenzidine; o-dianisidine | 3,3’-dimetoxibenzidin; o-dianizidin |
204-355-4 | 119-90-4 | Carc.
1B Acute Tox. 4 * |
H350 H302 |
GHS08 GHS07 Dgr |
H350 H302 |
CLP00 | |||
| 612-037-00-5 | salts of 3,3'-dimethoxybenzidine; salts of o-dianisidine | 3,3'-dimetoxibenzidin sói; o-dianizidin sói | Carc.
1B Acute Tox. 4 * |
H350 H302 |
GHS08 GHS07 Dgr |
H350 H302 |
A | CLP00 | ||||
| 612-038-00-0 | 2-nitro-p-anisidine; 4-methoxy-2-nitroaniline | 2-nitro-p-anizidin; 4-metoxi-2-nitroanilin |
202-547-2 | 96-96-8 | Acute
Tox. 1 Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 3 |
H310 H330 H300 H373 ** H412 |
GHS06 GHS08 Dgr |
H330 H310 H300 H373 ** H412 |
CLP00 | |||
| 612-039-00-6 | 2-ethoxyaniline; o-phenetidine | 2-etoxianilin; o-fenetidin |
202-356-4 | 94-70-2 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * |
H331 H311 H301 H373 ** |
GHS06 GHS08 Dgr |
H331 H311 H301 H373 ** |
CLP00 | |||
| 612-040-00-1 | 2,4-dinitroaniline | 2,4-dinitroanilin | 202-553-5 | 97-02-9 | Acute
Tox. 1 Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 2 |
H310 H330 H300 H373 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H330 H310 H300 H373 ** H411 |
CLP00 | |||
| 612-041-00-7 | 4,4'-bi-o-toluidine | 4,4'-bi-o-toluidin | 204-358-0 | 119-93-7 | Carc.
1B Acute Tox. 4 * Aquatic Chronic 2 |
H350 H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H411 |
CLP00 | |||
| 612-042-00-2 | benzidine; 1,1'-biphenyl-4,4'-diamine; 4,4'-diaminobiphenyl; biphenyl-4,4'-ylenediamine | benzidin; 1,1’-bifenil-4,4’-diamin; 4,4’-diaminobifenil; bifenil-4,4’-iléndiamin |
202-199-1 | 92-87-5 | Carc.
1A Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H410 |
Carc.
1A; H350: C ≥ 0,01 % |
CLP00 | ||
| 612-043-00-8 | N,N'-dimethylbenzidine | N,N-dimetilbenzidin | 2810-74-4 | Acute
Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H332 H312 H302 |
GHS07 Wng |
H332 H312 H302 |
CLP00 | ||||
| 612-044-00-3 | N,N'-diacetylbenzidine | N,N-diacetilbenzidin | 210-338-2 | 613-35-4 | Carc.
1B Muta. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H350 H341 H332 H312 H302 |
GHS08 GHS07 Dgr |
H350 H341 H332 H312 H302 |
CLP00/ATP01 | |||
| 612-046-00-4 | allylamine | allilamin | 203-463-9 | 107-11-9 | Flam.
Liq. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Chronic 2 |
H225 H331 H311 H301 H411 |
GHS02 GHS06 GHS09 Dgr |
H225 H331 H311 H301 H411 |
CLP00 | |||
| 612-047-00-X | benzylamine | benzilamin | 202-854-1 | 100-46-9 | Acute
Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
CLP00 | |||
| 612-048-00-5 | dipropylamine | dipropilamin | 205-565-9 | 142-84-7 | Flam.
Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H225 H332 H312 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H225 H332 H312 H302 H314 |
STOT
SE 3; H335: C ≥ 1 % |
CLP00 | ||
| 612-049-00-0 | di-n-butylamine
[1] di-sec-butylamine [2] |
di-n-butilamin;
[1] di-szek-butilamin [2] |
203-921-8
[1] 210-937-9 [2] |
111-92-2
[1] 626-23-3 [2] |
Flam.
Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H226 H332 H312 H302 |
GHS02 GHS07 Wng |
H226 H332 H312 H302 |
CLP00 | |||
| 612-050-00-6 | cyclohexylamine | ciklohexilamin | 203-629-0 | 108-91-8 | Flam.
Liq. 3 Repr. 2 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H226 H361f *** H312 H302 H314 |
GHS02 GHS05 GHS08 GHS07 Dgr |
H226 H361f *** H312 H302 H314 |
CLP00/ATP01corr | |||
| 612-051-00-1 | 4,4'-diaminodiphenylmethane; 4,4'-methylenedianiline | 4,4'-diaminodifenilmetán; 4,4'-metiléndianilin |
202-974-4 | 101-77-9 | Carc.
1B Muta. 2 STOT SE 1 STOT RE 2 * Skin Sens. 1 Aquatic Chronic 2 |
H350 H341 H370 ** H373 ** H317 H411 |
GHS08 GHS07 GHS09 Dgr |
H350 H341 H370 ** H373 ** H317 H411 |
CLP00 | |||
| 612-052-00-7 | (S)-sec-butylamine;
(S)-2-aminobutane [1] (R)-sec-butylamine; (R)-2-aminobutane [2] sec-butylamine; 2-aminobutane [3] |
(S)-szek-butilamin; (S)-2-aminobután; [1] (R)-szek-butilamin; (R)-2-aminobután; [2] szek-butilamin; 2-aminobután [3] |
208-164-7
[1] 236-232-6 [2] 237-732-7 [3] |
513-49-5
[1] 13250-12-9 [2] 13952-84-6 [3] |
Flam.
Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A Aquatic Acute 1 |
H225 H332 H302 H314 H400 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H225 H332 H302 H314 H400 |
C | CLP00 | ||
| 612-053-00-2 | N-ethylaniline | N-etilanilin | 203-135-5 | 103-69-5 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * |
H331 H311 H301 H373 ** |
GHS06 GHS08 Dgr |
H331 H311 H301 H373 ** |
CLP00 | |||
| 612-054-00-8 | N,N-diethylaniline | N,N-dietilanilin | 202-088-8 | 91-66-7 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 2 |
H331 H311 H301 H373 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H331 H311 H301 H373 ** H411 |
* |
CLP00 | ||
| 612-055-00-3 | N-methyl-o-toluidine
[1] N-methyl-m-toluidine [2] N-methyl-p-toluidine [3] |
N-metil-o-toluidin; [1] N-metil-m-toluidin; [2] N-metil-p-toluidin [3] | 210-260-9
[1] 211-795-0 [2] 210-769-6 [3] |
611-21-2
[1] 696-44-6 [2] 623-08-5 [3] |
Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 3 |
H331 H311 H301 H373 ** H412 |
GHS06 GHS08 Dgr |
H331 H311 H301 H373 ** H412 |
C | CLP00 | ||
| 612-056-00-9 | N,N-dimethyl-p-toluidine
[1] N,N-dimethyl-m-toluidine [2] N,N-dimethyl-o-toluidine [3] |
N,N-dimetil-p-toluidin; [1] N,N-dimetil-m-toluidin; [2] N,N-dimetil-o-toluidin [3] | 202-805-4
[1] 204-495-6 [2] 210-199-8 [3] |
99-97-8
[1] 121-72-2 [2] 609-72-3 [3] |
Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 3 |
H331 H311 H301 H373 ** H412 |
GHS06 GHS08 Dgr |
H331 H311 H301 H373 ** H412 |
* |
C | CLP00 | |
| 612-057-00-4 | piperazine; [solid] | piperazin; [szilárd] | 203-808-3 | 110-85-0 | Repr.
2 Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 |
H361fd H314 H334 H317 |
GHS05 GHS08 Dgr |
H361fd H314 H334 H317 |
CLP00/ATP01 | |||
| 612-057-01-1 | piperazine; [liquid] | piperazin; [folyékony] | 203-808-3 | 110-85-0 | Repr.
2 Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 |
H361fd H314 H334 H317 |
GHS05 GHS08 Dgr |
H361fd H314 H334 H317 |
ATP01 | |||
| 612-058-00-X | 2,2'-iminodiethylamine; diethylenetriamine | 2,2’-iminodietilamin; dietiléntriamin |
203-865-4 | 111-40-0 | Acute
Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 |
H312 H302 H314 H317 |
GHS05 GHS07 Dgr |
H312 H302 H314 H317 |
CLP00 | |||
| 612-059-00-5 | 3,6-diazaoctanethylenediamin; triethylenetetramine | 3,6-diazaoktánetiléndiamin; trietiléntetramin |
203-950-6 | 112-24-3 | Acute
Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H312 H314 H317 H412 |
GHS05 GHS07 Dgr |
H312 H314 H317 H412 |
CLP00 | |||
| 612-060-00-0 | 3,6,9-triazaundecamethylenediamine; tetraethylenepentamine | 3,6,9-triazaundekametiléndiamin; tetraetilénpentamin | 203-986-2 | 112-57-2 | Acute
Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H312 H302 H314 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H312 H302 H314 H317 H411 |
CLP00 | |||
| 612-061-00-6 | 3-aminopropyldimethylamine; N,N-dimethyl-1,3-diaminopropane | 3-aminopropildimetilamin; N,N-dimetil-1,3-diaminopropán | 203-680-9 | 109-55-7 | Flam.
Liq. 3 Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 |
H226 H302 H314 H317 |
GHS02 GHS05 GHS07 Dgr |
H226 H302 H314 H317 |
CLP00 | |||
| 612-062-00-1 | 3-aminopropyldiethylamine; N,N-diethyl-1,3-diaminopropane | 3-aminopropildietilamin; N,N-dietil-1,3-diaminopropán |
203-236-4 | 104-78-9 | Flam.
Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 |
H226 H312 H302 H314 H317 |
GHS02 GHS05 GHS07 Dgr |
H226 H312 H302 H314 H317 |
CLP00 | |||
| 612-063-00-7 | 3,3'-iminodi(propylamine); dipropylenetriamine | 3,3’-iminodi(propilamin); dipropiléntriamin |
200-261-2 | 56-18-8 | Acute
Tox. 2 * Acute Tox. 3 * Acute Tox. 4 * Skin Corr. 1A Skin Sens. 1 |
H330 H311 H302 H314 H317 |
GHS06 GHS05 Dgr |
H330 H311 H302 H314 H317 |
CLP00 | |||
| 612-064-00-2 | 3,6,9,12-tetra-azatetradecamethylenediamine; pentacthylenehexamine | 3,6,9,12-tetraazatetradekametiléndiamin; pentaktilénhexamin | 223-775-9 | 4067-16-7 | Skin
Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H410 |
CLP00 | |||
| 612-065-00-8 | polyethlyenepolyamines with the exception of those specified elsewhere in this Annex | polietilén-poliaminok (kivéve az e mellékletben külön szereplőket) | Acute
Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H312 H302 H314 H317 H410 |
CLP00 | |||||
| 612-066-00-3 | dicyclohexylamine | diciklohexilamin | 202-980-7 | 101-83-7 | Acute
Tox. 4 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H302 H314 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H410 |
CLP00 | |||
| 612-067-00-9 | 3-aminomethyl-3,5,5-trimethylcyclohexylamine | 3-aminometil-3,5,5-trimetilciklohexilamin | 220-666-8 | 2855-13-2 | Acute
Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H312 H302 H314 H317 H412 |
GHS05 GHS07 Dgr |
H312 H302 H314 H317 H412 |
CLP00 | |||
| 612-068-00-4 | 3,3'-dichlorobenzidine; 3,3'-dichlorobiphenyl-4,4'-ylenediamine | 3,3’-diklórbenzidin; 3,3’-diklóbifenil-4,4’-iléndiamin |
202-109-0 | 91-94-1 | Carc.
1B Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H312 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H312 H317 H410 |
CLP00 | |||
| 612-069-00-X | salts of 3,3'-dichlorobenzidine; salts of 3,3'-dichlorobiphenyl-4,4'-ylenediamine | 3,3’-diklórbenzidin
sói; 3,3’-diklóbifenil-4,4’-iléndiamin sói |
Carc.
1B Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H312 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H312 H317 H410 |
A | CLP00 | ||||
| 612-070-00-5 | salts
of benzidine [ [1] salts of benzidine [ [2] salts of benzidine [ [3] salts of benzidine [ [4] |
benzidin sói | 208-519-6
[1] 208-520-1 [2] 244-236-4 [3] 252-984-8 [4] |
531-85-1
[1] 531-86-2 [2] 21136-70-9 [3] 36341-27-2 [4] |
Carc.
1A Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H410 |
A | CLP00 | ||
| 612-071-00-0 | salts
of 2-naphthylamine [1] salts of 2-naphthylamine [2] |
2-naftilamin sói | 209-030-0
[1] 210-313-6 [2] |
553-00-4
[1] 612-52-2 [2] |
Carc.
1A Acute Tox. 4 * Aquatic Chronic 2 |
H350 H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H411 |
A | CLP00 | ||
| 612-072-00-6 | biphenyl-4-ylamine; xenylamine; 4-aminobiphenyl | bifenil-4-ilamin; xenilamin; 4-aminobifenil |
202-177-1 | 92-67-1 | Carc.
1A Acute Tox. 4 * |
H350 H302 |
GHS08 GHS07 Dgr |
H350 H302 |
CLP00 | |||
| 612-073-00-1 | salts of biphenyl-4-ylamine; salts of xenylamine; salts of 4-aminobiphenyl | bifenil-4-ilamin
sói; xenilamin sói; 4-aminobifenil sói |
Carc.
1A Acute Tox. 4 * |
H350 H302 |
GHS08 GHS07 Dgr |
H350 H302 |
A | CLP00 | ||||
| 612-074-00-7 | benzyldimethylamine | benzildimetilamin | 203-149-1 | 103-83-3 | Flam.
Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 3 |
H226 H332 H312 H302 H314 H412 |
GHS02 GHS05 GHS07 Dgr |
H226 H332 H312 H302 H314 H412 |
CLP00 | |||
| 612-075-00-2 | 2-aminoethyldimethylamine; 2-dimethylaminoethylamine | 2-aminoetildimetilamin; 2-dimetilaminoetilamin |
203-541-2 | 108-00-9 | Flam.
Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H225 H312 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H225 H312 H302 H314 |
CLP00 | |||
| 612-076-00-8 | ethyldimethylamine | etildimetilamin | 209-940-8 | 598-56-1 | Flam.
Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H225 H332 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H225 H332 H302 H314 |
CLP00/ATP01 | |||
| 612-077-00-3 | dimethylnitrosoamine; N-nitrosodimethylamine | dimetilnitrozoamin; N-nitrozodimetilamin |
200-549-8 | 62-75-9 | Carc.
1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Aquatic Chronic 2 |
H350 H330 H301 H372 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H350 H330 H301 H372 ** H411 |
Carc.
1B; H350: C ≥ 0,001 % |
CLP00 | ||
| 612-078-00-9 | 2,2'-dichloro-4,4'-methylenedianiline; 4,4'-methylene bis(2-chloroaniline) | 2,2'-diklór-4,4'-metiléndianilin; 4,4'-metilén-bisz(2-klóranilin) |
202-918-9 | 101-14-4 | Carc.
1B Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H410 |
CLP00 | |||
| 612-079-00-4 | salts of 2,2'-dichloro-4,4'-methylenedianiline; salts of 4,4'-methylenebis(2-chloroaniline) | 2,2'-diklór-4,4'-metiléndianilin
sói; 4,4’-metilénbisz(2-klóranilin) sói |
Carc.
1B Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H410 |
A | CLP00 | ||||
| 612-080-00-X | 4-amino-N,N-diethylaniline; N,N-diethyl-p-phenylendiamine | 4-amino-N,N-dietilanilin; N,N-dietil-p-feniléndiamin |
202-214-1 | 93-05-0 | Acute
Tox. 3 * Skin Corr. 1B |
H301 H314 |
GHS06 GHS05 Dgr |
H301 H314 |
CLP00 | |||
| 612-081-00-5 | salts
of 4,4'-bi-o-toluidine; salts of 3,3'-dimethylbenzidine; salts of o-tolidine
[1] salts of 4,4'-bi-o-toluidine; salts of 3,3'-dimethylbenzidine; salts of o-tolidine [2] salts of 4,4'-bi-o-toluidine; salts of 3,3'-dimethylbenzidine; salts of o-tolidine [3] |
4,4’-bi-o-toluidin
sói; 3,3’-dimetilbenzidin sói; o-tolidin sói |
210-322-5
[1] 265-294-7 [2] 277-985-0 [3] |
612-82-8
[1] 64969-36-4 [2] 74753-18-7 [3] |
Carc.
1B Acute Tox. 4 * Aquatic Chronic 2 |
H350 H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H411 |
A | CLP00 | ||
| 612-082-00-0 | thiourea; thiocarbamide | tiourea; tiokarbamid |
200-543-5 | 62-56-6 | Carc.
2 Repr. 2 Acute Tox. 4 * Aquatic Chronic 2 |
H351 H361d *** H302 H411 |
GHS08 GHS07 GHS09 Wng |
H351 H361d *** H302 H411 |
CLP00 | |||
| 612-083-00-6 | 1-methyl-3-nitro-1-nitrosoguanidine | 1-metil-3-nitro-1-nitrozoguanidin | 200-730-1 | 70-25-7 | Carc.
1B Acute Tox. 4 * Skin Irrit. 2 Eye Irrit. 2 Aquatic Chronic 2 |
H350 H332 H315 H319 H411 |
GHS08 GHS07 GHS09 Dgr |
H350 H332 H319 H315 H411 |
Carc.
1B; H350: C ≥ 0,01 % |
CLP00/ATP01 | ||
| 612-084-00-1 | dapsone; 4,4'-diamino diphenyl sulfone | dapszon; 4,4’-diaminodifenilszulfon |
201-248-4 | 80-08-0 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 612-085-00-7 | 4,4'-methylenedi-o-toluidine | 4,4’-metiléndi-o-toluidin | 212-658-8 | 838-88-0 | Carc.
1B Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H317 H410 |
CLP00 | |||
| 612-086-00-2 | amitraz (ISO); N,N-bis(2,4-xylyliminomethyl) methylamine | amitráz
(ISO); N,N-bisz(2,4-xililiminometil)metilamin |
251-375-4 | 33089-61-1 | Acute
Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H317 H410 |
M=10 |
CLP00 | ||
| 612-087-00-8 | guazatine (ISO) | guazatin (ISO) | 108173-90-6 | Acute
Tox. 2 * Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H312 H302 H335 H315 H318 H400 H410 |
GHS06 GHS05 GHS09 Dgr |
H330 H312 H302 H335 H315 H318 H410 |
CLP00 | ||||
| 612-088-00-3 | simazine (ISO); 6-chloro-N,N'-diethyl-1,3,5-triazine-2,4-diamine | simazin
(ISO); 6-klór-N,N'-dietil-1,3,5-triazin-2,4-diamin |
204-535-2 | 122-34-9 | Carc.
2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
CLP00 | |||
| 612-089-00-9 | 1,5-naphthylenediamine | 1,5-naftalindiamin | 218-817-8 | 2243-62-1 | Carc.
2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
CLP00 | |||
| 612-090-00-4 | 2,2'-(nitrosoimino)bisethanol | 2,2’-(nitrozoimino)biszetanol | 214-237-4 | 1116-54-7 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 612-091-00-X | o-toluidine; 2-aminotoluene | o-toluidin; 2-aminotoluol |
202-429-0 | 95-53-4 | Carc.
1B Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 Aquatic Acute 1 |
H350 H331 H301 H319 H400 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H301 H319 H400 |
CLP00 | |||
| 612-092-00-5 | N,N'-(2,2-dimethylpropylidene)hexamethylenediamine | N, N’-(2,2-dimetilpropilidén)-hexametiléndiamin | 401-660-6 | 1000-78-8 | Skin
Irrit. 2 Skin Sens. 1 |
H315 H317 |
GHS07 Wng |
H315 H317 |
CLP00 | |||
| 612-093-00-0 | 3,5-dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline | 3,5-diklór-4-(1,1,2,2-tetrafluoretoxi)anilin | 401-790-3 | 104147-32-2 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | |||
| 612-094-00-6 | 4-(2-chloro-4-trifluoromethyl)phenoxy-2-fluoroaniline hydrochloride | 4-(2-klór - 4-trifluormetil)fenoxi-2-fluoranilin-hidroklorid | 402-190-4 | 113674-95-6 | Acute
Tox. 4 * STOT RE 1 STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H372 ** H373 ** H318 H317 H400 H410 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H372
** H302 H373 ** H318 H317 H410 |
CLP00/ATP01 | |||
| 612-095-00-1 | benzyl-2-hydroxydodecyldimethylammonium benzoate | benzil-2-hidroxidodecil-dimetilammónium-benzoát | 402-610-6 | 113694-52-3 | Acute
Tox. 4 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H302 H314 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H314 H302 H410 |
CLP00 | |||
| 612-096-00-7 | 4,4'-carbonimidoylbis[N,N-dimethylaniline] | 4,4’-karbonimidoilbisz(N, N-dimetilanilin) | 207-762-5 | 492-80-8 | Carc.
2 Acute Tox. 4 * Eye Irrit. 2 Aquatic Chronic 2 |
H351 H302 H319 H411 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H319 H411 |
CLP00 | |||
| 612-097-00-2 | salts of 4,4'-carbonimidoylbis[N,N-dimethylaniline] | 4,4'-karbonimidoilbisz-(N, N-dimetilanilin) sói | Carc.
2 Acute Tox. 4 * Eye Irrit. 2 Aquatic Chronic 2 |
H351 H302 H319 H411 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H319 H411 |
A | CLP00 | ||||
| 612-098-00-8 | nitrosodipropylamine | nitrozodipropilamin | 210-698-0 | 621-64-7 | Carc.
1B Acute Tox. 4 * Aquatic Chronic 2 |
H350 H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H411 |
Carc.
1B; H350: C ≥ 0,001 % |
CLP00/ATP01 | ||
| 612-099-00-3 | 4-methyl-m-phenylenediamine; 2,4-toluenediamine | 4-metil-m-feniléndiamin; 2,4-toluoldiamin |
202-453-1 | 95-80-7 | Carc.
1B Muta. 2 Repr. 2 Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Chronic 2 |
H350 H341 H361f *** H301 H312 H373 ** H317 H411 |
GHS06 GHS08 GHS09 Dgr |
H350 H341 H361f *** H301 H312 H373 ** H317 H411 |
CLP00/ATP01 | |||
| 612-100-00-7 | propylenediamine | propiléndiamin | 201-155-9 | 78-90-0 | Flam.
Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H226 H312 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H226 H312 H302 H314 |
CLP00 | |||
| 612-101-00-2 | methenamine; hexamethylenetetramine | meténamin; hexametiléntetramin |
202-905-8 | 100-97-0 | Flam.
Sol. 2 Skin Sens. 1 |
H228 H317 |
GHS02 GHS07 Wng |
H228 H317 |
CLP00/ATP01 | |||
| 612-102-00-8 | N,N-bis(3-aminopropyl)methylamine | N, N-bisz(3-aminopropil)metilamin | 203-336-8 | 105-83-9 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * Skin Corr. 1B |
H331 H311 H302 H314 |
GHS06 GHS05 Dgr |
H331 H311 H302 H314 |
CLP00 | |||
| 612-103-00-3 | N,N,N',N'-tetramethylethylenediamine | N, N,N',N'-tetrametiletiléndiamin | 203-744-6 | 110-18-9 | Flam.
Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H225 H332 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H225 H332 H302 H314 |
CLP00 | |||
| 612-104-00-9 | hexamethylenediamine | hexametiléndiamin | 204-679-6 | 124-09-4 | Acute
Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Corr. 1B |
H312 H302 H335 H314 |
GHS05 GHS07 Dgr |
H312 H302 H335 H314 |
CLP00 | |||
| 612-105-00-4 | 2-piperazin-1-ylethylamine | 2-piperazin-1-iletilamin | 205-411-0 | 140-31-8 | Acute
Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H312 H302 H314 H317 H412 |
GHS05 GHS07 Dgr |
H312 H302 H314 H317 H412 |
CLP00 | |||
| 612-106-00-X | 2,6-diethylaniline | 2,6-dietilanilin | 209-445-7 | 579-66-8 | Acute
Tox. 4 * |
H302 |
H302 |
CLP00 | ||||
| 612-107-00-5 | 1-phenylethylamine
[1] Dl-α-methylbenzylamine [2] |
1-feniletilamin;
[1] DL-α-metilbenzilamin [2] |
202-706-6
[1] 210-545-8 [2] |
98-84-0
[1] 618-36-0 [2] |
Acute
Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
CLP00 | |||
| 612-108-00-0 | 3-aminopropyltriethoxysilane | 3-aminopropiltrietoxiszilán | 213-048-4 | 919-30-2 | Acute
Tox. 4 * Skin Corr. 1B |
H302 H314 |
GHS05 GHS07 Dgr |
H302 H314 |
CLP00 | |||
| 612-109-00-6 | bis(2-dimethylaminoethyl)(methyl)amine | bisz(2-dimetilaminoetil)metilamin | 221-201-1 | 3030-47-5 | Acute
Tox. 3 * Acute Tox. 4 * Skin Corr. 1B |
H311 H302 H314 |
GHS06 GHS05 Dgr |
H311 H302 H314 |
CLP00 | |||
| 612-110-00-1 | 2,2'-dimethyl-4,4'-methylenebis(cyclohexylamine) | 2,2’-dimetil-4,4’-metilénbisz(ciklohexilamin) | 229-962-1 | 6864-37-5 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * Skin Corr. 1A Aquatic Chronic 2 |
H331 H311 H302 H314 H411 |
GHS06 GHS05 GHS09 Dgr |
H331 H311 H302 H314 H411 |
CLP00 | |||
| 612-111-00-7 | 2-methyl-m-phenylenediamine; 2,6-toluenediamine | 2-metil-m-feniléndiamin; 2,6-toluoldiamin |
212-513-9 | 823-40-5 | Muta.
2 Acute Tox. 4 * Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H341 H312 H302 H317 H411 |
GHS08 GHS07 GHS09 Wng |
H341 H312 H302 H317 H411 |
CLP00 | |||
| 612-112-00-2 | p-anisidine; 4-methoxyaniline | p-anizidin; 4-metoxianilin |
203-254-2 | 104-94-9 | Acute
Tox. 1 Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 * Aquatic Acute 1 |
H310 H330 H300 H373 ** H400 |
GHS06 GHS08 GHS09 Dgr |
H330 H310 H300 H373 ** H400 |
CLP00 | |||
| 612-113-00-8 | 6-methyl-2,4-bis(methylthio)phenylene-1,3-diamine | 6-metil-2,4-bisz(metiltio)fenilén-1,3-diamin | 403-240-8 | 106264-79-3 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
CLP00 | |||
| 612-114-00-3 | R,R-2-hydroxy-5-(1-hydroxy-2-(4-phenylbut-2-ylamino)ethyl)benzamide hydrogen 2,3-bis(benzoyloxy)succinate | R, R-2-hidroxi-5-[1-hidroxi-2-(4-fenilbut-2-ilamino)etil]benzamid-hidrogén-2,3-bisz(benzoiloxi)-szukcinát | 404-390-7 | Flam.
Sol. 1 Skin Sens. 1 Aquatic Chronic 3 |
H228 H317 H412 |
GHS02 GHS07 Wng |
H228 H317 H412 |
CLP00 | ||||
| 612-115-00-9 | dimethyldioctadecylammonium hydrogen sulfate | dimetildioktadecilammónium-hidrogén-szulfát | 404-050-8 | 123312-54-9 | Eye
Irrit. 2 Aquatic Chronic 4 |
H319 H413 |
GHS07 Wng |
H319 H413 |
CLP00 | |||
| 612-116-00-4 | C8-18alkylbis(2-hydroxyethyl)ammonium bis(2-ethylhexyl)phosphate | C8-18-alkil-bisz(2-hidroxietil)ammónium-bisz(2-etilhexil)-foszfát | 404-690-8 | 68132-19-4 | Acute
Tox. 3 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H314 H317 H400 H410 |
GHS06 GHS05 GHS09 Dgr |
H331 H314 H317 H410 |
CLP00 | |||
| 612-117-00-X | C12-14-tert-alkylamine, methylphosphonic acid salt | C12-14-terc-alkilamin, metilfoszfonsav só | 404-750-3 | 119415-07-5 | Acute
Tox. 4 * Skin Corr. 1B Aquatic Chronic 2 |
H302 H314 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H411 |
CLP00 | |||
| 612-118-00-5 | A reaction mass of: (1,3-dioxo-2H-benz(de)isoquinolin-2-ylpropyl)hexadecyldimethylammonium 4-toluenesulfonate; (1,3-dioxo-2H-benz(de)isoquinolin-2-ylpropyl)hexadecyldimethylammonium bromide | (1,3-dioxo-2H-benz(de)izokinolin-2-ilpropil)hexadecildimetilammónium-4-toluolszulfonát és (1,3-dioxo-2H-benz(de)izokinolin-2-ilpropil)hexadecildimetilammónium-bromid keveréke | 405-080-4 | Eye
Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
CLP00 | ||||
| 612-119-00-0 | benzyldimethyloctadecylammonium 3-nitrobenzenesulfonate | benzildimetiloktadecilammónium-3-nitrobenzolszulfonát | 405-330-2 | Skin
Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H400 H410 |
GHS05 GHS09 Dgr |
H315 H318 H410 |
CLP00 | ||||
| 612-120-00-6 | aclonifen (ISO); 2-chloro-6-nitro-3-phenoxyaniline | aklonifen
(ISO); 2-klór-6-nitro-3-fenoxianilin |
277-704-1 | 74070-46-5 | Carc.
2 Skin Sens. 1A Aquatic Acute 1 Aquatic Chronic 1 |
H351 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H317 H351 H410 |
M=100 M=10 |
CLP00/ATP05 | ||
| 612-121-00-1 | amines, polyethylenepoly-; HEPA | polietilén-poliaminok; HEPA | 268-626-9 | 68131-73-7 | Acute
Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H312 H302 H314 H317 H410 |
CLP00 | |||
| 612-122-00-7 | hydroxylamine ....% [> 55 % in aqueous solution] | hidroxilamin
…% [> 55 % vizes oldatban] |
232-259-2 | 7803-49-8 | Unst.
Expl. Met. Corr. 1 Carc. 2 Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 |
H200 H290 H351 H312 H302 H335 H373 ** H315 H318 H317 H400 |
GHS01 GHS05 GHS08 GHS07 GHS09 Dgr |
H200 H290 H351 H312 H302 H373 ** H335 H315 H318 H317 H400 |
B | CLP00/ATP01 | ||
| 612-122-01-4 | hydroxylamine ...% [≤ 55% in aqueous solution] | hidroxilamin …%, [≤ 55 % vizes oldatban] | 232-259-2 | 7803-49-8 | Met.
Corr. 1 Carc. 2 Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 |
H290 H351 H312 H302 H335 H373 ** H315 H318 H317 H400 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H290 H351 H312 H302 H373 ** H335 H315 H318 H317 H400 |
B | ATP01 | ||
| 612-123-00-2 | hydroxylammonium
chloride; hydroxylamine hydrochloride [1] bis(hydroxylammonium) sulfate; hydroxylamine sulfate (2:1) [2] |
hidroxilammónium-klorid;
hidroxilamin-hidroklorid; [1] bisz(hidroxilammónium)-szulfát; hidroxilamin-szulfát (2:1) [2] |
226-798-2
[1] 233-118-8 [2] |
5470-11-1
[1] 10039-54-0 [2] |
Met.
Corr. 1 Carc. 2 Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 |
H290 H351 H312 H302 H373 ** H315 H319 H317 H400 |
GHS05 GHS08 GHS07 GHS09 Wng |
H290 H351 H312 H302 H373 ** H319 H315 H317 H400 |
CLP00/ATP01 | |||
| 612-124-00-8 | N,N,N-trimethylanilinium chloride | N,N,N-trimetilanilínium-klorid | 205-319-0 | 138-24-9 | Acute
Tox. 3 * Acute Tox. 3 * |
H311 H301 |
GHS06 Dgr |
H311 H301 |
CLP00 | |||
| 612-125-00-3 | 2-methyl-p-phenylenediamine; 2,5-toluenediamine | 2-metil-p-feniléndiamin; 2,5-toluoldiamin |
202-442-1 | 95-70-5 | Acute
Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H301 H332 H312 H317 H411 |
GHS06 GHS09 Dgr |
H301 H332 H312 H317 H411 |
CLP00 | |||
| 612-126-00-9 | toluene-2,4-diammonium sulphate; 4-methyl-m-phenylenediamine sulfate | toluol-2,4-diammónium-szulfát; 4-metil-m-feniléndiamin-szulfát |
265-697-8 | 65321-67-7 | Carc.
1B Acute Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H350 H301 H312 H319 H317 H411 |
GHS06 GHS08 GHS09 Dgr |
H350 H301 H312 H319 H317 H411 |
CLP00 | |||
| 612-127-00-4 | 3-aminophenol | 3-aminofenol | 209-711-2 | 591-27-5 | Acute
Tox. 4 * Acute Tox. 4 * Aquatic Chronic 2 |
H332 H302 H411 |
GHS07 GHS09 Wng |
H332 H302 H411 |
CLP00 | |||
| 612-128-00-X | 4-aminophenol | 4-aminofenol | 204-616-2 | 123-30-8 | Muta.
2 Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H341 H332 H302 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H341 H332 H302 H410 |
CLP00 | |||
| 612-129-00-5 | diisopropylamine | diizopropilamin | 203-558-5 | 108-18-9 | Flam.
Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H225 H332 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H225 H332 H302 H314 |
STOT
SE 3; H335: C ≥ 5 % |
CLP00 | ||
| 612-130-00-0 | 2,6-diamino-3,5-diethyltoluene;
4,6-diethyl-2-methyl-1,3-benzenediamine [1] 2,4-diamino-3,5-diethyltoluene; 2,4-diethyl-6-methyl-1,3-benzenediamine [2] diethylmethylbenzenediamine [3] |
2,6-diamino-3,5-dietiltoluol; 4,6-dietil-2-metil-1,3-benzoldiamin; [1] 2,4-diamino-3,5-dietiltoluol; 2,4-dietil-6-metil-1,3-benzoldiamin; [2] dietilmetilbenzoldiamin [3] |
218-255-3
[1] 218-256-9 [2] 270-877-4 [3] |
2095-01-4
[1] 2095-02-5 [2] 68479-98-1 [3] |
Acute
Tox. 4 * Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H373 ** H319 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H312 H302 H373 ** H319 H410 |
C | CLP00 | ||
| 612-131-00-6 | didecyldimethylammonium chloride | didecildimetilammónium-klorid | 230-525-2 | 7173-51-5 | Acute
Tox. 4 * Skin Corr. 1B |
H302 H314 |
GHS05 GHS07 Dgr |
H302 H314 |
CLP00 | |||
| 612-132-00-1 | N,N'-diphenyl-p-phenylenediamine; N,N'-diphenyl-1,4-benzenediamine | N,
N’-difenil-p-feniléndiamin; N, N’-difenil-1,4-benzoldiamin; |
200-806-4 | 74-31-7 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
CLP00 | |||
| 612-133-00-7 | (4-ammonio-m-tolyl)ethyl(2-hydroxyethyl)ammonium sulphate; 4-(N-ethyl-N-2-hydroxyethyl)-2-methylphenylenediamine sulphate | (4-ammónio-m-tolil)etil(2-hidroxietil)ammónium-szulfát; 4-(N-etil-N-2-hidroxietil)-2-metilfeniléndiamin-szulfát |
247-162-0 | 25646-77-9 | Acute
Tox. 3 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H373 ** H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H301 H373 ** H317 H410 |
CLP00 | |||
| 612-134-00-2 | N-(2-(4-amino-N-ethyl-m-toluidino)ethyl)methanesulphonamide sesquisulphate; 4-(N-ethyl-N-2-methanesulphonylaminoethyl)-2-methylphenylenediamine sesquisulphate monohydrate | N-[2-(4-amino-N-etil-m-toluidino)etil]metánszulfonamid-szeszkviszulfát; 4-(N-etil-N-2-metánszulfonilaminoetil)-2-metilfeniléndiamin-szeszkviszulfát-monohidrát |
247-161-5 | 25646-71-3 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
CLP00 | |||
| 612-135-00-8 | N-2-naphthylaniline; N-phenyl-2-naphthylamine | N-2-naftilanilin; N-fenil-2-naftilamin |
205-223-9 | 135-88-6 | Carc.
2 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H351 H315 H319 H317 H411 |
GHS08 GHS07 GHS09 Wng |
H351 H319 H315 H317 H411 |
CLP00 | |||
| 612-136-00-3 | N-isopropyl-N'-phenyl-p-phenylenediamine | N-izopropil-N’-fenil-p-feniléndiamin | 202-969-7 | 101-72-4 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
Skin
Sens. 1; H317: C ≥ 0,1 % |
CLP00 | ||
| 612-137-00-9 | 4-chloroaniline | 4-klóranilin | 203-401-0 | 106-47-8 | Carc.
1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H331 H311 H301 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H311 H301 H317 H410 |
CLP00 | |||
| 612-138-00-4 | furalaxyl (ISO); methyl N-(2,6-dimethylphenyl)-N-(2-furylcarbonyl)-Dl-alaninate | furalaxil
(ISO); metil-N-(2,6-dimetilfenil)-N-(2-furilkarbonil)-DL-alaninát |
260-875-1 | 57646-30-7 | Acute
Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
CLP00 | |||
| 612-139-00-X | mefenacet (ISO); 2-(benzothiazol-2-yloxy)-N-methyl-N-phenylacetamide | mefenacet
(ISO); 2-(benzotiazol-2-iloxi)-N-metil-N-fenilacetamid |
277-328-8 | 73250-68-7 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 612-140-00-5 | quaternary ammonium compounds, benzyl-C8-18-alkyldimethyl, chlorides | kvaterner ammónium vegyületek, benzil-C8-18-alkildimetilammónium, kloridok | 264-151-6 | 63449-41-2 | Acute
Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Aquatic Acute 1 |
H312 H302 H314 H400 |
GHS05 GHS07 GHS09 Dgr |
H312 H302 H314 H400 |
CLP00 | |||
| 612-141-00-0 | 4,4'-methylenebis(2-ethylaniline); 4,4'-methylenebis(2-ethylbenzeneamine) | 4,4’-metilénbisz(2-etilanilin); 4,4’-metilénbisz(2-etilbenzolamin); |
243-420-1 | 19900-65-3 | Carc.
2 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H410 |
CLP00 | |||
| 612-142-00-6 | biphenyl-2-ylamine | bifenil-2-ilamin | 201-990-9 | 90-41-5 | Carc.
2 Acute Tox. 4 * Aquatic Chronic 3 |
H351 H302 H412 |
GHS08 GHS07 Wng |
H351 H302 H412 |
CLP00 | |||
| 612-143-00-1 | N5,N5-diethyltoluene-2,5-diamine monohydrochloride; 4-diethylamino-2-methylaniline monohydrochloride | N 5,N 5-dietiltoluol-2,5-diamin-monohidroklorid; 4-dietilamino-2-metilanilin-monohidroklorid |
218-130-3 | 2051-79-8 | Acute
Tox. 3 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H319 H317 H400 H410 |
GHS06 GHS09 Dgr |
H301 H319 H317 H410 |
CLP00 | |||
| 612-144-00-7 | flumetralin (ISO); N-(2-chloro-6-fluorobenzyl)-N-ethyl-α,α,α-trifluoro-2,6-dinitro-p-toluidine | flumetralin
(ISO); N-(2-klór-6-fluorbenzil)-N-etil-α, α,α-trifluor-2,6-dinitro-p-toluidin |
62924-70-3 | Skin
Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H319 H317 H400 H410 |
GHS07 GHS09 Wng |
H319 H315 H317 H410 |
CLP00 | ||||
| 612-145-00-2 | o-phenylenediamine | o-feniléndiamin | 202-430-6 | 95-54-5 | Carc.
2 Muta. 2 Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H341 H301 H332 H312 H319 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H341 H301 H332 H312 H319 H317 H410 |
CLP00 | |||
| 612-146-00-8 | o-phenylenediamine dihydrochloride | p-feniléndiamin-dihidroklorid | 210-418-7 | 615-28-1 | Carc.
2 Muta. 2 Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H341 H301 H332 H312 H319 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H341 H301 H332 H312 H319 H317 H410 |
CLP00 | |||
| 612-147-00-3 | m-phenylenediamine | m-feniléndiamin | 203-584-7 | 108-45-2 | Muta.
2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H341 H331 H311 H301 H319 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H341 H331 H311 H301 H319 H317 H410 |
CLP00 | |||
| 612-148-00-9 | m-phenylenediamine dihydrochloride | m-feniléndiamin-dihidroklorid | 208-790-0 | 541-69-5 | Muta.
2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H341 H331 H311 H301 H319 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H341 H331 H311 H301 H319 H317 H410 |
CLP00 | |||
| 612-149-00-4 | 1,3-diphenylguanidine | 1,3-difenilguanidin | 203-002-1 | 102-06-7 | Repr.
2 Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Aquatic Chronic 2 |
H361f
*** H302 H335 H315 H319 H411 |
GHS08 GHS07 GHS09 Wng |
H361f
*** H302 H319 H335 H315 H411 |
CLP00 | |||
| 612-150-00-X | spiroxamine (ISO); 8-tert-butyl-1,4-dioxaspiro[4.5]decan-2-ylmethyl(ethyl)(propyl)amine | spiroxamin
(ISO); 8-terc-butil-1,4-dioxaspiro[4.5]dekán-2-ilmetil(etil)(propil)amin |
118134-30-8 | Repr.
2 Acute Tox. 4 Acute Tox. 4 Acute Tox. 4 STOT RE 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361d H332 H312 H302 H373 (eye) H315 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H332 H312 H302 H315 H317 H361d H373 (eye) H410 |
M=100 M=100 |
CLP00/ATP10 | |||
| 612-151-00-5 | methyl-phenylene diamine; diaminotoluene; [technical product – reaction mass of 4-methyl-m-phenylene diamine (EC No 202-453-1) and 2-methyl-m-phenylene diamine (EC No 212-513-9)] | metil-feniléndiamin; diaminotoluol; [technológiai termék – 4-metil-m-feniléndiamin (EK-szám 202-453-1) és 2-metil-m-feniléndiamin (EK-szám 212-513-9) keveréke] |
- | - | Carc.
1B Muta. 2 Repr. 2 Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H350 H341 H361f *** H301 H312 H373 ** H319 H317 H411 |
GHS06 GHS08 GHS09 Dgr |
H350 H341 H361f *** H301 H312 H373 ** H319 H317 H411 |
CLP00/ATP01 | |||
| 612-152-00-0 | N,N-diethyl-N',N'-dimethylpropan-1,3-diyl-diamine | N, N-dietil-N’,N’-dimetilpropán-1,3-diildiamin | 406-610-7 | 62478-82-4 | Flam.
Liq. 3 Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1A Aquatic Chronic 3 |
H226 H332 H302 H373 ** H314 H412 |
GHS02 GHS08 GHS05 GHS07 Dgr |
H226 H332 H302 H373 ** H314 H412 |
CLP00 | |||
| 612-153-00-6 | 4-[N-ethyl-N-(2-hydroxyethyl)amino]-1-(2-hydroxyethyl)amino-2-nitrobenzene, monohydrochloride | 4-[N-etil-N-(2-hidroxietil)amino]-1-(2-hidroxietil)amino-2-nitrobenzol, monohidroklorid | 407-020-2 | 132885-85-9 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Chronic 3 |
H302 H317 H412 |
GHS07 Wng |
H302 H317 H412 |
CLP00 | |||
| 612-154-00-1 | 6'-(isobutylethylamino)-3'-methyl-2'-phenylamino-spiro[isobenzo-2-oxofuran-7,9'-[9H]-xanthene] | 6’-(izobutiletilamino)-3’-metil-2’-fenilamino-spiro[izobenzo-2-oxofurán-7,9’-[9H]-xantén] | 410-890-6 | 95235-29-3 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 612-155-00-7 | 2'-anilino-6'-((3-ethoxypropyl)ethylamino)-3'-methylspiro(isobenzo-3-oxofuran)-1-(1H)-9'-xanthene | 2’-anilino-6’-[(3-etoxipropil)etilamino]-3’-metilspiro(izobenzo-3-oxofurán)-1-(1H)-9'-xantén | 411-730-8 | 93071-94-4 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 612-156-00-2 | reaction mass of: trihexadecylmethylammonium chloride; dihexadecyldimethylammonium chloride | trihexadecilmetilammónium-klorid; dihexadecildimetilammónium-klorid keveréke | 405-620-9 | Eye
Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
CLP00 | ||||
| 612-157-00-8 | (Z)-1-benzo[b]thien-2-ylethanone oxime hydrochloride | (Z)-1-benzo[b]tién-2-iletanon-oxim-hidroklorid | 410-780-8 | Acute
Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H302 H373 ** H318 H317 H411 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H302 H373 ** H318 H317 H411 |
CLP00 | ||||
| 612-158-00-3 | reaction mass of: bis(5-dodecyl-2-hydroxybenzald-oximate) copper (II) C12-alkyl group is branched; 4-dodecylsalicylaldoxime | bisz(5-dodecil-2-hidroxibenzaldoximát)-réz(II)
(elágazó C12-alkil láncú); 4-dodecilszalicilaldoxim keveréke |
410-820-4 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | |||||
| 612-159-00-9 | Reaction products of: trimethylhexamethylene diamine (a mixture of 2,2,4-trimethyl-1,6-hexanediamine and 2,4,4-trimethyl-1,6-hexanediamine, EINECS listed), Epoxide 8 (mono[(C10-C16-alkyloxy)methyl]oxirane derivatives) and p-toluene-sulfonic acid | trimetilhexametilén-diamin (2,2,4-trimetil-1,6-hexándiamin és 2,4,4-trimetil-1,6-hexándiamin keveréke, EINECS-ben listázott), epoxid-8-(mono[(C10-C16-alkiloxi)metil]oxirán származékok) és p-toluolszulfonsav reakciótermékei | 410-880-1 | Acute
Tox. 4 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H302 H314 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H410 |
CLP00 | ||||
| 612-160-00-4 | p-toluidine;
4-aminotoluene [1] toluidinium chloride [2] toluidine sulphate (1:1) [3] |
p-toluidin; 4-aminotoluol; [1] toluidinium-klorid; [2] toluidin-szulfát (1:1) [3] |
203-403-1
[1] 208-740-8 [2] 208-741-3 [3] |
106-49-0
[1] 540-23-8 [2] 540-25-0 [3] |
Carc.
2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 |
H351 H331 H311 H301 H319 H317 H400 |
GHS06 GHS08 GHS09 Dgr |
H351 H331 H311 H301 H319 H317 H400 |
CLP00 | |||
| 612-161-00-X | 2,6-xylidine; 2,6-dimethylaniline | 2,6-xilidin; 2,6-dimetilanilin |
201-758-7 | 87-62-7 | Carc.
2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Aquatic Chronic 2 |
H351 H332 H312 H302 H335 H315 H411 |
GHS08 GHS07 GHS09 Wng |
H351 H332 H312 H302 H335 H315 H411 |
CLP00 | |||
| 612-162-00-5 | dimethyldioctadecylammonium chloride; DODMAC | dimetildioktadecilammónium-klorid; DODMAC |
203-508-2 | 107-64-2 | Eye
Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
CLP00 | |||
| 612-163-00-0 | metalaxyl-M (ISO); mefenoxam; (R)-2-[(2,6-dimethylphenyl)-methoxyacetylamino]propionic acid methyl ester | metalaxil-M
(ISO); mefenoxam; (R)-2-[(2,6-dimetilfenil)-metoxiacetilamino]propionsav-metil-észter |
70630-17-0 | Acute
Tox. 4 * Eye Dam. 1 |
H302 H318 |
GHS05 GHS07 Dgr |
H302 H318 |
CLP00 | ||||
| 612-164-00-6 | 2-butyl-2-ethyl-1,5-diaminopentane | 2-butil-2-etil-1,5-diaminopentán | 412-700-7 | 137605-95-9 | Acute
Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H312 H302 H373 ** H314 H317 H412 |
GHS08 GHS05 GHS07 Dgr |
H312 H302 H373 ** H314 H317 H412 |
CLP00 | |||
| 612-165-00-1 | N,N'-diphenyl-N,N'-bis(3-methylphenyl)-(1,1'-diphenyl)-4,4'-diamine | N,N'-difenil-N,N'-bisz(3-metilfenil)-(1,1'-difenil)-4,4'-diamin | 413-810-8 | 65181-78-4 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 612-166-00-7 | reaction mass of: cis-(5-ammonium-1,3,3-trimethyl)-cyclohexanemethylammonium phosphate (1:1); trans-(5-ammonium-1,3,3-trimethyl)-cyclohexanemethylammonium phosphate (1:1) | cisz-(5-ammónium-1,3,3-trimetil)-ciklohexánmetilammónium-foszfát
(1:1); transz-(5-ammónium-1,3,3-trimetil)-ciklohexánmetilammónium-foszfát (1:1) keveréke |
411-830-1 | 114765-88-7 | Eye
Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
CLP00 | |||
| 612-167-00-2 | 5-acetyl-3-amino-10,11-dihydro-5H-dibenz[b,f]azepine-hydrochloride | 5-acetil-3-amino-10,11-dihidro-5H-dibenz[b, f]azepin-hidroklorid | 410-490-1 | Acute
Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H302 H373 ** H318 H317 H411 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H302 H373 ** H318 H317 H411 |
CLP00 | ||||
| 612-168-00-8 | 3,5-dichloro-2,6-difluoropyrdine-4-amine | 3,5-diklór-2,6-difluorpiridin-4-amin | 220-630-1 | 2840-00-8 | Acute
Tox. 4 * Acute Tox. 4 * Aquatic Chronic 2 |
H312 H302 H411 |
GHS07 GHS09 Wng |
H312 H302 H411 |
CLP00 | |||
| 612-169-00-3 | bis(N-methyl-N-phenylhydrazine)sulfate | bisz(N-metil-N-fenilhidrazin)szulfát | 423-170-1 | 618-26-8 | Flam.
Liq. 2 Acute Tox. 4 * STOT RE 1 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H225 H302 H372 ** H318 H317 H400 H410 |
GHS02 GHS05 GHS08 GHS07 GHS09 Dgr |
H225 H372 ** H302 H318 H317 H410 |
ATP01 | |||
| 612-170-00-9 | 4-chlorophenyl cyclopropyl ketone O-(4-aminobenzyl)oxime | 4-klórfenil-ciklopropil-keton-O-(4-aminobenzil)oxim | 405-260-2 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
CLP00 | ||||
| 612-171-00-4 | N,N,N',N'-tetraglycidyl-4,4'-diamino-3,3'-diethyldiphenylmethane | N,N,N',N'-tetraglicidil-4,4'-diamino-3,3'-dietildifenilmetán | 410-060-3 | 130728-76-6 | Muta.
2 Skin Sens. 1 Aquatic Chronic 2 |
H341 H317 H411 |
GHS08 GHS09 Wng |
H341 H317 H411 |
CLP00 | |||
| 612-172-00-X | 4,4'-methylenebis(N,N'-dimethylcyclohexanamine | 4,4’-metilénbisz(N,N'-dimetilciklohexánamin) | 412-840-9 | 13474-64-1 | Acute
Tox. 4 * STOT RE 2 * Skin Corr. 1A Aquatic Chronic 3 |
H302 H373 ** H314 H412 |
GHS08 GHS05 GHS07 Dgr |
H302 H373 ** H314 H412 |
CLP00 | |||
| 612-173-00-5 | lithium 1-amino-4-(4-tert-butylanilino)anthraquinone-2-sulfonate | lítium-1-amino-4-(4-terc-butilanilino)antrakinon-2-szulfonát | 411-140-0 | 125328-86-1 | Eye
Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H411 |
CLP00 | |||
| 612-174-00-0 | 4,4-dimethoxybutylamine | 4,4-dimetoxibutil-amin | 407-690-6 | 19060-15-2 | Acute
Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H302 H314 H317 H412 |
GHS05 GHS07 Dgr |
H302 H314 H317 H412 |
CLP00 | |||
| 612-175-00-6 | 2-(O-aminooxy)ethylamine dihydrochloride | 2-(O-aminooxi)etilamin-dihidroklorid | 412-310-7 | 37866-45-8 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
CLP00 | |||
| 612-176-00-1 | Polymer of 1,3-dibromopropane and N,N-diethyl-N',N'-dimethyl-1,3-propanediamine | 1,3-dibrómpropán és N,N-dietil-N',N'-dimetil-1,3-propándiamin polimerje | 410-570-6 | 143747-73-3 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 612-177-00-7 | 2-naphthylamino-6-sulfomethylamide | 2-naftilamino-6-szulfometilamid | 412-120-4 | 104295-55-8 | STOT
RE 2 * Skin Sens. 1 Aquatic Chronic 2 |
H373
** H317 H411 |
GHS08 GHS09 Wng |
H373
** H317 H411 |
CLP00 | |||
| 612-178-00-2 | 1,4,7,10-tetraazacyclododecane disulfate | 1,4,7,10-tetraazaciklododekán-diszulfát | 412-080-8 | 112193-77-8 | Acute
Tox. 4 * STOT SE 3 Eye Dam. 1 Aquatic Chronic 3 |
H302 H335 H318 H412 |
GHS05 GHS07 Dgr |
H302 H335 H318 H412 |
CLP00 | |||
| 612-179-00-8 | 1-(2-propenyl)pyridinium chloride | 1-(2-propenil)piridinium-klorid | 412-740-5 | 25965-81-5 | Acute
Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
CLP00 | |||
| 612-180-00-3 | 3-aminobenzylamine | 3-aminobenzilamin | 412-230-2 | 4403-70-7 | Acute
Tox. 4 * Skin Corr. 1B Aquatic Chronic 2 |
H302 H314 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H411 |
CLP00 | |||
| 612-181-00-9 | 2-phenylthioaniline | 2-feniltioanilin | 413-030-8 | 1134-94-7 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | |||
| 612-182-00-4 | 1-ethyl-1-methylmorpholinium bromide | 1-etil-1-metilmorfolínium-bromid | 418-250-8 | 65756-41-4 | Muta.
2 |
H341 |
GHS08 Wng |
H341 |
CLP00 | |||
| 612-183-00-X | 1-ethyl-1-methylpyrrolidinium bromide | 1-etil-1-metilpirrolidinium-bromid | 418-200-5 | 69227-51-6 | Muta.
2 |
H341 |
GHS08 Wng |
H341 |
CLP00 | |||
| 612-184-00-5 | 6'-(dibutylamino)-3'-methyl-2'-(phenylamino)spiro[isobenzofuran-1(3H),9-(9H)-xanthen]-3-one | 6’-(dibutilamino)3’-metil-2’-(fenilamino)spiro[izobenzofurán-1(3H),9-(9H)xantén]-3-on | 403-830-5 | 89331-94-2 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | ||||
| 612-185-00-0 | 1-[3-[4-((heptadecafluorononyl)oxy)-benzamido]propyl]-N,N,N-trimethylammonium iodide | 1-[3-[4-((heptadekafluornonil)oxi)benzamido]propil]-N, N,N-trimetilammónium-jodid | 407-400-8 | 59493-72-0 | Eye
Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
CLP00 | |||
| 612-186-00-6 | bis(N-(7-hydroxy-8-methyl-5-phenylphenazin-3-ylidene)dimethylammonium) sulfate | bisz(N-(7-hidroxi-8-metil-5-fenilfenazin-3-ilidén)dimetilammónium)-szulfát | 406-770-8 | 149057-64-7 | STOT
RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373
** H318 H317 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H373
** H318 H317 H410 |
CLP00 | |||
| 612-187-00-1 | 2,3,4-trifluoroaniline | 2,3,4-trifluoranilin | 407-170-9 | 3862-73-5 | Acute
Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 2 |
H312 H302 H373 ** H315 H318 H411 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H312 H302 H373 ** H315 H318 H411 |
CLP00 | |||
| 612-188-00-7 | 4,4'-(9H-fluoren-9-ylidene)bis(2-chloroaniline) | 4,4’-(9H-fluorén-9-ilidén)bisz(2-klóranilin) | 407-560-9 | 107934-68-9 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 612-189-00-2 | 4-amino-2-(aminomethyl)phenol dihydrochloride | 4-amino-2-(aminometil)fenol-dihidroklorid | 412-510-4 | 135043-64-0 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
CLP00 | |||
| 612-190-00-8 | 4,4'-methylenebis(2-isopropyl-6-methylaniline) | 4,4’-metilénbisz(2-izopropil-6-metilanilin) | 415-150-6 | 16298-38-7 | STOT
RE 2 * Aquatic Chronic 2 |
H373
** H411 |
GHS08 GHS09 Wng |
H373
** H411 |
CLP00 | |||
| 612-191-00-3 | Polymer of allylamine hydrochloride | allilamin-hidroklorid polimer | 415-050-2 | 71550-12-4 | Acute
Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
CLP00 | |||
| 612-192-00-9 | 2-isopropyl-4-(N-methyl)aminomethylthiazole | 2-izopropil-4-(N-metil)aminometiltiazol | 414-800-6 | 154212-60-9 | Acute
Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 2 |
H312 H302 H315 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H312 H302 H315 H318 H411 |
CLP00 | |||
| 612-193-00-4 | 3-methylaminomethylphenylamine | 3-metilaminometilfenilamin | 414-570-7 | 18759-96-1 | Acute
Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H312 H302 H314 H317 H410 |
CLP00 | |||
| 612-194-00-X | 2-hydroxy-3-[(2-hydroxyethyl)-[2-(1-oxotetradecyl)amino]ethyl]amino]-N,N,N-trimethyl-1-propanammonium chloride | 2-hidroxi-3-[(2-hidroxietil)-[2-(1-oxotetradecil)amino]etil]amino]-N,N,N-trimetil-1-propánammónium-klorid | 414-670-0 | 141890-30-4 | Acute
Tox. 4 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H410 |
CLP00 | |||
| 612-195-00-5 | bis[tributyl 4-(methylbenzyl)ammonium] 1,5-naphthalenedisulfonate | bisz[tributil-4-(metilbenzil)ammónium)-1,5-naftalindiszulfonát | 415-210-1 | 160236-81-7 | Acute
Tox. 4 * Acute Tox. 4 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H332 H302 H318 H410 |
CLP00 | |||
| 612-196-00-0 | 4-chloro-o-toluidine
[1] 4-chloro-o-toluidine hydrochloride [2] |
4-klór-o-toluidin;
[1] 4-klór-o-toluidin-hidroklorid [2] |
202-441-6
[1] 221-627-8 [2] |
95-69-2
[1] 3165-93-3 [2] |
Carc.
1B Muta. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H341 H331 H311 H301 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H341 H331 H311 H301 H410 |
CLP00 | |||
| 612-197-00-6 | 2,4,5-trimethylaniline
[1] 2,4,5-trimethylaniline hydrochloride [2] |
2,4,5-trimetilanilin;
[1] 2,4,5-trimetilanilin-hidroklorid [2] |
205-282-0
[1] |
137-17-7
[1] 21436-97-5 [2] |
Carc.
1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Chronic 2 |
H350 H331 H311 H301 H411 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H311 H301 H411 |
CLP00 | |||
| 612-198-00-1 | 4,4'-thiodianiline and its salts | 4,4’-tiodianilin és sói | 205-370-9 | 139-65-1 | Carc.
1B Acute Tox. 4 * Aquatic Chronic 2 |
H350 H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H411 |
CLP00 | |||
| 612-199-00-7 | 4,4'-oxydianiline and its salts; p-aminophenyl ether | 4,4’-oxidianilin
és sói; p-aminofenil-éter |
202-977-0 | 101-80-4 | Carc.
1B Muta. 1B Repr. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Chronic 2 |
H350 H340 H361f *** H331 H311 H301 H411 |
GHS06 GHS08 GHS09 Dgr |
H350 H340 H361f *** H331 H311 H301 H411 |
CLP00 | |||
| 612-200-00-0 | 2,4-diaminoanisole;
4-methoxy-m-phenylenediamine [1] 2,4-diaminoanisole sulphate [2] |
2,4-diaminoanizol; 4-metoxi-m-feniléndiamin; m-feniléndiamin; [1] 2,4-diaminoanizol-szulfát [2] |
210-406-1
[1] 254-323-9 [2] |
615-05-4
[1] 39156-41-7 [2] |
Carc.
1B Muta. 2 Acute Tox. 4 * Aquatic Chronic 2 |
H350 H341 H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H350 H341 H302 H411 |
CLP00 | |||
| 612-201-00-6 | N,N,N',N'-tetramethyl-4,4'-methylendianiline | N,N,N',N'-tetrametil-4,4'-metiléndianilin | 202-959-2 | 101-61-1 | Carc.
1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H400 H410 |
GHS08 GHS09 Dgr |
H350 H410 |
CLP00 | |||
| 612-202-00-1 | 3,4-dichloroaniline | 3,4-diklóranilin | 202-448-4 | 95-76-1 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H318 H317 H400 H410 |
GHS06 GHS05 GHS09 Dgr |
H331 H311 H301 H318 H317 H410 |
CLP00 | |||
| 612-203-00-7 | C8-10 alkyl dimethyl hydroxyethyl ammoniumchloride (chain < C8: <3%, chain = C8: 15%-70%, chain = C10: 30%-85%, chain > C10: <3%) | dimetil-(hidroxietil)-(C8-10-alkil)ammónium-klorid (lánchossz < C8: <3 %; lánchossz = C8: 15-70 %; lánchossz = C10: 30-85 %; lánchossz > C10: <3 %) | 417-360-3 | - | Acute
Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 |
H312 H302 H315 |
GHS07 Wng |
H312 H302 H315 |
ATP01 | |||
| 612-204-00-2 | C.I. Basic Violet 3; 4-[4,4'-bis(dimethylamino) benzhydrylidene]cyclohexa-2,5-dien-1-ylidene]dimethylammonium chloride | C.I.
Basic Violet 3; 4-[4,4’-bisz(dimetilamino)benzhidrilidén]ciklohexa-2,5-dién-1-ilidén]dimetilammónium-klorid |
208-953-6 | 548-62-9 | Carc.
2 Acute Tox. 4 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H318 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H351 H302 H318 H410 |
CLP00 | |||
| 612-205-00-8 | C.I. Basic Violet 3 with ≥ 0.1 % of Michler's ketone (EC no. 202-027-5) | C.I. Basic Violet 3 ≥ 0,1 % Michler-féle ketonnal (EK-szám 202-027-5) | 208-953-6 | 548-62-9 | Carc.
1B Acute Tox. 4 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H318 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H350 H302 H318 H410 |
CLP00 | |||
| 612-206-00-3 | famoxadone (ISO); 3-anilino-5-methyl-5-(4-phenoxyphenyl)-1,3-oxazolidine-2,4-dione | famoxadon
(ISO); 3-anilino-5-metil-5-(4-fenoxifenil)-1,3-oxazolidin-2,4-dion |
131807-57-3 | STOT
RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H373
** H400 H410 |
GHS08 GHS09 Wng |
H373
** H410 |
CLP00 | ||||
| 612-207-00-9 | 4-ethoxyaniline; p-phenetidine | 4-etoxianilin; p-fenetidin |
205-855-5 | 156-43-4 | Muta.
2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 |
H341 H332 H312 H302 H319 H317 |
GHS08 GHS07 Wng |
H341 H332 H312 H302 H319 H317 |
CLP00 | |||
| 612-208-00-4 | N-methylbenzene-1,2-diammonium hydrogen phosphate | N-metilbenzol-1,2-diammónium-hidrogénfoszfát | 424-460-0 | - | Acute
Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
ATP01 | |||
| 612-209-00-X | 6-methoxy-m-toluidine; p-cresidine | 6-metoxi-m-toluidin; p-krezidin |
204-419-1 | 120-71-8 | Carc.
1B Acute Tox. 4 * |
H350 H302 |
GHS08 GHS07 Dgr |
H350 H302 |
CLP00 | |||
| 612-210-00-5 | 5-nitro-o-toluidine
[1] 5-nitro-o-toluidine hydrochloride [2] |
5-nitro-o-toluidin;
[1] 5-nitro-o-toluidin-hidroklorid [2] |
202-765-8
[1] 256-960-8 [2] |
99-55-8
[1] 51085-52-0 [2] |
Carc.
2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Chronic 3 |
H351 H331 H311 H301 H412 |
GHS06 GHS08 Dgr |
H351 H331 H311 H301 H412 |
CLP00 | |||
| 612-211-00-0 | N-[(benzotriazole-1-yl)methyl)]-4-carboxybenzenesulfonamide | N-[(benzotriazol-1-il)metil)]-4-karboxibenzolszulfonamid | 416-470-9 | 170292-97-4 | Eye
Irrit. 2 Aquatic Chronic 2 |
H319 H411 |
GHS07 GHS09 Wng |
H319 H411 |
CLP00 | |||
| 612-212-00-6 | 2,6-dichloro-4-trifluoromethylaniline | 2,6-diklór-4-trifluormetilanilin | 416-430-0 | 24279-39-8 | Acute
Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H332 H302 H315 H317 H410 |
CLP00 | |||
| 612-213-00-1 | isobutylidene-(2-(2-isopropyl-4,4-dimethyloxazolidine-3-yl)-1,1-dimethylethyl)amine | izobutilidén-(2-(2-izopropil-4,4-dimetiloxazolidin-3-il)-1,1-dimetiletil)amin | 419-850-2 | 148348-13-4 | Skin
Corr. 1B Aquatic Chronic 3 |
H314 H412 |
GHS05 Dgr |
H314 H412 |
CLP00 | |||
| 612-214-00-7 | 4-(2,2-diphenylethenyl)-N,N-di-phenylbenzenamine | 4-(2,2-difeniletenil)-N,N-difenilbenzolamin | 421-390-2 | 89114-90-9 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 612-215-00-2 | 3-chloro-2-(isopropylthio)aniline | 3-klór-2-(izopropiltio)anilin | 421-700-6 | 179104-32-6 | Skin
Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
CLP00 | |||
| 612-216-00-8 | 1-amino-1-cyanamino-2,2-dicyanoethylene, sodium salt | 1-amino-1-ciánamino-2,2-dicianoetilén nátriumsója | 425-870-2 | 19450-38-5 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
ATP01 | |||
| 612-217-00-3 | 1-methoxy-2-propylamine | 1-metoxi-2-propilamin | 422-550-4 | 37143-54-7 | Flam.
Liq. 2 Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 3 |
H225 H302 H314 H412 |
GHS02 GHS05 GHS07 Dgr |
H225 H314 H302 H412 |
CLP00 | |||
| 612-219-00-4 | (2-hydroxy-3-(3,4-dimethyl-9-oxo-10-thiaanthracen-2-yloxy)propyl)trimethylammonium chloride | (2-hidroxi-3-(3,4-dimetil-9-oxo-10-tiaantracén-2-il-oxi)propil)trimetilammónium-klorid | 402-200-7 | - | Aquatic
Chronic 3 |
H412 |
- |
H412 |
ATP01 | |||
| 612-220-00-X | N-nitro-N-(3-methyl-3,6-dihydro-2H-1,3,5-oxadiazin-4-yl)amine | N-nitro-N-(3-metil-3,6-dihidro-2H-1,3,5-oxadiazin-4-il)amin | 431-060-1 | 153719-38-1 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Chronic 3 |
H302 H317 H412 |
GHS07 Wng |
H302 H317 H412 |
ATP01 | |||
| 612-221-00-5 | 2-amino-4-(trifluoromethyl)benzenethiol hydrochloride | 2-amino-4-(trifluormetil)benzoltiol-hidroklorid | 429-560-8 | 4274-38-8 | Acute
Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 |
H332 H312 H302 H373 ** H314 H317 H400 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H314 H332 H312 H302 H373 ** H317 H400 |
ATP01 | |||
| 612-222-00-0 | cis-1-(3-(4-fluorophenoxy)propyl)-3-methoxy-4-piperidinamine | cisz-1-(3-(4-fluorfenoxi)propil)-3-metoxi-4-piperidinamin | 425-080-8 | 104860-26-6 | Acute
Tox. 4 * Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H373 ** H318 H400 H410 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H312 H302 H373 ** H318 H410 |
ATP01 | |||
| 612-223-00-6 | N-benzyl-N-ethyl-(4-(5-nitro-benzo[c]isothiazol-3-ylazo)phenyl)amine | N-benzil-N-etil-(4-(5-nitrobenzo[c]izotiazol-3-il-azo)fenil)amin | 425-300-2 | 186450-73-7 | Skin
Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
ATP01 | |||
| 612-224-00-1 | N2,N4,N6-tris{4-[(1,4-dimethylpentyl)amino]phenyl}-1,3,5-triazine-2,4,6-triamine | N2,N4,N6-trisz{4-[(1,4-dimetilpentil)amino]fenil}-1,3,5-triazin-2,4,6-triamin | 426-150-0 | 121246-28-4 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
ATP01 | |||
| 612-225-00-7 | 1,4,7,10-tetraazacyclododecane | 1,4,7,10-tetraazaciklododekán | 425-450-9 | 294-90-6 | Acute
Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H314 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H314 H312 H302 H410 |
ATP01 | |||
| 612-226-00-2 | 3-(2'-phenoxyethoxy)propylamine | 3-(2'-fenoxietoxi)propilamin | 427-870-8 | 6903-18-0 | Acute
Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H302 H315 H318 H412 |
GHS05 GHS07 Dgr |
H302 H315 H318 H412 |
ATP01 | |||
| 612-227-00-8 | benzyl-N-(2-(2-methoxyphenoxy)ethyl)amine hydrochloride | benzil-N-(2-(2-metoxifenoxi)etil)amin-hidroklorid | 428-290-8 | 120606-08-8 | Acute
Tox. 4 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H410 |
ATP01 | |||
| 612-228-00-3 | reaction mass of: N-(3-(trimethoxysilyl)propyl)ethylenediamine; N-benzyl-N-(3-(trimethoxysilyl)propyl)ethylenediamine; N-benzyl-N'-[3-(trimethoxysilyl)propyl]ethylenediamine; N,N'-bis-benzyl-N'-[3-(trimethoxysilyl)propyl]ethylenediamine; N,N,N'-tris-benzyl-N'-[3-(trimethoxysilyl)propyl]ethylenediamine; N,N-bis-benzyl-N'-[3-(trimethoxysilyl)propyl]ethylenediamine | a
következő anyagok keveréke: N-(3-(trimetoxiszilil)propil)etiléndiamin; N-benzil-N-(3-(trimetoxiszilil)propil)etiléndiamin; N-benzil-N'-[3-(trimetoxiszilil)propil]etiléndiamin; N, N'-bisz-benzil-N'-[3-(trimetoxiszilil)propil]etiléndiamin; N, N,N'-trisz-benzil-N'-[3-(trimetoxiszilil)propil]etiléndiamin; N, N-bisz-benzil-N'-[3-(trimetoxiszilil)-propil]etiléndiamin |
414-340-6 | - | Flam.
Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT SE 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H226 H332 H312 H302 H371 H318 H317 H412 |
GHS02 GHS05 GHS08 GHS07 Dgr |
H226 H332 H312 H302 H371 H318 H317 H412 |
ATP01 | |||
| 612-229-00-9 | mepanipyrim; 4-methyl-N-phenyl-6-(1-propynyl)-2-pyrimidinamine | mepanipirim; 4-metil-N-fenil-6-(1-propinil)-2-pirimidinamin |
- | 110235-47-7 | Carc.
2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
ATP01 | |||
| 612-230-00-4 | N,N-bis(cocoyl-2-oxypropyl)-N,N-dibutylammonium bromide | N,N-bisz(kokoil-2-oxipropil)-N,N-dibutilammónium-bromid | 431-530-4 | - | Skin
Corr. 1A Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H410 |
ATP01 | |||
| 612-231-00-X | 3-((C12-18)-acylamino)-N-(2-((2-hydroxyethyl)amino)-2-oxoethyl)-N,N-dimethyl-1-propanaminium chloride | 3-((C12-18)-acilamino)-N-(2-((2-hidroxietil)amino)-2-oxoetil)-N,N-dimetil-1-propánaminium-klorid | 427-370-1 | 164288-56-6 | Eye
Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
ATP01 | |||
| 612-232-00-5 | reaction mass of: triisopropanolamine salt of 1-amino-4-(3-propionamidoanilino)anthraquinone-2-sulfonic acid; triisopropanolamine salt of 1-amino-4-[3,4-dimethyl-5-(2-hydroxyethylaminosulfonyl)anilino]anthraquinone-2-sulfonic acid | 1-amino-4-(3-propionamidoanilino)antrakinon-2-szulfonsav triizopropanolamin só; 1-amino-4-[3,4-dimetil-5-(2-hidroxietilaminoszulfonil)anilino]antrakinon-2-szulfonsav triizopropanolamin só keveréke | 430-410-9 | 186148-38-9 | Aquatic
Chronic 3 |
H412 |
- |
H412 |
ATP01 | |||
| 612-237-00-2 | hydroxylammonium
hydrogensulfate; hydroxylamine sulfate(1:1) [1] hydroxylamine phosphate [2] hydroxylamine dihydrogenphosphate [3] hydroxylamine 4-methylbenzenesulfonate [4] |
hidroxilammónium-hidrogénszulfát; hidroxilamin-szulfát (1:1); [1] hidroxilamin-foszfát; [2] hidroxilamin-dihidrogénfoszfát; [3] hidroxilamin-4-metilbenzolszulfonát [4] |
233-154-4
[1] 244-077-0 [2] 242-818-2 [3] 258-872-5 [4] |
10046-00-1
[1] 20845-01-6 [2] 19098-16-9 [3] 53933-48-5 [4] |
Expl.
1.1 Carc. 2 Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 |
H201 H351 H312 H302 H373 ** H315 H319 H317 H400 |
GHS01 GHS08 GHS07 GHS09 Dgr |
H201 H302 H312 H315 H319 H317 H351 H373 ** H400 |
T | ATP01/ATP01corr | ||
| 612-238-00-8 | (3-chloro-2-hydroxypropyl) trimethylammonium chloride ...% | (3-klór-2-hidroxipropil)trimetilamónium-klorid …% |
222-048-3 | 3327-22-8 | Carc.
2 Aquatic Chronic 3 |
H351 H412 |
GHS08 Wng |
H351 H412 |
B | ATP01 | ||
| 612-239-00-3 | biphenyl-3,3',4,4'-tetrayltetraamine; diaminobenzidine | bifenil-3,3',4,4'-tetrail-tetraamin; diaminobenzidin |
202-110-6 | 91-95-2 | Carc.
1B Muta. 2 |
H350 H341 |
GHS08 Dgr |
H350 H341 |
ATP01 | |||
| 612-240-00-9 | pyrimethanil (ISO); N-(4,6-dimethylpyrimidin-2-yl)aniline | pirimetanil
(ISO); N-(4,6-dimetilpirimidin-2-il)anilin |
- | 53112-28-0 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
ATP01 | |||
| 612-241-00-4 | piperazine
hydrochloride [1] piperazine dihydrochloride [2] piperazine phosphate [3] |
piperazin-hidroklorid; [1] piperazin-dihidroklorid; [2] piperazin-foszfát [3] | 228-042-7
[1] 205-551-2 [2] 217-775-8 [3] |
6094-40-2
[1] 142-64-3 [2] 1951-97-9 [3] |
Repr.
2 Skin Irrit. 2 Eye Irrit. 2 Resp. Sens. 1 Skin Sens. 1 Aquatic Chronic 3 |
H361fd H315 H319 H334 H317 H412 |
GHS08 Dgr |
H361fd H319 H315 H334 H317 H412 |
ATP01 | |||
| 612-242-00-X | cyprodinil (ISO); 4-cyclopropyl-6-methyl-N-phenylpyrimidin-2-amine | ciprodinil
(ISO); 4-ciklopropil-6-metil-N-fenilpirimidin-2-amin |
- | 121552-61-2 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
M=10 |
ATP01 | ||
| 612-243-00-5 | (1S-cis)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-N-methyl-1-naphthalenamine 2-hydroxy-2-phenylacetate | (1S-cisz)-4-(3,4-diklórfenil)1,2,3,4-tetrahidro-N-metil-1-naftalinamin-2-hidroxi-2-fenilacetát | 420-560-3 | 79617-97-3 | Eye
Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
M=10 |
ATP01 | ||
| 612-244-00-0 | 3-(piperazin-1-yl)-benzo[d]isothiazole hydrochloride | 3-(piperazin-1-il)-benzo[d]izotiazol-hidroklorid | 421-310-6 | 87691-88-1 | Repr.
2 Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361f
*** H302 H319 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361f
*** H302 H319 H317 H410 |
ATP01 | |||
| 612-245-00-6 | 2-ethylphenylhydrazine hydrochloride | 2-etilfenilhidrazin-hidroklorid | 421-460-2 | 19398-06-2 | Carc.
2 Acute Tox. 4 * STOT RE 1 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H372 ** H318 H317 H400 H410 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H351 H372 ** H302 H318 H317 H410 |
M=10 |
ATP01 | ||
| 612-246-00-1 | (2-chloroethyl)(3-hydroxypropyl)ammonium chloride | (2-klóretil)(3-hidroxipropil)ammónium-klorid | 429-740-6 | 40722-80-3 | Carc.
1B Muta. 1B STOT RE 2 * Skin Sens. 1 Aquatic Chronic 3 |
H350 H340 H373 ** H317 H412 |
GHS08 GHS07 Dgr |
H350 H340 H373 ** H317 H412 |
ATP01 | |||
| 612-247-00-7 | N-[3-(1,1-dimethylethyl)-1H-pyrazol-5-yl]-N'-hydroxy-4-nitrobenzenecarboximidamide | N-[3-(1,1-dimetiletil)-1H-pirazol-5-il]-N’-hidroxi-4-nitrobenzolkarboximidamid | 423-530-8 | 152828-23-4 | Acute
Tox. 4 * STOT RE 1 Aquatic Chronic 3 |
H302 H372 ** H412 |
GHS08 GHS07 Dgr |
H372
** H302 H412 |
ATP01 | |||
| 612-248-00-2 | reaction product of diphenylamine, phenothiazine, and alkenes, branched (C8-10, C9-rich) | difenilamin, fenotiazin és alkének, elágazó (C8-10, C9-ben gazdag) reakcióterméke | 439-540-0 | - | Skin
Irrit. 2 Skin Sens. 1 Aquatic Chronic 4 |
H315 H317 H413 |
GHS07 Wng |
H315 H317 H413 |
ATP01 | |||
| 612-249-00-8 | 4-[(3-chlorophenyl)(1H-imidazol-1-yl)methyl]-1,2-benzenediamine dihydrochloride | 4-[(3-klórfenil)(1H-imidazol-1-il)metil]-1,2-benzoldiamin-dihidroklorid | 425-030-5 | 159939-85-2 | Repr.
2 Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H361f
*** H302 H314 H317 H411 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H361f
*** H302 H314 H317 H411 |
ATP01 | |||
| 612-250-00-3 | chloro-N,N-dimethylformiminium chloride | klór-N, N-dimetilformiminium-klorid | 425-970-6 | 3724-43-4 | Repr.
1B Acute Tox. 4 * Skin Corr. 1A |
H360D
*** H302 H314 |
GHS05 GHS08 GHS07 Dgr |
H360D
*** H302 H314 |
EUH014 |
ATP01 | ||
| 612-251-00-9 | cis-1-(3-chloroallyl)-3,5,7-triaza-1-azoniaadamantane chloride | cisz-1-(3-klórallil)-3,5,7-triaza-1-azoniaadamantán-klorid | 426-020-3 | 51229-78-8 | Flam.
Sol. 2 Repr. 2 Acute Tox. 4 * Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H228 H361d *** H302 H315 H317 H411 |
GHS02 GHS08 GHS07 GHS09 Wng |
H228 H361d *** H302 H315 H317 H411 |
ATP01 | |||
| 612-252-00-4 | imidacloprid (ISO); 1-(6-chloropyridin-3-ylmethyl)-N-nitroimidazolidin-2-ylidenamine | imidakloprid
(ISO); 1-(6-klórpiridin-3-ilmetil)-N-nitroimidazolidin-2-ilidénamin |
428-040-8 | 138261-41-3 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
ATP01 | |||
| 612-253-00-X | 7-methoxy-6-(3-morpholin-4-yl-propoxy)-3H-quinazolin-4-one; [containing < 0.5 % formamide (EC No 200-842-0)] | 7-metoxi-6-(3-morfolin-4-ilpropoxi)-3H-kinazolin-4-on; [<0,5 % formamidot tartalmaz (EK-szám 200-842-0)] | 429-400-7 | 199327-61-2 | Aquatic
Chronic 3 |
H412 |
- |
H412 |
ATP01 | |||
| 612-253-01-7 | 7-methoxy-6-(3-morpholin-4-yl-propoxy)-3H-quinazolin-4-one; [containing ≥ 0.5 % formamide (EC No 200-842-0) ] | 7-metoxi-6-(3-morfolin-4-ilpropoxi)-3H-kinazolin-4-on; [≥0,5 % formamidot tartalmaz (EK-szám 200-842-0)] | 429-400-7 | 199327-61-2 | Repr.
1B Aquatic Chronic 3 |
H360D
*** H412 |
GHS08 Dgr |
H360D
*** H412 |
ATP01 | |||
| 612-254-00-5 | reaction products of diisopropanolamine with formaldehyde (1:4) | diizopropanolamin reakciótermékei formaldehiddel (1:4) | 432-440-8 | 220444-73-5 | Carc.
2 Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H351 H302 H314 H317 H411 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H351 H302 H314 H317 H411 |
ATP01 | |||
| 612-255-00-0 | 1-(3-methoxypropyl)-4-piperidinamine | 1-(3-metoxipropil)-4-piperidinamin | 431-950-8 | 179474-79-4 | Acute
Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 3 |
H312 H302 H314 H412 |
GHS05 GHS07 Dgr |
H312 H302 H314 H412 |
ATP01 | |||
| 612-256-00-6 | benzyl(S)-2-[(2'-cyanobiphenyl-4-ylmethyl)pentanoylamino]-3-methylbutyrate | benzil(S)-2-[(2'-cianobifenil-4-ilmetil)pentanoilamino]-3-metilbutirát | 427-470-3 | 137864-22-3 | Acute
Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
ATP01 | |||
| 612-257-00-1 | tripropylammonium dihydrogenphosphate | tripropilammónium-dihidrogén-foszfát | 433-700-3 | 35687-90-2 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
ATP01 | |||
| 612-259-00-2 | N-ethyl-3-trimethoxysilyl-2-methyl-propanamine | N-etil-3-trimetoxiszilil-2-metilpropánamin | 437-720-3 | 227085-51-0 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 612-261-00-3 | 3,5-dichloro-2-fluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)aniline | 3,5-diklór-2-fluor-4-(1,1,2,3,3,3-hexafluorpropoxi)anilin | 441-190-9 | 121451-05-6 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
M=10 |
ATP01 | ||
| 612-265-00-5 | bis(2-hydroxyethyl)-(2-hydroxypropyl)ammonium acetate | bisz(2-hidroxietil)-(2-hidroxipropil)ammónium-acetát | 444-360-0 | 191617-13-7 | Aquatic
Chronic 3 |
H412 |
- |
H412 |
ATP01 | |||
| 612-266-00-0 | 3-chloro-4-(3-fluorobenzyloxy)aniline | 3-klór-4-(3-fluorbenziloxi)anilin | 445-590-4 | 202197-26-0 | Muta.
2 Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H341 H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Wng |
H341 H302 H373 ** H410 |
ATP01 | |||
| 612-267-00-6 | bis(hydrogenated tallow C16-18-alkyl)hydroxylamine | bisz(hidrogénezett faggyú C16-18-alkil)hidroxilamin | 418-370-0 | - | Skin
Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
ATP01 | |||
| 612-269-00-7 | reaction mass of: 1-[di(4-octylphenyl)aminomethyl]-5-methyl-1H-benzotriazole; 1-[di(4-octylphenyl)aminomethyl]-4-methyl-1H-benzotriazole; reaction mass of: N-[(5-methyl-1H-benzotriazol-1-yl)methyl]-4-octyl-N-(4-octylphenyl)aniline; N-[(4-methyl-1H-benzotriazol-1-yl)methyl]-4-octyl-N-(4-octylphenyl)aniline | 1-[di(4-oktilfenil)aminometil]-5-metil-1H-benzotriazol; 1-[di(4-oktilfenil)aminometil]-4-metil-1H-benzotriazol keveréke N-[(5-metil-1H-benzotriazol-1-il)metil]-4-oktil-N-(4-oktilfenil)anilin; N-[(4-metil-1H-benzotriazol-1-il)metil]-4-oktil-N-(4-oktilfenil)anilin keveréke |
420-720-2 | - | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 612-270-00-2 | (S)-azetidine-2-carboxylic acid 4-cyanobenzylamide hydrochloride | (S)-azetidin-2-karboxilsav-4-cianobenzilamid-hidroklorid | 433-010-2 | - | Acute
Tox. 4 * Skin Sens. 1 Aquatic Chronic 3 |
H302 H317 H412 |
GHS07 Wng |
H302 H317 H412 |
ATP01 | |||
| 612-271-00-8 | reaction mass of: ethyl 2-((4-(5,6-dichlorobenzothiazol-2-ylazo)phenyl)ethylamino)benzoate; ethyl 2-((4-(6,7-dichlorobenzothiazol-2-ylazo)phenyl)ethylamino)benzoate | etil-2-((4-(5,6-diklórbenzotiazol-2-ilazo)fenil)etilamino)benzoát; etil-2-((4-(6,7-diklórbenzotiazol-2-ilazo)fenil)etilamino)benzoát keveréke |
434-970-5 | 160987-57-5 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 612-272-00-3 | ammonium (η-6-2-(2-(1,2-dicarboxylatoethylamino)ethylamino)butane-1,4-dioato(4-))iron(3+) monohydrate | ammónium-(η-6-2-(2-(1,2-dikarboxiláto-etilamino)etilamino)bután-1,4-dioát(4-))vas(3+)-monohidrát | 435-210-5 | - | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
ATP01 | |||
| 612-273-00-9 | alkyl(rapeseed oil), bis(2-hydroxyethyl)ammonium fluoride | alkil(repceolaj), bisz(2-hidroxietil)ammónium-fluorid | 435-650-8 | - | Acute
Tox. 4 * Skin Corr. 1A Aquatic Acute 1 Aquatic Chronic 1 |
H302 H314 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H410 |
ATP01 | |||
| 612-274-00-4 | (R,S)-1-[2-amino-1(4-methoxyphenyl)ethyl]cyclohexanol acetate | (R, S)-1-[2-amino-1(4-metoxifenil)etil]ciklohexanol-acetát | 445-750-3 | - | Acute
Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H302 H318 H317 H412 |
GHS05 GHS07 Dgr |
H302 H318 H317 H412 |
ATP01 | |||
| 612-275-00-X | fatty acids, C18-unsatd., dimers, reaction products with 1-piperazineethanamine and tall oil | zsírsavak, C18-telítetlen, dimerek reakciótermékei 1-piperazin-etánaminnal és tallolajjal | 447-880-6 | 206565-89-1 | Skin
Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H410 |
M=10 |
ATP01 | ||
| 612-276-00-5 | 1-amino-4-[(4-amino-2-sulfofenyl)amino]-9,10-dihydro-9,10-dioxo-2-anthracenesulfonic acid, disodium salt, reaction products with 2-[[3-[(4,6-dichloro-1,3,5-triazin-2-yl)ethylamino]phenyl]sulfonyl]ethyl hydrogen sulfate, sodium salts | 1-amino-4-[(4-amino-2-szulfofenil)amino]-9,10-dihidro-9,10-dioxo-2-antracénszulfonsav, dinátriumsó 2-[[3-[(4,6-diklór-1,3,5-triazin-2-yl)etilamino]fenil]szulfonil]etil-hidrogénszulfát nátriumsókkal képzett reakciótermékei | 451-430-4 | 500717-36-2 | Eye
Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
ATP01 | |||
| 612-277-00-0 | reaction mass of: 4-amino-3-(4-ethenesulfonyl-2-sulfonatophenylazo)-5-hydroxy-6-(5-{4-chloro-6-[4-(2-sulfonatooxyethanesulfonyl)phenylamino]-1,3,5-triazin-2-ylamino}-2-sulfonatophenylazo)naphthalene-2,7-disulfonate potassium/sodium; 4-amino-5-hydroxy-6-(5-{4-chloro-6-[4-(2-sulfonatooxyethanesulfonyl)phenylamino]-1,3,5-triazin-2-ylamino}-2-sulfonatophenylazo)-3-(2-sulfonato-4-(2-sulfonatooxyethanesulfonyl)phenylazo)naphthalene-2,7-disulfonate potassium/sodium | 4-amino-3-(4-eténszulfonil-2-szulfonátofenilazo)-5-hidroxi-6-(5-{4-klór-6-[4-(2-szulfonátooxietánszulfonil)fenilamino]-1,3,5-triazin-2-ilamino}-2-szulfonátofenilazo)naftalin-2,7-diszulfonát-kálium/nátrium; 4-amino-5-hidroxi-6-(5-{4-klór-6-[4-(2-szulfonátooxietánszulfonil)fenilamino]1,3,5-triazin-2-ilamino}-2-szulfonáto-fenilazo)-3-(2-szulfonáto-4-(2-szulfonátooxietánszulfonil)fenilazo)naftalin-2,7-diszulfonát-kálium/nátrium keveréke |
451-440-9 | 586372-44-3 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 612-278-00-6 | ethidium bromide; 3,8-diamino-1-ethyl-6-phenylphenantridinium bromide | etídium-bromid; 3,8-diamino-1-etil-6-fenilfenantridinium-bromid |
214-984-6 | 1239-45-8 | Muta.
2 Acute Tox. 2 * Acute Tox. 4 * |
H341 H330 H302 |
GHS06 GHS08 Dgr |
H341 H330 H302 |
ATP01 | |||
| 612-279-00-1 | (R,S)-2-amino-3,3-dimethylbutane amide | (R, S)-2-amino-3,3-dimetilbutánamid | 447-860-7 | 144177-62-8 | Repr.
2 STOT RE 2 * Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H361f
*** H373 ** H315 H319 H317 |
GHS08 GHS07 Wng |
H361f
*** H373 ** H319 H315 H317 |
ATP01 | |||
| 612-280-00-7 | 3-amino-9-ethyl carbazole; 9-ethylcarbazol-3-ylamine | 3-amino-9-etilkarbazol; 9-etilkarbazol-3-ilamin; |
205-057-7 | 132-32-1 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
ATP01 | |||
| 612-281-00-2 | leucomalachite green; N,N,N',N'-tetramethyl-4,4'-benzylidenedianiline | leukomalachitzöld; N, N,N',N'-tetrametil-4,4'-benzilidéndianilin | 204-961-9 | 129-73-7 | Carc.
2 Muta. 2 |
H351 H341 |
GHS08 Wng |
H351 H341 |
ATP03 | |||
| 612-282-00-8 | octadecylamine | oktadecilamin | 204-695-3 | 124-30-1 | Asp.
Tox. 1 STOT RE 2 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H304 H373 (gastro-intestinal tract, liver, immune system) H315 H318 H400 H410 |
GHS05 GHS08 GHS09 Dgr |
H315 H318 H373 (gastro-intestinal tract, liver, immune system) H304 H410 |
M=10 M=10 |
ATP05 | ||
| 612-283-00-3 | (Z)-octadec-9-enylamine | (Z)-oktadec-9-enilamin | 204-015-5 | 112-90-3 | Acute
Tox. 4 Asp. Tox. 1 STOT SE 3 STOT RE 2 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H302 H304 H335 H373 (gastro-intestinal tract, liver, immune system) H314 H400 H410 |
GHS05 GHS07 GHS08 GHS09 Dgr |
H302 H314 H335 H373 (gastro-intestinal tract, liver, immune system) H304 H410 |
M=10 M=10 |
ATP05 | ||
| 612-284-00-9 | amines, hydrogenated tallow alkyl | aminok, hidrogénezett faggyú-alkil | 262-976-6 | 61788-45-2 | Asp.
Tox. 1 STOT RE 2 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H304 H373 (gastro-intestinal tract, liver, immune system) H315 H318 H400 H410 |
GHS08 GHS05 GHS09 Dgr |
H315 H318 H373 (gastro-intestinal tract, liver, immune system) H304 H410 |
M=10 M=10 |
ATP05 | ||
| 612-285-00-4 | amines, coco alkyl | aminok, kokoalkil | 262-977-1 | 61788-46-3 | Acute
Tox. 4 Asp. Tox. 1 STOT SE 3 STOT RE 2 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H302 H304 H335 H373 H314 H400 H410 |
GHS05 GHS07 GHS08 GHS09 Dgr |
H302 H314 H335 H373 (gastro-intestinal tract, liver, immune system) H304 H410 |
M=10 M=10 |
ATP05 | ||
| 612-286-00-X | amines, tallow alkyl | aminok, faggyú-alkil | 263-125-1 | 61790-33-8 | Acute
Tox. 4 Asp. Tox. 1 STOT RE 2 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H302 H304 H373 (gastro-intestinal tract, liver, immune system) H314 H400 H410 |
GHS05 GHS07 GHS08 GHS09 Dgr |
H302 H314 H373 (gastro-intestinal tract, liver, immune system) H304 H410 |
M=10 M=10 |
ATP05 | ||
| 612-287-00-5 | fluazinam (ISO); 3-chloro-N-[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-5-(trifluoromethyl)pyridin-2-amine | fluazinam (ISO); 3-klór-N-[3-klór-2,6-dinitro-4-(trifluormetil)fenil]-5-(trifluormetil)piridin-2-amin | 79622-59-6 | Repr.
2 Acute Tox. 4 Eye Dam. 1 Skin Sens. 1A Aquatic Acute 1 Aquatic Chronic 1 |
H361d H332 H318 H317 H400 H410 |
GHS08 GHS07 GHS05 GHS09 Dgr |
H332 H318 H317 H361d H410 |
M=10 M=10 |
ATP06 | |||
| 612-288-00-0 | bupirimate (ISO); 5-butyl-2-ethylamino-6-methylpyrimidin-4-yl dimethylsulphamate | bupirimát
(ISO); 5-butil-2-etilamino-6-metilpirimidin-4-il dimetilszulfamát |
255-391-2 | 41483-43-6 | Carc.
2 Skin Sens. 1B Aquatic Chronic 1 |
H351 H317 H410 |
GHS08 GHS07 GHS09 Wng |
H317 H351 H410 |
M=1 |
ATP09 | ||
| 612-289-00-6 | triflumizole (ISO); (1E)-N-[4-chloro-2-(trifluoromethyl)phenyl]-1-(1H-imidazol-1-yl)-2-propoxyethanimine | triflumizol
(ISO); (1E)-N-[4-klór-2-(trifluormetil)fenil]-1-(1H-imidazol-1-il)-2-propoxi-etánimin |
68694-11-1 | Repr.
1B Acute Tox. 4 STOT RE 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360D H302 H373 (liver) H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H302 H317 H360D H373 (liver) H410 |
M=1 M=1 |
ATP09 | |||
| 612-290-00-1 | reaction
products of paraformaldehyde and 2-hydroxypropylamine (ratio 3:2); [formaldehyde released from 3,3′-methylenebis[5-methyloxazolidine]; [formaldehyde released from oxazolidin]; [MBO] |
paraformaldehid
és 2-hidroxipropilamin reakciótermékei (3:2 arányban); [3,3′-metilénbisz[5-metiloxazolidin]-ből felszabaduló formaldehid]; oxazolidinből felszabaduló formaldehid]; [MBO] |
Carc.
1B Muta. 2 Acute Tox. 3 Acute Tox. 4 Acute Tox. 4 STOT RE 2 Skin Corr. 1B Eye Dam. 1 Skin Sens. 1A Aquatic Chronic 2 |
H350 H341 H311 H332 H302 H373 (gastrointestinal tract, respiratory tract) H314 H318 H317 H411 |
GHS08 GHS06 GHS05 GHS09 Dgr |
H332 H311 H302 H314 H317 H341 H350 H373 (gastrointestinal tract, respiratory tract) H411 |
EUH071 |
8 9 | ATP10 | |||
| 612-291-00-7 | reaction
products of paraformaldehyde with 2-hydroxypropylamine (ratio 1:1); [formaldehyde released from α,α,α-trimethyl-1,3,5-triazine-1,3,5(2H,4H,6H)-triethanol]; [HPT] |
paraformaldehid
és 2-hidroxipropilamin reakciótermékei (1:1 arányban); [α,α,α-trimetil-1,3,5-triazin-1,3,5(2H,4H,6H)-trietanolból felszabaduló formaldehid]; [HPT] |
Carc.
1B Muta. 2 Acute Tox. 4 Acute Tox. 4 STOT RE 2 Skin Corr. 1C Eye Dam. 1 Skin Sens. 1A Aquatic Chronic 2 |
H350 H341 H332 H302 H373 (gastrointestinal tract, respiratory tract) H314 H318 H317 H411 |
GHS08 GHS07 GHS05 GHS09 Dgr |
H332 H302 H314 H317 H341 H350 H373 (gastrointestinal tract, respiratory tract) H411 |
EUH071 |
8 9 | ATP10 | |||
| 612-292-00-2 | methylhydrazine | metilhidrazin | 200-471-4 | 60-34-4 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
ATP10 | |||
| 612-293-00-8 | reaction mass of 1-[2-(2-aminobutoxy)ethoxy]but-2-ylamine and 1-({[2-(2-aminobutoxy)ethoxy]methyl}propoxy)but-2-ylamine | 1-[2-(2-aminobutoxi)etoxi]but-2-ilamin és 1-({[2-(2-aminobutoxi)etoxi]metil}propoxi)but-2-ilamin keveréke | 447-920-2 | Repr.
2 Acute Tox. 4 Skin Corr. 1B Eye Dam. 1 |
H361f H302 H314 H318 |
GHS08 GHS07 GHS05 Dgr |
H302 H314 H361f |
EUH071 |
ATP13 | |||
| 612-294-00-3 | mecetronium etilsulfate; N-ethyl-N,N-dimethylhexadecan-1-aminium ethyl sulfate; mecetronium ethyl sulphate; [MES] | #HIÁNYZIK | 221-106-5 | 3006-10-8 | Skin
Corr. 1 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H314 H318 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
EUH071 |
M=100 M=1000 |
ATP15 | |
| 613-001-00-1 | ethyleneimine; aziridine | etilénimin; aziridin | 205-793-9 | 151-56-4 | Flam.
Liq. 2 Carc. 1B Muta. 1B Acute Tox. 1 Acute Tox. 2 * Acute Tox. 2 * Skin Corr. 1B Aquatic Chronic 2 |
H225 H350 H340 H310 H330 H300 H314 H411 |
GHS02 GHS06 GHS08 GHS05 GHS09 Dgr |
H225 H350 H340 H330 H310 H300 H314 H411 |
D | CLP00 | ||
| 613-002-00-7 | pyridine | piridin | 203-809-9 | 110-86-1 | Flam.
Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H225 H332 H312 H302 |
GHS02 GHS07 Dgr |
H225 H332 H312 H302 |
* |
CLP00 | ||
| 613-003-00-2 | 1,2,3,4-tetranitrocarbazole | 1,2,3,4-tetranitrokarbazol | - | 6202-15-9 | Expl.
1.1 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H201 H332 H312 H302 |
GHS01 GHS07 Dgr |
H201 H332 H312 H302 |
CLP00/ATP01 | |||
| 613-004-00-8 | crimidine (ISO); 2-chloro-6-methylpyrimidin-4-yldimethylamine | krimidin (ISO); 2-klór-6-metilpirimidin-4- ildimetilamin | 208-622-6 | 535-89-7 | Acute
Tox. 2 * |
H300 |
GHS06 Dgr |
H300 |
CLP00 | |||
| 613-007-00-4 | desmetryne (ISO); 6-isopropylamino-2-methylamino-4-methylthio-1,3,5-triazine | dezmetrin (ISO); 6-izopropilamino-2-metilamino-4-metiltio-1,3,5-triazin | 213-800-1 | 1014-69-3 | Acute
Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
CLP00 | |||
| 613-008-00-X | dazomet (ISO); tetrahydro-3,5-dimethyl-1,3,5-thiadiazine-2-thione | dazomet (ISO); tetrahidro-3,5-dimetil-1,3,5-tiadiazin-2-tion | 208-576-7 | 533-74-4 | Acute
Tox. 4 * Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H410 |
CLP00 | |||
| 613-009-00-5 | 2,4,6-trichloro-1,3,5-triazine; cyanuric chloride | 2,4,6-triklór-1,3,5-triazin; cianur-klorid | 203-614-9 | 108-77-0 | Acute
Tox. 2 * Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 |
H330 H302 H314 H317 |
GHS06 GHS05 Dgr |
H330 H302 H314 H317 |
EUH014 |
STOT
SE 3; H335: C ≥ 5 % |
CLP00 | |
| 613-010-00-0 | ametryn (ISO); N-ethyl-N'-isopropyl-6-(methylthio)-1,3,5-triazine-2,4-diamine | ametrin (ISO); N-etil-N'-izopropil-6-(metiltio)-1,3,5-triazin-2,4-diamin | 212-634-7 | 834-12-8 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
M=100 |
CLP00/ATP01corr | ||
| 613-011-00-6 | amitrole (ISO); 1,2,4-triazol-3-ylamine | amitrol (ISO); 1,2,4-triazol-3-ilamin | 200-521-5 | 61-82-5 | Repr.
2 STOT RE 2 * Aquatic Chronic 2 |
H361d
*** H373 ** H411 |
GHS08 GHS09 Wng |
H361d
*** H373 ** H411 |
CLP00 | |||
| 613-012-00-1 | bentazone (ISO); 3-isopropyl-2,1,3-benzothiadiazine-4-one-2,2-dioxide | bentazon (ISO); 3-izopropil-2,1,3-benzotiadiazin-4-on-2,2-dioxid | 246-585-8 | 25057-89-0 | Acute
Tox. 4 * Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H302 H319 H317 H412 |
GHS07 Wng |
H302 H319 H317 H412 |
CLP00 | |||
| 613-013-00-7 | cyanazine (ISO); 2-(4-chloro-6-ethylamino-1,3,5-triazine-2-ylamino)-2-methylpropionitrile | cianazin (ISO); 2-(4-klór-6-etilamino-1,3,5-triazin-2-ilamino)-2-metilpropionitril | 244-544-9 | 21725-46-2 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | |||
| 613-014-00-2 | ethoxyquin (ISO); 6-ethoxy-1,2-dihydro-2,2,4-trimethylquinoline | etoxikvin (ISO); 6-etoxi-1,2-dihidro-2,2,4-trimetilkinolin | 202-075-7 | 91-53-2 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 613-015-00-8 | fenazaflor (ISO); phenyl 5,6-dichloro-2-trifluoromethylbenzimidazole-1-carboxylate | fenazaflor (ISO); fenil-5,6-diklór-2-trifluormetilbenzimidazol-1-karboxilát | 238-134-9 | 14255-88-0 | Acute
Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
CLP00 | |||
| 613-016-00-3 | fuberidazole (ISO); 2-(2-furyl)-1H-benzimidazole | fuberidazol (ISO); 2-(2-furil-)-1H-benzimidazol | 223-404-0 | 3878-19-1 | Carc.
2 Acute Tox. 4 STOT RE 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H373 (heart) H317 H400 H410 |
GHS07 GHS08 GHS09 Wng |
H351 H302 H373 (heart) H317 H410 |
M=1 |
CLP00/ATP03 | ||
| 613-017-00-9 | bis (8-hydroxyquinolinium) sulphate | bisz(8-hidroxikinolin)-szulfát | 205-137-1 | 134-31-6 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 613-018-00-4 | morfamquat (ISO); 1,1'-bis(3,5-dimethylmorpholinocarbonylmethyl)-4,4'-bipyridilium ion | morfamkvat (ISO); 1,1’-bisz(3,5-dimetilmorfolinokarbonilmetil)-4,4’-bipiridilium ion | 7411-47-4 | Acute
Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Aquatic Chronic 3 |
H302 H335 H315 H319 H412 |
GHS07 Wng |
H302 H319 H335 H315 H412 |
CLP00 | ||||
| 613-019-00-X | thioquinox (ISO); 2-thio-1,3-dithiolo(4,5,b)quinoxaline | tiokinox (ISO); 2-tio-1,3-ditiolo(4,5,b)kinoxalin | 202-272-8 | 93-75-4 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 613-020-00-5 | tridemorph (ISO); 2,6-dimethyl-4-tridecylmorpholine | tridemorf (ISO); 2,6-dimetil-4-tridecilmorfolin | 246-347-3 | 24602-86-6 | Repr.
1B Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H360D
*** H332 H302 H315 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H360D
*** H332 H302 H315 H410 |
CLP00 | |||
| 613-021-00-0 | dithianon (ISO); 5,10-dihydro-5,10-dioxonaphtho(2,3-b)(1,4)dithiazine-2,3-dicarbonitrile | ditianon (ISO); 5,10-dihidro-5,10-dioxonafto(2,3-b)(1,4)ditiazin-2,3-dikarbonitril | 222-098-6 | 3347-22-6 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | |||
| 613-022-00-6 | pyrethrins including cinerins, with the exception of those specified elsewhere in this Annex | piretrinek, beleértve a cinerineket is (kivéve az e mellékletben külön szereplőket) | Acute
Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
A | CLP00 | ||||
| 613-023-00-1 | 2-methyl-4-oxo-3-(penta-2,4-dienyl)cyclopent-2-enyl [1R-[1α[S*(Z)],3β]]-chrysanthemate; pyrethrin I | 2-metil-4-oxo-3-(penta-2,4-dienil)ciklopent-2-enil[1R-[1α[S*(Z)],3β]]-krizantemát; piretrin I | 204-455-8 | 121-21-1 | Acute
Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
CLP00 | |||
| 613-024-00-7 | 2-methyl-4-oxo-3-(penta-2,4-dienyl)cyclopent-2-enyl[1R-[1α[S*(Z)](3β)]]-3-(3-methoxy-2-methyl-3-oxoprop-1-enyl)-2,2-dimethylcyclopropanecarboxylate; pyrethrin II | 2-metil-4-oxo-3-(penta-2,4-dienil)ciklopent-2-enil[1R-[1α[S*(Z)],3β]]-3-(3-metoxi-2-metil-3-oxoprop-1-enil)-2,2-dimetilciklopropán-karboxilát; piretrin II | 204-462-6 | 121-29-9 | Acute
Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
CLP00 | |||
| 613-025-00-2 | cinerin I; 3-(but-2-enyl)-2-methyl-4-oxocyclopent-2-enyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate | cinerin I; 3-(but-2-enil)-2-metil-4-oxociklopent-2-enil-2,2-dimetil-3-(2-metilprop-1-enil)ciklopropánkarboxilát | 246-948-0 | 25402-06-6 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | |||
| 613-026-00-8 | cinerin II; 3-(but-2-enyl)-2-methyl-4-oxocyclopent-2-enyl 2,2-dimethyl-3-(3-methoxy-2-methyl-3-oxoprop-1-enyl)cyclopropanecarboxylate | cinerin II; 3-(but-2-enil)-2-metil-4-oxociklopent-2-enil-2,2-dimetil-3-(3-metoxi-2-metil-3-oxoprop-1-enil)-ciklopropánkarboxilát | 204-454-2 | 121-20-0 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | |||
| 613-027-00-3 | piperidine | piperidin | 203-813-0 | 110-89-4 | Flam.
Liq. 2 Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B |
H225 H331 H311 H314 |
GHS02 GHS06 GHS05 Dgr |
H225 H331 H311 H314 |
* |
CLP00 | ||
| 613-028-00-9 | morpholine | morfolin | 203-815-1 | 110-91-8 | Flam.
Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H226 H332 H312 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H226 H332 H312 H302 H314 |
CLP00 | |||
| 613-029-00-4 | dichloro-1,3,5-triazinetrione; dichloroisocyanuric acid | diklór-1,3,5-triazintrion; diklórizocianursav | 220-487-5 | 2782-57-2 | Ox.
Sol. 2 Acute Tox. 4 * STOT SE 3 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H272 H302 H335 H319 H400 H410 |
GHS03 GHS07 GHS09 Dgr |
H272 H302 H319 H335 H410 |
EUH031 |
T | CLP00 | |
| 613-030-00-X | troclosene
potassium [1] troclosene sodium [2] |
troklozén-kálium; [1] troklozén-nátrium [2] | 218-828-8
[1] 220-767-7 [2] |
2244-21-5
[1] 2893-78-9 [2] |
Ox.
Sol. 2 Acute Tox. 4 * STOT SE 3 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H272 H302 H335 H319 H400 H410 |
GHS03 GHS07 GHS09 Dgr |
H272 H302 H319 H335 H410 |
EUH031 |
* STOT SE 3; H335: C ≥ 10 % EUH031: C ≥ 10 % |
G | CLP00/ATP01 |
| 613-030-01-7 | troclosene sodium, dihydrate | troklozén-nátrium, dihidrát | 220-767-7 | 51580-86-0 | Acute
Tox. 4 * STOT SE 3 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H335 H319 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H335 H410 |
EUH031 |
CLP00 | ||
| 613-031-00-5 | symclosene; trichloroisocyanuric acid; trichloro-1,3,5-triazinetrion | szimklozén; triklórizocianursav; triklór-1,3,5-triazintrion | 201-782-8 | 87-90-1 | Ox.
Sol. 2 Acute Tox. 4 * STOT SE 3 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H272 H302 H335 H319 H400 H410 |
GHS03 GHS07 GHS09 Dgr |
H272 H302 H319 H335 H410 |
EUH031 |
CLP00 | ||
| 613-032-00-0 | methyl-2,3,5,6-tetrachloro-4-pyridylsulphone; 2,3,5,6-tetrachloro-4-(methylsulphonyl)pyridine | metil-2,3,5,6-tetraklór-4-piridilszulfon; 2,3,5,6-tetraklór-4-(metilszulfonil)piridin | 236-035-5 | 13108-52-6 | Acute
Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 |
H312 H302 H319 H317 |
GHS07 Wng |
H312 H302 H319 H317 |
CLP00 | |||
| 613-033-00-6 | 2-methylaziridine; propyleneimine | 2-metilaziridin; propilén-imin | 200-878-7 | 75-55-8 | Flam.
Liq. 2 Carc. 1B Acute Tox. 1 Acute Tox. 2 * Acute Tox. 2 * Eye Dam. 1 Aquatic Chronic 2 |
H225 H350 H310 H330 H300 H318 H411 |
GHS02 GHS06 GHS08 GHS05 GHS09 Dgr |
H225 H350 H330 H310 H300 H318 H411 |
Carc.
1B; H350: C ≥ 0,01 % |
CLP00 | ||
| 613-034-00-1 | 1,2-dimethylimidazole | 1,2-dimetilimidazol | 217-101-2 | 1739-84-0 | Acute
Tox. 4 * Skin Irrit. 2 Eye Dam. 1 |
H302 H315 H318 |
GHS05 GHS07 Dgr |
H302 H315 H318 |
CLP00 | |||
| 613-035-00-7 | 1-methylimidazole | 1-metilimidazol | 210-484-7 | 616-47-7 | Acute
Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
CLP00 | |||
| 613-036-00-2 | 2-methylpyridine; 2-picoline | 2-metilpiridin; 2-pikolin | 203-643-7 | 109-06-8 | Flam.
Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Eye Irrit. 2 |
H226 H332 H312 H302 H335 H319 |
GHS02 GHS07 Wng |
H226 H332 H312 H302 H319 H335 |
CLP00 | |||
| 613-037-00-8 | 4-methylpyridine; 4-picoline | 4-metilpiridin; 4-pikolin | 203-626-4 | 108-89-4 | Flam.
Liq. 3 Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 |
H226 H311 H332 H302 H335 H315 H319 |
GHS02 GHS06 Dgr |
H226 H311 H332 H302 H319 H335 H315 |
CLP00 | |||
| 613-038-00-3 | 6-phenyl-1,3,5-triazine-2,4-diyldiamine; 6-phenyl-1,3,5-triazine-2,4-diamine; benzoguanamine | 6-fenil-1,3,5-triazin-2,4-diil-diamin; 6-fenil-1,3,5-triazin-2,4-diamin; benzoguánamin | 202-095-6 | 91-76-9 | Acute
Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
CLP00 | |||
| 613-039-00-9 | ethylene thiourea; imidazolidine-2-thione; 2-imidazoline-2-thiol | etiléntiokarbamid; imidazolidin-2-tion; 2-imidazolin-2-tiol | 202-506-9 | 96-45-7 | Repr.
1B Acute Tox. 4 * |
H360D
*** H302 |
GHS08 GHS07 Dgr |
H360D
*** H302 |
CLP00 | |||
| 613-040-00-4 | azaconazole (ISO); 1-{}{[2-(2,4-dichlorophenyl)-1,3-dioxolan-2-yl]methyl}}-1H-1,2.4-triazole | azakonazol (ISO); 1-{[2-(2,4-diklórfenil)-1,3-dioxolan-2-il]metil}-1H-1,2,4-triazol | 262-102-3 | 60207-31-0 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 613-041-00-X | morpholine-4-carbonyl chloride | morfolin-4-karbonil-klorid | 239-213-0 | 15159-40-7 | Carc.
2 Skin Irrit. 2 Eye Irrit. 2 |
H351 H315 H319 |
GHS08 Wng |
H351 H319 H315 |
EUH014 |
CLP00 | ||
| 613-042-00-5 | imazalil (ISO); 1-[2-(allyloxy)-2-(2,4-dichlorophenyl)ethyl]-1H-imidazole | imazalil (ISO); 1-[2-(alliloxi)-2-(2,4-diklórfenil)etil]-1-H-imidazol | 252-615-0 | 35554-44-0 | Carc.
2 Acute Tox. 3 Acute Tox. 4 Eye Dam. 1 Aquatic Chronic 1 |
H351 H301 H332 H318 H410 |
GHS08 GHS06 GHS05 GHS09 Dgr |
H301 H332 H318 H351 H410 |
M=10 |
CLP00/ATP07 | ||
| 613-043-00-0 | imazalil
sulphate (ISO) powder; 1-
[2-(allyloxy)ethyl-2-(2,4-dichlorophenyl)]-1H-imidazolium hydrogen sulphate
[1] (±)-1- [2-(allyloxy)ethyl-2-(2,4-dichlorophenyl)]-1H-imidazolium hydrogen sulphate [2] |
imazalil-szulfát (ISO) por; 1-[2-(alliloxi)etil-2-(2,4-diklórfenil)-1H-imidazólium-hidrogénszulfát; [1] (±)-1-[2-(alliloxi)etil-2-(2,4-diklórfenil)-1H-imidazólium- hidrogénszulfát [2] | 261-351-5
[1] 281-291-3 [2] |
58594-72-2
[1] 83918-57-4 [2] |
Acute
Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
CLP00 | |||
| 613-043-01-8 | imazalil
sulphate (ISO), aqueous solution; 1-
[2-(allyloxy)ethyl-2-(2,4-dichlorophenyl)]-1H-imidazolium hydrogen sulphate
[1] (±)-1- [2-(allyloxy)ethyl-2-(2,4-dichlorophenyl)]-1H-imidazolium hydrogen sulphate [2] |
imazalil szulfát (ISO), vizes oldat; 1- [2-(alliloxi)etil-2-(2,4-diklórfenil)]-1H-imidazolium-hidrogénszulfát; [1] (+/-)-1- [2-(alliloxi)etil-2-(2,4-diklórfenil)]-1H-imidazolium-hidrogénszulfát [2] | 261-351-5
[1] 281-291-3 [2] |
58594-72-2
[1] 83918-57-4 [2] |
Acute
Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Wng |
H302 H314 H317 H410 |
Skin
Corr. 1B; H314: C ≥ 50 % Skin Irrit. 2; H315: 30 % ≤ C < 50 % Eye Dam. 1; H318: 15 % ≤ C < 50 % Eye Irrit. 2; H319: 5 % ≤ C < 15 % |
CLP00 | ||
| 613-044-00-6 | captan (ISO); 1,2,3,6-tetrahydro-N-(trichloromethylthio)phthalimide | kaptán (ISO); 1,2,3,6-tetrahidro-N-(triklórmetiltio)ftálimid | 205-087-0 | 133-06-2 | Carc.
2 Acute Tox. 3 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 |
H351 H331 H318 H317 H400 |
GHS06 GHS05 GHS08 GHS09 Dgr |
H351 H331 H318 H317 H400 |
M=10 |
CLP00/ATP01 | ||
| 613-045-00-1 | folpet (ISO); N-(trichloromethylthio)phthalimide | folpet (ISO); N-(triklórmetiltio)ftálimid | 205-088-6 | 133-07-3 | Carc.
2 Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 |
H351 H332 H319 H317 H400 |
GHS08 GHS07 GHS09 Wng |
H351 H332 H319 H317 H400 |
M=10 |
CLP00/ATP01 | ||
| 613-046-00-7 | captafol (ISO); 1,2,3,6-tetrahydro-N-(1,1,2,2-tetrachloroethylthio)phthalimide | kaptafol (ISO); 1,2,3,6-tetrahidro-N-(1,1,2,2- tetraklóretiltio)ftálimid | 219-363-3 | 2425-06-1 | Carc.
1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350 H317 H410 |
CLP00 | |||
| 613-047-00-2 | 1-dimethylcarbamoyl-5-methylpyrazol-3-yl dimethylcarbamate; dimetilan (ISO) | 1-dimetilkarbamoil-5-metilpirazol-3-il-dimetilkarbamát; dimetilan (ISO) | 211-420-0 | 644-64-4 | Acute
Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H301 H312 H410 |
CLP00 | |||
| 613-048-00-8 | carbendazim (ISO); methyl benzimidazol-2-ylcarbamate | karbendazim (ISO); metilbenzimidazol-2-il-karbamát | 234-232-0 | 10605-21-7 | Muta.
1B Repr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H340 H360FD H400 H410 |
GHS08 GHS09 Dgr |
H340 H360FD H410 |
CLP00 | |||
| 613-049-00-3 | benomyl (ISO); methyl 1-(butylcarbamoyl)benzimidazol-2-ylcarbamate | benomil (ISO); metil-1-(butilkarbamoil)benzimidazol-2-il-karbamát | 241-775-7 | 17804-35-2 | Muta.
1B Repr. 1B STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H340 H360FD H335 H315 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H340 H360FD H335 H315 H317 H410 |
M=10 |
CLP00 | ||
| 613-050-00-9 | carbadox (INN); methyl 3-(quinoxalin-2-ylmethylene)carbazate 1,4-dioxide; 2-(methoxycarbonylhydrazonomethyl)quinoxaline 1,4-dioxide | karbadox (INN); metil-3-(kinoxalin-2-ilmetilén)-karbazát-1,4-dioxid; 2-(metoxikarbonilhidrazonometil)kinoxalin-1,4-dioxid | 229-879-0 | 6804-07-5 | Flam.
Sol. 1 Carc. 1B Acute Tox. 4 * |
H228 H350 H302 |
GHS02 GHS08 GHS07 Dgr |
H228 H350 H302 |
T | CLP00 | ||
| 613-051-00-4 | molinate (ISO); S-ethyl 1-perhydroazepinecarbothioate; S-ethyl perhydroazepine-1-carbothioate | molinát (ISO); S-etil-1-perhidroazepin-karbotioát; S-etil-perhidroazepin-1-karbotioát | 218-661-0 | 2212-67-1 | Carc.
2 Repr. 2 Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H361f *** H332 H302 H373 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H361f *** H332 H302 H373 ** H317 H410 |
M=100 |
CLP00 | ||
| 613-052-00-X | trifenmorph (ISO); 4-tritylmorpholine | trifenmorf (ISO); 4-tritilmorfolin | 215-812-2 | 1420-06-0 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | |||
| 613-053-00-5 | anilazine (ISO); 2-chloro-N-(4,6-dichloro-1,3,5-triazin-2-yl)aniline | anilazin (ISO); 2-klór-N-(4,6-diklór-1,3,5-triazin-2-il)anilin | 202-910-5 | 101-05-3 | Skin
Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H319 H400 H410 |
GHS07 GHS09 Wng |
H319 H315 H410 |
CLP00 | |||
| 613-054-00-0 | thiabendazole (ISO); 2-(thiazol-4-yl)benzimidazole | tiabendazol (ISO); 2-(tiazol-4-il)benzimidazol | 205-725-8 | 148-79-8 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
M=1 M=1 |
CLP00/ATP14 | ||
| 613-056-00-1 | 1,2-dimethyl-3,5-diphenylpyrazolium methylsulphate; difenzoquat methyl sulfate | 1,2-dimetil-3,5-difenilpirazólim-metilszulfát; difenzokvat-metilszulfát | 256-152-5 | 43222-48-6 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS09 Wng |
H302 H410 |
CLP00 | |||
| 613-057-00-7 | dodemorph (ISO); 4-cyclododecyl-2,6-dimethylmorpholine | dodemorf (ISO); 4-ciklododecil-2,6-dimetil-morfolin | 216-474-9 | 1593-77-7 | Repr.
2 STOT RE 2 Skin Corr. 1C Skin Sens. 1A Aquatic Acute 1 Aquatic Chronic 1 |
H361d H373 (liver) H314 H317 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H314 H317 H361d H373 (liver) H410 |
EUH071 |
M=1 M=1 |
CLP00/ATP07 | |
| 613-058-00-2 | permethrin (ISO); m-phenoxybenzyl 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate | permetrin (ISO); m-fenoxibenzil-3-(2,2-diklórvinil)-2,2-dimetilciklopropánkarboxilát | 258-067-9 | 52645-53-1 | Acute
Tox. 4 * Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H332 H302 H317 H410 |
M=1000 |
CLP00 | ||
| 613-059-00-8 | profluralin (ISO); N-(cyclopropylmethyl)-α,α,α-trifluoro-2,6-dinitro-N-propyl-p-toluidine | profluralin (ISO); N-(ciklopropilmetil)-α, α,α-trifluoro-2,6-dinitro-N-propil-p-toluidin | 247-656-6 | 26399-36-0 | Eye
Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H400 H410 |
GHS07 GHS09 Wng |
H319 H410 |
CLP00 | |||
| 613-060-00-3 | resmethrin (ISO); 5-benzyl-3-furylmethyl (±)-cis-trans-chrysanthemate | rezmetrin (ISO); 5-benzil-3-furilmetil (±)-cisz-transz-krizantemát | 233-940-7 | 10453-86-8 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
M=1000 |
CLP00/ATP01 | ||
| 613-061-00-9 | 6-(1α,5aβ,8aβ,9-pentahydroxy-7β-isopropyl-2β,5β,8β-trimethylperhydro-8bα,9-epoxy-5,8-ethanocyclopenta[1,2-b]indenyl) pyrrole-2-carboxylate; ryania | 6-(1α,5aβ,8aβ,9-pentahidroxi-7β-izopropil-2β,5β,8β- trimetilperhidro-8bα,9-epoxi-5,8-etanociklopenta[1,2,b]indenil] pirrol-2-karboxilát; riania | 239-732-2 | 15662-33-6 | Acute
Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
CLP00 | |||
| 613-062-00-4 | sabadilla (ISO); veratrine | szabadilla (ISO); veratrin | 8051-02-3 | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 |
H335 H315 H319 |
GHS07 Wng |
H319 H335 H315 |
CLP00 | ||||
| 613-063-00-X | secbumeton (ISO); 2-sec-butylamino-4-ethylamino-6-methoxy-1,3,5-triazine | szekbumeton (ISO); 2-szek-butilamino-4-etilamino- 6-metoxi-1,3,5-triazin | 247-554-1 | 26259-45-0 | Acute
Tox. 4 * Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H410 |
CLP00 | |||
| 613-064-00-5 | 5-(3,6,9-trioxa-2-undecyloxy)benzo(d)-1,3-dioxolane; sesamex | 5-(3,6,9-trioxa-2-undeciloxi)benzo(d)-1,3-dioxolán; szeszamex | 51-14-9 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | ||||
| 613-065-00-0 | simetryn (ISO); 2,4-bis(ethylamino)-6-methylthio-1,3,5-triazine | szimetrin (ISO); 2,4-bisz(etilamino)-6-metiltio-1,3,5-triazin | 213-801-7 | 1014-70-6 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | |||
| 613-066-00-6 | terbumeton (ISO); 2-tert-butylamino-4-ethylamino-6-methoxy-1,3,5-triazine | terbumeton (ISO); 2-terc-butilamino-4-etilamino- 6-metoxi-1,3,5-triazin | 251-637-8 | 33693-04-8 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | |||
| 613-067-00-1 | propazine (ISO); 2-chloro-4,6-bis(isopropylamino)-1,3,5-triazine | propazin (ISO); 2-klór-4,6-bisz(izopropilamino)-1,3,5-triazin | 205-359-9 | 139-40-2 | Carc.
2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
CLP00 | |||
| 613-068-00-7 | atrazine (ISO); 2-chloro-4-ethylamine-6-isopropylamine-1,3,5-triazine | atrazin (ISO); 2-klór-4-etilamin-6-izopropilamin-1,3,5-triazin | 217-617-8 | 1912-24-9 | STOT
RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373
** H317 H400 H410 |
GHS08 GHS09 Wng |
H373
** H317 H410 |
CLP00 | |||
| 613-069-00-2 | ε-caprolactam | ε- kaprolaktám | 203-313-2 | 105-60-2 | Acute
Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 |
H332 H302 H335 H315 H319 |
GHS07 Wng |
H332 H302 H319 H335 H315 |
CLP00 | |||
| 613-070-00-8 | propylenethiourea | propiléntiokarbamid | 2122-19-2 | Repr.
2 Acute Tox. 4 * Aquatic Chronic 3 |
H361d
*** H302 H412 |
GHS08 GHS07 Wng |
H361d
*** H302 H412 |
CLP00 | ||||
| 613-071-00-3 | 2-fluoro-5-trifluoromethylpyridine | 2-fluor-5-trifluormetilpiridin | 400-290-2 | 69045-82-5 | Flam.
Liq. 3 Skin Sens. 1 Aquatic Chronic 3 |
H226 H317 H412 |
GHS02 GHS07 Wng |
H226 H317 H412 |
CLP00 | |||
| 613-072-00-9 | N,N-bis(2-ethylhexyl)-((1,2,4-triazol-1-yl)methyl)amine | N, N-bisz(2-etilhexil)-[(1,2,4-triazol-1-il)metil]-amin | 401-280-0 | 91273-04-0 | Skin
Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H314 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H411 |
CLP00 | |||
| 613-073-00-4 | N,N-dimethyl-2-(3-(4-chlorophenyl)-4,5-dihydropyrazol-1-ylphenylsulphonyl)ethylamine | N, N-dimetil-2-[3-(4-klórfenil)-4,5-dihidropirazol-1-ilfenilszulfonil]etil-amin | 401-410-6 | 10357-99-0 | STOT
RE 2 * Skin Sens. 1 Aquatic Chronic 2 |
H373
** H317 H411 |
GHS08 GHS09 Wng |
H373
** H317 H411 |
CLP00 | |||
| 613-074-00-X | 3-(3-methylpent-3-yl)isoxazol-5-ylamine | 3-(3-metilpent-3-il)izoxazol-5-il-amin | 401-460-9 | 82560-06-3 | Acute
Tox. 3 * Acute Tox. 3 * Eye Dam. 1 Aquatic Chronic 3 |
H331 H301 H318 H412 |
GHS06 GHS05 Dgr |
H331 H301 H318 H412 |
CLP00 | |||
| 613-075-00-5 | 1,3-dichloro-5-ethyl-5-methylimidazolidine-2,4-dione | 1,3-diklór-5-etil-5-metilimidazolidin-2,4-dion | 401-570-7 | 89415-87-2 | Ox.
Sol. 1 **** Acute Tox. 3 * Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 |
H271 H331 H302 H314 H317 H400 |
GHS03 GHS06 GHS05 GHS09 Dgr |
H271 H331 H314 H302 H317 H400 |
CLP00 | |||
| 613-076-00-0 | 3-chloro-5-trifluoromethyl-2-pyridylamine | 3-klór-5-trifluormetil-2-piridil-amin | 401-670-0 | 79456-26-1 | Acute
Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
CLP00 | |||
| 613-077-00-6 | reaction mass of 5-heptyl-1,2,4-triazol-3-ylamine and 5-nonyl-1,2,4-triazol-3-ylamine | 5-heptil-1,2,4-triazol-3-il-amin és 5-nonil-1,2,4-triazol-3-il-amin keveréke | 401-940-8 | Acute
Tox. 4 * Eye Irrit. 2 Aquatic Chronic 2 |
H302 H319 H411 |
GHS07 GHS09 Wng |
H302 H319 H411 |
CLP00 | ||||
| 613-078-00-1 | N,N,N,N-tetrakis(4,6-bis(butyl-(N-methyl-2,2,6,6-tetramethylpiperidin-4-yl)amino)triazin-2-yl)-4,7-diazadecane-1,10-diamine | N, N’,N”,N”’-tetrakisz(4,6-bisz(butil-(N-metil-2,2,6,6-terametilpiperidin-4-il)amino)triazin-2-il)-4,7-diazadekán-1,10-diamin | 401-990-0 | 106990-43-6 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | |||
| 613-079-00-7 | 4-(1(or 4 or 5 or 6)-methyl-8,9,10-trinorborn-5-en-2-yl)pyridine, reaction mass of isomers | 4-(1 vagy 4 vagy 5 vagy 6)-metil-8,9,10-trinorborn-5-én-2-il)piridin (izomerkeverék) | 402-520-7 | Acute
Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H315 H317 H410 |
CLP00 | ||||
| 613-080-00-2 | 3-(bis(2-ethylhexyl)aminomethyl)benzothiazole-2(3H)-thione | 3-[bisz(2-etilhexil)aminometil]benzotiazol-2(3H)-tion | 402-540-6 | 105254-85-1 | Skin
Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H410 |
CLP00 | |||
| 613-081-00-8 | 1-butyl-2-methylpyridinium bromide | 1-butil-2-metilpiridinium-bromid | 402-680-8 | 26576-84-1 | Acute
Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
CLP00 | |||
| 613-082-00-3 | 2-methyl-1-pentylpyridinium bromide | 2-metil-1-pentilpiridinium-bromid | 402-690-2 | Acute
Tox. 4 * Acute Tox. 4 * Aquatic Chronic 3 |
H312 H302 H412 |
GHS07 Wng |
H312 H302 H412 |
CLP00 | ||||
| 613-083-00-9 | 2-(4-(3-(4-chlorophenyl)-2-pyrazolin-1-yl)phenylsulfonyl)ethyldimethylammonium formate | 2-(4-(3-(4klórfenil)-2-pirazolin-1-il)fenilszulfonil)etildimetilammónium-formiát | 402-120-2 | STOT
RE 2 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373
** H314 H317 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H314 H373 ** H317 H410 |
CLP00 | ||||
| 613-084-00-4 | 2-(4-(3-(4-chlorophenyl)-4,5-dihydropyrazolyl)phenylsulphonyl)ethyldimethylammonium hydrogen phosphonate | 2-(4-(3-(4-klórfenil)-4,5-dihidropirazolil)fenilszulfonil)etildimetilammónium-hidrogénfoszfonát | 402-490-5 | 106359-93-7 | Eye
Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H400 H410 |
GHS07 GHS09 Wng |
H319 H410 |
CLP00 | |||
| 613-085-00-X | reaction mass of 1,1'-(methylenebis(4,1-phenylene))dipyrrole-2,5-dione and N-(4-(4-(2,5-dioxopyrrol-1-yl)benzyl)phenyl)acetamide and 1-(4-(4-(5-oxo-2H-2-furylidenamino)benzyl)phenyl)pyrrole-2,5-dione | 1,1’-(metilénbisz(4,1-fenilén))dipirrol-2,5-dion és N-(4-(4-(2,5-dioxopirrol-1-il)benzil)fenil)acetamid és 1-(4-(4-(5-oxo-2H-2- furilidénamino)benzil)fenil)pirrol-2,5-dion keveréke | 401-970-1 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
CLP00 | ||||
| 613-086-00-5 | caffeine | koffein | 200-362-1 | 58-08-2 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 613-087-00-0 | tetrahydrothiophene | tetrahidrotiofén | 203-728-9 | 110-01-0 | Flam.
Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Eye Irrit. 2 Aquatic Chronic 3 |
H225 H332 H312 H302 H315 H319 H412 |
GHS02 GHS07 Dgr |
H225 H332 H312 H302 H319 H315 H412 |
CLP00 | |||
| 613-088-00-6 | 1,2-benzisothiazol-3(2H)-one; 1,2-benzisothiazolin-3-one | 1,2-benzizotiazol-3(2H)-on; 1,2-benzizotiazolin-3-on | 220-120-9 | 2634-33-5 | Acute
Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 |
H302 H315 H318 H317 H400 |
GHS05 GHS07 GHS09 Dgr |
H302 H315 H318 H317 H400 |
Skin
Sens. 1; H317: C ≥ 0,05 % |
CLP00 | ||
| 613-089-00-1 | diquat
dibromide [1] diquat dichloride [2] 6,7-dihydrodipyrido[1,2-α:2',1'-c]pyrazinediylium dihydroxide [3] |
dikvát-dibromid; [1] dikvát-diklorid; [2] 6,7-dihidrodipirido[1,2-α:2’,1’-c]pirazindiilium-dihidroxid [3] | 201-579-4
[1] 223-714-6 [2] 301-467-6 [3] |
85-00-7
[1] 4032-26-2 [2] 94021-76-8 [3] |
Acute
Tox. 2 * Acute Tox. 4 * STOT SE 3 STOT RE 1 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H302 H335 H372 ** H315 H319 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H372 ** H302 H319 H335 H315 H317 H410 |
CLP00 | |||
| 613-090-00-7 | paraquat
dichloride; 1,1-dimethyl-4,4'-bipyridinium dichloride [1] paraquat dimethylsulfate; 1,1-dimethyl-4,4'-bipyridinium dimethyl sulphate [2] |
parakvát-diklorid; 1,1-dimetil-4,4’-bipiridinium-diklorid; [1] parakvát-dimetil-szulfát; 1,1-dimetil-4,4’-bipiridinium-dimetil-szulfát [2] | 217-615-7
[1] 218-196-3 [2] |
1910-42-5
[1] 2074-50-2 [2] |
Acute
Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * STOT SE 3 STOT RE 1 Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H311 H301 H335 H372 ** H315 H319 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H311 H301 H372 ** H319 H335 H315 H410 |
CLP00 | |||
| 613-091-00-2 | morfamquat
dichloride [1] morfamquat sulfate [2] |
morfamkvat-diklorid; [1] morfamkvat-szulfát [2] | 225-062-8
[1] |
4636-83-3
[1] 29873-36-7 [2] |
Acute
Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Aquatic Chronic 3 |
H302 H335 H315 H319 H412 |
GHS07 Wng |
H302 H319 H335 H315 H412 |
CLP00 | |||
| 613-092-00-8 | 1,10-phenanthroline | 1,10-fenantrolin | 200-629-2 | 66-71-7 | Acute
Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
CLP00 | |||
| 613-093-00-3 | hexasodium 6,13-dichloro-3,10-bis((4-(2,5-disulfonatoanilino)-6-fluoro-1,3,5-triazin-2-ylamino)prop-3-ylamino)-5,12-dioxa-7,14-diazapentacene-4,11-disulfonate | hexanátrium-6,13-diklór-3,10-bisz((4-(2,5-diszulfonátoanilino)-6-fluor-1,3,5- triazin-2-ilamino)prop-3-ilamino)-5,12-dioxa-7,14-diazapentacén-4,11-diszulfonát | 400-050-7 | 85153-92-0 | Resp.
Sens. 1 Skin Sens. 1 |
H334 H317 |
GHS08 Dgr |
H334 H317 |
CLP00 | |||
| 613-094-00-9 | 4-methoxy-N,6-dimethyl-1,3,5-triazin-2-ylamine | 4-metoxi-N,6-dimetil-1,3,5-triazin-2-il-amin | 401-360-5 | 5248-39-5 | Acute
Tox. 4 * STOT RE 2 * |
H302 H373 ** |
GHS08 GHS07 Wng |
H302 H373 ** |
CLP00 | |||
| 613-095-00-4 | sodium 3-(2H-benzotriazol-2-yl)-5-sec-butyl-4-hydroxybenzenesulfonate | nátrium-3-(2H-benzotriazol-2-il)-5-szek-butil-4-hidroxibenzolszulfonát | 403-080-9 | 92484-48-5 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | |||
| 613-096-00-X | 2-amino-6-ethoxy-4-methylamino-1,3,5-triazine | 2-amino-6-etoxi-4-metilamino-1,3,5-triazin | 403-580-7 | 62096-63-3 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 613-097-00-5 | 7-amino-3-((5-carboxymethyl-4-methyl-1,3-thiazol-2-ylthio)methyl)-8-oxo-5-thia-1-azabicyclo(4.2.0)oct-2-ene-2-carboxylic acid | 7-amino-3-((5-karboximetil-4-metil-1,3-tiazol- 2-iltio)metil)-8-oxo-5-tia-1-azabiciklo(4.2.0)okt-2-én-2-karbonsav | 403-690-5 | 111298-82-9 | Resp.
Sens. 1 Skin Sens. 1 Aquatic Chronic 3 |
H334 H317 H412 |
GHS08 Dgr |
H334 H317 H412 |
CLP00 | |||
| 613-098-00-0 | N-(n-octyl)-2-pyrrolidone | N-(n-oktil)-2-pirrolidon | 403-700-8 | 2687-94-7 | Skin
Corr. 1B Aquatic Chronic 2 |
H314 H411 |
GHS05 GHS09 Dgr |
H314 H411 |
CLP00 | |||
| 613-099-00-6 | 1-dodecyl-2-pyrrolidone | 1-dodecil-2-pirrolidon | 403-730-1 | 2687-96-9 | Skin
Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H410 |
CLP00 | |||
| 613-100-00-X | 2,9-bis(3-(diethylamino)propylsulfamoyl)quino(2,3-b)acridine-7,14-dione | 2,9-bisz(3-(dietilamino)propilszulfamoil)kino(2,3-b)akridin-7,14-dion | 404-230-6 | Skin
Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
CLP00 | ||||
| 613-101-00-5 | N-tert-pentyl-2-benzothiazolesulfenamide | N–terc-pentil-2-benzotiazolszulfénamid | 404-380-2 | 110799-28-5 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
CLP00 | |||
| 613-102-00-0 | dimethomorph (ISO); 4-(3-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)acryloyl)morpholine | dimetomorf (ISO); 4-(3-(4-klórfenil)-3-(3,4-dimetoxifenil)akriloil)morfolin | 404-200-2 | 110488-70-5 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 613-103-00-6 | sodium 5-n-butylbenzotriazole | nátrium-5-n-butilbenzotriazol | 404-450-2 | 118685-34-0 | Acute
Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H302 H314 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H317 H411 |
CLP00 | |||
| 613-104-00-1 | 5-tert-butyl-3-isoxazolylamine hydrochloride | 5-terc-butil-3-izoxazolil-amin-hidroklorid | 404-840-2 | Acute
Tox. 4 * STOT RE 2 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H373 ** H318 H412 |
GHS08 GHS05 GHS07 Dgr |
H302 H373 ** H318 H412 |
CLP00 | ||||
| 613-105-00-7 | hexakis(tetramethylammonium) 4,4'-vinylenebis((3-sulfonato-4,1-phenylene)imino(6-morpholino-1,3,5-triazine-4,2-diyl)imino)bis(5-hydroxy-6-phenylazonaphthalene-2,7-disulfonate) | hexakisz(tetrametilammónium)-4,4’-vinilénbisz((3-szulfonáto-4,1- fenilén)imino) (6-morfolino-1,3,5-triazin-4,2-diil)imino) bisz(5-hidroxi-6- fenilazonaftalin-2,7-diszulfonát) | 405-160-9 | 124537-30-0 | Acute
Tox. 3 * Skin Sens. 1 Aquatic Chronic 3 |
H301 H317 H412 |
GHS06 Dgr |
H301 H317 H412 |
CLP00 | |||
| 613-106-00-2 | tetrapotassium 2-(4-(5-(1-(2,5-disulfonatophenyl)-3-ethoxycarbonyl-5-hydroxypyrazol-4-yl)penta-2,4-dienylidene)-3-ethoxycarbonyl-5-oxo-2-pyrazolin-1-yl)benzene-1,4-disulfonate | tetrakálium-2-(4-(5-(1-(2,5-diszulfonátofenil)-3-etoxikarbonil-5-hidroxipirazol-4-il)penta-2,4-dienilidén)-3-etoxikarbonil-5-oxo-2-pirazolin-1-il)-benzol-1,4-diszulfonát | 405-240-3 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | ||||
| 613-107-00-8 | hexasodium 2,2'-vinylenebis((3-sulfonato-4,1-phenylene)imino(6-(N-cyanoethyl-N-(2-hydroxypropyl)amino)-1,3,5-triazine-4,2-diyl)imino)dibenzene-1,4-disulfonate | hexanátrium-2,2’-vinilénbisz((3-szulfonáto-4,1-fenilén)imino(6-(N-cianoetil-N-(2-hidroxipropil)amino)-1,3,5-triazin-4,2-diil)imino)dibenzol-1,4-diszulfonát | 405-280-1 | 76508-02-6 | Eye
Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
CLP00 | |||
| 613-108-00-3 | benzothiazole-2-thiol | benzotiazol-2-tiol | 205-736-8 | 149-30-4 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
CLP00 | |||
| 613-109-00-9 | bis(piperidinothiocarbonyl) disulphide | bisz(piperidinotiokarbonil) diszulfide | 202-328-1 | 94-37-1 | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H335 H315 H319 H317 |
GHS07 Wng |
H319 H335 H315 H317 |
CLP00 | |||
| 613-110-00-4 | dimepiperate (ISO); S-(1-methyl-1-phenylethyl) piperidine-1-carbothioate | dimepiperát (ISO); S-(1-metil-1-feniletil) piperidin-1-karbotioát | 262-784-2 | 61432-55-1 | Acute
Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
CLP00 | |||
| 613-111-00-X | 1,2,4-triazole | 1,2,4-triazol | 206-022-9 | 288-88-0 | Repr.
2 Acute Tox. 4 * Eye Irrit. 2 |
H361d
*** H302 H319 |
GHS08 GHS07 Wng |
H361d
*** H302 H319 |
CLP00 | |||
| 613-112-00-5 | octhilinone (ISO); 2-octyl-2H-isothiazol-3-one; [OIT] | oktilinon (ISO); 2-oktil-2H-izotiazol-3-on | 247-761-7 | 26530-20-1 | Acute
Tox. 2 Acute Tox. 3 Acute Tox. 3 Skin Corr. 1 Eye Dam. 1 Skin Sens. 1A Aquatic Acute 1 Aquatic Chronic 1 |
H330 H311 H301 H314 H318 H317 H400 H410 |
GHS06 GHS05 GHS09 Dgr |
H330 H311 H301 H314 H317 H410 |
EUH071 |
Inhalation:
ATE = 0.27 mg/L (dusts/mists) Dermal: ATE = 311 mg/kg Oral: ATE = 125 mg/kg Skin Sens. 1A; : C ≥ ,0015 % M=100 M=100 |
CLP00/ATP15 | |
| 613-113-00-0 | 2-(morpholinothio)benzothiazole | 2-(morfolinotio)benzotiazol | 203-052-4 | 102-77-2 | Skin
Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H315 H319 H317 H411 |
GHS07 GHS09 Wng |
H319 H315 H317 H411 |
CLP00 | |||
| 613-114-00-6 | 2,2',2"-(hexahydro-1,3,5-triazine-1,3,5-triyl)triethanol; 1,3,5-tris(2-hydroxyethyl)hexahydro-1,3,5-triazine | 2,2’,2”-(hexahidro-1,3,5-triazin-1,3,5-triil)trietanol; 1,3,5-trisz(2-hidroxietil)hexahidro-1,3,5-triazin | 225-208-0 | 4719-04-4 | Acute
Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
Skin
Sens. 1; H317: C ≥ 0,1 % |
CLP00 | ||
| 613-115-00-1 | hymexazol (ISO); 3-hydroxy-5-methylisoxazole | himexazol (ISO); 3-hidroxi-5-metilizoxazol | 233-000-6 | 10004-44-1 | Repr.
2 Acute Tox. 4 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H361d H302 H318 H317 H411 |
GHS08 GHS07 GHS05 GHS09 Dgr |
H302 H318 H317 H361d H411 |
Oral:
ATE = 1600 mg/kg |
CLP00/ATP15 | ||
| 613-116-00-7 | tolylfluanid (ISO); dichloro-N- [(dimethylamino)sulphonyl]fluoro-N-(p-tolyl)methanesulphenamide; [containing ≥ 0.1 % (w/w) of particles with an aerodynamic diameter of below 50 µm] | tolilfluanid (ISO); diklór-N-[(dimetilamino)szulfonil]fluor-N-(p-tolil)metánszulfénamid; [≥ 0,1 % (w/w) 50 μm-nél kisebb aerodinamikai átmérőjű részecskét tartalmaz] | 211-986-9 | 731-27-1 | Acute
Tox. 2 * STOT SE 3 STOT RE 1 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 |
H330 H335 H372 ** H315 H319 H317 H400 |
GHS06 GHS08 GHS09 Dgr |
H330 H315 H319 H317 H335 H372 ** H400 |
M=10 |
CLP00/ATP01 | ||
| 613-116-01-4 | tolylfluanid (ISO); dichloro-N-[(dimethylamino)sulphonyl]fluoro-N-(p-tolyl)methanesulphenamide; [containing < 0.1% (w/w) of particles with an aerodynamic diameter of below 50 μm] | tolilfluanid (ISO); diklór-N-[(dimetilamino)szulfonil]fluor-N-(p-tolil)metánszulfénamid; [< 0,1 % (w/w) 50 μm-nél kisebb aerodinamikai átmérőjű részecskét tartalmaz] | 211-986-9 | 731-27-1 | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 |
H335 H315 H319 H317 H400 |
GHS07 GHS09 Wng |
H319 H335 H315 H317 H400 |
M=10 |
ATP01 | ||
| 613-117-00-2 | diniconazole (ISO); (E)-β-[(2,4-dichlorophenyl)methylene]-α-(1,1-dimethylethyl)-1H-1,2,4-triazol-1-ethanol; (E)-(RS)-1-(2,4-dichlorophenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1-yl)pent-1-en-3-ol | dinikonazol (ISO); (E)-β-[(2,4-diklórfenil)metilén]-α-(1,1-dimetil etil)-1H-1,2,4-triazol-1-etanol; (E)-(RS)-1-(2,4-diklórfenil)-4,4-dimetil-2-(1H-1,2,4-triazol-1-il)pent-1-én-3-ol | 76714-88-0 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | ||||
| 613-118-00-8 | flubenzimine (ISO); N-[3-phenyl-4,5-bis[(trifluoromethyl)imino]thiazolidin-2-ylidene]aniline | flubenzimin (ISO); N-[3-fenil-4,5-bisz[(trifluormetil)imino]tiazolidin-2-ilidén]anilin | 253-703-1 | 37893-02-0 | Eye
Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H400 H410 |
GHS07 GHS09 Wng |
H319 H410 |
CLP00 | |||
| 613-119-00-3 | (benzothiazol-2-ylthio)methyl thiocyanate; TCMTB | (benzotiazol-2-iltio)metil-tiocianát; TCMTB | 244-445-0 | 21564-17-0 | Acute
Tox. 2 * Acute Tox. 4 * Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H302 H315 H319 H317 H400 H410 |
GHS06 GHS09 Dgr |
H330 H302 H319 H315 H317 H410 |
CLP00 | |||
| 613-120-00-9 | bioresmethrin (ISO); (5-benzyl-3-furyl)methyl (1R)-2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropanecarboxylate | biorezmetrin (ISO); (5-benzil-3-furil)metil(1R)-2,2-dimetil-3-(2-metilprop-1-en-1-il)-ciklopropánkarboxilát | 249-014-0 | 28434-01-7 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
M=1000 |
CLP00/ATP01corr | ||
| 613-121-00-4 | chlorsulfuron (ISO); 2-chloro-N-[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)amino]carbonyl]benzenesulphonamide | klórszulfuron (ISO); 2-klór-N-[[(4-metoxi-6-metil-1,3,5-triazin-2- il)amino]karbonil]benzolszulfonamid | 265-268-5 | 64902-72-3 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
M=1000 M=100 |
CLP00/ATP09 | ||
| 613-122-00-X | diclobutrazole (ISO); (R*, R*)-(±)-β-[(2,4-dichlorophenyl)methyl]-α-(1,1-dimethylethyl)-1H-1,2,4-triazole-1-ethanol; (2RS, 3RS)-1-(2,4-dichlorophenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1yl)pentan-3-ol | diklobutrazol (ISO); (R*,R*)-(+/-)[(2,4-diklórfenil)metil]-α-(1,1-dimetiletil)-1H-1,2,4-triazol-1-etanol; (2RS, 3RS)-1-(2,4-diklórfenil)-4,4-dimetil-2-(1H-1,2,4-triazol-1-il)pentán-3-ol | 75736-33-3 | Eye
Irrit. 2 Aquatic Chronic 2 |
H319 H411 |
GHS07 GHS09 Wng |
H319 H411 |
CLP00 | ||||
| 613-123-00-5 | 5,6-dihydro-3H-imidazo[2,1-c]-1,2,4-dithiazole-3-thione; etem | 5,6-dihidro-3H-imidazo[2,1-c]-1,2,4-ditiazol-3-tion; etem | 251-684-4 | 33813-20-6 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | |||
| 613-124-00-0 | fenpropimorph (ISO); cis-4-[3-(p-tert-butylphenyl)-2-methylpropyl]-2,6-dimethylmorpholine | fenpropimorf (ISO); cisz-4-[3-(p-terc-butilfenil)-2-metilpropil]2,6-dimetilmorfolin | 266-719-9 | 67564-91-4 | Repr.
2 Acute Tox. 4 * Skin Irrit. 2 Aquatic Chronic 2 |
H361d
*** H302 H315 H411 |
GHS08 GHS07 GHS09 Wng |
H361d
*** H302 H315 H411 |
CLP00 | |||
| 613-125-00-6 | hexythiazox (ISO); trans-5-(4-chlorophenyl)-N-cyclohexyl-4-methyl-2-oxo-3-thiazolidine-carboxamide | hexitiazox (ISO); transz-5-(4-klórfenil)-N-ciklohexil-4-metil-2-oxo-3-tiazolidin-karboxamid | 78587-05-0 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
M=1 M=1 |
CLP00/ATP15 | |||
| 613-126-00-1 | imazapyr (ISO); 2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-3-pyridine carboxylate | imazapir (ISO); 2-[4,5-dihidro-4-metil-4-(1-metiletil)-5-oxo-1H-imidazol-2-il]-3-piridin-karboxilát | 81334-34-1 | Eye
Irrit. 2 Aquatic Chronic 3 |
H319 H412 |
GHS07 Wng |
H319 H412 |
CLP00 | ||||
| 613-127-00-7 | 1,1-dimethylpiperidinium chloride; mepiquat chloride | 1,1-dimetilpiperidínium-klorid; mepikvat-klorid | 246-147-6 | 24307-26-4 | Acute
Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
CLP00 | |||
| 613-128-00-2 | prochloraz (ISO); N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]-1H-imidazole-1-carboxamide | prokloraz (ISO); N-propil-N-[2-(2,4,6-triklórfenoxi)etil]-1H-imidazol-1-karboxamid | 266-994-5 | 67747-09-5 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | |||
| 613-129-00-8 | metamitron (ISO); 4-amino-3-methyl-6-phenyl-1,2,4-triazin-5-one | metamitron (ISO); 4-amino-3-metil-6-fenil-1,2,4-triazin-5-on | 255-349-3 | 41394-05-2 | Acute
Tox. 4 * Aquatic Acute 1 |
H302 H400 |
GHS07 GHS09 Wng |
H302 H400 |
CLP00 | |||
| 613-131-00-9 | pyroquilon (ISO); 1,2,5,6-tetrahydropyrrolo[3,2,1-ij]quinolin-4-one | pirrokilon (ISO); 1,2,5,6-tetrahidropirrolo[3,2,1-ij]kinolin-4-on | 57369-32-1 | Acute
Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
CLP00 | ||||
| 613-132-00-4 | hexazinone (ISO); 3-cyclohexyl-6-dimethylamino-1-methyl-1,2,3,4-tetrahydro-1,3,5-triazine-2,4-dione | hexazinon (ISO); 3-ciklohexil-6-dimetilamino-1-metil-1,2,3,4-tetrahidro-1,3,5-triazin-2,4-dion | 257-074-4 | 51235-04-2 | Acute
Tox. 4 * Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H410 |
CLP00 | |||
| 613-133-00-X | etridiazole (ISO); 5-ethoxy-3-trichloromethyl-1,2,4-thiadiazole | etridiazol (ISO); 5-etoxi-3-triklór-metil-1,2,4-tiadiazol | 219-991-8 | 2593-15-9 | Carc.
2 Acute Tox. 4 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H317 H351 H410 |
M=1 M=1 |
CLP00/ATP07 | ||
| 613-134-00-5 | myclobutanil (ISO); 2-(4-chlorophenyl)-2-(1H-1,2,4-triazol-1-ylmethyl)hexanenitrile | miklobutanil (ISO); 2-(4-klórfenil)-2-(1H-1,2,4-triazol-1-ilmetil)hexánnitril | 88671-89-0 | Repr.
2 Acute Tox. 4 * Eye Irrit. 2 Aquatic Chronic 2 |
H361d
*** H302 H319 H411 |
GHS08 GHS07 GHS09 Wng |
H361d
*** H302 H319 H411 |
CLP00 | ||||
| 613-135-00-0 | di(benzothiazol-2-yl) disulphide | di(benztiazol-2-il)-diszulfid | 204-424-9 | 120-78-5 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
EUH031 |
CLP00 | ||
| 613-136-00-6 | N-cyclohexylbenzothiazole-2-sulphenamide | N-ciklohexilbenzotiazol-2-szulfénamid | 202-411-2 | 95-33-0 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
CLP00 | |||
| 613-137-00-1 | methabenzthiazuron (ISO); 1-(1,3-benzothiazol-2-yl)1,3-dimethylurea | metabenztiazuron (ISO); 1-(1,3-benzotiazol-2-il)1,3-dimetilkarbamid | 242-505-0 | 18691-97-9 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 613-138-00-7 | quinoxyfen (ISO); 5,7-dichloro-4-(4-fluorophenoxy)quinoline | kinoxifen (ISO); 5,7-diklór-4-(4-fluorfenoxi)kinolin | 124495-18-7 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
CLP00 | ||||
| 613-139-00-2 | metsulfuron-methyl (ISO); methyl 2-{[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoyl]sulfamoyl}benzoate | metszulfuron-metil (ISO); metil-2-{[(4-metoxi-6-metil-1,3,5-triazin-2-il)karbamoil]szulfamoil}benzoát | 74223-64-6 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
M=1000 |
CLP00/ATP01corr | |||
| 613-140-00-8 | cycloheximide (ISO); 4-{}{(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl}}piperidine-2,6-dione | cycloheximid (ISO); 4-{(2R)-2-[(1S,3S,5S)-3,5-dimetil-2-oxociklohexil]-2-hidroxietil}piperidin-2,6-dion | 200-636-0 | 66-81-9 | Muta.
2 Repr. 1B Acute Tox. 2 * Aquatic Chronic 2 |
H341 H360D *** H300 H411 |
GHS06 GHS08 GHS09 Dgr |
H341 H360D *** H300 H411 |
CLP00 | |||
| 613-141-00-3 | 1,4-diamino-2-(2-butyltetrazol-5-yl)-3-cyanoanthraquinone | 1,4-diamino-2-(2-butiltetrazol-5-il)-3-cianoantrakinon | 401-470-3 | 93686-63-6 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 613-142-00-9 | trans-N-methyl-2-styryl-[4'-aminomethine-(1-acetyl-1-(2-methoxyphenyl)acetamido)]pyridinium acetate | transz–N-metil-2-sztiril-[4’-aminometin-(1-acetil-1-(2-metoxifenil)acetamido)]piridínium-acetát | 405-860-4 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | ||||
| 613-143-00-4 | 1-(3-phenylpropyl)-2-methylpyridinium bromide | 1-(3-fenilpropil)-2-metilpiridínium-bromid | 405-930-4 | 10551-42-5 | Acute
Tox. 4 * Eye Irrit. 2 Aquatic Chronic 3 |
H302 H319 H412 |
GHS07 Wng |
H302 H319 H412 |
CLP00 | |||
| 613-144-00-X | Reaction products of: poly(vinyl acetate), partially hydrolyzed, with (E)-2-(4-formylstyryl)-3,4-dimethylthiazoliummethyl sulfate | poli(vinil-acetát) (részlegesen hidrolizált) és (E)-2-(4-formilsztiril)-3,4-dimetiltiazólium-metilszulfát reakciótermékei | 406-460-2 | 125139-08-4 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | ||||
| 613-145-00-5 | (S)-3-benzyloxycarbonyl-1,2,3,4-tetrahydro-isoquinolinium 4-methylbenzenesulfonate | (S)-3-benziloxikarbonil-1,2,3,4-tetrahidro-izokinolínium-4-metilbenzolszulfonát | 406-960-0 | 77497-97-3 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 613-146-00-0 | N-ethyl-N-methylpiperidinium iodide | N-etil-N-metilpiperidínium jodid | 407-780-5 | 4186-71-4 | Acute
Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
CLP00 | |||
| 613-147-00-6 | 4-[2-(1-methyl-2-(4-morpholinyl)ethoxy)ethyl]morpholine | 4-[2-(1-metil-2-(4-morfolinil)etoxi)etil]morfolin | 407-940-4 | 111681-72-2 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | |||
| 613-148-00-1 | tetrasodium 1,2-bis(4-fluoro-6-[5-(1-amino-2-sulfonatoanthrachinon-4-ylamino)-2,4,6-trimethyl-3-sulfonatophenylamino]-1,3,5-triazin-2-ylamino)ethane | tetranátrium-1,2-bisz[4-fluor-6-[5-(1-amino-2-szulfonátoantra-kinon-4-ilamino)-2,4,6-trimetil-3-szulfonátofenilamino]-1,3,5-triazin-2-ilamino]etán | 411-240-4 | 143683-23-2 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
CLP00 | |||
| 613-149-00-7 | pyridaben (ISO); 2-tert-butyl-5-(4-tert-butylbenzylthio)-4-chloropyridazin-3(2H)-one | piridaben (ISO); 2-terc-butil-5-(4-terc-butil-benzil-tio)-4-klór-piridazin-3(2H)-on | 405-700-3 | 96489-71-3 | Acute
Tox. 3 Acute Tox. 3 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H410 |
M=1000 M=1000 |
CLP00/ATP07 | ||
| 613-150-00-2 | 2,2'-[3,3'-(piperazine-1,4-diyl)dipropyl]bis(1H-benzimidazo[2,1-b]benzo[l,m,n][3,8]phenanthroline-1,3,6-trione | 2,2’-[3,3’-(piperazin-1,4-diil)dipropil]bisz(1H-benzimidazo[2,1-b]benzo[l, m,n][3,8]fenantrolin-1,3,6-trion | 406-295-6 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | |||||
| 613-151-00-8 | 1-(3-mesyloxy-5-trityloxymethyl-2-D-threofuryl)thymine | 1-(3-meziloxi-5-tritiloximetil-2-D-treofuril)timin | 406-360-9 | 104218-44-2 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 613-152-00-3 | phenyl N-(4,6-dimethoxypyrimidin-2-yl)carbamate | fenil-N-(4,6-dimetoxipirimidin-2-il)-karbamát | 406-600-2 | 89392-03-0 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | |||
| 613-153-00-9 | 2,3,5-trichloropyridine | 2,3,5-triklórpiridin | 407-270-2 | 16063-70-0 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | ||||
| 613-154-00-4 | 2-amino-4-chloro-6-methoxypyrimidine | 2-amino-4-klór-6-metoxipirimidin | 410-050-9 | 5734-64-5 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 613-155-00-X | 5-chloro-2,3-difluoropyridine | 5-klór-2,3-difluoropiridin | 410-090-7 | 89402-43-7 | Flam.
Liq. 3 Acute Tox. 4 * Aquatic Chronic 3 |
H226 H302 H412 |
GHS02 GHS07 Wng |
H226 H302 H412 |
CLP00 | |||
| 613-156-00-5 | 2-butyl-4-chloro-5-formylimidazole | 2-butil-4-klór-5-formilimidazol | 410-260-0 | 83857-96-9 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | |||
| 613-157-00-0 | 2,4-diamino-5-methoxymethylpyrimidine | 2,4-diamino-5-methoximetilpirimidin | 410-330-0 | 54236-98-5 | Acute
Tox. 4 * STOT RE 2 * Eye Irrit. 2 |
H302 H373 ** H319 |
GHS08 GHS07 Wng |
H302 H373 ** H319 |
CLP00 | |||
| 613-158-00-6 | 2,3-dichloro-5-trifluoromethyl-pyridine | 2,3-diklór-5- trifluormetilpiridin | 410-340-5 | 69045-84-7 | Acute
Tox. 4 * Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H332 H302 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H332 H302 H318 H317 H411 |
CLP00 | |||
| 613-159-00-1 | fenazaquin (ISO); 4-[2-[4-(1,1-dimethylethyl)phenyl]-ethoxy]quinazoline | fenazakvin (ISO); 4-[2-[4-(1,1-dimetiletil)fenil]-etoxi]kinazolin | 410-580-0 | 120928-09-8 | Acute
Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H332 H400 H410 |
GHS06 GHS09 Dgr |
H301 H332 H410 |
CLP00 | |||
| 613-160-00-7 | (1S)-2-methyl-2,5-diazobicyclo[2.2.1]heptane dihydrobromide | (1S)-2-metil-2,5-diazobiciklo[2.2.1]heptán-dihidrobromid | 411-000-9 | 125224-62-6 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 613-161-00-2 | (2,4-diaminopteridin-6-yl)methanol hydrobromide | (2,4-diaminopteridin-6-il)metanol-hidrobromid | 430-620-0 | 76145-91-0 | STOT
RE 2 * Skin Sens. 1 Aquatic Chronic 3 |
H373
** H317 H412 |
GHS08 GHS07 Wng |
H317 H373 ** H412 |
ATP01/ATP01corr | |||
| 613-162-00-8 | (6R-trans)-1-((7-ammonio-2-carboxylato-8-oxo-5-thia-1-azabicyclo-[4.2.0]oct-2-en-3-yl)methyl)pyridinium iodide | (6R-transz)-1-((7-ammónio-2-karboxiláto-8-oxo-5-tia-1-azabiciklo-[4.2.0]okt-2-én-3-il)metil)piridinium-jodid | 423-260-0 | 100988-63-4 | Muta.
2 Skin Sens. 1 Aquatic Chronic 2 |
H341 H317 H411 |
GHS08 GHS07 GHS09 Wng |
H341 H317 H411 |
ATP01 | |||
| 613-163-00-3 | azimsulfuron (ISO); 1-(4,6-dimethoxypyrimidin-2-yl)-3-[1-methyl-4-(2-methyl-2H-tetrazol-5-yl)pyrazol-5-ylsulfonyl]urea | azimszulfuron (ISO); 1-(4,6-dimetoxi-pirimidin-2-il)-3-[1-metil-4-(2-metil-2H-tetrazol-5-il)pirazol-5-ilszulfonil]karbamid | - | 120162-55-2 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
M=1000 |
CLP00/ATP01 | ||
| 613-164-00-9 | flufenacet (ISO); N-(4-fluorophenyl)-N-isopropyl-2-(5-trifluoromethyl-[1,3,4]thiadiazol-2-yloxy)acetamide | flufenacet (ISO); N-(4-fluorfenil)-N-izopropil-2-(5-trifluormetil-[1,3,4]tiadiazol-2-iloxi)acetamid | - | 142459-58-3 | Acute
Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H317 H410 |
M=100 |
CLP00/ATP01 | ||
| 613-165-00-4 | flupyrsulfuron-methyl-sodium (ISO); methyl 2-[[(4,6-dimethoxypyrimidin-2-ylcarbamoyl)sulfamoyl]-6-trifluoromethyl]nicotinate, monosodium salt | flupirszulfuron-metil-nátrium (ISO); metil 2-[[(4,6-dimetoxipirimidin-2-ilkarbamoil)szulfamoil]-6-trifluormetil]nikotinát, mononátrium-só | - | 144740-54-5 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
M=100 |
CLP00/ATP01 | ||
| 613-166-00-X | flumioxazin (ISO); 2-[7-fluoro-3-oxo-4-(prop-2-yn-1-yl)-3,4-dihydro-2H-1,4-benzoxazin-6-yl]-4,5,6,7-tetrahydro-1H-isoindole-1,3(2H)-dione | flumioxazin
(ISO); 2-[7-fluor-3-oxo-4-(prop-2-in-1-il)-3,4-dihidro-2H-1,4-benzoxazin-6-il]-4,5,6,7-tetrahidro-1H-izoindol-1,3(2H)-dion |
103361-09-7 | Repr.
1B Aquatic Acute 1 Aquatic Chronic 1 |
H360D H400 H410 |
GHS08 GHS09 Dgr |
H360D H410 |
M=1000 M=1000 |
CLP00/ATP09 | |||
| 613-167-00-5 | reaction mass of 5-chloro-2-methyl-2H-isothiazol-3-one and 2-methyl-2H-isothiazol-3-one (3:1) | 5-klór-2-metil-2H-izotiazol-3-on és 2-metil-2H-izotiazol-3-on (3:1) keveréke | 55965-84-9 | Acute
Tox. 2 Acute Tox. 2 Acute Tox. 3 Skin Corr. 1C Eye Dam. 1 Skin Sens. 1A Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H301 H314 H318 H317 H400 H410 |
GHS06 GHS05 GHS09 Dgr |
H330 H310 H301 H314 H317 H410 |
EUH071 |
Skin
Corr. 1C; : C ≥ ,6 % Skin Irrit. 2; H315: ,06 % ≤ C < ,6 % Eye Dam. 1; : C ≥ ,6 % Eye Irrit. 2; H319: ,06 % ≤ C < ,6 % Skin Sens. 1A; : C ≥ ,0015 % M=100 M=100 |
B | CLP00/ATP13 | |
| 613-168-00-0 | 1-vinyl-2-pyrrolidone | 1-vinil-2-pirrolidon | 201-800-4 | 88-12-0 | Carc.
2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 STOT RE 2 * Eye Dam. 1 |
H351 H332 H312 H302 H335 H373 ** H318 |
GHS06 GHS05 GHS09 Dgr |
H351 H332 H312 H302 H373 ** H335 H318 |
D | CLP00 | ||
| 613-169-00-6 | 9-vinylcarbazole | 9-vinilkarbazol | 216-055-0 | 1484-13-5 | Muta.
2 Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H341 H312 H302 H315 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H341 H312 H302 H315 H317 H410 |
M=100 |
CLP00/ATP01 | ||
| 613-170-00-1 | 2,2-ethylmethylthiazolidine | 2,2-etilmetiltiazolidin | 404-500-3 | 694-64-4 | Acute
Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H302 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H317 H411 |
CLP00 | |||
| 613-171-00-7 | hexaconazole (ISO); (RS)-2-(2,4-dichlorophenyl)-1-(1H-1,2,4-triazol-1-yl)hexan-2-ol | hexakonazol (ISO);(RS)-2-(2,4-diklórfenil)-1-(1H-1,2,4-triazol-1-il)hexán-2-ol | 413-050-7 | 79983-71-4 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
CLP00 | |||
| 613-172-00-2 | 5-chloro-1,3-dihydro-2H-indol-2-one | 5-klór-1,3-dihidro-2H-indol-2-on | 412-200-9 | 17630-75-0 | Repr.
2 Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 3 |
H361f
*** H302 H317 H412 |
GHS08 GHS07 Wng |
H361f
*** H302 H317 H412 |
CLP00 | |||
| 613-173-00-8 | fluquinconazole (ISO); 3-(2,4-dichlorophenyl)-6-fluoro-2-(1H-1,2,4-triazol-1-yl)quinazolin-4-(3H)-one | flukvinkonazol (ISO); 3-(2,4-diklórfenil-6-fluor-2-(1H-1,2,4-triazol-1-il)kinazolin-4-(3H)-on | 411-960-9 | 136426-54-5 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * STOT RE 1 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H312 H372 ** H315 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H331 H301 H372 ** H312 H315 H410 |
CLP00 | |||
| 613-174-00-3 | tetraconazole (ISO); (±) 2-(2,4-dichlorophenyl)-3-(1H-1,2,4-triazol-1-yl)propyl-1,1,2,2-tetrafluoroethylether | tetrakonazol
(ISO); (±)-2-(2,4-diklórfenil)-3-(1H-1,2,4-triazol-1-il)propil-1,1,2,2-tetrafluoretil-éter |
407-760-6 | 112281-77-3 | Acute
Tox. 4 * Acute Tox. 4 * Aquatic Chronic 2 |
H332 H302 H411 |
GHS07 GHS09 Wng |
H332 H302 H411 |
CLP00/ATP01 | |||
| 613-175-00-9 | epoxiconazole (ISO); (2RS,3SR)-3-(2-chlorophenyl)-2-(4-fluorophenyl)-[( 1H-1,2,4-triazol-1-yl)methyl]oxirane | epoxikonazol (ISO); (2RS,3SR)-3-(2-klórfenil)-2-(4-fluorfenil)-[(1H-1,2,4-triazol-1-il)metil]oxirán | 406-850-2 | 133855-98-8 | Carc.
2 Repr. 1B Aquatic Chronic 2 |
H351 H360Df H411 |
GHS08 GHS09 Dgr |
H351 H360Df H411 |
CLP00/ATP05 | |||
| 613-176-00-4 | 2-methyl-2-azabicyclo[2.2.1]heptane | 2-metil-2-azabiciklo[2.2.1]heptán | 404-810-9 | 4524-95-2 | Flam.
Liq. 3 Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B |
H226 H312 H302 H373 ** H314 |
GHS02 GHS08 GHS05 GHS07 Dgr |
H226 H312 H302 H373 ** H314 |
CLP00 | |||
| 613-177-00-X | 8-amino-7-methylquinoline | 8-amino-7-metilkinolin | 412-760-4 | 5470-82-6 | Acute
Tox. 4 * Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H312 H302 H317 H411 |
GHS07 GHS09 Wng |
H312 H302 H317 H411 |
CLP00 | |||
| 613-178-00-5 | 4-ethyl-2-methyl-2-isopentyl-1,3-oxazolidine | 4-etil-2-metil-2-izopentil-1,3-oxazolidin | 410-470-2 | 137796-06-6 | Skin
Corr. 1B Skin Sens. 1 |
H314 H317 |
GHS05 GHS07 Dgr |
H314 H317 |
STOT
SE 3; H335: C ≥ 5 % |
CLP00 | ||
| 613-179-00-0 | lithium 3-oxo-1,2(2H)-benzisothiazol-2-ide | lítium-3-oxo-1,2(2H)-benzizotiazol-2-id | 411-690-1 | 111337-53-2 | Acute
Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H302 H314 H317 H411 |
GHS05 GHS07 Dgr |
H302 H314 H317 H411 |
CLP00 | |||
| 613-180-00-6 | N-(1,1-dimethylethyl)bis(2-benzothiazolesulfen)amide | N-(1,1-dimetiletil)bisz(2-benzotiazolszulfén)amid | 407-430-1 | 3741-80-8 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 613-181-00-1 | 5,5-dimethyl-perhydro-pyrimidin-2-one α-(4-trifluoromethylstyryl)-α-(4-trifluoromethyl)cinnamylidenehydrazone | 5,5-dimetil-perhidropirimidin-2-on-α-(4-trifluormetilsztiril)-α-(4-trifluormetil)cinnamilidénhidrazon | 405-090-9 | 67485-29-4 | Acute
Tox. 4 * STOT RE 1 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H372 ** H319 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H372
** H302 H319 H410 |
CLP00 | |||
| 613-182-00-7 | 1-(1-naphthylmethyl)quinolinium chloride | 1-(1-naftilmetil)kinolínium-klorid | 406-220-7 | 65322-65-8 | Carc.
2 Muta. 2 Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H351 H341 H302 H315 H318 H412 |
GHS08 GHS05 GHS07 Dgr |
H351 H341 H302 H315 H318 H412 |
CLP00 | |||
| 613-183-00-2 | reaction mass of: 5-(N-methylperfluorooctylsulfonamido)methyl-3-octadecyl-1,3-oxazolidin-2-one; 5-(N-methylperfluoroheptylsulfonamido)methyl-3-octadecyl-1,3-oxazolidin-2-one | 5-(N-metilperfluoroktilszulfonamido)metil-3-oktadecil-1,3-oxazolidin-2-on; 5-(N-metilperfluorheptilszulfonamido)metil-3-oktadecil-1,3-oxazolidin-2-on keveréke |
413-640-4 | STOT
RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H373
** H400 H410 |
GHS08 GHS09 Wng |
H373
** H410 |
CLP00 | ||||
| 613-184-00-8 | nitrilotriethyleneammoniopropane-2-ol 2-ethylhexanoate | nitrilotrietilénammóniopropán-2-ol-2-etilhexanoát | 413-670-8 | Eye
Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
CLP00 | ||||
| 613-185-00-3 | 2,3,5,6-tetrahydro-2-methyl-2H-cyclopenta[d]-1,2-thiazol-3-one | 2,3,5,6-tetrahidro-2-metil-2H-ciklopenta[d]-1,2-tiazol-3-on | 407-630-9 | 82633-79-2 | Acute
Tox. 3 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H318 H317 H400 H410 |
GHS06 GHS05 GHS09 Dgr |
H301 H318 H317 H410 |
CLP00 | |||
| 613-186-00-9 | (2R,3R)-3-((R)-1-(tert-butyldimethylsiloxy)ethyl)-4-oxoazetidin-2-yl acetate | (2R,3R)-3-((R)-1-(terc-butildimetilsziloxi)etil)-4-oxoazetidin-2-il-acetát | 408-050-9 | 76855-69-1 | Eye
Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H319 H317 H411 |
GHS07 GHS09 Wng |
H319 H317 H411 |
CLP00 | |||
| 613-187-00-4 | 5-(2-amino-5-cyano-6-[2-(2-hydroxyethoxy)ethylamino]-4-methylpyridin-3-ylazo)-3-methyl-2,4-dicarbonitrilethiophene | 5-(2-amino-5-ciano-6-[(2-(2-hidroxietoxi)etilamino)-4-metilpiridin-3-il-azo)-3-metil-2,4-dikarbonitriltiofén | 410-530-8 | - | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
ATP01 | |||
| 613-188-00-X | 1-(3-(4-fluorophenoxy)propyl)-3-methoxy-4-piperidinone | 1-(3-(4-fluorfenoxi)propil)-3-metoxi-4-piperidinon | 411-500-7 | 116256-11-2 | Acute
Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H302 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H317 H411 |
CLP00 | |||
| 613-189-00-5 | 1,4,7,10-tetrakis(p-toluensulfonyl)-1,4,7,10-tetraazacyclododecane | 1,4,7,10-tetrakisz(p-toluolszulfonil)-1,4,7,10-tetraazaciklododekán | 414-030-0 | 52667-88-6 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
CLP00 | |||
| 613-190-00-0 | disodium 1-amino-4-(2-(5-chloro-6-fluoro-pyrimidin-4-ylamino-methyl)-4-methyl-6-sulfo-phenylamino)-9,10-dioxo-9,10-dihydro-anthracene-2-sulfonate | dinátrium-1-amino-4-(2-(5-klór-6-fluorpirimidin-4-ilaminometil)-4-metil-6-szulfofenilamino)-9,10-dioxo-9,10-dihidroantracén-2-szulfonát | 414-040-5 | 149530-93-8 | Acute
Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
CLP00 | |||
| 613-191-00-6 | 3-ethyl-2-methyl-2-(3-methylbutyl)-1,3-oxazolidine | 3-etil-2-metil-2-(3-metilbutil)-1,3-oxazolidin | 421-150-7 | 143860-04-2 | Repr.
1B Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H360F
*** H314 H400 H410 |
GHS08 GHS05 GHS09 Dgr |
H360F
*** H314 H410 |
CLP00 | |||
| 613-192-00-1 | 3-benzyl-exo-6-nitro-2,4-dioxo-3-aza-cis-bicyclo[3.1.0]hexane | 3-benzil-exo-6-nitro-2,4-dioxo-3-aza-cisz-biciklo[3.1.0]hexán | 426-750-2 | 151860-15-0 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
ATP01 | |||
| 613-193-00-7 | pentakis[3-(dimethylammonio)propylsulfamoyl]-[(6-hydroxy-4,4,8,8-tetramethyl-4,8-diazoniaundecane-1,11-diyldisulfamoyl)di[phthalocyaninecopper(II)]] heptalactate | pentakisz[3-(dimetilammónio)propilszulfamoil)-[(6-hidroxi-4,4,8,8-tetrametil-4,8-diazoniaundekán-1,11-diildiszulfamoil)di[ftalocianin-réz(II)]]-heptalaktát | 414-930-3 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | ||||
| 613-194-00-2 | 6,13-dichloro-3,10-bis{}{2-[4-fluoro-6-(2-sulfophenylamino)-1,3,5-triazin-2-ylamino]propylamino}}benzo[5,6][1,4]oxazino[2,3-.b.]phenoxazine-4,11-disulphonic acid, lithium-, sodium salt | 6,13-diklór-3,10-bisz{2-[4-fluor-6-(2-szulfofenilamino)-1,3,5-triazin-2-ilamino]propilamino}benzo[5,6][1,4]oxazino[2,3-b.]fenoxazin-4,11-diszulfonsav, lítium-, nátriumsó | 418-000-8 | 163062-28-0 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | |||
| 613-195-00-8 | 2,2-(1,4-phenylene)bis((4H-3,1-benzoxazine-4-one) | 2,2-(1,4-fenilén)bisz(4H-3,1-benzoxazin-4-on) | 418-280-1 | 18600-59-4 | Skin
Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
CLP00 | |||
| 613-196-00-3 | 5-[[4-chloro-6-[[2-[[4-fluoro-6-[[5-hydroxy-6-[(4-methoxy-2-sulfophenyl)azo]-7-sulfo-2-naphthalenyl]amino]-1,3,5-triazin-2-yl]amino]-1-methylethyl]amino]-1,3,5-triazin-2-yl]amino]-3-[[4-(ethenylsulfonyl)phenyl]azo]-4-hydroxy-naphtalene-2,7-disulfonic acid, sodium salt | 5-[[4-klór-6-[[2-[[4-fluor-6-[[5-hidroxi-6-[(4-metoxi-2-szulfofenil)azo]-7-szulfo-2-naftalenil]amino]-1,3,5-triazin-2-il]amino]-1-metiletil]amino]-1,3,5-triazin-2-il]amino]-3-[[4-(etenilszulfonil)fenil]azo]-4-hidroxinaftalin-2,7-diszulfonsav nátriumsója | 418-380-5 | 168113-78-8 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | |||
| 613-197-00-9 | reaction mass of: 2,4,6-tri(butylcarbamoyl)-1,3,5-triazine; 2,4,6-tri(methylcarbamoyl)-1,3,5-triazine; [(2-butyl-4,6-dimethyl)tricarbamoyl]-1,3,5-triazine; [(2,4-dibutyl-6-methyl)tricarbamoyl]-1,3,5-triazine | a
következő anyagok keveréke: 2,4,6-tri(butilkarbamoil)-1,3,5-triazin; 2,4,6-tri(metilkarbamoil)-1,3,5-triazin; [(2-butil-4,6-dimetil)trikarbamoil]-1,3,5-triazin; [(2,4-dibutil-6-dimetil)trikarbamoil]-1,3,5-triazin |
420-390-1 | 187547-46-2 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | |||
| 613-198-00-4 | 2-amino-4-dimethylamino-6-trifluoroethoxy-1,3,5-triazine | 2-amino-4-dimetilamino-6-trifluoretoxi-1,3,5-triazin | 415-500-8 | 145963-84-4 | Acute
Tox. 4 * STOT RE 2 * Aquatic Chronic 3 |
H302 H373 ** H412 |
GHS08 GHS07 Wng |
H302 H373 ** H412 |
ATP01 | |||
| 613-199-00-X | reaction mass of: 1,3,5-tris(3-aminomethylphenyl)-1,3,5-(1H,3H,5H)-triazine-2,4,6-trione; reaction mass of oligomers of 3,5-bis(3-aminomethylphenyl)-1-poly[3,5-bis(3-aminomethylphenyl)-2,4,6-trioxo-1,3,5-(1H,3H,5H)-triazin-1-yl]-1,3,5-(1H,3H,5H)-triazine-2,4,6-trione | a
következő anyagok keveréke: 1,3,5-trisz(3-aminometilfenil)-1,3,5-(1H,3H,5H)-triazin-2,4,6-trion; 3,5-bisz(3-aminometilfenil)-1-poli[3,5-bisz(3-aminometilfenil)-2,4,6-trioxo-1,3,5-(1H,3H,5H)-triazin-1-il]-1,3,5-(1H,3H,5H)-triazin-2,4,6-trion oligomereinek keveréke |
421-550-1 | Carc.
1B Repr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H350 H360D *** H317 H412 |
GHS08 Dgr |
H350 H360D *** H317 H412 |
CLP00 | ||||
| 613-200-00-3 | Reaction product of: copper, (29H,31H-phthalocyaninato(2-)-N29,N30,N31,N32)-, chlorosulfuric acid and 3-(2-sulfooxyethylsulfonyl)aniline, sodium salts | réz, (29H,31H-ftalocianináto(2-)-N29,N30,N31,N32)klórkénsav és 3-(2-szulfooxietilszulfonil)anilin reakciótermékének nátriumsói | 420-980-7 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | ||||
| 613-201-00-9 | (R)-5-bromo-3-(1-methyl-2-pyrrolidinyl methyl)-1H-indole | (R)-5-bróm-3-(1-metil-2-pirrolidinilmetil)-1H-indol | 422-390-5 | 143322-57-0 | Repr.
2 Acute Tox. 4 * Acute Tox. 4 * STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361f
*** H332 H302 H372 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H361f
*** H372 ** H332 H302 H317 H410 |
EUH070 |
CLP00 | ||
| 613-202-00-4 | pymetrozine (ISO); (E)-4,5-dihydro-6-methyl-4-(3-pyridylmethyleneamino)-1,2,4-triazin-3(2H)-one | pimetrozin
(ISO); (E)-4,5-dihidro-6-metil-4-(3-piridilmetilénamino)-1,2,4-triazin-3(2H)-on |
123312-89-0 | Carc.
2 Repr. 2 Aquatic Chronic 1 |
H351 H361fd H410 |
GHS08 GHS09 Wng |
H351 H361fd H410 |
M=1 |
CLP00/ATP15 | |||
| 613-203-00-X | pyraflufen-ethyl
(ISO);
2-chloro-5-(4-chloro-5-difluoromethoxy-1-methylpyrazol-3-yl)-4-fluorophenoxyacetic
acid ethyl ester [1] pyraflufen (ISO); 2-chloro-5-(4-chloro-5-difluoromethoxy-1-methylpyrazol-3-yl)-4-fluorophenoxyacetic acid [2] |
piraflufen-etil
(ISO); 2-klór-5-(4-klór-5-difluorometoxi-1-metilpirazol-3-il)-4-fluorfenoxiecetsav-etil-észter; [1] piraflufen (ISO); 2-klór-5-(4-klór-5-difluorometoxi-1-metilpirazol-3-il)-4-fluorfenoxiecetsav [2] |
129630-19-9
[1] 129630-17-7 [2] |
Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
M=1000 |
CLP00/ATP01 | |||
| 613-204-00-5 | oxadiargyl (ISO); 3-[2,4-dichloro-5-(2-propynyloxy)phenyl]-5-(1,1-dimethylethyl)-1,3,4-oxadiazol-2(3H)-one | oxadiargil
(ISO); 3-[2,4-diklór-5-(2-propiniletoxi)fenil]-5-(1,1-dimetiletil)-1,3,4-oxadiazol-2(3H)-on |
254-637-6 | 39807-15-3 | Repr.
2 STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H361d
*** H373 ** H400 H410 |
GHS08 GHS09 Wng |
H361d
*** H373 ** H410 |
M=1000 |
CLP00/ATP01corr | ||
| 613-205-00-0 | propiconazole
(ISO); (2RS,4RS;2RS,4SR)-1-{[2-(2,4-dichlorophenyl)-4-propyl-1,3-dioxolan-2-yl]methyl}-1H-1,2,4-triazole |
propikonazol (ISO); (2RS,4RS;2RS,4SR)-1-{[2-(2,4-diklórfenil)-4-propil-1,3-dioxolán-2-il]metil}-1H-1,2,4-triazol | 262-104-4 | 60207-90-1 | Repr.
1B Acute Tox. 4 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360D H302 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H302 H317 H360D H410 |
M=1 M=1 |
CLP00/ATP13 | ||
| 613-206-00-6 | fenamidone (ISO); (S)-5-methyl-2-methylthio-5-phenyl-3-phenylamino-3,5-dihydroimidazol-4-one | fenamidon
(ISO); (S)-5-metil-2-metiltio-5-fenil-3-fenilamino-3,5-dihidroimidazol-4-on |
161326-34-7 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | ||||
| 613-208-00-7 | imazamox (ISO); (RS)-2-(4-isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl)-5-methoxymethylnicotinic acid | imazamox
(ISO); (RS)-2-(4-izopropil-4-metil-5-oxo-2-imidazolin-2-il)-5-metoximetilnikotinsav |
114311-32-9 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | ||||
| 613-209-00-2 | cis-1-(3-chloropropyl)-2,6-dimethyl-piperidin hydrochloride | cisz-1-(3-klórpropil)-2,6-dimetilpiperidin-hidroklorid | 417-430-3 | 63645-17-0 | Acute
Tox. 3 * STOT RE 2 * Skin Sens. 1 Aquatic Chronic 2 |
H301 H373 ** H317 H411 |
GHS06 GHS08 GHS09 Dgr |
H301 H373 ** H317 H411 |
CLP00 | |||
| 613-210-00-8 | 2-(3-chloropropyl)-2,5,5-trimethyl-1,3-dioxane | 2-(3-klórpropil)-2,5,5-trimetil-1,3-dioxán | 417-650-1 | 88128-57-8 | STOT
RE 2 * Aquatic Chronic 3 |
H373
** H412 |
GHS08 Wng |
H373
** H412 |
CLP00 | |||
| 613-211-00-3 | N-methyl-4-(p-formylstyryl)pyridinium methylsulfate | N-metil-4-(p-formilsztiril)piridinium-metilszulfát | 418-240-3 | 74401-04-0 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
CLP00 | |||
| 613-212-00-9 | 4-[4-(2-ethylhexyloxy)phenyl](1,4-thiazinane-1,1-dioxide) | 4-[4-(2-etilhexiloxi)fenil](1,4-tiazinán-1,1-dioxid) | 418-320-8 | 133467-41-1 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | |||
| 613-213-00-4 | cis-1-benzoyl-4-[(4-methylsulfonyl)oxy]-L-proline | cisz-1-benzoil-4[(4-metilszulfonil)oxi]-L-prolin | 416-040-0 | 120807-02-5 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | ||||
| 613-214-00-X | N,N-di-n-butyl-2-(1,2-dihydro-3-hydroxy-6-isopropyl-2-quinolylidene)-1,3-dioxoindan-5-carboxamide | N, N-di-n-butil-2-(1,2-dihidro-3-hidroxi-6-izopropil-2-kinolidén)-1,3-dioxoindán-5-karboxamid | 416-260-7 | 147613-95-4 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 613-215-00-5 | 2-chloromethyl-3,4-dimethoxypyridinium chloride | 2-klórmetil-3,4-dimetoxipiridínium-klorid | 416-440-5 | 72830-09-2 | Acute
Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H312 H302 H373 ** H315 H318 H317 H411 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H312 H302 H373 ** H315 H318 H317 H411 |
CLP00 | |||
| 613-216-00-0 | 6-tert-butyl-7-(6-diethylamino-2-methyl-3-pyridylimino)-3-(3-methylphenyl)pyrazolo[3,2-c][1,2,4]triazole | 6-terc-butil-7-(6-dietilamino-2-metil-3-piridilimino)-3-(3-metilfenil)pirazolo[3,2-c][1,2,4]triazol | 416-490-8 | 162208-01-7 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 613-217-00-6 | 4-[3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionyloxy]-1-[2-[3-(3,5-di-tert-butyl-4-hydrophenyl)propionyloxy]ethyl]-2,2,6,6-tetramethylpiperidine | 4-[3-(3,5-di-terc-butil-4-hidroxifenil)propioniloxi]-1-[2-[3-(3,5-di-terc-butil-4-hidrofenil)propioniloxi]etil]-2,2,6,6-tetrametilpiperidin | 416-770-1 | 73754-27-5 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 613-218-00-1 | 6-hydroxyindole | 6-hidroxiindol | 417-020-4 | 2380-86-1 | Acute
Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H302 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H317 H411 |
CLP00 | |||
| 613-219-00-7 | 7a-ethyl-3,5-bis(1-methylethyl)-2,3,4,5-tetrahydrooxazolo[3,4-c]-2,3,4,5-tetrahydrooxazole | 7a-etil-3,5-bisz(1-metiletil)-2,3,4,5-tetrahidrooxazolo[3,4-c]-2,3,4,5-tetrahidrooxazol | 417-140-7 | 79185-77-6 | Skin
Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
CLP00 | |||
| 613-220-00-2 | trans-(4S,6S)-5,6-dihydro-6-methyl-4H-thieno[2,3-b]thiopyran-4-ol, 7,7-dioxide | transz-(4S,6S)-5,6-dihidro-6-metil-4H-tieno[2,3-b]tiopirán-4-ol-7,7-dioxid | 417-290-3 | 147086-81-5 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 613-221-00-8 | 2-chloro-5-methyl-pyridine | 2-klór-5-metilpiridin | 418-050-0 | 18368-64-4 | Acute
Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Aquatic Chronic 3 |
H312 H302 H315 H412 |
GHS07 Wng |
H312 H302 H315 H412 |
CLP00 | |||
| 613-222-00-3 | 4-(1-oxo-2-propenyl)-morpholine | 4-(1-oxo-2-propenil)morfolin | 418-140-1 | 5117-12-4 | Acute
Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 |
H302 H373 ** H318 H317 |
GHS08 GHS05 GHS07 Dgr |
H302 H373 ** H318 H317 |
CLP00 | |||
| 613-223-00-9 | N-isopropyl-3-(4-fluorophenyl)-1H-indole | N-izopropil-3-(4-fluorfenil)-1H-indol | 418-790-4 | 93957-49-4 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 613-224-00-4 | 2,5-dimercaptomethyl-1,4-dithiane | 2,5-dimerkaptometil-1,4-ditián | 419-770-8 | 136122-15-1 | Acute
Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H317 H410 |
CLP00 | |||
| 613-225-00-X | reaction mass of:[2-(anthraquinon-1-ylamino)-6-[(5-benzoylamino)-anthraquinone-1-ylamino]-4-phenyl]-1,3,5-triazine; 2,6-bis-[(5-benzoylamino)-anthraquinon-1-ylamino]-4-phenyl-1,3,5-triazine. | [2-(antrakinon-1-ilamino)-6-[(5-benzoilamino)-antrakinon-1-ilamino]-4-fenil]-1,3,5-triazin; 2,6-bisz-[(5-benzoilamino)-antrakinon-1-ilamino]-4-fenil-1,3,5-triazin keveréke |
421-290-9 | STOT
RE 2 * Aquatic Chronic 4 |
H373
** H413 |
GHS08 Wng |
H373
** H413 |
CLP00 | ||||
| 613-226-00-5 | 1-(2-(ethyl(4-(4-(4-(4-(ethyl(2-pyridinoethyl)amino)-2-methylphenylazo)benzoylamino)-phenylazo)-3-methylphenyl)amino)ethyl)-pyridinium dichloride | 1-(2-(etil(4-(4-(4-(4-(etil(2-piridinoetil)amino)-2-metilfenilazo)benzoilamino)fenilazo)-3-metilfenil)amino)etil)piridinium-diklorid | 420-950-3 | 163831-67-2 | Eye
Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
CLP00 | |||
| 613-227-00-0 | (±)-[(R*,R*) and (R*,S*)]-6-fluoro-3,4-dihydro-2-oxiranyl-2H-1-benzopyran | (±)-[(R*,R*) és (R*,S*)]-6-fluor-3,4-dihidro-2-oxiranil-2H-1-benzopirán | 419-600-2 | 99199-90-3 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | |||
| 613-228-00-6 | (±)-(R*,S*)-6-fluoro-3,4-dihydro-2-oxiranyl-2H-1-benzopyran | (±)-(R*,S*)-6-fluor-3,4-dihidro-2-oxiranil-2H-1-benzopirán | 419-630-6 | 793669-26-8 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 613-229-00-1 | 1-acetyl-4-(3-dodecyl-2,5-dioxo-1-pyrrolidinyl)-2,2,6,6-tetramethylpiperidine | 1-acetil-4-(3-dodecil-2,5-dioxo-1-pirrolidinil)-2,2,6,6-tetrametilpiperidin | 411-930-5 | 106917-31-1 | Skin
Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H315 H317 H410 |
ATP01 | |||
| 613-230-00-7 | florasulam (ISO); 2',6',8-trifluoro-5-methoxy-5-triazolo[1,5-c]; pyrimidine-2-sulfonanilide | florazulam
(ISO); 2’,6’,8-trifluor-5-metoxi-5-triazolo[1,5-c]-pirimidin-2-szulfonanilid |
145701-23-1 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | ||||
| 613-231-00-2 | 2,6-diamino-3-((pyridine-3-yl)azo)pyridine | 2,6-diamino-3-((piridin-3-il)azo)piridin | 421-430-9 | 28365-08-4 | Acute
Tox. 4 * STOT RE 2 * Aquatic Chronic 2 |
H302 H373 ** H411 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H411 |
ATP01 | |||
| 613-232-00-8 | 3-(benzo[b]thien-2-yl)-5,6-dihydro-1,4,2-oxathiazine-4-oxide | 3-(benzo[b]tién-2-il)-5,6-dihidro-1,4,2-oxatiazin-4-oxid | 431-030-6 | 163269-30-5 | Acute
Tox. 3 * STOT RE 2 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H373 ** H318 H400 H410 |
GHS06 GHS05 GHS08 GHS09 Dgr |
H331 H373 ** H318 H410 |
ATP01 | |||
| 613-233-00-3 | 4,4'-(oxy-(bismethylene))-bis-1,3-dioxolane | 4,4’-(oxi-(biszmetilén))-bisz-1,3-dioxolán | 423-230-7 | 56552-15-9 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | |||
| 613-234-00-9 | imidazo[1,2-b]pyridazin hydrochloride | imidazo[1,2-b]-piridazin-hidroklorid | 431-510-5 | 18087-70-2 | Acute
Tox. 4 * Eye Irrit. 2 |
H302 H319 |
GHS07 Wng |
H302 H319 |
ATP01 | |||
| 613-235-00-4 | 2,3-dihydro-2,2-dimethyl-1H-perimidine | 2,3-dihidro-2,2-dimetil-1H-perimidin | 424-060-6 | 6364-17-6 | Acute
Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H317 H410 |
ATP01 | |||
| 613-236-00-X | 2-chloro-3-trifluoromethylpyridine | 2-klór-3-trifluormetilpiridin | 424-520-6 | 65753-47-1 | Acute
Tox. 3 * Acute Tox. 3 * STOT RE 1 Skin Corr. 1B Aquatic Chronic 3 |
H311 H301 H372 ** H314 H412 |
GHS06 GHS05 GHS08 Dgr |
H311 H301 H372 ** H314 H412 |
ATP01 | |||
| 613-237-00-5 | 6-tert-butyl-3-(3-dodecylsulfonyl)propyl-7H-1,2,4-triazolo[3.4b][1,3,4]thiadiazine | 6-terc-butil-3-(3-dodecilszulfonil)propil-7H-1,2,4-triazolo[3,4b][1,3,4]tiadiazin | 424-950-4 | 133949-92-5 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 613-238-00-0 | sodium 2-[[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]sulfonyl]ethyl sulfate | nátrium-2-[[4-[(4,6-diklór-1,3,5-triazin-2-il)amino]fenil]szulfonil]etil-szulfát | 430-890-1 | 81992-66-7 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
ATP01 | |||
| 613-239-00-6 | 2-[3-(methylamino)propyl]-1H-benzimidazole | 2-[3-(metilamino)propil]-1H-benzimidazol | 425-760-4 | 64137-52-6 | Eye
Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
ATP01 | |||
| 613-241-00-7 | 3-(2H-tetrazol-5-yl)pyridine | 3-(2H-tetrazol-5-il)piridin | 426-810-8 | 3250-74-6 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 613-242-00-2 | reaction products of 3,10-bis((2-aminopropyl)amino)-6,13-dichloro-4,11-triphenodioxazinedisulfonic acid with 2-amino-1,4-benzenedisulfonic acid, 2-((4-aminophenyl)sulfonyl)ethyl hydrogen sulfate and 2,4,6-trifluoro-1,3,5-triazine, sodium salts | 3,10-bisz((2-aminopropil)amino)-6,13-diklór-4,11-trifenodioxazindiszulfonsav 2-amino-1,4-benzoldiszulfonsavval,2-((4-aminofenil)szulfonil)etil-hidrogénszulfáttal és 2,4,6-trifluor-1,3,5-triazinnal képzett reakciótermékeinek nátriumsói | 426-860-0 | 191877-09-5 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 613-243-00-8 | 4,4'-(1,6-hexamethylenebis(formylimino))bis(2,2,6,6-tetramethyl-1-oxylpiperidine) | 4,4'-(1,6-hexametilénbisz(formilimino))bisz(2,2,6,6-tetrametil-1-oxilpiperidin) | 427-350-0 | 182235-14-9 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
ATP01 | |||
| 613-244-00-3 | 5,7-dichloro-4-hydroxyquinoline | 5,7-diklór-4-hidroxikinolin | 427-420-0 | 21873-52-9 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
ATP01 | |||
| 613-245-00-9 | 2-fluoro-6-trifluoromethylpyridine | 2-fluor-6-(trifluormetil)piridin | 428-100-3 | 94239-04-0 | Flam.
Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 3 |
H226 H332 H302 H412 |
GHS02 GHS07 Wng |
H226 H332 H302 H412 |
ATP01 | |||
| 613-246-00-4 | 2-hydroxymethyl-3-methyl-4-(2,2,2-trifluoroethoxy)pyridine | 2-hidroximetil-3-metil-4-(2,2,2-trifluoretoxi)piridin | 428-200-7 | 103577-66-8 | Aquatic
Chronic 3 |
H412 |
- |
H412 |
ATP01 | |||
| 613-247-00-X | 3-(2-methoxy-4-methoxycarboxybenzyl)-5-nitroindole | 3-(2-metoxi-4-metoxikarboxibenzil)-5-nitroindol | 428-910-7 | 107786-36-7 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 613-248-00-5 | 3,4-dimethyl-1H-pyrazole | 3,4-dimetil-1H-pirazol | 429-130-1 | 2820-37-3 | Acute
Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
ATP01 | |||
| 613-249-00-0 | 1-(2-hydroxyethyl)-1H-pyrazol-4,5-diyldiammoniumsulfate | 1-(2-hidroxietil)-1H-pirazol-4,5-diildiammónium-szulfát | 429-300-3 | 155601-30-2 | Eye
Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H411 |
ATP01 | |||
| 613-250-00-6 | reaction mass of: carbonato-bis-N-ethyl-2-isopropyl-1,3-oxazolidine; methyl carbonato-N-ethyl-2-isopropyl-1,3-oxazolidine; 2-isopropyl-N-hydroxyethyl 1,3-oxazolidine | karbonáto-bisz-N-etil-2-izopropil-1,3-oxazolidin; metil-karbonáto-N-etil-2-izopropil-1,3-oxazolidin; 2-izopropil-N-hidroxietil-1,3-oxazolidin keveréke |
429-990-6 | - | Eye
Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
ATP01 | |||
| 613-251-00-1 | (R)-3-[(1-methylpyrrolidin-2-yl)methyl]-5-[2-(phenylsulfonyl)ethenyl]-1H-indole | (R)-3-[(1-metilpirrolidin-2-il)metil]-5-[2-(fenilszulfonil)etenil]-1H-indol | 430-560-5 | 180637-89-2 | Acute
Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 |
H302 H373 ** H318 H317 |
GHS05 GHS08 GHS07 Dgr |
H302 H373 ** H318 H317 |
ATP01 | |||
| 613-253-00-2 | 2,2-dialkyl-4-hydroxymethyl-1,3-dioxolane; reaction products with ethylene oxide (alkyl is C1-12 and the sum to C13, average degree of ethoxylation is 3.5) | 2,2-dialkil-4-hidroximetil-1,3-dioxolán; etilén-oxiddal végbemenő reakciótermékei (alkilek: C1-12, összesen legfeljebb C13, átlagos etoxiszám 3,5) |
430-580-4 | - | Skin
Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
EUH019 |
ATP01 | ||
| 613-254-00-8 | forchlorfenuron (ISO); 1-(2-chloro-4-pyridyl)-3-phenylurea | forklórfenuron
(ISO); 1-(2-klór-4-piridil)-3-fenilkarbamid |
- | 68157-60-8 | Carc.
2 Aquatic Chronic 2 |
H351 H411 |
GHS08 GHS09 Wng |
H351 H411 |
ATP01 | |||
| 613-255-00-3 | reaction mass of isomers of: sodium [(2-hydroxyethylsulfamoyl){[2-(2-piperazin-1-ylethylamino)ethylsulfamoyl][2-(4-aminoethylpiperazine-1-yl)ethylsulfamoyl](sulfamoyl)}(sulfonatophthalocyaninato)]copper(II) | nátrium-[(2-hidroxietilszulfamoil){[2-(2-piperazin-1-iletilamino)etilszulfamoil][2-(4-aminoetilpiperazin-1-il)etilszulfamoil](szulfamoil)}(szulfonátoftalocianináto)]réz(II) izomerek keveréke | 424-270-8 | - | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 613-256-00-9 | 3'5'-anhydro thymidine | 3'5'-anhidrotimidin | 425-810-5 | 38313-48-3 | Aquatic
Chronic 3 |
H412 |
- |
H412 |
ATP01 | |||
| 613-257-00-4 | 2-phthalimidoethyl N-[4-(2-cyano-4-nitrophenylazo)phenyl]-N-methyl-β-alaninate | 2-ftálimidoetil-N-[4-(2-ciano-4-nitrofenilazo)fenil]-N-metil-β-alaninát | 426-400-9 | 170222-39-6 | Skin
Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
ATP01 | |||
| 613-258-00-X | reaction mass of: 4-chloro-7-methylbenzotriazole sodium salt; 4-chloro-5-methylbenzotriazole sodium salt; 5-chloro-4-methylbenzotriazole sodium salt | 4-klór-7-metilbenzotriazol
nátriumsója; 4-klór-5-metilbenzotriazol nátriumsója; 5-klór-4-metilbenzotriazol nátriumsója keveréke |
427-730-6 | 202420-04-0 | Skin
Corr. 1B Aquatic Chronic 3 |
H314 H412 |
GHS05 Dgr |
H314 H412 |
ATP01 | |||
| 613-259-00-5 | imiprothrin (ISO); reaction mass of: [2,4-dioxo-(2-propyn-1-yl)imidazolidin-3-yl]methyl(1R)-cis-chrysanthemate; [2,4-dioxo-(2-propyn-1-yl)imidazolidin-3-yl]methyl(1R)-trans-chrysanthemate | [2,4-dioxo-(2-propin-1-il)imidazolidin-3-il]metil(1R)-cisz-krizantemát; [2,4-dioxo-(2-propin-1-il)imidazolidin-3-il]metil(1R)-transz-krizantemát keveréke |
428-790-6 | 72963-72-5 | Carc.
2 Acute Tox. 4 Acute Tox. 4 STOT SE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H332 H302 H371 (nervous system; oral, inhalation) H400 |
GHS08 GHS07 GHS09 Wng |
H332 H302 H351 H371 (nervous system; oral) (inhalation) H410 |
Inhalation:
ATE = 1.4 mg/L (dusts/mists) Oral: ATE = 550 mg/kg M=10 M=10 |
ATP01/ATP15 | ||
| 613-260-00-0 | (±)-4-(3-chlorophenyl)-6-[(4-chlorophenyl)hydroxy(1-methyl-1H-imidazol-5-yl)methyl]-1-methyl-2(1H)-quinolin | (±)-4-(3-klórfenil)-6-[(4-klórfenil)hidroxi(1-metil-1H-imidazol-5-il)metil]-1-metil-2(1H)-kinolin | 430-730-9 | - | Eye
Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
ATP01 | |||
| 613-261-00-6 | pyrazole-1-carboxamidine monohydrochloride | pirazol-1-karboxamidin-monohidroklorid | 429-520-1 | 4023-02-3 | Acute
Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H302 H373 ** H318 H317 H412 |
GHS05 GHS08 GHS07 Dgr |
H302 H373 ** H318 H317 H412 |
ATP01 | |||
| 613-262-00-1 | disodium (E)-1,2-bis-(4-(4-methylamino-6-(4-methylcarbamoylphenylamino)-1,3,5-triazin-2-ylamino)phenyl-2-sulfonato)ethene | dinátrium-(E)-1,2-bisz-(4-(4-metilamino-6-(4-metilkarbamoil-fenilamino)-1,3,5-triazin-2-ilamino)fenil-2-szulfonáto)etén | 427-310-2 | 180850-95-7 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 613-263-00-7 | monosodium 3-cyano-5-fluoro-6-hydroxypyridine-2-olate | mononátrium-3-ciano-5-fluor-6-hidroxipiridin-2-olát | 429-570-2 | - | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
ATP01 | |||
| 613-266-00-3 | 2-chloro-5-chloromethylthiazole | 2-klór-5-klórmetiltiazol | 429-830-5 | 105827-91-6 | Acute
Tox. 3 * Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H311 H302 H314 H317 H411 |
GHS06 GHS05 GHS09 Dgr |
H311 H314 H302 H317 H411 |
ATP01 | |||
| 613-267-00-9 | thiamethoxam (ISO); 3-(2-chloro-thiazol-5-ylmethyl)-5-methyl[1,3,5]oxadiazinan-4-ylidene-N-nitroamine | tiametoxám
(ISO); 3-(2-klórtiazol-5-ilmetil)5-metil[1,3,5]oxadiazinan-4-ilidén-N-nitroamin |
428-650-4 | 153719-23-4 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
M=10 |
ATP01 | ||
| 613-268-00-4 | (4aS-cis-)-6-benzyl-octahydropyrrolo[3.4-b]pyridine | (4aS-cisz-)-6-benzil-oktahidropirrolo[3,4-b]piridin | 425-930-8 | 151213-39-7 | Acute
Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Aquatic Chronic 2 |
H332 H302 H373 ** H314 H411 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H314 H332 H302 H373 ** H411 |
ATP01 | |||
| 613-269-00-X | 2-thiazolidinylidenecyanamide | 2-tiazolidinilidénciánamid | 427-720-1 | 26364-65-8 | Acute
Tox. 4 * STOT RE 2 * Aquatic Chronic 3 |
H302 H373 ** H412 |
GHS08 GHS07 Wng |
H302 H373 ** H412 |
ATP01 | |||
| 613-270-00-5 | 5-amino-N-(2,6-dichloro-3-methylphenyl)-1H-1,2,4-triazole-3-sulfonamide | 5-amino-N-(2,6-diklór-3-metilfenil)-1H-1,2,4-triazol-3-szulfonamid | 428-150-6 | 113171-13-4 | Aquatic
Chronic 3 |
H412 |
- |
H412 |
ATP01 | |||
| 613-271-00-0 | tritosulfuron (ISO) (containing ≤ 0,02% AMTT); 1-[4-methoxy-6-(trifluoromethyl)-1,3,5-triazin-2-yl]-3-[2-(trifluoromethyl)benzenesulfonyl]urea (containing ≤ 0,02% AMTT) | tritoszulfuron
(ISO) (≤0,02 % AMTT-tartalommal); 1-[4-metoxi-6-(trifluormetil)-1,3,5-triazin-2-il]-3-[2-(trifluormetil)benzolszulfonil]karbamid (≤0,02 % AMTT-tartalommal); |
- | 142469-14-5 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
M=10 |
ATP01 | ||
| 613-272-00-6 | pyraclostrobin (ISO); methyl N-{2-[1-(4-chlorophenyl)-1H-pyrazol-3-yloxymethyl]phenyl}(N-methoxy)carbamate | piraklosztrobin
(ISO); metil-N-{2-[1-(4-klórfenil)-1H-pirazol-3-iloximetil]fenil}(N-metoxi)karbamát |
- | - | Acute
Tox. 3 * Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H315 H400 H410 |
GHS06 GHS09 Dgr |
H331 H315 H410 |
M=100 |
ATP01 | ||
| 613-273-00-1 | tetrahydro-3-methyl-5-((2-phenylthio)thiazol-5-ylmethyl)-[4H]-1,3,5-oxadiazinan-4-ylidene-N-nitroamine | tetrahidro-3-metil-5-((2-feniltio)tiazol-5-il-metil)-[4H]-1,3,5-oxadiazinan-4-ilidén-N-nitroamin | 427-600-9 | 192439-46-6 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
ATP01 | |||
| 613-274-00-7 | 2,6-dichloro-1-fluoropyridiniumtetrafluoroborate | 2,6-diklór-1-fluorpiridinium-tetrafluorborát | 427-400-1 | 140623-89-8 | Acute
Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H314 H302 H317 H410 |
ATP01 | |||
| 613-275-00-2 | 3-(2-chloroethyl)-6,7,8,9-tetra-hydro-2-methyl-4H-pyrido[1,2-a] pyrimidin-4-one monohydrochloride | 3-(2-klóretil)-6,7,8,9-tetrahidro-2-metil-4H-pirido[1,2-a]pirimidin-4-on-monohidroklorid | 424-530-0 | 93076-03-0 | Acute
Tox. 3 * STOT SE 2 STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H301 H371 ** H373 ** H318 H317 H411 |
GHS06 GHS05 GHS08 GHS09 Dgr |
H301 H318 H317 H371 ** H373 ** H411 |
ATP01/ATP01corr | |||
| 613-276-00-8 | 1-(2-chlorophenyl)-1,2-dihydro-5H-tetrazol-5-one | 1-(2-klórfenil)-1,2-dihidro-5H-tetrazol-5-on | 426-110-2 | 98377-35-6 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
ATP01 | |||
| 613-277-00-3 | (4-(6-diethylamino-2-methylpyridin-3-yl)imino-4,5-dihydro-3-methyl-1-(4-methylphenyl)-1H-pyrazol-5-one | (4-(6-dietilamino-2-metilpiridin-3-il)imino-4,5-dihidro-3-metil-1-(4-metilfenil)-1H-pirazol-5-on | 427-070-9 | - | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 613-278-00-9 | (3-aminophenyl)pyridin-3-ylmethanone | (3-aminofenil)piridin-3-il-metanon | 428-230-0 | 79568-06-2 | STOT
RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H373
** H400 H410 |
GHS08 GHS09 Wng |
H373
** H410 |
ATP01 | |||
| 613-279-00-4 | 2-ethyl-2,3-dihydro-2-methyl-1H-perimidine | 2-etil-2,3-dihidro-2-metil-1H-perimidin | 424-380-6 | 43057-68-7 | Acute
Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H410 |
ATP01 | |||
| 613-280-00-X | tetrahydro-1,3-dimethyl-1H-pyrimidin-2-one; dimethyl propyleneurea | tetrahidro-1,3-dimetil-1H-pirimidin-2-on; dimetilpropilénkarbamid |
230-625-6 | 7226-23-5 | Repr.
2 Acute Tox. 4 * Eye Dam. 1 |
H361f
*** H302 H318 |
GHS05 GHS08 GHS07 Dgr |
H361f
*** H302 H318 |
ATP01 | |||
| 613-281-00-5 | quinoline | kinolin | 202-051-6 | 91-22-5 | Carc.
1B Muta. 2 Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Eye Irrit. 2 Aquatic Chronic 2 |
H350 H341 H312 H302 H315 H319 H411 |
GHS08 GHS07 GHS09 Dgr |
H350 H341 H312 H302 H319 H315 H411 |
ATP01 | |||
| 613-282-00-0 | triticonazole (ISO); (RS)-(E)-5-(4-chlorobenzylidene)-2,2-dimethyl-1-(1H-1,2,4-triazol-1-methyl)cyclopentanol | tritikonazol
(ISO); (RS)-(E)-5-(4-klórbenzilidén)-2,2-dimetil-1-(1H-1,2,4-triazol-1-metil)ciklopentanol |
- | 131983-72-7 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
ATP01 | |||
| 613-283-00-6 | ketoconazole; 1-[4-[4-[[(2SR,4RS)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]ethanone | ketokonazol; 1-[4-[4-[[(2SR, 4RS)-2-(2,4-diklórfenil)-2-(imidazol-1-ilmetil)-1,3-dioxolán-4-il]metoxi]fenil]piperazin-1-il]etanon |
265-667-4 | 65277-42-1 | Repr.
1B Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H360F
*** H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H360F
*** H301 H373 ** H410 |
ATP01 | |||
| 613-284-00-1 | metconazole (ISO); (1RS,5RS;1RS,5SR)-5-(4-chlorobenzyl)-2,2-dimethyl-1-(1H-1,2,4-triazol-1-ylmethyl)cyclopentanol | metkonazol
(ISO); (1RS, 5RS;1RS, 5SR)-5-(4-klórbenzil)-2,2-dimetil-1-(1H-1,2,4-triazol-1-ilmetil)ciklopentanol |
- | 125116-23-6 | Repr.
2 Acute Tox. 4 * Aquatic Chronic 2 |
H361d
*** H302 H411 |
GHS08 GHS07 GHS09 Wng |
H361d
*** H302 H411 |
ATP01 | |||
| 613-285-00-7 | 1-hydroxybenzotriazole,
anhydrous [1] 1-hydroxybenzotriazole, monohydrated [2] |
1-hidroxibenzotriazol,
vízmentes; [1] 1-hidroxibenzotriazol, monohidrát [2] |
219-989-7
[1] 219-989-7 [2] |
2592-95-2
[1] 123333-53-9 [2] |
Expl.
1.3 |
H203 |
GHS01 Dgr |
H203 |
ATP01 | |||
| 613-286-00-2 | potassium 1-methyl-3-morpholinocarbonyl-4-[3-(1-methyl-3-morpholinocarbonyl-5-oxo-2-pyrazolin-4-ylidene)-1-propenyl]pyrazole-5-olate; [containing < 0.5 % N,N-dimethylformamide (EC no 200-679-5)] | kálium-1-metil-3-morfolinokarbonil-4-[3-(1-metil-3-morfolinokarbonil-5-oxo-2-pirazolin-4-ilidén)-1-propenil]pirazol-5-olát; [<0,5 % N,N-dimetilformamidot (EK szám 200-679-5) tartalmaz] |
418-260-2 | 183196-57-8 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
ATP01 | |||
| 613-286-01-X | potassium 1-methyl-3-morpholinocarbonyl-4-[3-(1-methyl-3-morpholinocarbonyl-5-oxo-2-pyrazolin-4-ylidene)-1-propenyl]pyrazole-5-olate; [containing ≥ 0.5 % N,N-dimethylformamide (EC No 200-679-5)] | kálium-1-metil-3-morfolinokarbonil-4-[3-(1-metil-3-morfolinokarbonil-5-oxo-2-pirazolin-4-ilidén)-1-propenil]pirazol-5-olát; [≥0,5 % N, N-dimetilformamidot (EK-szám 200-679-5) tartalmaz] |
418-260-2 | 183196-57-8 | Repr.
1B Skin Sens. 1 |
H360D
*** H317 |
GHS08 GHS07 Dgr |
H360D
*** H317 |
ATP01 | |||
| 613-287-00-8 | 1-(3-iodo-4-aminobenzyl)-1H-1,2,4-triazole | 1-(3-jód-4-aminobenzil)-1H-1,2,4-triazol | 419-540-7 | 160194-26-3 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
ATP01 | |||
| 613-288-00-3 | 1,3-bis(dimethylcarbamoyl)-imidazolium chloride | 1,3-bisz(dimetilkarbamoil)-imidazolium-klorid | 420-930-4 | 135756-61-5 | Acute
Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
ATP01 | |||
| 613-289-00-9 | 3-(4-chloro-2-fluoro-5-methylphenyl)-1-methyl-5-(trifluoromethyl)-1H-pyrazole | 3-(4-klór-2-fluor-5-metilfenil)-1-metil-5-(trifluormetil)-1H-pirazol | 432-020-4 | 142623-48-1 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
ATP01 | |||
| 613-290-00-4 | 4-hydroxy-7-(2-aminoethyl)-1,3-benzothiazol-2(3H)-one hydrochloride | 4-hidroxi-7-(2-aminoetil)-1,3-benzotiazol-2(3H)-on hidroklorid | 432-470-1 | 189012-93-9 | Eye
Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H410 |
ATP01 | |||
| 613-291-00-X | 2,4-dihydro-4-(4-(4-(4-hydroxyphenyl)-1-piperazinyl)phenyl)-2-(1-methylpropyl)-3H-1,2,4-triazol-3-one | 2,4-dihidro-4-(4-(4-(4-hidroxifenil)-1-piperazinil)fenil)-2-(1-metilpropil)-3H-1,2,4-triazol-3-on | 434-820-9 | 106461-41-0 | STOT
RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H373
** H400 H410 |
GHS08 GHS09 Wng |
H373
** H410 |
ATP01 | |||
| 613-292-00-5 | N,N',N''-tris(2-methyl-2,3-epoxypropyl)-perhydro-2,4,6-oxo-1,3,5-triazine | N, N',N''-trisz(2-metil-2,3-epoxipropil)-perhidro-2,4,6-oxo-1,3,5-triazin | 435-010-8 | 26157-73-3 | Muta.
2 Aquatic Chronic 3 |
H341 H412 |
GHS08 Wng |
H341 H412 |
ATP01 | |||
| 613-293-00-0 | 2-(4-tert-butylphenyl)-6-cyano-5-[bis(ethoxycarbonylmethyl)carbamoyloxy]-1H-pyrrolo[1,2-b][1,2,4] triazole-7-carboxylic acid 2,6-di-tert-butyl-4-methylcyclohexylester | 2-(4-terc-butilfenil)-6-ciano-5-[bisz(etoxikarbonilmetil)karbamoiloxi]-1H-pirrolo[1,2-b][1,2,4]triazol-7-karboxilsav-2,6-di-terc-butil-4-metilciklohexil-észter | 448-050-6 | 444065-11-6 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 613-294-00-6 | 2-hexyldecanoic acid [4-(6-tert-butyl-7-chloro-1H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)phenylcarbamoyl]methylester | 2-hexildekánsav-[4-(6-terc-butil-7-klór-1H-pirazolo[1,5-b][1,2,4]triazol-2-il)fenilkarbamoil]metilészter | 448-260-8 | 379268-96-9 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 613-295-00-1 | 11-amino-3-chloro-6,11-dihydro-5,5-dioxo-6-methyl-dibenzo[c,f][1,2]thiazepine hydrochloride | 11-amino-3-klór-6,11-dihidro-5,5-dioxo-6-metil-dibenzo[c, f][1,2]tiazepin-hidroklorid | 448-720-8 | 363138-44-7 | Acute
Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
ATP01 | |||
| 613-296-00-7 | pentapotassium 2-(4-(5-[1-(2,5-disulfonatophenyl)-4,5-dihydro-3-methylcarbamoyl-5-oxopyrazol-4-ylidene]-3-methyl-1,3-pentadienyl)-3-methylcarbamoyl-5-oxidopyrazol-1-yl)benzene-1,4-disulfonate | pentakálium-2-(4-(5-[1-(2,5-diszulfonátofenil)-4,5-dihidro-3-metilkarbamoil-5-oxopirazol-4-ilidén]-3-metil-1,3-pentadienil)-3-metilkarbamoil-5-oxidopirazol-1-il)benzol-1,4-diszulfonát | 418-270-7 | - | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
ATP01 | |||
| 613-297-00-2 | 5-(2-bromophenyl)-2-tert-butyl-2H-tetrazole | 5-(2-brómfenil)-2-terc-butil-2H-tetrazol | 420-820-6 | - | Flam.
Liq. 3 Acute Tox. 4 * Aquatic Chronic 2 |
H226 H302 H411 |
GHS02 GHS07 GHS09 Wng |
H226 H302 H411 |
ATP01 | |||
| 613-298-00-8 | bis-(6-hydroxy-4-methyl-5-(3-methylimidazolium-1-yl)-3-(4-phenylazo)-1H-pyridin-2-one)ethylene dilactate | bisz-(6-hidroxi-4-metil-5-(3-metilimidazolium-1-il)-3-(4-fenilazo)-1H-piridin-2-on)etilén-dilaktát | 421-560-6 | - | STOT
RE 2 * Eye Dam. 1 Aquatic Chronic 2 |
H373
** H318 H411 |
GHS05 GHS08 GHS09 Dgr |
H373
** H318 H411 |
ATP01 | |||
| 613-299-00-3 | main component 1 (isomer 1): 2-{6-fluoro-4-[3-(2,5-disulfo-phenylazo)-4-hydroxy-2-sulfonapht-7-ylamino]-1,3,5-triazin-2-ylamino}-3-{6-fluoro-4-[3-(1,5-disulfonaphth-2-ylazo)-4-hydroxy-2-sulfonaphth-7-ylamino]-1,3,5-triazin-2-ylamino}-propane sodium salt; main component 1 (isomer 2): 2-{6-fluoro-4-[3-(2,5-disulfo-phenylazo)-4-hydroxy-2-sulfonaphth-7-ylamino]-1,3,5-triazin-2-ylamino}-3-{6-fluoro-4-[3-(2,5-disulfo-phenylazo)-4-hydroxy-2-sulfonaphth-7-ylamino]-1,3,5-triazin-2-ylamino}-propane sodium salt; main component 2: 2,3-bis-{6-fluoro-4-[3-(2,5-disulfo-phenylazo)-4-hydroxy-2-sulfonaphth-7-ylamino]-1,3,5-triazin-2-ylamino}-propane sodium salt; main component 3: 2,3-bis-{6-fluoro-4-[3-(1,5-disulfonaphth-2-ylazo)-4-hydroxy-2-sulfonaphth-7-ylamino]-1,3,5-triazin-2-ylamino}-propane sodium salt | 1.
főkomponens (1. izomer): 2-{6-fluor-4-[3-(2,5-diszulfofenilazo)-4-hidroxi-2-szulfonaft-7-ilamino]-1,3,5-triazin-2-ilamino}-3-{6-fluor-4-[3-(1,5-diszulfonaft-2-ilazo)-4-hidroxi-2-szulfonaft-7-ilamino]-1,3,5-triazin-2-ilamino}propán nátriumsó; 1. főkomponens (2. izomer): 2-{6-fluor-4-[3-(2,5-diszulfofenilazo)-4-hidroxi-2-szulfonaft-7-ilamino]-1,3,5-triazin-2-ilamino}-3-{6-fluor-4-[3-(2,5-diszulfofenilazo)-4-hidroxi-2-szulfonaft-7-ilamino]-1,3,5-triazin-2-ilamino}-propán nátriumsó; 2. főkomponens: 2,3-bisz-{6-fluor-4-[3-(2,5-diszulfofenilazo)-4-hidroxi-2-szulfonaft-7-ilamino]-1,3,5-triazin-2-ilamino}propán nátriumsó; 3. főkomponens: 2,3-bisz-{6-fluor-4-[3-(1,5-diszulfonaft-2-ilazo)-4-hidroxi-2-szulfonaft-7-ilamino]-1,3,5-triazin-2-ilamino}propán nátriumsó |
422-610-1 | - | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 613-300-00-7 | 1-imidazol-1-yl-octadecan-2-ol | 1-imidazol-1-il-oktadekán-2-ol | 434-120-3 | - | Skin
Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
ATP01 | |||
| 613-301-00-2 | dimethyl-1-{[2-methoxy-5-(2-methyl-butoxycarbonyl)phenylcarbamoyl]-[2-octadecyl-1,1-dioxo-1,2,4-benzothiadiazin-3-yl]methyl} imidazole-4,5-dicarboxylate | dimetil-1-{[2-metoxi-5-(2-metilbutoxikarbonil)fenilkarbamoil]-[2-oktadecil-1,1-dioxo-1,2,4-benzotiadiazin-3-il]metil}imidazol-4,5-dikarboxilát | 443-910-7 | - | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 613-302-00-8 | disodium 2-(5-carbamoyl-1-ethyl-2-hydroxy-4-methyl-6-oxo-1,6-dihydro-pyridine-3-ylazo)-4-(4-fluoro-6-(4-(2-sulfonyloxy-ethylsulfonyl)-phenylamino)-1,3,5-triazine-2-ylamino)benzene sulfonate | dinátrium-2-(5-karbamoil-1-etil-2-hidroxi-4-metil-6-oxo-1,6-dihidropiridin-3-ilazo)-4-(4-fluor-6-(4-(2-szulfoniloxietilszulfonil)-fenilamino)-1,3,5-triazin-2-ilamino)benzol-szulfonát | 432-980-4 | 243858-60-8 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
ATP01 | |||
| 613-303-00-3 | 2-(1-methyl-2-(4-phenoxyphenoxy)ethoxy)pyridine | 2-(1-metil-2-(4-fenoxifenoxi)etoxi)piridin | 429-800-1 | 95737-68-1 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
ATP01 | |||
| 613-304-00-9 | 5,6-dihydroxy-2,3-dihydro-1H-indolium bromide | 5,6-dihidroxi-2,3-dihidro-1H-indolium-bromid | 421-170-6 | 138937-28-7 | Acute
Tox. 4 * Eye Dam. 1 |
H302 H318 |
GHS05 GHS07 Dgr |
H302 H318 |
ATP01 | |||
| 613-305-00-4 | 2-(2-hydroxy-4-octyloxyphenyl)-2H-benzotriazole | 2-(2-hidroxi-4-oktiloxifenil)-2H-benzotriazol | 448-630-9 | 3147-77-1 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 613-306-00-X | (2,5-dioxopyrrolidin-1-yl)-9H-fluoren-9-ylmethyl carbonate | (2,5-dioxopirrolidin-1-il)-9H-fluorén-9-ilmetil-karbonát | 433-520-5 | 82911-69-1 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
ATP01 | |||
| 613-307-00-5 | clothianidin (ISO); 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-methyl-1-nitroguanidine | klotianidin
(ISO); 3-[(2-klór-1,3-tiazol-5-il)metil]-2-metil-1-nitroguanidin |
- | 210880-92-5 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
M=10 |
ATP01 | ||
| 613-308-00-0 | 2-amino-5-methylthiazole | 2-amino-5-metiltiazol | 423-800-5 | 7305-71-7 | Acute
Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H410 |
ATP01 | |||
| 613-309-00-6 | 1-methyl-3-phenyl-1-piperazine | 1-metil-3-fenil-1-piperazin | 431-180-2 | 5271-27-2 | Acute
Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H312 H302 H315 H318 H412 |
GHS05 GHS07 Dgr |
H312 H302 H315 H318 H412 |
ATP01 | |||
| 613-310-00-1 | (-)(3S,4R)-4-(4-fluorophenyl)-3-(3,4-methylenedioxy-phenoxymethyl)-N-benzylpiperidine hydrochloride | (-)(3S, 4R)-4-(4-fluorfenil)-3-(3,4-metiléndioxifenoximetil)-N-benzilpiperidin-hidroklorid | 432-360-3 | 105813-13-6 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
ATP01 | |||
| 613-311-00-7 | methyl-5-nitrophenyl-guanidine | metil-5-nitrofenil-guanidin | 435-500-1 | 152460-07-6 | Acute
Tox. 4 * Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H302 H319 H317 H412 |
GHS07 Wng |
H302 H319 H317 H412 |
ATP01 | |||
| 613-312-00-2 | 2-(4-methyl-2-phenyl-1-piperazinyl)benzenemethanol monohydrochloride | 2-(4-metil-2-fenil-1-piperazinil)benzolmetanol-monohidroklorid | 420-200-5 | - | Acute
Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H302 H318 H317 H412 |
GHS05 GHS07 Dgr |
H302 H318 H317 H412 |
ATP01 | |||
| 613-313-00-8 | 2-(4-(4-(3-pyridinyl)-1H-imidazol-1-yl)butyl)-1H-isoindole-1,3(2H)-dione | 2-(4-(4-(3-piridinil)-1H-imidazol-1-il)butil)-1H-izoindol-1,3(2H)-dion | 442-780-9 | 173838-67-0 | Aquatic
Chronic 3 |
H412 |
- |
H412 |
ATP01 | |||
| 613-314-00-3 | 4-decyloxazolidin-2-one; 4-decyl-1,3-oxazolidin-2-one | 4-decil-oxazolidin-2-on; 4-decil-1,3-oxazolidin-2-on |
443-770-7 | 7693-82-5 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
ATP01 | |||
| 613-315-00-9 | tetrapotassium 4-[5-[3-carboxylato-4,5-dihydro-5-oxo-1-(4-sulfonatophenyl)pyrazol-4-ylidene]-3-(piperidinocarbonyl)penta-1,3-dienylidene]-5-hydroxy-1-(4-sulfonatophenyl)pyrazole-3-carboxylate | tetrakálium-4-[5-[3-karboxilát-4,5-dihidro-5-oxo-1-(4-szulfonátofenil)pirazol-4-ilidén]-3-(piperidinokarbonil)penta-1,3-dienilidén]-5-hidroxi-1-(4-szulfonátofenil)pirazol-3-karboxilát | 430-390-1 | - | Acute
Tox. 4 * Aquatic Chronic 3 |
H332 H412 |
GHS07 Wng |
H332 H412 |
ATP01 | |||
| 613-316-00-4 | trimethylopropane tri(3-aziridinylpropanoate); (TAZ) | trimetilopropán-tri(3-aziridinil-propanoát); (TAZ) |
257-765-0 | 52234-82-9 | Muta.
2 Eye Dam. 1 Skin Sens. 1 |
H341 H318 H317 |
GHS05 GHS08 GHS07 Dgr |
H341 H318 H317 |
ATP01 | |||
| 613-317-00-X | penconazole (ISO); 1-[2-(2,4-dichlorophenyl)pentyl]-1H-1,2,4-triazole | penkonazol
(ISO); 1-[2-(2,4-diklórfenil)pentil]-1H-1,2,4-triazol |
66246-88-6 | Repr.
2 Acute Tox. 4 Aquatic Acute 1 Aquatic Chronic 1 |
H361d H302 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H361d H410 |
M=1 M=1 |
ATP06 | |||
| 613-318-00-5 | fenpyrazamine (ISO); S-allyl 5-amino-2,3-dihydro-2-isopropyl-3-oxo-4-(o-tolyl)pyrazole-1-carbothioate; S-allyl 5-amino-2-isopropyl-4-(2-methylphenyl)-3-oxo-2,3-dihydropyrazole-1-carbothioate | fenpirazamin
(ISO); S-allil-5-amino-2,3-dihidro-2-izopropil-3-oxo-4-(o-tolil)pirazol-1-karbotioát; S-allil-5-amino-2-izopropil-4-(2-metilfenil)-3-oxo-2,3-dihidropirazol-1-karbotioát |
473798-59-3 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
M=10 M=1 |
ATP06/ATP10 | |||
| 613-319-00-0 | imidazole | imidazol | 206-019-2 | 288-32-4 | Repr.
1B Acute Tox. 4 Skin Corr. 1C |
H360D H302 H314 |
GHS08 GHS07 GHS05 Dgr |
H302 H314 H360D |
ATP07 | |||
| 613-320-00-6 | lenacil (ISO); 3-cyclohexyl-6,7-dihydro-1H-cyclopenta[d]pyrimidine-2,4(3H,5H)-dione | lenacil (ISO); 3-ciklohexil-6,7-dihidro-1H-ciklopenta[d]pirimidin-2,4(3H,5H)-dion | 218-499-0 | 2164-08-1 | Carc.
2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
M=10 M=10 |
ATP07 | ||
| 613-321-00-1 | (RS)-4-[1-(2,3-dimethylphenyl)ethyl]-1H-imidazole; medetomidine |
(RS)-4-[1-(2,3-dimetilfenil)etil]-1H-imidazol; medetomidin |
86347-14-0 | Acute
Tox. 2 Acute Tox. 2 STOT SE 3 STOT SE 1 STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H336 H370 (eye) H372 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H300 H370 (eye) H336 H372 H410 |
M=1 M=100 |
ATP10 | |||
| 613-322-00-7 | triadimenol
(ISO); (1RS,2RS;1RS,2SR)-1-(4-chlorophenoxy)-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl)butan-2-ol; α-tert-butyl-β-(4-chlorophenoxy)-1H-1,2,4-triazole-1-ethanol |
triadimenol
(ISO);
(1RS,2RS;1RS,2SR)-1-(4-klórfenoxi)-3,3-dimetil-1-(1H-1,2,4-triazol-1-il)bután-2-ol; α-terc-butil-β-(4-klórfenoxi)-1H-1,2,4-triazol-1-etanol |
259-537-6 | 55219-65-3 | Repr.
1B Lact. Acute Tox. 4 Aquatic Chronic 2 |
H360 H362 H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H302 H360 H362 H411 |
ATP10 | |||
| 613-323-00-2 | terbuthylazine
(ISO); N-tert-butyl-6-chloro-N′-ethyl-1,3,5-triazine-2,4-diamine |
terbutilazin
(ISO); N-terc-butil-6-klór-N′-etil-1,3,5-triazin-2,4-diamin |
227-637-9 | 5915-41-3 | Acute
Tox. 4 STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 H400 H410 |
GHS07 GHS08 GHS09 Wng |
H302 H373 H410 |
M=10 M=10 |
ATP10 | ||
| 613-324-00-8 | quinolin-8-ol; 8-hydroxyquinoline |
kinolin-8-ol; 8-hidroxikinolin |
205-711-1 | 148-24-3 | Repr.
1B Acute Tox. 3 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360D H301 H318 H317 H400 H410 |
GHS08 GHS06 GHS05 GHS09 Dgr |
H301 H318 H317 H360D H410 |
M=1 M=1 |
ATP10 | ||
| 613-325-00-3 | thiacloprid
(ISO); (Z)-3-(6-chloro-3-pyridylmethyl)-1,3-thiazolidin-2-ylidenecyanamide; {(2Z)-3-[(6-chloropyridin-3-yl)methyl]-1,3-thiazolidin-2-ylidene}cyanamide |
tiakloprid
(ISO); (Z)-3-(6-klór-3-piridilmetil)-1,3-tiazolidin-2-ilidénciánamid; {(2Z)-3-[(6-klórpiridin-3-il)metil]-1,3-tiazolidin-2-ilidén}ciánamid |
111988-49-9 | Carc.
2 Repr. 1B Acute Tox. 3 Acute Tox. 4 STOT SE 3 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H360FD H301 H332 H336 H400 H410 |
GHS08 GHS06 GHS09 Dgr |
H332 H301 H351 H360FD H336 H410 |
M=100 M=100 |
ATP10 | |||
| 613-326-00-9 | 2-methylisothiazol-3(2H)-one | 2-metilisotiazol-3(2H)-on | 220-239-6 | 2682-20-4 | Acute
Tox. 2 Acute Tox. 3 Acute Tox. 3 Skin Corr. 1B Eye Dam. 1 Skin Sens. 1A Aquatic Acute 1 Aquatic Chronic 1 |
H330 H311 H301 H314 H318 H317 H400 H410 |
GHS05 GHS06 GHS09 Dgr |
H330 H311 H301 H314 H317 H410 |
EUH071 |
Skin
Sens. 1A; H317: C ≥ 0,0015 % M=10 M=1 |
ATP13 | |
| 613-327-00-4 | pyroxsulam
(ISO); N-(5,7-dimethoxy[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-2-methoxy-4-(trifluoromethyl) pyridine-3-sulfonamide |
piroxszulam
(ISO); N-(5,7-dimetoxi[1,2,4]triazolo[1,5-a]pirimidin-2-il)-2-metoxi-4-(trifluormetil)piridin-3-szulfonamid |
422556-08-9 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
M=100 M=100 |
ATP13 | |||
| 613-328-00-X | 1-vinylimidazole | 1-vinilimidazol | 214-012-0 | 1072-63-5 | Repr.
1B |
H360D |
GHS08 Dgr |
H360D |
Repr.
1B; H360D: C ≥ 0,03 % |
ATP13 | ||
| 613-329-00-5 | halosulfuron-methyl
(ISO); methyl 3-chloro-5-{[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]sulfamoyl}-1-methyl-1H-pyrazole-4-carboxylate |
#HIÁNYZIK | 100784-20-1 | Repr.
1B Aquatic Acute 1 Aquatic Chronic 1 |
H360D H400 H410 |
GHS08 GHS09 Dgr |
H360D H410 |
M=1000 M=1000 |
ATP14 | |||
| 613-330-00-0 | 2-methylimidazole | #HIÁNYZIK | 211-765-7 | 693-98-1 | Repr.
1B |
H360Df |
GHS08 Dgr |
H360Df |
ATP14 | |||
| 613-331-00-6 | (2RS)-2-[4-(4-chlorophenoxy)-2-(trifluoromethyl)phenyl]-1-(1H- 1,2,4-triazol-1-yl)propan-2-ol; mefentrifluconazole | #HIÁNYZIK | 1417782-03-6 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
M=1 M=1 |
ATP15 | |||
| 613-332-00-1 | oxathiapiprolin (ISO); 1-(4-{4-[5-(2,6-difluorophenyl)-4,5-dihydro-1,2-oxazol-3- yl]-1,3-thiazol-2-yl}piperidin-1-yl)-2-[5- methyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]ethanone | #HIÁNYZIK | 1003318-67-9 | Aquatic
Chronic 1 |
H410 |
GHS09 Wng |
H410 |
M=1 |
ATP15 | |||
| 613-333-00-7 | pyrithione zinc; (T-4)- bis[1-(hydroxy-.kappa.O)pyridine-2(1H)- thionato-.kappa.S]zinc | #HIÁNYZIK | 236-671-3 | 13463-41-7 | Repr.
1B Acute Tox. 2 Acute Tox. 3 STOT RE 1 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360D H330 H301 H372 H318 H400 H410 |
GHS08 GHS06 GHS05 GHS09 Dgr |
H330 H301 H318 H360D H372 H410 |
Inhalation:
ATE = 0.14 mg/L (dusts/mists) Oral: ATE = 221 mg/kg M=1000 M=10 |
ATP15 | ||
| 613-334-00-2 | flurochloridone (ISO); 3-chloro-4-(chloromethyl)-1-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one | #HIÁNYZIK | 262-661-3 | 61213-25-0 | Repr.
1B Acute Tox. 4 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360FD H302 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H302 H317 H360FD H410 |
Oral:
ATE = 500 mg/kg M=100 M=100 |
ATP15 | ||
| 613-335-00-8 | 4,5-dichloro-2-octyl- 2H-isothiazol-3-one; [DCOIT] | #HIÁNYZIK | 264-843-8 | 64359-81-5 | Acute
Tox. 2 Acute Tox. 4 Skin Corr. 1 Eye Dam. 1 Skin Sens. 1A Aquatic Acute 1 Aquatic Chronic 1 |
H330 H302 H314 H318 H317 H400 H410 |
GHS06 GHS05 GHS09 Dgr |
H330 H302 H314 H317 H410 |
EUH071 |
Inhalation:
ATE = 0.16 mg/L (dusts/mists) Oral: ATE = 567 mg/kg Skin Irrit. 2; H315: 0,025 % ≤ C < 5 % Eye Irrit. 2; H319: 0,025 % ≤ C < 3 % Skin Sens. 1A; H317: C ≥ 0,0015 % M=100 M=100 |
ATP15 | |
| 613-336-00-3 | 2-methyl-1,2-benzothiazol-3(2H)-one; [MBIT] | #HIÁNYZIK | 2527-66-4 | Acute
Tox. 3 Acute Tox. 4 Skin Corr. 1C Eye Dam. 1 Skin Sens. 1A Aquatic Acute 1 Aquatic Chronic 2 |
H301 H312 H314 H318 H317 H400 H411 |
GHS06 GHS05 GHS09 Dgr |
H312 H301 H314 H317 H410 |
EUH071 |
Oral:
ATE = 175 mg/kg Dermal: ATE = 1100 mg/kg Skin Sens. 1A; H317: C ≥ 0,0015 % M=1 |
ATP15 | ||
| 614-001-00-4 | nicotine
(ISO); 3-[(2S)-1-methylpyrrolidin-2-yl]pyridine |
nikotin
(ISO); 3-[(2S)-1-metil-pirrolidin-2-il]piridin |
200-193-3 | 54-11-5 | Acute
Tox. 2 Acute Tox. 2 Acute Tox. 2 Aquatic Chronic 2 |
H330 H310 H300 H411 |
GHS06 GHS09 Dgr |
H330 H310 H300 H411 |
Inhalation:
ATE = 0.19 mg/L (dusts/mists) Dermal: ATE = 70 mg/kg Oral: ATE = 5 mg/kg |
CLP00/ATP13 | ||
| 614-002-00-X | salts of nicotine | nikotin sói | Acute
Tox. 1 Acute Tox. 2 * Acute Tox. 2 * Aquatic Chronic 2 |
H310 H330 H300 H411 |
GHS06 GHS09 Dgr |
H330 H310 H300 H411 |
A | CLP00 | ||||
| 614-003-00-5 | strychnine | sztrichnin | 200-319-7 | 57-24-9 | Acute
Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
CLP00 | |||
| 614-004-00-0 | salts of strychnine | sztrichnin sói | Acute
Tox. 2 * Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H410 |
A | CLP00 | ||||
| 614-005-00-6 | colchicine | kolhicin | 200-598-5 | 64-86-8 | Muta.
1B Acute Tox. 2 * |
H340 H300 |
GHS06 GHS08 Dgr |
H340 H300 |
CLP00/ATP01 | |||
| 614-006-00-1 | brucine; 2,3-dimethoxystrychnine | brucin; 2,3-dimetoxisztrichnin |
206-614-7 | 357-57-3 | Acute
Tox. 2 * Acute Tox. 2 * Aquatic Chronic 3 |
H330 H300 H412 |
GHS06 Dgr |
H330 H300 H412 |
CLP00 | |||
| 614-007-00-7 | brucine
sulphate [1] brucine nitrate [2] Strychnidin-10-one, 2,3-dimethoxy-, mono[(R)-1-methylheptyl 1,2-benzenedicarboxylate] [3] Strychnidin-10-one, 2,3-dimethoxy-, compd. with (S)mono(1-methylheptyl)-1,2-benzenedicarboxylate (1:1) [4] |
brucin-szulfát;
[1] brucin-nitrát; [2] sztrichnidin-10-on, 2,3-dimetoxi-, mono[(R)-1-metilheptil-1,2-benzoldikarboxilát]; [3] sztrichnidin-10-on, 2,3-dimetoxi-, reakcióterméke (S)mono(1-metilheptil)-1,2-benzoldikarboxiláttal (1:1) [4] |
225-432-9
[1] 227-317-9 [2] 269-439-5 [3] 269-710-8 [4] |
4845-99-2
[1] 5786-97-0 [2] 68239-26-9 [3] 68310-42-9 [4] |
Acute
Tox. 2 * Acute Tox. 2 * Aquatic Chronic 3 |
H330 H300 H412 |
GHS06 Dgr |
H330 H300 H412 |
A | CLP00 | ||
| 614-008-00-2 | aconitine | akonitin | 206-121-7 | 302-27-2 | Acute
Tox. 2 * Acute Tox. 2 * |
H330 H300 |
GHS06 Dgr |
H330 H300 |
CLP00 | |||
| 614-009-00-8 | salts of aconitine | akonitin sói | Acute
Tox. 2 * Acute Tox. 2 * |
H330 H300 |
GHS06 Dgr |
H330 H300 |
A | CLP00 | ||||
| 614-010-00-3 | atropine | atropin | 200-104-8 | 51-55-8 | Acute
Tox. 2 * Acute Tox. 2 * |
H330 H300 |
GHS06 Dgr |
H330 H300 |
CLP00 | |||
| 614-011-00-9 | salts of atropine | atropin sói | Acute
Tox. 2 * Acute Tox. 2 * |
H330 H300 |
GHS06 Dgr |
H330 H300 |
A | CLP00 | ||||
| 614-012-00-4 | hyoscyamine | hioszciamin | 202-933-0 | 101-31-5 | Acute
Tox. 2 * Acute Tox. 2 * |
H330 H300 |
GHS06 Dgr |
H330 H300 |
CLP00 | |||
| 614-013-00-X | salts of hyoscyamine | hioszciamin sói | Acute
Tox. 2 * Acute Tox. 2 * |
H330 H300 |
GHS06 Dgr |
H330 H300 |
A | CLP00 | ||||
| 614-014-00-5 | hyoscine | hioszcin | 200-090-3 | 51-34-3 | Acute
Tox. 1 Acute Tox. 2 * Acute Tox. 2 * |
H310 H330 H300 |
GHS06 Dgr |
H330 H310 H300 |
CLP00 | |||
| 614-015-00-0 | salts of hyoscine | hioszcin sói | Acute
Tox. 1 Acute Tox. 2 * Acute Tox. 2 * |
H310 H330 H300 |
GHS06 Dgr |
H330 H310 H300 |
A | CLP00 | ||||
| 614-016-00-6 | pilocarpine | pilokarpin | 202-128-4 | 92-13-7 | Acute
Tox. 2 * Acute Tox. 2 * |
H330 H300 |
GHS06 Dgr |
H330 H300 |
CLP00 | |||
| 614-017-00-1 | salts of pilocarpine | pilokarpin sói | Acute
Tox. 2 * Acute Tox. 2 * |
H330 H300 |
GHS06 Dgr |
H330 H300 |
A | CLP00 | ||||
| 614-018-00-7 | papaverine | papaverin | 200-397-2 | 58-74-2 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 614-019-00-2 | salts of papaverine | papaverin sói | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
A | CLP00 | ||||
| 614-020-00-8 | physostigmine | fizosztigmin | 200-332-8 | 57-47-6 | Acute
Tox. 2 * Acute Tox. 2 * |
H330 H300 |
GHS06 Dgr |
H330 H300 |
CLP00 | |||
| 614-021-00-3 | salts of physostigmine | fizosztigmin sói | Acute
Tox. 2 * Acute Tox. 2 * |
H330 H300 |
GHS06 Dgr |
H330 H300 |
A | CLP00 | ||||
| 614-022-00-9 | digitoxin | digitoxin | 200-760-5 | 71-63-6 | Acute
Tox. 3 * Acute Tox. 3 * STOT RE 2 * |
H331 H301 H373 ** |
GHS06 GHS08 Dgr |
H331 H301 H373 ** |
CLP00 | |||
| 614-023-00-4 | ephedrine | efedrin | 206-080-5 | 299-42-3 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 614-024-00-X | salts of ephedrine | efedrin sói | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
A | CLP00 | ||||
| 614-025-00-5 | ouabain | ouabain | 211-139-3 | 630-60-4 | Acute
Tox. 3 * Acute Tox. 3 * STOT RE 2 * |
H331 H301 H373 ** |
GHS06 GHS08 Dgr |
H331 H301 H373 ** |
CLP00 | |||
| 614-026-00-0 | strophantin-K | k-sztrofantin | 234-239-9 | 11005-63-3 | Acute
Tox. 3 * Acute Tox. 3 * STOT RE 2 * |
H331 H301 H373 ** |
GHS06 GHS08 Dgr |
H331 H301 H373 ** |
CLP00 | |||
| 614-027-00-6 | bufa-4,20,22-trienolide, 6-(acetyloxy)-3-(β-D-glucopyranosyloxy)-8,14-dihydroxy-, (3β, 6β)-; red squill; scilliroside | bufa-4,20,22-trienolid,
6β-(acetiloxi)-3-(β-D-glükopiranoziloxi)-8,14-dihidroxi-, (3β,
6β)-; red squill; scillirozid |
208-077-4 | 507-60-8 | Acute
Tox. 2 * |
H300 |
GHS06 Dgr |
H300 |
CLP00 | |||
| 614-028-00-1 | reaction mass of: 2-ethylhexyl mono-D-glucopyranoside; 2-ethylhexyl di-D-glucopyranoside | 2-etilhexil-mono-D-glükopiranozid; 2-etilhexil-di-D-glükopiranozid keveréke |
414-420-0 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | ||||
| 614-029-00-7 | constitutional isomers of penta-O-allyl-β-D-fructofuranosyl-α-D-glucopyranoside; constitutional isomers of hexa-O-allyl-β-D-fructofuranosyl-α-D-glucopyranoside; constitutional isomers of hepta-O-allyl-β-D-fructofuransoyl-α-D-glucopyranoside | penta-O-allil-β-D-fruktofuranozil-α-D-glükopiranozid
szerkezeti izomerei; hexa-O-allil-β-D-fruktofuranozil-α-D-glükopiranozid szerkezeti izomerei; hepta-O-allil-β-D-fruktofuranozil-α-D-glükopiranozid szerkezeti izomerei; |
419-640-0 | 68784-14-5 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 615-001-00-7 | methyl isocyanate | metil-izocianát | 210-866-3 | 624-83-9 | Flam.
Liq. 2 Repr. 2 Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H225 H361d *** H330 H311 H301 H335 H315 H318 H334 H317 |
GHS02 GHS06 GHS05 GHS08 Dgr |
H225 H361d *** H330 H311 H301 H334 H317 H335 H315 H318 |
CLP00/ATP01 | |||
| 615-002-00-2 | methyl isothiocyanate | metil-izotiocianát | 209-132-5 | 556-61-6 | Acute
Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H314 H317 H400 H410 |
GHS06 GHS05 GHS09 Dgr |
H331 H301 H314 H317 H410 |
CLP00 | |||
| 615-003-00-8 | thiocyanic acid | tiociánsav | 207-337-4 | 463-56-9 | Acute
Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 3 |
H332 H312 H302 H412 |
GHS07 Wng |
H332 H312 H302 H412 |
EUH032 |
CLP00 | ||
| 615-004-00-3 | salts of thiocyanic acid, with the exception of those specified elsewhere in this Annex | tiociánsav sói (kivéve az e mellékletben külön szereplőket) | - | - | Acute
Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 3 |
H332 H312 H302 H412 |
GHS07 Wng |
H332 H312 H302 H412 |
EUH032 |
A | CLP00/ATP01 | |
| 615-005-00-9 | 4,4'-methylenediphenyl
diisocyanate; diphenylmethane-4,4'-diisocyanate [1] 2,2'-methylenediphenyl diisocyanate; diphenylmethane-2,2'-diisocyanate [2] o-(p-isocyanatobenzyl)phenyl isocyanate; diphenylmethane-2,4'-diisocyanate [3] methylenediphenyl diisocyanate [4] |
4,4'-metiléndifenil-diizocianát;
difenilmetán-4,4'-diizocianát; [1] 2,2'-metiléndifenil-diizocianát; difenilmetán-2,2'-diizocianát; [2] o-(p-izocianátobenzil)fenil-izocianát; difenilmetán-2,4'-diizocianát; [3] metiléndifenil-diizocianát [4] |
202-966-0
[1] 219-799-4 [2] 227-534-9 [3] 247-714-0 [4] |
101-68-8
[1] 2536-05-2 [2] 5873-54-1 [3] 26447-40-5 [4] |
Carc.
2 Acute Tox. 4 * STOT SE 3 STOT RE 2 * Skin Irrit. 2 Eye Irrit. 2 Resp. Sens. 1 Skin Sens. 1 |
H351 H332 H335 H373 ** H315 H319 H334 H317 |
GHS08 GHS07 Dgr |
H351 H332 H373 ** H319 H335 H315 H334 H317 |
Eye
Irrit. 2; H319: C ≥ 5 % Skin Irrit. 2; H315: C ≥ 5 % Resp. Sens. 1; H334: C ≥ 0,1 % STOT SE 3; H335: C ≥ 5 % |
2 C | CLP00/ATP01 | |
| 615-006-00-4 | 2-methyl-m-phenylene
diisocyanate; toluene-2,6-di-isocyanate [1] 4-methyl-m-phenylene diisocyanate; toluene-2,4-di-isocyanate [2] m-tolylidene diisocyanate; toluene-diisocyanate [3] |
2-metil-m-fenilén-diizocianát; toluol-2,4-diizocianát; [1] 4-metil-m-fenilén-diizocianát; toluol-2,6-diizocianát; [2] m-tolilidén-diizocianát; toluol-diizocianát [3] |
202-039-0
[1] 209-544-5 [2] 247-722-4 [3] |
91-08-7
[1] 584-84-9 [2] 26471-62-5 [3] |
Carc.
2 Acute Tox. 2 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Resp. Sens. 1 Skin Sens. 1 Aquatic Chronic 3 |
H351 H330 H335 H315 H319 H334 H317 H412 |
GHS06 GHS08 Dgr |
H351 H330 H319 H335 H315 H334 H317 H412 |
Resp.
Sens. 1; H334: C ≥ 0,1 % |
C | CLP00 | |
| 615-007-00-X | 1,5-naphthylene diisocyanate | 1,5-naftilén-diizocianát | 221-641-4 | 3173-72-6 | Acute
Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Resp. Sens. 1 Aquatic Chronic 3 |
H332 H335 H315 H319 H334 H412 |
GHS08 GHS07 Dgr |
H332 H319 H335 H315 H334 H412 |
CLP00 | |||
| 615-008-00-5 | 3-isocyanatomethyl-3,5,5-trimethylcyclohexyl isocyanate; isophorone di-isocyanate | 3-izocianátometil-3,5,5-trimetilciklohexil-izocianát; izoforon-diizocianát | 223-861-6 | 4098-71-9 | Acute
Tox. 3 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Resp. Sens. 1 Skin Sens. 1 Aquatic Chronic 2 |
H331 H335 H315 H319 H334 H317 H411 |
GHS06 GHS08 GHS09 Dgr |
H331 H319 H335 H315 H334 H317 H411 |
* Resp. Sens. 1; H334: C ≥ 0,5 % Skin Sens.1; H317: C ≥ 0,5 % |
2 | CLP00 | |
| 615-009-00-0 | 4,4'-methylenedi(cyclohexyl isocyanate); dicyclohexylmethane-4,4'-di-isocyanate | 4,4’-metiléndi(ciklohexil-izocianát); diciklohexilmetán-4,4’-diizocianát | 225-863-2 | 5124-30-1 | Acute
Tox. 3 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Resp. Sens. 1 Skin Sens. 1 |
H331 H335 H315 H319 H334 H317 |
GHS06 GHS08 Dgr |
H331 H319 H335 H315 H334 H317 |
* Resp. Sens. 1; H334: C ≥ 0,5 % Skin Sens. 1; H317: C ≥ 0,5 % |
2 | CLP00 | |
| 615-010-00-6 | 2,2,4-trimethylhexamethylene-1,6-di-isocyanate
[1] 2,4,4-trimethylhexamethylene-1,6-di-isocyanate [2] |
2,2,4-trimetilhexametilén-1,6-diizocianát;
[1] 2,4,4-trimetilhexametilén-1,6-diizocianát [2] |
241-001-8
[1] 239-714-4 [2] |
16938-22-0
[1] 15646-96-5 [2] |
Acute
Tox. 3 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Resp. Sens. 1 |
H331 H335 H315 H319 H334 |
GHS06 GHS08 Dgr |
H331 H319 H335 H315 H334 |
* Resp. Sens. 1; H334: C ≥ 0,5 % Skin Sens. 1; H317: C ≥ 0,5 % |
2 C | CLP00 | |
| 615-011-00-1 | hexamethylene-di-isocyanate | hexametilén-diizocianát | 212-485-8 | 822-06-0 | Acute
Tox. 3 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Resp. Sens. 1 Skin Sens. 1 |
H331 H335 H315 H319 H334 H317 |
GHS06 GHS08 Dgr |
H331 H319 H335 H315 H334 H317 |
* Resp. Sens. 1; H334: C ≥ 0,5 % Skin Sens. 1; H317: C ≥ 0,5 % |
2 | CLP00 | |
| 615-012-00-7 | 4-isocyanatosulphonyltoluene; tosyl isocyanate | 4-izocianát-szulfonil-toluol; tozil-izocianát |
223-810-8 | 4083-64-1 | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 Resp. Sens. 1 |
H335 H315 H319 H334 |
GHS08 GHS07 Dgr |
H319 H335 H315 H334 |
EUH014 |
Eye
Irrit.; H319: C ≥ 5 % STOT SE 3; H335: C ≥ 5 % Skin Irrit. 2; H315: C ≥ 5 % |
CLP00 | |
| 615-013-00-2 | cyanamide; carbamonitril | ciánamid; karbamonitril |
206-992-3 | 420-04-2 | Carc.
2 Repr. 2 Acute Tox. 3 Acute Tox. 3 STOT RE 2 Skin Corr. 1 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H351 H361fd H311 H301 H373 (thyroid) H314 H318 H317 H412 |
GHS08 GHS06 GHS05 Dgr |
H311 H301 H314 H317 H351 H361fd H373 (thyroid) H412 |
CLP00/ATP10 | |||
| 615-014-00-8 | tris(1-dodecyl-3-methyl-2-phenylbenzimidazolium)hexacyanoferrate | trisz(1-dodecil-3-metil-2-fenilbenzimidazolium)hexacianoferrát | 7276-58-6 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | ||||
| 615-015-00-3 | 1,7,7-trimethylbicyclo(2,2,1)hept-2-yl thiocyanatoacetate; isobornyl thiocyanoacetate | 1,7,7-trimetilbiciklo[2.2.1]hept-2-il-tiocianoacetát; izobornil-tiocianoacetát |
204-081-5 | 115-31-1 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | |||
| 615-016-00-9 | potassium cyanate | kálium-cianát | 209-676-3 | 590-28-3 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 615-017-00-4 | calcium cyanamide | kálcium-ciánamid | 205-861-8 | 156-62-7 | Acute
Tox. 4 * STOT SE 3 Eye Dam. 1 |
H302 H335 H318 |
GHS05 GHS07 Dgr |
H302 H335 H318 |
CLP00 | |||
| 615-018-00-X | 2-(2-butoxyethoxy)ethyl thiocyanate | 2-(2-butoxietoxi)etil-tiocianát | 203-985-7 | 112-56-1 | Flam.
Liq. 3 Acute Tox. 3 * Acute Tox. 3 * |
H226 H311 H301 |
GHS02 GHS06 Dgr |
H226 H311 H301 |
CLP00 | |||
| 615-019-00-5 | dicyclohexylcarbodiimide | N, N-diciklohexilkarbodiimid | 208-704-1 | 538-75-0 | Acute
Tox. 3 * Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 |
H311 H302 H318 H317 |
GHS06 GHS05 Dgr |
H311 H302 H318 H317 |
CLP00 | |||
| 615-020-00-0 | methylene dithiocyanate | metilén-ditiocianát | 228-652-3 | 6317-18-6 | Acute
Tox. 2 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 |
H330 H301 H314 H317 H400 |
GHS06 GHS05 GHS09 Dgr |
H330 H301 H314 H317 H400 |
CLP00 | |||
| 615-021-00-6 | 1,3,5-tris(oxiranylmethyl)-1,3,5-triazine-2,4,6(1H,3H,5H)-trione; TGIC | 1,3,5-trisz(oxiranilmetil)-1,3,5-triazin-2,4,6-(1H,3H,5H)-trion; TGIC |
219-514-3 | 2451-62-9 | Muta.
1B Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H340 H331 H301 H373 ** H318 H317 H412 |
GHS06 GHS08 GHS05 Dgr |
H340 H331 H301 H373 ** H318 H317 H412 |
CLP00 | |||
| 615-022-00-1 | methyl 3-isocyanatosulfonyl-2-thiophene-carboxylate | metil-3-izocianátoszulfonil-2-tiofénkarboxilát | 410-550-7 | 79277-18-2 | STOT
RE 2 * Resp. Sens. 1 Skin Sens. 1 |
H373
** H334 H317 |
GHS08 Dgr |
H373
** H334 H317 |
EUH014 |
CLP00/ATP01 | ||
| 615-023-00-7 | 2-(isocyanatosulfonylmethyl)benzoic acid methyl ester; (alt.):methyl 2-(isocyanatosulfonylmethyl)benzoate | 2-(izocianátoszulfonilmetil)benzoesav-metil-észter; metil-2-(izocianátoszulfonilmetil)benzoát | 410-900-9 | 83056-32-0 | Flam.
Liq. 3 Muta. 2 Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Resp. Sens. 1 |
H226 H341 H332 H373 ** H318 H334 |
GHS02 GHS08 GHS05 GHS07 Dgr |
H226 H341 H332 H373 ** H318 H334 |
EUH014 |
CLP00 | ||
| 615-024-00-2 | 2-phenylethylisocyanate | 2-feniletilizocianát | 413-080-0 | 1943-82-4 | Acute
Tox. 3 * Acute Tox. 4 * Skin Corr. 1A Resp. Sens. 1 Skin Sens. 1 Aquatic Chronic 2 |
H331 H302 H314 H334 H317 H411 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H331 H302 H314 H334 H317 H411 |
CLP00 | |||
| 615-025-00-8 | 4,4'-ethylidenediphenyl dicyanate | 4,4’-etilidéndifenil-dicianát | 405-740-1 | 47073-92-7 | Acute
Tox. 4 * Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H373 ** H318 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H332 H302 H373 ** H318 H410 |
CLP00 | |||
| 615-026-00-3 | 4,4'-methylenebis(2,6-dimethylphenyl cyanate) | 4,4’-metilénbisz(2,6-dimetilfenil-cianát) | 405-790-4 | 101657-77-6 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
CLP00 | |||
| 615-028-00-4 | ethyl 2-(isocyanatosulfonyl)benzoate | etil-2-(izocianátoszulfonil)benzoát | 410-220-2 | 77375-79-2 | Acute
Tox. 4 * STOT RE 2 * Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H302 H373 ** H318 H334 H317 |
GHS05 GHS08 GHS07 Dgr |
H302 H373 ** H318 H334 H317 |
EUH014 |
CLP00/ATP01 | ||
| 615-029-00-X | 2,5-bis-isocyanatomethyl-bicyclo[2.2.1]heptane | 2,5-bisz(izocianátometil)-biciklo[2.2.1]heptán | 411-280-2 | Acute
Tox. 2 * Acute Tox. 4 * Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Chronic 3 |
H330 H302 H314 H334 H317 H412 |
GHS06 GHS08 GHS05 Dgr |
H330 H302 H314 H334 H317 H412 |
CLP00 | ||||
| 615-030-00-5 | alkali salts and alkali earth salts of thiocyanic acid, with the exception of those specified elsewhere in this Annex | tiociánsav alkálisói és földalkálisói (kivéve az e mellékletben külön szereplőket) | - | - | Acute
Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 3 |
H332 H312 H302 H412 |
GHS07 Wng |
H332 H312 H302 H412 |
A | CLP00/ATP01 | ||
| 615-031-00-0 | thallium thiocyanate | tallium-tiocianát | 222-571-7 | 3535-84-0 | Acute
Tox. 2 * Acute Tox. 2 * Acute Tox. 4 * STOT RE 2 Aquatic Chronic 2 |
H330 H300 H312 H373 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H330 H300 H312 H373 ** H411 |
CLP00/ATP01 | |||
| 615-032-00-6 | metal salts of thiocyanic acid, with the exception of those specified elsewhere in this Annex | tiociánsav fémsói (kivéve az e mellékletben külön szereplőket) | - | - | Acute
Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
A | CLP00/ATP01 | ||
| 615-033-00-1 | reaction product of diphenylmethanediisocyanate, octylamine, oleylamine and cyclohexylamine (1:1.58:0.32:0.097) | difenilmetán-diizocianát, oktil-amin, oleil-amin és ciklohexil-amin (1:1,58:0,32:0,097) reakcióterméke | 430-980-9 | - | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 615-034-00-7 | reaction product of diphenylmethanediisocyanate, octylamine, 4-ethoxyaniline and ethylenediamine (1:0,37:1,53:0,05) | difenilmetán-diizocianát,
oktil-amin, 4-etoxianilin és etiléndiamin (1:0,37:1,53:0,05) reakcióterméke |
430-750-8 | - | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 615-035-00-2 | reaction product of diphenylmethanediisocyanate, octylamine and oleylamine (molar ratio 1:1.86:0.14) | difenilmetán-diizocianát, oktil-amin és oleil-amin (mólarány 1:1,86:0,14) reakcióterméke | 430-930-6 | 122886-55-9 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 615-036-00-8 | reaction product of diphenylmethanediisocyanate, toluenediisocyanate ( reaction mass of isomers: 65 % 2,4- and 35 % 2,6-diisocyanate), octylamine, oleylamine and 4-ethoxyaniline (molar ratio 4:1:7:1:2) | difenilmetán-diizocianát, toluol-diizocianát (65 % 2,4- és 35 % 2,6-diizocianát izomer keveréke), oktil-amin, oleil-amin és 4-etoxianilin (mólarány 4:1:7:1:2) reakcióterméke | 430-940-0 | - | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 615-037-00-3 | reaction product of diphenylmethanediisocyanate, toluenediisocyanate ( reaction mass of isomers: 65 % 2,4- and 35 % 2,6-diisocyanate), octylamine and oleylamine (molar ratio 4:1:9:1) | difenilmetán-diizocianát, toluol-diizocianát (65 % 2,4- és 35 % 2,6-diizocianát izomer keveréke), oktil-amin és oleil-amin (mólarány 4:1:9:1) reakcióterméke | 430-950-5 | - | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 615-038-00-9 | reaction product of toluenediisocyanate ( reaction mass of isomers: 65 % 2,4- and 35 % 2,6-diisocyanate) and aniline (molarratio 1:2) | toluol-diizocianát (65 % 2,4- és 35 % 2,6-diizocianát izomer keveréke) és anilin (mólarány 1:2) reakcióterméke | 430-960-1 | - | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 615-039-00-4 | reaction product of diphenylmethanediisocyanate, toluenediisocyanate ( reaction mass of isomers: 65 % 2,4- and 35 % 2,6-diisocyanate), octylamine, oleylamine and 4-ethoxyaniline (molar ratio 3.88:1:6.38:0.47:2.91) | difenilmetán-diizocianát, toluol-diizocianát (65 % 2,4- és 35 % 2,6-diizocianát izomer keveréke), oktil-amin, oleil-amin és 4-etoxianilin (mólarány 3,88:1:6,38:0,47:2,91) reakcióterméke | 430-970-4 | - | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 615-044-00-1 | 4-chlorophenylisocyanate | 4-klórfenil-izocianát | 203-176-9 | 104-12-1 | Acute
Tox. 2 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Resp. Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H302 H335 H315 H318 H334 H400 H410 |
GHS06 GHS05 GHS08 GHS09 Dgr |
H330 H302 H335 H315 H318 H334 H410 |
ATP01 | |||
| 615-045-00-7 | 4,4'-methylene bis(3-chloro-2,6-di-ethylphenylisocyanate) | 4,4'-metilénbisz(3-klór-2,6-dietilfenilizocianát) | 420-530-1 | - | Resp.
Sens. 1 Skin Sens. 1 Aquatic Chronic 4 |
H334 H317 H413 |
GHS08 Dgr |
H334 H317 H413 |
ATP01 | |||
| 616-001-00-X | N,N-dimethylformamide; dimethyl formamide | N,
N-dimetilformamid; dimetilformamid |
200-679-5 | 68-12-2 | Repr.
1B Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 |
H360D
*** H332 H312 H319 |
GHS08 GHS07 Dgr |
H360D
*** H332 H312 H319 |
CLP00 | |||
| 616-002-00-5 | 2-fluoroacetamide | 2-fluoracetamid | 211-363-1 | 640-19-7 | Acute
Tox. 2 * Acute Tox. 3 * |
H300 H311 |
GHS06 Dgr |
H300 H311 |
CLP00 | |||
| 616-003-00-0 | acrylamide; prop-2-enamide | akrilamid; prop-2-énamid |
201-173-7 | 79-06-1 | Carc.
1B Muta. 1B Repr. 2 Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 1 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H350 H340 H361f *** H301 H332 H312 H372 ** H315 H319 H317 |
GHS06 GHS08 Dgr |
H350 H340 H361f *** H301 H372 ** H332 H312 H319 H315 H317 |
D | CLP00 | ||
| 616-004-00-6 | allidochlor (ISO); N,N-diallylchloroacetamide | allidoklór
(ISO); N,N-diallilklóracetamid |
202-270-7 | 93-71-0 | Acute
Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Eye Irrit. 2 Aquatic Chronic 2 |
H312 H302 H315 H319 H411 |
GHS07 GHS09 Wng |
H312 H302 H319 H315 H411 |
CLP00 | |||
| 616-005-00-1 | chlorthiamid (ISO); 2,6-dichloro (thiobenzamide) | klórtiamid
(ISO); 2,6-diklór-(tiobenzamid) |
217-637-7 | 1918-13-4 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 616-006-00-7 | dichlofluanid (ISO); N-[(dichlorofluoromethyl)thio]-N′,N′-dimethyl-N-phenylsulfamide | diklofluanid
(ISO); N-[(diklórfluormetil)tio]-N′,N′-dimetil-N-fenilszulfamid |
214-118-7 | 1085-98-9 | Acute
Tox. 4 Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 |
H332 H319 H317 H400 |
GHS07 GHS09 Wng |
H332 H319 H317 H400 |
M=10 |
CLP00/ATP10 | ||
| 616-007-00-2 | diphenamid (ISO); N,N-dimethyl-2,2-diphenylacetamide | difénamid
(ISO); N, N-dimetil-2,2-difenilacetamid |
213-482-4 | 957-51-7 | Acute
Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
CLP00 | |||
| 616-008-00-8 | propachlor (ISO); 2-chloro-N-isopropylacetanilide; α-chloro-N-isopropylacetanilide | propaklór
(ISO); 2-klór-N-izopropilacetanilid; α-klór-N-izopropilacetanilid |
217-638-2 | 1918-16-7 | Acute
Tox. 4 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H317 H410 |
CLP00 | |||
| 616-009-00-3 | propanil (ISO); 3',4'-dichloropropionanilide | propanil
(ISO); 3',4'-diklórpropionanilid |
211-914-6 | 709-98-8 | Acute
Tox. 4 * Aquatic Acute 1 |
H302 H400 |
GHS07 GHS09 Wng |
H302 H400 |
M=10 |
CLP00/ATP01 | ||
| 616-010-00-9 | tosylchloramide sodium | tozilklóramid-nátrium | 204-854-7 | 127-65-1 | Acute
Tox. 4 * Skin Corr. 1B Resp. Sens. 1 |
H302 H314 H334 |
GHS08 GHS05 GHS07 Dgr |
H302 H314 H334 |
EUH031 |
CLP00 | ||
| 616-011-00-4 | N,N-dimethylacetamide | N,N-dimetil-acetamid | 204-826-4 | 127-19-5 | Repr.
1B Acute Tox. 4 * Acute Tox. 4 * |
H360D
*** H332 H312 |
GHS08 GHS07 Dgr |
H360D
*** H332 H312 |
CLP00/ATP09 | |||
| 616-012-00-X | N-(dichlorofluoromethylthio)phthalimide; N-(fluorodichloromethylthio)phthalimide | N-(diklórfluormetiltio)ftálimid; N-(fluordiklórmetiltio)ftálimid |
211-952-3 | 719-96-0 | Skin
Irrit. 2 |
H315 |
GHS07 Wng |
H315 |
CLP00 | |||
| 616-013-00-5 | butyraldehyde oxime | butiraldehid-oxim | 203-792-8 | 110-69-0 | Acute
Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 |
H311 H302 H319 |
GHS06 Dgr |
H311 H302 H319 |
CLP00 | |||
| 616-014-00-0 | butanone oxime; ethyl methyl ketoxime; ethyl methyl ketone oxime | 2-butanon-oxim; etil-metil-ketoxim; etil-metil-keton-oxim |
202-496-6 | 96-29-7 | Carc.
1B Acute Tox. 3 Acute Tox. 4 STOT SE 3 STOT SE 1 STOT RE 2 Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H350 H301 H312 H336 H370 (upper respiratory tract) H373 (blood system) H315 H318 H317 |
GHS08 GHS06 GHS05 Dgr |
H312 H301 H315 H318 H317 H350 H370 (upper respiratory tract) H336 H373 (blood system) |
Oral:
ATE = 100 mg/kg Dermal: ATE = 1100 mg/kg |
CLP00/ATP15 | ||
| 616-015-00-6 | alachlor (ISO); 2-chloro-2',6'-diethyl-N-(methoxymethyl)acetanilide | alaklór
(ISO); 2-klór-2’,6’-dietil-N-(metoximetil)acetanilid |
240-110-8 | 15972-60-8 | Carc.
2 Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H317 H410 |
M=10 |
CLP00 | ||
| 616-016-00-1 | 1-(3,4-dichlorophenylimino) thiosemicarbazide | 1-(3,4-diklórfenilimino)tioszemikarbazid | 5836-73-7 | Acute
Tox. 2 * |
H300 |
GHS06 Dgr |
H300 |
CLP00 | ||||
| 616-017-00-7 | cartap hydrochloride | kartap-hidroklorid | 239-309-2 | 15263-52-2 | Acute
Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
CLP00 | |||
| 616-018-00-2 | diethyltoluamide (ISO): N,N-diethyl-m-toluamide; [deet] | N,N-dietil-m-toluamid; deet |
205-149-7 | 134-62-3 | Acute
Tox. 4 Skin Irrit. 2 Eye Irrit. 2 |
H302 H315 H319 |
GHS07 Wng |
H302 H315 H319 |
Oral:
ATE = 1892 mg/kg |
CLP00/ATP14 | ||
| 616-019-00-8 | perfluidone (ISO); 1,1,1-trifluoro-N-(4-phenylsulphonyl-o-tolyl)methanesulphonamide | perfluidon
(ISO); 1,1,1-trifluor-N-(4-fenilszulfonil-o-tolil)metánszulfonamid |
253-718-3 | 37924-13-3 | Acute
Tox. 4 * Eye Irrit. 2 |
H302 H319 |
GHS07 Wng |
H302 H319 |
CLP00 | |||
| 616-020-00-3 | tebuthiuron (ISO); 1-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-1,3-dimethylurea | tebutiuron
(ISO); 1-(5-terc-butil-1,3,4-tiadiazol-2-il)-1,3-dimetilkarbamid |
251-793-7 | 34014-18-1 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | |||
| 616-021-00-9 | thiazafluron (ISO); 1,3-dimethyl-1-(5-trifluoromethyl-1,3,4-thiadiazol-2-yl)urea | tiazafluron
(ISO); 1,3-dimetil-1-(5-trifluormetil-1,3,4-tiadiazol-2-il)karbamid |
246-901-4 | 25366-23-8 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | |||
| 616-022-00-4 | acetamide | acetamid | 200-473-5 | 60-35-5 | Carc.
2 |
H351 |
GHS08 Wng |
H351 |
CLP00 | |||
| 616-023-00-X | N-hexadecyl(or octadecyl)-N-hexadecyl(or octadecyl)benzamide | N-hexadecil(vagy oktadecil)-N-hexadecil(vagy oktadecil)benzamid | 401-980-6 | Skin
Irrit. 2 Skin Sens. 1 |
H315 H317 |
GHS07 Wng |
H315 H317 |
CLP00 | ||||
| 616-024-00-5 | 2-(4,4-dimethyl-2,5-dioxooxazolidin-1-yl)-2-chloro-5-(2-(2,4-di-tert-pentylphenoxy)butyramido)-4,4-dimethyl-3-oxovaleranilide | 2-(4,4-dimetil-2,5-dioxooxazolidin-1-il)-2-klór-5-[2-(2,4-di-(terc-pentilfenoxi))butiramido]-4,4-dimetil-3-oxovaleranilid | 402-260-4 | 54942-74-4 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 616-025-00-0 | valinamide | valinamid | 402-840-7 | 20108-78-5 | Repr.
2 Eye Irrit. 2 Skin Sens. 1 |
H361f
*** H319 H317 |
GHS08 Wng |
H361f
*** H319 H317 |
CLP00 | |||
| 616-026-00-6 | thioacetamide | tioacetamid | 200-541-4 | 62-55-5 | Carc.
1B Acute Tox. 4 * Skin Irrit. 2 Eye Irrit. 2 Aquatic Chronic 3 |
H350 H302 H315 H319 H412 |
GHS08 GHS07 Dgr |
H350 H302 H319 H315 H412 |
CLP00 | |||
| 616-027-00-1 | tris(2-(2-hydroxyethoxy)ethyl)ammonium 3-acetoacetamido-4-methoxybenzenesulfonate | trisz(2-(2-hidroxietoxi)etil)ammónium 3-acetoacetamido-4-metoxibenzol-szulfonát | 403-760-5 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | ||||
| 616-028-00-7 | N-(4-(3-(4-cyanophenyl)ureido)-3-hydroxyphenyl)-2-(2,4-di-tert-pentylphenoxy)octanamide | N-[4-[3-(4-cianofenil)ureido]3-hidroxifenil]-2-(2,4-di-terc-pentilfenoxi)oktánamid | 403-790-9 | 108673-51-4 | Skin
Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
CLP00 | |||
| 616-029-00-2 | N,N'-ethylenebis(vinylsulfonylacetamide) | N, N’-etilénbisz(vinilszulfonilacetamid) | 404-790-1 | 66710-66-5 | Eye
Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
CLP00 | |||
| 616-030-00-8 | ethidimuron (ISO); 1-(5-ethylsulphonyl-1,3,4-thiadiazol-2-yl)-1,3-dimethylurea | etidimuron
(ISO); 1-(5-etilszulfonil-1,3,4-tiadiazol-2-il)-1,3-dimetilkarbamid |
250-010-6 | 30043-49-3 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
CLP00 | |||
| 616-031-00-3 | dimethachlor (ISO); 2-chloro-N-(2,6-dimethylphenyl)-N-(2-methoxyethyl)acetamide | dimetaklór
(ISO); 2-klór-N-(2,6-dimetilfenil)-N-(2-metoxietil)acetamid; |
256-625-6 | 50563-36-5 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
CLP00 | |||
| 616-032-00-9 | diflufenican (ISO); N-(2,4-difluorophenyl)-2-[3-(trifluoromethyl)phenoxy]-3-pyridinecarboxamide | diflufenikán
(ISO); N-(2,4-difluorfenil)-2-[3-(trifluormetil)fenoxi]-3-piridinkarboxamid |
83164-33-4 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | |||||
| 616-033-00-4 | cyprofuram (ISO); N-(3-chlorophenyl)-N-(tetrahydro-2-oxo-3-furyl)cyclopropanecarboxamide | ciprofurám
(ISO); N-(3-klórfenil)-N-(tetrahidro-2-oxo-3-furil)ciklopropánkarboxamid |
274-050-9 | 69581-33-5 | Acute
Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H301 H312 H410 |
CLP00 | |||
| 616-034-00-X | pyracarbolid (ISO); 3,4-dihydro-6-methyl-2H-pyran-5-carboxanilide | pirakarbolid
(ISO); 3,4-dihidro-6-metil-2H-pirán-5-karboxanilid |
246-419-4 | 24691-76-7 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | ||||
| 616-035-00-5 | cymoxanil (ISO); 2-cyano-N-[(ethylamino)carbonyl]-2-(methoxyimino)acetamide | cimoxanil
(ISO); 2-ciano-N-[(etilamino)karbonil]-2-(metoxiimino)acetamid |
261-043-0 | 57966-95-7 | Repr.
2 Acute Tox. 4 STOT RE 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361fd H302 H373 (blood, thymus) H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H317 H361fd H373 (blood, thymus) H410 |
M=1 M=1 |
CLP00/ATP06 | ||
| 616-036-00-0 | 2-chloracetamide | 2-klóracetamid | 201-174-2 | 79-07-2 | Repr.
2 Acute Tox. 3 * Skin Sens. 1 |
H361f
*** H301 H317 |
GHS06 GHS08 Dgr |
H361f
*** H301 H317 |
Skin
Sens. 1; H317: C ≥ 0,1 % |
CLP00 | ||
| 616-037-00-6 | acetochlor (ISO); 2-chloro-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)acetamide | acetoklór (ISO); 2-klór-N-(etoximetil)-N-(2-etil-6-metilfenil)acetamid | 251-899-3 | 34256-82-1 | Carc.
2 Repr. 2 Acute Tox. 4 STOT SE 3 STOT RE 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H361f H332 H335 H373 (kidney) H315 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H332 H315 H317 H351 H361f H335 H373 (kidney) H410 |
M=1000 M=100 |
CLP00/ATP09 | ||
| 616-038-00-1 | (4-aminophenyl)-N-methylmethylensulfonamide hydrochloride | (4-aminofenil)-N-metilmetilénszulfonamid-hidroklorid | 406-010-5 | 88918-84-7 | Eye
Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H411 |
CLP00 | |||
| 616-039-00-7 | 3',5'-dichloro-4'-ethyl-2'-hydroxypalmitanilide | 3’,5’-diklór-4’-etil-2’-hidroxipalmitinanilid | 406-200-8 | 117827-06-2 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 616-040-00-2 | potassium N-(4-toluenesulfonyl)-4-toluenesulfonamide | kálium-N-(4-toluolszulfonil)-4-toluolszulfonamid | 406-650-5 | 97888-41-0 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | |||
| 616-041-00-8 | 3',5'-dichloro-2-(2,4-di-tert-pentylphenoxy)-4'-ethyl-2'-hydroxyhexananilide | 3’,5’-diklór-2-[2,4-di(terc-pentil)fenoxi]-4’-etil-2’-hidroxihexánanilid | 406-840-8 | 101664-25-9 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 616-042-00-3 | N-(2-(6-ethyl-7-(4-methylphenoxy)-1H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)propyl)-2-octadecyloxybenzamide | N-[2-(6-etil-7-(4-metilfenoxi)-1H-pirazol[1,5-b][1,2,4]triazol-2-il)propil]-2-oktadeciloxibenzamid | 407-070-5 | 142859-67-4 | Skin
Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
CLP00 | |||
| 616-043-00-9 | isoxaben (ISO); N-[3-(1-ethyl-1-methylpropyl)-1,2-oxazol-5-yl]-2,6-dimethoxybenzamide | izoxaben
(ISO); N-[3-(1-etil-1-metilpropil)-1,2-oxazol-5-il]-2,6-dimetoxibenzamid |
407-190-8 | 82558-50-7 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 616-044-00-4 | N-(3,5-dichloro-4-ethyl-2-hydroxyphenyl)-2-(3-pentadecylphenoxy)-butanamide | N-(3,5-diklór-4-etil-2-hidroxifenil)-2-(3-pentadecilfenoxi)butánamid | 402-510-2 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | ||||
| 616-045-00-X | 2'-(4-chloro-3-cyano-5-formyl-2-thienylazo)-5'-diethylamino-2-methoxyacetanilide | 2’-(4-klór-3-ciano-5-formil-2-tienilazo)-5’-dietilamino-2-metoxiacetanilid | 405-190-2 | 122371-93-1 | Skin
Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
CLP00 | |||
| 616-046-00-5 | N-(2-(6-chloro-7-methylpyrazolo(1,5-b)-1,2,4-triazol-4-yl)propyl)-2-(2,4-di-tert-pentylphenoxy)octanamide | N-(2-(6-klór-7-metilpirazolo(1,5-b)-1,2,4-triazol-4-il)propil)-2-(2,4-di-terc-pentilfenoxi)oktánamid | 406-390-2 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | ||||
| 616-047-00-0 | reaction mass of: 2,2',2'',2'''-(ethylenedinitrilotetrakis-N,N-di(C16)alkylacetamide; 2,2',2'',2'''-(ethylenedinitrilotetrakis-N,N-di(C18)alkylacetamide | 2,2’,2”,2’”-(etiléndinitrilotetrakisz-N,
N-di(C16)alkilacetamid; 2,2’,2”,2”’-(etiléndinitrilotetrakisz-N, N-di(C18)alkilacetamid keveréke |
406-640-0 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | ||||
| 616-048-00-6 | 3'-trifluoromethylisobutyranilide | 3’-trifluormetilizobutiranilid | 406-740-4 | 1939-27-1 | STOT
RE 2 * Aquatic Chronic 2 |
H373
** H411 |
GHS08 GHS09 Wng |
H373
** H411 |
CLP00 | |||
| 616-049-00-1 | 2-(2,4-bis(1,1-dimethylethyl)phenoxy)-N-(3,5-dichloro-4-ethyl-2-hydroxyphenyl)-hexanamide | 2-(2,4-bisz(1,1-dimetiletil)fenoxi)-N-(3,5-diklór-4-etil-2-hidroxifenil)hexánamid | 408-150-2 | 99141-89-6 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 616-050-00-7 | lufenuron (ISO); N-[2,5-dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)-phenyl-aminocarbonyl]-2,6-difluorobenzamide | lufenuron
(ISO); N-[2,5-diklór-4-(1,1,2,3,3,3-hexafluorpropoxi)fenil-aminokarbonil]-2,6-difluorbenzamid |
410-690-9 | 103055-07-8 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
CLP00 | |||
| 616-051-00-2 | reaction mass of: 2,4 -bis(N'-(4-methylphenyl)-ureido)-toluene; 2,6 -bis(N'-(4-methylphenyl)-ureido)-toluene | 2,4-bisz[N'-(4-metilfenil)ureido)toluol; 2,6-bisz[N'-(4-metilfenil)ureido)toluol keveréke |
411-070-0 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | |||||
| 616-052-00-8 | formamide | formamid | 200-842-0 | 75-12-7 | Repr.
1B |
H360D
*** |
GHS08 Dgr |
H360D
*** |
CLP00 | |||
| 616-053-00-3 | N-methylacetamide | N-metilacetamid | 201-182-6 | 79-16-3 | Repr.
1B |
H360D
*** |
GHS08 Dgr |
H360D
*** |
CLP00 | |||
| 616-054-00-9 | iprodione (ISO); 3-(3,5-dichlorophenyl)-2,4-dioxo-N-isopropylimidazolidine-1-carboxamide | iprodion
(ISO); 3-(3,5-diklórfenil)-2,4-dioxo-N-izopropilimidazolidin-1-karboxamid |
253-178-9 | 36734-19-7 | Carc.
2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
CLP00 | |||
| 616-055-00-4 | propyzamide (ISO); 3,5-dichloro-N-(1,1-dimethylprop-2-ynyl)benzamide | propizamid
(ISO); 3,5-diklór-N-(1,1-dimetilprop-2-inil)benzamid |
245-951-4 | 23950-58-5 | Carc.
2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
CLP00 | |||
| 616-056-00-X | N-methylformamide | N-metilformamid | 204-624-6 | 123-39-7 | Repr.
1B Acute Tox. 4 * |
H360D
*** H312 |
GHS08 GHS07 Dgr |
H360D
*** H312 |
CLP00 | |||
| 616-057-00-5 | reaction mass of: N-[3-hydroxy-2-(2-methylacryloylaminomethoxy)propoxymethyl]-2-methylacrylamide; N-[2,3-bis-(2-methylacryloylaminomethoxy)propoxymethyl]-2-methylacrylamide; methacrylamide; 2-methyl-N-(2-methylacryloylaminomethoxymethyl)-acrylamide; N-(2,3-dihydroxypropoxymethyl)-2-methylacrylamide | a
következő anyagok keveréke: N-[3-hidroxi-2-(2-metilakriloilaminometoxi)propoximetil]-2-metilakrilamid; N-(2,3-bisz(2-metilakriloilaminometoxi)propoximetil]-2-metilakrilamid; metakrilamid; 2-metil-N-(2-metilakriloilaminometoximetil)-akrilamid; N-(2,3-dihidroxipropoximetil)-2-metilakrilamid |
412-790-8 | Carc.
1B Muta. 2 STOT RE 2 * |
H350 H341 H373 ** |
GHS08 Dgr |
H350 H341 H373 ** |
CLP00 | ||||
| 616-058-00-0 | 1,3-bis(3-methyl-2,5-dioxo-1H-pyrrolinylmethyl)benzene | 1,3-bisz(3-metil-2,5-dioxo-1H-pirrolinilmetil)benzol | 412-570-1 | 119462-56-5 | STOT
RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373
** H318 H317 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H373
** H318 H317 H410 |
CLP00 | |||
| 616-059-00-6 | 4-((4-(diethylamino)-2-ethoxyphenyl)imino)-1,4-dihydro-1-oxo-N-propyl-2-naphthalenecarboxamide | 4-[[4-(dietilamino)-2-etoxifenil]imino]-1,4-dihidro-1-oxo-N-propil-2-naftalinkarboxamid | 412-650-6 | 121487-83-0 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 616-060-00-1 | Condensation product of: 3-(7-carboxyhept-1-yl)-6-hexyl-4-cyclohexene-1,2-dicarboxylic acid with polyamines (primarily amino-ethyl-piperazine and triethylenetetramine) | 3-(7-karboxihept-1-il)-6-hexil-4-ciklohexén-1,2-dikarbonsav kondenzációs terméke poliaminokkal (elsődlegesen aminoetilpiperazinnal és trietiléntetraminnal) | 413-770-1 | Acute
Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H317 H410 |
CLP00 | ||||
| 616-061-00-7 | N,N'-1,6-hexanediylbis(N-(2,2,6,6-tetramethyl-piperidin-4-yl)-formamide | N,N'-1,6-hexándiilbisz[N-(2,2,6,6-tetrametilpiperidin-4-il)-formamid] | 413-610-0 | 124172-53-8 | Eye
Irrit. 2 Aquatic Chronic 3 |
H319 H412 |
GHS07 Wng |
H319 H412 |
CLP00 | |||
| 616-062-00-2 | N-[3-[(2-acetyloxy)ethyl](phenyl-methyl)amino]-4-methoxyphenylacetamide | N-[3-[(2-acetiloxi)etil](fenilmetil)amino]-4-metoxifenilacetamid | 411-590-8 | 70693-57-1 | Skin
Corr. 1B Aquatic Chronic 3 |
H314 H412 |
GHS05 Dgr |
H314 H412 |
CLP00 | |||
| 616-063-00-8 | 3-dodecyl-(1-(1,2,2,6,6-pentamethyl-4-piperidin)-yl)-2,5-pyrrolidindione | 3-dodecil-[1-(1,2,2,6,6-pentametil-4-piperidin)-il]-2,5-pirrolidindion | 411-920-0 | 106917-30-0 | Acute
Tox. 3 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1A Aquatic Acute 1 Aquatic Chronic 1 |
H331 H302 H373 ** H314 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H331 H302 H373 ** H314 H410 |
CLP00 | |||
| 616-064-00-3 | N-tert-butyl-3-methylpicolinamide | N-terc-butil-3-metilpikolinamid | 406-720-5 | 32998-95-1 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | ||||
| 616-065-00-9 | 3'-(3-acetyl-4-hydroxyphenyl)-1,1-diethylurea | 3’-(3-acetil-4-hidroxifenil)-1,1-dietilkarbamid | 411-970-3 | 79881-89-3 | Acute
Tox. 4 * STOT RE 2 * |
H302 H373 ** |
GHS08 GHS07 Wng |
H302 H373 ** |
CLP00 | |||
| 616-066-00-4 | 5,6,12,13-tetrachloroanthra(2,1,9-def:6,5,10-d'e'f')diisoquinoline-1,3,8,10(2H,9H)-tetrone | 5,6,12,13-tetraklórantra(2,1,9-def: 6,5,10-d’e’f’)diizokinolin-1,3,8,10(2H,9H)-tetron | 405-100-1 | 115662-06-1 | Repr.
2 |
H361f
*** |
GHS08 Wng |
H361f
*** |
CLP00 | |||
| 616-067-00-X | dodecyl 3-(2-(3-benzyl-4-ethoxy-2,5-dioxoimidazolidin-1-yl)-4,4-dimethyl-3-oxovaleramido)-4-chlorobenzoate | dodecil-3-[2-(3-benzil-4-etoxi-2,5-dioxoimidazolidin-1-il)-4,4-dimetil-3-oxovaleramido]-4-klórbenzoát | 407-300-4 | 92683-20-0 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 616-068-00-5 | potassium 4-(11-methacrylamidoundecanamido)benzenesulfonate | kálium-4-(11-metakrilamidoundekánamido)benzolszulfonát | 406-500-9 | 174393-75-0 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 616-069-00-0 | 1-hydroxy-5-(2-methylpropyloxycarbonylamino)-N-(3-dodecyloxypropyl)-2-naphthoamide | 1-hidroxi-5-(2-metilpropiloxikarbonilamino)-N-(3-dodeciloxipropil)-2-naftoamid | 406-210-2 | 110560-22-0 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 616-070-00-6 | reaction mass of: 3,3'-dicyclohexyl-1,1'-methylenebis(4,1-phenylene)diurea; 3-cyclohexyl-1-(4-(4-(3-octadecylureido)benzyl)phenyl)urea; 3,3'-dioctadecyl-1,1'-methylenebis(4,1-phenylene)diurea | 3,3’-diciklohexil-1,1’-metilénbisz(4,1-fenilén)dikarbamid; 3-ciklohexil-1-[4-[4-(3-oktadecilureido)benzil]fenil]karbamid; 3,3’-dioktadecil-1,1’-metilénbisz(4,1-fenilén)dikarbamid keveréke |
406-530-2 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | |||||
| 616-071-00-1 | reaction mass of: bis(N-cyclohexyl-N'-phenyleneureido)methylene; bis(N-octadecyl-N'-phenyleneureido)methylene; bis(N-dicyclohexyl-N'-phenyleneureido)methylene (1:2:1) | bisz(N-ciklohexil-N’-fenilénureido)metilén; bisz(N-oktadecil-N-fenilénureido)metilén; bisz(N-diciklohexil-N’-fenilénureido)metilén (1:2:1) keveréke |
406-550-1 | Skin
Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
CLP00 | ||||
| 616-072-00-7 | 1-(2-deoxy-5-O-trityl-β-D-threopentofuranosyl)thymine | 1-(2-deoxi-5-O-tritil-β-D-treopentofuranozil)timin | 407-120-6 | 55612-11-8 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 616-073-00-2 | 4'-ethoxy-2-benzimidazoleanilide | 4’-etoxi-2-benzimidazolanilid | 407-600-5 | 120187-29-3 | Muta.
2 Aquatic Chronic 4 |
H341 H413 |
GHS08 Wng |
H341 H413 |
CLP00 | |||
| 616-074-00-8 | N-butyl-2-(4-morpholinylcarbonyl)benzamide | N-butil-2-(4-morfolinilkarbonil)benzamid | 407-730-2 | 104958-67-0 | Eye
Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H319 H317 H412 |
GHS07 Wng |
H319 H317 H412 |
CLP00 | |||
| 616-075-00-3 | D,L-(N,N-diethyl-2-hydroxy-2-phenylacetamide) | D, L-(N,N-dietil-2-hidroxi-2-fenilacetamid) | 408-120-9 | 65197-96-8 | Acute
Tox. 4 * Eye Dam. 1 |
H302 H318 |
GHS05 GHS07 Dgr |
H302 H318 |
CLP00 | |||
| 616-076-00-9 | tebufenozide (ISO); N-tert-butyl-N'-(4-ethylbenzoyl)-3,5-dimethylbenzohydrazide | tebufenozid
(ISO); N-terc-butil-N'-(4-etilbenzoil)-3,5-dimetilbenzohidrazid |
412-850-3 | 112410-23-8 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 616-077-00-4 | reaction mass of: 2-(9-methyl-1,3,8,10-tetraoxo-2,3,9,10-tetrahydro-(1H,8H)-anthra[2,1,9-def: 6,5,10-d'e'f']diisoquinolin-2-ylethansulfonic acid; potassium 2-(9-methyl-1,3,8,10-tetraoxo-2,3,9,10-tetrahydro-(1H,8H)-anthra[2,1,9-def: 6,5,10-d'e'f']diisoquinolin-2-ylethansulfate | 2-(9-metil-1,3,8,10-tetraoxo-2,3,9,10-tetrahidro-(1H,8H)-antra[2,1,9-def:
6,5,10-d'e'f']diizokinolin-2-iletánszulfonsav; kálium-2-(9-metil-1,3,8,10-tetraoxo-2,3,9,10-tetrahidro-(1H,8H)-antra[2,1,9-def: 6,5,10-d'e'f']diizokinolin-2-iletánszulfonát keveréke |
411-310-4 | Eye
Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
CLP00 | ||||
| 616-078-00-X | 2-[2,4-bis(1,1-dimethyl-ethyl)phenoxy]-N-(2-hydroxy-5-methyl-phenyl)hexanamide | 2-[2,4-bisz(1,1-dimetiletil)fenoxi]-N-(2-hidroxi-5-metil-fenil)hexánamid | 411-330-3 | 104541-33-5 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 616-079-00-5 | 1,6-hexanediyl-bis(2-(2-(1-ethylpentyl)-3-oxazolidinyl)ethyl)carbamate | 1,6-hexándiilbisz[2-[2-(1-etilpentil)-3-oxazolidinil]etil]karbamát | 411-700-4 | 140921-24-0 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 616-080-00-0 | 4-(2-((3-ethyl-4-methyl-2-oxo-pyrrolin-1-yl)carboxamido)ethyl)benzenesulfonamide) | 4-[2-[(3-etil-4-metil-2-oxo-pirrolin-1-il)karboxamido]etil]benzolszulfonamid | 411-850-0 | 119018-29-0 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | ||||
| 616-081-00-6 | 5-bromo-8-naphtholactam | 5-bróm-8-naftolaktám | 413-480-5 | 24856-00-6 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
CLP00 | |||
| 616-082-00-1 | N-(5-chloro-3-((4-(diethylamino)-2-methylphenyl)imino-4-methyl-6-oxo-1,4-cyclohexadien-1-yl)benzamide | N-[5-klór-3-[[4-(dietilamino)-2-metilfenil]imino-4-metil-6-oxo-1,4-ciklohexadién-1-il]benzamid | 413-200-1 | 129604-78-0 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 616-083-00-7 | [2-[(4-nitrophenyl)amino]ethyl]urea | [2-[(4-nitrofenil)amino]etil]karbamid | 410-700-1 | 27080-42-8 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
CLP00 | |||
| 616-084-00-2 | 2,4-bis[N'-(4-methylphenyl)ureido]toluene | 2,4-bisz[N’-(4-metilfenil)ureido)toluol | 411-790-5 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | ||||
| 616-085-00-8 | 3-(2,4-dichlorophenyl)-6-fluoro-quinazoline-2,4(1H,3H)-dione | 3-(2,4-diklórfenil)-6-fluor-kinazolin-2,4(1H,3H)-dion | 412-190-6 | 168900-02-5 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 616-086-00-3 | 2-acetylamino-6-chloro-4-[(4-diethylamino)2-methylphenyl-imino]-5-methyl-1-oxo-2,5-cyclohexadiene | 2-acetilamino-6-klór-4-[(4-dietilamino)-2-metilfenilimino]-5-metil-1-oxo-2,5-ciklohexadién | 412-250-1 | 102387-48-4 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 616-087-00-9 | reaction mass of: 7,9,9-trimethyl-3,14-dioxa-4,13-dioxo-5,12-diazahexadecane-1,16-diyl-prop-2-enoate; 7,7,9-trimethyl-3,14-dioxa-4,13-dioxo-5,12-diazahexadecan-1,16-diyl-prop-2-enoate | 7,9,9-trimetil-3,14-dioxa-4,13-dioxo-5,12-diazahexadekán-1,16-diil-prop-2-enoát; 7,7,9-trimetil-3,14-dioxa-4,13-dioxo-5,12-diazahexadekán-1,16-diil-prop-2-enoát keveréke |
412-260-6 | 52658-19-2 | Eye
Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H319 H317 H411 |
GHS07 GHS09 Wng |
H319 H317 H411 |
CLP00 | |||
| 616-088-00-4 | 2-aminosulfonyl-N,N-dimethylnicotinamide | 2-aminoszulfonil-N, N-dimetilnikotinamid | 413-440-7 | 112006-75-4 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
CLP00 | |||
| 616-089-00-X | 5-(2,4-dioxo-1,2,3,4-tetrahydropyrimidine)-3-fluoro-2-hydroxymethyltetrahydrofuran | 5-(2,4-dioxo-1,2,3,4-tetrahidropirimidin)-3-fluor-2-hidroximetiltetrahidrofurán | 415-360-8 | 41107-56-6 | Muta.
2 |
H341 |
GHS08 Wng |
H341 |
CLP00 | |||
| 616-090-00-5 | 1-(1,4-benzodioxan-2-ylcarbonyl)piperazine hydrochloride | 1-(1,4-benzodioxán-2-ilkarbonil)piperazin-hidroklorid | 415-660-9 | 70918-74-0 | Acute
Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 2 |
H331 H311 H301 H373 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H331 H311 H301 H373 ** H411 |
CLP00 | |||
| 616-091-00-0 | 1,3,5-tris-[(2S and 2R)-2,3-epoxypropyl]-1,3,5-triazine-2,4,6-(1H,3H,5H)-trione | 1,3,5-trisz[(2S és 2R)-2,3-epoxipropil]-1,3,5-triazin-2,4,6-(1H,3H,5H)-trion | 423-400-0 | 59653-74-6 | Muta.
1B Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 |
H340 H331 H302 H373 ** H318 H317 |
GHS06 GHS08 GHS05 Dgr |
H340 H331 H302 H373 ** H318 H317 |
CLP00 | |||
| 616-092-00-6 | Polymeric reaction product of bicyclo[2.2.1]hepta-2,5-diene, ethene, 1,4-hexadiene, 1-propene with N,N-di-2-propenylformamide | biciklo[2.2.1]hepta-2,5-dién, etén, 1,4-hexadién és 1-propén N, N-di-2-propenilformamiddal képzett polimerizációs reakcióterméke | 404-035-6 | Skin
Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
CLP00 | ||||
| 616-093-00-1 | Reaction products of: aniline-terephthalaldehyde-o-toluidine condensate with maleic anhydride | anilin-tereftálaldehid-o-toluidin maleinsav-anhidriddel képzett kondenzációs reakciótermékei | 406-620-1 | 129217-90-9 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | |||
| 616-094-00-7 | 3,3'-dicyclohexyl-1,1'-methylenebis(4,1-phenylene)diurea | 3,3′-diciklohexil-1,1′-metilénbisz(4,1-fenilén)dikarbamid | 406-370-3 | 58890-25-8 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00/ATP10 | ||||
| 616-095-00-2 | 3,3'-dioctadecyl-1,1'-methylenebis(4,1-phenylene)diurea | 3,3'-diklór-1,1'-metilénbisz(4,1-fenilén)dikarbamid | 406-690-3 | 43136-14-7 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 616-096-00-8 | N-(3-hexadecyloxy-2-hydroxyprop-1-yl)-N-(2-hydroxyethyl)palmitamide | N-(3-hexadeciloxi-2-hidroxiprop-1-il)-N-(2-hidroxietil)palmitamid | 408-110-4 | 110483-07-3 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 616-097-00-3 | N,N'-1,4-phenylenebis(2-((2-methoxy-4-nitrophenyl)azo)-3-oxobutanamide | N,N'-1,4-fenilénbisz(2-((2-metoxi-4-nitrofenil)azo)-3-oxobutánamid) | 411-840-6 | 83372-55-8 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 616-098-00-9 | 1-[4-chloro-3-((2,2,3,3,3-pentafluoropropoxy)methyl)phenyl]-5-phenyl-1H-1,2,4-triazole-3-carboxamide | 1-[4-klór-3-((2,2,3,3,3-pentafluorpropoxi)metil)fenil]-5-fenil-1H-1,2,4-triazol-3-karboxamid | 411-750-7 | 119126-15-7 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 616-099-00-4 | 2-[4-[(4-hydroxyphenyl)sulfonyl]phenoxy]-4,4-dimethyl-N-[5-[(methylsulfonyl)amino]-2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]phenyl]-3-oxopentanamide | 2-[4-[(4-hidroxifenil)szulfonil]fenoxi]-4,4-dimetil-N-[5-[(metilszulfonil)amino]-2-[4-(1,1,3,3-tetrametilbutil)fenoxi]fenil]-3-oxopentánamid | 414-170-2 | 135937-20-1 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 616-100-00-8 | 1,3-dimethyl-1,3-bis(trimethylsilyl)urea | 1,3-dimetil-1,3-bisz(trimetilszilil)karbamid | 414-180-7 | 10218-17-4 | Acute
Tox. 4 * Skin Irrit. 2 |
H302 H315 |
GHS07 Wng |
H302 H315 |
CLP00 | |||
| 616-101-00-3 | (S)-N-tert-butyl-1,2,3,4-tetrahydro-3-isoquinolinecarboxamide | (S)-N-terc -butil-1,2,3,4-tetrahidro-3-izokinolinkarboxamid | 414-600-9 | 149182-72-9 | Acute
Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
CLP00 | |||
| 616-102-00-9 | reaction mass of: α-[3-(3-mercaptopropanoxycarbonylamino)methylphenylaminocarbonyl]-ω-[3-(3-mercaptopropanoxycarbonylamino)methylphenylaminocarbonyloxy]-poly-(oxyethylene-co-oxypropylene); 1,2-(or 1,3-)bis[α-(3-mercaptopropanoxycarbonylamino)methylphenylaminocarbonyl)-ω-oxy-poly(oxyethylene-co-oxypropylene)]-3-(or 2-)propanol; 1,2,3-tris[α-(3-mercaptopropanoxycarbonyl-amino)methylphenylaminocarbonyl)-ω-oxy-poly-(oxyethylene-co-oxypropylene)]propane] | α-[3-(3-merkaptopropánoxikarbonilamino)metilfenilaminokarbonil]-ω-[3-(3-merkaptopropánoxilkarbonilamino)metilfenilaminokarboniloxi]-poli(oxietilén-ko-oxipropilén); 1,2-(vagy 1,3-)bisz[α-(3-merkaptopropánoxikarbonilamino)metilfenilaminokarbonil)-ω-oxi-poli(oxietilén-ko-oxipropilén)]-3-(vagy 2-)propanol; 1,2,3-trisz[α-(3-merkaptopropánoxikarbonilamino)metilfenilaminokarbonil)-ω-oxi-poli(oxietilén-co-oxipropilén)]propán] keveréke |
415-870-0 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | ||||
| 616-103-00-4 | (S,S)-trans-4-(acetylamino)-5,6-dihydro-6-methyl-7,7-dioxo-4H-thieno[2,3-b]thiopyran-2-sulfonamide | (S,S)-transz-4-acetilamino)-5,6-dihidro-6-metil-7,7-dioxo-4H-tieno[2,3-b]tiopirán-2-szulfonamid | 415-030-3 | 120298-38-6 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
CLP00 | |||
| 616-104-00-X | benalaxyl (ISO); methyl N-(2,6-dimethylphenyl)-N-(phenylacetyl)-DL-alaninate | benalaxil
(ISO); metil-N-(2,6-dimetilfenil)-N-(fenilacetil)-DL-alaninát |
275-728-7 | 71626-11-4 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 616-105-00-5 | chlorotoluron (ISO); 3-(3-chloro-p-tolyl)-1,1-dimethylurea | klórtoluron
(ISO); 3-(3-klór-p-tolil)-1,1-dimetilkarbamid |
239-592-2 | 15545-48-9 | Carc.
2 Repr. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H361d *** H400 H410 |
GHS08 GHS09 Wng |
H351 H361d *** H410 |
CLP00 | |||
| 616-106-00-0 | phenmedipham (ISO); methyl 3-(3-methylcarbaniloyloxy)carbanilate | fenmedifám
(ISO); metil-3-(3-metilkarbaniloiloxi)karbanilát |
237-199-0 | 13684-63-4 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 616-107-00-6 | cinidon ethyl (ISO); ethyl (Z)-2-chloro-3-[2-chloro-5-(cyclohex-1-ene-1,2-dicarboximido)phenyl]acrylate | cinidon-etil
(ISO); etil(Z)-2-klór-3-[2-klór-5-(ciklohex-1-én-1,2-dikarboximido)fenil]akrilát |
- | 142891-20-1 | Carc.
2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H317 H410 |
ATP01 | |||
| 616-108-00-1 | iodosulfuron-methyl-sodium; sodium ({}{[5-iodo-2-(methoxycarbonyl)phenyl]sulfonyl}}carbamoyl)(4-methoxy-6-methyl-1,3,5-triazin-2-yl)azanide | jódszulfuron-metil-nátrium; nátrium ({[5-jód-2-(metoxikarbonil)fenil]szulfonil}karbamoil)(4-metoxi-6-metil-1,3,5-triazin-2-il)azanid |
144550-36-7 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | ||||
| 616-109-00-7 | sulfosulfuron (ISO); 1-(4,6-dimethoxypyrimidin-2-yl)-3-(2-ethylsulfonylimidazo[1,2-a]pyridin-3-yl)sulfonylurea | szulfoszulfuron
(ISO); 1-(4,6-dimetoxipirimidin-2-il)-3-(2-etilszulfonilimidazo[1,2-a]piridin-3-il)szulfonilkarbamid |
141776-32-1 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | ||||
| 616-110-00-2 | cyclanilide (ISO); 1-(2,4-dichloroanilinocarbonyl)cyclopropanecarboxylic acid | ciklanilid
(ISO); 1-(2,4-diklóranilinokarbonil)ciklopropánkarbonsav |
419-150-7 | 113136-77-9 | Acute
Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
CLP00 | |||
| 616-111-00-8 | fenhexamid (ISO); N-(2,3-dichlor-4-hydroxyphenyl)-1-methylcyclohexancarboxamid | fenhexamid
(ISO); N-(2,3-diklór-4-hidroxifenil)-1-metilciklohexánkarboxamid |
422-530-5 | 126833-17-8 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | |||
| 616-112-00-3 | oxasulfuron (ISO); oxetan-3-yl 2-[(4,6-dimethylpyrimidin-2-yl)-carbamoylsulfamoyl]benzoate | oxaszulfuron
(ISO); oxetán-3-il 2-[(4,6-dimetilpirimidin-2-il)karbamoilszulfamoil]benzoát |
144651-06-9 | STOT
RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H373
** H400 H410 |
GHS08 GHS09 Wng |
H373
** H410 |
CLP00 | ||||
| 616-113-00-9 | desmedipham (ISO); ethyl 3-phenylcarbamoyloxyphenylcarbamate | dezmedifám
(ISO); etil-3-fenilkarbamoiloxifenil-karbamát |
237-198-5 | 13684-56-5 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
M=10 |
CLP00 | ||
| 616-114-00-4 | dodecanamide, N,N'-(9,9',10,10'-tetrahydro-9,9',10,10'-tetraoxo(1,1'-bianthracene)-4,4'-diyl)bis- | N,N'-(9,9’,10,10’-tetrahidro-9,9’,10,10’-tetraoxo(1,1’-biantracén)-4,4’-diil)biszdodekánamid | 418-010-2 | 136897-58-0 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 616-115-00-X | N-(3-acetyl-2-hydroxyphenyl)-4-(4-phenylbutoxy)benzamide | N-(3-acetil-2-hidroxifenil)-4-(4-fenilbutoxi)benzamid | 416-150-9 | 136450-06-1 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 616-116-00-5 | N-(4-dimethylaminopyridinium)-3-methoxy-4-(1-methyl-5-nitroindol-3-ylmethyl)-N-(o-tolylsulfonyl)benzamidate | N-(4-dimetilaminopiridinium)-3-metoxi-4-(1-metil-5-nitroindol-3-ilmetil)-N-(o-tolilszulfonil)benzamidát | 416-790-9 | 143052-96-4 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 616-117-00-0 | N-[2-(3-acetyl-5-nitrothiophen-2-ylazo)-5-diethylaminophenyl]acetamide | N-[2-(3-acetil-5-nitrotiofen-2-ilazo)-5-dietilaminofenil]acetamid | 416-860-9 | 777891-21-1 | Repr.
2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361f
*** H317 H400 H410 |
GHS08 GHS09 Wng |
H361f
*** H317 H410 |
CLP00 | |||
| 616-118-00-6 | N-(2',6'-dimethylphenyl)-2-piperidinecarboxamide hydrochloride | N-(2’,6’-dimetilfenil)-2-piperidinkarboxamid-hidroklorid | 417-950-0 | 65797-42-4 | Acute
Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
CLP00 | |||
| 616-119-00-1 | 2-(1-butyl-3,5-dioxo-2-phenyl-(1,2,4)-triazolidin-4-yl)-4,4-dimethyl-3-oxo-N-(2-methoxy-5-(2-(dodecyl-1-sulfonyl))propionylamino)-phenyl)-pentanamide | 2-(1-butil-3,5-dioxo-2-fenil-(1,2,4)-triazolidin-4-il)-4,4-dimetil-3-oxo-N-(2-metoxi-5-(2-(dodecil-1-szulfonil)propionilamino)fenil)pentánamid | 418-060-5 | 118020-93-2 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 616-120-00-7 | reaction mass of: N-(3-dimethylamino-4-methyl-phenyl)-benzamide; N-(3-dimethylamino-2-methyl-phenyl)-benzamide; N-(3-dimethylamino-3-methyl-phenyl)-benzamide | N-(3-dimetilamino-4-metilfenil)benzamid; N-(3-dimetilamino-2-metilfenil)benzamid; N-(3-dimetilamino-3-metilfenil)benzamid keveréke |
420-600-1 | STOT
RE 2 * Aquatic Chronic 2 |
H373
** H411 |
GHS08 GHS09 Wng |
H373
** H411 |
CLP00 | ||||
| 616-121-00-2 | 2,4-dihydroxy-N-(2-methoxyphenyl)benzamide | 2,4-dihidroxi-N-(2-metoxifenil)benzamid | 419-090-1 | 129205-19-2 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | |||
| 616-122-00-8 | methyl neodecanamide | metilneodekánamid | 414-460-9 | 105726-67-8 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
ATP01 | |||
| 616-123-00-3 | N-[3-[[4-(diethylamino)-2-methylphenyl]imino]-6-oxo-1,4-cyclohexadienyl]acetamide | N-[3-[[4-(dietilamino)-2-metilfenil]imino]-6-oxo-1,4-ciklohexadienil]acetamid | 414-740-0 | 96141-86-5 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 616-124-00-9 | lithium bis(trifluoromethylsulfonyl)imide | lítium-bisz(trifluormetilszulfonil)imid | 415-300-0 | 90076-65-6 | Acute
Tox. 3 * Acute Tox. 3 * STOT RE 2 * Skin Corr. 1B Aquatic Chronic 3 |
H311 H301 H373 ** H314 H412 |
GHS06 GHS05 GHS08 Dgr |
H311 H301 H373 ** H314 H412 |
CLP00/ATP01 | |||
| 616-125-00-4 | 3-cyano-N-(1,1-dimethylethyl)androsta-3,5-diene-17-β-carboxamide | 3-ciano-N-(1,1-dimetiletil)androszta-3,5-dién-17-β-karboxamid | 415-730-9 | 151338-11-3 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 616-126-00-X | 1-methyl-4-nitro-3-propyl-1H-pyrazole-5-carboxamide | 1-metil-4-nitro-3-propil-1H-pirazol-5-karboxamid | 423-960-6 | 139756-01-7 | Acute
Tox. 4 * STOT RE 2 * Aquatic Chronic 3 |
H302 H373 ** H412 |
GHS08 GHS07 Wng |
H302 H373 ** H412 |
ATP01 | |||
| 616-127-00-5 | reaction mass of: N,N'-Ethane-1,2-diylbis(decanamide); 12-Hydroxy-N-[2-[1-oxydecyl)amino]ethyl]octadecanamide; N,N'-Ethane-1,2-diylbis(12-hydroxyoctadecanamide) | a
következő anyagok keveréke: N, N’-etán-1,2-diilbisz(dekánamid); 12-hidroxi-N-[2-[1-oxidecil)amino]etil]oktadekánamid; N, N’-etán-1,2-diilbisz(12-hidroxioktadekánamid) |
430-050-2 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
CLP00 | ||||
| 616-128-00-0 | N-(2-(1-allyl-4,5-dicyanoimidazol-2-ylazo)-5-(dipropylamino)phenyl)-acetamide | N-(2-(1-allil-4,5-dicianoimidazol-2-ilazo)-5-(dipropilamino)fenil)acetamid | 417-530-7 | 123590-00-1 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 616-129-00-6 | N,N'-bis(2,2,6,6-tetramethyl-4-piperidyl)isophthalamide | N,N'-bisz(2,2,6,6-tetrametil-4-piperidil)izoftálamid | 419-710-0 | 42774-15-2 | Acute
Tox. 4 * Eye Irrit. 2 |
H302 H319 |
GHS07 Wng |
H302 H319 |
CLP00 | |||
| 616-130-00-1 | N-(3-(2-(4,4-dimethyl-2,5-dioxo-imidazolin-1-yl)-4,4-dimethyl-3-oxo-pentanoylamino)-4-methoxy-phenyl)-octadecanamide | N-(3-(2-(4,4-dimetil-2,5-dioxoimidazolin-1-il)-4,4-dimetil-3-oxopentanoilamino)-4-metoxifenil)oktadekánamid | 421-780-2 | 150919-56-5 | Aquatic
Chronic 4 |
H413 |
H413 |
CLP00 | ||||
| 616-131-00-7 | 1-aminocyclopentanecarboxamide | 1-aminociklopentánkarboxamid | 422-950-9 | 17193-28-1 | Acute
Tox. 4 * STOT RE 1 Eye Dam. 1 |
H302 H372 ** H318 |
GHS05 GHS08 GHS07 Dgr |
H372
** H302 H318 |
ATP01 | |||
| 616-132-00-2 | N-[4-(4-cyano-2-furfurylidene-2,5-dihydro-5-oxo-3-furyl)phenyl]butane-1-sulfonamide | N-[4-(4-ciano-2-furfurilidén-2,5-dihidro-5-oxo-3-furil)fenil]bután-1-szulfonamid | 423-250-6 | 130016-98-7 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 616-133-00-8 | N-cyclohexyl-S,S-dioxobenzo[b]tiophene-2-carboxamide | N-ciklohexil-S, S-dioxobenzo[b]tiofén-2-karboxamid | 423-990-1 | 149118-66-1 | Acute
Tox. 4 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H410 |
CLP00 | |||
| 616-134-00-3 | 3,3'-bis(dioctyloxyphosphinothioylthio)-N,N'-oxybis(methylene)dipropionamide | 3,3’-bisz(dioktiloxifoszfinotioiltio)-N, N’-oxibisz(metilén)dipropionamid | 401-820-5 | 793710-14-2 | Aquatic
Chronic 3 |
H412 |
H412 |
CLP00 | ||||
| 616-135-00-9 | (3S,4aS,8aS)-2-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]-N-tert-butyldecahydroisoquinoline-3-carboxamide | (3S,4aS,8aS)-2-[(2R,3S)-3-amino-2-hidroxi-4-fenilbutil]-N-terc-butildekahidroizokinolin-3-karboxamid | 430-230-0 | 136522-17-3 | Acute
Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
CLP00 | |||
| 616-136-00-4 | reaction product of cocoalkyldiethanolamides and cocoalkylmonoglycerides and molybdenumtrioxide (1.75-2.2: 0.75-1.0:0.1-1.1) | kokoalkil-dietanolamidok és kokoalkil-monogliceridek és molibdén-trioxid (1,75-2,2: 0,75-1,0:0,1-1,1) reakcióterméke | 430-380-7 | - | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
ATP01 | |||
| 616-137-00-X | 4-dichloroacetyl-1-oxa-4-azaspiro[4.5]decane | 4-diklóracetil-1-oxa-4-azaspiro[4.5]dekán | 401-130-4 | 71526-07-3 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
ATP01 | |||
| 616-138-00-5 | benzoic acid, N-tert-butyl-N'-(4-chlorobenzoyl)hydrazide | benzoesav, N-terc-butil-N'-(4-klórbenzoil)hidrazid | 431-600-4 | 112226-61-6 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
ATP01 | |||
| 616-139-00-0 | (3S,4aS,8aS)-N-tert-butyldecahydro-3-isoquinolinecarboxamide | (3S,4aS,8aS)-N-terc-butildekahidro-3-izokinolinkarboxamid | 420-380-5 | 136465-81-1 | Acute
Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
ATP01 | |||
| 616-140-00-6 | N,N''-(methylenedi-4,1-phenylene)bis[N'-(4-methylphenyl)urea] | N, N''-(metilén-di-4,1-fenilén)bisz[N'-(4-metilfenil)karbamid] | 429-380-1 | 133336-92-2 | Skin
Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
ATP01 | |||
| 616-141-00-1 | zoxamide (ISO); (RS)-3,5-dichloro-N-(3-chloro-1-ethyl-1-methyl-2-oxopropyl)-p-toluamide | zoxamid
(ISO); (RS)-3,5-diklór-N-(3-klór-1-etil-1-metil-2-oxopropil)-p-toluamid |
- | 156052-68-5 | Skin
Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
M=10 |
ATP01 | ||
| 616-142-00-7 | 1,3-Bis(vinylsulfonylacetamido)propane | 1,3-bisz(vinilszulfonilacetamido)propán | 428-350-3 | 93629-90-4 | Muta.
2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H341 H318 H317 H412 |
GHS08 GHS05 GHS07 Dgr |
H341 H318 H317 H412 |
CLP00 | |||
| 616-143-00-2 | N,N'-dihexadecyl-N,N'-bis(2-hydroxyethyl)propanediamide | N,N'-dihexadecil-N,N'-bisz(2-hidroxietil)propándiamid | 422-560-9 | 149591-38-8 | Repr.
2 Eye Irrit. 2 Aquatic Chronic 4 |
H361f
*** H319 H413 |
GHS08 Wng |
H361f
*** H319 H413 |
CLP00 | |||
| 616-144-00-8 | 3,4-dichloro-N-[5-chloro-4-[2-[4-dodecyloxyphenylsulfonyl]butyramido]-2-hydroxyphenyl]benzamide | 3,4-diklór-N-[5-klór-4-[2-[4-dodeciloxifenilszulfonil]butiramido]-2-hidroxifenil]benzamid | 431-130-1 | - | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 616-145-00-3 | pethoxamide (ISO); 2-chloro-N-(2-ethoxyethyl)-N-(2-methyl-1-phenylprop-1-enyl)acetamide | petoxamid
(ISO); 2-klór-N-(2-etoxietil)-N-(2-metil-1-fenilprop-1-enil)acetamid |
- | 106700-29-2 | Acute
Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
M=100 |
ATP01 | ||
| 616-146-00-9 | N-(2-methoxy-5-octadecanoylaminophenyl)-2-(3-benzyl-2,5-dioxoimidazolidin-1-yl)-4,4-dimethyl-3-oxopentanoic acidamide | N-(2-metoxi-5-oktadekanoilaminofenil)-2-(3-benzil-2,5-dioxo-imidazolidin-1-il)-4,4-dimetil-3-oxopentánsav-amid | 431-330-7 | 142776-95-2 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 616-147-00-4 | 1-methyl-4-(2-methyl-2H-tetrazol-5-yl)-1H-pyrazole-5-sulfonamide | 1-metil-4-(2-metil-2H-tetrazol-5-il)-1H-pirazol-5-szulfonamid | 424-160-1 | 139481-22-4 | Acute
Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
ATP01 | |||
| 616-148-00-X | N-[6,9-dihydro-9-[[2-hydroxy-1-(hydroxymethyl)ethoxy]methyl]-6-oxo-1H-purin-2-yl]acetamide | N-[6,9-dihidro-9-[[2-hidroxi-1-(hidroximetil)etoxi]metil]6-oxo-1H-purin-2-il]acetamid | 424-550-1 | 84245-12-5 | Carc.
1B Muta. 1B Repr. 1B |
H350 H340 H360FD |
GHS08 Dgr |
H350 H340 H360FD |
ATP01 | |||
| 616-150-00-0 | (2R,3S)-N-(3-amino-2-hydroxy-4-phenylbutyl)-N-isobutyl-4-nitrobenzenesulfonamide hydrochloride | (2R,3S)-N-(3-amino-2-hidroxi-4-fenilbutil)-N-izobutil-4-nitrobenzolszulfonamid-hidroklorid | 425-260-6 | - | STOT
RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H373
** H318 H317 H411 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H373
** H318 H317 H411 |
ATP01 | |||
| 616-151-00-6 | N-(2-amino-4,6-dichloropyrimidin-5-yl)formamide | N-(2-amino-4,6-diklórpirimidin-5-il)formamid | 425-650-6 | 171887-03-9 | Acute
Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H302 H318 H317 H412 |
GHS05 GHS07 Dgr |
H302 H318 H317 H412 |
ATP01 | |||
| 616-152-00-1 | 4-(4-fluorophenyl)-2-(2-methyl-1-oxopropyl)-4-oxo-3,N-diphenylbutanamide | 4-(4-fluorfenil)-2-(2-metil-1-oxopropil)-4-oxo-3,N-difenilbutánamid | 425-850-3 | 125971-96-2 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 616-153-00-7 | 4-methyl-3-oxo-N-phenyl-2-(phenylmethylene)pentanamide | 4-metil-3-oxo-N-fenil-2-(fenilmetilén)pentánamid | 425-860-8 | 125971-57-5 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
ATP01 | |||
| 616-154-00-2 | 3,4-dichloro-N-[5-chloro-4-[2-[4-(hexadecyloxy)phenylsulfonyl]butyramido]-2-hydroxyphenyl]benzamide | 3,4-diklór-N-[5-klór-4-[2-[4-(hexadeciloxi)fenilszulfonil]butiramido]-2-hidroxifenil]benzamid | 431-110-0 | - | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 616-155-00-8 | N,N,N',N'-tetracyclohexyl-1,3-benzenedicarboxamide | N,N,N',N'-tetraciklohexil-1,3-benzoldikarboxamid | 431-040-0 | 104560-40-9 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
ATP01 | |||
| 616-156-00-3 | 6-(2-chloro-6-cyano-4-nitrophenylazo)-4-methoxy-3-[N-(methoxycarbonylmethyl)-N-(1-methoxycarbonylethyl)amino]acetanilide | 6-(2-klór-6-ciano-4-nitrofenilazo)-4-metoxi-3-[N-(metoxikarbonilmetil)-N-(1-metoxikarboniletil)amino]acetanilid | 430-500-8 | 204277-61-2 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 616-157-00-9 | 3-amino-4-hydroxy-N-(3-isopropoxypropyl)benzenesulfonamide hydrochloride | 3-amino-4-hidroxi-N-(3-izopropoxipropil)benzolszulfonamid-hidroklorid | 427-780-9 | 114565-70-7 | Acute
Tox. 4 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H410 |
ATP01/ATP01corr | |||
| 616-158-00-4 | N-[4-cyano-3-trifluoromethylphenyl]methacrylamide | N-[4-ciano-3-trifluormetilfenil]metakrilamid | 427-880-2 | 90357-53-2 | STOT
RE 2 * Aquatic Chronic 2 |
H373
** H411 |
GHS08 GHS09 Wng |
H373
** H411 |
ATP01 | |||
| 616-160-00-5 | 2,2'-azobis[N-(2-hydroxyethyl)-2-methylpropionamide] | 2,2'-azobisz[N-(2-hidroxietil)2-metilpropionamid] | 429-090-3 | 61551-69-7 | Skin
Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
ATP01 | |||
| 616-161-00-0 | 2,4-dichloro-5-hydroxyacetanilide | 2,4-diklór-5-hidroxiacetanilid | 429-110-0 | 67669-19-6 | Aquatic
Chronic 3 |
H412 |
- |
H412 |
ATP01 | |||
| 616-162-00-6 | isostearic acid monoisopropanolamide | izosztearinsav-monoizopropanolamid | 431-540-9 | - | Skin
Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
ATP01 | |||
| 616-163-00-1 | 4,4'-methylenebis[N-(4-chlorophenyl)-3-hydroxynaphthalene-2-carboxamide] | 4,4'-metilénbisz[N-(4-klórfenil)-3-hidroxinaftalin-2-karboxamid] | 430-350-3 | 192463-88-0 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 616-164-00-7 | dimoxystrobin (ISO); (E)-2-(methoxyimino)-N-methyl-2-[α-(2,5-xylyloxy)-o-tolyl]acetamide | dimoxisztrobin
(ISO); (E)-2-(metoxiimino)-N-metil-2-[α-(2,5-xililoxi)-o-tolil]acetamid |
- | 149961-52-4 | Carc.
2 Repr. 2 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H361d *** H332 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H361d *** H332 H410 |
M=10 |
ATP01 | ||
| 616-165-00-2 | beflubutamid (ISO); (RS)-N-benzyl-2-(α,α,α,4-tetrafluoro-m-tolyoxy)butyramide | beflubutamid
(ISO); (RS)-N-benzil-2-(α, α,α,4-tetrafluor-m-tolioxi)butiramid |
- | 113614-08-7 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
M=100 |
ATP01 | ||
| 616-166-00-8 | cyazofamid (ISO); 4-chloro-2-cyano-N,N-dimethyl-5-p-tolylimidazole-1-sulfonamide | ciazofamid
(ISO); 4-klór-2-ciano-N, N-dimetil-5-p-tolilimidazol-1-szulfonamid |
- | 120116-88-3 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
M=10 |
ATP01 | ||
| 616-167-00-3 | N,N-dibutyl-(2,5-dihydro-5-thioxo-1H-tetrazol-1-yl)acetamide | N, N-dibutil-(2,5-dihidro-5-tioxo-1H-tetrazol-1-il)acetamid | 418-290-6 | 168612-06-4 | Eye
Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
ATP01 | |||
| 616-168-00-9 | 1-dimethylcarbamoyl-4-(2-sulfonatoethyl)pyridinium | 1-dimetilkarbamoil-4-(2-szulfonátoetil)piridinium | 418-440-0 | 136997-71-2 | Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
ATP01 | |||
| 616-169-00-4 | 4-[4-(2,2-dimethyl-propanamido)]phenylazo-3-(2-chloro-5-(2-(3-pentadecylphenoxy)butylamido)anilino)-1-(2,4,6-trichlorophenyl)-2-pyrazoline-5-one | 4-[4-(2,2-dimetil-propánamido)]fenilazo-3-(2-klór-5-(2-(3-pentadecilfenoxi)butilamid)anilino)-1-(2,4,6-triklórfenil)-2-pirazolin-5-on | 420-220-4 | 92771-56-7 | Skin
Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
ATP01 | |||
| 616-170-00-X | (2R)-2-amino-2-phenylacetamide | (2R)-2-amino-2-fenilacetamid | 420-370-0 | 6485-67-2 | Eye
Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
ATP01 | |||
| 616-171-00-5 | 2-(para-chlorophenyl)glycineamide | 2-(p-klórfenil)glicinamid | 420-830-0 | 102333-75-5 | Eye
Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
ATP01 | |||
| 616-172-00-0 | N-(2,2,6,6-tetramethyl-1-oxylpiperidin-4-yl)acetamide; (4-acetamido-2,2,6,6-tetramethyl-1-piperidinyl)oxidanyl | N-(2,2,6,6,-tetrametil-1-oxilpiperidin-4-il)acetamid; (4-acetamido-2,2,6,6-tetrametil-1-piperidinil)oxidanil |
423-840-3 | 14691-89-5 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
ATP01 | |||
| 616-174-00-1 | 2-butyl-1,3-diazaspiro[4.4]non-1-en-4-one hydrochloride | 2-butil-1,3-diazaspiro[4.4]non-1-én-4-on-hidroklorid | 424-560-4 | 151257-01-1 | Acute
Tox. 4 * Eye Irrit. 2 |
H302 H319 |
GHS07 Wng |
H302 H319 |
ATP01 | |||
| 616-175-00-7 | 2-(2-hexyldecyloxy)benzamide | 2-(2-hexildeciloxi)benzamid | 431-230-3 | 202483-62-3 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 616-176-00-2 | 3-N,N-bis(methoxyethyl)aminoacetanilide | 3-N, N-bisz(metoxietil)aminoacetanilid | 432-530-7 | 24294-01-7 | Acute
Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
ATP01 | |||
| 616-177-00-8 | (3-(4-(2-(butyl-(4-methylphenylsulfonyl)amino)phenylthio)-5-oxo-1-(2,4,6-trichlorophenyl)-4,5-dihydro-1H-pyrazole-3-ylamino)-4-chlorophenyl)tetradecanamide; N-[3-({4-[(2-{butyl[(4-methylphenyl)sulfonyl]amino}phenyl)thio]-5-oxo-1-(2,4,6-trichlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl}amino)-4-chlorophenyl]tetradecanamide | (3-(4-(2-(butil-(4-metilfenilszulfonil)amino)feniltio)5-oxo-1-(2,4,6-triklórfenil)-4,5-dihidro-1H-pirazol-3-ilamino)-4-klórfenil)tetradekánamid; N-[3-({4-[(2-{butil[(4-metilfenil)szulfonil]amino}fenil)tio]-5-oxo-1-(2,4,6-triklórfenil)-4,5-dihidro-1H-pirazol-3-il}amino)-4-klórfenil]tetradekánamid |
432-970-1 | 217324-98-6 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 616-178-00-3 | N-(5-(bis(2-methoxyethyl)amino)-2-((2-cyano-4,6-dinitrophenyl)-azo)phenyl)acetamide | N-(5-(bisz(2-metoxietil)amino)-2-((2-ciano-4,6-dinitrofenil)-azo)fenil)acetamid | 434-500-9 | 52583-35-4 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 616-179-00-9 | 2-chloro-N-(4-methylphenyl)acetamide | 2-klór-N-(4-metilfenil)acetamid | 435-170-9 | 16634-82-5 | Eye
Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H410 |
ATP01 | |||
| 616-180-00-4 | N,N-(dimethylamino)thioacetamide hydrochloride | N, N-(dimetilamino)tioacetamid-hidroklorid | 435-470-1 | 27366-72-9 | Repr.
1B Aquatic Acute 1 Aquatic Chronic 1 |
H360D
*** H400 H410 |
GHS08 GHS09 Dgr |
H360D
*** H410 |
ATP01 | |||
| 616-181-00-X | 4'-methyldodecane-1-sulfonanilide | 4'-metildodekán-1-szulfonanilid | 435-490-9 | 17417-32-2 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
ATP01 | |||
| 616-182-00-5 | N'-(1,3-dimethylbutylidene)-3-hydroxy-2-naphthohydrazide | N'-(1,3-dimetilbutilidén)-3-hidroxi-2-naftohidrazid | 435-860-1 | 214417-91-1 | Skin
Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
ATP01 | |||
| 616-183-00-0 | N-dodecyl-4-methoxybenzamide | N-dodecil-4-metoxibenzamid | 442-340-6 | 1854-15-5 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 616-184-00-6 | 3-methyl-N-(5,8,13,14-tetrahydro-5,8,14-trioxonaphth[2,3-c]acridin-6-yl)benzamide | 3-metil-N-(5,8,13,14-tetrahidro-5,8,14-trioxonaft[2,3-c]akridin-6-il)benzamid | 442-560-2 | 105043-55-8 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 616-186-00-7 | N,N'-(2-chloro-1,4-phenylene)bis(3-oxobutaneamide) | N, N'-(2-klór-1,4-fenilén)bisz(3-oxobutánamid) | 443-010-4 | 53641-10-4 | Aquatic
Chronic 3 |
H412 |
- |
H412 |
ATP01 | |||
| 616-188-00-8 | 2-(5,5-dimethyl-2,4-dioxooxazolidin-3-yl)-4,4-dimethyl-3-oxo-N-(2-methoxy-5-octadecanoylaminophenyl)pentanoic acid amide | 2-(5,5-dimetil-2,4-dioxooxazolidin-3-il)-4,4-dimetil-3-oxo-N-(2-metoxi-5-oktadekanoilaminofenil)pentánsav-amid | 443-980-9 | 221215-20-9 | Skin
Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
ATP01 | |||
| 616-189-00-3 | N-[5-(bis-(2-methoxy-ethyl)-amino]-2-(6-bromo-2-methyl-1,3-dioxo-2,3-dihydro-1H-isoindol-5-ylazo)-phenyl]acetamide | N-[5-(bisz-(2-metoxietil)amino]-2-(6-bróm-2-metil-1,3-dioxo-2,3-dihidro-1H-izoindol-5-ilazo)fenil]acetamid | 444-780-4 | 452962-97-9 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 616-190-00-9 | N-decyl-4-nitrobenzamide | N-decil-4-nitrobenzamid | 445-880-0 | 64026-19-3 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 616-191-00-4 | 2-ethyl-N-methyl-N-(3-methylphenyl)butanamide | 2-etil-N-metil-N-(3-metilfenil)butánamid | 446-190-2 | 406488-30-0 | Acute
Tox. 4 * Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H302 H315 H319 H317 H411 |
GHS07 GHS09 Wng |
H302 H319 H315 H317 H411 |
ATP01 | |||
| 616-192-00-X | 2-[2-(3-butoxypropyl)-1,1-dioxo-1,2,4-benzothiadiazin-3-yl]-5'-tert-butyl-2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-2'-[(2-ethylhexyl)thio]acetanilide | 2-[2-(3-butoxipropil)-1,1-dioxo-1,2,4-benzotiadiazin-3-il]-5'-terc-butil-2-(5,5-dimetil-2,4-dioxo-1,3-oxazolidin-3-il)-2'-[(2-etilhexil)tio]acetanilid | 448-060-0 | 727678-39-9 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 616-193-00-5 | N-[2-(2-butyl-4,6-dicyano-1,3-dioxo-2,3-dihydro-1H-isoindol-5-ylazo)-5-diethylamino-phenyl]acetamide | N-[2-(2-butil-4,6-diciano-1,3-dioxo-2,3-dihidro-1H-izoindol-5-ilazo)-5-dietilaminofenil]acetamid | 449-940-7 | 368450-39-9 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 616-194-00-0 | 2,2-diethoxy-N,N-dimethylacetamide | 2,2-dietoxi-N, N-dimetilacetamid | 449-950-1 | 34640-92-1 | Eye
Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
ATP01 | |||
| 616-196-00-1 | disodium salt of 1-hydroxy-4-(β-(4-(1-hydroxy-3,6-disulfo-8-acetylamino-2-naphthylazo)phenoxy)ethoxy)-N-dodecyl-2-naphthamide | 1-hidroxi-4-(β-(4-(1-hidroxi-3,6-diszulfo-8-acetilamino-2-naftilazo)fenoxi)etoxi)-N-dodecil-2-naftamid dinátriumsója | 419-990-4 | - | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
ATP01 | |||
| 616-197-00-7 | reaction mass of: potassium N-[3-(dimethyloxidoamino)propyl]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane sulfonamidate; N-[3-(dimethyloxidoamino)propyl]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane sulfonamide | kálium-N-[3-(dimetiloxidoamino)propil]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadekafluoroktán-szulfonamidát; N-[3-(dimetiloxidoamino)propil]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadekafluoroktán-szulfonamid keveréke | 422-500-1 | - | STOT
RE 2 * |
H373
** |
GHS08 Wng |
H373
** |
ATP01 | |||
| 616-198-00-2 | 1,3-bis[12-hydroxy-octadecamide-N-methylene]-benzene | 1,3-bisz[12-hidroxioktadekamid-N-metilén]benzol | 423-300-7 | - | Skin
Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
ATP01 | |||
| 616-200-00-1 | reaction mass of N,N'-ethane-1,2-diylbis(hexanamide) and 12-hydroxy-N-[2-[(1-oxyhexyl)amino]ethyl]octadecanamide and N,N'-ethane-1,2-diylbis(12-hydroxyoctadecan amide) | N, N'-etán-1,2-diilbisz(hexánamid) és 12-hidroxi-N-[2-[(1-oxihexil)amino]etil]oktadekánamid és N, N'-etán-1,2-diilbisz(12-hidroxioktadekánamid) keveréke | 432-430-3 | Aquatic
Chronic 4 |
H413 |
GHS07 |
H413 |
ATP01/ATP05 | ||||
| 616-201-00-7 | 12-hydroxyoctadecanoic acid, reaction products with 1,3-benzenedimethanamine and hexamethylenediamine | 12-hidroxi-oktadekánsav 1,3-benzoldimetánaminnal és hexametiléndiaminnal képzett reakciótermékei | 432-840-2 | 220926-97-6 | Acute
Tox. 4 * Aquatic Chronic 4 |
H332 H413 |
GHS07 Wng |
H332 H413 |
ATP01 | |||
| 616-202-00-2 | reaction mass of: 2,2'-[(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis(azo)]bis[N-(2,4-dimethylphenyl)]-3-oxo-butanamide; 2-[[3,3'-dichloro-4'-[[1[[(2,4-dimethylphenyl)amino]carbonyl]-2-oxopropyl]azo][1,1'-biphenyl]-4-yl]azo]-N-(2-methylphenyl)-3-oxo-butanamide; 2-[[3,3'-dichloro-4'-[[1[[(2,4-dimethylphenyl)amino]carbonyl]-2-oxopropyl]azo][1,1'-biphenyl]-4-yl]azo]-N-(2-carboxylphenyl)-3-oxo-butanamide | 2,2'-[(3,3'-diklór[1,1'-bifenil]-4,4'-diil)bisz(azo)]bisz[N-(2,4-dimetilfenil)]-3-oxobutánamid; 2-[[3,3'-diklór-4'-[[1[[(2,4-dimetilfenil)amino]karbonil]-2-oxopropil]azo][1,1'-bifenil]-4-il]azo]-N-(2-metilfenil)-3-oxobutánamid; 2-[[3,3'-diklór-4'-[[1[[(2,4-dimetilfenil)amino]karbonil]-2-oxopropil]azo][1,1'-bifenil]-4-il]azo]-N-(2-karboxilfenil)-3-oxobutánamid keveréke |
434-330-5 | - | Carc.
2 Skin Sens. 1 Aquatic Chronic 4 |
H351 H317 H413 |
GHS08 GHS07 Wng |
H351 H317 H413 |
ATP01 | |||
| 616-203-00-8 | reaction mass of: N-[5-[bis-(2-methoxyethyl)amino]-2-(2-butyl-4,6-dicyano-1,3-dioxo-2,3-dihydro-1H-isoindol-5-yl-azo)phenyl]acetamide; N-[2-(2-butyl-4,6-dicyano-1,3-dioxo-2,3-dihydro-1H-isoindol-5-ylazo)5-diethylaminophenyl]acetamide | N-[5-[bisz-(2-metoxietil)amino]-2-(2-butil-4,6-diciano-1,3-dioxo-2,3-dihidro-1H-izoindol-5-ilazo)fenil]acetamid; N-[2-(2-butil-4,6-diciano-1,3-dioxo-2,3-dihidro-1H-izoindol-5-ilazo)-5-dietilaminofenil]acetamid keveréke |
442-280-0 | - | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 616-204-00-3 | N,N''-(methylenedi-4,1-phenylene)bis[N'-octylurea] | N, N''-(metiléndianilin-4,1-fenilén)bisz[N'-oktilkarbamid] | 451-060-3 | 122886-55-9 | Aquatic
Chronic 4 |
H413 |
- |
H413 |
ATP01 | |||
| 616-205-00-9 | Metazachlor (ISO); 2-chloro-N-(2,6-dimethylphenyl)-N-(1H-pyrazol-1-ylmethyl)acetamide | metazaklór
(ISO); 2-klór-N-(2,6-dimetilfenil)-N-(1H-pirazol-1-ilmetil)acetamid |
266-583-0 | 67129-08-2 | Carc.
2 Skin Sens. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H351 H317 H400 H410 |
GHS07 GHS08 GHS09 Wng |
H317 H351 H410 |
M=100 M=100 |
ATP03 | ||
| 616-206-00-4 | flufenoxuron (ISO); 1-(4-(2-cloro-α,α,α-p-trifluorotolyloxy)-2-fluorophenyl)-3-(2,6-difluorobenzolyl)urea | flufenoxuron
(ISO); 1-(4-(2-klór-α, α,α-p-trifluortoliloxi)-2-fluorfenil-3-(2,6-difluorbenzolil)karbamid |
417-680-3 | 101463-69-8 | Lact. Aquatic Acute 1 Aquatic Chronic 1 |
H362 H400 H410 |
GHS09 Wng |
H362 H410 |
M=10000 M=10000 |
ATP05 | ||
| 616-207-00-X | polyhexamethylene
biguanide hydrochloride; PHMB [1] PHMB [2] |
polihexametilén-biguanid-hidroklorid; PHMB |
32289-58-0
[1] 27083-27-8 [2] |
Carc.
2 Acute Tox. 2 Acute Tox. 4 STOT RE 1 Eye Dam. 1 Skin Sens. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H351 H330 H302 H372 (respiratory tract) (inhalation) H318 H317 H400 H410 |
GHS08 GHS06 GHS05 GHS09 Dgr |
H330 H302 H318 H317 H351 H372 (respiratory tract) (inhalation) H410 |
M=10 M=10 |
ATP05/ATP09 | |||
| 616-208-00-5 | N-ethyl-2-pyrrolidone; 1-ethylpyrrolidin-2-one | N-etil-2-pirrolidon; 1-etilpirrolidin-2-on |
220-250-6 | 2687-91-4 | Repr.
1B |
H360D |
GHS08 Dgr |
H360D |
ATP05 | |||
| 616-209-00-0 | amidosulfuron (ISO); 3-(4,6-dimethoxypyrimidin-2-yl)-1-((N-methyl-N-methylsulfonylamino)sulfonyl)urea | amidoszulfuron
(ISO); 3-(4,6-dimetoxipirimidin-2-il)-1-((N-metil-N-metilszulfonilamino)szulfonil)karbamid |
407-380-0 | 120923-37-7 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
M=100 M=100 |
ATP05 | ||
| 616-210-00-6 | tebufenpyrad (ISO); N-(4-tertbutylbenzyl)-4-chloro-3-ethyl-1-methyl-1Hpyrazole-5- carboxamide | tebufenpirad
(ISO); N-(4-terc-butilbenzil)-4-klór-3-etil-1-metil-1H-pirazol-5-karboxamid |
119168-77-3 | Acute
Tox. 3 Acute Tox. 4 STOT RE 2 Skin Sens. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H301 H332 H373 (gastro-intestinal tract) (oral) H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H301 H332 H317 H373 (gastro-intestinal tract) (oral) H410 |
M=10 M=10 |
ATP05 | |||
| 616-211-00-1 | proquinazid (ISO); 6-iodo-2-propoxy-3-propylquinazolin-4(3H)-one | prokinazid
(ISO); 6-jód-2-propoxi-3-propilkinazolin-4(3H)-on |
189278-12-4 | Carc.
2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
M=1 M=10 |
ATP05 | |||
| 616-212-00-7 | 3-iodo-2-propynyl butylcarbamate; 3-iodoprop-2-yn-1-yl butylcarbamate | 3-jód-2-propinilbutilkarbamát; 3-jódprop-2-in-1-ilbutilkarbamát | 259-627-5 | 55406-53-6 | Acute
Tox. 3 Acute Tox. 4 STOT RE 1 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H302 H372 (larynx) H318 H317 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H302 H331 H318 H317 H372 (larynx) H410 |
M=10 M=1 |
ATP06 | ||
| 616-213-00-2 | mandipropamid (ISO); 2-(4-chlorophenyl)-N-{2-[3-methoxy-4-(prop-2-yn-1-yloxy)phenyl]ethyl}-2-(prop-2-yn-1-yloxy)acetamide | mandipropamid (ISO); 2-(4-klór-fenil)-N-{2-[3-metoxi-4-(prop-2-in-1-iloxi)fenil]etil}-2-(prop-2-in-1-iloxi)acetamid | 374726-62-2 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
M=1 M=1 |
ATP07 | |||
| 616-214-00-8 | metosulam (ISO); N-(2,6-dichloro-3-methylphenyl)-5,7-dimethoxy[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide | metosulam (ISO); N-(2,6-diklór-3-metil-fenil)-5,7-dimetoxi[1,2,4]triazol[1,5-a]pirimidin-2-szulfonamid | 139528-85-1 | Carc.
2 STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H373 (eyes, kidneys) H400 H410 |
GHS08 GHS09 Wng |
H351 H373 (eyes, kidneys) H410 |
M=1000 M=100 |
ATP07 | |||
| 616-215-00-3 | dimethenamid-P (ISO); 2-chloro-N-(2,4-dimethyl-3-thienyl)-N-[(2S)-1-methoxypropan-2-yl]acetamide | dimetén-amid-P (ISO); 2-klór-N-(2,4-dimetil-3-tienil)-N-[(2S)-1-metoxi-propán-2-il]acetamid | 163515-14-8 | Acute
Tox. 4 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
M=10 M=10 |
ATP07 | |||
| 616-216-00-9 | flonicamid (ISO); N-(cyanomethyl)-4-(trifluoromethyl)pyridine-3-carboxamide | flonikamid (ISO); N-(ciano-metil)-4-(trifluor-metil)piridin-3-karboxamid | 158062-67-0 | Acute
Tox. 4 |
H302 |
GHS07 Wng |
H302 |
ATP07 | ||||
| 616-217-00-4 | sulfoxaflor (ISO); [methyl(oxo){1-[6-(trifluoromethyl)-3-pyridyl]ethyl}-λ6-sulfanylidene]cyanamide | szulfoxaflór (ISO); [metil(oxo){1-[6-(trifluor-metil)-3-piridil]etil}-λ6-szulfanilidén]cianamid | 946578-00-3 | Acute
Tox. 4 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
M=1 M=1 |
ATP07 | |||
| 616-218-00-X | benzovindiflupyr (ISO); N-[9-(dichloromethylene)-1,2,3,4-tetrahydro-1,4-methanonaphthalen-5-yl]-3-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxamide | benzovindiflupir (ISO); N-[9-(diklórmetilén)-1,2,3,4-tetrahidro-1,4-metano-naftalin-5-il]-3-(difluormetil)-1-metil-1H-pirazol-4-karboxamid | 1072957-71-1 | Acute
Tox. 3 Acute Tox. 3 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H410 |
M=100 M=100 |
ATP09 | |||
| 616-219-00-5 | fluopyram (ISO); N-{2-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]ethyl}-2-(trifluoromethyl)benzamide | fluopiram (ISO); N-{2-[3-klór-5-(trifluormetil)piridin-2-il]etil}-2-(trifluormetil)benzamid | 658066-35-4 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
ATP09 | ||||
| 616-220-00-0 | pencycuron (ISO); 1-[(4-chlorophenyl)methyl]-1-cyclopentyl-3-phenylurea | pencikuron (ISO); 1-[(4-klórfenil)metil]-1-ciklopentil-3-fenilurea | 266-096-3 | 66063-05-6 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
M=1 M=1 |
ATP09 | ||
| 616-221-00-6 | hexaflumuron
(ISO); 1-(3,5-dichloro-4-(1,1,2,2-tetrafluoroethoxy)phenyl)-3-(2,6-difluorobenzoyl)urea |
hexaflumuron
(ISO); 1-(3,5-diklór-4-(1,1,2,2-tetrafluoretoxi)fenil)-3-(2,6-difluorbenzoil)karbamid |
401-400-1 | 86479-06-3 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
M=1000 M=10000 |
ATP10 | ||
| 616-222-00-1 | penthiopyrad
(ISO); (RS)-N-[2-(1,3-dimethylbutyl)-3-thienyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
pentiopirad
(ISO); (RS)-N-[2-(1,3-dimetilbutil)-3-tienil]-1-metil-3-(trifluormetil)pirazol-4-karboxamid |
183675-82-3 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
M=1 M=1 |
ATP10 | |||
| 616-223-00-7 | carbetamide
(ISO); (R)-1-(ethylcarbamoyl)ethyl carbanilate; (2R)-1-(ethylamino)-1-oxopropan-2-yl phenylcarbamate |
karbetamid
(ISO); (R)-1-(etilkarbamoil)etilkarbanilát; (2R)-1-(etilamin)-1-oxopropán-2-il fenilkarbamát |
240-286-6 | 16118-49-3 | Carc.
2 Repr. 1B Acute Tox. 4 Aquatic Chronic 2 |
H351 H360D H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H302 H351 H360D H411 |
ATP10 | |||
| 616-224-00-2 | amisulbrom
(ISO); 3-(3-bromo-6-fluoro-2-methylindol-1-ylsulfonyl)-N,N-dimethyl-1H-1,2,4-triazole-1-sulfonamide |
amiszulbróm
(ISO); 3-(3-bróm-6-fluor-2-metilindol-1-ilszulfonil)-N,N-dimetil-1H-1,2,4-triazol-1-szulfonamid |
348635-87-0 | Carc.
2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H319 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H319 H351 H410 |
M=10 M=10 |
ATP13 | |||
| 616-225-00-8 | (RS)-2-methoxy-N-methyl-2-[α-(2,5-xylyloxy)-o-tolyl]acetamide; mandestrobin | #HIÁNYZIK | 173662-97-0 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
M=1 M=10 |
ATP14 | |||
| 616-226-00-3 | carboxin
(ISO); 2-methyl-N-phenyl-5,6-dihydro-1,4-oxathiine-3-carboxamide; 5,6-dihydro-2-methyl-1,4-oxathiine-3-carboxanilide |
#HIÁNYZIK | 226-031-1 | 5234-68-4 | STOT
RE 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373
(Kidneys) H317 H400 H410 |
GHS07 GHS08 GHS09 Wng |
H317 H373 (kidneys) H410 |
M=1 M=1 |
ATP14 | ||
| 616-227-00-9 | metaflumizone
(ISO); (EZ)-2'-[2-(4-cyanophenyl)-1-(α,α,α -trifluoro-m-tolyl)ethylidene]-[4-(trifluoromethoxy)phenyl]carbanilohydrazide [E-isomer > 90%, Z-isomer <10% relative content] [1] (E)-2'-[2-(4-cyanophenyl)-1-(α,α,α -trifluoro-m-tolyl)ethylidene]-[4-(trifluoromethoxy)phenyl]carbanilohydrazide [2] |
#HIÁNYZIK | 139968-49-3
[1] 852403-68-0 [2] |
Repr.
2 Lact. STOT RE 2 |
H361fd H362 H373 |
GHS08 Wng |
H361fd H362 H373 |
ATP14 | ||||
| 616-228-00-4 | 3-(difluoromethyl)-1-methyl-N-(3',4',5'-trifluorobiphenyl-2-yl) pyrazole-4-carboxamide; fluxapyroxad | #HIÁNYZIK | 907204-31-3 | Lact. Aquatic Acute 1 Aquatic Chronic 1 |
H362 H400 H410 |
GHS09 Wng |
H362 H410 |
M=1 M=1 |
ATP15 | |||
| 616-230-00-5 | N-(hydroxymethyl)acrylamide; methylolacrylamide; [NMA] | #HIÁNYZIK | 213-103-2 | 924-42-5 | Carc.
1B Muta. 1B STOT RE 1 |
H350 H340 H372 (peripheral nervous system) |
GHS08 Dgr |
H340 H350 H372 (peripheral nervous system) |
ATP15 | |||
| 616-231-00-0 | 5-fluoro-1,3-dimethyl-N-[2-(4-methylpentan-2-yl) phenyl]-1H-pyrazole-4-carboxamide; 2'-[(RS)-1,3-dimethylbutyl]-5-fluoro-1,3-dimethylpyrazole-4-carboxanilide; penflufen | #HIÁNYZIK | 494793-67-8 | Carc.
2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
M=1 M=1 |
ATP15 | |||
| 616-232-00-6 | iprovalicarb (ISO); isopropyl [(2S)-3-methyl-1-{[1-(4- methylphenyl)ethyl]amino}-1-oxobutan-2-yl]carbamate | #HIÁNYZIK | 140923-17-7 | Carc.
2 |
H351 |
GHS08 Wng |
H351 |
ATP15 | ||||
| 616-233-00-1 | silthiofam (ISO); N-allyl-4,5-dimethyl- 2-(trimethylsilyl)thiophene-3-carboxamide | #HIÁNYZIK | 175217-20-6 | STOT
RE 2 Aquatic Chronic 2 |
H373 H411 |
GHS08 GHS09 Wng |
H373 H411 |
ATP15 | ||||
| 617-001-00-2 | di-tert-butyl peroxide | di(terc-butil)-peroxid | 203-733-6 | 110-05-4 | Flam.
Liq. 2 Org. Perox. E Muta. 2 |
H225 H242 H341 |
GHS02 GHS08 Dgr |
H242 H225 H341 |
CLP00/ATP03 | |||
| 617-002-00-8 | α,α-dimethylbenzyl hydroperoxide; cumene hydroperoxide | α,
α-dimetilbenzil-hidroperoxid; kumol-hidroperoxid |
201-254-7 | 80-15-9 | Org.
Perox. E Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Aquatic Chronic 2 |
H242 H331 H312 H302 H373 ** H314 H411 |
GHS02 GHS06 GHS08 GHS05 GHS09 Dgr |
H242 H331 H312 H302 H373 ** H314 H411 |
Skin
Corr. 1B; H314: C ≥ 10 % Skin Irrit. 2; H315: 3 % ≤ C < 10 % Eye Dam. 1; H318: 3 % ≤ C < 10 % Eye Irrit. 2; H319: 1 % ≤ C < 3 % STOT SE 3; H335: C < 10 % |
CLP00 | ||
| 617-003-00-3 | dilauroyl peroxide | dilauroil-peroxid | 203-326-3 | 105-74-8 | Org.
Perox. D |
H242 |
GHS02 Dgr |
H242 |
CLP00 | |||
| 617-004-00-9 | 1,2,3,4-tetrahydro-1-naphthyl hydroperoxide | 1,2,3,4-tetrahidro-1-naftil-hidroperoxid | 212-230-0 | 771-29-9 | Org.
Perox. D Acute Tox. 4 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H242 H302 H314 H400 H410 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H242 H302 H314 H410 |
STOT
SE 3; H335: C ≥ 5 % |
CLP00 | ||
| 617-006-00-X | bis(α,α-dimethylbenzyl) peroxide | bisz(α, α-dimetilbenzil)-peroxid | 201-279-3 | 80-43-3 | Org.
Perox. F Repr. 1B Skin Irrit. 2 Eye Irrit. 2 Aquatic Chronic 2 |
H242 H360D H315 H319 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H242 H315 H319 H360D H411 |
CLP00/ATP15 | |||
| 617-007-00-5 | tert-butyl α,α-dimethylbenzyl peroxide | terc-butil-α, α-dimetilbenzil-peroxid | 222-389-8 | 3457-61-2 | Org.
Perox. E Skin Irrit. 2 Aquatic Chronic 2 |
H242 H315 H411 |
GHS02 GHS07 GHS09 Wng |
H242 H315 H411 |
CLP00 | |||
| 617-008-00-0 | dibenzoyl peroxide; benzoyl peroxide | dibenzoil-peroxid; benzoil-peroxid |
202-327-6 | 94-36-0 | Org.
Perox. B Eye Irrit. 2 Skin Sens. 1 |
H241 H319 H317 |
GHS01 GHS02 GHS07 Dgr |
H241 H319 H317 |
CLP00/ATP01corr | |||
| 617-010-00-1 | 1-hydroperoxycyclohexyl
1-hydroxycyclohexyl peroxide; [> 91 % solution] [1] 1,1’-dioxybiscyclohexan-1-ol; [> 91 % solution] [2] cyclohexylidene hydroperoxide; [> 91 % solution] [3] cyclohexanone, peroxide; [> 91 % solution] [4] |
1-hidroperoxiciklohexil-1-hidroxiciklohexil-peroxid;
[1] 1,1'-dioxibiszciklohexán-1-ol; [2] ciklohexilidén-hidroperoxid; [3] ciklohexanon-peroxid [4] |
201-091-1
[1] 219-306-2 [2] 220-279-4 [3] 235-527-7 [4] |
78-18-2
[1] 2407-94-5 [2] 2699-11-8 [3] 12262-58-7 [4] |
Org.
Perox. A Acute Tox. 4 * Skin Corr. 1B |
H240 H302 H314 |
GHS01 GHS05 GHS07 Dgr |
H240 H302 H314 |
STOT
SE 3; H335: C ≥ 5 % |
C | CLP00/ATP01corr | |
| 617-010-01-9 | 1-hydroperoxycyclohexyl
1-hydroxycyclohexyl peroxide; [≤ 91 % solution] [1] 1,1'-dioxybiscyclohexan-1-ol; [≤ 91 % solution] [2] cyclohexylidene hydroperoxide; [≤ 91 % solution] [3] cyclohexanone, peroxide; [≤ 91 % solution] [4] |
1-hidroperoxiciklohexil-1-hidroxiciklohexil-peroxid;
[1] 1,1'-dioxibiszciklohexán-1-ol; [2] ciklohexilidén-hidroperoxid; [3] ciklohexanon, peroxid [4] [≤ 91 % oldat] |
201-091-1
[1] 219-306-2 [2] 220-279-4 [3] 235-527-7 [4] |
78-18-2
[1] 2407-94-5 [2] 2699-11-8 [3] 12262-58-7 [4] |
Org.
Perox. C Acute Tox. 4 * Skin Corr. 1B |
H242 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H242 H302 H314 |
STOT
SE 3; H335: C ≥ 5 % |
C T | CLP00 | |
| 617-012-00-2 | 8-p-menthyl hydroperoxide; p-menthane hydroperoxide | 8-p-mentil-hidroperoxid; p-mentán-hidroperoxid |
201-281-4 | 80-47-7 | Org.
Perox. D Acute Tox. 4 * Skin Corr. 1B |
H242 H332 H314 |
GHS02 GHS05 GHS07 Dgr |
H242 H314 H332 |
STOT
SE 3; H335: C ≥ 5 % |
CLP00 | ||
| 617-013-00-8 | O,O-tert-butyl O-docosyl monoperoxyoxalate | O, O-terc-butil-O-dokozil-monoperoxioxalát | 404-300-6 | 116753-76-5 | Org.
Perox. C **** Aquatic Acute 1 Aquatic Chronic 1 |
H242 H400 H410 |
GHS02 GHS09 Dgr |
H242 H410 |
CLP00 | |||
| 617-014-00-3 | 6-(nonylamino)-6-oxo-peroxyhexanoic acid | 6-(nonilamino)-6-oxoperoxihexánsav | 406-680-9 | 104788-63-8 | Org.
Perox. C **** Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 |
H242 H318 H317 H400 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H242 H318 H317 H400 |
CLP00 | |||
| 617-015-00-9 | bis(4-methylbenzoyl)peroxide | bisz(4-metilbenzoil)-peroxid | 407-950-9 | 895-85-2 | Org.
Perox. B **** Aquatic Acute 1 Aquatic Chronic 1 |
H241 H400 H410 |
GHS01 GHS02 GHS09 Dgr |
H241 H410 |
CLP00 | |||
| 617-016-00-4 | 3-hydroxy-1,1-dimethylbutyl 2-ethyl-2-methylheptaneperoxoate | 3-hidroxi-1,1-dimetilbutil-2-etil-2-metilheptánperoxoát | 413-910-1 | Flam.
Liq. 3 Org. Perox. C **** Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H242 H315 H400 H410 |
GHS02 GHS07 GHS09 Dgr |
H242 H226 H315 H410 |
CLP00 | ||||
| 617-017-00-X | reaction mass of: 2,2'-bis(tert-pentylperoxy)-p-diisopropylbenzene; 2,2'-bis(tert-pentylperoxy)-m-diisopropylbenzene | 2,2'-bisz(terc-pentilperoxi)-p-diizopropilbenzol; 2,2'-bisz(terc-pentilperoxi)-m-diizopropilbenzol keveréke |
412-140-3 | 32144-25-5 | Org.
Perox. D Aquatic Chronic 4 |
H242 H413 |
GHS02 Dgr |
H242 H413 |
T | CLP00/ATP01 | ||
| 617-018-00-5 | reaction mass of: 1-methyl-1-(3-(1-methylethyl)phenyl)ethyl-1-methyl-1-phenylethylperoxide, 63 % by weight; 1-methyl-1-(4-(1-methylethyl)phenyl)ethyl-1-methyl-1-phenylethylperoxide, 31 % by weight | 1-metil-1-(3-(1-metiletil)fenil)etil-1-metil-1-feniletil-peroxid
(63 % w/w); 1-metil-1-(4-(1- metiletil)fenil)etil-1-metil-1-feniletil-peroxid (31 % w/w) keveréke |
410-840-3 | 71566-50-2 | Org.
Perox. C **** Aquatic Chronic 2 |
H242 H411 |
GHS02 GHS09 Dgr |
H242 H411 |
T | CLP00 | ||
| 617-019-00-0 | 6-(phthalimido)peroxyhexanoic acid | 6-(ftálimido)peroxihexánsav | 410-850-8 | 128275-31-0 | Org.
Perox. D Eye Dam. 1 Aquatic Acute 1 |
H242 H318 H400 |
GHS02 GHS05 GHS09 Dgr |
H242 H318 H400 |
T | CLP00 | ||
| 617-020-00-6 | 1,3-di(prop-2,2-diyl)benzene bis(neodecanoylperoxide) | 1,3-di(prop-2,2-diil)benzolbisz(neodekanoil-peroxid) | 420-060-5 | 117663-11-3 | Flam.
Liq. 3 Org. Perox. D **** Aquatic Chronic 2 |
H226 H242 H411 |
GHS02 GHS09 Dgr |
H226 H242 H411 |
CLP00 | |||
| 617-021-00-1 | methylethylketone peroxide trimer | metiletil-keton-peroxid trimer | 429-320-2 | - | Org.
Perox. B **** Asp. Tox. 1 Skin Irrit. 2 Skin Sens. 1 |
H241 H304 H315 H317 |
GHS01 GHS02 GHS08 GHS07 Dgr |
H241 H304 H315 H317 |
ATP01 | |||
| 617-022-00-7 | reaction mass of: 1,2-dimethylpropylidene dihydroperoxide; dimethyl 1,2-benzenedicarboxylate | 1,2-dimetilpropilidén-dihidroperoxid; dimetil-1,2-benzoldikarboxilát keveréke | 442-480-8 | - | Org.
Perox. C Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H242 H302 H314 H317 H411 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H242 H302 H314 H317 H411 |
ATP01 | |||
| 617-023-00-2 | tert-butyl hydroperoxide | tert-butil hidroperoxid | 200-915-7 | 75-91-2 | Muta.
2 |
H341 |
GHS08 Wng |
H341 |
ATP09 | |||
| 647-001-00-8 | glucosidase, β- | β-glükozidáz | 232-589-7 | 9001-22-3 | Resp.
Sens. 1 |
H334 |
GHS08 Dgr |
H334 |
CLP00 | |||
| 647-002-00-3 | cellulase | celluláz | 232-734-4 | 9012-54-8 | Resp.
Sens. 1 |
H334 |
GHS08 Dgr |
H334 |
CLP00 | |||
| 647-003-00-9 | cellobiohydrolase, exo- | exo-cellobiohidroláz | 253-465-9 | 37329-65-0 | Resp.
Sens. 1 |
H334 |
GHS08 Dgr |
H334 |
CLP00 | |||
| 647-004-00-4 | cellulases with the exception of those specified elsewhere in this Annex | cellulázok (kivéve az e mellékletben külön szereplőket) | Resp.
Sens. 1 |
H334 |
GHS08 Dgr |
H334 |
A | CLP00 | ||||
| 647-005-00-X | bromelain, juice | bromelain juice | 232-572-4 | 9001-00-7 | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 Resp. Sens. 1 |
H335 H315 H319 H334 |
GHS08 GHS07 Dgr |
H319 H335 H315 H334 |
CLP00 | |||
| 647-006-00-5 | ficin | ficin | 232-599-1 | 9001-33-6 | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 Resp. Sens. 1 |
H335 H315 H319 H334 |
GHS08 GHS07 Dgr |
H319 H335 H315 H334 |
CLP00 | |||
| 647-007-00-0 | papain | papain | 232-627-2 | 9001-73-4 | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 Resp. Sens. 1 |
H335 H315 H319 H334 |
GHS08 GHS07 Dgr |
H319 H335 H315 H334 |
CLP00 | |||
| 647-008-00-6 | pepsin A | pepszin-A | 232-629-3 | 9001-75-6 | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 Resp. Sens. 1 |
H335 H315 H319 H334 |
GHS08 GHS07 Dgr |
H319 H335 H315 H334 |
CLP00 | |||
| 647-009-00-1 | rennin | rennin | 232-645-0 | 9001-98-3 | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 Resp. Sens. 1 |
H335 H315 H319 H334 |
GHS08 GHS07 Dgr |
H319 H335 H315 H334 |
CLP00 | |||
| 647-010-00-7 | trypsin | tripszin | 232-650-8 | 9002-07-7 | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 Resp. Sens. 1 |
H335 H315 H319 H334 |
GHS08 GHS07 Dgr |
H319 H335 H315 H334 |
CLP00 | |||
| 647-011-00-2 | chymotrypsin | kimotripszin | 232-671-2 | 9004-07-3 | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 Resp. Sens. 1 |
H335 H315 H319 H334 |
GHS08 GHS07 Dgr |
H319 H335 H315 H334 |
CLP00 | |||
| 647-012-00-8 | subtilisin | szubtilizin | 232-752-2 | 9014-01-1 | STOT
SE 3 Skin Irrit. 2 Eye Dam. 1 Resp. Sens. 1 |
H335 H315 H318 H334 |
GHS08 GHS05 GHS07 Dgr |
H335 H315 H318 H334 |
CLP00 | |||
| 647-013-00-3 | proteinase, microbial neutral | proteináz, semleges, mikrobiális eredetű | 232-966-6 | 9068-59-1 | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 Resp. Sens. 1 |
H335 H315 H319 H334 |
GHS08 GHS07 Dgr |
H319 H335 H315 H334 |
CLP00 | |||
| 647-014-00-9 | proteases with the exception of those specified elsewhere in this Annex | proteázok (kivéve az e mellékletben külön szereplőket) | STOT
SE 3 Skin Irrit. 2 Eye Irrit. 2 Resp. Sens. 1 |
H335 H315 H319 H334 |
GHS08 GHS07 Dgr |
H319 H335 H315 H334 |
CLP00 | |||||
| 647-015-00-4 | amylase, α- | α-amiláz | 232-565-6 | 9000-90-2 | Resp.
Sens. 1 |
H334 |
GHS08 Dgr |
H334 |
CLP00 | |||
| 647-016-00-X | amylases with the exception of those specified elsewhere in this Annex | amilázok (kivéve az e mellékletben külön szereplőket) | Resp.
Sens. 1 |
H334 |
GHS08 Dgr |
H334 |
CLP00 | |||||
| 647-017-00-5 | laccase | lakkáz | 420-150-4 | 80498-15-3 | Resp.
Sens. 1 |
H334 |
GHS08 Dgr |
H334 |
ATP01 | |||
| 648-001-00-0 | Distillates (coal tar), benzole fraction; Light Oil; [A complex combination of hydrocarbons obtained by the distillation of coal tar. It consists of hydrocarbons having carbon numbers primarily in the range of C4 to C10 and distilling in the approximate range of 80 °C to 160 °C (175 °F to 320 °F).] | Párlatok
(kőszénkátrány), benzol frakció; Könnyűolaj; [A kőszénkátrány desztillációjából származó szénhidrogének összetett keveréke. Főként C4-C10 szénatomszámú szénhidrogének keveréke. Forráspont tartomány: 80 oC–160 oC (175 oF-320 oF).] |
283-482-7 | 84650-02-2 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 648-002-00-6 | Tar oils, brown-coal; Light Oil; [The distillate from lignite tar boiling in the range of approximately 80°C to 250°C (176°F to 482°F). Composed primarily of aliphatic and aromatic hydrocarbons and monobasic phenols.] | Kátrányolajok,
barnakőszén; Könnyűolaj; [Lignitkátrány desztillátuma, melynek forrásponttartománya kb. 80 oC-tól 250 oC-ig (176 oF-tól 482 oF-ig) terjed. Elsősorban alifás és aromás szénhidrogének, valamint egybázisú fenolok alkotják.] |
302-674-4 | 94114-40-6 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-003-00-1 | Benzol forerunnings (coal); Light Oil Redistillate, low boiling; [The distillate from coke oven light oil having an approximate distillation range below 100°C (212°F). Composed primarily of C4 to C6 aliphatic hydrocarbons.] | Benzol
előpárlatok (kőszén); Könnyűolaj redesztillátum, alacsony forráspontú; [A kokszolókemencéből származó könnyűolaj párlata, melynek közelítő desztillációs tartománya 100 oC (212 oF) alatt van. Elsősorban C4–C6 alifás szénhidrogének alkotják.] |
266-023-5 | 65996-88-5 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-004-00-7 | Distillates (coal tar), benzole fraction, BTX-rich; Light Oil Redistillate, low boiling; [A residue from the distillation of crude benzole to remove benzole fronts. Composed primarily of benzene, toluene and xylenes boiling in the range of approximately 75°C to 200°C (167°F to 392°F).] | Párlatok
(kőszénkátrány), benzol frakció, BTX-ben gazdag; Könnyűolaj redesztillátum, alacsony forráspontú; [A nyers benzol desztilláció távozó terméke, a benzol előpárlatok eltávolítása során keletkezik. Elsősorban benzolból, toluolból és xilolokból áll, forráspont tartománya kb. 75 oC-tól 200 oC-ig (167 oF-tól 392 oF-ig) terjed.] |
309-984-9 | 101896-26-8 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-005-00-2 | Aromatic hydrocarbons, C6-10, C8-rich; Light Oil Redistillate, low boiling | Aromás szénhidrogének, C6-10, C8-ban gazdag; Könnyűolaj redesztillátum, alacsony forráspontú | 292-697-5 | 90989-41-6 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-006-00-8 | Solvent naphtha (coal), light; Light Oil Redistillate, low boiling | Oldószer benzin (kőszén), könnyű; Könnyűolaj redesztillátum, alacsony forráspontú | 287-498-5 | 85536-17-0 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-007-00-3 | Solvent naphtha (coal), xylene-styrene cut; Light Oil Redistillate, intermediate boiling | Oldószer benzin (kőszén), xilol-sztirol frakció; Könnyűolaj redesztillátum, közepes forráspontú | 287-502-5 | 85536-20-5 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-008-00-9 | Solvent naphtha (coal), coumarone-styrene contg.; Light Oil Redistillate, intermediate boiling | Oldószer benzin (kőszén), kumaron-sztirol frakció; Könnyűolaj redesztillátum, közepes forráspontú | 287-500-4 | 85536-19-2 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-009-00-4 | Naphtha (coal), distn. residues; Light Oil Redistillate, high boiling; [The residue remaining from the distillation of recovered naphtha. Composed primarily of naphthalene and condensation products of indene and styrene.] | Benzin
(kőszén) desztillációs maradékok; Könnyűolaj redesztillátum, magas forráspontú; [A visszanyert benzin desztillációjából származó maradék. Elsősorban naftalinból, valamint indén és sztirén kondenzációs termékekből áll.] |
292-636-2 | 90641-12-6 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-010-00-X | Aromatic hydrocarbons, C8; Light Oil Redistillate, high boiling | Aromás szénhidrogének, C8; Könnyűolaj redesztillátum, magas forráspontú | 292-694-9 | 90989-38-1 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-012-00-0 | Aromatic hydrocarbons, C8-9, hydrocarbon resin polymn. by-product; Light Oil Redistillate, high boiling; [A complex combination of hydrocarbons obtained from the evaporation of solvent under vacuum from polymerized hydrocarbon resin. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C8 through C9 and boiling in the range of approximately 120°C to 215°C (248°F to 419°F).] | Aromás
szénhidrogének, C8-9, szénhidrogén műgyanta polim. melléktermék; Könnyűolaj redesztillátum, magas forráspontú; [Szénhidrogének összetett keveréke, melyet polimerizált szénhidrogén műgyantából nyernek az oldószer vákuum alatti elpárologtatásával. Főleg olyan aromás szénhidrogénekből áll, melyek szénatomszáma C8-tól C9-ig terjed, és forrásponttartományuk kb. 120 oC–215 oC (248 oF–419 oF).] |
295-281-1 | 91995-20-9 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-013-00-6 | Aromatic hydrocarbons, C9-12, benzene distn.; Light Oil Redistillate, high boiling | Aromás
szénhidrogének, C9–12, benzol desztillátum; Könnyűolaj redesztillátum, magas forráspontú |
295-551-9 | 92062-36-7 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-014-00-1 | Extract residues (coal), benzole fraction alk., acid ext.; Light Oil Extract Residues, low boiling; [The redistillate from the distillate, freed of tar acids and tar bases, from bituminous coal high temperature tar boiling in the approximate range of 90°C to 160°C (194°F to 320°F). It consists predominantly of benzene, toluene and xylenes.] | Extrakciós
maradékok (kőszén), benzol frakció, lúgos, savas extr.; Könnyűolaj extrakciós maradékok, alacsony forráspontú; [A desztillátum redesztillátuma bitumenes kőszén magas hőmérsékletű kátrányból, mely mentes kátránysavaktól és kátránybázisoktól. Közelítő forrásponttartománya 90 oC-tól 160 oC-ig (194 oF-tól 320 oF-ig) terjed. Elsősorban benzolból, toluolból és xilolokból áll.] |
295-323-9 | 91995-61-8 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-015-00-7 | Extract residues (coal tar), benzole fraction alk., acid ext.; Light Oil Extract Residues, low boiling; [A complex combination of hydrocarbons obtained by the redistillation of the distillate of high temperature coal tar (tar acid and tar base free). It consists predominantly of unsubstituted and substituted mononuclear aromatic hydrocarbons boiling in the range of 85°C to 195°C (185°F to 383°F).] | Extrakciós
maradékok (kőszénkátrány), benzol frakció lúgos, savas extr.; Könnyűolaj
extrakciós maradékok, alacsony forráspontú; [Szénhidrogének összetett keveréke, melyet a magas hőmérsékletű kőszénkátrány desztillátum (kátránysav és kátránybázis mentes) újradesztillálásával nyernek. Főleg nem szubsztituált és szubsztituált mononukleáris aromás szénhidrogénekből áll, melyek forrásponttartománya 85 oC-tól 195 oC-ig (185 oF–383 oF) terjed.] |
309-868-8 | 101316-63-6 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-016-00-2 | Extract residues (coal), benzole fraction acid; Light Oil Extract Residues, low boiling; [An acid sludge by-product of the sulfuric acid refining of crude high temperature coal. Composed primarily of sulfuric acid and organic compounds.] | Extrakciós
maradékok (kőszén), benzol frakció sav; Könnyűolaj extrakciós maradékok, alacsony forráspontú; [A magas hőmérsékletű nyers kőszén kénsavas finomításának savas iszapos mellékterméke. Főleg kénsavból és szerves vegyületekből áll.] |
298-725-2 | 93821-38-6 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-017-00-8 | Extract residues (coal), light oil alk., distn. overheads; Light Oil Extract Residues, low boiling; [The first fraction from the distillation of aromatic hydrocarbons, coumarone, naphthalene and indene rich prefractionator bottoms or washed carbolic oil boiling substantially below 145°C (293°F). Composed primarily of C7 and C8 aliphatic and aromatic hydrocarbons.] | Extrakciós
maradékok (kőszén), könnyűolaj lúgos, deszt. fejtermékek; Könnyűolaj extrakciós maradékok, alacsony forráspontú; [Aromás szénhidrogének, kumaron, naftalin és az indénben gazdag prefrakcionáló fenéktermékek vagy mosott karbololaj desztillációjának első frakciója, melynek forráspontja alapvetően 145 oC (293 oF) alatt van. Főként C7 és C8 alifás és aromás szénhidrogénekből áll.] |
292-625-2 | 90641-02-4 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-018-00-3 | Extract residues (coal), light oil alk., acid ext., indene fraction; Light Oil Extract Residues, intermediate boiling | Extrakciós
maradékok (kőszén), könnyűolaj lúgos, savas extr., indén frakció; Könnyűolaj extrakciós maradékok, közepes forráspontú |
309-867-2 | 101316-62-5 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-019-00-9 | Extract residues (coal), light oil alk., indene naphtha fraction; Light Oil Extract Residues, high boiling; [The distillate from aromatic hydrocarbons, coumarone, naphthalene and indene rich prefractionator bottoms or washed carbolic oils, having an approximate boiling range of 155°C to 180°C (311°F to 356°F). Composed primarily of indene, indan and trimethylbenzenes.] | Extrakciós
maradékok (kőszén), könnyűolaj lúgos, indén benzin frakció; Könnyűolaj
extrakciós maradékok, magas forráspontú; [Aromás szénhidrogének, kumaron, naftalin és az indénben gazdag prefrakcionáló fenéktermékek vagy mosott karbololaj desztillátuma, melynek forráspont tartománya 155 oC-tól 180 oC-ig (311 oF-tól 356 oF-ig) terjed. Elsősorban indénből, indánból és trimetilbenzolokból áll.] |
292-626-8 | 90641-03-5 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-020-00-4 | Solvent naphtha (coal); Light Oil Extract Residues, high boiling; [The distillate from either high temperature coal tar, coke oven light oil, or coal tar oil alkaline extract residue having an approximate distillation range of 130°C to 210°C (266°F to 410°F). Composed primarily of indene and other polycyclic ring systems containing a single aromatic ring. May contain phenolic compounds and aromatic nitrogen bases.] | Oldószer
benzin (kőszén); Könnyűolaj extrakciós maradékok, magas forráspontú; [Magas hőmérsékletű kőszénkátrány, kokszolókemence könnyűolaj vagy kőszénkátrány olaj lúgos extrakciós maradékának desztillátuma, melynek közelítő desztillációs tartománya 130 oC-tól 210 oC-ig (266 oF-tól 410 oF-ig) terjed. Elsősorban indénből és más policiklusos gyűrűs rendszerekből áll, melyek egy aromás gyűrűt tartalmaznak. Tartalmazhat még fenolvegyületeket és aromás nitrogén bázisokat is.] |
266-013-0 | 65996-79-4 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-021-00-X | Distillates (coal tar), light oils, neutral fraction; Light Oil Extract Residues, high boiling; [A distillate from the fractional distillation of high temperature coal tar. Composed primarily of alkyl-substituted one ring aromatic hydrocarbons boiling in the range of approximately 135°C to 210°C (275°F to 410°F). May also include unsaturated hydrocarbons such as indene and coumarone.] | Desztillátumok (kőszénkátrány), könnyű olajok, semleges frakció; Könnyűolaj extrakciós maradékok, magas forráspontú; [Magas hőmérsékletű kőszénkátrány frakcionált desztillációjából származó desztillátum. Elsősorban alkil-szubsztituált egygyűrűs aromás szénhidrogénekből áll, melyek nagyjából a 135 oC-tól 210 oC-ig (275 oF-tól 410 oF-ig) terjedő tartományban forrnak. Tartalmazhat még telítetlen szénhidrogéneket is, például indént és kumaront.] | 309-971-8 | 101794-90-5 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-022-00-5 | Distillates (coal tar), light oils, acid exts.; Light Oil Extract Residues, high boiling; [This oil is a complex reaction mass of aromatic hydrocarbons, primarily indene, naphthalene, coumarone, phenol, and o-, m- and p-cresol and boiling in the range of 140°C to 215°C (284°F to 419°F).] | Desztillátumok
(kőszénkátrány), könnyűolajok, savas extr.; Könnyűolaj extrakciós maradékok,
magas forráspontú; [Ez az olaj aromás szénhidrogének, elsősorban indén, naftalin, kumaron, fenol, valamint o-, m- és p-krezol összetett keveréke, mely a 140 oC-tól 215 oC-ig (284 oF-tól 419 oF-ig) terjedő tartományban forr.] |
292-609-5 | 90640-87-2 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-023-00-0 | Distillates (coal tar), light oils; Carbolic Oil; [A complex combination of hydrocarbons obtained by distillation of coal tar. It consists of aromatic and other hydrocarbons, phenolic compounds and aromatic nitrogen compounds and distills at the approximate range of 150°C to 210°C (302°F to 410°F).] | Desztillátumok
(kőszénkátrány), könnyűolajok; Karbololaj; [Szénhidrogének összetett keveréke, melyet kőszénkátrány desztillációjával állítanak elő. Aromás és egyéb szénhidrogénekből, fenolvegyületekből és aromás nitrogénvegyületekből áll. Megközelítőleg a 150 oC-tól 210 oC-ig (302 oF-tól 410 oF-ig) terjedő tartományban desztillálható.] |
283-483-2 | 84650-03-3 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-024-00-6 | Tar oils, coal; Carbolic Oil; [The distillate from high temperature coal tar having an approximate distillation range of 130°C to 250°C (266°F to 410°F). Composed primarily of naphthalene, alkylnaphthalenes, phenolic compounds, and aromatic nitrogen bases.] | Kátrányolajok,
kőszén; Karbololaj; [Magas hőmérsékletű kőszénkátrány desztillátuma, melynek hozzávetőleges desztillációs tartománya 130 oC-tól 250 oC-ig (266 oF-tól 410 oF-ig) terjed. Elsősorban naftalinból, alkil-naftalinokból, fenolvegyületekből és aromás nitrogén bázisokból áll.] |
266-016-7 | 65996-82-9 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-026-00-7 | Extract residues (coal), light oil alk., acid ext.; Carbolic Oil Extract Residue; [The oil resulting from the acid washing of alkali-washed carbolic oil to remove the minor amounts of basic compounds (tar bases). Composed primarily of indene, indan and alkylbenzenes.] | Extrakciós
maradékok (kőszén), könnyűolaj lúgos, savas extr.; Karbololaj extrakciós maradék; [A kis mennyiségű bázikus vegyületek (kátrány bázisok) eltávolítása céljából lúggal-mosott karbololaj savas mosásával előállított olaj. Főleg indénből, indánból és alkilbenzolokból áll.] |
292-624-7 | 90641-01-3 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-027-00-2 | Extract residues (coal), tar oil alk.; Carbolic Oil Extract Residue; [The residue obtained from coal tar oil by an alkaline wash such as aqueous sodium hydroxide after the removal of crude coal tar acids. Composed primarily of naphthalenes and aromatic nitrogen bases.] | Extrakciós
maradékok (kőszén), kátrányolaj lúgos; Karbololaj extrakciós maradék; [Kőszénkátrány olajból a nyers kőszénkátrány savak eltávolítása után lúgos mosással (pl. nátrium hidroxid vizes oldatával) előállított maradék. Elsősorban naftalinokból és aromás nitrogén bázisokból áll.] |
266-021-4 | 65996-87-4 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-028-00-8 | Extract oils (coal), light oil; Acid Extract; [The aqueous extract produced by an acidic wash of alkali-washed carbolic oil. Composed primarily of acid salts of various aromatic nitrogen bases including pyridine, quinoline and their alkyl derivatives.] | Extraktum
olajok (kőszén), könnyűolaj, savas extraktum; [A lúggal mosott karbololaj savas mosásával előállított vizes extraktum. Elsősorban különféle aromás nitrogénbázisok, pl. piridin, kinolin és ezek alkilszármazékainak savval alkotott sói alkotják.] |
292-622-6 | 90640-99-6 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-029-00-3 | Pyridine, alkyl derivs.; Crude Tar Bases; [The complex combination of polyalkylated pyridines derived from coal tar distillation or as high-boiling distillates approximately above 150°C (302°F) from the reaction of ammonia with acetaldehyde, formaldehyde or paraformaldehyde.] | Piridin,
alkilszárm; Nyers kátrány bázisok; [Polialkilezett piridinek kőszénkátrány desztillációból vagy magas forráspontú, kb. 150 oC (302 oF) feletti desztillátumként ammónia reakciójából acetaldehiddel, formaldehiddel, vagy paraformaldehiddel előállított összetett keveréke.] |
269-929-9 | 68391-11-7 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-030-00-9 | Tar bases, coal, picoline fraction; Distillate Bases; [Pyridine bases boiling in the range of approximately 125°C to 160°C (257°F 320°F) obtained by distillation of neutralized acid extract of the base-containing tar fraction obtained by the distillation of bituminous coal tars. Composed chiefly of lutidines and picolines.] | Kátrány
bázisok, kőszén, pikolin frakció; Desztillátum bázisok; [Piridin bázisok, melyek közelítő forráspont-tartománya 125 oC-tól 160 oC-ig (257 oF-320 oF) terjed, és bitumenes kőszénkátrányok desztillációjával előállított, bázis tartalmú kátrányfrakció semlegesített, savas extraktumának desztillációjával nyerhetők. Főleg lutidinekből és pikolinokból áll.] |
295-548-2 | 92062-33-4 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-031-00-4 | Tar bases, coal, lutidine fraction; Distillate Bases | Kátrány
bázisok, kőszén, lutidin frakció; Desztillátum bázisok |
293-766-2 | 91082-52-9 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-032-00-X | Extract oils (coal), tar base, collidine fraction; Distillate Bases; [The extract produced by the acidic extraction of bases from crude coal tar aromatic oils, neutralization, and distillation of the bases. Composed primarily of collidines, aniline, toluidines, lutidines, xylidines.] | Extraktum
olajok (kőszén), kátrány bázis, kollidin frakció; Desztillátum bázisok; [Extraktum, melyet a nyers kőszénkátrány aromás olajaiból származó bázisok savas extrakciójával, semlegesítésével és desztillációjával állítanak elő. Elsősorban kollidinekből, anilinból, toluidinekből, lutidinekből és xilidinekből áll.] |
273-077-3 | 68937-63-3 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-033-00-5 | Tar bases, coal, collidine fraction; Distillate Bases; [The distillation fraction boiling in the range of approximately 181 °C to 186 °C (356 °F to 367 °F) from the crude bases obtained from the neutralized, acid-extracted base-containing tar fractions obtained by the distillation of bituminous coal tar. It contains chiefly aniline and collidines.] | Kátrány
bázisok, kőszén, kollidin frakció; Desztillátum bázisok; [Bitumenes kőszénkátrány desztillációjából nyert, semlegesített, savval extrahált bázisokat tartalmazó kátrányfrakciókból előállított nyers bázisok desztillációs frakciója, mely a kb. 181 oC-tól 186 oC-ig (356 oF-tól 367 oF-ig) terjedő tartományban forr. Fő alkotója az anilin és a kollidinek.] |
295-543-5 | 92062-28-7 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-034-00-0 | Tar bases, coal, aniline fraction; Distillate Bases; [The distillation fraction boiling in the range of approximately 180 °C to 200 °C (356 °F to 392 °F) from the crude bases obtained by dephenolating and debasing the carbolated oil from the distillation of coal tar. It contains chiefly aniline, collidines, lutidines and toluidines.] | Kátrány
bázisok, kőszén, anilin frakció; Desztillátum bázisok; [Kőszénkátrány desztillációjából származó karbolsavas olaj fenol- és bázismentesítésével nyert nyers bázisok azon desztillátum frakciója, mely közelítőleg a 180 oC-tól 200 oC-ig (356 oF-tól 392 oF-ig) terjedő tartományban forr. Főleg anilint, kollidineket, lutidineket és toluidineket tartalmaz.] |
295-541-4 | 92062-27-6 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-035-00-6 | Tar bases, coal, toluidine fraction; Distillate Bases | Kátrány
bázisok, kőszén, toluidin frakció; Desztillátum bázisok |
293-767-8 | 91082-53-0 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-036-00-1 | Distillates (petroleum), alkene-alkyne manuf. pyrolysis oil, mixed with high-temp. coal tar, indene fraction; Redistillates; [A complex combination of hydrocarbons obtained as a redistillate from the fractional distillation of bituminous coal high temperature tar and residual oils that are obtained by the pyrolytic production of alkenes and alkynes from petroleum products or natural gas. It consists predominantly of indene and boils in a range of approximately 160°C to 190°C (320°F to 374°F).] | Desztillátumok
(ásványolaj), alkén-alkin gyárt. pirolízis olaj, magas hőm. kőszénkátránnyal
keverve, indén frakció; Redesztillátumok; [Összetett keverék, mely bitumenes kőszén magas hőmérsékletű kátrány frakcionált desztillációjának redesztillációjával előállított szénhidrogénekből és földgázból vagy ásványolajtermékekből alkének és alkinek pirolitikus úton való előállításával nyert maradék olajokból áll. Főleg indénből áll és forráspont tartománya kb. 160 oC-tól 190 oC-ig (320 oF-tól 374 oF-ig) terjed.] |
295-292-1 | 91995-31-2 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-037-00-7 | Distillates (coal), coal tar-residual pyrolysis oils, naphthalene oils; Redistillates; [The redistillate obtained from the fractional distillation of bituminous coal high temperature tar and pyrolysis residual oils and boiling in the range of approximately 190°C to 270°C (374°F to 518°F). Composed primarily of substituted dinuclear aromatics.] | Desztillátumok
(kőszén), kőszénkátrány maradék pirolízis olajok, naftalin olajok; Redesztillátumok; [Bitumenes kőszén magas hőmérsékletű kátrány és pirolízis maradékolajok frakcionált desztillációjának redesztillátuma, melynek forráspont tartománya kb. 190 oC-tól 270 oC-ig (374 oF-tól 518 oF-ig) terjed. Főleg szubsztituált dinukleáris aromásokból áll.] |
295-295-8 | 91995-35-6 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-038-00-2 | Extract oils (coal), coal tar-residual pyrolysis oils, naphthalene oil, redistillate; Redistillates; [The redistillate from the fractional distillation of dephenolated and debased methylnaphthalene oil obtained from bituminous coal high temperature tar and pyrolysis residual oils boiling in the approximate range of 220°C to 230°C (428°F to 446°F). It consists predominantly of unsubstituted and substituted dinuclear aromatic hydrocarbons.] | Extraktum
olajok (kőszén), kőszénkátrány-maradék pirolízis olajok, naftalinolajok,
redesztillátum; Redesztillátumok; [Bitumenes kőszén magas hőmérsékletű kátrányból és pirolízis maradékolajokból előállított, fenol- és bázismentesített metilnaftalin olaj frakcionált desztillációjának redesztillátuma, melynek forráspont tartománya kb. 220 oC-tól 230 oC-ig (428 oF-tól 446 oF-ig) terjed. Túlnyomórészt nem szubsztituált és szubsztituált dinukleáris aromás szénhidrogénekből áll.] |
295-329-1 | 91995-66-3 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-039-00-8 | Extract oils (coal), coal tar-residual pyrolysis oils, naphthalene oils; Redistillates; [A neutral oil obtained by debasing and dephenolating the oil obtained from the distillation of high temperature tar and pyrolysis residual oils which has a boiliing range of 225°C to 255°C (437°F to 491°F). Composed primarily of substituted dinuclear aromatic hydrocarbons.] | Extraktum
olajok (kőszén), kőszénkátrány-maradék pirolízis olajok,
naftalinolajok; Redesztillátumok; [Semleges olaj, melyet magas hőmérsékletű kátrány és pirolízis maradékolajok desztillációjából nyert olaj bázis- és fenolmentesítésével állítanak elő, és forráspont-tartománya 225 oC-tól 255 oC-ig (437 oF-tól 491 oF-ig) terjed. Elsősorban szubsztituált dinukleáris aromás szénhidrogénekből áll.] |
310-170-0 | 122070-79-5 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-040-00-3 | Extract oils (coal), coal tar residual pyrolysis oils, naphthalene oil, distn. residues; Redistillates; [Residue from the distillation of dephenolated and debased methylnaphthalene oil (from bituminous coal tar and pyrolysis residual oils) with a boiling range of 240°C to 260°C (464°F to 500°F). Composed primarily of substituted dinuclear aromatic and heterocyclic hydrocarbons.] | Extraktum
olajok (kőszén), kőszénkátrány-maradék pirolízis olajok, naftalinolaj, deszt.
maradékok; Redesztillátumok; [Fenol- és bázismentesített metilnaftalin olaj desztillációs távozó terméke (bitumenes kőszénkátrányból és pirolízis maradékolajokból), melynek forráspont tartománya 240 oC-tól 260 oC-ig (464 oF-tól 500 oF-ig) terjed. Elsősorban szubsztituált dinukleáris aromás és heterociklusos szénhidrogénekből áll.] |
310-171-6 | 122070-80-8 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-041-00-9 | Absorption oils, bicyclo arom. and heterocyclic hydrocarbon fraction; Wash Oil Redistillate; [A complex combination of hydrocarbons obtained as a redistillate from the distillation of wash oil. It consists predominantly of 2-ringed aromatic and heterocyclic hydrocarbons boiling in the range of approximately 260 °C to 290 °C (500 °F to 554 °F).] | Abszorpciós
olajok, biciklusos arom. és heterociklusos szénhidrogén frakció; Mosóolaj-redesztillátum; [Szénhidrogének összetett keveréke, a gázmosó olaj desztillációjának újradesztillált terméke. Főleg két gyűrűt tartalmazó aromás és heterociklusos szénhidrogéneket tartalmaz. Hozzávetőleges forráspont-tartomány: 260 oC-tól 290 oC-ig (500 oF-tól 554 oF-ig).] |
309-851-5 | 101316-45-4 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-042-00-4 | Distillates (coal tar), upper, fluorene-rich; Wash Oil Redistillate; [A complex combination of hydrocarbons obtained by the crystallization of tar oil. It consists af aromatic and polycyclic hydrocarbons primarily fluorene and some acenaphthene.] | Párlatok
(kőszénkátrány), felső, fluorénben gazdag; Mosóolaj-redesztillátum; [Kátrányolaj kristályosításával kapott összetett szénhidrogén keverék. Aromás és policiklikus szénhidrogéneket, főleg fluorént és némi acenaftént tartalmaz.] |
284-900-0 | 84989-11-7 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-043-00-X | Creosote oil, acenaphthene fraction, acenaphthene-free; Wash Oil Redistillate; [The oil remaining after removal by a crystallization process of acenaphthene from acenaphthene oil from coal tar. Composed primarily of naphthalene and alkylnaphthalenes.] | Kreozotolaj,
acenaftén-frakció, acenaftén-mentes; Mosóolaj-redesztillátum; [Az acenafténnak a kőszénkátrányban lévő acenaftén olajból kristályosodási folyamattal történő kivonásából fennmaradó olaj. Elsősorban naftalint és alkil-naftalinokat tartalmaz.] |
292-606-9 | 90640-85-0 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00/ATP01 | ||
| 648-044-00-5 | Distillates (coal tar), heavy oils; Heavy Anthracene Oil; [Distillate from the fractional distillation of coal tar of bituminous coal, with boiling range of 240 °C to 400 °C (464 °F to 752 °F). Composed primarily of tri- and polynuclear hydrocarbons and heterocyclic compounds.] | Párlatok (kőszénkátrány); Nehéz antracén olajok; [Bitumenes szén kőszénkátrány frakciójának frakcionált desztillációjával kapott frakció desztillációs terméke. Forráspont-tartomány: 240 oC-400 oC (464 oF-752 oF). Főleg trinukleáris és polinukleáris szénhidrogéneket és heterociklusos vegyületeket tartalmaz.] | 292-607-4 | 90640-86-1 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 648-045-00-0 | Distillates (coal tar), upper; Heavy Anthracene Oil; [The distillate from coal tar having an approximate distillation range of 220 °C to 450 °C (428 °F to 842 °F). Composed primarily of three to four membered condensed ring aromatic hydrocarbons and other hydrocarbons.] | Párlatok
(kőszénkátrány), felső, Nehéz antracén olaj; [Kőszénkátrányból desztillációval nyert termék. Forráspont-tartomány: 220 oC-450 oC (428 oF-842 oF). Főleg 3-4 tagú kondenzált gyűrűs aromás szénhidrogéneket és más szénhidrogénekből áll.] |
266-026-1 | 65996-91-0 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-046-00-6 | Anthracene oil, acid ext.; Anthracene Oil Extract Residue; [A complex combination of hydrocarbons from the base-freed fraction obtained from the distillation of coal tar and boiling in the range of approximately 325 °C to 365 °C (617 °F to 689 °F). It contains predominantly anthracene and phenanthrene and their alkyl derivatives.] | Antracén olaj, savas extr.; Antracén olaj extr. maradék; [Szénhidrogén keverék, kőszénkátrány desztillációjának bázismentesített frakciója. Forráspont-tartomány: 325 oC-365 oC (617 oF-689 oF). Főleg antracént, fenantrént és alkil származékaikat tartalmazza.] | 295-274-3 | 91995-14-1 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-047-00-1 | Distillates (coal tar); Heavy Anthracene Oil; [The distillate from coal tar having an approximate distillation range of 100 °C to 450 °C (212 °F to 842 °F). Composed primarily of two to four membered condensed ring aromatic hydrocarbons, phenolic compounds, and aromatic nitrogen bases.] | Párlatok
(kőszénkátrány), Nehéz antracén olaj; [Kőszénkátrányból desztillációval nyert termék. Forráspont-tartomány: 100 oC-450 oC (212 oF-842 oF). Főleg 2-4 tagú kondenzált aromás szénhidrogéneket, fenolos vegyületeket és aromás nitrogénbázisokat tartalmaz.] |
266-027-7 | 65996-92-1 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-048-00-7 | Distillates (coal tar), pitch, heavy oils; Heavy Anthracene Oil; [The distillate from the distillation of the pitch obtained from bituminous high temperature tar. Composed primarily of tri- and polynuclear aromatic hydrocarbons and boiling in the range of approximately 300 °C to 470 °C (572 °F to 878 °F). The product may also contain heteroatoms.] | Párlatok
(kőszénkátrány), szurok, nehézolajok; Nehéz antracén olajok; [Bitumenes „magas hőmérsékletű” kátrány desztillációjával kapott szurok desztillációs terméke. Főleg trinukleáris és polinukleáris aromás szénhidrogénekből áll. Forráspont-tartomány: 300 oC-470 oC (572 oF-878 oF). Tartalmazhat heteroatomokat is.] |
295-312-9 | 91995-51-6 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-049-00-2 | Distillates (coal tar), pitch; Heavy Anthracene Oil; [The oil obtained from condensation of the vapors from the heat treatment of pitch. Composed primarily of two- to four-ring aromatic compounds boiling in the range of 200 °C to greater than 400 °C (392 °F to greater than 752 °F).] | Párlatok
(kőszénkátrány), szurok, Nehéz antracén olaj; [Hővel kezelt szurok gőzeinek kondenzálásával kapott olaj. Főleg 2-4 tagú gyűrűs aromás szénhidrogénekből áll. Forráspont tartomány: 200 oC – >400 oC (392 oF – >752 oF).] |
309-855-7 | 101316-49-8 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-050-00-8 | Distillates (coal tar), heavy oils, pyrene fraction; Heavy Anthracene Oil Redistillate; [The redistillate obtained from the fractional distillation of pitch distillate boiling in the range of approximately 350 °C to 400 °C (662 °F to 752 °F). Consists predominantly of tri- and polynuclear aromatics and heterocyclic hydrocarbons.] | Párlatok
(kőszénkátrány), nehézolajok, pirén frakció; Nehéz antracén olaj redesztillátum; A szurok desztillátum frakcionált desztillációs termékének újradesztillált terméke. Forráspont-tartomány: 350 oC-400 oC (662 oF-752 oF). Főleg trinukleáris és polinukleáris aromás és heterociklusos szénhidrogénekből áll.] |
295-304-5 | 91995-42-5 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-051-00-3 | Distillates (coal tar), pitch, pyrene fraction; Heavy Anthracene Oil Redistillate; [The redistillate obtained from the fractional distillation of pitch distillate and boiling in the range of approximately 380 °C to 410 °C (716 to 770 °F). Composed primarily of tri- and polynuclear aromatic hydrocarbons and heterocyclic compounds.] | Párlatok
(kőszénkátrány), szurok, pirén frakció; Nehéz antracén olaj redesztillátum; A szurok desztillátum frakcionált desztillációs termékének újradesztillált terméke. Forráspont-tartomány: 380 oC-410 oC (716 oF-770 oF). Főleg trinukleáris és polinukleáris aromás szénhidrogéneket és heterociklusos vegyületeket tartalmaz.] |
295-313-4 | 91995-52-7 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-052-00-9 | Paraffin waxes (coal), brown-coal high-temp. tar, carbon-treated; Coal Tar Extract; [A complet combination of hydrocarbons obtained by the treatment of lignite carbonization tar with activated carbon for removal of trace constituents and impurities. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers predominantly greater than C12.] | Paraffin
viaszok (kőszén), barnaszén magas hőmérsékletű kátrány, aktívszénnel
kezelt; Szén kátrány extraktum; [Nyomokban jelenlevő összetevők és szennyezések eltávolítása céljából aktív szénnel kezelt kokszosított lignit kátrányból nyert összetett szénhidrogénkeverék. Főleg telített egyenes és elágazó láncú, jellemzően C12-nél nagyobb szénatomszámú szénhidrogénekből áll.] |
308-296-6 | 97926-76-6 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-053-00-4 | Paraffin waxes (coal), brown-coal high-temp tar, clay-treated; Coal Tar Extract; [A complex combination of hydrocarbons obtained by the treatment of lignite carbonization tar with bentonite for removal of trace constituents and impurities. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers predominantly greater than C12.] | Paraffin-viaszok
(szén), barnaszén magas hőmérsékletű kátrány, agyaggal kezelt; Szén kátrány
extraktum; [Nyomokban jelenlevő összetevők és szennyezések eltávolítása céljából bentonittal kezelt kokszosított lignit kátrányból nyert összetett szénhidrogénkeverék. Főleg telített egyenes és elágazó láncú, jellemzően C12-nél nagyobb szénatomszámú szénhidrogénekből áll.] |
308-297-1 | 97926-77-7 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-054-00-X | Pitch; Pitch | Szurok; Szurok | 263-072-4 | 61789-60-4 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-055-00-5 | pitch, coal tar, high-temp.,; [The residue from the distillation of high temperature coal tar. A black solid with an approximate softening point from 30 °C to 180 °C (86 °F to 356 °F). Composed primarily of a complex mixture of three or more membered condensed ring aromatic hydrocarbons.] | Szurok, kőszénkátrány, magas hőmérsékletű; [Magas hőmérsékletű kőszénkátrány desztillációs maradéka. Fekete szilárd anyag, melynek hozzávetőleges lágyulási hőmérséklete: 30 °C – 180 °C (86 °F – 356 °F). Főleg 3- vagy többtagú kondenzált gyűrűs aromás szénhidrogének összetett keveréke.] | 266-028-2 | 65996-93-2 | Carc.
1A Muta. 1B Repr. 1B |
H350 H340 H360FD |
GHS08 Dgr |
H340 H350 H360FD |
CLP00/ATP14 | |||
| 648-056-00-0 | Pitch, coal tar, high-temp., heat-treated; Pitch; [The heat treated residue from the distillation of high temperature coal tar. A black solid with an approximate softening point from 80 °C to 180 °C (176 °F to 356 °F). Composed primarily of a complex mixture of three or more membered condensed ring aromatic hydrocarbons.] | Szurok, szén kátrány, magas hőm., hőkezelt; Szurok; [„Magas hőmérsékletű” kőszénkátrány hőkezelt desztillációs maradéka. Fekete szilárd anyag, melynek hozzávetőleges lágyulási hőmérséklete: 80 oC-180 oC (176 oF-356 oF). Főleg 3- vagy többtagú kondenzált gyűrűs aromás szénhidrogének összetett keveréke.] | 310-162-7 | 121575-60-8 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-057-00-6 | Pitch, coal tar, high-temp., secondary; Pitch Redistillate; [The residue obtained during the distillation of high boiling fractions from bituminous coal high temperature tar and/or pitch coke oil, with a softening point of 140 °C to 170 °C (284 °F to 392 °F) according to DIN 52025. Composed primarily of tri- and polynuclear aromatic compounds which also contain heteroatoms.] | Szurok;
szén kátrány, magas hőm., másodlagos; Szurok redesztillátum; [Bitumenes szén „magas hőmérsékletű” kátrány frakciója és/vagy koksz olaj desztillációjakor kapott magas forráspontú frakció desztillációs maradéka, melynek DIN 52025 szerinti lágyulási hőmérséklete: 140 oC-170 oC (284 oF-392 oF). Főleg trinukleáris és polinukleáris, heteroatomot is tartalmazó aromás vegyületekből áll.] |
302-650-3 | 94114-13-3 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-058-00-1 | Residues (coal tar), pitch distn.; Pitch Redistillate; [Residue from the fractional distillation of pitch distillate boiling in the range of approximately 400 °C to 470 °C (752 °F to 846 °F). Composed primarily of polynuclear aromatic hydrocarbons, and heterocyclic compounds.] | Maradékok
(kőszénkátrány), szurok deszt.; Szurok redesztillátum; [Szurok desztillátum frakcionált desztillációs maradéka, melynek hozzávetőleges forráspont-tartománya: 400 oC-470 oC (752 oF-846 oF). Főleg polinukleáris aromás szénhidrogéneket és heterociklusos vegyületeket tartalmaz.] |
295-507-9 | 92061-94-4 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-059-00-7 | Tar, coal, high-temp., distn. and storage residues; Coal Tar Solids Residue; [Coke- and ash-containing solid residues that separate on distillation and thermal treatment of bituminous coal high temperature tar in distillation installations and storage vessels. Consists predominantly of carbon and contains a small quantity of hetero compounds as well as ash components.] | Kátrány,
szén, magas hőmérsékletű, deszt. és tárolási maradékok; Kőszénkátrány szilárd maradék; [Koksz- és hamutartalmú szilárd maradék, amely a bitumenes szén „magas hőmérsékletű” kátrányfrakció desztillációjának és hőkezelésének hatására válik el lepárlóüzemekben és tárolótartályokban. Főleg szenet, kis mennyiségű heterovegyületet, valamint hamu összetevőket tartalmaz.] |
295-535-1 | 92062-20-9 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-060-00-2 | Tar, coal, storage residues; Coal Tar Solids Residue; [The deposit removed from crude coal tar storages. Composed primarily of coal tar and carbonaceous particulate matter.] | Kőszénkátrány;
tárolási maradékok; Kőszénkátrány szilárd maradék; [A nyers kőszénkátrány tárolókból eltávolított üledék. Főleg kőszénkátrányt és széntartalmú szemcsés anyagot tartalmaz.] |
293-764-1 | 91082-50-7 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-061-00-8 | Tar, coal, high-temp., residues; Coal Tar Solids Residue; [Solids formed during the coking of bituminous coal to produce crude bituminous coal high temperature tar. Composed primarily of coke and coal particles, highly aromatized compounds and mineral substances.] | Kőszénkátrány;
magas hőm., maradékok; Kőszénkátrány szilárd maradék; [A bitumenes szén kokszolása folyamán keletkezett szilárd nyers bitumenes kőszén „magas hőmérsékletű” kátrány. Főleg kokszot, szénszemcséket, aromás vegyületeket és ásványi anyagokat tartalmaz.] |
309-726-5 | 100684-51-3 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-062-00-3 | Tar, coal, high-temp., high-solids; Coal Tar Solids Residue; [The condensation product obtained by cooling, to approximately ambient temperature, the gas evolved in the high temperature (greater than 700 °C (1292 °F)) destructive distillation of coal. Composed primarily of a complex mixture of condensed ring aromatic hydrocarbons with a high solid content of coal-type materials.] | Kőszénkátrány;
magas hőm., szilárd; Kőszénkátrány szilárd maradék; [Kondenzációs termék, a szén magas hőmérsékletű, 700 oC (1292 oF) feletti krakkoló desztillációjával kapott gáz hozzávetőlegesen szobahőmérsékletre hűtött terméke. Főleg kondenzált gyűrűs aromás szénhidrogének összetett keverékéből áll, magas szilárd szén és koksz tartalommal.] |
273-615-7 | 68990-61-4 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-063-00-9 | Waste solids, coal-tar pitch coking; Coal Tar Solids Residue; [The combination of wastes formed by the coking of bituminous coal tar pitch. It consists predominantly of carbon.] | Hulladék
szilárd anyagok; kőszénkátrány szurok kokszosítás; Kőszénkátrány szilárd maradék; [Bitumenes kőszénkátrány szurok kokszosításával kapott hulladékok keveréke. Főleg szenet tartalmaz.] |
295-549-8 | 92062-34-5 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-064-00-4 | Extract residues (coal), brown; Coal Tar Extract; [The residue from extraction of dried coal.] | Extrakciós
maradékok (barnaszén), Kőszén kátrány extr.; [A szárított barnaszén toluolos extrahálásának maradéka.] |
294-285-0 | 91697-23-3 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-065-00-X | Paraffin waxes (coal), brown-coal-high-temp. tar; Coal Tar Extract; [A complex combination of hydrocarbons obtained from lignite carbonization tar by solvent crystallisation (solvent deoiling), by sweating or an adducting process. It consists predominantly of straight and branched chain saturated hydrocarbons having carbon numbers predominantly greater than C12.] | Paraffinviaszok
(kőszén); barnaszén magas hőfokú kátrány; Kőszénkátrány extr.; [Kokszosított lignit kátrányból kristályosítással (oldószeres olajmentesítéssel), kicsapással vagy addukt hozzáadásával kapott anyag. Főleg telített egyenes és elágazó láncú, jellemzően C12-nél nagyobb szénatomszámú szénhidrogénekből áll.] |
295-454-1 | 92045-71-1 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-066-00-5 | Paraffin waxes (coal), brown-coal-high-temp. tar, hydrotreated; Coal Tar Extract; [A complex combination of hydrocarbons obtained from lignite carbonization tar by solvent crystallisation (solvent deoiling), by sweating or an adducting process treated with hydrogen in the presence of a catalyst. It consists predominantly of straight and branched chain saturated hydrocarbons having carbon numbers predominantly greater than C12.] | Paraffinviaszok
(kőszén), barnaszén magas hőmérsékletű kátrány, hidrogénnel kezelt; Kőszénkátrány extraktum; [Kokszosított lignit kátrányból kristályosítással (oldószeres olajmentesítéssel), kicsapással vagy addukt hozzáadásával kapott anyag katalitikus hidrogénezésének terméke. Főleg egyenes és elágazó láncú, jellemzően C12-nél nagyobb szénatomszámú telített szénhidrogénekből áll.] |
295-455-7 | 92045-72-2 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-067-00-0 | Paraffin waxes (coal), brown-coal high-temp tar, silicic acid-treated; Coal Tar Extract; [A complex combination of hydrocarbons obtained by the treatment of lignite carbonization tar with silicic acid for removal of trace constituents and impurities. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers predominantly greater than C12.] | Paraffinviaszok
(kőszén); barnaszén magas hőfokú kátrány, kovasavval kezelt; Kőszénkátrány extraktum; [Nyomokban jelenlevő összetevők és szennyezések eltávolítása céljából kovasavval kezelt kokszosított lignit kátrányból nyert összetett szénhidrogénkeverék. Főleg telített egyenes és elágazó láncú, jellemzően C12-nél nagyobb szénatomszámú szénhidrogénekből áll.] |
308-298-7 | 97926-78-8 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-068-00-6 | Tar, coal, low-temp., distn. residues; Tar Oil, intermediate boiling; [Residues from fractional distillation of low temperature coal tar to remove oils that boil in a range up to approximately 300 °C (572 °F). Composed primarily of aromatic compounds.] | Kőszénkátrány,
alacsony hőm., deszt. maradékok; Kátrány olaj; [Alacsony hőfokú kőszénkátrány frakcionált desztillációjának maradéka, ahol a desztilláció a hozzávetőleg 300 oC (572 oF) alatt forró olajok eltávolítását célozta. Főleg aromás vegyületeket tartalmaz.] |
309-887-1 | 101316-85-2 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-069-00-1 | Pitch, coal tar, low-temp; Pitch Residue; [A complex black solid or semi-solid obtained from the distillation of a low temperature coal tar. It has a softening point within the approximate range of 40 °C to 180 °C (104 °F to 356 °F). Composed primarily of a complex mixture of hydrocarbons.] | Kőszénkátrány
szurok; alacsony hőm.; Szurok maradék; [Alacsony hőfokú kőszénkátrány desztillációjánál kapott fekete, szilárd vagy félszilárd termék. Hozzávetőleges lágyuláspont-tartomány: 40 oC-180 oC (104 oF-356 oF). Elsősorban szénhidrogének összetett elegyéből áll.] |
292-651-4 | 90669-57-1 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-070-00-7 | Pitch, coal tar, low-temp., oxidized; Pitch Residue, oxidised; [The product obtained by air-blowing, at elevated temperature, low-temperature coal tar pitch. It has a softening-point within the approximate range of 70 °C to 180 °C (158 °F to 356 °F). Composed primarily of a complex mixture of hydrocarbons.] | Kőszénkátrány
szurok; alacsony hőm., oxidált; Szurok maradék, oxidált; [Alacsony hőfokú kőszénkátrány szurok magas hőmérsékleten levegővel átfúvatott (oxidált) terméke. Hozzávetőleges lágyuláspont-tartomány: 70 oC-180 oC (158 oF-356 oF). Elsősorban szénhidrogének összetett elegyéből áll.] |
292-654-0 | 90669-59-3 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-071-00-2 | Pitch, coal tar, low-temp., heat-treated; Pitch Residue, oxidised; Pitch Residue, heat-treated; [A complex black solid obtained by the heat treatment of low temperature coal tar pitch. It has a softening point within the approximate range of 50 °C to 140 °C (122 °F to 284 °F). Composed primarily of a complex mixture of aromatic compounds.] | Kőszénkátrány
szurok; alacsony hőm., hővel kezelt; Szurok maradék, oxidált; Szurok maradék, hővel kezelt; [Alacsony hőfokú kőszénkátrány szurok hővel kezelt fekete, szilárd terméke. Hozzávetőleges lágyuláspont-tartomány: 50 oC-140 oC (122 oF-284 oF). Elsősorban aromás vegyületek összetett elegyéből áll.] |
292-653-5 | 90669-58-2 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-072-00-8 | Distillates (coal-petroleum), condensed-ring arom; Distillates; [The distillate from a mixture of coal and tar and aromatic petroleum streams having an approximate distillation range of 220 °C to 450 °C (428 °F to 842 °F). Composed primarily of 3- to 4-membered condensed ring aromatic hydrocarbons.] | Párlatok
(kőszén-ásványolaj); kondenzált gyűrűs, aromás; Párlatok; [Kőszénkátrány és aromás ásványolaj származékok keverékének desztillátuma, melynek hozzávetőleges desztillációs tartománya 220 oC-tól 450 oC-ig (428 oF-tól 842 oF-ig) terjed. Elsősorban 3-4 gyűrűs kondenzált aromás szénhidrogénekből áll.] |
269-159-3 | 68188-48-7 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-073-00-3 | Aromatic hydrocarbons, C20-28, polycyclic, mixed coal-tar pitch-polyethylene-polypropylene pyrolysis-derived; Pyrolysis Products; [A complex combination hydrocarbons obtained from mixed coal tar pitch-polyethylene-polypropylene pyrolysis. Composed primarily of polycyclic aromatic hydrocarbons having carbon numbers predominantly in the range of C20 through C28 and having a softening point of 100 °C to 220 °C (212 °F to 428 °F) according to DIN 52025.] | Aromás
szénhidrogének, C20-28, policiklusos, kőszénkátrány
szurok-polietilén-polipropilén keverék pirolízis terméke; Pirolízis
termékek [Kőszénkátrány-szurok-polietilén-polipropilén keverék pirolíziséből nyert összetett szénhidrogénkeverék. Elsősorban C20–28 szénatomszámú, policiklusos aromás szénhidrogénekből áll; DIN 52025 szerint mért lágyuláspont-tartománya: 100 oC-220 oC (212 oF-428 oF).]; |
309-956-6 | 101794-74-5 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-074-00-9 | Aromatic hydrocarbons, C20-28, polycyclic, mixed coal-tar pitch-polyethylene pyrolysis-derived; Pyrolysis Products; [A complex combination of hydrocarbons obtained from mixed coal tar pitch-polyethylene pyrolysis. Composed primarily of polycyclic aromatic hydrocarbons having carbon numbers predominantly in the range of C20 through C28 and having a softening point of 100 °C to 220 °C (212 °F to 428 °F) according to DIN 52025.] | Aromás
policiklusos szénhidrogének, C20-28, kőszénkátrány szurok-polietilén keverék
pirolízis terméke; Pirolízis termékek; [Kőszénkátrány-szurok-polietilén keverék pirolíziséből nyert összetett szénhidrogénkeverék. Elsősorban C20-C28 szénatomszámú, policiklusos aromás szénhidrogénekből áll; DIN 52025 szerint mért lágyuláspont-tartománya: 100 oC-220 oC (212 oF-428 oF).] |
309-957-1 | 101794-75-6 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-075-00-4 | Aromatic hydrocarbons, C20-28, polycyclic, mixed coal-tar pitch-polystyrene pyrolysis-derived; Pyrolysis Products; [A complex combination of hydrocarbons obtained from mixed coal tar pitch-polystyrene pyrolysis. Composed primarily of polycyclic aromatic hydrocarbons having carbon numbers predominantly in the range of C20 through C28 and having a softening point of 100 °C to 220 °C (212 °F to 428 °F) according to DIN 52025.] | Aromás
policiklusos szénhidrogének, C20-28, kőszénkátrány szurok-polisztirol keverék
pirolízis terméke; Pirolízis termékek; [Kőszénkátrány-szurok-polisztirol keverék pirolíziséből nyert összetett szénhidrogénkeverék. Elsősorban C20-C28 szénatomszámú, policiklusos aromás szénhidrogénekből áll; DIN 52025 szerint mért lágyuláspont-tartománya: 100 oC-220 oC (212 oF-428 oF).] |
309-958-7 | 101794-76-7 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-076-00-X | Pitch, coal tar-petroleum; Pitch Residues; [The residue from the distillation of a mixture of coal tar and aromatic petroleum streams. A solid with a softening point from 40 °C to 180 °C (140 °F to 356 °F). Composed primarily of a complex combination of three or more membered condensed ring aromatic hydrocarbons.] | Kőszénkátrány-ásványolaj
szurok; Szurok maradékok; [Kőszénkátrány és aromás ásványolaj-származékok keverékének desztillációs maradéka. Szilárd anyag, melynek lágyulási hőmérséklete: 40 oC-180 oC (140 oF-356 oF). Főleg 3- vagy többtagú kondenzált gyűrűs aromás szénhidrogének összetett keveréke.] |
269-109-0 | 68187-57-5 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-077-00-5 | Phenanthrene, distn. residues; Heavy Anthracene Oil Redistillate; [Residue from the distillation of crude phenanthrene boiling in the approximate range of 340 °C to 420 °C (644 °F to 788 °F). It consists predominantly of phenanthrene, anthracene and carbazole.] | Fenantrén,
deszt. maradékok; Nehéz antracénolaj redesztillátum; [Nyers fenantrén desztillációs maradéka, melynek hozzávetőleges forráspont-tartománya: 340 oC-420 oC (644 oF-788 oF). Főleg fenantrént, antracént és karbazolt tartalmaz.] |
310-169-5 | 122070-78-4 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-078-00-0 | Distillates (coal tar), upper, fluorene-free; Wash Oil Redistillate; [A complex combination of hydrocarbons obtained by the crystallization of tar oil. It consists of aromatic polycyclic hydrocarbons, primarily diphenyl, dibenzofuran and acenaphthene.] | Párlatok
(kőszénkátrány), felső, fluorén mentes; Mosóolaj-redesztillátum; [Kátrányolaj kristályosításával kapott összetett szénhidrogén keverék. Aromás policiklusos szénhidrogénekből, elsősorban difenilből, dibenzofuránból és acenafténből áll.] |
284-899-7 | 84989-10-6 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-079-00-6 | Anthracene oil; [A complex combination of polycyclic aromatic hydrocarbons obtained from coal tar having an approximate distillation range of 300 °C to 400 °C (572 °F to 752 °F). Composed primarily of phenanthrene, anthracene and carbazole.] | Antracénolaj;
Antracénolaj; [Kőszénkátrányból nyert policiklusos aromás szénhidrogének összetett keveréke, melynek hozzávetőleges desztillációs tartománya: 300 oC-400 oC (572 oF-752 oF). Elsősorban fenantrént, antracént és karbazolt tartalmaz.] |
292-602-7 | 90640-80-5 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-080-00-1 | Residues (coal tar), creosote oil distn.; Wash Oil Redistillate; [The residue from the fractional distillation of wash oil boiling in the approximate range of 270°C to 330°C (518°F to 626°F). It consists predominantly of dinuclear aromatic and heterocyclic hydrocarbons.] | Maradékanyagok
(kőszénkátrány), kreozotolaj deszt.; Mosóolaj-redesztillátum; [Mosóolaj frakcionált desztillációjának maradéka, melynek hozzávetőleges forráspontja: 270 oC-330 oC (518 oF-626 oF). Főleg dinukleáris aromás és heterociklusos szénhidrogénekből áll.] |
295-506-3 | 92061-93-3 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00/ATP01 | ||
| 648-081-00-7 | Tar, coal; Coal tar; [The by-product from the destructive distillation of coal. Almost black semisolid. A complex combination of aromatic hydro-carbons, phenolic compounds, nitrogen bases and thiophene.] | Kőszénkátrány;
Kőszénkátrány; [A kőszén krakkoló desztillációjának mellékterméke. Majdnem fekete, félszilárd anyag. Aromás szénhidrogéneket, fenolvegyületeket, nitrogén bázisokat és tiofént tartalmazó összetett keverék.] |
232-361-7 | 8007-45-2 | Carc.
1A |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 648-082-00-2 | Tar, coal, high-temp.; Coal tar; [The condensation product obtained by cooling, to approximately ambient temperature, the gas evolved in the high temperature (greater than 700 °C (1292 °F)) destructive distillation of coal. A black viscous liquid denser than water. Composed primarily of a complex mixture of condensed ring aromatic hydrocarbons. May contain minor amounts of phenolic compounds and aromatic nitrogen bases.] | Kőszénkátrány, magas hőm.; Kőszénkátrány; [Kondenzációs termék, a szén magas hőmérsékletű, 700 oC (1292 oF) feletti krakkoló desztillációjával kapott gáz hozzávetőlegesen szobahőmérsékletre hűtött terméke. Víznél sűrűbb, fekete viszkózus folyadék. Főleg kondenzált gyűrűs aromás szénhidrogének összetett keveréke. Tartalmazhat még kis mennyiségben fenolvegyületeket és aromás nitrogén bázisokat is.] | 266-024-0 | 65996-89-6 | Carc.
1A |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 648-083-00-8 | Tar, coal, low-temp.; Coal oil; [The condensation product obtained by cooling, to approximately ambient temperature, the gas evolved in low temperature (less than 700 °C (1292 °F)) destructive distillation of coal. A black viscous liquid denser than water. Composed primarily of condensed ring aromatic hydrocarbons, phenolic compounds, aromatic nitrogen bases, and their alkyl derivatives.] | Kőszénkátrány,
alacsony hőm.; Párlatok (kőszén); [Kondenzációs termék, a szén alacsony hőmérsékletű, 700 oC (1292 oF) alatti krakkoló desztillációjával kapott gáz hozzávetőlegesen szobahőmérsékletre hűtött terméke. Víznél sűrűbb, fekete viszkózus folyadék. Főleg kondenzált gyűrűs aromás szénhidrogénekből, fenolvegyületekből, szerves nitrogén bázisokból és ezek alkil származékaiból áll.] |
266-025-6 | 65996-90-9 | Carc.
1A |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 648-084-00-3 | Distillates (coal), coke-oven light oil, naphthalene cut; Naphthalene Oil; [The complex combination of hydrocarbons obtained from prefractionation (continuous distillation) of coke oven light oil. It consists predominantly of naphthalene, coumarone and indene and boils above 148°C (298°F).] | Párlatok
(kőszén), kokszolókemence könnyűolaj, naftalin párlat; Naftalinolaj; [Kokszolókemence könnyűolaj előfrakcionálásából (folyamatos desztillálással) nyert szénhidrogének összetett keveréke. Főleg naftalinból, kumaronból és indénből áll, forráspontja 148 oC fölött (298 oF) van.] |
285-076-5 | 85029-51-2 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-085-00-9 | Distillates (coal tar), naphthalene oils; Naphthalene Oil; [A complex combination of hydrocarbons obtained by the distillation of coal tar. It consists primarily of aromatic and other hydrocarbons, phenolic compounds and aromatic nitrogen compounds and distills in the approximate range of 200°C to 250°C (392°F to 482°F).] | Párlatok
(kőszénkátrány), naftalinolajok; Naftalinolaj; [A kőszénkátrány desztillációjából származó szénhidrogének összetett keveréke. Elsősorban aromás és egyéb szénhidrogénekből, fenolvegyületekből és aromás nitrogénvegyületekből áll, forráspont tartománya kb. 200 oC-tól 250 oC-ig (392 oF-tól 482 oF-ig) terjed.] |
283-484-8 | 84650-04-4 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-086-00-4 | Distillates (coal tar), naphthalene oils, naphthalene-low; Naphthalene Oil Redistillate; [A complex combination of hydrocarbons obtained by crystallization of naphthalene oil. Composed primarily of naphthalene, alkyl naphthalenes and phenolic compounds.] | Párlatok (kőszénkátrány), naftalinolajok, naftalinban szegény; Naftalinolaj redesztillátum; [Naftalinolaj kristályosításával előállított összetett szénhidrogén keverék. Elsősorban naftalinból, alkil-naftalinokból és fenolvegyületekből áll.] | 284-898-1 | 84989-09-3 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-087-00-X | Distillates (coal tar), naphthalene oil crystn. mother liquor; Naphthalene Oil Redistillate; [A complex combination of organic compounds obtained as a filtrate from the crystallization of the naphthalene fraction from coal tar and boiling in the range of approximately 200°C to 230°C (392°F to 446°F). Contains chiefly naphthalene, thionaphthene and alkylnaphthalenes.] | Párlatok
(kőszénkátrány), naftalinolaj kristályosítás anyalúgja; Naftalinolaj
redesztillátum; [Kőszénkátrány naftalin frakciójának kristályosításából szűrletként nyert szerves vegyületek összetett keveréke, melynek forráspont-tartománya hozzávetőleg 200 oC-tól 230 oC-ig (392 oF-tól 446 oF-ig) terjed. Főleg naftalinból, tionafténből és alkil-naftalinokból áll.] |
295-310-8 | 91995-49-2 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-088-00-5 | Extract residues (coal), naphthalene oil, alk.; Naphthalene Oil Extract Residue; [A complex combination of hydrocarbons obtained from the alkali washing of naphthalene oil to remove phenolic compounds (tar acids). It is composed of naphthalene and alkyl naphthalenes.] | Extrakciós
maradékok (kőszén), naftalinolaj, lúgos; Naftalinolaj extrakciós
maradéka; [Szénhidrogének összetett keveréke, melyet naftalinolajból a fenolvegyületek (kátránysavak) eltávolítása céljából végzett lúgos mosással nyernek. Naftalinból és alkil-naftalinokból áll.] |
310-166-9 | 121620-47-1 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-089-00-0 | Extract residues (coal), naphthalene oil, alk., naphthalene-low; Naphthalene Oil Extract Residue; [A complex combination of hydrocarbons remaining after the removal of naphthalene from alkali-washed naphthalene oil by a crystallization process. It is composed primarily of naphthalene and alkyl naphthalenes.] | Extrakciós
maradékok (kőszén), naftalinolaj, lúgos, naftalinban szegény; Naftalinolaj extrakciós maradék; [Szénhidrogének összetett keveréke, mely a lúggal mosott naftalinolajból a naftalinnak kristályosítással történő eltávolítása után marad vissza. Elsősorban naftalinból és alkil-naftalinokból áll.] |
310-167-4 | 121620-48-2 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-090-00-6 | Distillates (coal tar), naphthalene oils, naphthalene-free, alk. exts.; Naphthalene Oil Extract Residue; [The oil remaining after the removal of phenolic compounds (tar acids) from drained naphthalene oil by an alkali wash. Composed primarily of naphthalene and alkyl naphthalenes.] | Párlatok
(kőszénkátrány), naftalinolajok, naftalinmentes, lúgos extr.; Naftalinolaj extrakciós maradék; [A fenolvegyületek (kátránysavak) szikkasztott naftalinolajból lúgos mosással történő eltávolítása után visszamaradó olaj. Főleg naftalinból és alkil-naftalinokból áll.] |
292-612-1 | 90640-90-7 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-091-00-1 | Extract residues (coal), naphthalene oil alk., distn. overheads; Naphthalene Oil Extract Residue; [The distillate from alkali-washed naphthalene oil having an approximate distillation range of 180°C to 220°C (356°F to 428°F). Composed primarily of naphthalene, alkylbenzenes, indene and indan.] | Extrakciós
maradékok (kőszén), naftalinolaj lúgos, deszt. fejtermékek; Naftalinolaj extrakciós maradék; [Lúggal mosott naftalinolaj desztillátuma, melynek desztillációs tartománya kb. 180 oC-tól 220 oC-ig (356 oF-tól 428 oF-ig) terjed. Főleg naftalinból, alkilbenzolokból, indénből és indánból áll.] |
292-627-3 | 90641-04-6 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-092-00-7 | Distillates (coal tar), naphthalene oils, methylnaphthalene fraction; Methylnaphthalene Oil; [A distillate from the fractional distillation of high temperature coal tar. Composed primarily of substituted two ring aromatic hydrocarbons and aromatic nitrogen bases boiling in the range of approximately 225°C to 255°C (437°F to 491°F).] | Párlatok
(kőszénkátrány), naftalinolajok, metilnaftalin frakció; Metilnaftalin olaj; [A magas hőmérsékletű kőszénkátrány frakcionált desztillációjából származó párlat. Elsősorban szubsztituált kétgyűrűs aromás szénhidrogénekből és aromás nitrogénbázisokból áll, és hozzávetőleg a 225 oC-tól 255 oC-ig (437 oF-tól 491 oF-ig) terjedő tartományban forr.] |
309-985-4 | 101896-27-9 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-093-00-2 | Distillates (coal tar), naphthalene oils, indole-methylnaphthalene fraction; Methylnaphthalene Oil; [A distillate from the fractional distillation of high temperature coal tar. Composed primarily of indole and methylnaphthalene boiling in the range of approximately 235°C to 255°C (455°F to 491°F).] | Párlatok
(kőszénkátrány), naftalinolajok, indol-metilnaftalin frakció; Metilnaftalin
olaj; [A magas hőmérsékletű kőszénkátrány frakcionált desztillációjából származó párlat. Elsősorban indolból és metil-naftalinból áll, és hozzávetőleg a 235 oC-tól 255 oC-ig (455 oF-tól 491 oF-ig) terjedő tartományban forr.] |
309-972-3 | 101794-91-6 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-094-00-8 | Distillates (coal tar), naphthalene oils, acid exts.; Methylnaphthalene Oil Extract Residue; [A complex combination of hydrocarbons obtained by debasing the methylnaphthalene fraction obtained by the distillation of coal tar and boiling in the range of approximately 230°C to 255°C (446°F to 491°F). Contains chiefly 1(2)-methylnaphthalene, naphthalene, dimethylnaphthalene and biphenyl.] | Párlatok
(kőszénkátrány), naftalinolajok, savas extr.; Metilnaftalin olaj extrakciós
maradék; [Szénhidrogének összetett keveréke, melyet kőszénkátrány desztillációjával nyert metilnaftalin frakció bázismentesítésével állítanak elő; forráspont-tartománya hozzávetőleg 230 oC-tól 255 oC-ig (446 oF-tól 491 oF-ig) terjed. Főleg 1(2)-metilnaftalinból, naftalinból, dimetil-naftalinból és difenilből áll.] |
295-309-2 | 91995-48-1 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-095-00-3 | Extract residues (coal), naphthalene oil alk., distn. residues; Methylnaphthalene Oil Extract Residue; [The residue from the distillation of alkali-washed naphthalene oil having an approximate distillation range of 220°C to 300°C (428°F to 572°F). Composed primarily of naphthalene, alkylnaphthalenes and aromatic nitrogen bases.] | Extrakciós
maradékok (kőszén), naftalinolaj, lúgos, deszt. maradékok; Metilnaftalin olaj
extrakciós maradéka; [Lúggal mosott naftalinolaj desztillációs maradéka, melynek desztillációs tartománya kb. 220 oC-tól 300 oC-ig (428 oF-tól 572 oF-ig) terjed. Elsősorban naftalinból, alkil-naftalinokból és aromás nitrogénbázisokból áll.] |
292-628-9 | 90641-05-7 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-096-00-9 | Extract oils (coal), acidic, tar-base free; Methylnaphthalene Oil Extract Residue; [The extract oil boiling in the range of approximately 220°C to 265°C (428°F to 509°F) from coal tar alkaline extract residue produced by an acidic wash such as aqueous sulfuric acid after distillation to remove tar bases. Composed primarily of alkylnaphthalenes.] | Extraktumolajok
(kőszén), savas, kátrány-bázis mentes; Metilnaftalin olaj extrakciós maradék; [Kőszénkátrány lúgos extrakciós maradékából a desztilláció után a kátrány-bázisok eltávolítása céljából savval, pl. kénsav vizes oldatával végzett mosással nyert extraktumolaj, mely hozzávetőleg a 220 oC-tól 265 oC-ig (428 oF-tól 509 oF-ig) terjedő tartományban forr. Főleg alkil-naftalinokból áll.] |
284-901-6 | 84989-12-8 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-097-00-4 | Distillates (coal tar), benzole fraction, distn. residues; Wash Oil; [A complex combination of hydrocarbons obtained from the distillation of crude benzole (high temperature coal tar). It may be a liquid with the approximate distillation range of 150°C to 300°C (302°F to 572°F) or a semi-solid or solid with a melting point up to 70°C (158°F). It is composed primarily of naphthalene and alkyl naphthalenes.] | Párlatok
(kőszénkátrány), benzol frakció, deszt. maradékok; Mosóolaj; [Szénhidrogének összetett keveréke, melyet nyersbenzol (magas hőmérsékletű kőszénkátrány) desztillációjával nyernek. Lehet folyékony, kb. 150 oC-tól 300 oC-ig (302 oF-tól 572 oF-ig) terjedő forráspont-tartománnyal, ill. félszilárd vagy szilárd, legfeljebb 70 oC-os (158 oF-os) olvadásponttal. Elsősorban naftalinból és alkil-naftalinokból áll.] |
310-165-3 | 121620-46-0 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-098-00-X | Creosote oil, acenaphthene fraction; Wash Oil; [A complex combination of hydrocarbons produced by the distillation of coal tar and boiling in the range of approximately 240°C to 280°C (464°F to 536°F). Composed primarily of acenaphthene, naphthalene and alkyl naphthalene.] | Kreozotolaj,
acenaftén frakció; Mosóolaj; [Kőszénkátrány desztillációjából származó szénhidrogének összetett keveréke, melynek forráspont-tartománya hozzávetőleg 240 oC-280 oC (464 oF-536 oF). Főleg acenaftént, naftalint és alkil–naftalint tartalmaz.] |
292-605-3 | 90640-84-9 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00/ATP01 | ||
| 648-099-00-5 | Creosote oil; [A complex combination of hydrocarbons obtained by the distillation of coal tar. It consists primarily of aromatic hydrocarbons and may contain appreciable quantities of tar acids and tar bases. It distills at the approximate range of 200°C to 325°C (392°F to 617°F).] | Kreozotolaj; [A kőszénkátrány desztillációjából származó szénhidrogének összetett keveréke. Főként aromás szénhidrogénekből áll, és esetlegesen jelentős mennyiségű kátránysavat és kátránybázist tartalmazhat. Hozzávetőleges desztillációs tartománya: 200 oC-325 oC (392oF-617oF).] |
263-047-8 | 61789-28-4 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00/ATP01 | ||
| 648-100-00-9 | Creosote oil, high-boiling distillate; Wash Oil; [The high-boiling distillation fraction obtained from the high temperature carbonization of bituminous coal which is further refined to remove excess crystalline salts. It consists primarily of creosote oil with some of the normal polynuclear aromatic salts, which are components of coal tar distillates, removed. It is crystal free at approximately 5°C (41°F).] | Kreozotolaj,
magas forráspontú párlat; Mosóolaj; [A kőszénkátrány magas hőfokon végzett karbonizációjából nyert magas forráspontú desztillációs frakció, amely további finomításra kerül a felesleges kristályos sók eltávolítása céljából. Elsősorban kreozotolajat tartalmaz, melyből eltávolításra kerül a kőszénkátrány-párlatokban jelen lévő normál polinukleáris aromás sók egy része. Hozzávetőleg 5 oC-on (41 oF) kristálymentes.) |
274-565-9 | 70321-79-8 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00/ATP01 | ||
| 648-101-00-4 | Creosote; [The distillate of coal tar produced by the high temperature carbonization of bituminous coal. It consists primarily of aromatic hydrocarbons, tar acids and tar bases.] | Kreozot; [Bitumenes szén magas hőmérsékletű kokszosításával kapott kőszénkátrány párlat. Főként aromás szénhidrogénekből, kátránysavakból és kátránybázisokból áll. |
232-287-5 | 8001-58-9 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 648-102-00-X | Extract residues (coal), creosote oil acid; Wash Oil Extract Residue; [A complex combination of hydrocarbons from the base-freed fraction from the distillation of coal tar, boiling in the range of approximately 250°C to 280°C (482°F to 536°F). It consists predominantly of biphenyl and isomeric diphenylnaphthalenes.] | Extrakciós
maradékok (szén), kreozotolajsav; mosóolaj extrakciós maradék; [Kőszénkátrány desztillációjának bázismentes frakciójából kapott szénhidrogének összetett keveréke, melynek hozzávetőleges forráspont-tartománya: 250 oC-280 oC (482 oF-536 oF). Döntően difenilből és izomer difenilnaftalinokból áll.] |
310-189-4 | 122384-77-4 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00/ATP01 | ||
| 648-103-00-5 | Anthracene oil, anthracene paste; Anthracene Oil Fraction; [The anthracene-rich solid obtained by the crystallization and centrifuging of anthracene oil. It is composed primarily of anthracene, carbazole and phenanthrene.] | Antracénolaj,
antracénpaszta; Antracénolaj frakció; [Antracénben gazdag szilárd anyag, melyet antracénolaj kristályosításával és centrifugálásával állítanak elő. Főleg antracénből, karbazolból és fenantrénből áll.] |
292-603-2 | 90640-81-6 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-104-00-0 | Anthracene oil, anthracene-low; Anthracene Oil Fraction; [The oil remaining after the removal, by a crystallization process, of an anthracene-rich solid (anthracene paste) from anthracene oil. It is composed primarily of two, three and four membered aromatic compounds.] | Antracénolaj,
antracénpaszta; Antracénolaj frakció; [Antracénolajból egy antracénben gazdag szilárd anyag (antracénpaszta) kristályosítással történő eltávolítása után visszamaradó olaj. Elsősorban két-, három- és négytagú aromás vegyületekből áll.] |
292-604-8 | 90640-82-7 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-105-00-6 | Residues (coal tar), anthracene oil distn.; Anthracene Oil Fraction; [The residue from the fraction distillation of crude anthracene boiling in the approximate range of 340°C to 400°C (644°F to 752°F). It consists predominantly of tri- and polynuclear aromatic and heterocyclic hydrocarbons.] | maradékanyagok
(kőszénkátrány), antracénolaj deszt.; Antracénolaj frakció; [Nyers antracén frakcionált desztillációjának maradéka, mely hozzávetőleg a 340 oC-tól 400 oC-ig (644 oF-tól 752 oF-ig) terjedő tartományban forr. Túlnyomórészt tri- és polinukleáris aromás és heterociklusos szénhidrogénekből áll.] |
295-505-8 | 92061-92-2 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-106-00-1 | Anthracene oil, anthracene paste, anthracene fraction; Anthracene Oil Fraction; [A complex combination of hydrocarbons from the distillation of anthracene obtained by the crystallization of anthracene oil from bituminous high temperature tar and boiling in the range of 330°C to 350°C (626°F to 662°F). It contains chiefly anthracene, carbazole and phenanthrene.] | Antracénolaj,
antracénpaszta, antracén frakció; Antracénolaj frakció; [Bitumenes magas hőmérsékletű kátrányból nyert antracénolaj kristályosításával előállított antracén desztillációjából származó szénhidrogének összetett keveréke, mely a 330 oC-tól 350 oC-ig (626 oF-tól 662 oF-ig) terjedő tartományban forr. Főleg antracénből, karbazolból és fenantrénből áll.] |
295-275-9 | 91995-15-2 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-107-00-7 | Anthracene oil, anthracene paste, carbazole fraction; Anthracene Oil Fraction; [A complex combination of hydrocarbons from the distillation of anthracene obtained by crystallization of anthracene oil from bituminous coal high temperature tar and boiling in the approximate range of 350°C to 360°C (662°F to 680°F). It contains chiefly anthracene, carbazole and phenanthrene.] | Antracénolaj,
antracénpaszta, karbazol frakció; Antracénolaj frakció; [Bitumenes kőszén magas hőmérsékletű kátrányból származó antracénolaj kristályosításával előállított antracén desztillációjával nyert szénhidrogének összetett keveréke, mely hozzávetőleg a 350 oC-tól 360 oC-ig (662 oF-tól 680 oF-ig) terjedő tartományban forr. Főleg antracénből, karbazolból és fenantrénből áll.] |
295-276-4 | 91995-16-3 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-108-00-2 | Anthracene oil, anthracene paste, distn. lights; Anthracene Oil Fraction; [A complex combination of hydrocarbons from the distillation of anthracene obtained by crystallization of anthracene oil from bituminous high temperature tar and boiling in the range of approximately 290°C to 340°C (554°F to 644°F). It contains chiefly trinuclear aromatics and their dihydro derivatives.] | Antracénolaj,
antracénpaszta, könnyű desztillátumok; Antracénolaj frakció; [Bitumenes magas hőmérsékletű kátrányból nyert antracénolaj kristályosításával előállított antracén desztillációjával gyártott szénhidrogének összetett keveréke, mely hozzávetőleg a 290 oC-tól 340 oC-ig (554 oF-tól 644 oF-ig) terjedő tartományban forr. Elsősorban trinukleáris aromás vegyületekből és dihidro-származékaikból áll.] |
295-278-5 | 91995-17-4 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-109-00-8 | Tar oils, coal, low-temp.; Tar Oil, high boiling; [A distillate from low-temperature coal tar. Composed primarily of hydrocarbons, phenolic compounds and aromatic nitrogen bases boiling in the range of approximately 160°C to 340°C (320°F to 644°F).] | Kátrányolajok,
kőszén, alacsony hőm.; Kátrányolaj, magas forráspontú; [Alacsony hőmérsékletű kőszénkátrány desztillátuma. Elsősorban szénhidrogénekből, fenolvegyületekből és aromás nitrogénbázisokból áll, és hozzávetőleg a 160 oC-tól 340 oC-ig (320 oF-tól 644oF-ig) terjedő tartományban forr.] |
309-889-2 | 101316-87-4 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-110-00-3 | Extract residues (coal), low temp. coal atar alk.; [The residue from low temperature coal tar oils after an alkaline wash, such as aqueous sodium hydroxide, to remove crude coal tar acids. Composed primarily of hydrocarbons and aromatic nitrogen bases.] | Extrakciós
maradékok (kőszén), alacsony hőm. kőszénkátrány lúgos; [Alacsony hőmérsékletű kőszénkátrány olajok lúggal, pl. nátrium-hidroxid vizes oldatával a nyers kőszénkátrány savak eltávolítása céljából végzett mosásának távozó terméke. Elsősorban szénhidrogénekből és aromás nitrogénbázisokból áll.] |
310-191-5 | 122384-78-5 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-111-00-9 | Phenols, ammonia liquor ext.; Alkaline Extract; [The combination of phenols extracted, using isobutyl acetate, from the ammonia liquor condensed from the gas evolved in low-temperature (less than 700°C (1292°F)) destructive distillation of coal. It consists predominantly of a reaction mass of monohydric and dihydric phenols.] | Fenolok,
ammóniás oldat extr.; Lúgos extraktum; [Kőszén alacsony hőmérsékletű (700 oC (1292 oF) alatti) destruktív desztillációjából felszabaduló gázok kondenzációjából kapott ammóniaoldat izobutil-acetáttal végzett extrakciója útján előállított fenolok elegye. Túlnyomórészt egy- és kétértékű fenolok keverékéből áll.] |
284-881-9 | 84988-93-2 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-112-00-4 | Distillates (coal tar), light oils, alk. exts.; Alkaline Extract; [The aqueous extract from carbolic oil produced by an alkaline wash such as aqueous sodium hydroxide. Composed primarily of the alkali salts of various phenolic compounds.] | Desztillátumok
(kőszénkátrány), könnyűolajok, lúgos extr.; Lúgos extraktum; [Lúgos mosással, pl. nátrium-hidroxid vizes oldatával karbololajból nyert vizes extraktum. Elsősorban különféle fenolvegyületek alkálisói alkotják.] |
292-610-0 | 90640-88-3 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-113-00-X | Extracts, coal tar oil alk.; Alkaline Extract; [The extract from coal tar oil produced by an alkaline wash such as aqueous sodium hydroxide. Composed primarily of the alkali salts of various phenolic compounds.] | Extraktumok,
kőszénkátrány olaj lúgos; Lúgos extraktum; [Lúgos mosással, pl. nátrium-hidroxid vizes oldatával kőszénkátrányolajból nyert vizes extraktum. Elsősorban különféle fenolvegyületek alkálisói alkotják.] |
266-017-2 | 65996-83-0 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-114-00-5 | Distillates (coal tar), naphthalene oils, alk. exts.; Alkaline Extract; [The aqueous extract from naphthalene oil produced by an alkaline wash such as aqueous sodium hydroxide. Composed primarily of the alkali salts of various phenolic compounds.] | Desztillátumok
(kőszénkátrány), naftalinolajok, lúgos extr.; Lúgos extraktum; [Lúgos mosással, pl. nátrium-hidroxid vizes oldatával naftalinolajból nyert vizes extraktum. Elsősorban különféle fenolvegyületek alkálisói alkotják.] |
292-611-6 | 90640-89-4 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-115-00-0 | Extract residues (coal), tar oil alk., carbonated, limed; Crude Phenols; [The product obtained by treatment of coal tar oil alkaline extract with CO2 and CaO. Composed primarily of CaCO3, Ca(OH)2, Na2CO3 and other organic and inorganic impurities.] | Extrakciós
maradékok (kőszén), kátrányolaj lúgos, szénsavas, meszezett; Nyers fenolok; [Kőszénkátrány olaj lúgos extraktumából CO2-dal és CaO-dal végzett kezeléssel előállított termék. Elsősorban CaCO3-ból, Ca(OH)2-ból, Na2CO3-ból és más szerves és szervetlen szennyeződésekből áll.] |
292-629-4 | 90641-06-8 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-116-00-6 | Tar acids, coal, crude; Crude Phenols; [The reaction product obtained by neutralizing coal tar oil alkaline extract with an acidic solution, such as aqueous sulfuric acid, or gaseous carbon dioxide, to obtain the free acids. Composed primarily of tar acids such as phenol, cresols, and xylenols.] | Fenolfrakciók,
kőszén, nyers; Nyers fenolok; [Reakciótermék, melyet kőszénkátrány olaj lúgos extraktumának a szabad savak előállítása céljából savas oldattal (pl. vizes kénsavval vagy szén-dioxid gázzal) végzett kezelésével állítanak elő. Elsősorban kátránysavakból áll, mint pl. fenol, krezolok vagy xilenolok.] |
266-019-3 | 65996-85-2 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-117-00-1 | Tar acids, brown-coal, crude; Crude Phenols; [An acidified alkaline extract of brown coal tar distillate. Composed primarily of phenol and phenol homologs.] | Kátránysavak,
barnakőszén, nyers; Nyers fenolok; [Barnakőszén-kátrány desztillátumának savanyított lúgos extraktuma. Elsősorban fenolból és fenol homológokból áll.] |
309-888-7 | 101316-86-3 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-118-00-7 | Tar acids, brown-coal gasification; Crude Phenols; [A complex combination of organic compounds obtained from brown coal gasification. Composed primarily of C6-10 hydroxy aromatic phenols and their homologs.] | Kátránysavak,
barnakőszén gázosítás; Nyers fenolok; [Szerves vegyületek összetett keveréke, melyet barnakőszén gázosításával nyernek. Elsősorban C6–10 hidroxi-aromás fenolokból és homológjaikból áll.] |
295-536-7 | 92062-22-1 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-119-00-2 | Tar acids, distn. residues; Distillate Phenols; [A residue from the distillation of crude phenol from coal. It consists predominantly of phenols having carbon numbers in the range of C8 through C10 with a softening point of 60°C to 80°C (140°F to 176°F).] | Kátránysavak,
deszt. maradékok; Fenol párlatok; [Nyers fenol kőszénből történő desztillációjának távozó terméke. Főleg olyan fenolokból áll, melyek szénatomszáma a C8-C10 tartományban van, lágyuláspontja pedig 60 oC-80 oC (140 oF-176 oF).] |
306-251-5 | 96690-55-0 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-120-00-8 | Tar acids, methylphenol fraction; Distillate Phenols; [The fraction of tar acid rich in 3- and 4-methylphenol, recovered by distillation of low-temperature coal tar crude tar acids.] | Kátránysavak,
metilfenol frakció; Fenol párlatok; [3- és 4-metilfenolban gazdag kátránysav frakció, amelyet az alacsony hőmérsékletű kőszénkátrányból származó nyers kátránysav frakciók desztillációjával nyernek.] |
284-892-9 | 84989-04-8 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-121-00-3 | Tar acids, polyalkylphenol fraction; Distillate Phenols; [The fraction of tar acids, recovered by distillation of low-temperature coal tar crude tar acids, having an approximate boiling range of 225°C to 320°C (437°F to 608°F). Composed primarily of polyalkylphenols.] | Fenolfrakciók,
polialkilfenol frakció; Fenol párlatok; [Alacsony hőmérsékletű kőszénkátrányból származó nyers fenolfrakciók desztillációjával visszanyert fenolfrakciók, melyek hozzávetőleges forráspont-tartománya 225 oC-tól 320 oC-ig (437 oF-tól 608 oF-ig) terjed. Elsősorban polialkilfenolokból áll.] |
284-893-4 | 84989-05-9 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-122-00-9 | Tar acids, xylenol fraction; Distillate Phenols; [The fraction of tar acids, rich in 2,4- and 2,5-dimethylphenol, recovered by distillation of low-temperature coal tar crude tar acids.] | Fenolfrakciók,
xilenol frakció; Fenol párlatok; [Kátránysav frakció 2,4- és 2,5-dimetilfenolban gazdag párlata, melyet az alacsony hőmérsékletű kőszénkátrányból származó nyers kátránysav frakció desztillációjával nyernek vissza.] |
284-895-5 | 84989-06-0 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-123-00-4 | Tar acids, ethylphenol fraction; Distillate Phenols; [The fraction of tar acids, rich in 3- and 4-ethylphenol, recovered by distillation of low-temperature coal tar crude tar acids.] | Fenolfrakciók,
etilfenol frakció; Fenol párlatok; [Fenolfrakciók 3- és 4-etilfenolban gazdag párlata, melyet az alacsony hőmérsékletű kőszénkátrányból származó nyers kátránysav frakciók desztillációjával nyernek vissza.] |
284-891-3 | 84989-03-7 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-124-00-X | Tar acids, 3,5-xylenol fraction; Distillate Phenols; [The fraction of tar acids, rich in 3,5-dimethylphenol, recovered by distillation of low-temperature coal tar acids.] | Fenolfrakciók,
3,5- xilenol frakció; Fenol párlatok; [Kátránysav frakciók 3,5-dimetilfenolban gazdag párlata, melyet alacsony hőmérsékletű kőszénkátránysav frakciók desztillációjával nyernek vissza.] |
284-896-0 | 84989-07-1 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-125-00-5 | Tar acids, residues, distillates, first-cut; Distillate Phenols; [The residue from the distillation in the range of 235°C to 355°C (481°F to 697°F) of light carbolic oil.] | Kátránysavak,
maradékok, desztillátumok, első párlat; Fenol párlatok; [A könnyű karbololaj 235 oC-tól 355 oC-ig (481 oF-tól 697 oF-ig) terjedő tartományban végzett desztillációjának maradéka.] |
270-713-1 | 68477-23-6 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-126-00-0 | Tar acids, cresylic, residues; Distillate Phenols; [The residue from crude coal tar acids after removal of phenol, cresols, xylenols and any higher boiling phenols. A black solid with a melting point approximately 80°C (176°F). Composed primarily of polyalkylphenols, resin gums, and inorganic salts.] | Kátránysavak,
krezolos, maradékok; Fenol párlatok; [Nyers kőszénkátránysavakból a fenol, krezolok, xilenolok és a magasabban forró fenolok eltávolítása után kapott maradék. Fekete színű anyag, melynek olvadáspontja kb. 80 oC (176 oF). Elsősorban polialkilfenolokból, gyantákból és szervetlen sókból áll.] |
271-418-0 | 68555-24-8 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-127-00-6 | Phenols, C9-11; Distillate Phenols | Fenolok, C9-11; Fenol párlatok | 293-435-2 | 91079-47-9 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-128-00-1 | Tar acids, cresylic; Distillate Phenols; [A complex combination of organic compounds obtained from brown coal and boiling in the range of approximately 200°C to 230°C (392°F to 446°F). It contains chiefly phenols and pyridine bases.] | Kátránysavak,
krezolos; Fenol párlatok; [Szerves vegyületek barnakőszénből nyert összetett keveréke, mely megközelítőleg a 200 oC-tól 230 oC-ig (392oF-tól 446 oF-ig) terjedő tartományban forr. Főleg fenolokból és piridinbázisokból áll.] |
295-540-9 | 92062-26-5 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-129-00-7 | Tar acids, brown-coal, C2-alkylphenol fraction; Distillate Phenols; [The distillate from the acidification of alkaline washed lignite tar distillate boiling in the range of approximately 200°C to 230°C (392°F to 446°F). Composed primarily of m- and p-ethylphenol as well as cresols and xylenols.] | Kátránysavak,
barnakőszén, C2-alkilfenol frakció; Fenol párlatok; [Lúggal mosott lignitkátrány desztillátum savanyítása után végzett desztillációval nyert desztillátum, melynek hozzávetőleges forráspont-tartománya 200 oC-tól 230 oC-ig (392 oF-tól 446 oF-ig) terjed. Elsősorban m- és p-etilfenolból, valamint krezolokból és xilenolokból áll.] |
302-662-9 | 94114-29-1 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-130-00-2 | Extract oils (coal), naphthalene oils; Acid Extract; [The aqueous extract produced by an acidic wash of alkali-washed naphthalene oil. Composed primarily of acid salts of various aromatic nitrogen bases including pyridine, quinoline and their alkyl derivatives.] | Extraktum
olajok (kőszén), naftalinolajok; Savas extraktum; [Vizes extraktum, melyet a lúggal mosott naftalinolaj savas mosásával állítanak elő. Elsősorban különféle aromás nitrogénbázisok, pl. piridin, kinolin és ezek alkilszármazékainak savval alkotott sói alkotják.] |
292-623-1 | 90641-00-2 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-131-00-8 | Tar bases, quinoline derivs.; Distillate Bases | Kátránybázisok, kinolin származékok; Bázikus desztillátum | 271-020-7 | 68513-87-1 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-132-00-3 | Tar bases, coal, quinoline derivs. fraction; Distillate Bases | Kátránybázisok,
kőszén, kinolinszárm. frakció; Bázikus desztillátum |
274-560-1 | 70321-67-4 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-133-00-9 | Tar bases, coal, distn. residues; Distillate Bases; [The distillation residue remaining after the distillation of the neutralized, acid-extracted base-containing tar fractions obtained by the distillation of coal tars. It contains chiefly aniline, collidines, quinoline and quinoline derivatives and toluidines.] | Kátránybázisok,
kőszén, deszt. maradékok; Desztillátum bázisok; [Kőszénkátrányok desztillációjával előállított bázis tartalmú kátrányfrakciók savas extrakciója, semlegesítése és desztillációja után nyert desztillációs maradék. Főleg anilinből, kollidinekből, kinolinból és kinolinszármazékokból, valamint toluidinekből áll.] |
295-544-0 | 92062-29-8 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-134-00-4 | Hydrocarbon oils, arom., mixed with polyethylene and polypropylene, pyrolyzed, light oil fraction; Heat Treatment Products; [The oil obtained from the heat treatment of a polyethylene/polypropylene reaction mass with coal tar pitch or aromatic oils. It consists predominantly of benzene and its homologs boiling in a range of approximately 70°C to 120°C (158°F to 248°F).] | Szénhidrogén
olajok, aromás, polietilénnel és polipropilénnel kevert, pirolizált,
könnyűolaj frakció; Hőkezelés termékei; [Polietilén/polipropilén, kőszénkátrány szurok és aromás olajok keverékének hőkezelésével kapott olaj. Főleg benzolból és homológjaiból áll, közelítő forrásponttartománya 70 oC-tól 120 oC-ig (158 oF-tól 248 oF-ig) terjed.] |
309-745-9 | 100801-63-6 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-135-00-X | Hydrocarbon oils, arom., mixed with polyethylene, pyrolyzed, light oil fraction; Heat Treatment Products; [The oil obtained from the heat treatment of polyethylene with coal tar pitch or aromatic oils. It consists predominantly of benzene and its homologs boiling in a range of 70°C to 120°C (158°F to 248°F).] | Szénhidrogénolajok,
aromás, polietilénnel kevert, pirolizált, könnyűolaj frakció; Hőkezelés termékei; [Polietilén kátrányszurokkal vagy aromás olajokkal végzett hőkezelésével előállított olaj. Főleg benzolból és homológjaiból áll, forráspont tartománya 70 oC-tól 120 oC-ig (158 oF-tól 248 oF-ig) terjed.] |
309-748-5 | 100801-65-8 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-136-00-5 | Hydrocarbon oils, arom., mixed with polystyrene, pyrolyzed, light oil fraction; Heat Treatment Products; [The oil obtained from the heat treatment of polystyrene with coal tar pitch or aromatic oils. It consists predominantly of benzene and its homologs boiling in a range of approximately 70°C to 210°C (158°F to 410°F).] | Szénhidrogénolajok,
arom., polisztirollal kevert, pirolizált, könnyűolaj frakció; Hőkezelés termékei; [Polisztirol kátrányszurokkal vagy aromás olajokkal végzett hőkezelésével előállított olaj. Főleg benzolból és homológjaiból áll, közelítő forrásponttartománya 70 oC-tól 210 oC-ig (158 oF-tól 410 oF-ig) terjed.] |
309-749-0 | 100801-66-9 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-137-00-0 | Extract residues (coal), tar oil alk., naphthalene distn. residues; Naphthalene Oil Extract Residue; [The residue obtained from chemical oil extracted after the removal of naphthalene by distillation composed primarily of two to four membered condensed ring aromatic hydrocarbons and aromatic nitrogen bases.] | Extrakciós
maradékok (kőszén), kátrányolaj, lúgos, naftalin deszt. maradékok;
Naftalinolaj extrakciós maradéka; [A 2-4 tagú kondenzált gyűrűs aromás szénhidrogének és aromás nitrogénbázisok keverékéből a naftalin eltávolítása (desztillációval) után kapott kémiai olajból extrakcióval nyert maradék.] |
277-567-8 | 73665-18-6 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-138-00-6 | Creosote oil, low-boiling distillate; Wash Oil; [The low-boiling distillation fraction obtained from the high temperature carbonization of bituminous coal, which is further refined to remove excess crystalline salts. It consists primarily of creosote oil with some of the normal polynuclear aromatic salts, which are components of coal tar distillate, removed. It is crystal free at approximately 38°C (100°F).] | Kreozotolaj,
alacsony forráspontú desztillátum; mosóolaj; [A kőszénkátrány magas hőfokon végzett karbonizációjából nyert alacsony forráspontú desztillációs frakció, amely további finomításra kerül a felesleges kristályos sók eltávolítása céljából. Elsősorban kreozotolajat tartalmaz, melyből eltávolításra kerül a kőszénkátrány-párlatban jelen lévő normál polinukleáris aromás sók egy része. Hozzávetőleg 38 oC-on (100 oF) kristálymentes.) |
274-566-4 | 70321-80-1 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00/ATP01 | ||
| 648-139-00-1 | Tar acids, cresylic, sodium salts, caustic solns.; Alkaline Extract | Kátrány savak, krezolos, nátriumsók, maró old.; Lúgos extraktum | 272-361-4 | 68815-21-4 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-140-00-7 | Extract oils (coal), tar base; Acid Extract; [The extract from coal tar oil alkaline extract residue produced by an acidic wash such as aqueous sulfuric acid after distillation to remove naphthalene. Composed primarily of the acid salts of various aromatic nitrogen bases including pyridine, quinoline, and their alkyl derivatives.] | Extraktum
olajok (kőszén), kátránybázis, Savas extraktum; [Kőszénkátrány olaj lúgos extrakciós maradékából származó extraktum, melyet a naftalin eltávolítása céljából végzett desztilláció után savas (pl. vizes kénsavas) mosással kapnak. Főleg különféle aromás nitrogénbázisok (pl. piridin, kinolin és alkáli származékaik) savval alkotott sói alkotják.] |
266-020-9 | 65996-86-3 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-141-00-2 | Tar bases, coal, crude; Crude Tar Bases; [The reaction product obtained by neutralizing coal tar base extract oil with an alkaline solution, such as aqueous sodium hydroxide, to obtain the free bases. Composed primarily of such organic bases as acridine, phenanthridine, pyridine, quinoline and their alkyl derivatives.] | Fenolfrakciók,
kőszén, nyers; Nyers kátránybázisok; [Reakciótermék, melyet kőszénkátrány bázis extraktum olajból a szabad bázisok előállítása céljából lúgos oldattal (pl. vizes nátrium-hidroxiddal) végzett semlegesítéssel nyernek. Fő alkotórészei olyan szerves bázisok, mint az akridin, fenantridin, piridin, kinolin és ezek alkilszármazékai.] |
266-018-8 | 65996-84-1 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J M | CLP00/ATP01 | ||
| 648-142-00-8 | Residues (coal), liq. solvent extn.; [A cohesive powder composed of coal mineral matter and undissolved coal remaining after extraction of coal by a liquid solvent.] | Maradékok
(kőszén), oldószeres extr.; [Tapadó por, amely a kőszén oldószeres extrakciója után maradt ásványi anyagokból és oldhatatlan szénből áll.] |
302-681-2 | 94114-46-2 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-143-00-3 | Coal liquids, liq. solvent extn. soln.; [The product obtained by filtration of coal mineral matter and undissolved coal from coal extract solution produced by digesting coal in a liquid solvent. A black, viscous, highly complex liquid combination composed primarily of aromatic and partly hydro-genated aromatic hydrocarbons, aromatic nitrogen compounds, aromatic sulfur compounds, phenolic and other aromatic oxygen compounds and their alkyl derivatives.] | Kőszén
folyadékok, oldószeres extr. oldat; [Kőszén oldószeres digerálásával kapott kőszénextraktum oldat szűrésével nyert, ásványi anyagokból és oldhatatlan szénből álló termék. A fekete viszkózus folyadék aromás és részlegesen hidrogénezett aromás szénhidrogének, aromás nitrogénvegyületek, aromás kénvegyületek, fenol- és más aromás oxigénvegyületek és származékaik rendkívül összetett kombinációja.] |
302-682-8 | 94114-47-3 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-144-00-9 | Coal liquids, liq. solvent extn.; [The substantially solvent-free product obtained by the distillation of the solvent from filtered coal extract solution produced by digesting coal in a liquid solvent. A black semi-solid, composed primarily of a complex combination of condensed-ring aromatic hydrocarbons, aromatic nitrogen compounds, aromatic sulfur compounds, phenolic compounds and other aromatic oxygen compounds, and their alkyl derivatives.] | Kőszén
folyadékok, oldószeres ext.; [A lényegében oldószermentes terméket a szén oldószeres digerálással kapott kőszénextraktum oldat szűrletének desztillációjával kapják. A fekete, félszilárd termék főleg kondenzált gyűrűs aromás szénhidrogének, aromás nitrogénvegyületek, aromás kénvegyületek, fenol- és más aromás oxigénvegyületek és származékaik összetett kombinációja.] |
302-683-3 | 94114-48-4 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
M | CLP00 | ||
| 648-145-00-4 | Tar brown-coal; [An oil distilled from brown-coal tar. Composed primarily of aliphatic, naphthenic and one- to three-ring aromatic hydrocarbons, their alkyl derivates, heteroaromatics and one- and two-ring phenols boiling in the range of approximately 150 °C to 360 °C (302 °F to 680 °F).] | Barnaszén
kátrány; [Barnaszén kátrány lepárlásával nyert olaj. Főleg alifás, naftén- és 1-3-gyűrűs aromás szénhidrogénekből, ezek alkilszármazékaiból, heteroaromás vegyületekből és 1-2 gyűrűs fenolokból áll; hozzávetőleges forráspont-tartománya: 150 oC-360 oC (302 oF-680 oF).] |
309-885-0 | 101316-83-0 | Carc.
1A |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 648-146-00-X | Tar, brown-coal, low-temp.; [A tar obtained from low temperature carbonization and low temperature gasification of brown coal. Composed primarily of aliphatic, naphthenic and cyclic aromatic hydrocarbons, heteroaromatic hydrocarbons and cyclic phenols.] | Barnaszén
kátrány, alacsony hőm; [Barnaszén alacsony hőmérsékletű kokszosításával és alacsony hőmérsékletű gázosításával kapott kátrány. Főleg alifás, naftén és gyűrűs aromás szénhidrogénekből, heteroaromás szénhidrogénekből és gyűrűs fenolokból áll.] |
309-886-6 | 101316-84-1 | Carc.
1A |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 648-147-00-5 | Light oil (coal), coke-oven; Crude benzole; [The volatile organic liquid extracted from the gas evolved in the high temperature (greater than 700°C (1292°F)) destructive distillation of coal. Composed primarily of benzene, toluene, and xylenes. May contain other minor hydrocarbon constituents.] | Könnyűolaj
(kőszén), kokszolókemence; Nyers benzol; [Kőszén magas hőmérsékletű (700 oC (1292 oF) fölött végzett) destruktív desztillációja során felszabaduló gázból kivont, illékony szerves folyadék. Elsősorban benzolból, toluolból és xilolokból tevődik össze. Kis mennyiségben más szénhidrogén összetevőket is tartalmazhat.] |
266-012-5 | 65996-78-3 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-148-00-0 | Distillates (coal), liq. solvent extn., primary; [The liquid product of condensation of vapors emitted during the digestion of coal in a liquid solvent and boiling in the range of approximately 30°C to 300°C (86°F to 572°F). Composed primarily of partly hydrogenated condensed-ring aromatic hydrocarbons, aromatic compounds containing nitrogen, oxygen and sulfur, and their alkyl derivatives having carbon numbers predominantly in the range of C4 through C14.] | Desztillátumok
(kőszén), foly. oldószeres extr., primer; [Kőszén folyékony oldószerben végzett feltárása során felszabaduló gőzök kondenzációjának folyékony terméke, mely közelítőleg a 30 oC-tól 300 oC-ig (86 oC-tól 572 oC-ig) terjedő tartományban forr. Főleg részben hidrogénezett kondenzált gyűrűs aromás szénhidrogénekből, nitrogént, oxigént és ként tartalmazó aromás vegyületekből és ezek alkilszármazékaiból áll, melyek szénatomszáma a C4-C14 tartományban van.] |
302-688-0 | 94114-52-0 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-149-00-6 | Distillates (coal), solvent extn., hydrocracked; [Distillate obtained by hydrocracking of coal extract or solution produced by the liquid solvent extraction or supercritical gas extraction processes and boiling in the range of approximately 30°C to 300°C (86°F to 572°F). Composed primarily of aromatic, hydrogenated aromatic and naphthenic compounds, their alkyl derivatives and alkanes with carbon numbers predominantly in the range of C4 through C14. Nitrogen, sulfur and oxygen-containing aromatic and hydrogenated aromatic compounds are also present.] | Desztillátumok
(kőszén), oldószeres extr., hidrokrakkolt; [Kőszén extraktum hidrokrakkolásával előállított desztillátum, vagy olyan oldat, melyet oldószeres extrakcióval vagy szuperkritikus gázextrakcióval állítanak elő; forráspont-tartománya megközelítőleg 30 oC-tól 300 oC-ig (86 oF-tól 572 oF-ig) terjed. Elsősorban aromás, hidrogénezett aromás és nafténvegyületekből, ill. ezek alkilszármazékaiból áll, melyek szénatomszáma túlnyomórészt a C4-C14 tartományban van. Nitrogént, ként és oxigént tartalmazó aromás és hidrogénezett aromás vegyületeket is tartalmaz.] |
302-689-6 | 94114-53-1 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-150-00-1 | Naphtha (coal), solvent extn., hydrocracked; [Fraction of the distillate obtained by hydrocracking of coal extract or solution produced by the liquid solvent extraction or supercritical gas extraction processes and boiling in the range of approximately 30°C to 180°C (86°F to 356°F). Composed primarily of aromatic, hydrogenated aromatic and naphthenic compounds, their alkyl derivatives and alkanes with carbon numbers predominantly in the range of C4 to C9. Nitrogen, sulfur and oxygen-containing aromatic and hydrogenated aromatic compounds are also present.] | Benzin
(kőszén), oldószeres extr., hidrokrakkolt; [Kőszén extraktum hidrokrakkolással nyert desztillátumának frakciója, vagy olyan oldat, melyet oldószeres extrakcióval vagy szuperkritikus gázextrakcióval állítanak elő; forráspont-tartománya hozzávetőleg 30 oC-tól 180 oC-ig (86 oF-tól 356 oF-ig) terjed. Elsősorban aromás, hidrogénezett aromás és nafténvegyületekből, ill. ezek alkilszármazékaiból áll, melyek szénatomszáma túlnyomórészt a C4-C9 tartományban van. Nitrogént, ként és oxigént tartalmazó aromás és hidrogénezett aromás vegyületeket is tartalmaz.] |
302-690-1 | 94114-54-2 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-151-00-7 | Gasoline, coal solvent extn., hydrocracked naphtha; [Motor fuel produced by the reforming of the refined naphtha fraction of the products of hydrocracking of coal extract or solution produced by the liquid solvent extraction or supercritical gas extraction processes and boiling in the range of approximately 30 °C to 180 °C (86 °F to 356 °F). Composed primarily of aromatic and naphthenic hydrocarbons, their alkyl derivatives and alkyl hydrocarbons having carbon numbers in the range of C4 through C9.] | Gazolin,
kőszén oldószer extr., hidrokrakkolt nafta; [A kőszén extraktum hidrokrakkolásakor kapott termékek vagy folyadék extrakcióval vagy a szuperkritikus gázextrakciós folyamatok során kapott oldat finomított nafta frakciójának reformálásával kapott motorbenzin, melynek hozzávetőleges forráspont-tartománya 30 oC és 180 oC (86 oF és 356 oF) között van. Főleg aromás és naftén-szénhidrogénekből, ezek alkilszármazékaiból és C4-C9 szénatomszámú alkil-szénhidrogénekből áll.] |
302-691-7 | 94114-55-3 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 648-152-00-2 | Distillates (coal), solvent extn., hydrocracked middle; [Distillate obtained from the hydrocracking of coal extract or solution produced by the liquid solvent extraction or supercritical gas extraction processes and boiling in the range of approximately 180°C to 300°C (356°F to 572°F. Composed primarily of two-ring aromatic, hydrogenated aromatic and naphthenic compounds, their alkyl derivatives and alkanes having carbon numbers predominantly in the range of C9 through C14. Nitrogen, sulfur and oxygen-containing compounds are also present.] | Desztillátumok
(kőszén), oldószeres extr., hidrokrakkolt középfázis; [Kőszén extraktum hidrokrakkolással nyert desztillátuma, vagy olyan oldat, melyet folyékony oldószeres extrakcióval vagy szuperkritikus gázextrakcióval állítanak elő; forráspont-tartománya hozzávetőleg 180 oC-tól 300 oC-ig (356 oF-tól 572 oF-ig) terjed. Elsősorban olyan kétgyűrűs aromás, hidrogénezett aromás és nafténvegyületekből, ill. ezek alkil származékaiból és alkánokból áll, melyek szénatomszáma túlnyomórészt a C9-C14 tartományban van. Nitrogént, ként és oxigént tartalmazó vegyületeket is tartalmaz.] |
302-692-2 | 94114-56-4 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-153-00-8 | Distillates (coal), solvent extn., hydrocracked hydrogenated middle; [Distillate from the hydrogenation of hydrocracked middle distillate from coal extract or solution produced by the liquid solvent extraction or supercritical gas extraction processes and boiling in the range of approximately 180°C to 280°C (356°F to 536°F). Composed primarily of hydrogenated two- ring carbon compounds and their alkyl derivatives having carbon numbers predominantly in the range of C9 through C14.] | Desztillátumok
(kőszén), oldószeres extr., hidrokrakkolt hidrogénezett középfázis; [Kőszén extraktum hidrokrakkolással nyert desztillátuma, vagy olyan oldat, melyet folyékony oldószeres extrakcióval vagy szuperkritikus gázextrakcióval állítanak elő; forráspont-tartománya hozzávetőleg 180 oC-tól 280 oC-ig (356 oF-tól 536 oF-ig) terjed. Főleg hidrogénezett kétgyűrűs szénvegyületekből és alkilszármazékaikból áll, melyek szénatomszáma túlnyomórészt a C9–C14 tartományban van.] |
302-693-8 | 94114-57-5 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 648-154-00-3 | Fuels, jet aircraft, coal solvent extn., hydrocracked hydrogenated; [Jet engine fuel produced by hydrogenation of the middle distillate fraction of the products of hydrocracking of coal extract or solution produced by the liquid solvent extraction or supercritical gas extraction processes and boiling in the range of approximately 180 °C to 225 °C (356 °F to 473 °F). Composed primarily of hydrogenated two-ring hydrocarbons and their alkyl derivatives having carbon numbers predominantly in the range of C10 through C12.] | Üzemanyagok,
sugárhajtású repülőgép, kőszén oldószeres extr., hidrokrakkolt
hidrogénezett; [A kőszén extraktum hidrokrakkolásakor kapott termékek vagy folyadék extrakcióval vagy a szuperkritikus gázextrakciós folyamatok során kapott oldat közép desztillációs frakciójának hidrogénezésével előállított sugárhajtású repülőgépmotor hajtóanyag, melynek hozzávetőleges forráspont-tartománya 180 oC és 225 oC (356 oF és 473 oF) között van. Elsősorban hidrogénezett kétgyűrűs szénhidrogénekből, ill. ezek alkilszármazékaiból áll, melyek szénatomszáma túlnyomórészt a C10-C12 tartományban van.] |
302-694-3 | 94114-58-6 | Carc.
2 |
H351 |
GHS08 Wng |
H350 |
CLP00 | |||
| 648-155-00-9 | Fuels, diesel, coal solvent extn., hydrocracked hydrogenated; [Diesel engine fuel produced by the hydrogenation of the middle distillate fraction of the products of hydrocracking of coal extract or solution produced by the liquid solvent extraction or supercritical gas extraction processes and boiling in the range of approximately 200 °C to 280 °C (392 °F to 536 °F). Composed primarily of hydrogenated two-ring hydrocarbons and their alkyl derivatives having carbon numbers predominantly in the range of C11 through C14.] | Üzemanyagok, dízel, kőszén oldószeres extr., hidrokrakkolt hidrogénezett; [A kőszén extraktum hidrokrakkolásakor kapott termékek vagy folyadék extrakcióval vagy a szuperkritikus gázextrakciós folyamatok során kapott oldat közép desztillációs frakciójának hidrogénezésével előállított dízelmotor hajtóanyag, melynek hozzávetőleges forráspont-tartománya 200 oC és 280 oC (392 oF és 536 oF) között van. Elsősorban hidrogénezett kétgyűrűs szénhidrogénekből, ill. ezek alkilszármazékaiból áll, melyek szénatomszáma túlnyomórészt a C11-C14 tartományban van.] | 302-695-9 | 94114-59-7 | Carc.
2 |
H351 |
GHS08 Wng |
H350 |
CLP00 | |||
| 648-156-00-4 | Light oil (coal), semi-coking process; Fresh oil; [The volatile organic liquid condensed from the gas evolved in the low-temperature (less than 700°C (1292°F)) destructive distillation of coal. Composed primarily of C6-10 hydrocarbons.] | Könnyűolaj
(szén), félkokszolási folyamat, Nyers olajpárlat; [Kőszén alacsony hőmérsékletű (700 oC (1292oF) alatt végzett) destruktív desztillációja során felszabaduló gázból kivont, illékony szerves folyadék. Főként C6-10 szénhidrogénekből áll.] |
292-635-7 | 90641-11-5 | Carc.
1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
J | CLP00/ATP01 | ||
| 649-001-00-3 | Extracts (petroleum), light naphthenic distillate solvent | Extraktumok (ásványolaj), könnyű nafténes desztillátum oldószer | 265-102-1 | 64742-03-6 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-002-00-9 | Extracts (petroleum), heavy paraffinic distillate solvent | Extraktumok (ásványolaj), nehéz paraffinos desztillátum oldószer | 265-103-7 | 64742-04-7 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-003-00-4 | Extracts (petroleum), light paraffinic distillate solvent | Extraktumok (ásványolaj), könnyű paraffinos desztillátum oldószer | 265-104-2 | 64742-05-8 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-004-00-X | Extracts (petroleum), heavy naphthenic distillate solvent | Extraktumok (ásványolaj), nehéz nafténes desztillátum oldószer | 265-111-0 | 64742-11-6 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-005-00-5 | Extracts (petroleum), light vacuum gas oil solvent | Extraktumok (ásványolaj), könnyű vákuum gázolaj oldószer | 295-341-7 | 91995-78-7 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-006-00-0 | hydrocarbons C26-55, arom-rich | szénhidrogének, C26-C55, aromás vegyületekben gazdag | 307-753-7 | 97722-04-8 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-007-00-6 | fatty acids, tall-oil, reaction products with iminodiethanol and boric acid | zsírsavak, tall-olaj, iminodietanollal és bórsavval végbemenő reakció termékei | 400-160-5 | Skin
Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
CLP00 | ||||
| 649-008-00-1 | Residues (petroleum), atm. tower; Heavy Fuel oil; [A complex residuum from the atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly greater than C20 and boiling above approximately 350 °C (662 °F). This stream is likely to contain 5 wt. % or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | Maradékok
(ásványolaj), atm. torony; Nehéz gázolaj; [Nyersolaj atmoszferikus desztillációjából származó összetett maradék. Főként C20-nál nagyobb szénatomszámú telítetlen szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 350 oC (662 oF) fölött van. Ez a származék tartalmazhat 5 tömeg% vagy több 4-6 tagú kondenzált gyűrűs aromás szénhidrogéneket is.] |
265-045-2 | 64741-45-3 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-009-00-7 | Gas oils (petroleum), heavy vacuum; Heavy Fuel oil; [A complex combination of hydrocarbons produced by the vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and boiling in the range of approximately 350 °C to 600 °C (662 °F to 1112 °F). This stream is likely to contain 5 wt. % or more of 4-to 6-membered condensed ring aromatic hydrocarbons.] | Gázolajok
(ásványolaj); nehéz vákuum; Nehéz gázolaj; [Nyersolaj atmoszferikus desztillációs maradékának vákuumdesztillációs termékeként képzett, összetett szénhidrogén-keverék. Főként C20-C50 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 350 oC-600 oC (662 oF-1112 oF). Ez a származék tartalmazhat 5 tömeg% vagy több 4-6 tagú kondenzált gyűrűs aromás szénhidrogéneket is.] |
265-058-3 | 64741-57-7 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-010-00-2 | Distillates (petroleum), heavy catalytic cracked; Heavy Fuel oil; [A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C35 and boiling in the range of approximately 260 °C to 500 °C (500 °F to 932 °F). This stream is likely to contain 5 wt. % or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | Párlatok
(ásványolaj), nehéz katalitikusan krakkolt; Nehéz gázolaj; [Szénhidrogének összetett keveréke, melyet katalitikus krakkolási folyamat termékeinek desztillációjával nyernek. Főként C15-C35 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 260 oC-500 oC (500 oF-932 oF). Ez a származék tartalmazhat 5 tömeg% vagy több 4-6 tagú kondenzált gyűrűs aromás szénhidrogéneket is.] |
265-063-0 | 64741-61-3 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-011-00-8 | Clarified oils (petroleum), catalytic cracked; Heavy Fuel oil; [A complex combination of hydrocarbons produced as the residual fraction from distillation of the products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly greater than C20 and boiling above approximately 350 °C (662 °F). This stream is likely to contain 5 wt. % or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | Derített
olajok (ásványolaj), katalitikusan krakkolt; Nehéz gázolaj; [Katalitikus krakkolási folyamat eredményeként kapott termékek desztillálásának maradék frakciójaként nyert összetett szénhidrogénkeverék. Főként C20-nál nagyobb szénatomszámú telítetlen szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 350 oC (662 oF) fölött van. Ez a származék tartalmazhat 5 tömeg% vagy több 4-6 tagú kondenzált gyűrűs aromás szénhidrogéneket is.] |
265-064-6 | 64741-62-4 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-012-00-3 | Residues (petroleum), hydrocracked; Heavy Fuel oil; [A complex combination of hydrocarbons produced as the residual fraction from distillation of the products of a hydrocracking process. It consists of hydrocarbons having carbon numbers predominantly greater than C20 and boiling above approximately 350 °C (662 °F).] | Maradékok
(ásványolaj), hidrokrakkolt; Nehéz gázolaj; [Hidrokrakkolási folyamat eredményeként kapott termékek desztillálásának maradék frakciójaként nyert összetett szénhidrogénkeverék. Főként C20-nál nagyobb szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 350 oC (662 oF) fölött van. |
265-076-1 | 64741-75-9 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-013-00-9 | Residues (petroleum), thermal cracked; Heavy Fuel oil; [A complex combination of hydrocarbons produced as the residual fraction from distillation of the product from a thermal cracking process. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly greater than C20 and boiling above approximately 350 °C (662 °F). This stream is likely to contain 5 wt. % or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | Maradékok
(ásványolaj), termikusan krakkolt; Nehéz gázolaj; [Termikus krakkolási folyamat eredményeként kapott termékek desztillálásának maradék frakciójaként nyert összetett szénhidrogénkeverék. Főként C20-nél nagyobb szénatomszámú telítetlen szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 350 oC (662 oF) fölött van.] Ez a származék tartalmazhat 5 tömeg% vagy több 4-6 tagú kondenzált gyűrűs aromás szénhidrogéneket is.] |
265-081-9 | 64741-80-6 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-014-00-4 | Distillates (petroleum), heavy thermal cracked; Heavy Fuel oil; [A complex combination of hydrocarbons from the distillation of the products from a thermal cracking process. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly in the range of C15 through C36 and boiling in the range of approximately 260 °C to 480 °C (500 °F to 896 °F). This stream is likely to contain 5 wt. % or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | Desztillátumok
(ásványolaj), nehéz termikusan krakkolt; Nehéz gázolaj; [Termikus krakkolási folyamat eredményeként kapott termékek desztillálásának eredményeként nyert összetett szénhidrogénkeverék. Főként C15-C36 szénatomszámú telítetlen szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 260 oC-480 oC (500 oF-896 oF). Ez a származék tartalmazhat 5 tömeg% vagy több 4-6 tagú kondenzált gyűrűs aromás szénhidrogéneket is.] |
265-082-4 | 64741-81-7 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-015-00-X | Gas oils (petroleum), hydrotreated vacuum; Heavy Fuel oil; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly in the range of C13 through C50 and boiling in the range of approximately 230 °C to 600 °C (446 °F to 1112 °F). This stream is likely to contain 5 wt.% or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | Gázolajok
(ásványolaj), hidrogénnel kezelt vákuum; Nehéz gázolaj; [Ásványolaj frakció katalitikus hidrogénezésével nyert összetett szénhidrogénkeverék. Főként C13-C50 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 230 oC-600 oC (446 oF-1112 oF). Ez a származék tartalmazhat 5 tömeg% vagy több 4-6 tagú kondenzált gyűrűs aromás szénhidrogéneket is.] |
265-162-9 | 64742-59-2 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-016-00-5 | Residues (petroleum), hydrodesulfurized atmospheric tower; Heavy Fuel oil; [A complex combination of hydrocarbons obtained by treating an atmospheric tower residuum with hydrogen in the presence of a catalyst under conditions primarily to remove organic sulfur compounds. It consists of hydrocarbons having carbon numbers predominantly greater than C20 and boiling above approximately 350 °C (662 °F). This stream is likely to contain 5 wt. % or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | Maradékok
(ásványolaj) hidrogénezéssel kéntelenített, atmoszferikus torony; Nehéz
gázolaj; [Atmoszferikus torony maradékából elsősorban a kénvegyületek eltávolítására végzett katalitikus hidrogénezéssel előállított összetett szénhidrogénkeverék. Főként C20-nál nagyobb szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 350 oC (662 oF) fölött van. Ez a származék tartalmazhat 5 tömeg% vagy több 4-6 tagú kondenzált gyűrűs aromás szénhidrogéneket is.] |
265-181-2 | 64742-78-5 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-017-00-0 | Gas oils (petroleum), hydrodesulfurized heavy vacuum; Heavy Fuel oil; [A complex combination of hydrocarbons obtained from a catalytic hydrodesulfurization process. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and boiling in the range of approximately 350 °C to 600 °C (662 °F to 1112 °C). This stream is likely to contain 5 wt. % or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | Gázolajok (ásványolaj) hidrogénezéssel kéntelenített, nehéz vákuum; Nehéz gázolaj; [A katalitikus hidrogénezéssel történő kéntelenítési folyamat termékeként nyert összetett szénhidrogénkeverék. Főként C20-C50 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 350 oC-600 oC (662 oF-1112 oF). Ez a származék tartalmazhat 5 tömeg% vagy több 4-6 tagú kondenzált gyűrűs aromás szénhidrogéneket is.] | 265-189-6 | 64742-86-5 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-018-00-6 | Residues (petroleum), steam-cracked; Heavy Fuel oil; [A complex combination of hydrocarbons obtained as the residual fraction from the distillation of the products of a steam cracking process (including steam cracking to produce ethylene). It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly greater than C14 and boiling above approximately 260 °C (500 °F). This stream is likely to contain 5 wt. % or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | Maradékok
(ásványolaj), gőzzel krakkolt; Nehéz gázolaj; [A gőzzel történő krakkolás (beleértve a gőzkrakkolásos etiléngyártást is) során kapott termékek desztillációs maradék frakciójaként nyert összetett szénhidrogénkeverék. Főként C14-nél nagyobb szénatomszámú telítetlen szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 260 oC (500 oF) fölött van.] Ez a származék tartalmazhat 5 tömeg% vagy több 4-6 tagú kondenzált gyűrűs aromás szénhidrogéneket is.] |
265-193-8 | 64742-90-1 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-019-00-1 | Residues (petroleum), atmospheric; Heavy Fuel oil; [A complex residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly greater than C11 and boiling above approximately 200 °C (392 °F). This stream is likely to contain 5 wt. % or more of 4-to 6-membered condensed ring aromatic hydrocarbons.] | Maradékok
(ásványolaj), atmoszferikus; Nehéz gázolaj; [Nyersolaj atmoszferikus desztillációjából származó összetett maradék. Főként C11-nél nagyobb szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 200 oC (392 oF) fölött van. Ez a származék tartalmazhat 5 tömeg% vagy több 4-6 tagú kondenzált gyűrűs aromás szénhidrogéneket is.] |
269-777-3 | 68333-22-2 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-020-00-7 | Clarified oils (petroleum), hydrodesulfurized catalytic cracked; Heavy Fuel oil; [A complex combination of hydrocarbons obtained by treating catalytic cracked clarified oil with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It consists of hydrocarbons having carbon numbers predominantly greater than C20 and boiling above approximately 350 °C (662 °F). This stream is likely to contain 5 wt. % or more of 4-to 6-membered condensed ring aromatic hydrocarbons.] | Derített
olajok (ásványolaj), hidrogénezéssel kéntelenített, katalitikusan
krakkolt; Nehéz gázolaj; [Derített olaj katalitikus krakkolási termékének hidrogénezésével nyert összetett szénhidrogénkeverék; a hidrogénezés célja a szerves kénvegyületek hidrogén-szulfiddá alakítása, majd eltávolítása. Főként C20-nál nagyobb szénatomszámú telítetlen szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 350 oC (662 oF) fölött van. Ez a származék tartalmazhat 5 tömeg% vagy több 4-6 tagú kondenzált gyűrűs aromás szénhidrogéneket is.] |
269-782-0 | 68333-26-6 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-021-00-2 | Distillates (petroleum), hydrodesulfurized intermediate catalytic cracked; Heavy Fuel oil; [A complex combination of hydrocarbons obtained by treating intermediate catalytic cracked distillates with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It consists of hydrocarbons having carbon numbers predominantly in the range of C11 through C30 and boiling in the range of approximately 205 °C to 450 °C (401 °F to 842 °F). It contains a relatively large proportion of tricyclic aromatic hydrocarbons.] | Párlatok
(ásványolaj), hidrogénezéssel kéntelenített közbenső katalitikusan krakkolt
termék; Nehéz gázolaj; [Közbenső katalitikus krakkolási párlatok hidrogénezésével nyert összetett szénhidrogénkeverék; a hidrogénezés célja a szerves kénvegyületek hidrogén-szulfiddá alakítása, majd eltávolítása. Főként C11-C30 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 205 oC-450 oC (401 oF-842 oF). Viszonylag nagy arányban tartalmaz triciklusos aromás szénhidrogéneket.] |
269-783-6 | 68333-27-7 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-022-00-8 | Distillates (petroleum), hydrodesulfurized heavy catalytic cracked; Heavy Fuel oil; [A complex combination of hydrocarbons obtained by treatment of heavy catalytic cracked distillates with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C35 and boiling in the range of approximately 260 °C to 500 °C (500 °F to 932 °F). This stream is likely to contain 5 wt. % or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | Párlatok
(ásványolaj), hidrogénezéssel kéntelenített nehéz katalitikusan
krakkolt; Nehéz gázolaj; [Nehéz katalitikus krakkolási párlatok hidrogénezésével nyert összetett szénhidrogénkeverék; a hidrogénezés célja a szerves kénvegyületek hidrogén-szulfiddá alakítása, majd eltávolítása. Főként C15-C35 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 260 oC-500 oC (500 oF-932 oF). Ez a származék tartalmazhat 5 tömeg% vagy több 4-6 tagú kondenzált gyűrűs aromás szénhidrogéneket is.] |
269-784-1 | 68333-28-8 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-023-00-3 | Fuel oil, residues-straight-run gas oils, high-sulfur; Heavy Fuel oil | Üzemanyag
olajok, maradék-közvetlen lepárlású gázolaj, magas kéntartalom; Nehéz gázolaj |
270-674-0 | 68476-32-4 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-024-00-9 | Fuel oil, residual; Heavy Fuel oil; [The liquid product from various refinery streams, usually residues. The composition is complex and varies with the source of the crude oil.] | Gázolajok,
maradék; Nehéz gázolaj; [Folyékony termék, különböző finomítási eljárásokból kapott, főleg maradékok. Komplex összetételű, az összetétele függ a nyersolajforrástól.] |
270-675-6 | 68476-33-5 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-025-00-4 | Residues (petroleum), catalytic reformer fractionator residue distn.; Heavy Fuel oil; [A complex residuum from the distillation of catalytic reformer fractionator residue. It boils approximately above 399 °C (750 °F).] | Maradékok
(ásványolaj), katalitikus reformáló frakcionáló maradék deszt.; Nehéz gázolaj; [A katalitikus frakcionáló reformálás maradékának komplex desztillációs maradéka. Hozzávetőleges forráspont 399 oC (750 oF) felett.] |
270-792-2 | 68478-13-7 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-026-00-X | Residues (petroleum), heavy coker gas oil and vacuum gas oil; Heavy Fuel oil; [A complex combination of hydrocarbons produced as the residual fraction from the distillation of heavy coker gas oil and vacuum gas oil. It predominantly consists of hydrocarbons having carbon numbers predominantly greater than C13 and boiling above approximately 230 °C (446 °F).] | Maradékok
(ásványolaj), nehéz koksz gázolaj és vákuum gázolaj; Nehéz gázolaj; [Nehéz koksz gázolaj és vákuum gázolaj desztillációjának maradékaként keletkező összetett szénhidrogénkeverék. Főként C13-nál nagyobb szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 230 oC (446 oF) fölött van. |
270-796-4 | 68478-17-1 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-027-00-5 | Residues (petroleum), heavy coker and light vacuum; Heavy Fuel oil; [A complex combination of hydrocarbons produced as the residual fraction from the distillation of heavy coker gas oil and light vacuum gas oil. It consists predominantly of hydrocarbons having carbon numbers predominantly greater than C13 and boiling above approximately 230 °C (446 °F).] | Maradékok
(ásványolaj), nehéz koksz és könnyű vákuum; Nehéz gázolaj; [Nehéz koksz gázolaj és könnyű vákuum gázolaj desztillációjának maradékaként keletkező összetett szénhidrogénkeverék. Főként C13-nél nagyobb szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 230 oC (446 oF) fölött van.] |
270-983-0 | 68512-61-8 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-028-00-0 | Residues (petroleum), light vacuum; Heavy Fuel oil; [A complex residuum from the vacuum distillation of the residuum from the atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly greater than C13 and boiling above approximately 230 °C (446 °F).] | Maradékok
(ásványolaj), könnyű vákuum; Nehéz gázolaj; [Nyersolaj atmoszferikus desztillációs maradékának vákuumdesztillációja útján képzett összetett maradék. Főként C13-nál nagyobb szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 230 oC (446 oF) fölött van. |
270-984-6 | 68512-62-9 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-029-00-6 | Residues (petroleum), steam-cracked light; Heavy Fuel oil; [A complex residuum from the distillation of the products from a steam-cracking process. It consists predominantly of aromatic and unsaturated hydrocarbons having carbon numbers greater than C7 and boiling in the range of approximately 101 °C to 555 °C (214 °F to 1030 °F).] | Maradékok
(ásványolaj), gőzzel krakkolt könnyű; Nehéz gázolaj; [Gőzkrakkolás termékeinek desztillálása során kapott összetett maradék. Főként C7-nél nagyobb szénatomszámú aromás és telítetlen szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 101 oC-555 oC (214 oF-1030 oF).] |
271-013-9 | 68513-69-9 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-030-00-1 | Fuel oil, No 6; Heavy Fuel oil; [A distillate oil having a minimum viscosity of 900 SUS at 37.7 °C (100 °F) to a maximum of 9000 SUS at 37.7 °C (100 °F).] | Üzemanyag
olaj (no.6); Nehéz gázolaj; [Az olajpárlat viszkozitása: minimum 900 SUS 37,7 oC-on (100 oF), maximum 9000 SUS 37,7 oC-on (100 oF).] |
271-384-7 | 68553-00-4 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-031-00-7 | Residues (petroleum), topping plant, low-sulfur; Heavy Fuel oil; [A low-sulfur complex combination of hydrocarbons produced as the residual fraction from the topping plant distillation of crude oil. It is the residuum after the straight-run gasoline cut, kerosene cut and gas oil cut have been removed.] | Maradékok
(ásványolaj), lepárlótorony, alacsony kéntartalom; Nehéz gázolaj; [A nyersolaj lepárlótoronyban végzett atmoszferikus desztillációjának maradék frakciójaként képződő, alacsony kéntartalmú szénhidrogének összetett keveréke. Közvetlen lepárlási maradék a gazolin, kerozin és gázolaj eltávolítása után.] |
271-763-7 | 68607-30-7 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-032-00-2 | Gas oils (petroleum), heavy atmospheric; Heavy Fuel oil; [A complex combination of hydrocarbons obtained by the distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C7 through C35 and boiling in the range of approximately 121 °C to 510 °C (250 °F to 950 °F).] | Gázolajok
(ásványolaj), nehéz atmoszferikus; Nehéz gázolaj; [Nyersolaj desztillációjával nyert összetett szénhidrogénkeverék. Főként C7-C35 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 121 oC-510 oC (250 oF-950 oF). |
272-184-2 | 68783-08-4 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-033-00-8 | Residues (petroleum), coker scrubber, Condensed-ring-arom.-contg.; Heavy Fuel oil; [A very complex combination of hydrocarbons produced as the residual fraction from the distillation of vaccum residuum and the products from a thermal cracking process. It consists predominantly of hydrocarbons having carbon numbers predominantly greater than C20 and boiling above approximately 350 °C (662 °F). This stream is likely to contain 5 wt.% or more of 4- to 6-membered condensed rind aromatic hydrocarbons.] | Maradékok (ásványolaj), koksz mosó, kondenzált gyűrűs aromás tart.; Nehéz gázolaj; [Vákuumdesztillációs maradék és hőkrakkolás termékeinek desztillációs maradékaként nyert nagymértékben összetett szénhidrogénkeverék. Főként C20-nél nagyobb szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 350 oC (662 oF) fölött van. Ez a származék tartalmazhat 5 tömeg% vagy több 4-6 tagú kondenzált gyűrűs aromás szénhidrogéneket is.] | 272-187-9 | 68783-13-1 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-034-00-3 | Distillates (petroleum), petroleum residues vacuum; Heavy Fuel oil; [A complex combination of hydrocarbons produced by the vacuum distillation of the residuum from the atmospheric distillation of crude oil.] | Párlatok
(ásványolaj), ásványolaj maradékok vákuum; Nehéz gázolaj; [Nyersolaj atmoszferikus desztillációs maradékának vákuumdesztillációs termékeként képzett, összetett szénhidrogén keverék.] |
273-263-4 | 68955-27-1 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-035-00-9 | Residues (petroleum), steam-cracked, resinous; Heavy Fuel oil; [A complex residuum from the distillation of steam-cracked petroleum residues.] | Maradékok
(ásványolaj), gőzzel krakkolt, gyantás; Nehéz gázolaj; [Gőzzel krakkolt ásványolaj maradékok összetett desztillációs maradéka.] |
273-272-3 | 68955-36-2 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-036-00-4 | Distillates (petroleum), intermediate vacuum; Heavy Fuel oil; [A complex combination of hydrocarbons produced by the vacuum, distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C14 through C42 and boiling in the range of approximately 250 °C to 545 °C (482 °F to 1013 °F). This stream is likely to contain 5 wt. % or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | Párlatok
(ásványolaj), közép vákuum; Nehéz gázolaj; [Nyersolaj atmoszferikus desztillációs maradékának vákuumdesztillációs termékeként képzett, összetett szénhidrogén keverék. Főként C14-C42 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 250 oC-545 oC (482 oF-1013 oF). Ez a származék tartalmazhat 5 tömeg% vagy több 4-6 tagú kondenzált gyűrűs aromás szénhidrogéneket is.] |
274-683-0 | 70592-76-6 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-037-00-X | Distillates (petroleum), light vacuum; Heavy Fuel oil; [A complex combination of hydrocarbons produced by the vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C11 through C35 and boiling in the range of approximately 250 °C to 545 °C (482 °F to 1013 °F).] | Párlatok
(ásványolaj), könnyű vákuum; Nehéz gázolaj; [Nyersolaj atmoszferikus desztillációs maradékának vákuumdesztillációs termékeként képzett, összetett szénhidrogén keverék. Főként C11-C35 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 250 oC-545 oC (482 oF-1013 oF). |
274-684-6 | 70592-77-7 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-038-00-5 | Distillates (petroleum), vacuum; Heavy Fuel oil; [A complex combination of hydrocarbons produced by the vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having numbers predominantly in the range of C15 through C50 and boiling in the range of approximately 270 °C to 600 °C (518 °F to 1112 °F). This stream is likely to contain 5 wt.% or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | Párlatok
(ásványolaj), vákuum; Nehéz gázolaj; [Nyersolaj atmoszferikus desztillációs maradékának vákuumdesztillációs termékeként képzett, összetett szénhidrogén keverék. Főként C15-C50 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 270 oC-600 oC (518 oF-1112 oF). Ez a származék tartalmazhat 5 tömeg% vagy több 4-6 tagú kondenzált gyűrűs aromás szénhidrogéneket is.] |
274-685-1 | 70592-78-8 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-039-00-0 | Gas oils (petroleum), hydrodesulfurized coker heavy vacuum; Heavy Fuel oil; [A complex combination of hydrocarbons obtained by hydrodesulfurization of heavy coker distillate stocks, It consists predominantly of hydrocarbons having carbon numbers predominantly in the range C18 to C44 and boiling in the range of approximately 304 °C to 548 °C (579 °F to 1018 °F). Likely to contain 5 % or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | Gázolajok
(ásványolaj), hidrogénezéssel kénmentesített koksz nehéz vákuum; Nehéz
gázolaj; [Kokszosító nehéz párlatának hidrogénezés útján végzett kénmentesítésével nyert összetett szénhidrogénkeverék. Főként C18-C44 szénatomszámú telítetlen szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 304 oC-548 oC (579 oF-1018 oF). Tartalmazhat 5 tömeg% vagy több 4-6 tagú kondenzált gyűrűs aromás szénhidrogéneket is.] |
285-555-9 | 85117-03-9 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-040-00-6 | Residues (petroleum), steam-cracked, distillates; Heavy Fuel oil; [A complex combination of hydrocarbons obtained during the production of refined petroleum tar by the distillation of steam cracked tar. It consists predominantly of aromatic and other hydrocarbons and organic sulfur compounds.] | Maradékok
(ásványolaj), gőzzel krakkolt, desztillátum; Nehéz gázolaj; [A finomított ásványolaj kátrány előállítása során gőzzel krakkolt kátrányból nyert összetett szénhidrogénkeverék. Elsősorban aromás és más szénhidrogéneket, valamint szerves kénvegyületeket tartalmaz.] |
292-657-7 | 90669-75-3 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-041-00-1 | Residues (petroleum), vacuum, light; Heavy Fuel oil; [A complex residuum from the vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists predominantly of hydrocarbons having carbon numbers predominantly greater than C24 and boiling above approximately 390 °C (734 °F).] | Maradékok
(ásványolaj) vákuum, könnyű; Nehéz gázolaj; [Nyersolaj atmoszferikus desztillációs maradékának vákuumdesztillációja útján képzett összetett maradék. Főként C24-nél nagyobb szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 390 oC (734 oF) fölött van.] |
292-658-2 | 90669-76-4 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-042-00-7 | Fuel oil, heavy, high-sulfur; Heavy Fuel oil; [A complex combination of hydrocarbons obtained by the distillation of crude petroleum. It consists predominantly of aliphatic, aromatic and cycloaliphatic hydrocarbons having carbon numbers predominantly higher than C25 and boiling above approximately 400 °C (752 °F).] | Üzemanyag
olaj, nehéz, magas kéntartalmú; Nehéz gázolaj; [Nyers ásványolaj desztillációjával nyert összetett szénhidrogénkeverék. Főként C25-nél nagyobb szénatomszámú alifás, aromás és cikloalifás szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 400 oC (752 oF) fölött van. |
295-396-7 | 92045-14-2 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-043-00-2 | Residues (petroleum), catalytic cracking; Heavy Fuel oil; [A complex combination of hydrocarbons produced as the residual fraction from the distillation of the products from a catalytic cracking process. It consists predominantly of hydrocarbons having carbon numbers predominantly greater than C11 and boiling above approximately 200 °C (392 °F).] | Maradékok
(ásványolaj) katalitikus krakkolás; Nehéz gázolaj; [Katalitikus krakkolási folyamat eredményeként kapott termékek desztillálásának maradék frakciójaként nyert összetett szénhidrogénkeverék. Főként C11-nél nagyobb szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 200 oC (392 oF) fölött van.] |
295-511-0 | 92061-97-7 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-044-00-8 | Distillates (petroleum), intermediate catalytic cracked, thermally degraded; Heavy Fuel oil; [A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process which has been used as a heat transfer fluid. It consists predominantly of hydrocarbons boiling in the range of approximately 220 °C to 450 °C (428 °F to 842 °F). This stream is likely to contain organic sulfur compounds.] | Párlatok
(ásványolaj), közepes katalitikus krakkolás, termikus bontás; Nehéz gázolaj; [Szénhidrogének összetett keveréke, melyet katalitikus krakkolási folyamat termékeinek desztillációjával nyernek és hőátadó közegként használatos. Főként olyan szénhidrogénekből áll, melyek hozzávetőleges forráspont-tartománya 220 oC-450 oC (428 oF-842 oF). Ez a származék szerves kénvegyületeket is tartalmazhat.] |
295-990-6 | 92201-59-7 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-045-00-3 | Residual oils (petroleum); Heavy Fuel oil; [A complex combination of hydrocarbons, sulfur compounds and metal-containing organic compounds obtained as the residue from refinery fractionation cracking processes. It produces a finished oil with a viscosity above 2cSt. at 100 °C.] | Maradék
olajok (ásványolaj); Nehéz gázolaj; [Finomítóban végzett frakcionált krakkolás maradékaként nyert, szénhidrogéneket, kénvegyületeket és fém-organikus vegyületeket tartalmazó összetett keverék. A végtermék olaj viszkozitása 100 oC-on meghaladja a 2 cSt értéket.] |
298-754-0 | 93821-66-0 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-046-00-9 | Residues, steam cracked, thermally treated; Heavy Fuel oil; [A complex combination of hydrocarbons obtained by the treatment and distillation of raw steam-cracked naphtha. It consists predominantly of unsaturated hydrocarbons boiling in the range above approximately 180 °C (356 °F).] | Maradékok,
gőzzel krakkolt, hőkezelt; Nehéz gázolaj; [A nyers, gőzzel krakkolt nafta hőkezelt és desztillált származékaként nyert összetett szénhidrogénkeverék. Elsősorban telítetlen szénhidrogénekből áll, hozzávetőleges forrásponttartománya 180 oC (356 oF) felett van.] |
308-733-0 | 98219-64-8 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-047-00-4 | Distillates (petroleum), hydrodesulfurized full-range middle; Heavy Fuel oil; [A complex combination of hydrocarbons obtained by treating a petroleum stock with hydrogen. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C9 through C25 and boiling in the range of approximately 150 °C to 400 °C (302 °F to 752 °F).] | Párlatok
(ásványolaj) hidrogénnel kénmentesített, teljes közép tartomány; Nehéz
gázolaj; [Ásványolaj párlat hidrogénezésével nyert összetett szénhidrogénkeverék. Főként C9-C25 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 150 oC-400 oC (302 oF-752 oF). |
309-863-0 | 101316-57-8 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-048-00-X | Residues (petroleum), catalytic reformer fractionator; Heavy Fuel oil; [A complex combination of hydrocarbons produced as the residual fraction from distillation of the product from a catalytic reforming process. It consists of predominantly aromatic hydrocarbons having carbon numbers predominantly in the range of C10 through C25 and boiling in the range of approximately 160 °C to 400 °C (320 °F to 725 °F). This stream is likely to contain 5 wt. % or more of 4- or 6-membered condensed ring aromatic hydrocarbons.] | Maradékok
(ásványolaj), katalitikus reformáló frakcionáló; Nehéz gázolaj; [Katalitikus reformáló folyamat eredményeként kapott termékek desztillálásának maradék frakciójaként kapott összetett szénhidrogénkeverék. Főként C10-C25 szénatomszámú aromás szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 160 oC-400 oC (320 oF-725 oF). Ez a származék tartalmazhat 5 tömeg% vagy több 4-6 tagú kondenzált gyűrűs aromás szénhidrogéneket is.] |
265-069-3 | 64741-67-9 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-049-00-5 | Petroleum; Crude oil; [A complex combination of hydrocarbons, It consists predominantly of aliphatic, alicyclic and aromatic hydrocarbons. It may also contain small amounts of nitrogen, oxygen and sulfur compounds. This category encompasses light, medium, and heavy petroleums, as well as the oils extended from tar sands. Hydrocarbonaceous materials requiring major chemical changes for their recovery or conversion to petroleum refinery feedstocks such as crude shale oils; upgraded shale oils and liquid coal fuels are not included in this definition.] | Ásványolaj;
Nehéz gázolaj; [Főként alifás, aliciklikus és aromás szénhidrogénekből álló összetett szénhidrogénkeverék. Kis mennyiségben nitrogén-, oxigén- és kéntartalmú vegyületeket is tartalmazhat. Ebbe a kategóriába tartoznak a könnyű, közép és nehéz ásványolajok és a kátrányhomokból extrahált olajok. Nem sorolhatók ebbe a meghatározásba az olyan szénhidrogén tartalmú anyagok, amelyek csak nagyobb vegyi átalakítással (visszanyerés vagy konverzió) tehetők alkalmassá az olajfinomítókban való betáplálásra, mint például a nyers és a dúsított palaolajok és a folyékony szén-tüzelőanyagok.] |
232-298-5 | 8002-05-9 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-050-00-0 | Distillates (petroleum), light paraffinic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons produced by vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100 °F (19cSt at 40 °C). It contains a relatively large proportion of saturated aliphatic hydrocarbons normally present in this distillation range of crude oil.] | Párlatok
(ásványolaj), könnyű paraffinos; Nem finomított és közepesen finomított alapolaj; [Nyersolaj atmoszferikus desztillációs maradékának vákuumdesztillációs termékeként képzett, összetett szénhidrogén keverék. Főként C15-C30 szénatomszámú szénhidrogénekből áll, és végtermék olajként viszkozitása nem éri el a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). Viszonylag nagy mennyiségben tartalmaz telített alifás szénhidrogéneket, melyek általában a nyersolaj ilyen hőmérséklet-tartományban végzett lepárlásakor jelen vannak.] |
265-051-5 | 64741-50-0 | Carc.
1A |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-051-00-6 | Distillates (petroleum), heavy paraffinic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons produced by vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of at least 100 SUS at 100 °F (19cSt at 40 °C). It contains a relatively large proportion of saturated aliphatic hydrocarbons.] | Párlatok
(ásványolaj), nehéz paraffinos; Nem finomított és közepesen finomított alapolaj; [Nyersolaj atmoszferikus desztillációs maradékának vákuumdesztillációs termékeként képzett, összetett szénhidrogén keverék. Főként C20-C50 szénatomszámú szénhidrogénekből áll, és végtermék olajként viszkozitása eléri vagy meghaladja a 100 SUS értéket 100 oF-on (19 cSt értéket 40 oC-on). Viszonylag nagy mennyiségben tartalmaz telített alifás szénhidrogéneket.] |
265-052-0 | 64741-51-1 | Carc.
1A |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-052-00-1 | Distillates (petroleum), light naphthenic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons produced by vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100 °F (19cSt at 40 °C). It contains relatively few normal paraffins.] | Párlatok
(ásványolaj), könnyű nafténes; Nem finomított és közepesen finomított alapolaj; [Nyersolaj atmoszferikus desztillációs maradékának vákuumdesztillációs termékeként képzett, összetett szénhidrogén keverék. Főként C15-C30 szénatomszámú szénhidrogénekből áll, és végtermék olajként viszkozitása nem éri el a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). Viszonylag kevés normál paraffint tartalmaz.] |
265-053-6 | 64741-52-2 | Carc.
1A |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-053-00-7 | Distillates (petroleum), heavy naphthenic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons produced by vacuum distillation of the residuum from atmospheric distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of at least 100 SUS at 100 °F (19cSt at 40 °C). It contains relatively few normal paraffins.] | Párlatok
(ásványolaj), nehéz nafténes; Nem finomított és közepesen finomított alapolaj; [Nyersolaj atmoszferikus desztillációs maradékának vákuumdesztillációs termékeként képzett, összetett szénhidrogén keverék. Főként C20-C50 szénatomszámú szénhidrogénekből áll, és végtermék olajként viszkozitása eléri vagy meghaladja a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). Viszonylag kevés normál paraffint tartalmaz.] |
265-054-1 | 64741-53-3 | Carc.
1A |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-054-00-2 | Distillates (petroleum), acid-treated heavy naphthenic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of at least 100 SUS at 100 °F (19cSt at 40 °C). It contains relatively few normal paraffins.] | Párlatok
(ásványolaj), savval kezelt nehéz nafténes; Nem finomított és közepesen
finomított alapolaj; [Kénsavas kezelés során raffinátumként nyert összetett szénhidrogénkeverék. Főként C20-C50 szénatomszámú szénhidrogénekből áll, és végtermék olajként viszkozitása eléri vagy meghaladja a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). Viszonylag kevés normál paraffint tartalmaz.] |
265-117-3 | 64742-18-3 | Carc.
1A |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-055-00-8 | Distillates (petroleum), acid-treated light naphthenic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100 °F (19cSt at 40 °C). It contains relatively few normal paraffins.] | Párlatok
(ásványolaj), savval kezelt könnyű nafténes; Nem finomított és közepesen
finomított alapolaj; [Kénsavas kezelés során raffinátumként nyert összetett szénhidrogénkeverék. Főként C15-C30 szénatomszámú szénhidrogénekből áll, és végtermék olajként viszkozitása nem éri el a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). Viszonylag kevés normál paraffint tartalmaz.] |
265-118-9 | 64742-19-4 | Carc.
1A |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-056-00-3 | Distillates (petroleum), acid-treated heavy paraffinic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid process. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil having a viscosity of a least 100 SUS at 100 °F (19cSt at 40 °C).] | Párlatok
(ásványolaj), savval kezelt nehéz paraffinos; Nem finomított és közepesen
finomított alapolaj; [Kénsavas kezelés során raffinátumként nyert összetett szénhidrogénkeverék. Főként C20-C50 szénatomszámú telített szénhidrogénekből áll, és végtermék olajként viszkozitása eléri vagy meghaladja a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). |
265-119-4 | 64742-20-7 | Carc.
1A |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-057-00-9 | Distillates (petroleum), acid-treated light paraffinic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil having a viscosity of less than 100 SUS at 100 °F (19cSt at 40 °C).] | Párlatok
(ásványolaj), savval kezelt könnyű paraffinos; Nem finomított és közepesen
finomított alapolaj; [Kénsavas kezelés során raffinátumként nyert összetett szénhidrogénkeverék. Főként C15-C30 szénatomszámú telített szénhidrogénekből áll, és végtermék olajként viszkozitása nem éri el a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). |
265-121-5 | 64742-21-8 | Carc.
1A |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-058-00-4 | Distillates (petroleum), chemically neutralized heavy paraffinic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons obtained from a treating process to remove acidic materials. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of at least 100 SUS at 100 °F (19cSt at 40 °C). It contains a relatively large proportion of aliphatic hydrocarbons.] | Párlatok
(ásványolaj), kémiailag közömbösített nehéz paraffinos; Nem finomított és közepesen finomított alapolaj; [A savas maradék eltávolítása érdekében végzett kezelés eredményeképpen nyert összetett szénhidrogénkeverék. Főként C20-C50 szénatomszámú szénhidrogénekből áll, és végtermék olajként viszkozitása eléri vagy meghaladja a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). Viszonylag nagy arányban tartalmaz alifás szénhidrogéneket.] |
265-127-8 | 64742-27-4 | Carc.
1A |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-059-00-X | Distillates (petroleum), chemically neutralized light paraffinic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity less than 100 SUS at 100 °F (19cSt at 40 °C).] | Párlatok
(ásványolaj), kémiailag közömbösített könnyű parafinos; Nem finomított és közepesen finomított alapolaj; [A savas maradék eltávolítása érdekében végzett kezelés eredményeképpen nyert összetett szénhidrogénkeverék. Főként C15-C30 szénatomszámú szénhidrogénekből áll, és végtermék olajként viszkozitása nem éri el a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). |
265-128-3 | 64742-28-5 | Carc.
1A |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-060-00-5 | Distillates (petroleum), chemically neutralized heavy naphthenic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of at least 100 SUS at 100 °F (19cSt at 40 °C). It contains relatively few normal paraffins.] | Párlatok
(ásványolaj), kémiailag közömbösített nehéz nafténes; Nem finomított és közepesen finomított alapolaj; [A savas maradék eltávolítása érdekében végzett kezelés eredményeképpen nyert összetett szénhidrogénkeverék. Főként C20-C50 szénatomszámú szénhidrogénekből áll, és végtermék olajként viszkozitása eléri vagy meghaladja a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). Viszonylag kevés normál paraffint tartalmaz.] |
265-135-1 | 64742-34-3 | Carc.
1A |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-061-00-0 | Distillates (petroleum), chemically neutralized light naphthenic; Unrefined or mildly refined baseoil; [A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS a 100 °F (19cSt at 40 °C). It contains relatively few normal paraffins.] | Párlatok
(ásványolaj), kémiailag közömbösített könnyű nafténes; Nem finomított és közepesen finomított alapolaj; [A savas maradék eltávolítása érdekében végzett kezelés eredményeképpen nyert összetett szénhidrogénkeverék. Főként C15-C30 szénatomszámú szénhidrogénekből áll, és végtermék olajként viszkozitása nem éri el a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). Viszonylag kevés normál paraffint tartalmaz.] |
265-136-7 | 64742-35-4 | Carc.
1A |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-062-00-6 | Gases (petroleum), catalytic cracked naphtha depropanizer overhead, C3-rich acid-free; Petroleum gas; [A complex combination of hydrocarbons obtained from fractionation of catalytic cracked hydrocarbons and treated to remove acidic impurities. It consists of hydrocarbons having carbon numbers in the range of C2 through C4, predominantly C3.] | Gázok
(ásványolaj), katalitikusan krakkolt benzin propánmentesített fejtermék,
C3-ban gazdag savmentes; Ásványolaj gáz; [Katalitikusan krakkolt szénhidrogének frakcionálásával előállított és a savas szennyeződések eltávolítása céljából megfelelően kezelt összetett szénhidrogénkeverék. Olyan szénhidrogénekből áll, melyek szénatomszáma a C2-C4 tartományban van, főként C3.] |
270-755-0 | 68477-73-6 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-063-00-1 | Gases (petroleum), catalytic cracker; Petroleum gas; [A complex combination of hydrocarbons produced by the distillation of the products from a catalytic cracking process. It consists predominantly of aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | Gázok
(ásványolaj), katalitikus krakkoló; Ásványolaj gáz; [Katalitikus krakkolási eljárásból származó termékek desztillálásával nyert összetett szénhidrogénkeverék. Főként C1-C6 szénatomszámú alifás szénhidrogénekből áll.] |
270-756-6 | 68477-74-7 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-064-00-7 | Gases (petroleum), catalytic cracker, C1-5-rich; Petroleum gas; [A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process. It consists of aliphatic hydrocarbons having carbon numbers in the range of C1 through C6, predominantly C1 through C5.] | Gázok
(ásványolaj), katalitikus krakkoló, C1-5-ben gazdag; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet katalitikus krakkolási folyamat termékeinek desztillációjával nyernek. Főleg olyan alifás szénhidrogénekből áll, melyek szénatomszáma a C1-C6 tartományban van, de túlnyomórészt C1-C5.] |
270-757-1 | 68477-75-8 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-065-00-2 | Gases (petroleum), catalytic polymd. naphtha stabilizer overhead, C2-4-rich; Petroleum gas; [A complex combination of hydrocarbons obtained from the fractionation stabilization of catalytic polymerized naphtha. It consists of aliphatic hydrocarbons having carbon numbers in the range of C2 through C6, predominantly C2 through C4.] | Gázok
(ásványolaj), katalitikusan polim. benzin stabilizált fejtermék, C2-4-ben
gazdag; Ásványolaj gáz; [Katalitikusan polimerizált benzin frakcionált stabilizálásából nyert összetett szénhidrogénkeverék. Főleg olyan alifás szénhidrogénekből áll, melyek szénatomszáma a C2-C6 tartományban van, de túlnyomórészt C2-C4.] |
270-758-7 | 68477-76-9 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-066-00-8 | Gases (petroleum), catalytic reformer, C1-4-rich; Petroleum gas; [A complex combination of hydrocarbons produced by distillation of products from a catalytic reforming process. It consists of hydrocarbons having carbon numbers in the range of C1 through C6, predominantly C1 through C4.] | Gázok
(ásványolaj), katalitikus reformer, C1-4-ben gazdag; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet katalitikus reformálással előállított termékek desztillációjával nyernek. Főleg olyan szénhidrogénekből áll, melyek szénatomszáma a C1-C6 tartományban van, de túlnyomórészt C1-C4.] |
270-760-8 | 68477-79-2 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-067-00-3 | Gases (petroleum), C3-5 olefinic-paraffinic alkylation feed; Petroleum gas; [A complex combination of olefinic and paraffinic hydrocarbons having carbon numbers in the range of C3 through C5 which are used as alkylation feed. Ambient temperatures normally exceed the critical temperature of these combinations.] | Gázok
(ásványolaj), C3-5 olefines-paraffinos alkilezési alapanyag; Ásványolaj
gáz; [Olefines és paraffinos szénhidrogének (szénatomszám: C3-C5) összetett keveréke, melyet alkilezési alapanyagként használnak. A környezeti hőmérséklet általában magasabb, mint ezeknek az elegyeknek a kritikus hőmérséklete.] |
270-765-5 | 68477-83-8 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-068-00-9 | Gases (petroleum), C4-rich; Petroleum gas; [A complex combination of hydrocarbons produced by distillation of products from a catalytic fractionation process. It consists of aliphatic hydrocarbons having carbon numbers in the range of C3 through C5, predominantly C4.] | Gázok
(ásványolaj), C4-ben gazdag; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet katalitikus frakcionálással előállított termékek desztillációjával nyernek. Főleg olyan alifás szénhidrogénekből áll, melyek szénatomszáma a C3-C5 tartományban van, de túlnyomórészt C4.] |
270-767-6 | 68477-85-0 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-069-00-4 | Gases (petroleum), deethanizer overheads; Petroleum gas; [A complex combination of hydrocarbons produced from distillation of the gas and gasoline fractions from the catalytic cracking process. It contains predominantly ethane and ethylene.] | Gázok
(ásványolaj), etánmentesítő fejpárlat; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet a katalitikus krakkolási folyamat gáz és benzin frakciójának desztillálásával nyernek. Főleg etánból és etilénből áll.] |
270-768-1 | 68477-86-1 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-070-00-X | Gases (petroleum), deisobutanizer tower overheads; Petroleum gas; [A complex combination of hydrocarbons produced by the atmospheric distillation of a butane-butylene stream. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C3 through C4.] | Gázok
(ásványolaj), izobután-mentesítő torony fejpárlatok; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet bután-butilén elegy atmoszferikus desztillációjával állítanak elő. Főként C3-C4 szénatomszámú alifás szénhidrogénekből áll.] |
270-769-7 | 68477-87-2 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-071-00-5 | Gases (petroleum), depropanizer dry, propene-rich; Petroleum gas; [A complex combination of hydrocarbons produced by the distillation of products from the gas and gasoline fractions of a catalytic cracking process. It consists predominantly of propylene with some ethane and propane.] | Gázok
(ásványolaj), propánmentesítő száraz, propilénben gazdag; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet a katalitikus krakkolási folyamat során előállított gáz és benzin frakciók termékeinek desztillálásával nyernek. Főleg propilénből, valamint kevés etánból és propánból áll.] |
270-772-3 | 68477-90-7 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-072-00-0 | Gases (petroleum), depropanizer overheads; Petroleum gas; [A complex combination of hydrocarbons produced by distillation of products from the gas and gasoline fractions of a catalytic cracking process. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C4.] | Gázok
(ásványolaj), propánmentesítő fejpárlatok; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet a katalitikus krakkolási folyamat során előállított gáz és benzin frakciók termékeinek desztillálásával nyernek. Főként C2-C4 szénatomszámú alifás szénhidrogénekből áll.] |
270-773-9 | 68477-91-8 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-073-00-6 | Gases (petroleum), gas recovery plant depropanizer overheads; Petroleum gas; [A complex combination of hydrocarbons obtained by fractionation of miscellaneous hydrocarbon streams. It consists predominantly of hydrocarbons having carbon numbers in the range of C1 through C4, predominantly propane.] | Gázok
(nyersolaj), gázregeneráló berendezés propánmentesítő fejpárlatok; Ásványolaj
gáz; [Szénhidrogének összetett keveréke, melyet vegyes folyékony szénhidrogének frakcionálásával állítanak elő. Főként C1-C4 szénatomszámú szénhidrogénekből áll, elsősorban propánt.] |
270-777-0 | 68477-94-1 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-074-00-1 | Gases (petroleum), Girbotol unit feed; Petroleum gas; [A complex combination of hydrocarbons that is used as the feed into the Girbatol unit to remove hydrogen sulfide. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C4.] | Gázok
(ásványolaj), Girbotol-egység nyersanyaga; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet a Girbotol-egység nyersanyagaként használnak hidrogén-szulfid eltávolítása céljából. Főként C2-C4 szénatomszámú alifás szénhidrogénekből áll.] |
270-778-6 | 68477-95-2 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-075-00-7 | Gases (petroleum), isomerized naphtha fractionator, C4-rich, hydrogen sulfide-free; Petroleum gas | Gázok
(ásványolaj), izomerizált benzin frakcionáló, C4-ben gazdag,
hidrogén-szulfid-mentes; Ásványolaj gáz |
270-782-8 | 68477-99-6 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-076-00-2 | Tail gas (petroleum), catalytic cracked clarified oil and thermal cracked vacuum residue fractionation reflux drum; Petroleum gas; [A complex combination of hydrocarbons obtained from fractionation of catalytic cracked clarified oil and thermal cracked vacuum residue. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | Véggáz
(ásványolaj), katalitikusan krakkolt, derített olaj és vákuum hőkrakkolt
maradék frakcionáló reflux henger; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet katalitikusan krakkolt, derített olaj és vákuum hőkrakkolt maradék frakcionálásával nyernek. Főként C1-C6 szénatomszámú szénhidrogénekből áll.] |
270-802-5 | 68478-21-7 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-077-00-8 | Tail gas (petroleum), catalytic cracked naphtha stabilization absorber; Petroleum gas; [A complex combination of hydrocarbons obtained from the stabilization of catalytic cracked naphtha. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | Véggáz
(ásványolaj), katalitikusan krakkolt benzin stabilizáló abszorber; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet katalitikusan krakkolt benzin stabilizálásával állítanak elő. Főként C1-C6 szénatomszámú szénhidrogénekből áll.] |
270-803-0 | 68478-22-8 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-078-00-3 | Tail gas (petroleum), catalytic cracker, catalytic reformer and hydrodesulfurizer combined fractionater; Petroleum gas; [A complex combination of hydrocarbons obtained from the fractionation of products from catalytic cracking, catalytic reforming and hydrodesulfurizing processes treated to remove acidic impurities. It consists predominantly of hydrocarbons having cabon numbers predominantly in the range of C1 through C5.] | Véggáz
(ásványolaj), katalitikus krakkoló, katalitikus reformer és hidrogénes
kéntelenítővel kombinált frakcionáló; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet katalitikus krakkolásból, katalitikus reformálásból és hidrogénes kéntelenítésből származó, a savas szennyeződések eltávolítása céljából kezelt termékekből állítanak elő. Főként C1-C5 szénatomszámú szénhidrogénekből áll.] |
270-804-6 | 68478-24-0 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-079-00-9 | Tail gas (petroleum), catalytic reformed naphtha fractionation stabilizer; Petroleum gas; [A complex combination of hydrocarbons obtained from the fractionation stabilization of catalytic reformed naphtha. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | Véggáz
(ásványolaj), katalitikusan reformált benzin frakcionált stabilizátor; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet a katalitikusan reformált benzin frakcionált stabilizációjával állítanak elő. Főként C1-C4 szénatomszámú szénhidrogénekből áll.] |
270-806-7 | 68478-26-2 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-080-00-4 | Tail gas (petroleum), saturate gas plant mixed stream, C4-rich; Petroleum gas; [A complex combination of hydrocarbons obtained from the fractionation stabilization of straight-run naphtha, distillation tail gas and catalytic reformed naphtha stabilizer tail gas. It consists of hydrocarbons having carbon numbers in the range of C3 through C6, predominantly butane and isobutane.] | Véggáz
(ásványolaj), telítőgáz berendezés kevert áram, C4-ben gazdag; Ásványolaj
gáz; [Szénhidrogének összetett keveréke, melyet közvetlen lepárlású benzin, desztillációs véggáz és katalitikusan reformált benzin stabilizáló véggáz frakcionált stabilizálásával nyernek. C3-C6 szénatomszámú szénhidrogénekből áll, elsősorban butánt és izobutánt.] |
270-813-5 | 68478-32-0 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-081-00-X | Tail gas (petroleum), saturate gas recovery plant, C1-2-rich; Petroleum gas; [A complex combination of hydrocarbons obtained from fractionation of distillate tail gas, straight-run naphtha, catalytic reformed naphtha stabilizer tail gas. It consists predominantly of hydrocarbons having carbon numbers in the range of C1through C5, predominantly methane and ethane.] | Véggáz
(ásványolaj), telítőgáz visszanyerő berendezés, C1-2-ben gazdag; Ásványolaj
gáz; [Szénhidrogének összetett keveréke, melyet desztillációs véggáz, közvetlen lepárlású benzin és katalitikusan reformált benzin stabilizáló véggáz frakcionálásából nyernek. Főként C1-C5 szénatomszámú szénhidrogénekből áll, elsősorban metánt és propánt.] |
270-814-0 | 68478-33-1 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-082-00-5 | Tail gas (petroleum), vacuum residues thermal cracker; Petroleum gas; [A complex combination of hydrocarbons obtained from the thermal cracking of vacuum residues. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | Véggáz
(ásványolaj), vákuum maradékok, hőkrakkolás; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet a vákuum maradékok hőkrakkolásával állítanak elő. Főként C1-C5 szénatomszámú szénhidrogénekből áll.] |
270-815-6 | 68478-34-2 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-083-00-0 | Hydrocarbons, C3-4-rich, petroleum distillate; Petroleum gas; [A complex combination of hydrocarbons produced by distillation and condensation of crude oil. It consists of hydrocarbons having carbon numbers in the range of C3 through C5, predominantly C3 through C4.] | Szénhidrogének,
C3-4-ben gazdag, ásványolaj desztillátum; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet nyersolaj desztillációjával és kondenzációjával állítanak elő. Főleg olyan szénhidrogénekből áll, melyek szénatomszáma a C3-C5 tartományban van, de túlnyomórészt C3-C4.] |
270-990-9 | 68512-91-4 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-084-00-6 | Gases (petroleum), full-range straight-run naphtha dehexanizer off; petroleum gas; [A complex combination of hydrocarbons obtained by the fractionation of the full-range straight-run naphtha. It consists of hydrocarbons having carbon numbers predominantly in the range of C2 through C6.] | Gázok
(nyersolaj), teljes közvetlen lepárlású benzin, hexánmentesítő maradék;
Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet teljes közvetlen lepárlású benzin frakcionálásával nyernek. Főként C2-C6 szénatomszámú szénhidrogénekből áll.] |
271-000-8 | 68513-15-5 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-085-00-1 | Gases (petroleum), hydrocracking depropanizer off, hydrocarbon-rich; Petroleum gas; [A complex combination of hydrocarbon produced by the distillation of products from a hydrocracking process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C4. It may also contain small amounts of hydrogen and hydrogen sulfide.] | Gázok
(ásványolaj), hidrokrakkoló propánmentesítő távozó terméke, szénhidrogénben
gazdag; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet hidrokrakkolási folyamatból származó termékek desztillációjával állítanak elő. Főként C1-C4 szénatomszámú szénhidrogénekből áll. Kis mennyiségben hidrogént és hidrogén-szulfidot is tartalmazhat.] |
271-001-3 | 68513-16-6 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-086-00-7 | Gases (petroleum), light straight-run naphtha stabilizer off; Petroleum gas; [A complex combination of hydrocarbons obtained by the stabilization of light straight-run naphtha. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C6.] | Gázok
(ásványolaj), közvetlen lepárlású könnyűbenzin stabilizátor távozó
terméke; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet közvetlen lepárlású könnyűbenzin stabilizálásával nyernek. Főként C2-C6 szénatomszámú telített alifás szénhidrogénekből áll.] |
271-002-9 | 68513-17-7 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-087-00-2 | Residues (petroleum), alkylation splitter, C4-rich; Petroleum gas; [A complex residuum from the distillation of streams various refinery operations. It consists of hydrocarbons having carbon numbers in the range of C4 through C5, predominantly butane and boiling in the range of approximately – 11.7 °C to 27.8 °C (11 °F to 82 °F).] | maradékok
(ásványolaj), alkilező hasító, C4-ben gazdag; Ásványolaj gáz; [Különféle finomítási műveletekből származó származékok desztillációjából nyert összetett maradék. C4-C5 szénatomszámú szénhidrogénekből, elsősorban butánból áll, hozzávetőleges forráspont-tartománya –11,7 oC- 27,8 oC (11 oF-82 oF).] |
271-010-2 | 68513-66-6 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-088-00-8 | Hydrocarbons, C1-4; Petroleum gas; [A complex combination of hydrocarbons provided by thermal cracking and absorber operations and by distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C4 and boiling in the range of approximately minus 164 °C to minus 0.5 °C (– 263 °F to 31 °F).] | Szénhidrogének,
C1-4; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet hőkrakkolással és abszorber műveletekkel, valamint nyersolaj desztillációjával állítanak elő. Főként C1-C4 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya –164 oC és –0,5 oC (–263 oF és 31 oF) között van.] |
271-032-2 | 68514-31-8 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-089-00-3 | Hydrocarbons, C1-4, sweetened; Petroleum gas; [A complex combination of hydrocarbons obtained by subjecting hydrocarbon gases to a sweetening process to convert mercaptans or to remove acidic impurities. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C4 and boiling in the range of approximately – 164 °C to – 0.5 °C (– 263 °F to 31 °F).] | Szénhidrogének,
C1-4, kéntelenített; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet úgy állítanak elő, hogy szénhidrogén gázokat kéntelenítő eljárásnak vetnek alá a merkaptánok konverziója vagy a savas szennyeződések eltávolítása céljából. Főként C1-C4 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya –164 oC és –0,5 oC (–263 oF és 31 oF) között van.] |
271-038-5 | 68514-36-3 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-090-00-9 | Hydrocarbons, C1-3; Petroleum gas; [A complex combination of hydrocarbons having carbon numbers predominantly in the range of C1 through C3 and boiling in the range of approximately minus 164 °C to minus 42 °C (– 263 °F to – 44 °F).] | Szénhidrogének,
C1-3; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyek szénatomszáma főleg a C1-C3 tartományban van, és hozzávetőleges forráspont-tartománya –164 oC és –42 oC (–263 oF és –44 oF) között van.] |
271-259-7 | 68527-16-2 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-091-00-4 | Hydrocarbons, C1-4, debutanizer fraction; Petroleum gas | Szénhidrogének,
C1-4, butánmentesítő frakció; Ásványolaj gáz |
271-261-8 | 68527-19-5 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-092-00-X | Gases (petroleum), C1-5, wet; Petroleum gas; [A complex combination of hydrocarbons produced by the distillation of crude oil and/or the cracking of tower gas oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | Gázok
(ásványolaj), C1-5, nedves; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet nyersolaj desztillációjával és/vagy toronygáz olaj krakkolásával állítanak elő. Főként C1-C5 szénatomszámú szénhidrogénekből áll.] |
271-624-0 | 68602-83-5 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-093-00-5 | Hydrocarbons, C2-4; Petroleum gas | Szénhidrogének, C2-4; Ásványolaj gáz; | 271-734-9 | 68606-25-7 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-094-00-0 | Hydrocarbons, C3; Petroleum gas | Szénhidrogének, C3; Ásványolaj gáz; | 271-735-4 | 68606-26-8 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-095-00-6 | Gases (petroleum), alkylation feed; Petroleum gas; [A complex combination of hydrocarbons produced by the catalytic cracking of gas oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C3 through C4.] | Gázok
(ásványolaj), alkilezési nyersanyag; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet gázolaj katalitikus krakkolásával állítanak elő. Főként C3-C4 szénatomszámú szénhidrogénekből áll.] |
271-737-5 | 68606-27-9 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-096-00-1 | Gases (petroleum), depropanizer bottoms fractionation off; Petroleum gas; [A complex combination of hydrocarbons obtained from the fractionation of depropanizer bottoms. It consists predominantly of butane, isobutane and butadiene.] | Gázok
(nyersolaj), propánmentesítő fenéktermékek frakcionálási távozó terméke;
Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet propánmentesítő fenéktermékeinek frakcionálásával nyernek. Főleg butánból, izobutánból és butadiénből áll.] |
271-742-2 | 68606-34-8 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-097-00-7 | Gases (petroleum), refinery blend; Petroleum gas; [A complex combination obtained from various processes. It consists of hydrogen, hydrogen sulfide and hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | Gázok
(ásványolaj), finomított elegy; Ásványolaj gáz; [Összetett keverék, melyet különféle folyamatokból nyernek. Hidrogént, hidrogén-szulfidot és főként C1-C5 szénatomszámú szénhidrogénekből áll.] |
272-183-7 | 68783-07-3 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-098-00-2 | Gases (petroleum), catalytic cracking; Petroleum gas; [A complex combination of hydrocarbons produced by the distillation of the products from a catalytic cracking process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C3 through C5.] | Gázok
(ásványolaj), katalitikus krakkolás; Ásványolaj gáz; [Katalitikus krakkolási eljárásból származó termékek desztillálásával nyert összetett szénhidrogénkeverék. Főként C3-C5 szénatomszámú szénhidrogénekből áll.] |
272-203-4 | 68783-64-2 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-099-00-8 | Gases (petroleum), C2-4, sweetened; Petroleum gas; [A complex combination of hydrocarbons obtained by subjecting a petroleum distillate to a sweetening process to convert mercaptans or to remove acidic impurities. It consists predominantly of saturated and unsaturated hydrocarbons having carbon numbers predominantly in the range of C2 through C4 and boiling in the range of approximately – 51 °C to – 34 °C (– 60 °F to – 30 °F).] | Gázok
(ásványolaj), C2-4, kéntelenített; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet úgy állítanak elő, hogy nyersolaj desztillátumot kéntelenítési eljárásnak vetnek alá a merkaptánok konvertálása vagy a savas szennyeződések eltávolítása céljából. Főként C2-C4 szénatomszámú telített és telítetlen szénhidrogénekből áll, és hozzávetőleges forráspont-tartománya –51 oC és –34 oC (–60 oF és –30 oF) között van.] |
272-205-5 | 68783-65-3 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-100-00-1 | Gases (petroleum), crude oil fractionation off; Petroleum gas; [A complex combination of hydrocarbons produced by the fractionation of crude oil. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | Gázok
(ásványolaj), nyersolaj frakcionálás távozó terméke; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet nyersolaj frakcionálásával állítanak elő. Főként C1-C5 szénatomszámú telített alifás szénhidrogénekből áll.] |
272-871-7 | 68918-99-0 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-101-00-7 | Gases (petroleum), dehexanizer off; Petroleum gas; [A complex combination of hydrocarbons obtained by the fractionation of combined naphtha streams. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | Gázok
(ásványolaj), hexánmentesítő távozó terméke; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet vegyes benzin származékok frakcionálásával állítanak elő. Főként C1-C5 szénatomszámú telített alifás szénhidrogénekből áll.] |
272-872-2 | 68919-00-6 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-102-00-2 | Gases (petroleum), light straight run gasoline fractionation stabilizer off; Petroleum gas; [A complex combination of hydrocarbons obtained by the fractionation of light straight-run gasoline. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | Gázok
(ásványolaj), könnyű közvetlen lepárlású benzin frakcionált stabilizáló
távozó terméke; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet könnyű közvetlen lepárlású benzin frakcionálásával nyernek. Főként C1-C5 szénatomszámú telített alifás szénhidrogénekből áll.] |
272-878-5 | 68919-05-1 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-103-00-8 | Gases (petroleum), naphtha unifiner desulfurization stripper off; Petroleum gas; [A complex combination of hydrocarbons produced by a naphtha unifiner desulfurization process and stripped from the naphtha product. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | Gázok
(ásványolaj), benzin egyesítő kéntelenítő kigőzölés; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet benzin egyesítő-kéntelenítő folyamattal állítanak elő, és kihajtják a benzintermékből. Főként C1-C4 szénatomszámú telített alifás szénhidrogénekből áll.] |
272-879-0 | 68919-06-2 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-104-00-3 | Gases (petroleum), straight-run naphtha catalytic reforming off; Petroleum gas; [A complex combination of hydrocarbons obtained by the catalytic reforming of straight-run naphtha and fractionation of the total effluent. It consists of methane, ethane, and propane.] | Gázok
(nyersolaj), közvetlen lepárlású benzin katalitikus reformálás távozó
terméke; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet közvetlen lepárlású benzin katalitikus reformálásával és a teljes kilépő termék frakcionálásával állítanak elő. Metánból, etánból és propánból áll.] |
272-882-7 | 68919-09-5 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-105-00-9 | Gases (petroleum), fluidized catalytic cracker splitter overheads; Petroleum gas; [A complex combination of hydrocarbons produced by the fractionation of the charge to the C3-C4 splitter. It consists predominantly of C3 hydrocarbons.] | Gázok
(ásványolaj), fluidizált katalitikus krakkoló-bontó fejtermékek; Ásványolaj
gáz; [Szénhidrogének összetett keveréke, melyet a kiindulási anyag C3-C4 bontón való frakcionálásával nyernek. Főként C3 szénhidrogénekből áll.] |
272-893-7 | 68919-20-0 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 |
H220 H350 H340 |
K U | CLP00/ATP01corr | ||
| 649-106-00-4 | Gases (petroleum), straight-run stabilizer off; Petroleum gas; [A complex combination of hydrocarbons obtained from the fractionation of the liquid from the first tower used in the distillation of crude oil. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | Gázok
(ásványolaj), közvetlen stabilizáló távozó terméke; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet a nyersolaj desztillációjánál használt első toronyból nyert folyadék frakcionálásával állítanak elő. Főként C1-C4 szénatomszámú telített alifás szénhidrogénekből áll.] |
272-883-2 | 68919-10-8 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-107-00-X | Gases (petroleum), catalytic cracked naphtha debutanizer; Petroleum gas; [A complex combination of hydrocarbons obtained from fractionation of catalytic cracked naphtha. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | Gázok
(ásványolaj), katalitikusan krakkolt benzin butánmentesítő; Ásványolaj
gáz; [Szénhidrogének összetett keveréke, melyet katalitikusan krakkolt benzin frakcionálásával állítanak elő. Főként C1-C4 szénatomszámú szénhidrogénekből áll.] |
273-169-3 | 68952-76-1 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-108-00-5 | Tail gas (petroleum), catalytic cracked distillate and naphtha stabilizer; Petroleum gas; [A complex combination of hydrocarbons obtained by the fractionation of catalytic cracked naphtha and distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | Véggáz
(ásványolaj), katalitikusan krakkolt desztillátum és benzin
stabilizáló; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet katalitikusan krakkolt benzin és desztillátum frakcionálásával állítanak elő. Főként C1-C4 szénatomszámú szénhidrogénekből áll.] |
273-170-9 | 68952-77-2 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 |
H220 H350 H340 |
K U | CLP00/ATP01corr | ||
| 649-109-00-0 | Tail gas (petroleum), thermal-cracked distillate, gas oil and naphtha absorber; petroleum gas; [A complex combination of hydrocarbons obtained from the separation of thermal-cracked distillates, naphtha and gas oil. It consists pedrominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | Véggáz
(ásványolaj), termikusan krakkolt desztillátum, gázolaj és benzin
abszorber; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet a termikusan krakkolt desztillátumok, benzin és gázolaj elválasztásából nyernek. Főként C1-C6 szénatomszámú szénhidrogénekből áll.] |
273-175-6 | 68952-81-8 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-110-00-6 | Tail gas (petroleum), thermal cracked hydrocarbon fractionation stabilizer, petroleum coking; Petroleum gas; [A complex combination of hydrocarbons obtained from the fractionation stabilization of thermal cracked hydrocarbons from petroleum coking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | Véggáz
(ásványolaj), termikusan krakkolt szénhidrogén frakcionáló stabilizáló,
ásványolaj kokszolás; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet nyersolaj kokszolásból származó termikusan krakkolt szénhidrogének frakcionált stabilizációjával állítanak elő. Főként C1-C6 szénatomszámú szénhidrogénekből áll.] |
273-176-1 | 68952-82-9 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-111-00-1 | Gases (petroleum, light steam-cracked, butadiene conc.; Petroleum gas; [A complex combination of hydrocarbons produced by the distillation of products from a thermal cracking process. It consists of hydrocarbons having a carbon number predominantly of C4.] | Gázok
(nyersolaj), könnyű, gőzzel krakkolt, butadién konc.; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet termikus krakkolási folyamatból származó termékek desztillációjával állítanak elő. Főként C4 szénatomszámú szénhidrogénből áll.] |
273-265-5 | 68955-28-2 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-112-00-7 | Gases (petroleum), straight-run naphtha catalytic reformer stabilizer overhead; Petroleum gas; [A complex combination of hydrocarbons obtained by the catalytic reforming of straight-run naphtha and the fractionation of the total effluent. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C4.] | Gázok
(ásványolaj), közvetlen lepárlású benzin katalitikus reformáló- stabilizáló
fejtermék; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet közvetlen lepárlású benzin katalitikus reformálásával és a teljes kilépő termék frakcionálásával állítanak elő. Főként C2-C4 szénatomszámú telített alifás szénhidrogénekből áll.] |
273-270-2 | 68955-34-0 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-113-00-2 | Hydrocarbons, C4; Petroleum gas | Szénhidrogének, C4; Ásványolaj gáz; | 289-339-5 | 87741-01-3 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-114-00-8 | Alkanes, C1-4, C3-rich; Petroleum gas | Alkánok, C1-4, C3-ban gazdag; Ásványolaj gáz | 292-456-4 | 90622-55-2 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-115-00-3 | Gases (petroleum), steam-cracker C3-rich; Petroleum gas; [A complex combination of hydrocarbons produced by the distillation of products from a steam cracking process. It consists predominantly of propylene with some propane and boils in the range of approximately – 70 °C to 0 °C (– 94 °F to 32 °F).] | Gázok
(ásványolaj), gőzkrakkoló, C3-ban gazdag; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet a gőzkrakkolási folyamat termékeinek desztillációjával állítanak elő. Elsősorban propilénből áll, de tartalmaz kevés propánt is, és megközelítőleg a –70 oC-tól 0 oC-ig (–94 oF-tól 32 oF-ig) terjedő tartományban forr.] |
295-404-9 | 92045-22-2 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-116-00-9 | Hydrocarbons, C4, steam-cracker distillate; Petroleum gas; [A complex combination of hydrocarbons produced by the distillation of the products of a steam cracking process. It consists predominantly of hydrocarbons having a carbon number of C4, predominantly 1-butene and 2-butene, containing also butane and isobutene and boiling in the range of approximately minus 12 °C to 5 °C (10.4 °F to 41 °F).] | Szénhidrogének,
C4, gőzkrakkoló desztillátum; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet a gőzkrakkolási folyamat termékeinek desztillációjával állítanak elő. Főként C4 szénatomszámú szénhidrogénekből, elsősorban 1-buténből és 2-buténből áll, de tartalmaz még butánt és izobutént is, és megközelítőleg a –12 oC-tól 5 oC-ig (10,4 oF-tól 41 oF-ig) terjedő tartományban forr.] |
295-405-4 | 92045-23-3 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-117-00-4 | Petroleum gases, liquefied, sweetened, C4 fraction; Petroleum gas; [A complex combination of hydrocarbons obtained by subjecting a liquified petroleum gas mix to a sweetening process to oxidize mercaptans or to remove acidic impurities. It consists predominantly of C4 saturated and unsaturated hydrocarbons.] | Ásványolaj
gázok, cseppfolyósított, kéntelenített, C4 frakció; Ásványolaj
gáz; [Szénhidrogének összetett keveréke, melyet úgy állítanak elő, hogy a cseppfolyósított ásványolaj gázelegyet kéntelenítő eljárásnak vetik alá a merkaptánok oxidálása vagy a savas szennyeződések eltávolítása céljából. Főként C4-es, telített és telítetlen szénhidrogénekből áll.] |
295-463-0 | 92045-80-2 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K S U | CLP00/ATP01corr | ||
| 649-118-00-X | Hydrocarbons, C4, 1,3-butadiene- and isobutene-free; Petroleum gas | Szénhidrogének, C4, 1,3-butadién- és izobutén-mentes; Ásványolaj gáz | 306-004-1 | 95465-89-7 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-119-00-5 | Raffinates (petroleum), steam-cracked C4 fraction cuprous ammonium acetate extn., C3-5 and C3-5 unsatd., butadiene-free; Petroleum gas | Raffinátumok (nyersolaj), gőzkrakkolt C4 frakció réz(I)-ammónium-acetát extr., C3-5 és telítetlen C3-5 , butadién-mentes; Ásványolaj gáz | 307-769-4 | 97722-19-5 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-120-00-0 | Gases (petroleum), amine system feed; Refinery gas; [The feed gas to the amine system for removal of hydrogen sulfide. It consists of hydrogen. Carbon monoxide, carbon dioxide, hydrogen sulfide and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5 may also be present.] | Gázok
(ásványolaj), amin szisztéma adagolás; Finomítói gáz; [Az amin rendszerbe táplált gáz a hidrogén-szulfid eltávolítására szolgál. Hidrogénből áll. Tartalmazhat szén-monoxidot, szén-dioxidot, hidrogén-szulfidot, és elsősorban a C1-C5 tartományba eső szénatomszámú alifás szénhidrogéneket.] |
270-746-1 | 68477-65-6 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-121-00-6 | Gases (petroleum), benzene unit hydrodesulfurizer off; Refinery gas; [Off gases produced by the benzene unit. It consists primarily of hydrogen. Carbon monoxide and hydrocarbons having carbon numbers predominantly in the range of C1 through C6, including benzene, may also be present.] | Gázok
(ásványolaj), benzol egység hidrogénes kéntelenítő távozó terméke; Finomítói gáz; [A benzolegység távozó gázai. Elsődlegesen hidrogént tartalmaz. Tartalmazhat még szén-monoxidot, és főként C1-C6 szénatomszámú szénhidrogéneket, beleértve a benzolt is.] |
270-747-7 | 68477-66-7 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-122-00-1 | Gases (petroleum), benzene unit recycle, hydrogen-rich; Refinery gas; [A complex combination of hydrocarbons obtained by recycling the gases of the benzene unit. It consists primarily of hydrogen with various small amounts of carbon monoxide and hydrocarbons having carbon numbers in the range of C1 through C6.] | Gázok
(ásványolaj), benzol egység újrafeldolgozás, hidrogénben gazdag; Finomítói gáz; [Szénhidrogének összetett keveréke, melyet a benzol egység gázainak újrafeldolgozásával nyernek. Elsősorban hidrogénből áll, valamint különböző kis mennyiségben szén-monoxidból, és olyan szénhidrogénekből, melyek szénatomszáma elsősorban a C1-C6 tartományban van.] |
270-748-2 | 68477-67-8 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-123-00-7 | Gases (petroleum), blend oil, hydrogen-nitrogen-rich; Refinery gas; [A complex combination of hydrocarbons obtained by distillation of a blend oil. It consists primarily of hydrogen and nitrogen with various small amounts of carbon monoxide, carbon dioxide, and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | Gázok
(ásványolaj), kevert olaj, hidrogénben és nitrogénben gazdag; Finomítói gáz; [Szénhidrogének összetett keveréke, melyet kevert olaj desztillációjával nyernek. Elsősorban hidrogénből és nitrogénből áll, valamint kis mennyiségben tartalmaz még szén-monoxidot, szén-dioxidot és főként C1-C5 szénatomszámú alifás szénhidrogéneket.] |
270-749-8 | 68477-68-9 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-124-00-2 | Gases (petroleum), catalytic reformed naphtha stripper overheads; Refinery gas; [A complex combination of hydrocarbons obtained from stabilization of catalytic reformed naphtha. Its consists of hydrogen and saturated hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | Gázok
(nyersolaj), katalitikusan reformált benzin kigőzölés, fejtermékek; Finomítói gáz; [Szénhidrogének összetett keveréke, melyet katalitikusan reformált benzin stabilizációjával nyernek. Hidrogént és főként C1-C4 szénatomszámú telített szénhidrogénekből áll.] |
270-759-2 | 68477-77-0 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-125-00-8 | Gases (petroleum), C6-8 catalytic reformer recycle; Refinery gas; [A complex combination of hydrocarbons produced by distillation of products from catalytic reforming of C6-C8 feed and recycled to conserve hydrogen. It consists primarily of hydrogen. It may also contain various small amounts of carbon monoxide, carbon dioxide, nitrogen, and hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | Gázok
(ásványolaj), C6-8 katalitikus reformáló visszanyerő; Finomítói gáz; [Szénhidrogének összetett keveréke, melyet a C6-C8 nyersanyag katalitikus reformálásával nyernek és visszaforgatnak a hidrogén megőrzése érdekében. Elsődlegesen hidrogént tartalmaz. Kis mennyiségben tartalmazhat még szén-monoxidot, szén-dioxidot, nitrogént és főként C1-C6 szénatomszámú szénhidrogéneket.] |
270-761-3 | 68477-80-5 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-126-00-3 | Gases (petroleum), C6-8 catalytic reformer; Refinery gas; [A complex combination of hydrocarbons produced by distillation of products from catalytic reforming of C6-C8feed. It consists of hydrocarbons having carbon numbers in the range of C1 through C5 and hydrogen.] | Gázok
(ásványolaj), C6-8 katalitikus reformáló; Finomítói gáz; [Szénhidrogének összetett keveréke, melyet a C6-C8 nyersanyag katalitikus reformálásának termékeiből desztillálással nyernek. Főként C1-C5 szénatomszámú szénhidrogéneket, valamint hidrogént tartalmaz.] |
270-762-9 | 68477-81-6 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-127-00-9 | Gases (petroleum), C6-8 catalytic reformer recycle, hydrogen-rich; Refinery gas | Gázok (ásványolaj), C6-8 katalitikus reformáló visszanyerés, hidrogénben gazdag; Finomítói gáz | 270-763-4 | 68477-82-7 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-128-00-4 | Gases (petroleum), C2-return stream; Refinery gas; [A complex combination of hydrocarbons obtained by the extraction of hydrogen from a gas stream which consists primarily of hydrogen with small amounts of nitrogen, carbon monoxide, methane, ethane, and ethylene. It contains predominantly hydrocarbons such as methane, ethane, and ethylene with small amounts of hydrogen, nitrogen and carbon monoxide.] | Gázok
(ásványolaj), C2-visszatérő áram; Finomítói gáz; [Szénhidrogének összetett keveréke, melyet a főleg hidrogént, valamint kis mennyiségben nitrogént, szén-monoxidot, metánt, etánt és etilént tartalmazó gázból a hidrogén extrakciójával nyernek. Főleg szénhidrogénekből áll, például metánból, etánból és etilénből, valamint kis mennyiségű hidrogénből, nitrogénből és szén-monoxidból.] |
270-766-0 | 68477-84-9 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 |
H220 H350 H340 |
K U | CLP00/ATP01corr | ||
| 649-129-00-X | Gases (petroleum), dry sour, gas-concn.-unit-off; Refinery gas; [The complex combination of dry gases from a gas concentration unit. It consists of hydrogen, hydrogen sulfide and hydrocarbons having carbon numbers predominantly in the range of C1 through C3.] | Gázok
(ásványolaj), száraz merkaptános termékek, gázkonc. egység távozó
termék; Finomítói gáz; [Száraz gázok összetett keveréke a gázkoncentráló egységből. Hidrogént, hidrogén-szulfidot és főként C1-C3 szénatomszámú szénhidrogénekből áll.] |
270-774-4 | 68477-92-9 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-130-00-5 | Gases (petroleum), gas concn. reabsorber distn.; Refinery gas; [A complex combination of hydrocarbons produced by distillation of products from combined gas streams in a gas concentration reabsorber. It consists predominantly of hydrogen, carbon monoxide, carbon dioxide, nitrogen, hydrogen sulfide and hydrocarbons having carbon numbers in the range of C1 through C3.] | Gázok
(ásványolaj), gáz konc. reabszorber deszt.; Finomítói gáz; [Szénhidrogének összetett keveréke, melyet gázkoncentráló reabszorberben állítanak elő vegyes gázelegyek desztillációjával. Főleg hidrogénből, szén-monoxidból, szén-dioxidból, nitrogénből, hidrogén-szulfidból és C1-C3 szénatomszámú szénhidrogénekből áll.] |
270-776-5 | 68477-93-0 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-131-00-0 | Gases (petroleum), hydrogen absorber off; Refinery gas; [A complex combination obtained by absorbing hydrogen from a hydrogen rich stream. It consists of hydrogen, carbon monoxide, nitrogen, and methane with small amounts of C2 hydrocarbons.] | Gázok
(ásványolaj), hidrogén abszorber távozó terméke; Finomítói gáz; [Összetett keverék, melyet a hidrogénben gazdag anyagból a hidrogén megkötésével állítanak elő. Hidrogénből, szén-monoxidból, nitrogénből és metánból áll, valamint kis mennyiségű C2 szénhidrogéneket is tartalmaz.] |
270-779-1 | 68477-96-3 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-132-00-6 | Gases (petroleum), hydrogen-rich; Refinery gas; [A complex combination separated as a gas from hydrocarbon gases by chilling. It consists primarily of hydrogen with various small amounts of carbon monoxide, nitrogen, methane, and C2 hydrocarbons.] | Gázok
(ásványolaj), hidrogénben gazdag; Finomítói gáz; [Összetett keverék, melyet gázként választanak el szénhidrogén-gázok kifagyasztása során. Főleg hidrogénből áll, de tartalmaz kis, változó mennyiségben szén-monoxidot, nitrogént, metánt és C2 szénhidrogéneket is.] |
270-780-7 | 68477-97-4 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-133-00-1 | Gases (petroleum), hydrotreater blend oil recycle, hydrogen-nitrogen-rich; Refinery gas; [A complex combination obtained from recycled hydrotreated blend oil. It consists primarily of hydrogen and nitrogen with various small amounts of carbon monoxide, carbon dioxide and hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | Gázok
(ásványolaj), hidrogénező olajkeverék visszanyerés, hidrogénben és
nitrogénben gazdag; Finomítói gáz; [Összetett keverék, melyet visszanyert hidrogénezett olajkeverékből állítanak elő. Elsősorban hidrogénből és nitrogénből áll, valamint kis mennyiségben tartalmaz még szén-monoxidot, szén-dioxidot és főként C1-C5 szénatomszámú szénhidrogéneket.] |
270-781-2 | 68477-98-5 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-134-00-7 | Gases (petroleum), recycle, hydrogen-rich; Refinery gas; [A complex combination obtained from recycled reactor gases. It consists primarily of hydrogen with various small amounts of carbon monoxide, carbon dioxide, nitrogen, hydrogen sulfide, and saturated aliphatic hydrocarbons having carbon numbers in the range of C1 through C5.] | Gázok
(ásványolaj), visszanyerés, hidrogénben gazdag; Finomítói gáz; [Összetett keverék, melyet visszanyert reaktorgázokból állítanak elő. Elsősorban hidrogénből áll, valamint kis mennyiségben tartalmaz még szén-monoxidot, szén-dioxidot, nitrogént és főként C1-C5 szénatomszámú telített alifás szénhidrogéneket.] |
270-783-3 | 68478-00-2 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-135-00-2 | Gases (petroleum), reformer make-up, hydrogen-rich; Refinery gas; [A complex combination obtained from the reformers. It consists primarily of hydrogen with various small amounts of carbon monoxide and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | Gázok
(ásványolaj), reformer feltöltés, hidrogénben gazdag; Finomítói gáz; [Összetett keverék, melyet a reformerekből nyernek. Elsősorban hidrogénből áll, valamint kis mennyiségben szén-monoxidból és elsősorban C1-C5 szénatomszámú alifás szénhidrogénekből.] |
270-784-9 | 68478-01-3 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-136-00-8 | Gases (petroleum), reforming hydrotreater; Refinery gas; [A complex combination obtained from the reforming hydrotreating process. It consists primarily of hydrogen, methane, and ethane with various small amounts of hydrogen sulfide and aliphatic hydrocarbons having carbon numbers predominantly in the range of C3 through C5.] | Gázok
(ásványolaj), reformáló hidrogénező; Finomítói gáz; [Összetett keverék, melyet a reformáló hidrogénező eljárásból nyernek. Elsősorban hidrogénből, metánból és etánból áll, valamint kis mennyiségben hidrogén-szulfidból és elsősorban C3-C5 szénatomszámú alifás szénhidrogénekből.] |
270-785-4 | 68478-02-4 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-137-00-3 | Gases (petroleum), reforming hydrotreater, hydrogen-methane-rich; Refinery gas; [A complex combination obtained from the reforming hydrotreating process. It consists primarily of hydrogen and methane with various small amounts of carbon monoxide, carbon dioxide, nitrogen and saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C5.] | Gázok
(ásványolaj), reformáló hidrogénező, hidrogénben és metánban gazdag; Finomítói gáz; [Összetett keverék, melyet a reformáló hidrogénező eljárásból nyernek. Elsősorban hidrogénből és metánból áll, valamint kis mennyiségben tartalmaz még szén-monoxidot, szén-dioxidot, nitrogént és főként C2-C5 szénatomszámú telített alifás szénhidrogéneket.] |
270-787-5 | 68478-03-5 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-138-00-9 | Gases (petroleum), reforming hydrotreater make-up, hydrogen-rich; Refinery gas; [A complex combination obtained from the reforming hydrotreating process. It consists primarily of hydrogen with various small amounts of carbon monoxide and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | Gázok
(ásványolaj), reformáló hidrogénező feltöltés, hidrogénben gazdag; Finomítói gáz; [Összetett keverék, melyet a reformáló hidrogénező eljárásból nyernek. Elsősorban hidrogénből áll, valamint kis mennyiségben szén-monoxidból és elsősorban C1-C5 szénatomszámú alifás szénhidrogénekből.] |
270-788-0 | 68478-04-6 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-139-00-4 | Gases (petroleum), thermal cracking distn.; Refinery gas; [A complex combination produced by distillation of products from a thermal cracking process. It consists of hydrogen, hydrogen sulfide, carbon monoxide, carbon dioxide and hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | Gázok
(ásványolaj), termikus krakkolás deszt.; Finomítói gáz; [Összetett keverék, melyet termikus krakkolási folyamatból származó termékek desztillációjával állítanak elő. Hidrogént, hidrogén-szulfidot, szén-monoxidot, szén-dioxidot és főként C1-C6 szénatomszámú szénhidrogénekből áll.] |
270-789-6 | 68478-05-7 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-140-00-X | Tail gas (petroleum), catalytic cracker refractionation absorber; Refinery gas; [A complex combination of hydrocarbons obtained from refractionation of products from a catalytic cracking process. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C3.] | Véggáz
(ásványolaj), katalitikus krakkoló refrakcionáló abszorber; Finomítói
gáz; [Szénhidrogének összetett keveréke, melyet katalitikus krakkolásból származó termékek refrakcionálásával állítanak elő. Hidrogént és főként C1-C3 szénatomszámú szénhidrogénekből áll.] |
270-805-1 | 68478-25-1 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-141-00-5 | Tail gas (petroleum), catalytic reformed naphtha separator; Refinery gas; [A complex combination of hydrocarbons obtained from the catalytic reforming of straight run naphtha. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | Véggáz
(ásványolaj), katalitikusan reformált benzin szeparátor; Finomítói gáz; [Szénhidrogének összetett keveréke, melyet a közvetlen lepárlású benzin katalitikus reformálásából nyernek. Hidrogént és főként C1-C6 szénatomszámú szénhidrogénekből áll.] |
270-807-2 | 68478-27-3 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-142-00-0 | Tail gas (petroleum), catalytic reformed naphtha stabilizer; Refinery gas; [A complex combination of hydrocarbons obtained from the stabilization of catalytic reformed naphtha. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | Véggáz
(ásványolaj), katalitikusan reformált benzin szeparátor; Finomítói gáz; [Szénhidrogének összetett keveréke, melyet katalitikusan reformált benzin stabilizálásával állítanak elő. Összetevői: hidrogén és főként C1-C6 szénatomszámú szénhidrogének.] |
270-808-8 | 68478-28-4 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-143-00-6 | Tail gas (petroleum), cracked distillate hydrotreater separator; Refinery gas; [A complex combination of hydrocarbons obtained by treating cracked distillates with hydrogen in the presence of a catalyst. It consists of hydrogen and saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | Véggáz (ásványolaj), krakkolt desztillátum hidrogénező szeparátor; Finomítói gáz; [Szénhidrogének összetett keveréke, melyet krakkolt desztillátumok katalizátor jelenlétében végzett hidrogénezésével nyernek. Hidrogént és főként C1-C5 szénatomszámú telített alifás szénhidrogénekből áll.] | 270-809-3 | 68478-29-5 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-144-00-1 | Tail gas (petroleum), hydrodesulfurized straight-run naphtha separator; Refinery gas; [A complex combination of hydrocarbons obtained from hydrodesulfurization of straight-run naphtha. It consists of hydrogen and saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | Véggáz
(ásványolaj), hidrogénnel kéntelenített közvetlen lepárlású benzin
szeparátor; Finomítói gáz; [Szénhidrogének összetett keveréke, melyet közvetlen lepárlású benzin hidrogénnel végzett kéntelenítésével nyernek. Hidrogént és főként C1-C6 szénatomszámú telített alifás szénhidrogénekből áll.] |
270-810-9 | 68478-30-8 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-145-00-7 | Gases (petroleum), catalytic reformed straight-run naphtha stabilizer overheads; Refinery gas; [A complex combination of hydrocarbons obtained from the catalytic reforming of straight-run naphtha followed by fractionation of the total effluent. It consists of hydrogen, methane, ethane and propane.] | Gázok
(ásványolaj), katalitikusan reformált közvetlen lepárlású benzin stabilizáló
fejtermékek; Finomítói gáz; [Szénhidrogének összetett keveréke, melyet közvetlen lepárlású benzin katalitikus reformálásával, majd a teljes kilépő termék frakcionálásával állítanak elő. Hidrogénből, metánból, etánból és propánból áll.] |
270-999-8 | 68513-14-4 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-146-00-2 | Gases (petroleum), reformer effluent high-pressure flash drum off; Refinery gas; [A complex combination produced by the high-pressure flashing of the effluent from the reforming reactor. It consists primarily of hydrogen with various small amounts of methane, ethane, and propane.] | Gázok
(ásványolaj), reformáló kilépő termék nagynyomású flesselés; Finomítói
gáz; [A reformáló reaktorból kilépő termék nagynyomású flesselésével kapott összetett szénhidrogénelegy. Elsősorban hidrogénből, mellette kis mennyiségű metánból, etánból és propánból áll.] |
271-003-4 | 68513-18-8 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-147-00-8 | Gases (petroleum), reformer effluent low-pressure flash drum off; Refinery gas; [A complex combination produced by low-pressure flashing of the effluent from the reforming reactor. It consists primarily of hydrogen with various small amounts of methane, ethane, and propane.] | Gázok
(ásványolaj), reformáló kilépő termék kisnyomású flesselés; Finomítói
gáz; [A reformáló reaktorból kilépő termék kisnyomású flesselésével kapott összetett szénhidrogénelegy. Elsősorban hidrogénből, mellette kis mennyiségű metánból, etánból és propánból áll.] |
271-005-5 | 68513-19-9 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-148-00-3 | Gases (petroleum), oil refinery gas distn. off; Refinery gas; [A complex combination separated by distillation of a gas stream containing hydrogen, carbon monoxide, carbon dioxide and hydrocarbons having carbon numbers in the range of C1 through C6 or obtained by cracking ethane and propane. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C2, hydrogen, nitrogen, and carbon monoxide.] | Gázok
(ásványolaj), olajfinomító gáz deszt. távozó terméke; Finomítói gáz; [Összetett keverék, melyet hidrogént, szén-monoxidot, szén-dioxidot és C1-C6 szénatomszámú szénhidrogénekből álló gázelegy desztillációjával vagy etán és propán krakkolásával állítanak elő. Olyan szénhidrogénekből áll, melyek szénatomszáma főleg a C1-C2 tartományban van, valamint hidrogénből, nitrogénből és szén-monoxidból.] |
271-258-1 | 68527-15-1 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-149-00-9 | Gases (petroleum), benzene unit hydrotreater depentanizer overheads; Refinery gas; [A complex combination produced by treating the feed from the benzene unit with hydrogen in the presence of a catalyst followed by depentanizing. It consists primarily of hydrogen, ethane and propane with various small amounts of nitrogen, carbon monoxide, carbon dioxide and hydrocarbons having carbon numbers predominantly in the range of C1 through C6. It may contain trace amounts of benzene.] | Gázok
(ásványolaj), benzol egység hidrogénező pentánmentesítő fejtermékek;
Finomítói gáz; [Összetett keverék, melyet a benzol egységből származó nyersanyag katalizátor jelenlétében végzett hidrogénezésével, majd ezt követően pentánmentesítésével állítanak elő. Elsősorban hidrogénből, etánból és propánból áll, valamint kis mennyiségben tartalmaz még nitrogént, szén-monoxidot, szén-dioxidot és főként C1-C6 szénatomszámú szénhidrogéneket.] Nyomokban benzolt is tartalmazhat.] |
271-623-5 | 68602-82-4 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-150-00-4 | Gases (petroleum), secondary absorber off, fluidized catalytic cracker overheads fractionator; Refinery gas; [A complex combination produced by the fractionation of the overhead products from the catalytic cracking process in the fluidized catalytic cracker. It consists of hydrogen, nitrogen, and hydrocarbons having carbon numbers predominantly in the range of C1 through C3.] | Gázok
(ásványolaj), másodlagos abszorber távozó termékei, fluidizált katalitikus
krakkoló fejtermék frakcionáló; Finomítói gáz; [Összetett keverék, melyet a fluidizált katalitikus krakkolóban lejátszódó katalitikus krakkolási folyamat fejtermékeinek frakcionálásával állítanak elő. Hidrogént, nitrogént és főként C1-C3 szénatomszámú szénhidrogénekből áll.] |
271-625-6 | 68602-84-6 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-151-00-X | Petroleum products, refinery gases; Refinery gas; [A complex combination which consists primarily of hydrogen with various small amounts of methane, ethane, and propane.] | Ásványolaj-termékek,
finomítói gázok; Finomítói gáz; [Összetett keverék, mely főleg hidrogénből és különböző kis mennyiségű metánból, etánból és propánból áll.] |
271-750-6 | 68607-11-4 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-152-00-5 | Gases (petroleum), hydrocracking low-pressure separator; Refinery gas; [A complex combination obtained by the liquid-vapor separation of the hydrocracking process reactor effluent. It consists predominantly of hydrogen and saturated hydrocarbons having carbon numbers predominantly in the range of C1 through C3.] | Gázok
(ásványolaj), hidrokrakkoló alacsony hőmérsékletű szeparátor; Finomítói
gáz; [Összetett keverék, melyet a hidrokrakkoló reaktor kilépő termékének folyadék-gőz szeparációjával állítanak elő. Főleg hidrogént és főként C1-C3 szénatomszámú telített szénhidrogénekből áll.] |
272-182-1 | 68783-06-2 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-153-00-0 | Gases (petroleum), refinery; Refinery gas; [A complex combination obtained from various petroleum refining operations. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C3.] | Gázok
(ásványolaj), finomító; Finomítói gáz; [Összetett keverék, melyet különféle ásványolaj-finomítási eljárásokból nyernek. Hidrogént és főként C1-C3 szénatomszámú szénhidrogénekből áll.] |
272-338-9 | 68814-67-5 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-154-00-6 | Gases (petroleum), platformer products separator off; Refinery gas; [A complex combination obtained from the chemical reforming of naphthenes to aromatics. It consists of hydrogen and saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C4.] | Gázok
(ásványolaj), platformer termék szeparátor távozó termékei; Finomítói gáz; [Összetett keverék, melyet naftének aromás vegyületekké történő kémiai reformálásával állítanak elő. Hidrogént és főként C2-C4 szénatomszámú telített alifás szénhidrogénekből áll.] |
272-343-6 | 68814-90-4 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-155-00-1 | Gases (petroleum), hydrotreated sour kerosine depentanizer stabilizer off; Refinery gas; [The complex combination obtained from the depentanizer stabilization of hydrotreated kerosine. It consists primarily of hydrogen, methane, ethane, and propane with various small amounts of nitrogen, hydrogen sulfide, carbon monoxide and hydrocarbons having carbon numbers predominantly in the range of C4 through C5.] | Gázok
(ásványolaj), hidrogénezett merkaptános petróleum pentánmentesítő stabilizáló
távozó terméke; Finomítói gáz; [Összetett keverék, melyet hidrogénezett petróleum pentánmentesítő stabilizációjával nyernek. Elsősorban hidrogénből, metánból, etánból és propánból áll, valamint kis mennyiségben nitrogénből, hidrogén-szulfidból, szén-monoxidból és főként C4-C5 szénatomszámú szénhidrogénekből.] |
272-775-5 | 68911-58-0 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-156-00-7 | Gases (petroleum), hydrotreated sour kerosine flash drum; Refinery gas; [A complex combination obtained from the flash drum of the unit treating sour kerosine with hydrogen in the presence of a catalyst. It consists primarily of hydrogen and methane with various small amounts of nitrogen, carbon monoxide, and hydrocarbons having carbon numbers predominantly in the range of C2 through C5.] | Gázok
(ásványolaj), hidrogénezett merkaptános petróleum expanziós tartály;
Finomítói gáz; [Összetett keverék, melyet az egység expanziós tartályából nyernek merkaptános petróleum katalizátor jelenlétében végzett hidrogénezése során. Elsősorban hidrogénből és metánból áll, valamint kis mennyiségben tartalmaz még nitrogént, szén-monoxidot és főként C2-C5 szénatomszámú szénhidrogéneket.] |
272-776-0 | 68911-59-1 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-157-00-2 | Gases (petroleum), distillate unifiner desulfurization stripper off; Refinery gas; [A complex combination stripped from the liquid product of the unifiner desulfurization process. It consists of hydrogen sulfide, methane, ethane, and propane.] | Gázok
(ásványolaj), desztillátum egyesítő kéntelenítő kigőzölés; Finomítói gáz; [Összetett keverék, melyet az egyesítő kéntelenítő folyamatból választanak el. Hidrogén-szulfidból, metánból, etánból és propánból áll.] |
272-873-8 | 68919-01-7 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-158-00-8 | Gases (petroleum), fluidized catalytic cracker fractionation off; Refinery gas; [A complex combination produced by the fractionation of the overhead product of the fluidized catalytic cracking process. It consists of hydrogen, hydrogen sulfide, nitrogen, and hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | Gázok
(ásványolaj), fluidizált katalitikus krakkoló frakcionáló távozó
terméke; Finomítói gáz; [Összetett keverék, melyet a fluidizált katalitikus krakkolási folyamat fejtermékének frakcionálásával állítanak elő. Hidrogént, hidrogén-szulfidot, nitrogént és főként C1-C5 szénatomszámú szénhidrogénekből áll.] |
272-874-3 | 68919-02-8 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-159-00-3 | Gases (petroleum), fluidized catalytic cracker scrubbing secondary absorber off; Refinery gas; [A complex combination produced by scrubbing the overhead gas from the fluidized catalytic cracker. It consists of hydrogen, nitrogen, methane, ethane and propane.] | Gázok
(ásványolaj), fluidizált katalitikus krakkoló másodlagos mosótorony távozó
terméke; Finomítói gáz; [Összetett keverék, melyet a fluidizációs katalitikus krakkoló fejgázának mosásával nyernek. Hidrogénből, nitrogénből, metánból, etánból és propánból áll.] |
272-875-9 | 68919-03-9 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-160-00-9 | Gases (petroleum), heavy distillate hydrotreater desulfurization stripper off; Refinery gas; [A complex combination stripped from the liquid product of the heavy distillate hydrotreater desulfurization process. It consists of hydrogen, hydrogen sulfide, and saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | Gázok
(ásványolaj), nehéz desztillátum hidrogénező kéntelenítő kigőzölés; Finomítói gáz; [Összetett keverék, melyet a nehéz desztillátum hidrogénező kéntelenítésének folyékony termékéből választanak el. Hidrogént, hidrogén-szulfidot és főként C1-C5 szénatomszámú telített alifás szénhidrogénekből áll.] |
272-876-4 | 68919-04-0 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-161-00-4 | Gases (petroleum), platformer stabilizer off, light ends fractionation; Refinery gas; [A complex combination obtained by the fractionation of the light ends of the platinum reactors of the platformer unit. It consists of hydrogen, methane, ethane and propane.] | Gázok
(ásványolaj), platformer stabilizáló távozó terméke, előpárlatok
frakcionálása; Finomítói gáz; [Összetett keverék, melyet a platformer egység platina reaktoraiból nyert előpárlatok frakcionálásával nyernek. Hidrogénből, metánból, etánból és propánból áll.] |
272-880-6 | 68919-07-3 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-162-00-X | Gases (petroleum), preflash tower off, crude distn.; Refinery gas; [A complex combination produced from the first tower used in the distillation of crude oil. It consists of nitrogen and saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | Gázok
(ásványolaj), előlepárló torony távozó terméke, nyers deszt.; Finomítói gáz; [Összetett keverék, melyet a nyersolaj desztillációjánál használt első toronyról nyernek. Nitrogént és főként C1-C5 szénatomszámú telített alifás szénhidrogénekből áll.] |
272-881-1 | 68919-08-4 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-163-00-5 | Gases (petroleum), tar stripper off; Refinery gas; [A complex combination obtained by the fractionation of reduced crude oil. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | Gázok
(ásványolaj), kátrány sztripper távozó terméke; Finomítói gáz; [Összetett keverék, melyet redukált nyersolaj frakcionálásával nyernek. Hidrogént és főként C1-C4 szénatomszámú szénhidrogénekből áll.] |
272-884-8 | 68919-11-9 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-164-00-0 | Gases (petroleum), unifiner stripper off; Refinery gas; [A combination of hydrogen and methane obtained by fractionation of the products from the unifiner unit.] | Gázok
(ásványolaj), egyesítő sztripper távozó terméke; Finomítói gáz; [Hidrogén és metán elegye, melyet az egyesítő egység termékeinek frakcionálásával nyernek] |
272-885-3 | 68919-12-0 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-165-00-6 | Tail gas (petroleum), catalytic hydrodesulfurized naphtha separator; Refinery gas; [A complex combination of hydrocarbons obtained from the hydrodesulfurization of naphtha. It consists of hydrogen, methane, ethane, and propane.] | Véggáz
(ásványolaj), katalitikus hidrogénező kéntelenítő benzin szeparátor; Finomítói gáz; [Szénhidrogének összetett keveréke, melyet benzin hidrogénnel végzett kéntelenítésével állítanak elő. Hidrogénből, metánból, etánból és propánból áll.] |
273-173-5 | 68952-79-4 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-166-00-1 | Tail gas (petroleum), straight-run naphtha hydrodesulfurizer; Refinery gas; [A complex combination obtained from the hydrodesulfurization of straight-run naphtha. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | Véggáz
(ásványolaj), közvetlen lepárlású benzin hidrogénes kéntelenítő; [Összetett keverék, melyet közvetlen lepárlású benzin hidrogénes kéntelenítésével állítanak elő. Hidrogént és főként C1-C5 szénatomszámú szénhidrogénekből áll.] |
273-174-0 | 68952-80-7 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-167-00-7 | Gases (petroleum), sponge absorber off, fluidized catalytic cracker and gas oil desulfurizer overhead fractionation; Refinery gas; [A complex combination obtained by the fractionation of products from the fluidized catalytic cracker and gas oil desulfurizer. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | Gázok
(ásványolaj), szivacsos abszorber távozó terméke, fluidizált katalitikus
krakkoló és gázolaj kéntelenítő fejtermék frakcionálás; Finomítói gáz; [Összetett keverék, melyet a fluidizált katalitikus krakkolóból és a gázolaj kéntelenítőből kapott termékek frakcionálásával nyernek. Hidrogént és főként C1-C4 szénatomszámú szénhidrogénekből áll.] |
273-269-7 | 68955-33-9 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-168-00-2 | Gases (petroleum), crude distn. and catalytic cracking; Refinery gas; [A complex combination produced by crude distillation and catalytic cracking processes. It consists of hydrogen, hydrogen sulfide, nitrogen, carbon monoxide and paraffinic and olefinic hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | Gázok
(ásványolaj), nyers deszt. és katalitikus krakkolás; Finomítói gáz; [Összetett keverék, melyet nyers desztillációval és katalitikus krakkolási folyamatokkal állítanak elő. Hidrogént, hidrogén-szulfidot, nitrogént, szén-monoxidot, szén-dioxidot és főként C1-C6 szénatomszámú paraffin- és olefin-szénhidrogénekből áll.] |
273-563-5 | 68989-88-8 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-169-00-8 | Gases (petroleum), gas oil diethanolamine scrubber off; Refinery gas; [A complex combination produced by desulfurization of gas oils with diethanolamine. It consists predominantly of hydrogen sulfide, hydrogen and aliphatic hydrocarbons having carbon numbers in the range of C1 through C5.] | Gázok
(ásványolaj), gázolaj dietanolaminos gázmosó távozó terméke; Finomítói
gáz; [Összetett keverék, melyet gázolajok dietanolaminnal végzett kéntelenítésével állítanak elő. Elsősorban hidrogén-szulfidot, hidrogént és főként C1-C5 szénatomszámú alifás szénhidrogénekből áll.] |
295-397-2 | 92045-15-3 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-170-00-3 | Gases (petroleum), gas oil hydrodesulfurization effluent; Refinery gas; [A complex combination obtained by separation of the liquid phase from the effluent from the hydrogenation reaction. It consists predominantly of hydrogen, hydrogen sulfide and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C3.] | Gázok
(ásványolaj), gázolaj hidrogénes kéntelenítő kilépő termék; Finomítói
gáz; [Összetett keverék, melyet a hidrogénezési reakcióból származó kilépő termékből a folyadékfázis elválasztásával nyernek. Hidrogént, hidrogén-szulfidot és főként C1-C3 szénatomszámú alifás szénhidrogénekből áll.] |
295-398-8 | 92045-16-4 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-171-00-9 | Gases (petroleum), gas oil hydrodesulfurization purge; Refinery gas; [A complex combination of gases obtained from the reformer and from the purges from the hydrogenation reactor. It consists predominantly of hydrogen and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | Gázok
(ásványolaj), gázolaj hidrogénes kéntelenítő öblítés; Finomítói gáz; [Gázok összetett keveréke, melyet a reformálóból és a hidrogénező reaktorból származó öblítőkből nyernek. Főleg hidrogénből és főként C1-C4 szénatomszámú alifás szénhidrogénekből áll.] |
295-399-3 | 92045-17-5 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-172-00-4 | Gases (petroleum), hydrogenator effluent flash drum off; Refinery gas; [A complex combination of gases obtained from flash of the effluents after the hydrogenation reaction. It consists predominantly of hydrogen and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | Gázok
(ásványolaj), hidrogénező kilépő termék flesselés; Finomítói gáz; [A hidrogénező reakció után a kilépő termékek flesseléséből kapott összetett gázelegy. Elsősorban hidrogénből, valamint alifás, főleg C 1 –C 6 szénatomszámú szénhidrogénekből áll.] |
295-400-7 | 92045-18-6 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-173-00-X | Gases (petroleum), naphtha steam cracking high-pressure residual; Refinery gas; [A complex combination obtained as a reaction mass of the non-condensable portions from the product of a naphtha steam cracking process as well as residual gases obtained during the preparation of subsequent products. It consists predominantly of hydrogen and paraffinic and olefinic hydrocarbons having carbon numbers predominantly in the range of C1 through C5 with which natural gas may also be mixed.] | Gázok
(ásványolaj), benzingőz krakkolás nagy nyomású maradéka; Finomítói gáz; [Összetett keverék, mely a benzin gőzkrakkolási folyamat termékeinek nem kondenzáló részéből és a további termékek előállítása során nyert maradékgázokból áll. Főleg hidrogénből és főként C1-C5 szénatomszámú paraffin- és olefin-szénhidrogénekből áll, amelyhez még földgáz keveredhet.] |
295-401-2 | 92045-19-7 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-174-00-5 | Gases (petroleum), residue visbaking off; Refinery gas; [A complex combination obtained from viscosity reduction of residues in a furnace. It consists predominantly of hydrogen sulfide and paraffinic and olefinic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | Gázok
(ásványolaj), maradék visbaking távozó termék; Finomítói gáz; [Összetett keverék, melyet a maradékok kemencében végzett viszkozitás-csökkentésével nyernek. Főleg hidrogén-szulfidból, hidrogénből és főként C1-C5 szénatomszámú paraffin- és olefin-szénhidrogénekből áll.] |
295-402-8 | 92045-20-0 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-175-00-0 | Foots oil (petroleum), acid-treated; Foots oil; [A complex combination of hydrocarbons obtained by treatment of Foot's oil with sulfuric acid. It consists predominantly of branched-chain hydrocarbons with carbon numbers predominantly in the range of C20 through C50.] | Gacsolaj
(ásványolaj), savval kezelt; Gacsolaj; [Gacsolaj kénsavas kezelésével kapott összetett szénhidrogénkeverék. Főként C20-C50 szénatomszámú elágazó láncú szénhidrogénekből áll.] |
300-225-7 | 93924-31-3 | Flam.
Gas 1 Press. Gas Carc. 1B |
H220 H350 |
GHS02 GHS04 GHS08 Dgr |
H220 H340 H350 |
H K U | CLP00 | ||
| 649-176-00-6 | Foots oil (petroleum), clay-treated; Foots oil; [A complex combination of hydrocarbons obtained by treatment of Foot's oil with natural or modified clay in either a contacting or percolation process to remove the trace amounts of polar compounds and impurities present. It consists predominantly of branched chain hydrocarbons with carbon numbers predominantly in the range of C20 through C50.] | Gacsolaj
(ásványolaj), agyaggal kezelt; Gacsolaj; [Gacsolajnak – a nyomnyi mennyiségű poláros vegyületek és a szennyezések eltávolítása érdekében – érintkezéses módszerrel vagy perkolálással, természetes vagy módosított agyaggal történő kezelésével kapott összetett szénhidrogénkeverék. Főként C20-C50 szénatomszámú elágazó láncú szénhidrogénekből áll.] |
300-226-2 | 93924-32-4 | Flam.
Gas 1 Press. Gas Carc. 1B |
H220 H350 |
GHS02 GHS04 GHS08 Dgr |
H220 H340 H350 |
H K U | CLP00 | ||
| 649-177-00-1 | Gases (petroleum), C3-4; Petroleum gas; [A complex combination of hydrocarbons produced by distillation of products from the cracking of crude oil. It consists of hydrocarbons having carbon numbers in the range of C3 through C4, predominantly of propane and propylene, and boiling in the range of approximately – 51 °C to – 1 °C (– 60 °F to 30 °F.)] | Gázok (ásványolaj), C3-4; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet nyersolaj krakkolási termékeinek desztillációjával állítanak elő. C3-C4 szénatomszámú szénhidrogénekből, elsősorban propánból és propilénből áll, és hozzávetőleges forráspont-tartománya –51 oC és –1 oC (–60 oF és 30 oF) között van.] | 268-629-5 | 68131-75-9 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-178-00-7 | Tail gas (petroleum), catalytic cracked distillate and catalytic cracked naphtha fractionation absorber; Petroleum gas; [The complex combination of hydrocarbons from the distillation of the products from catalytic cracked distillates and catalytic cracked naphtha. It consists predominantly of hydrocarbons having carbon numbers in the range of C1 through C4.] | Véggáz
(ásványolaj), katalitikusan krakkolt desztillátum és katalitikusan krakkolt
benzin frakcionáló abszorber; Ásványolaj gáz; [Katalitikusan krakkolt desztillátumokból származó termékek és katalitikusan krakkolt benzin desztillációjával nyert összetett szénhidrogénkeverék. Főként C1-C4 szénatomszámú szénhidrogénekből áll. |
269-617-2 | 68307-98-2 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-179-00-2 | Tail gas (petroleum), catalytic polymn. naphtha fractionation stabilizer; Petroleum gas; [A complex combination of hydrocarbons from the fractionation stabilization products from polymerization of naphtha. It consists predominantly of hydrocarbons having carbon numbers in the range of C1 through C4.] | Véggáz
(ásványolaj), katalitikus polim. benzin frakcionált stabilizáló; Ásványolaj
gáz; [Szénhidrogének összetett keveréke, melyet benzin polimerizációjából származó frakcionált stabilizációs termékekből nyernek. Főként C1-C4 szénatomszámú szénhidrogénekből áll. |
269-618-8 | 68307-99-3 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-180-00-8 | Tail gas (petroleum), catalytic reformed naphtha fractionation stabilizer, hydrogen sulfide-free; Petroleum gas; [A complex combination of hydrocarbons obtained from fractionation stabilization of catalytic reformed naphtha and from which hydrogen sulfide has been removed by amine treatment. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | Véggáz
(ásványolaj), katalitikusan reformált benzin frakcionált stabilizáló,
hidrogén-szulfidtól mentes; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet katalitikusan reformált benzin frakcionált stabilizációjával állítanak elő, és amelyből a hidrogén-szulfidot aminnal eltávolították. Főként C1-C4 szénatomszámú szénhidrogénekből áll.] |
269-619-3 | 68308-00-9 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-181-00-3 | Tail gas (petroleum), cracked distillate hydrotreater stripper; Petroleum gas; [A complex combination of hydrocarbons obtained by treating thermal cracked distillates with hydrogen in the presence of a catalyst. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | Véggáz
(ásványolaj), krakkolt desztillátum hidrogénező kigőzölés; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet termikusan krakkolt desztillátumok katalizátor jelenlétében végzett hidrogénezésével nyernek. Főként C1-C6 szénatomszámú telített szénhidrogénekből áll.] |
269-620-9 | 68308-01-0 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-182-00-9 | Tail gas (petroleum), straight-run distillate hydrodesulfurizer, hydrogen sulfide-free; Petroleum gas; [A complex combination of hydrocarbons obtained from catalytic hydrodesulfurization of straight run distillates and from which hydrogen sulfide has been removed by amine treatment. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | Véggáz
(ásványolaj), közvetlen lepárlású desztillátum hidrogénes kéntelenítő,
hidrogén-szulfidtól mentes; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet közvetlen lepárlású desztillátumok katalitikus hidrogénezéssel végzett kéntelenítéséből nyernek, és amelyből a hidrogén-szulfidot aminos kezeléssel eltávolították. Főként C1-C4 szénatomszámú szénhidrogénekből áll.] |
269-630-3 | 68308-10-1 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-183-00-4 | Tail gas (petroleum), gas oil catalytic cracking absorber; Petroleum gas; [A complex combination of hydrocarbons obtained from the distillation of products from the catalytic cracking of gas oil. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | Véggáz
(ásványolaj), gázolaj katalitikus krakkoló abszorber; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet a gázolaj katalitikus krakkolásából származó termékek desztillációjával állítanak elő. Főként C1-C5 szénatomszámú szénhidrogénekből áll.] |
269-623-5 | 68308-03-2 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-184-00-X | Tail gas (petroleum), gas recovery plant; Petroleum gas; [A complex combination of hydrocarbons from the distillation of products from miscellaneous hydrocarbon streams. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | Véggáz
(ásványolaj), gázvisszanyerő berendezés; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet vegyes szénhidrogén áramok termékeinek desztillációjából nyernek. Főként C1-C5 szénatomszámú szénhidrogénekből áll.] |
269-624-0 | 68308-04-3 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-185-00-5 | Tail gas (petroleum), gas recovery plant deethanizer; Petroleum gas; [A complex combination of hydrocarbons from the distillation of products from miscellaneous hydrocarbon streams. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | Véggáz
(ásványolaj), gázvisszanyerő berendezés etánmentesítő; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet vegyes szénhidrogén áramok termékeinek desztillációjából nyernek. Főként C1-C4 szénatomszámú szénhidrogénekből áll.] |
269-625-6 | 68308-05-4 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-186-00-0 | Tail gas (petroleum), hydrodesulfurized distillate and hydrodesulfurized naphtha fractionator, acid-free; Petroleum gas; [A complex combination of hydrocarbons obtained from fractionation of hydrodesulfurized naphtha and distillate hydrocarbon streams and treated to remove acidic impurities. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | Véggáz
(ásványolaj), hidrogénezéssel kéntelenített desztillátum és hidrogénezéssel
kéntelenített benzin frakcionáló, savmentes; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet hidrogénezéssel kéntelenített benzin és desztillált szénhidrogénelegyek frakcionálásával nyernek, és a savas szennyeződések eltávolítása céljából megfelelően kezelnek. Főként C1-C5 szénatomszámú szénhidrogénekből áll.] |
269-626-1 | 68308-06-5 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-187-00-6 | Tail gas (petroleum), hydrodesulfurized vacuum gas oil stripper, hydrogen sulfide-free; Petroleum gas; [A complex combination of hydrocarbons obtained from stripping stabilization of catalytic hydrodesulfurized vacuum gas oil and from which hydrogen sulfide has been removed by amine treatment. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | Véggáz
(ásványolaj), hidrogénezéssel kéntelenített vákuum gázolaj kigőzölés,
hidrogén-szulfid mentes; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet a katalitikusan hidrogénnel kéntelenített vákuum gázolaj sztrippeléses stabilizációjával nyernek és amelyből a hidrogén-szulfidot aminos kezeléssel eltávolították. Főként C1-C6 szénatomszámú szénhidrogénekből áll.] |
269-627-7 | 68308-07-6 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-188-00-1 | Tail gas (petroleum), light straight-run naphtha stabilizer, hydrogen sulfide-free; Petroleum gas; [A complex combination of hydrocarbons obtained from fractionation stabilization of light straight run naphtha and from which hydrogen sulfide has been removed by amine treatment. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | Véggáz
(ásványolaj), könnyű közvetlen lepárlású benzin stabilizáló, hidrogén-szulfid
mentes; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet könnyű közvetlen lepárlású benzin frakcionált stabilizációjával nyernek és amelyből aminos kezeléssel a hidrogén-szulfidot eltávolították. Főként C1-C5 szénatomszámú szénhidrogénekből áll.] |
269-629-8 | 68308-09-8 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-189-00-7 | Tail gas (petroleum), propane-propylene alkylation feed prep deethanizer; Petroleum gas; [A complex combination of hydrocarbons obtained from the distillation of the reaction products of propane with propylene. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | Véggáz
(ásványolaj), propán-propilén alkilezési nyersanyag előáll.
etánmentesítő; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet a propán és propilén reakciójából származó termékek desztillációjával nyernek. Főként C1-C4 szénatomszámú szénhidrogénekből áll.] |
269-631-9 | 68308-11-2 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-190-00-2 | Tail gas (petroleum), vacuum gas oil hydrodesulfurizer, hydrogen sulfide-free; Petroleum gas; [A complex combination of hydrocarbons obtained from catalytic hydrodesulfurization of vacuum gas oil and from which hydrogen sulfide has been removed by amine treatment. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | Véggáz
(ásványolaj), vákuum gázolaj hidrogénező kéntelenítő, hidrogén-szulfid
mentes; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet vákuum gázolajok katalitikus hidrogénező kéntelenítésével nyernek, és amelyből a hidrogén-szulfidot aminos kezeléssel eltávolították. Főként C1-C6 szénatomszámú szénhidrogénekből áll.] |
269-632-4 | 68308-12-3 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-191-00-8 | Gases (petroleum), catalytic cracked overheads; Petroleum gas; [A complex combination of hydrocarbons produced by the distillation of products from the catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C3 through C5 and boiling in the range of approximately – 48 °C to 32 °C (– 54 °F to 90 °F).] | Gázok
(nyersolaj), katalitikusan krakkolt fejtermékek; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet a katalitikus krakkolási folyamatból származó termékek desztillációjával nyernek. Főként C3-C5 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya –48 oC és 32 oC (–54 oF és 90 oF) között van.] |
270-071-2 | 68409-99-4 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-193-00-9 | Alkanes, C1-2; Petroleum gas | Alkánok, C1-2; Ásványolaj gáz; | 270-651-5 | 68475-57-0 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-194-00-4 | Alkanes, C2-3; Petroleum gas | Alkánok, C2-3; Ásványolaj gáz; | 270-652-0 | 68475-58-1 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-195-00-X | Alkanes, C3-4; petroleum gas | Alkánok, C3-4; Ásványolaj gáz; | 270-653-6 | 68475-59-2 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 |
H220 H350 H340 |
K U | CLP00/ATP01corr | ||
| 649-196-00-5 | Alkanes, C4-5; Petroleum gas | Alkánok, C4-5; Ásványolaj gáz; | 270-654-1 | 68475-60-5 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-197-00-0 | Fuel gases; Petroleum gas; [A combination of light gases. It consists predominantly of hydrogen and/or low molecular weight hydrocarbons.] | Fűtőgázok;
Ásványolaj gáz; [Könnyű gázok elegye. Főleg hidrogénből és/vagy alacsony molekulatömegű szénhidrogénekből áll.] |
270-667-2 | 68476-26-6 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-198-00-6 | Fuel gases, crude oil of distillates; Petroleum gas; [A complex combination of light gases produced by distillation of crude oil and by catalytic reforming of naphtha. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C4 and boiling in the range of approximately – 217 °C to – 12 °C (– 423 °F to 10 °F).] | Éghető
gázok, desztillátumok nyersolaja; Ásványolaj gáz; [Könnyű gázok összetett keveréke, melyet nyersolaj desztillációjával és benzin katalitikus reformálásával állítanak elő. Hidrogénből és főként C1-C4 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya –217 oC és –12 oC (–423 oF és 10 oF) között van.] |
270-670-9 | 68476-29-9 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-199-00-1 | Hydrocarbons, C3-4; Petroleum gas | Szénhidrogének, C3-4; Ásványolaj gáz; | 270-681-9 | 68476-40-4 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-200-00-5 | Hydrocarbons, C4-5; Petroleum gas | Szénhidrogének, C4-5; Ásványolaj gáz; | 270-682-4 | 68476-42-6 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-201-00-0 | Hydrocarbons, C2-4, C3-rich; Petroleum gas | Szénhidrogének, C2-4, C3-ban gazdag; Ásványolaj gáz | 270-689-2 | 68476-49-3 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-202-00-6 | Petroleum gases, liquefied; Petroleum gas; [A complex combination of hydrocarbons produced by the distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C3 through C7 and boiling in the range of approximately – 40 °C to 80 °C (– 40 °F to 176 °F).] | Ásványolaj
gázok, cseppfolyósított; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet nyersolaj desztillációjával állítanak elő. Főként C3-C7 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya –40 oC és 80 oC (–40 oF és 176oF) között van.] |
270-704-2 | 68476-85-7 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K S U | CLP00/ATP01corr | ||
| 649-203-00-1 | Petroleum gases, liquefied, sweetened; Petroleum gas; [A complex combination of hydrocarbons obtained by subjecting liquefied petroleum gas mix to a sweetening process to convert mercaptans or to remove acidic impurities. It consists of hydrocarbons having carbon numbers predominantly in the range of C3 through C7 and boiling in the range of approximately – 40 °C to 80 °C (– 40 °F to 176 °F).] | Ásványolaj
gázok, cseppfolyósított, kéntelenített; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet úgy állítanak elő, hogy cseppfolyósított ásványolaj gáz elegyet kéntelenítő eljárásnak vetnek alá a merkaptánok eltávolítása vagy a savas szennyeződések eltávolítása céljából. Főként C3-C7 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya –40 oC és 80 oC (–40 oF és 176oF) között van.] |
270-705-8 | 68476-86-8 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K S U | CLP00/ATP01corr | ||
| 649-204-00-7 | gases (petroleum), C3-4, isobutane-rich; Petroleum gas; [A complex combination of hydrocarbons from the distillation of saturated and unsaturated hydrocarbons usually ranging in carbon numbers from C3 through C6, predominantly butane and isobutane. It consists of saturated and unsaturated hydrocarbons having carbon numbers in the range of C3 through C4, predominantly isobutane.] | Gázok
(ásványolaj), C3-4, izobutánban gazdag; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet C3-C6 szénatomszámú telített és telítetlen szénhidrogének, főleg bután és izobután desztillációjával állítanak elő. C3-C4 szénatomszámú telített és telítetlen szénhidrogénekből, főleg izobutánból áll.] |
270-724-1 | 68477-33-8 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-205-00-2 | Distillates (petroleum), C3-6, piperylene-rich; Petroleum gas; [A complex combination of hydrocarbons from the distillation of saturated and unsaturated aliphatic hydrocarbons usually ranging in the carbon numbers C3 through C6. It consists of saturated and unsaturated hydrocarbons having carbon numbers in the range of C3 through C6, predominantly piperylenes.] | Desztillátumok
(ásványolaj), C3-6, piperilénben gazdag; Ásványolaj gáz; [Általában C3-C6 szénatomszámú telített és telítetlen alifás szénhidrogének desztillációjából nyert összetett szénhidrogénkeverék. C3-C6 szénatomszámú telített és telítetlen alifás szénhidrogéneket, elsősorban piperiléneket tartalmaz.] |
270-726-2 | 68477-35-0 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-206-00-8 | Gases (petroleum), butane splitter overheads; Petroleum gas; [A complex combination of hydrocarbons obtained from the distillation of the butane stream. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C3 through C4.] | Gázok
(ásványolaj), butánbontó fejtermékek; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet a butánfrakció desztillációjával nyernek. Főként C3-C4 szénatomszámú alifás szénhidrogénekből áll.] |
270-750-3 | 68477-69-0 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-207-00-3 | Gases (petroleum), C2-3-; Petroleum gas; [A complex combination of hydrocarbons produced by the distillation of products from a catalytic fractionation process. It contains predominantly ethane, ethylene, propane, and propylene.] | Gázok
(ásványolaj), C2-3; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet katalitikus frakcionálással előállított termékek desztillációjával nyernek. Főleg etánból, etilénből, propánból és propilénből áll.] |
270-751-9 | 68477-70-3 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-208-00-9 | Gases (petroleum), catalytic-cracked gas oil depropanizer bottoms, C4-rich acid-free; Petroleum gas; [A complex combination of hydrocarbons obtained from fractionation of catalytic cracked gas oil hydrocarbon stream and treated to remove hydrogen sulfide and other acidic components. It consists of hydrocarbons having carbon numbers in the range of C3 through C5, predominantly C4.] | Gázok
(nyersolaj), katalitikusan krakkolt gázolaj propánmentesítő fenéktermékek,
C4-ben gazdag savmentes; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet a katalitikusan krakkolt gázolaj szénhidrogén párlatának frakcionálásával nyernek és megfelelően kezelnek a hidrogén-szulfid és más savas komponensek eltávolítása céljából. Főleg olyan szénhidrogénekből áll, melyek szénatomszáma a C3-C5 tartományban van, de túlnyomórészt C4.] |
270-752-4 | 68477-71-4 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-209-00-4 | Gases (petroleum), catalytic-cracked naphtha debutanizer bottoms, C3-5-rich; Petroleum gas; [A complex combination of hydrocarbons obtained from the stabilization of catalytic cracked naphtha. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C3 through C5.] | Gázok
(nyersolaj), katalitikusan krakkolt benzin butánmentesítő fenéktermékek,
C3-5-ben gazdag; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet katalitikusan krakkolt benzin stabilizálásával állítanak elő. Főként C3-C5 szénatomszámú alifás szénhidrogénekből áll.] |
270-754-5 | 68477-72-5 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-210-00-X | Tail gas (petroleum), isomerized naphtha fractionation stabilizer; Petroleum gas; [A complex combination of hydrocarbons obtained from the fractionation stabilization products from isomerized naphtha. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | Véggáz
(ásványolaj), izomerizált benzin frakcionáló stabilizátor; Ásványolaj gáz; [Szénhidrogének összetett keveréke, melyet izomerizált benzin frakcionált stabilizációjának termékeiből állítanak elő. Főként C1-C4 szénatomszámú szénhidrogénekből áll.] |
269-628-2 | 68308-08-7 | Flam.
Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H340 H350 |
K U | CLP00/ATP01corr | ||
| 649-211-00-5 | Foots oil (petroleum), carbon-treated; Foots oil; [A complex combination of hydrocarbons obtained by the treatment of Foots oil with activated carbon for the removal of trace constituents and impurities. It consists predominantly of saturated straight chain hydrocarbons having carbon numbers predominantly greater than C12.] | Gacsolaj
(ásványolaj), aktív szénnel kezelt; Gacsolaj; [Gacsolaj nyomokban jelenlevő összetevőinek és szennyeződéseinek eltávolítása érdekében végzett aktív szenes kezelésével előállított, összetett szénhidrogénkeverék. Főleg telített egyenes láncú, jellemzően C12-nél nagyobb szénatomszámú szénhidrogénekből áll.] |
308-126-0 | 97862-76-5 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-212-00-0 | Distillates (petroleum), sweetened middle; Gasoil - unspecified; [A complex combination of hydrocarbons obtained by subjecting a petroleum distillate to a sweetening process to convert mercaptans or to remove acidic impurities. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C20 and boiling in the range of approximately 150 °C to 345 °C (302 °F to 653 °F).] | Párlatok
(ásványolaj), kéntelenített középfrakció; Gázolaj – nem meghatározott; [Szénhidrogének összetett keveréke, melyet úgy állítanak elő, hogy ásványolaj desztillátumot kéntelenítési eljárásnak vetnek alá a merkaptánok konvertálása vagy a savas szennyeződések eltávolítása céljából. Főként C9-C20 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 150 oC-345 oC (302 oF-653 oF). |
265-088-7 | 64741-86-2 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-213-00-6 | Gas oils (petroleum), solvent-refined; Gasoil - unspecified; [A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists predominantly of aliphatic hydrocarbons having carbon numbers predominantly in the range of C11 through C25 and boiling in the range of approximately 205 °C to 400 °C (401 °F to 752 °F).] | Gázolajok
(ásványolaj), oldószerrel finomított; Gázolaj – nem meghatározott; [Oldószeres extrahálásból raffinátumként kapott, összetett szénhidrogénkeverék. Főként C11-C25 szénatomszámú alifás szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 205 oC-400 oC (401 oF-752 oF). |
265-092-9 | 64741-90-8 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-214-00-1 | Distillates (petroleum), solvent-refined middle; Gasoil - unspecified; [A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists predominantly of aliphatic hydrocarbons having carbon numbers predominantly in the range of C9 through C20 and boiling in the range of approximately 150 °C to 345 °C (302 °F to 653 °F).] | Párlatok
(ásványolaj), oldószerrel finomított középpárlat; Gázolaj – nem meghatározott; [Oldószeres extrahálásból raffinátumként kapott, összetett szénhidrogénkeverék. Főként C9-C20 szénatomszámú alifás szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 150 oC-345 oC (302 oF-653 oF). |
265-093-4 | 64741-91-9 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-215-00-7 | Gas oils (petroleum), acid-treated; Gasoil - unspecified; [A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists of hydrocarbons having carbon numbers predominantly in the range of C13 through C25 and boiling in the range of approximately 230 °C to 400 °C (446 °F to 752 °F).] | Gázolajok
(ásványolaj), savval kezelt; Gázolaj – nem meghatározott; [Kénsavas kezelési folyamatból raffinátumként kapott, összetett szénhidrogénkeverék. Főként C13-C25 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 230 oC-400 oC (446 oF-752 oF). |
265-112-6 | 64742-12-7 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-216-00-2 | Distillates (petroleum), acid-treated middle; Gasoil - unspecified; [A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists of hydrocarbons having carbon numbers predominantly in the range of C11 through C20 and boiling in the range of approximately 205 °C to 345 °C (401 °F to 653 °F).] | Párlatok
(ásványolaj), savval kezelt középpárlat; Gázolaj – nem meghatározott; [Kénsavas kezelési folyamatból raffinátumként kapott, összetett szénhidrogénkeverék. Főként C11-C20 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 205 oC-345 oC (401 oF-653 oF). |
265-113-1 | 64742-13-8 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-217-00-8 | Distillates (petroleum), acid-treated light; Gasoil - unspecified; [A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C16 and boiling in the range of approximately 150 °C to 290 °C (302 °F to 554 °F).] | Párlatok
(ásványolaj), savval kezelt könnyűpárlat; Gázolaj – nem meghatározott; [Kénsavas kezelési folyamatból raffinátumként kapott, összetett szénhidrogénkeverék. Főként C9-C16 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 150 oC-290 oC (302 oF-554 oF).] |
265-114-7 | 64742-14-9 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-218-00-3 | Gas oils (petroleum), chemically neutralized; Gasoil - unspecified; [A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantly in the range of C13 through C25 and boiling in the range of approximately 230 °C to 400 °C (446 °F to 752 °F).] | Gázolajok
(ásványolaj), kémiai úton semlegesített; Gázolaj – nem meghatározott; [A savas maradék eltávolítása érdekében végzett kezelés eredményeképpen nyert összetett szénhidrogénkeverék. Főként C13-C25 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 230 oC-400 oC (446 oF-752 oF). |
265-129-9 | 64742-29-6 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-219-00-9 | Distillates (petroleum), chemically neutralized middle; Gasoil - unspecified; [A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantly in the range of C11 through C20 and boiling in the range of approximately 205 °C to 345 °C (401 °F to 653 °F).] | Párlatok
(ásványolaj), kémiai úton semlegesített középpárlat; Gázolaj – nem meghatározott; [A savas maradék eltávolítása érdekében végzett kezelés eredményeképpen nyert összetett szénhidrogénkeverék. Főként C11-C20 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 205 oC-345 oC (401 oF-653 oF). |
265-130-4 | 64742-30-9 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-220-00-4 | Distillates (petroleum), clay-treated middle; Gasoil - unspecified; [A complex combination of hydrocarbons resulting from treatment of a petroleum fraction with natural or modified clay, usually in a percolation process to remove the trace amounts of polar compounds and impurities present. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C20 and boiling in the range of approximately 150 °C to 345 °C (302 °F to 653 °F).] | Párlatok
(ásványolaj), agyaggal kezelt középpárlat; Gázolaj – nem meghatározott; [Ásványolaj párlatnak természetes vagy módosított agyaggal kezelt terméke a poláros vegyületek nyomainak és a szennyeződéseknek eltávolítása érdekben (általában perkolálással). Főként C9-C20 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 150 oC-345 oC (302 oF-653 oF). |
265-139-3 | 64742-38-7 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-221-00-X | Distillates (petroleum), hydrotreated middle; Gasoil - unspecified; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly in the range of C11 through C25 and boiling in the range of approximately 205 °C to 400 °C (401 °F to 752 °F).] | Párlatok
(ásványolaj), hidrogénnel kezelt középpárlat; Gázolaj – nem meghatározott; [Ásványolaj frakció katalitikus hidrogénezésével nyert összetett szénhidrogénkeverék. Főként C11-C25 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 205 oC-400 oC (401 oF-752 oF). |
265-148-2 | 64742-46-7 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-222-00-5 | Gas oils (petroleum), hydrodesulfurized; Gasoil - unspecified; [A complex combination of hydrocarbons obtained from a petroleum stock by treating with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C13 through C25 and boiling in the range of approximately 230 °C to 400 °C (446 °F to 752 °F).] | Gázolajok
(ásványolaj), hidrogénezéssel kénmentesített; Gázolaj – nem meghatározott; [Ásványolaj párlatból nyert összetett szénhidrogénkeverék, melyet a szerves kén hidrogén-szulfiddá alakítása céljából katalizátor jelenlétében hidrogéneznek, és a hidrogén-szulfidot eltávolítják. Főként C13-C25 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 230 oC-400 oC (446 oF-752 oF). |
265-182-8 | 64742-79-6 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-223-00-0 | Distillates (petroleum), hydrodesulfurized middle; Gasoil - unspecified; [A complex combination of hydrocarbons obtained from a petroleum stock by treating with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It consists of hydrocarbons having carbon numbers predominantly in the range of C11 through C25 and boiling in the range of approximately 205 °C to 400 °C (401 °F to 752 °F).] | Párlatok
(ásványolaj), hidrogénezéssel kénmentesített középpárlat; Gázolaj – nem meghatározott; [Ásványolaj párlatból nyert összetett szénhidrogénkeverék, melyet a szerves kén hidrogén-szulfiddá alakítása céljából katalizátor jelenlétében hidrogéneznek, és a hidrogén-szulfidot eltávolítják. Főként C11-C25 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 205 oC-400 oC (401 oF-752 oF). |
265-183-3 | 64742-80-9 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-224-00-6 | Fuels, diesel; Gasoil - unspecified; [A complex combination of hydrocarbons produced by the distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C20 and boiling in the range of approximately 163 °C to 357 °C (325 °F to 675 °F).] | Dízelolaj; Gázolaj – nem meghatározott; [Szénhidrogének összetett keveréke, melyet nyersolaj desztillációjával állítanak elő. Főként C9-C20 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 163 oC-357 oC (325 oF-675 oF). |
269-822-7 | 68334-30-5 | Carc.
2 |
H351 |
GHS08 Wng |
H351 |
N | CLP00 | ||
| 649-225-00-1 | Fuel oil, No 2; Gasoil - unspecified; [A distillate oil having a minimum viscosity of 32,6 SUS at 37,7 °C (100 °F) to a maximum of 37,9 SUS at 37,7 °C (100 °F).] | Gázolaj
no.2; Gázolaj – nem meghatározott; [Az olajpárlat viszkozitása: minimum 32,6 SUS 37,7 oC-on (100 oF), maximum 37,9 SUS 37,7 oC-on (100 oF).] |
270-671-4 | 68476-30-2 | Carc.
2 |
H351 |
GHS08 Wng |
H351 |
CLP00 | |||
| 649-226-00-7 | Fuel oil, No 4; Gasoil - unspecified; [A distillate oil having a minimum viscosity of 45 SUS at 37,7 °C (100 °F) to a maximum of 125 SUS at 37,7 °C (100 °F).] | Gázolaj
no.4; Gázolaj – nem meghatározott; [Az olajpárlat viszkozitása: minimum 45 SUS 37,7 oC-on (100 oF), maximum 125 SUS 37,7 oC-on (100 oF).] |
270-673-5 | 68476-31-3 | Carc.
2 |
H351 |
GHS08 Wng |
H351 |
CLP00 | |||
| 649-227-00-2 | Fuels, diesel, No 2; Gasoil - unspecified; [A distillate oil having a minimum viscosity of 32,6 SUS at 37,7 °C (100 °F).] | Dízelolaj
no.2; Gázolaj – nem meghatározott; [Az olajpárlat viszkozitása: minimum 32,6 SUS 37,7 oC-on (100 oF-on).] |
270-676-1 | 68476-34-6 | Carc.
2 |
H351 |
GHS08 Wng |
H351 |
CLP00 | |||
| 649-228-00-8 | Distillates (petroleum), catalytic reformer fractionator residue, high-boiling; Gasoil - unspecified; [A complex combination of hydrocarbons from the distillation of catalytic reformer fracftionator residue. It boils in the range of approximately 343 °C to 399 °C (650 °F to 750 °F).] | Párlatok
(ásványolaj), katalitikus reformáló szakaszos lepárló maradék, magas
forráspontú; Gázolaj – nem meghatározott; [A katalitikus frakcionáló reformálás maradékából desztilláció útján nyert összetett szénhidrogénkeverék. Hozzávetőleges forráspont-tartománya: 343 oC-399 oC (650 oF-750 oF). |
270-719-4 | 68477-29-2 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-229-00-3 | Distillates (petroleum), catalytic reformer fractionator residue, intermediate-boiling; Gasoil - unspecified; [A complex combination of hydrocarbons from the distillation of catalytic reformer fractionator residue. It boils in the range of approximately 288 °C to 371 °C (550 °F to 700 °F).] | Párlatok
(ásványolaj), katalitikus reformáló szakaszos lepárló maradék, közepes
forráspontú; Gázolaj – nem meghatározott; [A katalitikus frakcionáló reformálás maradékából desztilláció útján nyert összetett szénhidrogénkeverék. Hozzávetőleges forráspont-tartománya: 288 oC-371 oC (550 oF-700 oF). |
270-721-5 | 68477-30-5 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-230-00-9 | Distillates (petroleum), catalytic reformer fractionator residue, low-boiling; Gasoil - unspecified; [The complex combination of hydrocarbons from the distillation of catalytic reformer fractionator residue. It boils approximately below 288 °C (550 °F).] | Párlatok
(ásványolaj), katalitikus reformáló szakaszos lepárló maradék, alacsony
forráspontú; Gázolaj – nem meghatározott; [A katalitikus frakcionáló reformálás maradékából desztilláció útján nyert összetett szénhidrogénkeverék. Forráspont-tartománya 288 oC (550 oF) alatt van.] |
270-722-0 | 68477-31-6 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-231-00-4 | Distillates (petroleum), highly refined middle; Gasoil - unspecified; [A complex combination of hydrocarbons obtained by the subjection of a petroleum fraction to several of the following steps: filtration, centrifugation, atmospheric distillation, vacuum distillation, acidification, neutralization and clay treatment. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C10 through C20.] | Párlatok
(ásványolaj), magasan finomított középpárlat; Gázolaj – nem meghatározott; [Összetett szénhidrogénkeverék, melyet ásványolajból a következőkben felsorolt műveletek közül többet is alkalmazva állítanak elő: szűrés, centrifugálás, atmoszferikus desztilláció, vákuumdesztilláció, savazás, semlegesítés és agyagos kezelés. Főként C10-C20 szénatomszámú szénhidrogénekből áll.] |
292-615-8 | 90640-93-0 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-232-00-X | Distillates (petroleum) catalytic reformer, heavy arom. conc.; Gasoil - unspecified; [A complex combination of hydrocarbons obtained from the distillation of a catalytically reformed petroleum cut. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C10 through C16 and boiling in the range of approximately 200 °C to 300 °C (392 °F to 572 °F).] | Párlatok
(ásványolaj), katalitikus reformáló, nehéz aromás konc.; Gázolaj – nem
meghatározott; [Katalitikusan reformált ásványolaj frakció desztillációjával
előállított, összetett szénhidrogénkeverék. Főként C10-C16 szénatomszámú
aromás szénhidrogénekből áll, hozzávetőleges forráspont-tartománya:
200 oC-300 oC (392 oF-572 oF).] |
295-294-2 | 91995-34-5 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-233-00-5 | Gas oils, paraffinic; Gasoil - unspecified; [A distillate obtained from the redistillation of a complex combination of hydrocarbons obtained by the distillation of the effluents from a severe catalytic hydrotreatment of paraffins. It boils in the range of approximately 190 °C to 330 °C (374 °F to 594 °F).] | Gázolajok,
paraffinos; Gázolaj – nem meghatározott; [Paraffinok intenzív katalitikus hidrogénezésével előállított származékainak desztillációjával kapott, összetett szénhidrogénkeverék újradesztillálásával nyert párlat. Hozzávetőleges forráspont-tartománya: 190 oC-330 oC (374 oF-594 oF). |
300-227-8 | 93924-33-5 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-234-00-0 | Naphtha (petroleum), solvent-refined hydrodesulfurized heavy; Gasoil - unspecified | Nehézbenzin
(ásványolaj), oldószerrel finomított hidrogénnel kéntelenített
nehézpárlat; Gázolaj – nem meghatározott |
307-035-3 | 97488-96-5 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-235-00-6 | Hydrocarbons, C16-20, hydrotreated middle distillate, distn. lights; Gasoil - unspecified; [A complex combination of hydrocarbons obtained as first runnings from the vacuum distillation of effluents from the treatment of a middle distillate with hydrogen. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C16 through C20 and boiling in the range of approximately 290 °C to 350 °C (554 °F to 662 °F). It produces a finished oil having a viscosity of 2cSt at 100 °C (212 °F).] | Szénhidrogének,
C16-20, hidrogénnel kezelt közép párlat, deszt. könnyű; Gázolaj – nem meghatározott; [Középpárlat hidrogénes kezelésével előállított termékek vákuumdesztillációja során első párlatként kapott, összetett szénhidrogénkeverék. Főként C16-C20 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 290 oC-350 oC (554 oF-662 oF). A végtermék olaj viszkozitása 2 cSt 100 oC-on (212 oF-on).] |
307-659-6 | 97675-85-9 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-236-00-1 | Hydrocarbons, C12-20, hydrotreated paraffinic, distn. lights; Gasoil - unspecified; [A complex combination of hydrocarbons obtained as first runnings from the vacuum distillation of effluents from the treatment of heavy paraffins with hydrogen in the presence of a catalyst. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C12 through C20 and boiling in the range of approximately 230 °C to 350 °C (446 °F to 662 °F). It produces a finished oil having a viscosity of 2cSt at 100 °C (212 °F).] | Szénhidrogének,
C12-20, hidrogénnel kezelt paraffinos, deszt. könnyű; Gázolaj – nem meghatározott; [Nehéz paraffinok hidrogénes kezelésével előállított termékek vákuumdesztillációja során első párlatként kapott, összetett szénhidrogénkeverék. Főként C12-C20 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 230 oC-350 oC (446 oF-662 oF). A végtermék olaj viszkozitása 2 cSt 100 oC-on (212 oF-on).] |
307-660-1 | 97675-86-0 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-237-00-7 | Hydrocarbons, C11-17, solvent-extd. light naphthenic; Gasoil - unspecified; [A complex combination of hydrocarbons obtained by extraction of the aromatics from a light naphthenic distillate having a visciosity of 2.2 cSt at 40 °C (104 °F). It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C11 through C17 and boiling in the range of approximately 200 °C to 300 °C (392 °F to 572 °F).] | Szénhidrogének,
C11-17, oldószerrel extrahált könnyű nafténbázisú; Gázolaj – nem meghatározott; [Nafténes könnyűpárlatból az aromás vegyületek extrahálásával kapott, 40 oC (104 oF) 2,2 cSt viszkozitású, összetett szénhidrogénkeverék. Főként C11-C17 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 200 oC-300 oC (392 oF-572 oF). |
307-757-9 | 97722-08-2 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-238-00-2 | Gas oils, hydrotreated; Gasoil - unspecified; [A complex combination of hydrocarbons obtained from the redistillation of the effluents from the treatment of paraffins with hydrogen in the presence of a catalyst. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C17 through C27 and boiling in the range of approximately 330 °C to 340 °C (626 °F to 644 °F).] | Gázolajok,
hidrogénnel kezelt; Gázolaj – nem meghatározott; [Paraffinok katalitikus hidrogénezésével előállított származékok újradesztillációjával kapott, összetett szénhidrogénkeverék. Főként C17-C27 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 330 oC-340 oC (626 oF-644 oF). |
308-128-1 | 97862-78-7 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-239-00-8 | Distillates (petroleum), carbon-treated light paraffinic; Gasoil - unspecified; [A complex combination of hydrocarbons obtained by the treatment of a petroleum oil fraction with activated charcoal for the removal of traces of polar constituents and impurities. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C12 through C28.] | Párlatok
(ásványolaj), aktív szénnel kezelt; Gázolaj – nem meghatározott; [Ásványolaj frakciónak a nyomokban jelenlevő poláros összetevők és szennyeződések eltávolítása érdekében aktív szénnel végzett kezelése útján előállított, összetett szénhidrogénkeverék. Főként C12-C28 szénatomszámú szénhidrogénekből áll.] |
309-667-5 | 100683-97-4 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-240-00-3 | Distillates (petroleum), intermediate paraffinic, carbon-treated; Gasoil - unspecified; [A complex combination of hydrocarbons obtained by the treatment of petroleum with activated charcoal for the removal of trace polar constituents and impurities. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C16 through C36.] | Párlatok
(ásványolaj), paraffinos középpárlat, aktív szénnel kezelt; Gázolaj – nem meghatározott; [Ásványolajnak a nyomokban jelenlevő poláros összetevők és szennyeződések eltávolítása érdekében aktív szénnel végzett kezelése útján előállított, összetett szénhidrogénkeverék. Főként C16-C36 szénatomszámú szénhidrogénekből áll.] |
309-668-0 | 100683-98-5 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-241-00-9 | Distillates (petroleum), intermediate paraffinic, clay-treated; Gasoil - unspecified; [A complex combination of hydrocarbons obtained by the treatment of petroleum with bleaching earth for the removal of trace polar constituents and impurities. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C16 through C36.] | Párlatok
(ásványolaj), paraffinos középpárlat, agyaggal kezelt; Gázolaj – nem
meghatározott; [Ásványolajnak a nyomokban jelenlevő poláros összetevők és szennyeződések eltávolítása érdekében derítőfölddel végzett kezelése útján előállított, összetett szénhidrogénkeverék. Főként C16-C36 szénatomszámú szénhidrogénekből áll.] |
309-669-6 | 100683-99-6 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-242-00-4 | Alkanes, C12-26-branched and linear | Alkánok, C12-26, elágazó és egyenes láncú | 292-454-3 | 90622-53-0 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-243-00-X | Lubricating greases; Grease; [A complex combination of hydrocarbons having carbon numbers predominantly in the range of C12 through C50. May contain organic salts of alkali metals, alkaline earth metals, and/or aluminium compounds.] | Kenőzsírok;
Zsír; [Túlnyomóan C12-C50 szénatomszámú szénhidrogénekből álló, összetett szénhidrogénkeverék. Alkálifémek és alkáli-földfémek szerves sóit és/vagy alumínium-vegyületeket is tartalmazhat.] |
278-011-7 | 74869-21-9 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-244-00-5 | Slack wax (petroleum); Slack wax; [A complex combination of hydrocarbons obtained from a petroleum fraction by solvent crystallization (solvent dewaxing) or as a distillation fraction from a very waxy crude. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers predominantly greater than C20.] | Paraffingacs
(ásványolaj); Paraffingacs; [Ásványolaj frakcióból oldószeres kristályosítással (oldószeres viaszmentesítés) vagy nagyon viaszos nyersanyagból lepárlási frakcióként előállított, összetett szénhidrogénkeverék. Főleg telített egyenes és elágazó láncú, jellemzően C20-nél nagyobb szénatomszámú szénhidrogénekből áll.] |
265-165-5 | 64742-61-6 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-245-00-0 | Slack wax (petroleum), acid-treated; Slack wax; [A complex combination of hydrocarbons obtained as a raffinate by treatment of a petroleum slack wax fraction with sulfuric acid treating process. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers predominantly greater than C20.] | Paraffingacs
(ásványolaj), savval kezelt; Paraffingacs; [Ásványolaj paraffingacs frakciójából kénsavas kezelési folyamat útján, raffinátumként előállított, összetett szénhidrogénkeverék. Főleg telített egyenes és elágazó láncú, jellemzően C20-nél nagyobb szénatomszámú szénhidrogénekből áll.] |
292-659-8 | 90669-77-5 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-246-00-6 | Slack wax (petroleum), clay-treated; Slack wax; [A complex combination of hydrocarbons obtained by treatment of a petroleum slack wax fraction with natural or modified clay in either a contacting or percolation process. It consists predominantly of saturated straight and branched hydrocarbons having carbon numbers predominantly greater than C20.] | Paraffingacs
(ásványolaj), agyaggal kezelt; Paraffingacs; [Ásványolaj paraffingacs frakciójából perkolálással vagy érintkezéses módszerrel, természetes vagy módosított agyaggal történő kezeléssel kapott, összetett szénhidrogénkeverék. Főleg telített egyenes és elágazó láncú, jellemzően C20-nél nagyobb szénatomszámú szénhidrogénekből áll.] |
292-660-3 | 90669-78-6 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-247-00-1 | Slack wax (petroleum), hydrotreated; Slack wax; [A complex combination of hydrocarbons obtained by treating slack wax with hydrogen in the presence of a catalyst. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers predominantly greater than C20.] | Paraffingacs
(ásványolaj), hidrogénnel kezelt; Paraffingacs; [Paraffingacsnak katalizátor jelenlétében hidrogénnel végzett kezelésével előállított, összetett szénhidrogénkeverék. Főleg telített egyenes és elágazó láncú, jellemzően C20-nél nagyobb szénatomszámú szénhidrogénekből áll.] |
295-523-6 | 92062-09-4 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-248-00-7 | Slack wax (petroleum), low-melting; Slack wax; [A complex combination of hydrocarbons obtained from a petroleum fraction by solvent deparaffination. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers predominantly greater than C12.] | Paraffingacs
(ásványolaj), alacsony olvadáspontú; Paraffingacs; [Ásványolaj frakcióból oldószeres paraffinmentesítéssel előállított, összetett szénhidrogénkeverék. Főleg telített egyenes és elágazó láncú, jellemzően C12-nél nagyobb szénatomszámú szénhidrogénekből áll.] |
295-524-1 | 92062-10-7 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-249-00-2 | Slack wax (petroleum), low-melting, hydrotreated; Slack wax; [A complex combination of hydrocarbons obtained by treatment of low-melting petroleum slack wax with hydrogen in the presence of a catalyst. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers predominantly greater than C12.] | Paraffingacs
(ásványolaj), alacsony olvadáspontú, hidrogénnel kezelt; Paraffingacs; [Alacsony olvadáspontú ásványolaj paraffingacs katalizátor jelenlétében hidrogénnel végzett kezelésével előállított, összetett szénhidrogénkeverék. Főleg telített egyenes és elágazó láncú, jellemzően C12-nél nagyobb szénatomszámú szénhidrogénekből áll.] |
295-525-7 | 92062-11-8 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-250-00-8 | Slack wax (petroleum), low-melting, carbon-treated; Slack wax; [A complex combination of hydrocarbons obtained by the treatment of low-melting slack wax with activated carbon for the removal of trace polar constituents and impurities. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers predominantly greater than C12.] | Paraffingacs
(ásványolaj), alacsony olvadáspontú, aktív szénnel kezelt; Paraffingacs; [Alacsony olvadáspontú paraffingacsnak a nyomokban jelenlevő poláros összetevők és szennyeződések eltávolítása érdekében aktív szénnel végzett kezelésével előállított, összetett szénhidrogénkeverék. Főleg telített egyenes és elágazó láncú, jellemzően C12-nél nagyobb szénatomszámú szénhidrogénekből áll.] |
308-155-9 | 97863-04-2 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-251-00-3 | Slack wax (petroleum), low-melting, clay-treated; Slack wax; [A complex combination of hydrocarbons obtained by the treatment of low-melting petroleum slack wax with bentonite for removal of trace polar constituents and impurities. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers predominantly greater than C12.] | Paraffingacs
(ásványolaj), alacsony olvadáspontú, agyaggal kezelt; Paraffingacs; [Alacsony olvadáspontú ásványolaj paraffingacsnak a nyomokban jelenlevő poláros összetevők és szennyeződések eltávolítása érdekében bentonittal végzett kezelésével előállított, összetett szénhidrogénkeverék. Főleg telített egyenes és elágazó láncú, jellemzően C12-nél nagyobb szénatomszámú szénhidrogénekből áll.] |
308-156-4 | 97863-05-3 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-252-00-9 | Slack wax (petroleum), low-melting, silicic acid-treated; Slack wax; [A complex combination of hydrocarbons obtained by the treatment of low-melting petroleum slack wax with silicic acid for the removal of trace polar constituents and impurities. It consists predominantly of saturated straight and branched chain hydrocarbons having carbon numbers predominantly greater than C12.] | Paraffingacs (ásványolaj), alacsony olvadáspontú, kovasavval kezelt; Paraffingacs; [Alacsony olvadáspontú ásványolaj paraffingacsnak a nyomokban jelenlevő poláros összetevők és szennyeződések eltávolítása érdekében kovasavval végzett kezelésével előállított, összetett szénhidrogénkeverék. Főleg telített egyenes és elágazó láncú, jellemzően C12-nél nagyobb szénatomszámú szénhidrogénekből áll.] | 308-158-5 | 97863-06-4 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-253-00-4 | Slack wax (petroleum), carbon-treated; Slack wax; [A complex combination of hydrocarbons obtained by treatment of petroleum slack wax with activated charcoal for the removal of trace polar constituents and impurities.] | Paraffingacs
(ásványolaj), aktív szénnel kezelt; Paraffingacs; [Ásványolaj paraffingacsnak a nyomokban jelenlevő poláros összetevők és szennyeződések eltávolítása érdekében aktív szénnel végzett kezelésével előállított, összetett szénhidrogénkeverék.] |
309-723-9 | 100684-49-9 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-254-00-X | Petrolatum; Petrolatum; [A complex combination of hydrocarbons obtained as a semi-solid from dewaxing paraffinic residual oil. It consists predominantly of saturated crystalline and liquid hydrocarbons having carbon numbers predominantly greater than C25.] | Petrolátum;
Petrolátum; [Paraffinos maradék olajból viaszmentesítéssel, félig szilárd anyagként előállított, összetett szénhidrogénkeverék. Főleg telített, kristályos és folyékony halmazállapotú, jellemzően C25-nél nagyobb szénatomszámú szénhidrogénekből áll.] |
232-373-2 | 8009-03-8 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-255-00-5 | Petrolatum (petroleum), oxidized; Petrolatum; [A complex combination of organic compounds, predominantly high molecular weight carboxylic acids, obtained by the air oxidation of petrolatum.] | Petrolátum
(ásványolaj), oxidált; Petrolátum; [Petrolátum levegővel végzett oxidációjával előállított, szerves vegyületekből, túlnyomóan nagy molekulatömegű karbonsavakból álló összetett keverék.] |
265-206-7 | 64743-01-7 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-256-00-0 | Petrolatum (petroleum), alumina-treated; Petrolatum; [A complex combination of hydrocarbons obtained when petrolatum is treated with Al2O3 to remove polar components and impurities. It consists predominantly of saturated, crystalline, and liquid hydrocarbons having carbon numbers predominantly greater than C25.] | Petrolátum
(ásványolaj), timfölddel kezelt; Petrolátum; [Petrolátumnak a nyomokban jelenlevő poláros összetevők és szennyeződések eltávolítása érdekében Al2O3 -dal (timfölddel) végzett kezelésével előállított, összetett szénhidrogénkeverék. Főleg telített, kristályos és folyékony halmazállapotú, jellemzően C25-nél nagyobb szénatomszámú szénhidrogénekből áll.] |
285-098-5 | 85029-74-9 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-257-00-6 | Petrolatum (petroleum), hydrotreated; Petrolatum; [A complex combination of hydrocarbons obtained as a semi-solid from dewaxed paraffinic residual oil treated with hydrogen in the presence of a catalyst. It consists predominantly of saturated microcrystalline and liquid hydrocarbons having carbon numbers predominantly greater than C20.] | Petrolátum
(ásványolaj), hidrogénnel kezelt; Petrolátum; [Viaszmentesített paraffinos maradék olajból, katalizátor jelenlétében végzett hidrogénes kezeléssel, félig szilárd anyagként kapott, összetett szénhidrogénkeverék. Főleg telített, mikrokristályos és folyékony halmazállapotú, jellemzően C20-nél nagyobb szénatomszámú szénhidrogénekből áll.] |
295-459-9 | 92045-77-7 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-258-00-1 | Petrolatum (petroleum), carbon-treated; Petrolatum; [A complex combination of hydrocarbons obtained by the treatment of petroleum petrolatum with activated carbon for the removal of trace polar constituents and impurities. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly greater than C20.] | Petrolátum
(ásványolaj), aktív szénnel kezelt; Petrolátum; [Ásványolaj petrolátumnak a nyomokban jelenlevő poláros összetevők és szennyeződések eltávolítsa érdekében aktív szénnel végzett kezelésével előállított, összetett szénhidrogénkeverék. Főleg telített, jellemzően C20-nél nagyobb szénatomszámú szénhidrogénekből áll.] |
308-149-6 | 97862-97-0 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-259-00-7 | Petrolatum (petroleum), silicic acid-treated; Petrolatum; [A complex combination of hydrocarbons obtained by the treatment of petroleum petrolatum with silicic acid for the removal of trace polar constituents and impurities. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly greater than C20.] | Petrolátum
(ásványolaj), kovasavval kezelt; Petrolátum; [Ásványolaj petrolátumnak a nyomokban jelenlevő poláros összetevők és szennyeződések eltávolítása érdekében kovasavval végzett kezelésével előállított, összetett szénhidrogénkeverék. Főleg telített, jellemzően C20-nél nagyobb szénatomszámú szénhidrogénekből áll.] |
308-150-1 | 97862-98-1 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-260-00-2 | Petrolatum (petroleum), clay-treated; Petrolatum; [A complex combination of hydrocarbons obtained by treatment of petrolatum with bleaching earth for the removal of traces of polar constituents and impurities. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of greater than C25.] | Petrolátum
(ásványolaj), agyaggal kezelt; Petrolátum; [Petrolátumnak a nyomokban jelenlevő poláros összetevők és szennyeződések eltávolítása érdekében derítőfölddel végzett kezelésével előállított, összetett szénhidrogénkeverék. Főként C25-nél nagyobb szénatomszámú szénhidrogénekből áll.] |
309-706-6 | 100684-33-1 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
N | CLP00 | ||
| 649-261-00-8 | Gasoline, natural; Low boiling point naphtha; [A complex combination of hydrocarbons separated from natural gas by processes such as refrigeration or absorption. It consists predominantly of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C4 through C8 and boiling in the range of approximately minus 20°C to 120°C (-4°F to 248°F).] | Gazolin,
természetes; Alacsony forráspontú benzin; [Földgáztól pl. hűtéssel vagy abszorpció útján elválasztott, összetett szénhidrogénkeverék. Főként C4-C8 szénatomszámú telített alifás szénhidrogénekből áll, és hozzávetőleges forráspont-tartománya –20 oC és 120 oC (–4 oF és 248 oF) között van.] |
232-349-1 | 8006-61-9 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-262-00-3 | Naphtha; Low boiling point naphtha; [Refined, partly refined, or unrefined petroleum products produced by the distillation of natural gas. It consists of hydrocarbons having carbon numbers predominantly in the range of C5 through C6 and boiling in the range of approximately 100°C to 200°C (212°F to 392°F).] | Benzin; Alacsony forráspontú benzin; [Finomított, részben finomított vagy finomítatlan ásványolajtermékek, melyeket földgáz desztillációjával állítanak elő. Főként C5-C6 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 100 oC és 200 oC (212 oF és 392 oF) között van.] |
232-443-2 | 8030-30-6 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-263-00-9 | Ligroine; Low boiling point naphtha; [A complex combination of hydrocarbons obtained by the fractional distillation of petroleum. This fraction boils in a range of approximately 20°C to 135°C (58°F to 275°F).] | Ligroin; Alacsony forráspontú benzin; [Szénhidrogének összetett keveréke, melyet nyersolaj frakcionált desztillációjával állítanak elő. Ez a frakció a kb. 20 oC-tól 135 oC-ig (58 oF-tól 275 oF-ig) terjedő tartományban forr.] |
232-453-7 | 8032-32-4 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-264-00-4 | Naphtha (petroleum), heavy straight-run; Low boiling point naphtha; [A complex combination of hydrocarbons produced by distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C6 through C12 and boiling in the range of approximately 65°C to 230°C (149°F to 446°F).] | Benzin (nyersolaj), nehéz közvetlen lepárlású; Alacsony forráspontú benzin; [Szénhidrogének összetett keveréke, melyet nyersolaj desztillációjával állítanak elő. Főként C6-C12 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 65 oC és 230 oC (149 oF és 446 oF) között van.] | 265-041-0 | 64741-41-9 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-265-00-X | Naphtha (petroleum), full-range straight-run; Low boiling point naphtha; [A complex combination of hydrocarbons produced by distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C11 and boiling in the range of approximately -20°C to 220°C (-4°F to 428°F).] | Benzin
(ásványolaj), teljes közvetlen lepárlású; Alacsony forráspontú benzin; [Szénhidrogének összetett keveréke, melyet nyersolaj desztillációjával nyernek. Főként C4-C11 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya –20 oC és 220 oC (–4 oF és 428 oF) között van.] |
265-042-6 | 64741-42-0 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-266-00-5 | Naphtha (petroleum), light straight-run; Low boiling point naphtha; [A complex combination of hydrocarbons produced by distillation of crude oil. It consists predominantly of aliphatic hydrocarbons having carbon numbers predominantly in the range of C4 through C10 and boiling in the range of approximately -20°C to 180°C (-4°F to 356°F).] | Benzin
(ásványolaj), könnyű közvetlen lepárlású; Alacsony forráspontú benzin; [Szénhidrogének összetett keveréke, melyet nyersolaj desztillációjával nyernek. Főként C4-C10 szénatomszámú alifás szénhidrogénekből áll, hozzávetőleges forráspont-tartománya –20 oC és 180 oC (–4 oF és 356 oF) között van.] |
265-046-8 | 64741-46-4 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-267-00-0 | Solvent naphtha (petroleum), light aliph.; Low boiling point naphtha; [A complex combination of hydrocarbons obtained from the distillation of crude oil or natural gasoline. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C5 through C10 and boiling in the range of approximately 35°C to 160°C (95°F to 320°F).] | Oldószer
benzin (ásványolaj), könnyű alif.; Alacsony forráspontú benzin; [Szénhidrogének összetett keveréke, melyet nyersolaj vagy természetes gazolin desztillációjával nyernek. Főként C5-C10 szénatomszámú telített szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 35 oC és 160 oC (95 oF és 320 oF) között van.] |
265-192-2 | 64742-89-8 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-268-00-6 | Distillates (petroleum), straight-run light; Low boiling point naphtha; [A complex combination of hydrocarbons produced by the distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C2 through C7 and boiling in the range of approximately -88°C to 99°C (-127°F to 210°F).] | Desztillátumok
(ásványolaj), közvetlen lepárlású könnyű; Alacsony forráspontú benzin; [Szénhidrogének összetett keveréke, melyet nyersolaj desztillációjával állítanak elő. Főként C2-C7 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya –88 oC és 99 oC (–127 oF és 210 oF) között van.] |
270-077-5 | 68410-05-9 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-269-00-1 | Gasoline, vapor-recovery; Low boiling point naphtha; [A complex combination of hydrocarbons separated from the gases from vapor recovery systems by cooling. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C11 and boiling in the range of approximately -20°C to 196°C(-4°F to 384°F).] | Benzin,
gőzvisszanyerés; Alacsony forráspontú benzin; [Szénhidrogének összetett keveréke, melyet gőzvisszanyerő rendszerekből származó gázokból hűtéssel választanak el. Főként C4-C11 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya –20 oC és 196 oC (–4 oF és 384 oF) között van.] |
271-025-4 | 68514-15-8 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-270-00-7 | Gasoline, straight-run, topping-plant; Low boiling point naphtha; [A complex combination of hydrocarbons produced from the topping plant by the distillation of crude oil. It boils in the range of approximately 36.1°C to 193.3°C (97°F to 380°F).] | Benzin,
közvetlen lepárlású, könnyűlepárló; Alacsony forráspontú benzin; [Szénhidrogének összetett keveréke, melyet nyersolaj desztillációjával a könnyűlepárlóból nyernek. Hozzávetőlegesen a 36,1 oC-tól 193,3 oC-ig (97 oF-tól 380 oF-ig) terjedő tartományban forr.] |
271-727-0 | 68606-11-1 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-271-00-2 | Naphtha (petroleum), unsweetened; Low boiling point naphtha; [A complex combination of hydrocarbons produced from the distillation of naphtha streams from various refinery processes. It consists of hydrocarbons having carbon numbers predominantly in the range of C5 through C12 and boiling in the range of approximately 0°C to 230°C (25°F to 446°F).] | Benzin (nyersolaj), nem kéntelenített; Alacsony forráspontú benzin; [Szénhidrogének összetett keveréke, melyet különféle finomítási folyamatokból származó benzin elegyek desztillációjából nyernek. Főként C5-C12 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 0 oC és 230 oC (25 oF és 446 oF) között van.] | 272-186-3 | 68783-12-0 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-272-00-8 | Distillates (petroleum), light straight-run gasoline fractionation stabilizer overheads; Low boiling point naphtha; [A complex combination of hydrocarbons obtained by the fractionation of light straight-run gasoline. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C3 through C6.] | Desztillátumok
(ásványolaj), könnyű közvetlen lepárlású benzin frakcionált stabilizáló
fejtermékek; Alacsony forráspontú benzin; [Szénhidrogének összetett keveréke, melyet könnyű közvetlen lepárlású benzin frakcionálásával nyernek. Főként C3-C6 szénatomszámú telített alifás szénhidrogénekből áll.] |
272-931-2 | 68921-08-4 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-273-00-3 | Naphtha (petroleum), heavy straight run, arom.-contg.; Low boiling point naphtha; [A complex combination of hydrocarbons obtained from a distillation process of crude petroleum. It consists predominantly of hydrocarbons having carbon numbers in the range of C8 through C12 and boiling in the range of approximately 130°C to 210°C (266°F to 410°F).] | Benzin
(ásványolaj), nehéz közvetlen lepárlású, aromás tart.; Alacsony forráspontú benzin; [Szénhidrogének összetett keveréke, melyet nyersolaj desztillációs folyamatából nyernek. Főként C8-C12 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 130 oC és 210 oC (266 oF és 410 oF) között van.] |
309-945-6 | 101631-20-3 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-274-00-9 | Naphtha (petroleum), full-range alkylate; Low boiling point modified naphtha; [A complex combination of hydrocarbons produced by distillation of the reaction products of isobutane with monoolefinic hydrocarbons usually ranging in carbon numbers from C3 through C5 It consists of predominantly branched chain saturated hydrocarbons having carbon numbers predominantly in the range of C7 through C12 and boiling in the range of approximately 90°C to 220°C (194°F to 428°F).] | Benzin
(ásványolaj), teljes alkilátum; Alacsony forráspontú módosított benzin; [Szénhidrogének összetett keveréke, melyet izobután és főként C3-C5 szénatomszámú monoolefin-szénhidrogének reakciójának termékeiből desztillálással nyernek. Főleg elágazó láncú telített szénhidrogénekből áll, melyek szénatomszáma főleg a C7-C12 tartományban, forráspontja kb. a 90 oC-tól 220 oC-ig (194 oF-tól 428 oF-ig) terjedő tartományban van.] |
265-066-7 | 64741-64-6 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-275-00-4 | Naphtha (petroleum), heavy alkylate; Low boiling point modified naphtha; [A complex combination of hydrocarbons produced by distillation of the reaction products of isobutane with monoolefinic hydrocarbons usually ranging in carbon numbers from C3 to C5. It consists of predominantly branched chain saturated hydrocarbons having carbon numbers predominantly in the range of C9 through C12 and boiling in the range of approximately 150°C to 220°C (302°F to 428°F).] | Benzin
(ásványolaj), nehéz alkilátum; Alacsony forráspontú módosított benzin; [Szénhidrogének összetett keveréke, melyet izobután és főként C3-C5 szénatomszámú monoolefin-szénhidrogének reakciójának termékeiből desztillálással nyernek. Főként C9-C12 szénatomszámú, elágazó láncú telített szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 150 oC és 220 oC (302 oF és 428 oF) között van.] |
265-067-2 | 64741-65-7 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-276-00-X | Naphtha (petroleum), light alkylate; Low boiling point modified naphtha; [A complex combination of hydrocarbons produced by distillation of the reaction products of isobutane with monoolefinic hydrocarbons usually ranging in carbon numbers from C3 through C5. It consists of predominantly branched chain saturated hydrocarbons having carbon numbers predominantly in the range of C7 through C10 and boiling in the range of approximately 90°C to 160°C (194°F to 320°F).] | Benzin
(ásványolaj), könnyű alkilátum; Alacsony forráspontú módosított benzin; [Szénhidrogének összetett keveréke, melyet izobután és főként C3-C5 szénatomszámú monoolefin-szénhidrogének reakciójának termékeiből desztillálással nyernek. Főként C7-C10 szénatomszámú, elágazó láncú telített szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 90 oC és 160 oC (194 oF és 320 oF) között van.] |
265-068-8 | 64741-66-8 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-277-00-5 | Naphtha (petroleum), isomerization; Low boiling point modified naphtha; [A complex combination of hydrocarbons obtained from catalytic isomerization of straight chain paraffinic C4 through C6 hydrocarbons. It consists predominantly of saturated hydrocarbons such as isobutane, isopentane, 2,2-dimethylbutane, 2-methylpentane, and 3-methylpentane.] | Benzin
(ásványolaj), izomerizáció; Alacsony forráspontú módosított benzin; [Szénhidrogének összetett keveréke, melyet C4-C6 szénatomszámú egyenes láncú paraffin-szénhidrogének katalitikus izomerizációjából nyernek. Főleg telített szénhidrogénekből áll, például izobutánból, izopentánból, 2,2-dimetilbutánból, 2-metilpentánból és 3-metilpentánból.] |
265-073-5 | 64741-70-4 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-278-00-0 | Naphtha (petroleum), solvent-refined light; Low boiling point modified naphtha; [A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists predominantly of aliphatic hydrocarbons having carbon numbers predominantly in the range of C5 through C11 and boiling in the range of approximately 35°C to 190°C (95°F to 374°F).] | Benzin
(ásványolaj), oldószerrel finomított könnyű; Alacsony forráspontú módosított benzin; [Oldószeres extrahálásból raffinátumként kapott, összetett szénhidrogénkeverék. Főként C5-C11 szénatomszámú alifás szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 35 oC és 190 oC (95 oF és 374 oF) között van.] |
265-086-6 | 64741-84-0 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-279-00-6 | Naphtha (petroleum), solvent-refined heavy; Low boiling point modified naphtha; [A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists predominantly of aliphatic hydrocarbons having carbon numbers predominantly in the range of C7 through C12 and boiling in the range of approximately 90°C to 230°C (194°F to 446°F).] | Benzin
(ásványolaj), oldószerrel finomított nehéz; Alacsony forráspontú módosított benzin; [Oldószeres extrahálásból raffinátumként kapott, összetett szénhidrogénkeverék. Főként C7-C12 szénatomszámú alifás szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 90 oC és 230 oC (194 oF és 446 oF) között van.] |
265-095-5 | 64741-92-0 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-280-00-1 | Raffinates (petroleum), catalytic reformer ethylene glycol-water countercurrent exts.; Low boiling point modified naphtha; [A complex combination of hydrocarbons obtained as the raffinate from the UDEX extraction process on the catalytic reformer stream. It consists of saturated hydrocarbons having carbon numbers predominantly in the range of C6 through C9.] | Raffinátumok
(ásványolaj), katalitikus reformáló etilénglikol-víz ellenáramú extr.; Alacsony forráspontú módosított benzin; [Szénhidrogének összetett keveréke, melyet a katalitikus reformáló elegy UDEX extrakciójának raffinátumaként nyernek. Főként C6-C9 szénatomszámú telített szénhidrogénekből áll.] |
270-088-5 | 68410-71-9 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-281-00-7 | Raffinates (petroleum), reformer, Lurgi unit-sepd.; Low boiling point modified naphtha; [The complex combination of hydrocarbons obtained as a raffinate from a Lurgi separation unit. It consists predominantly of non-aromatic hydrocarbons with various small amounts of aromatic hydrocarbons having carbon numbers predominantly in the range of C6 through C8.] | Raffinátumok
(ásványolaj), reformáló, Lurgi egység elvál.; Alacsony forráspontú módosított benzin; [Szénhidrogének összetett keveréke, melyet a Lurgi elválasztóegység raffinátumaként nyernek. Főleg nem aromás szénhidrogénekből áll, de kis, változó mennyiségben tartalmaz olyan aromás szénhidrogéneket is, melyek szénatomszáma főleg a C6-C8 tartományban van.] |
270-349-3 | 68425-35-4 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-282-00-2 | Naphtha (petroleum), full-range alkylate, butane-contg.; Low boiling point modified naphta; [A complex combination of hydrocarbons produced by the distillation of the reaction products of isobutane with monoolefinic hydrocarbons usually ranging in carbon numbers from C3 through C5. It consists of predominantly branched chain saturated hydrocarbons having carbon numbers predominantly in the range of C7 through C12 with some butanes and boiling in the range of approximately 35°C to 200°C (95°F to 428°F).] | #HIÁNYZIK | 271-267-0 | 68527-27-5 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-283-00-8 | Distillates (petroleum), naphtha steam cracking-derived, solvent-refined light hydrotreated; Low boiling point modified naphtha; [A complex combination of hydrocarbons obtained as the raffinates from a solvent extraction process of hydrotreated light distillate from steam-cracked naphtha.] | Desztillátumok
(ásványolaj), benzin gőzkrakkolásból származó, finomított könnyű
hidrogénezett; Alacsony forráspontú módosított benzin; [Szénhidrogének összetett keveréke, melyet a gőzkrakkolású benzin hidrogénezett könnyű desztillátumának oldószeres extrakciójából származó raffinátumként nyernek.] |
295-315-5 | 91995-53-8 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-284-00-3 | Naphtha (petroleum), C4-12, butane-alkylate, isooctane-rich; Low boiling point modified naphtha; [A complex combination of hydrocarbons obtained by alkylation of butanes. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C4 through C12, rich in isooctane, and boiling in the range of approximately 35°C to 210°C (95°F to 410°F).] | Benzin
(petróleum),C4-12, bután-alkilátum, izooktánban gazdag; Alacsony forráspontú
módosított benzin; [Szénhidrogének összetett keveréke, melyet butánok alkilezésével nyernek. Főként C4-C12 szénatomszámú szénhidrogénekből áll, izooktánban gazdag, hozzávetőleges forráspont-tartománya 35 oC és 210 oC (95 oF és 410 oF) között van.] |
295-430-0 | 92045-49-3 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-285-00-9 | Hydrocarbons, hydrotreated light naphtha distillates, solvent-refined; Low boiling point modified naphtha; [A combination of hydrocarbons obtained from the distillation of hydrotreated naphtha followed by a solvent extraction and distillation process. It consists predominantly of saturated hydrocarbons boiling in the range of approximately 94°C to 99°C (201°F to 210°F).] | Szénhidrogének,
hidrogénezett könnyűbenzin desztillátumok, oldószerrel finomított; Alacsony forráspontú módosított benzin; [Szénhidrogének elegye, melyet hidrogénezett benzin desztillációjával, majd oldószeres extrakciójával és desztillációjával nyernek. Főleg telített szénhidrogénekből áll, melyek forráspont-tartománya kb. 94 oC-tól 99 oC-ig (201 oF-tól 210 oF-ig) terjed.] |
295-436-3 | 92045-55-1 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-286-00-4 | Naphtha (petroleum), isomerization, C6-fraction; Low boiling point modified naphtha; [A complex combination of hydrocarbons obtained by distillation of a gasoline which has been catalytically isomerized. It consists predominantly of hexane isomers boiling in the range of approximately 60°C to 66°C (140°F to 151°F).] | Benzin
(ásványolaj), izomerizálás, C6-frakció; Alacsony forráspontú módosított benzin; [Szénhidrogének összetett keveréke, melyet katalitikusan izomerizált benzin desztillációjával nyernek. Főleg hexánizomerekből áll, melyek forráspont-tartománya kb. 60 oC-tól 66 oC-ig (140 oF-tól 151 oF-ig) terjed.] |
295-440-5 | 92045-58-4 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-287-00-X | Hydrocarbons, C6-7, naphtha-cracking, solvent-refined; Low boiling point modified naphtha; [A complex combination of hydrocarbons obtained by the sorption of benzene from a catalytically fully hydrogenated benzene-rich hydrocarbon cut that was distillatively obtained from prehydrogenated cracked naphtha. It consists predominantly of paraffinic and naphthenic hydrocarbons having carbon numbers predominantly in the range of C6 through C7 and boiling in the range of approximately 70°C to 100°C (158°F to 212°F).] | Szénhidrogének,
C6-7, benzin krakkolás, oldószerrel finomított; Alacsony forráspontú módosított benzin; [Szénhidrogének összetett keveréke, melyet előhidrogénezett krakkolt benzinből desztillációs úton nyert, katalitikusan teljesen hidrogénezett, benzolban gazdag frakcióból állítanak elő a benzol szorpciójával. Főként C6-C7 szénatomszámú paraffinos és nafténes szénhidrogénekből áll, és hozzávetőleges forráspont-tartománya 70 oC és100 oC (158 oF és 212 oF) között van.] |
295-446-8 | 92045-64-2 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-288-00-5 | Hydrocarbons, C6-rich, hydrotreated light naphtha distillates, solvent-refined; Low boiling point modified naphtha; [A complex combination of hydrocarbons obtained by distillation of hydrotreated naphtha followed by solvent extraction. It consists predominantly of saturated hydrocarbons and boiling in the range of approximately 65°C to 70°C (149°F to 158°F).] | Szénhidrogének,
C6-ban gazdag, hidrogénezett könnyűbenzin desztillátumok, oldószerrel
finomított; Alacsony forráspontú módosított benzin; [Szénhidrogének összetett keveréke, melyet hidrogénezett benzin desztillációjával, majd oldószeres extrakciójával állítanak elő. Főleg telített szénhidrogénekből áll, és hozzávetőleges forráspont-tartománya 65 oC-tól 70 oC-ig (149 oF-tól 158 oF-ig) terjed.] |
309-871-4 | 101316-67-0 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-289-00-0 | Naphtha (petroleum), heavy catalytic cracked; Low boiling point cat-cracked naphtha; [A complex combination of hydrocarbons produced by a distillation of products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C6 through C12 and boiling in the range of approximately 65°C to 230°C (148°F to 446°F). It contains a relatively large proportion of unsaturated hydrocarbons.] | Benzin
(ásványolaj), nehéz katalitikusan krakkolt; Alacsony forráspontú katalitikusan krakkolt benzin; [Szénhidrogének összetett keveréke, melyet katalitikus krakkolási folyamatból származó termékek desztillációjával nyernek. Főként C6-C12 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 65 oC és 230 oC (148 oF és 446 oF) között van.] Viszonylag nagy arányban tartalmaz telítetlen szénhidrogéneket.] |
265-055-7 | 64741-54-4 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-290-00-6 | Naphtha (petroleum), light catalytic cracked; Low boiling point cat-cracked naphtha; [A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C11 and boiling in the range of approximately -20°C to 190°C (-4°F to 374°F). It contains a relatively large proportion of unsaturated hydrocarbons.] | Benzin
(ásványolaj), könnyű katalitikusan krakkolt; Alacsony forráspontú katalitikusan krakkolt benzin; [Szénhidrogének összetett keveréke, melyet katalitikus krakkolási folyamat termékeinek desztillációjával nyernek. Főként C4-C11 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya –20 oC és 190 oC (–4 oF és 374 oF) között van.] Viszonylag nagy arányban tartalmaz telítetlen szénhidrogéneket.] |
265-056-2 | 64741-55-5 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-291-00-1 | Hydrocarbons, C3-11, catalytic cracker distillates; Low boiling point cat-cracked naphtha; [A complex combination of hydrocarbons produced by the distillations of products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C3 through C11 and boiling in a range approximately up to 204°C (400°F).] | Szénhidrogének,
C3-11, katalitikus krakkoló desztillátumok; Alacsony forráspontú katalitikusan krakkolt benzin; [Szénhidrogének összetett keveréke, melyet katalitikus krakkolási folyamat termékeinek desztillációjával nyernek. Főként C3-C11 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 204 oC-ig (400 oF-ig) terjed.] |
270-686-6 | 68476-46-0 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-292-00-7 | Naphtha (petroleum), catalytic cracked light distd.; Low boiling point cat-cracked naphtha; [A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | Benzin
(ásványolaj), katalitikusan krakkolt könnyű deszt.; Alacsony forráspontú katalitikusan krakkolt benzin; [Szénhidrogének összetett keveréke, melyet katalitikus krakkolási folyamat termékeinek desztillációjával nyernek. Főként C1-C5 szénatomszámú szénhidrogénekből áll.] |
272-185-8 | 68783-09-5 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-293-00-2 | Distillates (petroleum), naphtha steam cracking-derived, hydrotreated light arom.; Low boiling point cat-cracked naphtha.; [A complex combination of hydrocarbons obtained by treating a light distillate from steam-cracked naphtha. It consists predominantly of aromatic hydrocarbons.] | Desztillátumok
(ásványolaj), benzin gőzkrakkolásból származó hidrogénezett könnyű
arom.; Alacsony forráspontú katalitikusan krakkolt benzin.; [Szénhidrogének összetett keveréke, melyet gőzkrakkolt benzin könnyű desztillátumának kezelésével állítanak elő. Főleg aromás szénhidrogénekből áll.] |
295-311-3 | 91995-50-5 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-294-00-8 | Naphtha (petroleum), heavy catalytic cracked, sweetened; Low boiling point cat-cracked naphtha; [A complex combination of hydrocarbons obtained by subjecting a catalytic cracked petroleum distillate to a sweetening process to convert mercaptans or to remove acidic impurities. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C6 through C12 and boiling in the range of approximately 60°C to 200°C (140°F to 392°F).] | Benzin
(nyersolaj), nehéz katalitikusan krakkolt, kéntelenített; Alacsony
forráspontú katalitikusan krakkolt benzin; [Szénhidrogének összetett keveréke, melyet úgy állítanak elő, hogy a katalitikusan krakkolt nyersolaj desztillátumot kéntelenítő eljárásnak vetik alá a merkaptánok konvertálása vagy a savas szennyeződések eltávolítása céljából. Főként C6-C12 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 60 oC és 200 oC (140 oF és 392 oF) között van.] |
295-431-6 | 92045-50-6 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-295-00-3 | Naphtha (petroleum), light catalytic cracked sweetened; Low boiling point cat-cracked naphtha; [A complex combination of hydrocarbons obtained by subjecting naphtha from a catalytic cracking process to a sweetening process to convert mercaptans or to remove acidic impurities. It consists predominantly of hydrocarbons boiling in a range of approximately 35°C to 210°C (95°F to 410°F).] | Benzin
(nyersolaj), könnyű katalitikusan krakkolt, kéntelenített; Alacsony
forráspontú katalitikusan krakkolt benzin; [Szénhidrogének összetett keveréke, melyet úgy állítanak elő, hogy katalitikus krakkolásból származó benzint kéntelenítésnek vetnek alá a merkaptánok konvertálása vagy a savas szennyeződések eltávolítása céljából. Főleg szénhidrogénekből áll, melyek hozzávetőleges forráspont-tartománya 35 oC-tól 210 oC-ig (95oF-tól 410 oF-ig) terjed.] |
295-441-0 | 92045-59-5 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-296-00-9 | Hydrocarbons, C8-12, catalytic-cracking, chem. neutralized; Low boiling point cat-cracked naphtha; [A complex combination of hydrocarbons produced by the distillation of a cut from the catalytic cracking process, having undergone an alkaline washing. It consists predominantly of hydrocarbons having carbon numbers in the range of C8 through C12 and boiling in the range of approximately 130°C to 210°C (266°F to 410°F).] | Szénhidrogének,
C8-12, katalitikus krakkolás, kém. semlegesített; Alacsony forráspontú katalitikusan krakkolt benzin; [Szénhidrogének összetett keveréke, melyet lúgos mosással kezelt, katalitikus krakkolási folyamatból származó párlat desztillációjával nyernek. Főként C8-C12 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 130 oC és 210 oC (266 oF és 410 oF) között van.] |
295-794-0 | 92128-94-4 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-297-00-4 | Hydrocarbons, C8-12, catalytic cracker distillates; Low boiling point cat-cracked naphtha; [A complex combination of hydrocarbons obtained by distillation of products from a catalytic cracking process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C8 through C12 and boiling in the range of approximately 140°C to 210°C (284°F to 410°F).] | Szénhidrogének,
C8-12, katalitikus krakkoló desztillátumok; Alacsony forráspontú katalitikusan krakkolt benzin; [Szénhidrogének összetett keveréke, melyet katalitikus krakkolási folyamat termékeinek desztillációjával nyernek. Főként C8-C12 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 140 oC és 210 oC (284 oF és 410 oF) között van.] |
309-974-4 | 101794-97-2 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-298-00-X | Hydrocarbons, C8-12, catalytic cracking, chem. neutralized, sweetened; Low boiling point cat-cracked naphtha | Szénhidrogének, C8-12, katalitikus krakkolás, kém. semlegesített, kéntelenített; Alacsony forráspontú, katalitikusan krakkolt benzin | 309-987-5 | 101896-28-0 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-299-00-5 | Naphtha (petroleum), light catalytic reformed; Low boiling point cat-reformed naphtha; [A complex combination of hydrocarbons produced from the distillation of products from a catalytic reforming process. It consists of hydrocarbons having carbon numbers predominantly in the range of C5 through C11 and boiling in the range of approximately 35°C to 190°C (95°F to 374°F). It contains a relatively large proportion of aromatic and branched chain hydrocarbons. This stream may contain 10 vol. % or more benzene.] | Benzin
(ásványolaj), könnyű katalitikusan reformált; Alacsony forráspontú kat-reformált benzin; [Szénhidrogének összetett keveréke, melyet katalitikus reformálási eljárás termékeinek desztillációjával nyernek. Főként C5-C11 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 35 oC és 190 oC (95 oF és 374 oF) között van.] Viszonylag nagy arányban tartalmaz aromás és elágazó láncú szénhidrogéneket. Ez a termék 10 (v/v)% vagy még több benzolt is tartalmazhat.] |
265-065-1 | 64741-63-5 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-300-00-9 | Naphtha (petroleum), heavy catalytic reformed; Low boiling point cat-reformed naphtha; [A complex combination of hydrocarbons produced from the distillation of products from a catalytic reforming process. It consists of predominantly aromatic hydrocarbons having carbon numbers predominantly in the range of C7 through C12 and boiling in the range of approximately 90°C to 230°C (194°F to 446°F).] | Benzin
(ásványolaj), nehéz katalitikusan reformált; Alacsony forráspontú kat-reformált benzin; [Szénhidrogének összetett keveréke, melyet katalitikus reformálási eljárás termékeinek desztillációjával nyernek. Főként C7-C12 szénatomszámú aromás szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 90 oC és 230 oC (194 oF és 446 oF) között van.] |
265-070-9 | 64741-68-0 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-301-00-4 | Distillates (petroleum), catalytic reformed depentanizer; Low boiling point cat-reformed naphtha; [A complex combination of hydrocarbons from the distillation of products from a catalytic reforming process. It consists predominantly of aliphatic hydrocarbons having carbon numbers predominantly in the range of C3 through C6 and boiling in the range of approximately -49°C to 63°C (-57°F to 145°F).] | Desztillátumok
(ásványolaj), katalitikusan reformált pentánmentesítő; Alacsony forráspontú kat-reformált benzin; [Szénhidrogének összetett keveréke, melyet katalitikus reformálási eljárás termékeinek desztillációjával nyernek. Főként C3-C6 szénatomszámú alifás szénhidrogénekből áll, hozzávetőleges forráspont-tartománya –49 oC és 63 oC (–57 oF és 145 oF) között van.] |
270-660-4 | 68475-79-6 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-302-00-X | Hydrocarbons, C2-6, C6-8 catalytic reformer; Low boiling point cat-reformed naphtha | Szénhidrogének,
C2-6, C6-8 katalitikus reformáló; Alacsony forráspontú kat-reformált benzin; |
270-687-1 | 68476-47-1 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-303-00-5 | Residues (petroleum), C6-8 catalytic reformer; Low boiling point cat-reformed naphtha; [A complex residuum from the catalytic reforming of C6-8 feed. It consists of hydrocarbons having carbon numbers predominantly in the range of C2 through C6.] | Maradékok
(ásványolaj), C6-8 katalitikus reformáló; Alacsony forráspontú kat-reformált benzin; [A C6-8 nyersanyag katalitikus reformálásának összetett maradéka. Főként C2-C6 szénatomszámú szénhidrogénekből áll.] |
270-794-3 | 68478-15-9 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-304-00-0 | Naphtha (petroleum), light catalytic reformed, arom.-free; Low boiling point cat-reformed naphtha; [A complex combination of hydrocarbons obtained from distillation of products from a catalytic reforming process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C5 through C8 and boiling in the range of approximately 35°C to 120°C (95°F to 248°F). It contains a relatively large proportion of branched chain hydrocarbons with the aromatic components removed.] | Benzin
(ásványolaj), könnyű, katalitikusan reformált, aromásoktól mentes; Alacsony
forráspontú katalitikusan krakkolt benzin; [Szénhidrogének összetett keveréke, melyet katalitikus reformálási folyamat termékeinek desztillációjából nyernek. Főként C5-C8 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 35 oC és 120 oC (95 oF és 248 oF) között van.] Viszonylag nagy arányban tartalmaz elágazó láncú szénhidrogéneket, melyekből az aromás komponenseket eltávolították.] |
270-993-5 | 68513-03-1 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-305-00-6 | Distillates (petroleum), catalytic reformed straight-run naphtha overheads; Low boiling point cat-reformed naphtha; [A complex combination of hydrocarbons obtained by the catalytic reforming of straight-run naphtha followed by the fractionation of the total effluent. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C6.] | Desztillátumok
(ásványolaj), katalitikusan reformált közvetlen lepárlású benzin
fejtermékek; Alacsony forráspontú kat-reformált benzin; [Szénhidrogének összetett keveréke, melyet közvetlen lepárlású benzin katalitikus reformálásával, majd a teljes kilépő termék frakcionálásával nyernek. Főként C2-C6 szénatomszámú telített alifás szénhidrogénekből áll.] |
271-008-1 | 68513-63-3 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-306-00-1 | Petroleum products, hydrofiner-powerformer reformates; Low boiling point cat-reformed naphtha; [The complex combination of hydrocarbons obtained in a hydrofiner-powerformer process and boiling in a range of approximately 27°C to 210°C (80°F to 410°F).] | Ásványolajtermékek,
hidrogénes finomítási-átalakítási reformátumok; Alacsony forráspontú kat-reformált benzin; [Szénhidrogének összetett keveréke, melyet hidrogénes finomítási-átalakítási folyamatból nyernek, és hozzávetőleges forráspont-tartománya 27 oC-tól 210 oC-ig (80 oF-tól 410 oF-ig) terjed.] |
271-058-4 | 68514-79-4 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-307-00-7 | Naphtha (petroleum), full-range reformed; Low boiling point cat-reformed naphtha; [A complex combination of hydrocarbons produced by the distillation of the products from a catalytic reforming process. It consists of hydrocarbons having carbon numbers predominantly in the range of C5 through C12 and boiling in the range of approximately 35°C to 230°C (95°F to 446°F).] | Benzin
(ásványolaj), teljesen reformált; Alacsony forráspontú kat-reformált benzin; [Szénhidrogének összetett keveréke, melyet katalitikus reformálási eljárásból származó termékek desztillációjával nyernek. Főként C5-C12 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 35 oC és 230 oC (95 oF és 446 oF) között van.] |
272-895-8 | 68919-37-9 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-308-00-2 | Naphtha (petroleum), catalytic reformed; Low boiling point cat-reformed naphtha; [A complex combination of hydrocarbons produced by the distillation of products from a catalytic reforming process. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C12 and boiling in the range of approximately 30°C to 220°C (90°F to 430°F). It contains a relatively large proportion of aromatic and branched chain hydrocarbons. This stream may contain 10 vol. % or more benzene.] | Benzin
(ásványolaj), katalitikusan reformált; Alacsony forráspontú kat-reformált benzin; [Szénhidrogének összetett keveréke, melyet katalitikus reformálási eljárás termékeinek desztillációjával nyernek. Főként C4-C12 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 30 oC és 220 oC (90 oF és 430 oF) között van.] Viszonylag nagy arányban tartalmaz aromás és elágazó láncú szénhidrogéneket. Ez a termék 10 (v/v)% vagy még több benzolt is tartalmazhat.] |
273-271-8 | 68955-35-1 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-309-00-8 | Distillates (petroleum), catalytic reformed hydrotreated light, C8-12 arom. fraction; Low boiling point cat-reformed naphtha; [A complex combination of alkylbenzenes obtained by the catalytic reforming of petroleum naphtha. It consists predominantly of alkylbenzenes having carbon numbers predominantly in the range of C8 through C10 and boiling in the range of approximately 160°C to 180°C (320°F to 356°F).] | Desztillátumok
(ásványolaj), katalitikusan reformált hidrogénezett könnyű, C8-12 arom.
frakció; Alacsony forráspontú kat-reformált benzin; [Alkilbenzolok összetett keveréke, melyet ásványolaj benzin katalitikus reformálásával nyernek. Főként C8-C10 szénatomszámú alkilbenzolokból áll, hozzávetőleges forráspont-tartománya 160 oC és 180 oC (320 oF és 356 oF) között van.] |
285-509-8 | 85116-58-1 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-310-00-3 | Aromatic hydrocarbons, C8, catalytic reforming-derived; Low boiling point cat-reformed naphtha | Aromás
szénhidrogének, C8, katalitikus reformálásból származó; Alacsony forráspontú kat-reformált benzin |
295-279-0 | 91995-18-5 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-311-00-9 | Aromatic hydrocarbons, C7-12, C8-rich; Low boiling point cat-reformed naphtha; [A complex combination of hydrocarbons obtained by separation from the platformate-containing fraction. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C7 through C12 (primarily C8) and can contain nonaromatic hydrocarbons, both boiling in the range of approximately 130°C to 200°C (266°F to 392°F).] | Aromás
szénhidrogének, C7-12, C8-ban gazdag; Alacsony forráspontú kat-reformált benzin; [Szénhidrogének összetett keveréke, melyet platformát-tartalmú frakció szeparációjával állítanak elő. Főleg aromás szénhidrogénekből áll, melyek szénatomszáma főleg a C7-C12 tartományban van (elsősorban C8), és tartalmazhat nem aromás szénhidrogéneket is. Mindkettő a kb. 130 oC-tól 200 oC-ig (266 oF-tól 392 oF-ig) terjedő tartományban forr.] |
297-401-8 | 93571-75-6 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-312-00-4 | Gasoline, C5-11, high-octane stabilised reformed; Low boiling point cat-reformed naphtha; [A complex high octane combination of hydrocarbons obtained by the catalytic dehydrogenation of a predominantly naphthenic naphtha. It consists predominantly of aromatics and non-aromatics having carbon numbers predominantly in the range of C5 through C11 and boiling in the range of approximately 45°C to 185°C (113°F to 365°F).] | Benzin,
C5-11, magas oktánszámú stabilizált reformált; Alacsony forráspontú kat-reformált benzin; [Szénhidrogének összetett, magas oktánszámú keveréke, melyet főleg nafténes benzin katalitikus dehidrogénezésével állítanak elő. Főként C5-C11 szénatomszámú aromás és nem aromás szénhidrogénekből áll, és hozzávetőleges forráspont-tartománya 45 oC és185 oC (113 oF és 365 oF) között van.] |
297-458-9 | 93572-29-3 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-313-00-X | Hydrocarbons, C7-12, C≥9-arom.-rich, reforming heavy fraction; Low boiling point cat-reformed naphtha; [A complex combination of hydrocarbons obtained by separation from the platformate-containing fraction. It consists predominantly of nonaromatic hydrocarbons having carbon numbers predominantly in the range of C7 through C12 and boiling in the range of approximately 120°C to 210°C (248°F to 380°F) and C9 and higher aromatic hydrocarbons.] | Szénhidrogének,
C7-12, C≥9-arom.-ban gazdag, reformálás nehéz frakció; Alacsony
forráspontú kat-reformált benzin; [Szénhidrogének összetett keveréke, melyet platformát-tartalmú frakció szeparációjával állítanak elő. Főleg nem aromás szénhidrogénekből áll, melyek szénatomszáma főleg a C7-C12 tartományban, forráspontja a kb. 120 oC-tól 210 oC-ig (248 oF-tól 380 oF-ig) terjedő tartományban van, és tartalmaz még C9 és nagyobb szénatomszámú aromás szénhidrogéneket is.] |
297-465-7 | 93572-35-1 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-314-00-5 | Hydrocarbons, C5-11, nonaroms.-rich, reforming light fraction; Low boiling point cat-reformed naphtha; [A complex combination of hydrocarbons obtained by separation from the platformate-containing fraction. It consists predominantly of nonaromatic hydrocarbons having carbon numbers predominantly in the range of C5 through C11 and boiling in the range of approximately 35°C to 125°C (94°F to 257°F), benzene and toluene.] | Szénhidrogének,
C5-11, nem aromásokban gazdag, reformáló könnyű frakció; Alacsony forráspontú kat-reformált benzin; [Szénhidrogének összetett keveréke, melyet platformát-tartalmú frakció szeparációjával állítanak elő. Főként C5-C11 szénatomszámú nem aromás szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 35 oC és 125 oC (94 oF és 257 oF) között van.] |
297-466-2 | 93572-36-2 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-315-00-0 | Foots oil (petroleum), silicic acid-treated; Foots oil; [A complex combination of hydrocarbons obtained by the treatment of Foots oil with silicic acid for removal of trace constituents and impurities. It consists predominantly of straight chain hydrocarbons having carbon numbers predominantly greater than C12.] | Gacsolaj
(ásványolaj), kovasavval kezelt; Gacsolaj; [Gacsolaj nyomokban jelenlevő összetevőinek és szennyeződéseinek eltávolítása érdekében végzett kovasavas kezelésével előállított, összetett szénhidrogénkeverék. Főleg egyenes láncú, jellemzően C12-nél nagyobb szénatomszámú szénhidrogénekből áll.] |
308-127-6 | 97862-77-6 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-316-00-6 | Naphtha (petroleum), light thermal cracked; Low boiling point thermally cracked naphtha; [A complex combination of hydrocarbons from distillation of products from a thermal cracking process. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly in the range of C4 through C8 and boiling in the range of approximately -10 °C to 130 °C (14 °F to 266 °F).] | Benzin
(ásványolaj), könnyű termikusan krakkolt; Alacsony forráspontú termikusan krakkolt benzin; [Szénhidrogének összetett keveréke, melyet termikus krakkolásból származó termékek desztillációjával nyernek. Főként C4-C8 szénatomszámú telítetlen szénhidrogénekből áll, hozzávetőleges forráspont-tartománya –10 oC és 130 oC (14 oF és 266 oF) között van.] |
265-075-6 | 64741-74-8 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-317-00-1 | Naphtha (petroleum), heavy thermal cracked; Low boiling point thermally cracked naphtha; [A complex combination of hydrocarbons from distillation of the products from a thermal cracking process. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly in the range of C6 through C12 and boiling in the range of approximately 65°C to 220°C (148°F to 428°F).] | Benzin
(ásványolaj), nehéz termikusan krakkolt; Alacsony forráspontú termikusan krakkolt benzin; [Szénhidrogének összetett keveréke, melyet termikus krakkolási folyamat termékeinek desztillációjával állítanak elő. Főként C6-C12 szénatomszámú telítetlen szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 65 oC és 220 oC (148 oF és 428 oF) között van.] |
265-085-0 | 64741-83-9 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-318-00-7 | Distillates (petroleum), heavy arom.; Low boiling point thermally cracked naphtha; [The complex combination of hydrocarbons from the distillation of the products from the thermal cracking of ethane and propane. This higher boiling fraction consists predominantly of C5-7 aromatic hydrocarbons with some unsaturated aliphatic hydrocarbons having carbon number predominantly of C5. This stream may contain benzene.] | Desztillátumok
(ásványolaj), nehéz arom.; Alacsony forráspontú termikusan krakkolt benzin; [Szénhidrogének összetett keveréke, melyet etán és propán termikus krakkolásának termékeiből desztillációval nyernek. Ez a magasabb forráspontú frakció főként C5-7 szénatomszámú aromás szénhidrogénekből áll, valamint kevés, főként C5 szénatomszámú telítetlen alifás szénhidrogénből. Ez a párlat benzolt is tartalmazhat.] |
267-563-4 | 67891-79-6 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-319-00-2 | Distillates (petroleum), light arom.; Low boiling point thermally cracked naphtha; [The complex combination of hydrocarbons from the distillation of the products from the thermal cracking of ethane and propane. This lower boiling fraction consists predominantly of C5-7 aromatic hydrocarbons with some unsaturated aliphatic hydrocarbons having a carbon number predominantly of C5. This stream may contain benzene.] | Desztillátumok
(ásványolaj), könnyű arom.; Alacsony forráspontú termikusan krakkolt benzin; [Szénhidrogének összetett keveréke, melyet etán és propán termikus krakkolásának termékeiből desztillációval nyernek. Ez az alacsonyabb forráspontú frakció főként C5-7 szénatomszámú aromás szénhidrogénekből áll, valamint kevés, főként C5 szénatomszámú telítetlen alifás szénhidrogénből. Ez a párlat benzolt is tartalmazhat.] |
267-565-5 | 67891-80-9 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-320-00-8 | Distillates (petroleum), naphtha-raffinate pyrolyzate-derived, gasoline-blending; Low boiling point thermally cracked naphtha; [The complex combination of hydrocarbons obtained by the pyrolysis fractionation at 816°C (1500°F) of naphtha and raffinate. It consists predominantly of hydrocarbons having a carbon number of C9 and boiling at approximately 204°C (400°F).] | Desztillátumok
(ásványolaj), benzin raffinátum pirolizátum származék, benzin elegy; Alacsony forráspontú termikusan krakkolt benzin; [Szénhidrogének összetett keveréke, melyet benzin és raffinátum 816 oC-on (1500 oF-on) végzett frakcionált pirolízisével nyernek. Főként C9 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspontja 204 oC (400 oF).] |
270-344-6 | 68425-29-6 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-321-00-3 | Aromatic hydrocarbons, C6-8, naphtha-raffinate pyrolyzate-derived; Low boiling point thermally cracked naphtha; [A complex combination of hydrocarbons obtained by the fractionation pyrolysis at 816°C (1500°F) of naphtha and raffinate. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C6 through C8, including benzene.] | Aromás szénhidrogének, C6-8, benzin raffinátum pirolizátum származék; Alacsony forráspontú termikusan krakkolt benzin; [Szénhidrogének összetett keveréke, melyet benzin és raffinátum 816 oC-on (1500 oF-on) végzett frakcionált pirolízisével nyernek. Főként C6-C8 szénatomszámú aromás szénhidrogénekből áll.] | 270-658-3 | 68475-70-7 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-322-00-9 | Distillates (petroleum), thermal cracked naphtha and gas oil; Low boiling point thermally cracked naphtha; [A complex combination of hydrocarbons produced by distillation of thermally cracked naphtha and/or gas oil. It consists predominantly of olefinic hydrocarbons having a carbon number of C5 and boiling in the range of approximately 33°C to 60°C (91°F to 140°F).] | Desztillátumok
(ásványolaj), termikusan krakkolt benzin és gázolaj; Alacsony forráspontú
termikusan krakkolt benzin; [Szénhidrogének összetett keveréke, melyet termikusan krakkolt benzin és/vagy gázolaj desztillációjával állítanak elő. Főként C5 szénatomszámú olefin-szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 33 oC-60 oC (91 oF-140 oF).] |
271-631-9 | 68603-00-9 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-323-00-4 | Distillates (petroleum), thermal cracked naphtha and gas oil, C5-dimer-contg.; Low boiling point thermally cracked naphtha; [A complex combination of hydrocarbons produced by the extractive distillation of thermal cracked naphtha and/or gas oil. It consists predominantly of hydrocarbons having a carbon number of C5 with some dimerized C5 olefins and boiling in the range of approximately 33°C to 184°C (91°F to 363°F).] | Desztillátumok
(ásványolaj), termikusan krakkolt benzin és gázolaj, C5-dimer tart.; Alacsony forráspontú termikusan krakkolt benzin; [Szénhidrogének összetett keveréke, melyet termikusan krakkolt benzin és/vagy gázolaj extraktív desztillációjával állítanak elő. Főként C5 szénatomszáma szénhidrogénekből áll, és tartalmaz kevés dimerizált C5 olefint; a forráspont-tartománya kb. 33 oC-tól 184 oC-ig (91 oF-tól 363 oF-ig) terjed.] |
271-632-4 | 68603-01-0 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-324-00-X | Distillates (petroleum), thermal cracked naphtha and gas oil, extractive; Low boiling point thermally cracked naphtha; [A complex combination of hydrocarbons produced by the extractive distillation of thermal cracked naphtha and/or gas oil. It consists of paraffinic and olefinic hydrocarbons, predominantly isoamylenes such as 2-methyl-1-butene and 2-methyl-2-butene and boiling in the range of approximately 31°C to 40°C (88°F to 104°F).] | Desztillátumok
(ásványolaj), termikusan krakkolt benzin és gázolaj, extrakciós; Alacsony forráspontú termikusan krakkolt benzin; [Szénhidrogének összetett keveréke, melyet termikusan krakkolt benzin és/vagy gázolaj extraktív desztillációjával állítanak elő. Paraffin és olefin szénhidrogénekből, főleg izoamilénekből áll, mint pl. a 2-metil-1-butén és a 2-metil-2-butén. Forrásponttartománya kb. 31 oC-tól 40 oC-ig (88 oF-tól 104 oF-ig) terjed.] |
271-634-5 | 68603-03-2 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-325-00-5 | Distillates (petroleum), light thermal cracked, debutanized arom.; Low boiling point thermally cracked naphtha; [A complex combination of hydrocarbons produced by the distillation of products from a thermal cracking process. It consists predominantly of aromatic hydrocarbons, primarily benzene.] | Desztillátumok
(ásványolaj), könnyű termikusan krakkolt, butánmentesített arom.; Alacsony forráspontú termikusan krakkolt benzin; [Szénhidrogének összetett keveréke, melyet termikus krakkolási folyamat termékeinek desztillációjával nyernek. Főleg aromás szénhidrogénekből, elsősorban benzolból áll.] |
273-266-0 | 68955-29-3 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-326-00-0 | Naphtha (petroleum), light thermal cracked, sweetened; Low boiling point thermally cracked naphtha; [A complex combination of hydrocarbons obtained by subjecting a petroleum distillate from the high temperature thermal cracking of heavy oil fractions to a sweetening process to convert mercaptans. It consists predominantly of aromatics, olefins and saturated hydrocarbons boiling in the range of approximately 20°C to 100°C (68°F to 212°F).] | Benzin
(ásványolaj), könnyű termikusan krakkolt, kéntelenített; Alacsony forráspontú termikusan krakkolt benzin; [[Szénhidrogének összetett keveréke, melyet úgy állítanak elő, hogy a nehézolaj frakciók magas hőmérsékletű termikus krakkolási folyamatából származó ásványolaj desztillátumot kéntelenítési eljárásnak vetik alá a merkaptánok konvertálása céljából. Főleg aromásokból, olefinekből és telített szénhidrogénekből áll, melyek forrásponttartománya kb. 20 oC-tól 100 oC-ig (68 oF-tól 212 oF-ig) terjed.] |
295-447-3 | 92045-65-3 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-327-00-6 | Naphtha (petroleum), hydrotreated heavy; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly in the range of C6 through C13 and boiling in the range of approximately 65°C to 230°C (149°F to 446°F).] | Benzin
(ásványolaj), hidrogénezett nehéz; Alacsony forráspontú hidrogénnel kezelt benzin; [Ásványolaj frakció katalitikus hidrogénezésével nyert összetett szénhidrogénkeverék. Főként C6-C13 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 65 oC és 230 oC (149 oF és 446 oF) között van.] |
265-150-3 | 64742-48-9 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-328-00-1 | Naphtha (petroleum), hydrotreated light; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C11 and boiling in the range of approximately minus 20°C to 190°C (-4°F to 374°F).] | Benzin
(ásványolaj), hidrogénezett könnyű; Alacsony forráspontú hidrogénnel kezelt benzin; [Ásványolaj frakció katalitikus hidrogénezésével nyert összetett szénhidrogénkeverék. Főként C4-C11 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya –20 oC és 190 oC (–4 oF és 374 oF) között van.] |
265-151-9 | 64742-49-0 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-329-00-7 | Naphtha (petroleum), hydrodesulfurized light; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained from a catalytic hydrodesulfurization process. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C11 and boiling in the range of approximately -20°C to 190°C (-4°F to 374°F).] | Benzin
(ásványolaj), hidrogénezéssel kénmentesített könnyű; Alacsony forráspontú, hidrogénnel kezelt benzin; [Szénhidrogének összetett keveréke, melyet hidrogénnel végzett katalitikus kéntelenítési folyamatból nyernek. Főként C4-C11 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya –20 oC és 190 oC (–4 oF és 374 oF) között van.] |
265-178-6 | 64742-73-0 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-330-00-2 | naphtha (petroleum), hydrodesulphurized heavy; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained from a catalytic hydrodesulfurization process. It consists of hydrocarbons having carbon numbers predominantly in the range of C7 through C12 and boiling in the range of approximately 90 °C to 230 °C (194 °F to 446 °F).] | Benzin
(ásványolaj), hidrogénezéssel kénmentesített nehéz; Alacsony forráspontú, hidrogénnel kezelt benzin; [Szénhidrogének összetett keveréke, melyet hidrogénnel végzett katalitikus kéntelenítési folyamatból nyernek. Főként C7-C12 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 90 oC és 230 oC (194 oF és 446 oF) között van.] |
265-185-4 | 64742-82-1 | Carc.
1B Muta. 1B Asp. Tox. 1 STOT RE 1 |
H350 H340 H304 H372 (central nervous system) |
GHS08 Dgr |
H340 H350 H372 (central nervous system) H304 |
P | CLP00/ATP05 | ||
| 649-331-00-8 | Distillates (petroleum), hydrotreated middle, intermediate boiling; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained by the distillation of products from a middle distillate hydrotreating process. It consists of hydrocarbons having carbon numbers predominantly in the range of C5 through C10 and boiling in the range of approximately 127°C to 188°C (262°F to 370°F).] | Desztillátum
(ásványolaj), hidrogénnel kezelt középfázis, közepes forráspontú; Alacsony forráspontú hidrogénnel kezelt benzin; [Szénhidrogének összetett keveréke, melyet a hidrogénezési folyamat középfázisának desztillációjával állítanak elő. Főként C5-C10 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 127 oC és 188 oC (262 oF és 370 oF) között van.] |
270-092-7 | 68410-96-8 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-332-00-3 | Distillates (petroleum), light distillate hydrotreating process, low-boiling; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained by the distillation of products from the light distillate hydrotreating process. It consists of hydrocarbons having carbon numbers predominantly in the range of C6 through C9 and boiling in the range of approximately 3°C to 194°C (37°F to 382°F).] | Desztillátumok
(ásványolaj), könnyű desztillátum hidrogénes kezelés, alacsony
forráspontú; Alacsony forráspontú hidrogénnel kezelt benzin; [Szénhidrogének összetett keveréke, melyet a könnyű desztillátum hidrogénes kezeléséből származó termékek desztillációjával nyernek. Főként C6-C9 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 3 oC és 194 oC (37 oF és 382 oF) között van.] |
270-093-2 | 68410-97-9 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-333-00-9 | Distillates (petroleum), hydrotreated heavy naphtha, deisohexanizer overheads; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained by distillation of the products from a heavy naphtha hydrotreating process. It consists of hydrocarbons having carbon numbers predominantly in the range of C3 through C6 and boiling in the range of approximately -49°C to 68°C (-57°F to 155°F).] | Desztillátumok
(ásványolaj), hidrogénnel kezelt nehéz benzin, izohexán-mentesítő
fejtermékek; Alacsony forráspontú, hidrogénnel kezelt benzin; [Szénhidrogének összetett keveréke, melyet nehéz benzin hidrogénes kezelésének termékeiből desztillációval nyernek. Főként C3-C6 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya –49 oC és 68 oC (–57 oF és 155 oF) között van.] |
270-094-8 | 68410-98-0 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-334-00-4 | Solvent naphtha (petroleum), light arom., hydrotreated; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C8 through C10 and boiling in the range of approximately 135°C to 210°C (275°F to 410°F).] | Oldószer
benzin (ásványolaj), könnyű aromás, hidrogénezett; Alacsony forráspontú hidrogénnel kezelt benzin; [Ásványolaj frakció katalitikus hidrogénezésével nyert összetett szénhidrogénkeverék. Főként C8-C10 szénatomszámú aromás szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 135 oC és 210 oC (275 oF és 410 oF) között van.] |
270-988-8 | 68512-78-7 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-335-00-X | Naphtha (petroleum), hydrodesulfurized thermal cracked light; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained by fractionation of hydrodesulfurized thermal cracker distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C5 to C11 and boiling in the range of approximately 23°C to 195°C (73°F to 383°F).] | Benzin
(ásványolaj), hidrogénnel kéntelenített termikusan krakkolt könnyű; Alacsony
forráspontú hidrogénnel kezelt benzin; [Szénhidrogének összetett keveréke, melyet hidrogénnel kéntelenített termikus krakkoló desztillátum frakcionálásával nyernek. Főként C5-C11 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 23 oC és 195 oC (73 oF és 383 oF) között van.] |
285-511-9 | 85116-60-5 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-336-00-5 | Naphtha (petroleum), hydrotreated light, cycloalkane-contg.; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained from the distillation of a petroleum fraction. It consists predominantly of alkanes and cycloalkanes boiling in the range of approximately -20°C to 190°C (-4°F to 374°F).] | Benzin
(ásványolaj), hidrogénnel kezelt könnyű, cikloalkán-tart.; Alacsony
forráspontú hidrogénnel kezelt benzin; [Szénhidrogének összetett keveréke, melyet nyersolaj frakció desztillációjával nyernek. Főleg telített alkánokból és cikloalkánokból áll, és hozzávetőleges forráspont-tartománya –20 oC-tól 190 oC-ig (–4 oF-tól 374 oF-ig) terjed.] |
285-512-4 | 85116-61-6 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-337-00-0 | Naphtha (petroleum), heavy steam-cracked, hydrogenated; Low boiling point hydrogen treated naphtha | Benzin (ásványolaj), nehéz gőzkrakkolt, hidrogénezett; Alacsony forráspontú, hidrogénnel kezelt benzin; | 295-432-1 | 92045-51-7 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-338-00-6 | Naphtha (petroleum), hydrodesulfurized full-range; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained from a catalytic hydrodesulfurization process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C4 through C11 and boiling in the range of approximately 30°C to 250°C (86°F to 482°F).] | Benzin
(nyersolaj), teljes, hidrogénnel kéntelenített; Alacsony forráspontú, hidrogénnel kezelt benzin; [Szénhidrogének összetett keveréke, melyet hidrogénnel végzett katalitikus kéntelenítési folyamatból nyernek. Főként C4-C11 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 30 oC és 250 oC (86 oF és 482 oF) között van.] |
295-433-7 | 92045-52-8 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-339-00-1 | Naphtha (petroleum), hydrotreated light steam-cracked; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained by treating a petroleum fraction, derived from a pyrolysis process, with hydrogen in the presence of a catalyst. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly in the range of C5 through C11 and boiling in the range of approximately 35°C to 190°C (95°F to 374°F).] | Benzin
(ásványolaj), hidrogénnel kezelt könnyű gőzkrakkolt; Alacsony forráspontú, hidrogénnel kezelt benzin; [Szénhidrogének összetett keveréke, melyet pirolízisből származó nyersolaj frakció katalizátor jelenlétében végzett hidrogénezésével nyernek. Főként C5-C11 szénatomszámú telítetlen szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 35 oC és 190 oC (95 oF és 374 oF) között van.] |
295-438-4 | 92045-57-3 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-340-00-7 | Hydrocarbons, C4-12, naphtha-cracking, hydrotreated; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained by distillation from the product of a naphtha steam cracking process and subsequent catalytic selective hydrogenation of gum formers. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C12 and boiling in the range of approximately 30°C to 230°C (86°F to 446°F).] | Szénhidrogének,
C4-12, benzin krakkolás, hidrogénnel kezelt; Alacsony forráspontú, hidrogénnel kezelt benzin; [Szénhidrogének összetett keveréke, melyet benzin gőzkrakkolásának termékeiből desztillációval és a gumiképzők desztillációt követő szelektív katalitikus hidrogénezésével nyernek. Főként C4-C12 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 30 oC és 230 oC (86 oF és 446 oF) között van.] |
295-443-1 | 92045-61-9 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-341-00-2 | Solvent naphtha (petroleum), hydrotreated light naphthenic; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists predominantly of cycloparaffinic hydrocarbons having carbon numbers predominantly in the range of C6 through C7 and boiling in the range of approximately 73°C to 85°C (163°F to 185°F).] | Oldószer
benzin (nyersolaj), hidrogénnel kezelt könnyű nafténes; Alacsony forráspontú
hidrogénnel kezelt benzin; [Ásványolaj frakció katalitikus hidrogénezésével nyert összetett szénhidrogénkeverék. Főként C6-C7 szénatomszámú aromás szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 73 oC és 85 oC (163 oF és 185 oF) között van.] |
295-529-9 | 92062-15-2 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-342-00-8 | Naphtha (petroleum), light steam-cracked, hydrogenated; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons produced from the separation and subsequent hydrogenation of the products of a steam-cracking process to produce ethylene. It consists predominantly of saturated and unsaturated paraffins, cyclic paraffins and cyclic aromatic hydrocarbons having carbon numbers predominantly in the range of C4 through C10 and boiling in the range of approximately 50°C to 200°C (122°F to 392°F). The proportion of benzene hydrocarbons may vary up to 30 wt. % and the stream may also contain small amounts of sulfur and oxygenated compounds.] | Benzin
(ásványolaj), könnyű gőzkrakkolt, hidrogénezett; Alacsony forráspontú
hidrogénnel kezelt benzin; [Szénhidrogének összetett keveréke, melyet gőzkrakkolási eljárás termékeinek etilén előállítása céljából végzett szeparációjával, majd hidrogénezésével nyernek. Főként C4-C10 szénatomszámú telített és telítetlen, paraffinokat, ciklikus paraffinokat és cikloaromás szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 50 oC-200 oC (122 oF-392 oF). A benzol szénhidrogének aránya elérheti a 30 (m/m) %-ot, és az elegy kis mennyiségben tartalmazhat kén- és oxigénvegyületeket is.] |
296-942-7 | 93165-55-0 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-343-00-3 | Hydrocarbons, C6-11, hydrotreated, dearomatized; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained as solvents which have been subjected to hydrotreatment in order to convert aromatics to naphthenes by catalytic hydrogenation.] | Szénhidrogének,
C6-11, hidrogénnel kezelt, aromásoktól mentesített; Alacsony forráspontú, hidrogénnel kezelt benzin; [Szénhidrogének összetett keveréke, az aromások nafténné konvertálása céljából végzett katalitikus hidrogénezés útján nyert oldószerek.] |
297-852-0 | 93763-33-8 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-344-00-9 | Hydrocarbons, C9-12, hydrotreated, dearomatized; Low boiling point hydrogen treated naphtha; [A complex combination of hydrocarbons obtained as solvents which have been subjected to hydrotreatment in order to convert aromatics to naphthenes by catalytic hydrogenation.] | Szénhidrogének,
C9-12, hidrogénnel kezelt, aromásoktól mentesített; Alacsony forráspontú, hidrogénnel kezelt benzin; [Az aromások nafténné konvertálása céljából katalitikus hidrogénezésnek alávetett oldószerként nyert, összetett szénhidrogénkeverék.] |
297-853-6 | 93763-34-9 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-345-00-4 | stoddard solvent; Low boiling point naphtha - unspecified; [A colourless, refined petroleum distillate that is free from rancid or objectionable odours and that boils in a range of approximately 148,8 °C to 204,4 °C (300 °F to 400 °F).] | Oldószer
nafta; Alacsony forráspontú benzin – nem meghatározott; [Színtelen, finomított ásványolaj desztillátum, mely avas vagy kifogásolható szagoktól mentes, forráspont-tartománya hozzávetőlegesen a 148,8 oC-tól 204,4 oC-ig (300oF-tól 400 oF-ig) terjedő tartományban van.] |
232-489-3 | 8052-41-3 | Carc.
1B Muta. 1B Asp. Tox. 1 STOT RE 1 |
H350 H340 H304 H372 (central nervous system) |
GHS08 Dgr |
H340 H350 H372 (central nervous system) H304 |
P | CLP00/ATP05 | ||
| 649-346-00-X | Natural gas condensates (petroleum); Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons separated as a liquid from natural gas in a surface separator by retrograde condensation. It consists mainly of hydrocarbons having carbon numbers predominantly in the range of C2 to C20. It is a liquid at atmospheric temperature and pressure.] | Földgáz
kondenzátumok (ásványolaj); Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet folyadékként választanak el a földgáztól felületi szeparátorban végzett retrográd kondenzációval. Főként C2-C20 szénatomszámú szénhidrogénekből áll.] Atmoszferikus nyomáson és hőmérsékleten folyadék.] |
265-047-3 | 64741-47-5 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-347-00-5 | Natural gas (petroleum), raw liq. mix; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons separated as a liquid from natural gas in a gas recycling plant by processes such as refrigeration or absorption. It consists mainly of saturated aliphatic hydrocarbons having carbon numbers in the range of C2 through C8.] | Földgáz
(nyersolaj), nyers foly. elegy; Alacsony forráspontú benzin – nem
meghatározott; [Szénhidrogének összetett keveréke, melyet folyadékként választanak el a földgáztól gázvisszanyerő berendezésben olyan folyamatokkal, mint pl. hűtés vagy abszorpció. Főként C2-C8 szénatomszámú telített alifás szénhidrogénekből áll.] |
265-048-9 | 64741-48-6 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-348-00-0 | Naphtha (petroleum), light hydrocracked; Low boiling naphtha - unspecified; [A complex combination of hydrocarbons from distillation of the products from a hydrocracking process. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C4 through C10, and boiling in the range of approximately -20°C to 180°C (-4°F to 356°F).] | Benzin
(ásványolaj), könnyű hidrokrakkolt; Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet hidrokrakkolási eljárásból származó termékek desztillációjával nyernek. Főként C4-C10 szénatomszámú telített szénhidrogénekből áll, hozzávetőleges forráspont-tartománya –20 oC és 180 oC (–4 oF és 356 oF) között van.] |
265-071-4 | 64741-69-1 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-349-00-6 | Naphtha (petroleum), heavy hydrocracked; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons from distillation of the products from a hydrocracking process. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C6 through C12, and boiling in the range of approximately 65°C to 230°C (148°F to 446°F).] | Benzin
(ásványolaj), nehéz, hidrokrakkolt; Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet hidrokrakkolási eljárásból származó termékek desztillációjával nyernek. Főként C6-C12 szénatomszámú telített szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 65 oC és 230 oC (148 oF és 446 oF) között van.] |
265-079-8 | 64741-78-2 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-350-00-1 | Naphtha (petroleum), sweetened; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by subjecting a petroleum naphtha to a sweetening process to convert mercaptans or to remove acidic impurities. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C12 and boiling in the range of approximately -10°C to 230°C (14°F to 446°F).] | Benzin
(ásványolaj), kéntelenített; Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet úgy állítanak elő, hogy nyersolaj benzint a merkaptánok konverziója vagy a savas szennyeződések eltávolítása céljából kéntelenítési eljárásnak vetnek alá. Főként C4-C12 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya –10 oC és 230 oC (14 oF és 446 oF) között van.] |
265-089-2 | 64741-87-3 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-351-00-7 | Naphtha (petroleum), acid-treated; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained as a raffinate from a sulfuric acid treating process. It consists of hydrocarbons having carbon numbers predominantly in the range of C7 through C12 and boiling in the range of approximately 90°C to 230°C (194°F to 446°F).] | Benzin
(ásványolaj), savval kezelt; Alacsony forráspontú benzin – nem meghatározott; [Kénsavas kezelési folyamatból raffinátumként kapott, összetett szénhidrogénkeverék. Főként C7-C12 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 90 oC és 230 oC (194 oF és 446 oF) között van.] |
265-115-2 | 64742-15-0 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-352-00-2 | Naphtha (petroleum), chemically neutralized heavy; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantly in the range of C6 through C12 and boiling in the range of approximately 65°C to 230°C (149°F to 446°F).] | Benzin
(ásványolaj), kémiailag semlegesített nehéz; Alacsony forráspontú benzin – nem meghatározott; [A savas maradék eltávolítása érdekében végzett kezelés eredményeképpen nyert összetett szénhidrogénkeverék. Főként C6-C12 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 65 oC és 230 oC (149 oF és 446 oF) között van.] |
265-122-0 | 64742-22-9 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-353-00-8 | Naphtha (petroleum), chemically neutralized light; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C11 and boiling in the range of approximately -20°C to 190°C (-4°F to 374°F).] | Benzin
(ásványolaj), kémiailag semlegesített könnyű; Alacsony forráspontú benzin – nem meghatározott; [A savas maradék eltávolítása érdekében végzett kezelés eredményeképpen nyert összetett szénhidrogénkeverék. Főként C4-C11 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya –20 oC és 190 oC (–4 oF és 374 oF) között van.] |
265-123-6 | 64742-23-0 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-354-00-3 | Naphtha (petroleum), catalytic dewaxed; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained from the catalytic dewaxing of a petroleum fraction. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C5 through C12 and boiling in the range of approximately 35°C to 230°C (95°F to 446°F).] | Benzin
(ásványolaj), katalitikusan viaszmentesített; Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet nyersolaj frakció katalitikus viaszmentesítéséből nyernek. Főként C5-C12 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 35 oC és 230 oC (95 oF és 446 oF) között van.] |
265-170-2 | 64742-66-1 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-355-00-9 | Naphtha (petroleum), light steam-cracked; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by the distillation of the products from a steam cracking process. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly in the range of C4 through C11 and boiling in the range of approximately minus 20°C to 190°C (-4°F to 374°F). This stream is likely to contain 10 vol. % or more benzene.] | Benzin
(ásványolaj), könnyű, gőzkrakkolt; Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet gőzkrakkolási eljárás termékeinek desztillációjával nyernek. Főként C4-C11 szénatomszámú telítetlen szénhidrogénekből áll, hozzávetőleges forráspont-tartománya –20 oC és 190 oC (–4 oF és 374 oF) között van.] Ez az elegy gyakran tartalmaz 10 (v/v)% vagy még több benzolt.] |
265-187-5 | 64742-83-2 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-356-00-4 | Solvent naphtha (petroleum), light arom.; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained from distillation of aromatic streams. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C8 through C10 and boiling in the range of approximately 135°C to 210°C (275°F to 410°F).] | Oldószer
benzin (ásványolaj), könnyű arom.; Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet aromás elegyek desztillációjával nyernek. Főként C8-C10 szénatomszámú aromás szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 135 oC és 210 oC (275 oF és 410 oF) között van.] |
265-199-0 | 64742-95-6 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-357-00-X | Aromatic hydrocarbons, C6-10, acid-treated, neutralized; Low boiling point naphtha - unspecified | Aromás
szénhidrogének, C6-10, savval kezelt, semlegesített; Alacsony forráspontú benzin – nem meghatározott |
268-618-5 | 68131-49-7 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-358-00-5 | Distillates (petroleum), C3-5, 2-methyl-2-butene-rich; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons from the distillation of hydrocarbons usually ranging in carbon numbers from C3 through C5, predominantly isopentane and 3-methyl-1-butene. It consists of saturated and unsaturated hydrocarbons having carbon numbers in the range of C3 through C5, predominantly 2-methyl-2-butene.] | Desztillátumok
(ásványolaj), C3-5, 2-metil-2-buténben gazdag; Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet általában C3-C5 szénatomszámú szénhidrogénekből, főleg izopentánból és 3-metil-1-buténből álló elegy desztillációjával nyernek. Telített és telítetlen szénhidrogénekből áll (főleg 2-metil-2-buténből), melyek szénatomszáma a C3-C5 tartományban van.] |
270-725-7 | 68477-34-9 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-359-00-0 | Distillates (petroleum), polymd. steam-cracked petroleum distillates, C5-12 fraction; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained from the distillation of polymerized steam-cracked petroleum distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C5 through C12.] | Desztillátumok
(ásványolaj), polimerizált gőzkrakkolt nyersolaj desztillátumok,
C5-12 frakció; Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet polimerizált gőzkrakkolt nyersolaj desztillátum lepárlásával nyernek. Főként C5-C12 szénatomszámú szénhidrogénekből áll.] |
270-735-1 | 68477-50-9 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-360-00-6 | Distillates (petroleum), steam-cracked, C5-12 fraction; Low boiling point naphtha - unspecified; [A complex combination of organic compounds obtained by the distillation of products from a steam cracking process. It consists of unsaturated hydrocarbons having carbon numbers predominantly in the range of C5 through C12.] | Párlatok
(ásványolaj), gőzzel krakkolt, C5-12 frakció; Alacsony forráspontú benzin – nem meghatározott; [Szerves vegyületek összetett keveréke, melyet gőzkrakkolási folyamatból származó termékek desztillációjával nyernek. Főként C5-C12 szénatomszámú telítetlen szénhidrogénekből áll.] |
270-736-7 | 68477-53-2 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-361-00-1 | Distillates (petroleum), steam-cracked, C5-10 fraction, mixed with light steam-cracked petroleum naphtha C5 fraction; Low boiling point naphtha - unspecified | Desztillátumok (nyersolaj), gőzkrakkolt, C5-10 frakció, könnyű gőzkrakkolt nyersolaj benzin C5 frakciójával kevert; Alacsony forráspontú benzin – nem meghatározott | 270-738-8 | 68477-55-4 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-362-00-7 | Extracts (petroleum), cold-acid, C4-6; Low boiling point naphtha - unspecified; [A complex combination of organic compounds produced by cold acid unit extraction of saturated and unsaturated aliphatic hydrocarbons usually ranging in carbon numbers from C3 through C6, predominantly pentanes and amylenes. It consists predominantly of saturated and unsaturated hydrocarbons having carbon numbers in the range of C4 through C6, predominantly C5.] | Extraktumok (nyersolaj), hideg savas, C4-6; Alacsony forráspontú benzin – nem meghatározott; [Szerves vegyületek összetett keveréke, melyet C3-C6 szénatomszámú telített és telítetlen alifás szénhidrogéneket, főleg pentánokat és amiléneket tartalmazó elegy hideg savas egységben történő extrakciójából nyernek. Főleg olyan telített és telítetlen szénhidrogénekből áll, melyek szénatomszáma a C4-C6 tartományban van, elsősorban C5.] | 270-741-4 | 68477-61-2 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-363-00-2 | Distillates (petroleum), depentanizer overheads; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained from a catalytic cracked gas stream. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C4 through C6.] | Desztillátumok
(ásványolaj), pentánmentesítő fejtermékek; Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet katalitikusan krakkolt gázelegyből nyernek. Főként C4-C6 szénatomszámú alifás szénhidrogénekből áll.] |
270-771-8 | 68477-89-4 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-364-00-8 | Residues (petroleum), butane splitter bottoms; Low boiling point naphtha - unspecified; [A complex residuum from the distillation of butane stream. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C4 through C6.] | Maradékok
(ásványolaj), bután elválasztás fenéktermékek; Alacsony forráspontú benzin – nem meghatározott; [Bután áram desztillációjának komplex maradéka. Olyan alifás szénhidrogénekből áll, melyek szénatomszáma főleg a C4-C6 tartományban van.] |
270-791-7 | 68478-12-6 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H340 H350 H304 |
P | CLP00/ATP01corr | ||
| 649-365-00-3 | Residual oils (petroleum), deisobutanizer tower; Low boiling point naphtha - unspecified; [A complex residuum from the atmospheric distillation of the butane-butylene stream. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C4 through C6.] | Maradék
olajok (ásványolaj), izobután-mentesítő torony; Alacsony forráspontú benzin – nem meghatározott; [A bután-butilén áram atmoszferikus desztillációjának komplex terméke. Főként C4-C6 szénatomszámú alifás szénhidrogénekből áll.] |
270-795-9 | 68478-16-0 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-366-00-9 | Naphtha (petroleum), full-range coker; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons produced by the distillation of products from a fluid coker. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly in the range of C4 through C15 and boiling in the range of approximately 43°C to 250°C (110°F-500°F).] | Benzin
(ásványolaj), teljes kokszoló; Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet fluid kokszoló termékeinek desztillációjával nyernek. Főként C4-C15 szénatomszámú telítetlen szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 43 oC és 250 oC (110 oF és 500 oF) között van.] |
270-991-4 | 68513-02-0 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-367-00-4 | Naphtha (petroleum), steam-cracked middle arom.; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons produced by the distillation of products from a steam-cracking process. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C7 through C12 and boiling in the range of approximately 130°C to 220°C (266°F to 428°F).] | Benzin
(ásványolaj), gőzkrakkolt aromás középfrakció; Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet gőzkrakkolási folyamat termékeinek desztillációjával nyernek. Főként C7-C12 szénatomszámú aromás szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 130 oC és 220 oC (266 oF és 428 oF) között van.] |
271-138-9 | 68516-20-1 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-368-00-X | Naphtha (petroleum), clay-treated full-range straight-run; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons resulting from treatment of full-range straight-run naphtha with natural or modified clay, usually in a percolation process to remove the trace amounts of polar compounds and impurities present. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C11 and boiling in the range of approximately -20°C to 220°C (-4°F to 429°F).] | Benzin
(nyersolaj), agyaggal kezelt teljes közvetlen lepárlású; Alacsony forráspontú
benzin – nem meghatározott; [Szénhidrogének összetett keveréke, mely a teljes közvetlen lepárlású benzin természetes vagy módosított agyaggal, általában perkolációs eljárással végzett kezelésénél keletkezik, melyet a benne lévő poláros vegyületek nyomnyi mennyisége és a szennyeződések eltávolítása céljából végeznek. Főként C4-C11 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya –20 oC és 220 oC (–4 oF és 429 oF) között van.] |
271-262-3 | 68527-21-9 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-369-00-5 | Naphtha (petroleum), clay-treated light straight-run; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons resulting from treatment of light straight-run naphtha with a natural or modified clay, usually in a percolation process to remove the trace amounts of polar compounds and impurities present. It consists of hydrocarbons having carbon numbers predominantly in the range of C7 through C10 and boiling in the range of approximately 93°C to 180°C (200°F to 356°F).] | Benzin
(ásványolaj), agyaggal kezelt könnyű közvetlen lepárlású; Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, mely a közvetlen lepárlású könnyű benzin természetes vagy módosított agyaggal, általában perkolációs eljárással végzett kezelésénél keletkezik, melyet a benne lévő poláros vegyületek nyomnyi mennyisége és a szennyeződések eltávolítása céljából végeznek. Főként C7-C10 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 93 oC és 180 oC (200 oF és 356 oF) között van.] |
271-263-9 | 68527-22-0 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-370-00-0 | Naphtha (petroleum), light steam-cracked arom.; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons produced by distillation of products from a steam-cracking process. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C7 through C9 and boiling in the range of approximately 110°C to 165°C (230°F to 329°F).] | Benzin
(ásványolaj), könnyű gőzkrakkolt aromás; Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet gőzkrakkolási folyamat termékeinek desztillációjával nyernek. Főleg aromás szénhidrogénekből áll, melyek szénatomszáma a C7-C9 tartományban van, forráspont-tartománya kb. 110 oC-tól 165 oC-ig (230 oF-tól 329 oF-ig) terjed.] |
271-264-4 | 68527-23-1 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-371-00-6 | Naphtha (petroleum), light steam-cracked, debenzenized; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons produced by distillation of products from a steam-cracking process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C4 through C12 and boiling in the range of approximately 80°C to 218°C (176°F to 424°F).] | Benzin
(nyersolaj), könnyű gőzkrakkolt, benzolmentesített; Alacsony forráspontú
benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet gőzkrakkolási folyamat termékeinek desztillációjával nyernek. Főként C4-C12 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 80 oC és 218 oC (176 oF és 424 oF) között van.] |
271-266-5 | 68527-26-4 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-372-00-1 | Naphtha (petroleum), arom.-contg.; Low boiling point naphtha - unspecified | Benzin
(ásványolaj), aromás tart.; Alacsony forráspontú benzin – nem meghatározott |
271-635-0 | 68603-08-7 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-373-00-7 | Gasoline, pyrolysis, debutanizer bottoms; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained from the fractionation of depropanizer bottoms. It consists of hydrocarbons having carbon numbers predominantly greater than C5.] | Benzin,
pirolízis, butánmentesítő fenéktermékek; Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet propánmentesítő fenéktermékeinek frakcionálásával nyernek. Főként C5-nél nagyobb szénatomszámú szénhidrogénekből áll.] |
271-726-5 | 68606-10-0 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-374-00-2 | Naphtha (petroleum), light, sweetened; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by subjecting a petroleum distillate to a sweetening process to convert mercaptans or to remove acidic impurities. It consists predominantly of saturated and unsaturated hydrocarbons having carbon numbers predominantly in the range of C3 through C6 and boiling in the range of approximately -20°C to 100°C (-4°F to 212°F).] | Benzin
(ásványolaj), könnyű, kéntelenített; Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet úgy állítanak elő, hogy ásványolaj desztillátumot kéntelenítési eljárásnak vetnek alá a merkaptánok konvertálása vagy a savas szennyeződések eltávolítása céljából. Főként C3-C6 szénatomszámú telített és telítetlen szénhidrogénekből áll, és hozzávetőleges forráspont-tartománya –20 oC és 100 oC (–4 oF és 212 oF) között van.] |
272-206-0 | 68783-66-4 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-375-00-8 | Natural gas condensates; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons separated and/or condensed from natural gas during transportation and collected at the wellhead and/or from the production, gathering, transmission, and distribution pipelines in deeps, scrubbers, etc. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C2 through C8.] | Földgáz
kondenzátumok; Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet földgázból választanak el vagy kondenzálnak szállítás során és a fúrólyukfejnél és/vagy termelés, összegyűjtés, továbbítás során, ill. az elosztócsövekből, gázmosókból stb. gyűjtenek össze. Főként C2-C8 szénatomszámú szénhidrogénekből áll.] |
272-896-3 | 68919-39-1 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-376-00-3 | Distillates (petroleum), naphtha unifiner stripper; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons produced by stripping the products from the naphtha unifiner. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C6.] | Desztillátumok
(ásványolaj), benzin egyesítő sztripper; Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet a benzin egyesítő berendezésről származó termékek sztrippelésével nyernek. Főként C2-C6 szénatomszámú telített alifás szénhidrogénekből áll.] |
272-932-8 | 68921-09-5 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-377-00-9 | Naphtha (petroleum), catalytic reformed light, arom.-free fraction; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons remaining after removal of aromatic compounds from catalytic reformed light naphtha in a selective absorption process. It consists predominantly of paraffinic and cyclic compounds having carbon numbers predominantly in the range of C5 to C8 and boiling in the range of approximately 66°C to 121°C (151°F to 250°F).] | Benzin
(ásványolaj), katalitikusan reformált könnyű, aromásoktól mentes
frakció; Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, mely a katalitikusan reformált könnyűbenzinből az aromás vegyületek szelektív abszorpciós eljárással történő eltávolítása után marad vissza. Főként C5-C8 szénatomszámú paraffinokból és gyűrűs vegyületekből áll, és hozzávetőleges forráspont-tartománya 66 oC és 121 oC (151 oF és 250 oF) között van.] |
285-510-3 | 85116-59-2 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-378-00-4 | Gasoline; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons consisting primarily of paraffins, cycloparaffins, aromatic and olefinic hydrocarbons having carbon numbers predominantly greater than C3 and boiling in the range of 30°C to 260°C (86°F to 500°F).] | Benzin; Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, mely főleg paraffinokat, cikloparaffinokat, aromás és olefin szénhidrogénekből áll, melyek szénatomszáma általában magasabb mint C3, forrásponttartománya hozzávetőlegesen 30 oC-tól 260 oC-ig (86 oF-tól 500 oF-ig) terjed.] |
289-220-8 | 86290-81-5 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-379-00-X | Aromatic hydrocarbons, C7-8, dealkylation products, distn. residues; Low boiling point naphtha - unspecified | Aromás
szénhidrogének, C7-8, dealkilezési termékek, deszt. maradékok; Alacsony forráspontú benzin – nem meghatározott |
292-698-0 | 90989-42-7 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-380-00-5 | Hydrocarbons, C4-6, depentanizer lights, arom. hydrotreater; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained as first runnings from the depentanizer column before hydrotreatment of the aromatic charges. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C4 through C6, predominantly pentanes and pentenes, and boiling in the range of approximately 25°C to 40°C (77°F to 104°F).] | Szénhidrogének,
C4-6, pentánmentesítő könnyű termékek, arom. hidrogénező; Alacsony
forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet első párlatként nyernek a pentánmentesítő toronyból az aromás részek hidrogénes kezelése előtt. Főként C4-C6 szénatomszámú szénhidrogénekből, túlnyomórészt pentánokból és penténekből áll, hozzávetőleges forráspont-tartománya 25 oC és 40 oC (77 oF és 104 oF) között van.] |
295-298-4 | 91995-38-9 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-381-00-0 | Distillates (petroleum), heat-soaked steam-cracked naphtha, C5-rich; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by distillation of heat-soaked steam-cracked naphtha. It consists predominantly of hydrocarbons having carbon numbers in the range of C4 through C6, predominantly C5.] | Desztillátumok
(ásványolaj), melegen szikkasztott gőzkrakkolt benzin, C5-ben gazdag; Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet melegen szikkasztott gőzkrakkolt benzin desztillációjával nyernek. Főleg olyan szénhidrogénekből áll, melyek szénatomszáma a C4-C6 tartományban van, de túlnyomórészt C5.] |
295-302-4 | 91995-41-4 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-382-00-6 | Extracts (petroleum), catalytic reformed light naphtha solvent; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained as the extract from the solvent extraction of a catalytically reformed petroleum cut. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C7 through C8 and boiling in the range of approximately 100°C to 200°C (212°F to 392°F).] | Extraktumok
(nyersolaj), katalitikusan reformált könnyűbenzin oldószer; Alacsony
forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet katalitikusan reformált nyersolaj frakció oldószeres extrakciójának extraktumaként nyernek. Főként C7-C8 szénatomszámú aromás szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 100 oC és 200 oC (212 oF és 392 oF) között van.] |
295-331-2 | 91995-68-5 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-383-00-1 | Naphtha (petroleum), hydrodesulfurized light, dearomatized; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by distillation of hydrodesulfurized and dearomatized light petroleum fractions. It consists predominantly of C7 paraffins and cycloparaffins boiling in a range of approximately 90°C to 100°C (194°F to 212°F).] | Benzin
(nyersolaj), hidrogénnel kéntelenített könnyű, aromásoktól mentesített;
Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet hidrogénnel kéntelenített és aromásoktól mentesített könnyű ásványolaj frakciók desztillációjával nyernek. Főként C7-es paraffinokból és cikloparaffinokból áll, hozzávetőleg a 90 oC-tól 100 oC-ig (194 oF-tól 212 oF-ig) terjedő tartományban forr.] |
295-434-2 | 92045-53-9 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-384-00-7 | Naphtha (petroleum), light, C5-rich, sweetened; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by subjecting a petroleum naphtha to a sweetening process to convert mercaptans or to remove acidic impurities. It consists of hydrocarbons having carbon numbers predominantly in the range of C4 through C5, predominantly C5, and boiling in the range of approximately minus 10°C to 35°C (14°F to 95°F).] | Benzin
(ásványolaj), könnyű, C5-ben gazdag, kéntelenített; Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet úgy állítanak elő, hogy ásványolaj benzint a merkaptánok konverziója vagy a savas szennyeződések eltávolítása céljából kéntelenítési eljárásnak vetnek alá. Főként C4-C5, túlnyomórészt C5 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya –10 oC és 35 oC (14 oF és 95 oF) között van.] |
295-442-6 | 92045-60-8 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-385-00-2 | Hydrocarbons, C8-11, naphtha-cracking, toluene cut; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by distillation from prehydrogenated cracked naphtha. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C8 through C11 and boiling in the range of approximately 130°C to 205°C (266°F to 401°F).] | Szénhidrogének,
C8-11, benzin krakkolás, toluol frakció; Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet előhidrogénezett krakkolt benzin desztillációjával nyernek. Főként C8-C11 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 130 oC és 205 oC (266 oF és 401 oF) között van.] |
295-444-7 | 92045-62-0 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-386-00-8 | Hydrocarbons, C4-11, naphtha-cracking, arom.-free; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained from prehydrogenated cracked naphtha after distillative separation of benzene- and toluene-containing hydrocarbon cuts and a higher boiling fraction. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C4 through C11 and boiling in the range of approximately 30°C to 205°C (86°F to 401°F).] | Szénhidrogének,
C4-11, benzin krakkolás, aromásoktól mentes; Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet előhidrogénezett krakkolt benzinből nyernek a benzolt és toluolt tartalmazó szénhidrogén frakciók, valamint a magasabb forráspontú frakció desztillációs elválasztása után. Főként C4-C11 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 30 oC és 205 oC (86 oF és 401 oF) között van.] |
295-445-2 | 92045-63-1 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-387-00-3 | Naphtha (petroleum), light heat-soaked, steam-cracked; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by the fractionation of steam cracked naphtha after recovery from a heat soaking process. It consists predominantly of hydrocarbons having a carbon number predominantly in the range of C4 through C6 and boiling in the range of approximately 0°C to 80°C (32°F to 176°F).] | Benzin
(ásványolaj), könnyű, melegen szikkasztott, gőzkrakkolt; Alacsony forráspontú benzin – nem meghatározott; [A meleg szikkasztásból visszanyert, majd gőzzel krakkolt benzin frakcionálásából nyert, összetett szénhidrogénkeverék. Főként C4-C6 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 0 oC és 80 oC (32 oF és 176 oF) között van.] |
296-028-8 | 92201-97-3 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-388-00-9 | Distillates (petroleum), C6-rich; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained from the distillation of a petroleum feedstock. It consists predominantly of hydrocarbons having carbon numbers of C5 through C7, rich in C6, and boiling in the range of approximately 60°C to 70°C (140°F to 158°F).] | Desztillátumok
(ásványolaj), C6-ban gazdag; Alacsony forráspontú benzin – nem
meghatározott; [Szénhidrogének összetett keveréke, melyet nyersolaj kiindulási anyagok desztillációjával nyernek. Főként C5-C7 szénatomszámú szénhidrogénekből áll, C6-ban gazdag, hozzávetőleges forráspont-tartománya 60 oC és 70 oC (140 oF és 158 oF) között van.] |
296-903-4 | 93165-19-6 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-389-00-4 | Gasoline, pyrolysis, hydrogenated; Low boiling point naphtha-unspecified; [A distillation fraction from the hydrogenation of pyrolysis gasoline boiling in the range of approximately 20°C to 200°C (68°F to 392°F).] | Benzin,
pirolízis, hidrogénezett; Alacsony forráspontú benzin – nem meghatározott; [Pirolízis benzin hidrogénezésének desztillációs frakciója, melynek forráspont-tartománya hozzávetőlegesen 20 oC-tól 200 oC-ig (68 oF-tól 392 oF-ig) terjed.] |
302-639-3 | 94114-03-1 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-390-00-X | Distillates (petroleum), steam-cracked, C8-12 fraction, polymd., distn. lights; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by distillation of the polymerized C8 through C12 fraction from steam-cracked petroleum distillates. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C8 through C12.] | Desztillátumok
(ásványolaj), gőzkrakkolt, C8-12 frakció, polimerizált, deszt.
fejtermékek; Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet gőzkrakkolt nyersolaj desztillátumokból származó polimerizált C8-C12 frakció desztillációjával nyernek. Főként C8-C12 szénatomszámú aromás szénhidrogénekből áll.] |
305-750-5 | 95009-23-7 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-391-00-5 | Extracts (petroleum) heavy naphtha solvent, clay-treated; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by the treatment of heavy naphthic solvent petroleum extract with bleaching earth. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C6 through C10 and boiling in the range of approximately 80°C to 180°C (175°F to 356°F).] | Extraktumok
(nyersolaj), nehéz benzin oldószer, agyaggal kezelt; Alacsony forráspontú
benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet nehéz benzines oldószer nyersolaj extraktum derítőfölddel végzett kezelésével nyernek. Főként C6-C10 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 80 oC és 180 oC (175 oF és 356 oF) között van.] |
308-261-5 | 97926-43-7 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-392-00-0 | Naphtha (petroleum), light steam-cracked, debenzenized, thermally treated; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by the treatment and distillation of debenzenized light steam-cracked petroleum naphtha. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C7 through C12 and boiling in the range of approximately 95°C to 200°C (203°F to 392°F).] | Benzin
(ásványolaj), könnyű, gőzkrakkolt, benzolmentesített, hőkezelt; Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet benzolmentesített, könnyű gőzkrakkolt nyersolaj benzin kezelésével és desztillációjával nyernek. Főként C7-C12 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 95 oC és 200 oC (203 oF és 392 oF) között van.] |
308-713-1 | 98219-46-6 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-393-00-6 | Naphtha (petroleum), light steam-cracked, thermally treated; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by the treatment and distillation of light steam-cracked petroleum naphtha. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C5 through C6 and boiling in the range of approximately 35°C to 80°C (95°F to 176°F).] | Benzin
(ásványolaj), könnyű, gőzkrakkolt, hőkezelt; Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet könnyű gőzkrakkolt nyersolaj benzin kezelésével és desztillációjával nyernek. Főként C5-C6 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 35 oC és 80 oC (95 oF és 176 oF) között van.] |
308-714-7 | 98219-47-7 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-394-00-1 | Distillates (petroleum), C7-9, C8-rich, hydrodesulfurized dearomatized; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by the distillation of petroleum light fraction, hydrodesulfurized and dearomatized. It consists predominantly of hydrocarbons having carbon numbers in the range of C7 through C9, predominantly C8 paraffins and cycloparaffins, boiling in the range of approximately 120°C to 130°C (248°F to 266°F).] | Desztillátumok
(ásványolaj), C7-9, C8-ban gazdag, hidrogénnel kéntelenített, aromásoktól
mentes; Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet nyersolaj könnyű frakció desztillációjával, hidrogénnel való kéntelenítésével és az aromások eltávolításával nyernek. Főként C7-C9 szénatomszámú szénhidrogénekből, túlnyomórészt C8 paraffinokból és cikloparaffinokból áll, hozzávetőleges forráspont-tartománya 120 oC és 130 oC (248 oF és 266 oF) között van.] |
309-862-5 | 101316-56-7 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-395-00-7 | Hydrocarbons, C6-8, hydrogenated sorption-dearomatized, toluene raffination; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained during the sorptions of toluene from a hydrocarbon fraction from cracked gasoline treated with hydrogen in the presence of a catalyst. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C6 through C8 and boiling in the range of approximately 80°C to 135°C (176°F to 275°F).] | Szénhidrogének,
C6-8, aromásoktól szorpciósan mentesített, toluol raffinálás; Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet a katalizátor jelenlétében hidrogénnel kezelt krakkolt benzin szénhidrogén frakciójából a toluol szorpciója során nyernek. Főként C6-C8 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 80 oC és 135 oC (176 oF és 275 oF) között van.] |
309-870-9 | 101316-66-9 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-396-00-2 | Naphtha (petroleum), hydrodesulfurised full-range coker; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by fractionation from hydrodesulfurised coker distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C5 to C11 and boiling in the range of approximately 23°C to 196°C (73°F to 385°F).] | Benzin
(ásványolaj), hidrogénnel kéntelenített teljes kokszolás; Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet hidrogénnel kéntelenített kokszoló desztillátum frakcionálásával nyernek. Főként C5-C11 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 23 oC és 196 oC (73 oF és 385 oF) között van.] |
309-879-8 | 101316-76-1 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-397-00-8 | Naphtha (petroleum), sweetened light; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by subjecting a petroleum naphtha to a sweetening process to convert mercaptans or to remove acidic impurities. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C5 through C8 and boiling in the range of approximately 20°C to 130°C (68°F to 266°F).] | Benzin
(ásványolaj), kéntelenített könnyű; Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet úgy állítanak elő, hogy ásványolaj benzint a merkaptánok konverziója vagy a savas szennyeződések eltávolítása céljából kéntelenítési eljárásnak vetnek alá. Főként C5-C8 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 20 oC és 130 oC (68 oF és 266 oF) között van.] |
309-976-5 | 101795-01-1 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-398-00-3 | Hydrocarbons, C3-6, C5-rich, steam-cracked naphtha; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by distillation of steam-cracked naphtha. It consists predominantly of hydrocarbons having carbon numbers in the range of C3 through C6, predominantly C5.] | Szénhidrogének,
C3-6, C5-ban gazdag; gőzkrakkolt benzin Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet gőzkrakkolt benzin desztillációjával nyernek. Főleg olyan szénhidrogénekből áll, melyek szénatomszáma a C3-C6 tartományban van, de túlnyomórészt C5.] |
310-012-0 | 102110-14-5 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-399-00-9 | Hydrocarbons, C5-rich, dicyclopentadiene-contg.; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by distillation of the products from a steam-cracking process. It consists predominantly of hydrocarbons having carbon numbers of C5 and dicyclopentadiene and boiling in the range of approximately 30°C to 170°C (86°F to 338°F).] | Szénhidrogének,
C5-ben gazdag, diciklopentadién-tart.; Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet gőzkrakkolási eljárásból származó termékek desztillációjával nyernek. Főként C5 szénatomszámú szénhidrogénekből és diciklopentadiénből áll, forrásponttartománya hozzávetőlegesen 30 oC-tól 170 oC-ig (86 oF-tól 338 oF-ig) terjed.] |
310-013-6 | 102110-15-6 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-400-00-2 | Residues (petroleum), steam-cracked light, arom.; Low boiling point naphtha - unspecified; [A complex combination of hydrocarbons obtained by the distillation of the products of steam cracking or similar processes after taking off the very light products resulting in a residue starting with hydrocarbons having carbon numbers greater than C5. It consists predominantly of aromatic hydrocarbons having carbon numbers greater than C5 and boiling above approximately 40°C (104°F).] | Maradékok
(ásványolaj), gőzkrakkolt könnyű, arom.; Alacsony forráspontú benzin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet gőzkrakkolási vagy hasonló folyamatok termékeinek desztillációjával nyernek, miután a nagyon könnyű termékeket eltávolították belőle, olyan maradékot eredményezve, amely C5-nél nagyobb szénatomszámú szénhidrogénekkel kezdődik. Főként C5-nél nagyobb szénatomszámú aromás szénhidrogénekből áll, és forrásponttartománya hozzávetőlegesen 40 oC (104 oF) felett van.] |
310-057-6 | 102110-55-4 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-401-00-8 | Hydrocarbons, C≥5, C5-6-rich; Low boiling point naphtha - unspecified | Szénhidrogének, C≥5, C5-6-ban gazdag; Alacsony forráspontú benzin – nem meghatározott | 270-690-8 | 68476-50-6 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-402-00-3 | Hydrocarbons, C5-rich; Low boiling point naphtha - unspecified | Szénhidrogének,
C5-ben gazdag; Alacsony forráspontú benzin – nem meghatározott |
270-695-5 | 68476-55-1 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-403-00-9 | Aromatic hydrocarbons, C8-10; Low boiling point naphtha - unspecified | Aromás szénhidrogének, C8-10; Alacsony forráspontú benzin – nem meghatározott | 292-695-4 | 90989-39-2 | Carc.
1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
P | CLP00/ATP01 | ||
| 649-404-00-4 | Kerosine (petroleum); Straight run kerosine; [A complex combination of hydrocarbons produced by the distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C16 and boiling in the range of approximately 150 °C to 290 °C (320 °F to 554 °F).] | Kerozin
(ásványolaj), közvetlen lepárlású kerozin; [Szénhidrogének összetett keveréke, melyet nyersolaj desztillációjával állítanak elő. Főként C9-C16 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 150 oC-290 oC (320 oF-554 oF).] |
232-366-4 | 8008-20-6 | Asp.
Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
CLP00 | |||
| 649-405-00-X | solvent naphtha (petroleum), medium aliph.; Straight run kerosine; [A complex combination of hydrocarbons obtained from the distillation of crude oil or natural gasoline. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C9 through C12 and boiling in the range of approximately 140 °C to 220 °C (284 °F to 428 °F).] | Szolvens
nafta (ásványolaj), közép alifás; Közvetlen lepárlású kerozin; [Szénhidrogének összetett keveréke, melyet nyersolaj vagy természetes gazolin desztillációjával nyernek. Főként C9-C12 szénatomszámú telített szénhidrogénekből áll, forráspont-tartománya hozzávetőlegesen 140 oC-tól 220 oC-ig (284 oF-tól 428 oF-ig) terjed.] |
265-191-7 | 64742-88-7 | Asp.
Tox. 1 STOT RE 1 |
H304 H372 (central nervous system) |
GHS08 Dgr |
H372
(central nervous system) H304 |
CLP00/ATP05 | |||
| 649-406-00-5 | Solvent naphtha (petroleum) heavy aliph.; Straight run kerosine; [A complex combination of hydrocarbons obtained from the distillation of crude oil or natural gasoline. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C11 through C16 and boiling in the range of approximately 190 °C to 290 °C (374 °F to 554 °F).] | Szolvens
nafta (ásványolaj), nehéz alifás; Közvetlen lepárlású kerozin; [Szénhidrogének összetett keveréke, melyet nyersolaj vagy természetes gazolin desztillációjával nyernek. Főként C11-C16 szénatomszámú telített szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 190 oC-290 oC (374 oF-554 oF). |
265-200-4 | 64742-96-7 | Asp.
Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
CLP00 | |||
| 649-407-00-0 | Kerosine (petroleum), straight-run wide-cut; Straight run kerosine; [A complex combination of hydrocarbons obtained as a wide cut hydrocarbon fuel cut from atmospheric distillation and boiling in the range of approximately 70 °C to 220 °C (158 °F to 428 °F).] | Kerozin
(ásványolaj), közvetlen lepárlású széles frakció; Közvetlen lepárlású kerozin; [Atmoszferikus desztilláció széles szénhidrogénolaj párlataként nyert összetett szénhidrogénkeverék, melynek hozzávetőleges forráspont-tartománya 70 oC és 220 oC (158 oF és 428 oF) között van.] |
295-418-5 | 92045-37-9 | Asp.
Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
CLP00 | |||
| 649-408-00-6 | Distillates (petroleum), steam-cracked; Cracked kerosine; [A complex combination of hydrocarbons obtained by the distillation of the products from a steam cracking process. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly in the range of C7 through C16 and boiling in the range of approximately 90 °C to 290 °C (190 °F to 554 °F).] | Párlatok
(ásványolaj), gőzzel krakkolt; Krakkolt kerozin; [Szénhidrogének összetett keveréke, melyet gőzkrakkolási eljárás termékeinek desztillációjával nyernek. Főként C7-C16 szénatomszámú telítetlen szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 90 oC-290 oC (190 oF-554 oF). |
265-194-3 | 64742-91-2 | Asp.
Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
CLP00 | |||
| 649-409-00-1 | Distillates (petroleum), cracked stripped steam-cracked petroleum distillates, C8-10 fraction; Cracked kerosine; [A complex combination of hydrocarbons obtained by distilling cracked stripped steam-cracked distillates. It consists of hydro-carbons having carbon numbers in the range of C8 through C10 and boiling in the range of approximately 129 °C to 194 °C (264 °F to 382 °F).] | Desztillátumok
(ásványolaj), gőzzel krakkolt ásványolaj desztillátum,
C8-10 frakció; Krakkolt kerozin; [Szénhidrogének összetett keveréke, melyet elválasztott gőzkrakkolt desztillátumok desztillációja útján nyernek. Főként C8-C10 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 129 oC-194 oC (264 oF-382 oF). |
270-728-3 | 68477-39-4 | Asp.
Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
CLP00 | |||
| 649-410-00-7 | Distillates (petroleum), cracked stripped steam-cracked petroleum distillates, C10-12 fraction; Cracked kerosine; [A complex combination of hydrocarbons obtained by distilling cracked stripped steam-cracked distillates. It consists predominantly of aromatic hydrocarbons having carbon numbers in the range of C10 through C12.] | Desztillátumok
(ásványolaj), gőzzel krakkolt ásványolaj desztillátum,
C10-12 frakció; Krakkolt kerozin; [Szénhidrogének összetett keveréke, melyet elválasztott gőzkrakkolt desztillátumok desztillációja útján nyernek. Főként C10-C12 szénatomszámú aromás szénhidrogénekből áll. |
270-729-9 | 68477-40-7 | Asp.
Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
CLP00 | |||
| 649-411-00-2 | Distillates (petroleum), steam-cracked, C8-12 fraction; Cracked kerosine; [A complex combination of organic compounds obtained by the distillation of products from a steam cracking process. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly in the range of C8 through C12.] | Párlatok
(ásványolaj), gőzzel krakkolt, C8-12 frakció; Krakkolt kerozin; [Szerves vegyületek összetett keveréke, melyet gőzkrakkolási folyamatból származó termékek desztillációjával nyernek. Főként C8-C12 szénatomszámú telítetlen szénhidrogénekből áll.] |
270-737-2 | 68477-54-3 | Asp.
Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
CLP00 | |||
| 649-412-00-8 | Kerosine (petroleum), hydrodesulfurized thermal cracked; Cracked kerosine; [A complex combination of hydrocarbons obtained by fractionation from hydrodesulfurized thermal cracker distillate. It consists predominantly of hydrocarbons predominantly in the range of C8 to C16 and boiling in the range of approximately 120 °C to 283 °C (284 °F to 541 °F).] | Kerozin
(ásványolaj), hidrogénnel kéntelenített hővel krakkolt; Krakkolt
kerozin; [Szénhidrogének összetett keveréke, melyet hidrogénnel kéntelenített termikus krakkoló desztillátum frakcionálásával nyernek. Főként C8-C16 szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 120 oC-283 oC (284 oF-541 oF). |
285-507-7 | 85116-55-8 | Asp.
Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
CLP00 | |||
| 649-413-00-3 | Aromtic hydrocarbons, C≥10, steam-cracking, hydrotreated; Cracked kerosine; [A complex combination of hydrocarbons produced by the distillation of the products from a steam cracking process treated with hydrogen in the presence of a catalyst. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly greater than C10 and boiling in the range of approximately 150 °C to 320 °C (302 °F to 608 °F).] | Aromás
szénhidrogének, C≥10, gőzzel krakkolt, hidrogénnel kezelt; Krakkolt
kerozin; [Gőzkrakkolási folyamatot követő katalitikus hidrogénezéssel előállított termékek desztillálásával nyert összetett szénhidrogénkeverék. Főként C10-nél nagyobb szénatomszámú aromás szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 150 oC-320 oC (302 oF-608 oF).] |
292-621-0 | 90640-98-5 | Asp.
Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
CLP00 | |||
| 649-414-00-9 | Naphtha (petroleum), steam-cracked, hydrotreated, C9-10-arom.-rich; Cracked kerosine; [A complex combination of hydrocarbons produced by the distillation of the products from a steam cracking process thereafter treated with hydrogen in the presence of a catalyst. It consists predominantly of aromatic hydrocarbons having carbon numbers in the range of C9 through C10 and boiling in the range of approximately 140 °C to 200 °C (284 °F to 392 °F).] | Benzin
(ásványolaj), gőzzel krakkolt, hidrogénnel kezelt, C9-10 aromás gazdag;
Krakkolt kerozin; [Gőzkrakkolási folyamatot követő katalitikus hidrogénezéssel előállított termékek desztillálásával nyert összetett szénhidrogénkeverék. Főként C9-C10 szénatomszámú aromás szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 140 oC-200 oC (284 oF-392 oF). |
292-637-8 | 90641-13-7 | Asp.
Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
CLP00 | |||
| 649-415-00-4 | Distillates (petroleum), thermal-cracked, alkylarom. hydrocarbon-rich; Cracked kerosine; [A complex combination of hydrocarbons obtained by distillation of thermal-cracking heavy tars. It consists predominantly of highly alkylated aromatic hydrocarbons boiling in the range of approximately 100 °C to 250 °C (212 °F to 482 °F.] | Párlatok
(ásványolaj), hőkrakkolt, alkilaromás szénhidrogénekben gazdag; Krakkolt kerozin; [Hőkrakkolt nehéz kátrányok desztillációjával nyert összetett szénhidrogénkeverék. Főként többszörösen alkilezett aromás szénhidrogénekből áll, melyek hozzávetőleges forráspont-tartománya 100 oC-250 oC (212 oF-482 oF). |
309-866-7 | 101316-61-4 | Asp.
Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
CLP00 | |||
| 649-416-00-X | Distillates (petroleum), catalytic cracked heavy tar light; Cracked kerosine; [A complex combination of hydrocarbons obtained by distillation of catalytic cracking heavy tars. It consists predominantly of highly alkylated aromatic hydrocarbons boiling in the range of approximately 100 °C to 250 °C (212 °F to 482 °F).] | Párlatok
(ásványolaj), katalitikusan krakkolt nehéz kátrány, könnyű; Krakkolt kerozin; [Katalitikusan krakkolt nehéz kátrányok desztillációjával nyert összetett szénhidrogénkeverék. Főként többszörösen alkilezett aromás szénhidrogénekből áll, melyek hozzávetőleges forráspont-tartománya 100 oC-250 oC (212 oF-482 oF). |
309-938-8 | 101631-13-4 | Asp.
Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
CLP00 | |||
| 649-417-00-5 | Solvent naphtha (petroleum), hydrocracked heavy arom.; Cracked kerosine; [A complex combination of hydrocarbons obtained by the distillation of hydrocracked petroleum distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C9 through C16 and boiling in the range of approximately 235 °C to 290 °C (455 °F to 554 °F).] | Szolvens
nafta (ásványolaj), hidrogénezéssel krakkolt nehéz aromás; Krakkolt
kerozin; [Hidrokrakkolt ásványolaj desztillációjával nyert összetett szénhidrogénkeverék. Főként C9-C16 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 235 oC-290 oC (455 oF-554 oF). |
309-881-9 | 101316-80-7 | Asp.
Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
CLP00 | |||
| 649-418-00-0 | Distillates (petroleum), steam-cracked heavy tar light; Cracked kerosine; [A complex combination of hydrocarbons obtained by distillation of steam cracking heavy tars. It consists predominantly of highly alkylated aromatic hydrocarbons boiling in the range of approximately 100 °C to 250 °C (212 °F to 482 °F).] | Párlatok
(ásványolaj), gőzzel krakkolt nehéz kátrány, könnyű; Krakkolt kerozin; [Gőzkrakkolt nehéz kátrányok desztillációjával nyert összetett szénhidrogénkeverék. Főként többszörösen alkilezett aromás szénhidrogénekből áll, melyek hozzávetőleges forráspont-tartománya 100 oC-250 oC (212 oF-482 oF). |
309-940-9 | 101631-15-6 | Asp.
Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
CLP00 | |||
| 649-419-00-6 | Distillates (petroleum), alkylate; Kerosine - unspecified; [A complex combination of hydrocarbons produced by distillation of the reaction products of isobutane with monoolefinic hydrocarbons usually ranging in carbon numbers from C3 through C5. It consists of predominantly branched chain saturated hydro-carbons having carbon numbers predominantly in the range of C11 through C17 and boiling in the range of approximately 205 °C to 320 °C (401 °F to 608 °F).] | Párlatok
(ásványolaj), alkilát; Kerozin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet izobután és általában C3-C5 szénatomszámú monoolefin-szénhidrogének reakciójának termékeiből desztillálással nyernek. Főként C11-C17 szénatomszámú elágazó láncú telített szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 205 oC-320 oC (401 oF-608 oF). |
265-074-0 | 64741-73-7 | Asp.
Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
CLP00 | |||
| 649-420-00-1 | Extracts (petroleum), heavy naphtha solvent; Kerosine - unspecified; [A complex combination of hydrocarbons obtained as the extract from a solvent extraction process. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C7 through C12 and boiling in the range of approximately 90 °C to 220 °C (194 °F to 428 °F).] | Extraktumok
(ásványolaj), nehéz nafta oldószer; Kerozin – nem meghatározott; [Oldószeres extrahálási folyamatból extraktumként kapott, összetett szénhidrogénkeverék. Főként C7-C12 szénatomszámú aromás szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 90 oC-220 oC (194 oF-428 oF). |
265-099-7 | 64741-98-6 | Asp.
Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
CLP00 | |||
| 649-421-00-7 | Distillates (petroleum), chemically neutralized light; Kerosine - unspecified; [A complex combination of hydrocarbons produced by a treating process to remove acidic materials. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C16 and boiling in the range of approximately 150 °C to 290 °C (302 °F to 554 °F).] | Párlatok
(ásványolaj), kémiailag közömbösített könnyű; Kerozin – nem
meghatározott; [A savas maradék eltávolítása érdekében végzett kezelés eredményeképpen nyert összetett szénhidrogénkeverék. Főként C9-C16 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 150 oC-290 oC (302 oF-554 oF).] |
265-132-5 | 64742-31-0 | Asp.
Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
CLP00 | |||
| 649-422-00-2 | Distillates (petroleum), hydrotreated light; Kerosine - unspecified; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C16 and boiling in the range of approximately 150 °C to 290 °C (302 °F to 554 °F).] | Párlatok
(ásványolaj), hidrogénnel kezelt könnyűpárlat; Kerozin – nem meghatározott; [Ásványolaj frakció katalitikus hidrogénezésével nyert összetett szénhidrogénkeverék. Főként C9-C16 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 150 oC-290 oC (302 oF-554 oF).] |
265-149-8 | 64742-47-8 | Asp.
Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
CLP00 | |||
| 649-423-00-8 | Kerosine (petroleum), hydrodesulfurized; Kerosine - unspecified; [A complex combination of hydrocarbons obtained from a petroleum stock by treating with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C16 and boiling in the range of approximately 150 °C to 290 °C (302 °F to 554 °F).] | Kerozin
(ásványolaj), hidrogénezéssel kénmentesített; Kerozin – nem
meghatározott; [Ásványolaj párlatból nyert összetett szénhidrogénkeverék, melyet a szerves kén hidrogén-szulfiddá alakítása céljából katalizátor jelenlétében hidrogéneznek, és a hidrogén-szulfidot eltávolítják. Főként C9-C16 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 150 oC-290 oC (302 oF-554 oF).] |
265-184-9 | 64742-81-0 | Asp.
Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
CLP00 | |||
| 649-424-00-3 | Solvent naphtha (petroleum), heavy arom.; Kerosine - unspecified; [A complex combination of hydrocarbons obtained from distillation of aromatic streams. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C9 through C16 and boiling in the range of approximately 165 °C to 290 °C (330 °F to 554 °F).] | Oldószer
benzin (ásványolaj), nehéz arom.; Kerozin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet aromás elegyek desztillációjával nyernek. Főként C9-C16 szénatomszámú alifás szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 165 oC-290 oC (330 oF-554 oF). |
265-198-5 | 64742-94-5 | Asp.
Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
CLP00 | |||
| 649-425-00-9 | Naphtha (petroleum), heavy coker; Kerosine - unspecified; [A complex combination of hydrocarbons from the distillation of products from a fluid coker. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly in the range of C6 through C15 and boiling in the range of approximately 157 °C to 288 °C (315 °F to 550 °F).] | Nafta
(ásványolaj), nehéz koksz; Kerozin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet folyékony kokszoló termékeinek desztillációjával nyernek. Főként C6-C15 szénatomszámú telítetlen szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 157 oC-288 oC (315 oF-550 oF). |
269-778-9 | 68333-23-3 | Asp.
Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
CLP00 | |||
| 649-426-00-4 | Naphtha (petroleum), catalytic reformed hydrodesulfurized heavy, arom. fraction; Kerosine - unspecified; [A complex combination of hydrocarbons produced by fractionation from catalytically reformed hydrodesulfurized naphtha. It consists predominantly of aromatic hydrocarbons having carbon numbers predominently in the range of C7 to C 13 and boiling in the range of approximately 98 °C to 218 °C (208 °F to 424 °F).] | Nafta
(ásványolaj), katalitikusan reformált, hidrogénezéssel kénmentesített nehéz,
aromás frakció; Kerozin – nem meghatározott; [Katalitikusan reformált, hidrogénezéssel kénmentesített nafta frakcionált desztillációjával kapott összetett szénhidrogénkeverék. Főként C7-C13 szénatomszámú alifás szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 98 oC-218 oC (208 oF-424 oF). |
285-508-2 | 85116-57-0 | Asp.
Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
CLP00 | |||
| 649-427-00-X | Kerosine (petroleum), sweetened; Kerosine - unspecified; [A complex combination of hydrocarbons obtained by subjecting a petroleum distillate to a sweetening process to convert mercaptans or to remove acidic impurities. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C9 through C16 and boiling in the range of 130 °C to 290 °C (266 °F to 554 °F).] | Kerozin
(ásványolaj), kénmentesített; Kerozin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet úgy állítanak elő, hogy ásványolaj desztillátumot kéntelenítési eljárásnak vetnek alá a merkaptánok konvertálása vagy a savas szennyeződések eltávolítása céljából. Főként C9-C16 szénatomszámú szénhidrogénekből áll, forráspont-tartománya: 130 oC-290 oC (266 oF-554 oF). |
294-799-5 | 91770-15-9 | Asp.
Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
CLP00 | |||
| 649-428-00-5 | Kerosine (petroleum), solvent-refined sweetened; Kerosine - unspecified; [A complex combination of hydrocarbons obtained from a petroleum stock by solvent refining and sweetening and boiling in the range of approximately 150 °C to 260 °C (302 °F to 500 °F).] | Kerozin
(ásványolaj), oldószerrel finomított, kénmentesített; Kerozin – nem meghatározott; [Ásványolaj párlat kéntelenítése és oldószerrel végzett finomítása útján nyert összetett szénhidrogénkeverék, melynek hozzávetőleges forráspont-tartománya: 150 oC-260 oC (302 oF-500 oF).] |
295-416-4 | 92045-36-8 | Asp.
Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
CLP00 | |||
| 649-429-00-0 | Hydrocarbons, C9-16, hydrotreated, dearomatized; Kerosine - unspecified; [A complex combination of hydrocarbons obtained as solvents which have been subjected to hydrotreatment in order to convert aromatics to naphthenes by catalytic hydrogenation.] | Szénhidrogének,
C9-16, hidrogénnel kezelt, aromásoktól mentesített; Kerozin – nem meghatározott; [Szénhidrogének összetett keveréke, az aromások nafténné konvertálása céljából végzett katalitikus hidrogénezés útján nyert oldószerek.] |
297-854-1 | 93763-35-0 | Asp.
Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
CLP00 | |||
| 649-430-00-6 | Kerosine (petroleum), solvent-refined hydrodesulfurized; Kerosine - unspecified | Kerozin (ásványolaj), oldószerrel finomított, hidrogénnel kénmentesített; Kerozin – nem meghatározott | 307-033-2 | 97488-94-3 | Asp.
Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
CLP00 | |||
| 649-431-00-1 | Distillates (petroleum), hydrodesulfurized full-range middle coker; Kerosine - unspecified; [A complex combination of hydrocarbons obtained by fractionation from hydrodesulfurized coker distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C8 through C16 and boiling in the range of approximately 120 °C to 283 °C (248 °F to 541 °F).] | Párlatok
(ásványolaj), hidrogénnel kénmentesített, teljes sorozat közép koksz; Kerozin – nem meghatározott; [Szénhidrogének összetett keveréke, melyet hidrogénnel kéntelenített kokszoló desztillátum frakcionálásával nyernek. Főként C8-C16 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 120 oC-283 oC (248 oF-541 oF). |
309-864-6 | 101316-58-9 | Asp.
Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
CLP00 | |||
| 649-432-00-7 | Solvent naphtha (petroleum), hydrodesulfurized heavy arom.; Kerosine - unspecified; [A complex combination of hydrocarbons obtained by the catalytic hydrodesulfurization of a petroleum fraction. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C10 through C13 and boiling in the range of approximately 180 °C to 240 °C (356 °F to 464 °F).] | Szolvens
nafta (ásványolaj), hidrogénnel kénmentesített, nehéz aromás; Kerozin –
nem meghatározott; [Ásványolaj frakció katalitikus hidrogénezéssel kénmentesített termékeként nyert összetett szénhidrogénkeverék. Főként C10-C13 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 180 oC-240 oC (356 oF-464 oF). |
309-882-4 | 101316-81-8 | Asp.
Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
CLP00 | |||
| 649-433-00-2 | Solvent naphtha (petroleum), hydrodesulfurized medium; Kerosine - unspecified; [A complex combination of hydrocarbons obtained by the catalytic hydrodesulfurization of a petroleum fraction. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C10 through C13 and boiling in the range of approximately 175 °C to 220 °C (347 °F to 428 °F).] | Szolvens
nafta (ásványolaj), hidrogénnel kénmentesített közép; Kerozin – nem
meghatározott; [Ásványolaj frakció katalitikus hidrogénezéssel kénmentesített termékeként nyert összetett szénhidrogénkeverék. Főként C10-C13 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 175 oC-220 oC (347 oF-428 oF). |
309-884-5 | 101316-82-9 | Asp.
Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
CLP00 | |||
| 649-434-00-8 | Kerosine (petroleum), hydrotreated; Kerosine - unspecified; [A complex combination of hydrocarbons obtained from the distillation of petroleum and subsequent hydrotreatment. It consists predominantly of alkanes, cycloalkanes and alkylbenzenes having carbon numbers predominantly in the range of C12 through C16 and boiling in the range of approximately 230 °C to 270 °C (446 °F to 518 °F).] | Kerozin
(ásványolaj), hidrogénnel kezelt; Kerozin – nem meghatározott; [Ásványolaj desztillátum hidrogénezett termékeként nyert összetett szénhidrogénkeverék. Főként C12-C16 szénatomszámú alifás alkánokból, cikloalkánokból és alkilbenzolokból áll, hozzávetőleges forráspont-tartománya: 230 oC-270 oC (446 oF-518 oF). |
309-944-0 | 101631-19-0 | Asp.
Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
CLP00 | |||
| 649-435-00-3 | Distillates (petroleum), light catalytic cracked; Cracked gasoil; [A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C25 and boiling in the range of approximately 150 °C to 400 °C (302 °F to 752 °F). It contains a relatively large proportion of bicyclic aromatic hydrocarbons.] | Párlatok
(ásványolaj), katalitikusan krakkolt könnyű; Krakkolt gázolaj; [Szénhidrogének összetett keveréke, melyet katalitikus krakkolási folyamat termékeinek desztillációjával nyernek. Főként C9-C25 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 150 oC-400 oC (302 oF-752 oF). Viszonylag nagy arányban tartalmaz biciklikus aromás szénhidrogéneket is.] |
265-060-4 | 64741-59-9 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-436-00-9 | Distillates (petroleum), intermediate catalytic cracked; Cracked gasoil; [A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C11 through C30 and boiling in the range of approximately 205 °C to 450 °C (401 °F to 842 °F). It contains a relatively large proportion of tricyclic aromatic hydrocarbons.] | Párlatok
(ásványolaj) közepes katalitikus krakkolás; Krakkolt gázolaj; [Szénhidrogének összetett keveréke, melyet katalitikus krakkolási folyamat termékeinek desztillációjával nyernek. Főként C11-C30 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 205 oC-450 oC (401 oF-842 oF). Viszonylag nagy arányban tartalmaz triciklusos aromás szénhidrogéneket.] |
265-062-5 | 64741-60-2 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-437-00-4 | Distillates (petroleum), light hydrocracked; Cracked gasoil; [A complex combination of hydrocarbons from distillation of the products from a hydrocracking process. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C10 through C18 and boiling in the range of approximately 160 °C to 320 °C (320 °F to 608 °F).] | Párlatok
(ásványolaj), könnyű, hidrogénnel krakkolt; Krakkolt gázolaj; [Szénhidrogének összetett keveréke, melyet hidrokrakkolási eljárásból származó termékek desztillációjával nyernek. Főként C10-C18 szénatomszámú telítetlen szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 160 oC-320 oC (320 oF-608 oF). |
265-078-2 | 64741-77-1 | Carc.
2 |
H351 |
GHS08 Wng |
H351 |
CLP00 | |||
| 649-438-00-X | Distillates (petroleum), light thermal cracked; Cracked gasoil; [A complex combination of hydrocarbons from the distillation of the products from a thermal cracking process. It consists predominantly of unsaturated hydrocarbons having carbon numbers predominantly in the range of C10 through C22 and boiling in the range of approximately 160 °C to 370 °C (320 °F to 698 °F).] | Párlatok
(ásványolaj), termikusan krakkolt könnyű; Krakkolt gázolaj; [Termikus krakkolási folyamat eredményeként kapott termékek desztillálásának eredményeként nyert összetett szénhidrogénkeverék. Főként C10-C22 szénatomszámú telítetlen szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 160 oC-370 oC (320 oF-698 oF). |
265-084-5 | 64741-82-8 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-439-00-5 | Distillates (petroleum), hydrodesulfurized light catalytic cracked; Cracked gasoil; [A complex combination of hydrocarbons obtained by treating light catalytic cracked distillates with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C25 and boiling in the range of approximately 150 °C to 400 °C (302 °F to 752 °F). It contains a relatively large proportion of bicyclic aromatic hydrocarbons.] | Párlatok
(ásványolaj), hidrogénezéssel kéntelenített könnyű katalitikusan
krakkolt; Krakkolt gázolaj; [Könnyű katalitikus krakkolási párlatok hidrogénezésével nyert összetett szénhidrogénkeverék; a hidrogénezés célja a szerves kénvegyületek hidrogén-szulfiddá alakítása, majd eltávolítása. Főként C9-C25 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 150 oC-400 oC (302 oF-752 oF). Viszonylag nagy arányban tartalmaz biciklikus aromás szénhidrogéneket is.] |
269-781-5 | 68333-25-5 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-440-00-0 | Distillates (petroleum), light steam-cracked naphtha; Cracked gasoil; [A complex combination of hydrocarbons from the multiple distillation of products from a steam cracking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C10 through C18.] | Párlatok
(ásványolaj), gőzzel krakkolt könnyű nafta; Krakkolt gázolaj; [Gőzzel végzett krakkolás termékeinek többszörös desztillációjával előállított összetett szénhidrogénkeverék. Főként C10-C18 szénatomszámú szénhidrogénekből áll.] |
270-662-5 | 68475-80-9 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-441-00-6 | Distillates (petroleum), cracked steam-cracked petroleum distillates; Cracked gasoil; [A complex combination of hydrocarbons produced by distilling cracked steam cracked distillate and/or its fractionation products. It consists of hydrocarbons having carbon numbers predominently in the range of C10 to low molecular weight polymers.] | Párlatok
(ásványolaj), krakkolt gőzzel krakkolt ásványolaj párlatok; Krakkolt gázolaj; [Krakkolt és gőzzel krakkolt párlatok és/vagy azok frakcionálási termékeinek desztillációjával előállított összetett szénhidrogénkeverék. Főként C10-től kis mólsúlyú polimerekig terjedő szénatomszámú szénhidrogénekből áll.] |
270-727-8 | 68477-38-3 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-442-00-1 | Gas oils (petroleum), steam-cracked; Cracked gasoil; [A complex combination of hydrocarbons produced by distillation of the products from a steam cracking process. It consists of hydrocarbons having carbon numbers predominantly greater than C9 and boiling in the range of from approximately 205 °C to 400 °C (400 °F to 752 °F).] | Gázolajok
(ásványolaj), gőzzel krakkolt; Krakkolt gázolaj; [Gőzkrakkolás termékeinek desztillációjával előállított összetett szénhidrogénkeverék. Főként C9-nél nagyobb szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 205 oC-400 oC (400 oF-752 oF).] |
271-260-2 | 68527-18-4 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-443-00-7 | Distillates (petroleum), hydrodesulfurized thermal cracked middle; Cracked gasoil; [A complex combination of hydrocarbons obtained by fractionation from hydrodesulfurized themal cracker distillate stocks. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C11 to C25 and boiling in the range of approximately 205 °C to 400 °C (401 °F to 752 °F).] | Párlatok
(ásványolaj), hidrogénnel kéntelenített, termikusan krakkolt közép; Krakkolt gázolaj; [Szénhidrogének összetett keveréke, melyet hidrogénnel kéntelenített termikus krakkoló desztillátum frakciók frakcionálásával nyernek. Főként C11–C25 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 205 oC-400 oC (401 oF to 752 oF).] |
285-505-6 | 85116-53-6 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-444-00-2 | Gas oils (petroleum), thermal-cracked, hydrodesulfurized; Cracked gasoil | Gázolajok (ásványolaj), termikusan krakkolt, hidrogénnel kéntelenített; Krakkolt gázolaj | 295-411-7 | 92045-29-9 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-445-00-8 | Residues (petroleum), hydrogenated steam-cracked naphtha; Cracked gasoil; [A complex combination of hydrocarbons obtained as a residual fraction from the distillation of hydrotreated steam-cracked naphtha. It consists predominantly of hydrocarbons boiling in the range of approximately 200 °C to 350 °C (32 °F to 662 °F).] | Maradékok
(ásványolaj), hidrogénezett, gőzzel krakkolt nafta; Krakkolt gázolaj; [Hidrogénnel kezelt, gőzzel krakkolt nafta maradék frakciójaként kapott összetett szénhidrogénkeverék. Főként olyan szénhidrogénekből áll, melyek hozzávetőleges forráspont-tartománya 200 oC-350 oC (32 oF-662 oF). |
295-514-7 | 92062-00-5 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-446-00-3 | Residues (petroleum), steam-cracked naphtha distn.; Cracked gasoil; [A complex combination of hydrocarbons obtained as a column bottom from the separation of effluents from steam cracking naphtha at a high temperature. It boils in the range of approximately 147 °C to 300 °C (297 °F to 572 °F) and produces a finished oil having a viscosity of 18cSt at 50 °C.] | Maradékok
(ásványolaj); gőzzel krakkolt nafta deszt.; Krakkolt gázolaj; [Nafta magas hőmérsékletű gőzzel végzett krakkolási termékeinek elválasztása során fenéktermékként kapott, összetett szénhidrogénkeverék. Hozzávetőleges forráspont-tartománya: 147 oC-300 oC (297 oF-572 oF), a végtermék olaj viszkozitása18 cSt 50 oC-on.] |
295-517-3 | 92062-04-9 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-447-00-9 | Distillates (petroleum), light catalytic cracked, thermally degraded; Cracked gasoil; [A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking process which has been used as a heat transfer fluid. It consists predominantly of hydrocarbons boiling in the range of approximately 190 °C to 340 °C (374 °F to 644 °F). This stream is likely to contain organic sulfur compounds.] | Párlatok
(ásványolaj), katalitikusan krakkolt könnyű, termikusan degradált; Krakkolt gázolaj; [Szénhidrogének összetett keveréke, melyet katalitikus krakkolási folyamat termékeinek desztillációjával nyernek és hőátadó közegként használatos. Főként olyan szénhidrogénekből áll, melyek hozzávetőleges forráspont-tartománya 190 oC-340 oC (374 oF-644 oF). Ez a származék szerves kénvegyületeket is tartalmazhat.] |
295-991-1 | 92201-60-0 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-448-00-4 | Residues (petroleum), steam-cracked heat-soaked naphtha; Cracked gasoil; [A complex combination of hydrocarbons obtained as residue from the distillation of steam cracked heat soaked naphtha and boiling in the range of approximately 150 °C to 350 °C (302 °F to 662 °F).] | Maradékok
(ásványolaj), gőzzel krakkolt, melegen szikkasztott nafta; Krakkolt
gázolaj; [Melegen szikkasztott gőzzel krakkolt nafta desztillációja maradékaként kapott összetett szénhidrogénkeverék, melynek hozzávetőleges forráspont-tartománya: 150 oC-350 oC (302 oF-662 oF).] |
297-905-8 | 93763-85-0 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-449-00-X | Hydrocarbons, C16-20, solvent-dewaxed hydrocracked paraffinic distn. residue; Cracked gasoil; [A complex combination of hydrocarbons obtained by solvent dewaxing of a distillation residue from a hydrocracked paraffinic distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C16 through C20 and boiling in the range of approximately 360 °C to 500 °C (680 °F to 932 °F). It produces a finished oil having a viscosity of 4,5 cSt at approximately 100 °C (212 °F).] | Szénhidrogének,
C16-20, oldószerrel viaszmentesített, hidrokrakkolt paraffin deszt.
maradék; Krakkolt gázolaj; [Hidrogénnel krakkolt paraffin desztillátum desztillálási maradékának oldószerrel viaszmentesített termékeként nyert összetett szénhidrogénkeverék. Főként C16-C20 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 360 oC-500 oC (680 oF-932 oF). A végtermék olaj viszkozitása 4,5 cSt kb. 100 oC-on (212 oF-on).] |
307-662-2 | 97675-88-2 | Carc.
2 |
H351 |
GHS08 Wng |
H351 |
CLP00 | |||
| 649-450-00-5 | Gas oils (petroleum), light vacuum, thermal-cracked hydrodesulfurized; Cracked gasoil; [A complex combination of hydrocarbons obtained by catalytic dehydrosulfurization of thermal-cracked light vacuum petroleum. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C14 through C20 and boiling in the range of approximately 270 °C to 370 °C (518 °F to 698 °F).] | Gázolajok
(ásványolaj), vákuum könnyű, termikusan krakkolt, hidrogénnel kéntelenített;
Krakkolt gázolaj; Krakkolt gázolaj; [Termikusan krakkolt könnyű vákuum ásványolaj frakció katalitikus hidrogénes kéntelenítésével kapott összetett szénhidrogénkeverék. Főként C14-C20 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 270 oC-370 oC (518 oF-698 oF). |
308-278-8 | 97926-59-5 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-451-00-0 | Distillates (petroleum), hydrodesulfurized middle coker; Cracked gasoil; [A complex combination of hydrocarbons by fractionation from hydrodesulfurised coker distillate stocks. Is consists of hydro-carbons having carbon numbers predominantly in the range of C12 through C21 and boiling in the range of approximately 200 °C to 360 °C (392 °F to 680 °F).] | Párlatok
(ásványolaj), hidrogénnel kéntelenített közép kokszoló; Krakkolt
gázolaj; [Hidrogénnel kéntelenített kokszoló párlat frakcionált desztillációjával előállított összetett szénhidrogénkeverék. Főként C12-C21 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 200 oC-360 oC (392 oF-680 oF). |
309-865-1 | 101316-59-0 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-452-00-6 | Distillates (petroleum), heavy steam-cracked; Cracked gasoil; [A complex combination of hydrocarbons obtained by distillation of steam cracking heavy residues. It consists predominantly of highly alkylated heavy aromatic hydrocarbons boiling in the range of approximately 250 °C to 400 °C (482 °F to 752 °F).] | Párlatok
(ásványolaj), gőzzel krakkolt nehéz; Krakkolt gázolaj; [Nehéz maradékok gőzzel történő krakkolási termékeinek desztillációjával kapott, összetett szénhidrogénkeverék. Főként többszörösen alkilezett nehéz aromás szénhidrogénekből áll, melyek hozzávetőleges forráspont-tartománya 250 oC-400 oC (482 oF-752 oF). |
309-939-3 | 101631-14-5 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
CLP00 | |||
| 649-453-00-1 | Distillates (petroleum), heavy hydrocracked; Baseoil - unspecified; [A complex combination of hydrocarbons from the distillation of the products from a hydrocracking process. It consists predominantly of saturated hydrocarbons having carbon numbers in the range of C15-C39 and boiling in the range of approximately 260 °C to 600 °C (500 °F to 1112 °F).] | Párlatok
(ásványolaj), hidrogénnel krakkolt nehéz; Alapolaj – nem meghatározott; [Hidrogénes krakkolás termékeinek desztillációjával kapott, összetett szénhidrogénkeverék. Főként C15-C39 szénatomszámú telítetlen szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 260 oC-600 oC (500 oF-1112 oF). |
265-077-7 | 64741-76-0 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-454-00-7 | Distillates (petroleum), solvent-refined heavy paraffinic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of at least 100 SUS at 100 °F (19cSt at 40 °C).] | Párlatok
(ásványolaj), oldószerrel finomított nehéz paraffinos; Alapolaj – nem meghatározott; [Oldószeres extrahálásból raffinátumként kapott, összetett szénhidrogénkeverék. Főként C20-C50 szénatomszámú telített szénhidrogénekből áll, és végtermék olajként viszkozitása eléri vagy meghaladja a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). |
265-090-8 | 64741-88-4 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-455-00-2 | Distillates (petroleum), solvent-refined light paraffinic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100 °F (19cSt at 40 °C).] | Párlatok
(ásványolaj), oldószerrel finomított könnyű paraffinos; Alapolaj – nem meghatározott; [Oldószeres extrahálásból raffinátumként kapott, összetett szénhidrogénkeverék. Főként C15-C30 szénatomszámú telített szénhidrogénekből áll, és végtermék olajként viszkozitása nem éri el a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). |
265-091-3 | 64741-89-5 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-456-00-8 | Residual oils (petroleum), solvent deasphalted; Baseoil - unspecified; [A complex combination of hydrocarbons obtained as the solvent soluble fraction from C3-C4 solvent deasphalting of a residuum. It consists of hydrocarbons having carbon numbers predominantly higher than C25 and boiling above approximately 400 °C (752 °F).] | Maradék
olajok (ásványolaj), oldószerrel aszfaltmentesített; Alapolaj – nem meghatározott; [Lepárlási maradékokból oldószeres aszfaltmentesítés során C3-C4 oldószerrel kioldható frakcióként kapott, összetett szénhidrogénkeverék. Főként C25-nél nagyobb szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 400 oC (752 oF) fölött van. |
265-096-0 | 64741-95-3 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-457-00-3 | Distillates (petroleum), solvent-refined heavy naphthenic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of at least 100 SUS at 100 °F (19cSt a 40 °C). It contains relatively few normal paraffins.] | Párlatok
(ásványolaj), oldószerrel finomított nehéz nafténbázisú; Alapolaj – nem
meghatározott; [Oldószeres extrahálásból raffinátumként kapott, összetett szénhidrogénkeverék. Főként C20-C50 szénatomszámú szénhidrogénekből áll, és végtermék olajként viszkozitása eléri vagy meghaladja a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). Viszonylag kevés normál paraffint tartalmaz.] |
265-097-6 | 64741-96-4 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-458-00-9 | Distillates (petroleum), solvent-refined light naphthenic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained as the raffinate from a solvent extraction process. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100 °F (19cSt at 40 °C). It contains relatively few normal paraffins.] | Párlatok
(ásványolaj), oldószerrel finomított könnyű nafténbázisú; Alapolaj – nem meghatározott; [Oldószeres extrahálásból raffinátumként kapott, összetett szénhidrogénkeverék. Főként C15-C30 szénatomszámú szénhidrogénekből áll, és végtermék olajként viszkozitása nem éri el a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). Viszonylag kevés normál paraffint tartalmaz.] |
265-098-1 | 64741-97-5 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-459-00-4 | Residual oils (petroleum,) solvent-refined; Baseoil - unspecified; [A complex combination by hydrocarbons obtained as the solvent insoluble fraction from solvent refining of a residuum using a polar organic solvent such as phenol or furfural. It consists of hydrocarbons having carbon numbers predominantly higher than C25 and boiling above approximately 400 °C (752 °F).] | maradék
olajok (ásványolaj), oldószerrel finomított; Alapolaj – nem meghatározott; [Lepárlási maradékokból oldószeres finomítás során poláros oldószerrel (például fenollal vagy furfurollal) nem oldható frakcióként kapott, összetett szénhidrogénkeverék. Főként C25-nál nagyobb szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 400 oC (752 oF) fölött van. |
265-101-6 | 64742-01-4 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-460-00-X | Distillates (petroleum), clay-treated paraffinic; Baseoil - unspecified; [A complex combination of hydrocarbons resulting from treatment of a petroleum fraction with natural or modified clay in either a contacting or percolation process to remove the trace amounts of polar compounds and impurities present. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of at least 100 SUS at 100 °F (19cSt at 40 °C). It contains a relatively large proportion of saturated hydrocarbons.] | Párlatok
(ásványolaj), agyaggal kezelt paraffinbázisú; Alapolaj – nem meghatározott; [Ásványolaj frakciónak – a nyomnyi mennyiségű poláros vegyületek és a szennyezések eltávolítása érdekében – érintkezéses módszerrel vagy perkolálással, természetes vagy módosított agyaggal történő kezelésével kapott, összetett szénhidrogénkeverék. Főként C20-C50 szénatomszámú szénhidrogénekből áll, és végtermék olajként viszkozitása eléri vagy meghaladja a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). Viszonylag nagy arányban tartalmaz telített szénhidrogéneket is.] |
265-137-2 | 64742-36-5 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-461-00-5 | Distillates (petroleum), clay-treated light paraffinic; Baseoil - unspecified; [A complex combination of hydrocarbons resulting from treatment of a petroleum fraction with natural or modified clay in either a contacting or percolation process to remove the trace amounts of polar compounds and impurities present. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100 °F (19cSt at 40 °C). It contains a relatively large proportion of saturated hydrocarbons.] | Párlatok
(ásványolaj), agyaggal kezelt könnyű paraffinbázisú; Alapolaj – nem meghatározott; [Ásványolaj frakciónak – a nyomnyi mennyiségű poláros vegyületek és a szennyezések eltávolítása érdekében – érintkezéses módszerrel vagy perkolálással, természetes vagy módosított agyaggal történő kezelésével kapott, összetett szénhidrogénkeverék. Főként C15-C30 szénatomszámú szénhidrogénekből áll, és végtermék olajként viszkozitása nem éri el a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). Viszonylag nagy arányban tartalmaz telített szénhidrogéneket is.] |
265-138-8 | 64742-37-6 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-462-00-0 | Residual oils (petroleum), clay-treated; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treatment of a residual oil with a natural or modified clay in either a contacting or percolation process to remove the trace amounts of polar compounds and impurities present. It consists of hydro-carbons having carbon numbers predominantly higher than C25 and boiling above approximately 400 °C (752 °F).] | maradék
olajok (ásványolaj), agyaggal kezelt; Alapolaj – nem meghatározott; [Maradék olajnak – a nyomnyi mennyiségű poláros vegyületek és a szennyezések eltávolítása érdekében – érintkezéses módszerrel vagy perkolálással, természetes vagy módosított agyaggal történő kezelésével kapott összetett szénhidrogénkeverék. Főként C25-nél nagyobb szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 400 oC (752 oF) fölött van. |
265-143-5 | 64742-41-2 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-463-00-6 | Distillates (petroleum), clay-treated heavy naphthenic; Baseoil - unspecified; [A complex combination of hydrocarbons resulting from treatment of a petroleum fraction with natural or modified clay in either a contacting or percolation process to remove the trace amounts of polar compounds and impurities present. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of at least 100 SUS at 100 °F (19cSt at 40 °C). It contains relatively few normal paraffins.] | Párlatok (ásványolaj), agyaggal kezelt nehéz nafténbázisú; Alapolaj – nem meghatározott; [Ásványolaj frakciónak – a nyomnyi mennyiségű poláros vegyületek és a szennyezések eltávolítása érdekében – érintkezéses módszerrel vagy perkolálással, természetes vagy módosított agyaggal történő kezelésével kapott, összetett szénhidrogénkeverék. Főként C20-C50 szénatomszámú szénhidrogénekből áll, és végtermék olajként viszkozitása eléri vagy meghaladja a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). Viszonylag kevés normál paraffint tartalmaz.] | 265-146-1 | 64742-44-5 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-464-00-1 | Distillates (petroleum), clay-treated light naphthenic; Baseoil - unspecified; [A complex combination of hydrocarbons resulting from treatment of a petroleum fraction with natural or modified clay in either a contacting or percolation process to remove the trace amounts of polar compounds and impurities present. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100 °F (19cSt at 40 °C). It contains relatively few normal paraffins.] | Párlatok
(ásványolaj), agyaggal kezelt könnyű nafténbázisú; Alapolaj – nem meghatározott; [Ásványolaj frakciónak – a nyomnyi mennyiségű poláros vegyületek és a szennyezések eltávolítása érdekében – érintkezéses módszerrel vagy perkolálással, természetes vagy módosított agyaggal történő kezelésével kapott, összetett szénhidrogénkeverék. Főként C15-C30 szénatomszámú szénhidrogénekből áll, és végtermék olajként viszkozitása nem éri el a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). Viszonylag kevés normál paraffint tartalmaz.] |
265-147-7 | 64742-45-6 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-465-00-7 | Distillates (petroleum), hydrotreated heavy naphthenic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil of at least 100 SUS at 100 °F (19cSt at 40 °C). It contains relatively few normal paraffins.] | Párlatok
(ásványolaj), hidrogénnel kezelt nehéz nafténbázisú; Alapolaj – nem
meghatározott; [Ásványolaj frakció katalitikus hidrogénezésével nyert összetett szénhidrogénkeverék. Főként C20-C50 szénatomszámú szénhidrogénekből áll, és végtermék olajként viszkozitása eléri vagy meghaladja a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). Viszonylag kevés normál paraffint tartalmaz.] |
265-155-0 | 64742-52-5 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-466-00-2 | Distillates (petroleum), hydrotreated light naphthenic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100 °F (19cSt at 40 °C). It contains relatively few normal paraffins.] | Párlatok
(ásványolaj), hidrogénnel kezelt könnyű nafténbázisú; Alapolaj – nem
meghatározott; [Ásványolaj frakció katalitikus hidrogénezésével nyert összetett szénhidrogénkeverék. Főként C15-C30 szénatomszámú szénhidrogénekből áll, és végtermék olajként viszkozitása nem éri el a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). Viszonylag kevés normál paraffint tartalmaz.] |
265-156-6 | 64742-53-6 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-467-00-8 | Distillates (petroleum), hydrotreated heavy paraffinic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil of at least 100 SUS at 100 °F (19cSt at 40 °C). It contains a relatively large proportion of saturated hydrocarbons.] | Párlatok
(ásványolaj), hidrogénnel kezelt nehéz paraffinos; Alapolaj – nem
meghatározott; [Ásványolaj frakció katalitikus hidrogénezésével nyert összetett szénhidrogénkeverék. Túlnyomórészt C20-C50 szénatomszámú szénhidrogénekből áll, és végtermék olajként viszkozitása eléri vagy meghaladja a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). Viszonylag nagy arányban tartalmaz telített szénhidrogéneket is.] |
265-157-1 | 64742-54-7 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-468-00-3 | Distillates (petroleum), hydrotreated light paraffinic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100 °F (19cSt at 40 °C). It contains a relatively large proportion of saturated hydrocarbons.] | Párlatok
(ásványolaj), hidrogénnel kezelt könnyű paraffinos; Alapolaj – nem
meghatározott; [Ásványolaj frakció katalitikus hidrogénezésével nyert összetett szénhidrogénkeverék. Túlnyomórészt C15-C30 szénatomszámú szénhidrogénekből áll, és végtermék olajként viszkozitása nem éri el a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). Viszonylag nagy arányban tartalmaz telített szénhidrogéneket is.] |
265-158-7 | 64742-55-8 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-469-00-9 | Distillates (petroleum), solvent-dewaxed light paraffinic; Baseoil - unspecified; [A complex comination of hydrocarbons obtained by removal of normal paraffins from a petroleum fraction by solvent crystallization. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100 °F (19cSt at 40 °C).] | Párlatok
(ásványolaj), oldószerrel viasztalanított könnyű paraffinos; Alapolaj – nem meghatározott; [Összetett szénhidrogénkeverék, melynek előállításához oldószeres kristályosítással kivonják a normál paraffinokat az ásványolaj-frakcióból. Főként C15-C30 szénatomszámú szénhidrogénekből áll, és végtermék olajként viszkozitása nem éri el a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). |
265-159-2 | 64742-56-9 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-470-00-4 | Residual oils (petroleum), hydrotreated; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst. It consists of hydrocarbons having carbon numbers predominantly greater than C25 and boiling above approximately 400 °C (752 °F).] | Maradék
olajok (ásványolaj), hidrogénnel kezelt; Alapolaj – nem meghatározott; [Ásványolaj frakció katalitikus hidrogénezésével nyert összetett szénhidrogénkeverék. Főként C25-nál nagyobb szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 400 oC (752 oF) fölött van. |
265-160-8 | 64742-57-0 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-471-00-X | Residual oils (petroleum), solvent-dewaxed; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by removal of long, branched chain hydrocarbons from a residual oil by solvent crystallization. It consists of hydrocarbons having carbon numbers predominantly greater than C25 and boiling above approximately 400 °C (752 °F).] | Maradék
olajok (ásványolaj), oldószerrel viasztalanított; Alapolaj – nem meghatározott; [Összetett szénhidrogénkeverék, melynek előállításához oldószeres kristályosítással kivonják a hosszú, elágazó szénláncú szénhidrogéneket a maradék olajból. Főként C25-nál nagyobb szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya 400 oC (752 oF) fölött van. |
265-166-0 | 64742-62-7 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-472-00-5 | Distillates (petroleum), solvent-dewaxed heavy naphthenic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by removal of normal paraffins from a petroleum fraction by solvent crystallization. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 . through C50 and produces a finished oil of not less than 100 SUS at 100 °F (19cSt at 40 °C). It contains relatively few normal paraffins.] | Párlatok
(ásványolaj), oldószerrel viasztalanított nehéz nafténbázisú; Alapolaj –
nem meghatározott; [Összetett szénhidrogénkeverék, melynek előállításához oldószeres kristályosítással kivonják a normál paraffinokat az ásványolaj-frakcióból. Főként C20-C50 szénatomszámú szénhidrogénekből áll, és végtermék olajként viszkozitása legalább 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). Viszonylag kevés normál paraffint tartalmaz.] |
265-167-6 | 64742-63-8 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-473-00-0 | Distillates (petroleum), solvent-dewaxed light naphthenic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by removal of normal paraffins from a petroleum fraction by solvent crystallization. It consists of hydrocarbons having carbon numbers predominantly in the range C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100 °F (19cSt at 40 °C). It contains relatively few normal paraffins.] | Párlatok
(ásványolaj), oldószerrel viasztalanított könnyű nafténbázisú;
Alapolaj – nem meghatározott; [Összetett szénhidrogénkeverék, melynek előállításához oldószeres kristályosítással kivonják a normál paraffinokat az ásványolaj-frakcióból. Főként C15-C30 szénatomszámú szénhidrogénekből áll, és végtermék olajként viszkozitása nem éri el a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). Viszonylag kevés normál paraffint tartalmaz.] |
265-168-1 | 64742-64-9 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-474-00-6 | Distillates (petroleum), solvent-dewaxed heavy paraffinic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by removal of normal paraffins from a petroleum fraction by solvent crystallization. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity not less than 100 SUS at 100 °F (19cSt at 40 °C).] | Párlatok
(ásványolaj), oldószerrel viasztalanított nehéz paraffinbázisú;
Alapolaj – nem meghatározott; [Összetett szénhidrogénkeverék, melynek előállításához oldószeres kristályosítással kivonják a normál paraffinokat az ásványolaj-frakcióból. Főként C20-C50 szénatomszámú szénhidrogénekből áll, és végtermék olajként viszkozitása legalább a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). |
265-169-7 | 64742-65-0 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-475-00-1 | Naphthenic oils (petroleum), catalytic dewaxed heavy; Baseoil - unspecified; [A complex combination of hydrocarbons obtained from a catalytic dewaxing process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of at least 100 SUS at 100 °F (19cSt at 40 °C). It contains relatively few normal paraffins.] | Nafténes
olajok (ásványolaj), katalitikusan viasztalanított nehéz; Alapolaj – nem meghatározott; [Katalitikus viasztalanítással előállított, összetett szénhidrogénkeverék. Főként C20-C50 szénatomszámú szénhidrogénekből áll, és végtermék olajként viszkozitása eléri vagy meghaladja a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). Viszonylag kevés normál paraffint tartalmaz.] |
265-172-3 | 64742-68-3 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-476-00-7 | Naphthenic oils (petroleum), catalytic dewaxed light; Baseoil - unspecified; [A complex combination of hydrocarbons obtained from a catalytic dewaxing process. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity less than 100 SUS at 100 °F (19cSt at 40 °C). It contains relatively few normal paraffins.] | Nafténes
olajok (ásványolaj), katalitikusan viasztalanított könnyű; Alapolaj – nem meghatározott; [Katalitikus viasztalanítással előállított, összetett szénhidrogénkeverék. Főként C15-C30 szénatomszámú szénhidrogénekből áll, és végtermék olajként viszkozitása nem éri el a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). Viszonylag kevés normál paraffint tartalmaz.] |
265-173-9 | 64742-69-4 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-477-00-2 | Paraffin oils (petroleum), catalytic dewaxed heavy; Baseoil - unspecified; [A complex combination of hydrocarbons obtained from a catalytic dewaxing process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of at least 100 SUS at 100 °F (19cSt at 40 °C).] | Paraffinolajok
(ásványolaj), katalitikusan viasztalanított nehéz; Alapolaj – nem meghatározott; [Katalitikus viasztalanítással előállított, összetett szénhidrogénkeverék. Főként C20-C50 szénatomszámú szénhidrogénekből áll, és végtermék olajként viszkozitása eléri vagy meghaladja a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). |
265-174-4 | 64742-70-7 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-478-00-8 | Paraffin oils (petroleum), catalytic dewaxed light; Baseoil - unspecified; [A complex combination of hydrocarbons obtained from a catalytic dewxing process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100 °F (19cSt at 40 °C).] | Paraffinolajok
(ásványolaj), katalitikusan viasztalanított könnyű; Alapolaj – nem meghatározott; [Katalitikus viasztalanítással előállított, összetett szénhidrogénkeverék. Főként C15-C30 szénatomszámú szénhidrogénekből áll, és végtermék olajként viszkozitása nem éri el a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). |
265-176-5 | 64742-71-8 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-479-00-3 | Naphthenic oils (petroleum), complex dewaxed heavy; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by removing straight chain paraffin hydrocarbons as a solid by treatment with an agent such as urea. It consists of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil having a viscosity of at least 100 SUS at 100 °F (19cSt at 40 °C). It contains relatively few normal paraffins.] | Nafténes
olajok (ásványolaj), komplex viasztalanított nehéz; Alapolaj – nem meghatározott; [Az egyenes szénláncú paraffin szénhidrogének kivonása érdekében karbamiddal végzett kezelés eredményeképpen kapott, összetett szénhidrogénkeverék. Főként C20-C50 szénatomszámú szénhidrogénekből áll, és végtermék olajként viszkozitása eléri vagy meghaladja a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). Viszonylag kevés normál paraffint tartalmaz.] |
265-179-1 | 64742-75-2 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-480-00-9 | Naphthenic oils (petroleum), complex dewaxed light; Baseoil - unspecified; [A complex combination of hydrocarbons obtained from a catalytic dewaxing process. It consists of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil having a viscosity less than 100 SUS at 100 °F (19cSt at 40 °C). It contains relatively few normal paraffins.] | Nafténes
olajok (ásványolaj), komplex viasztalanított könnyű; Alapolaj – nem meghatározott; [Katalitikus viasztalanítással előállított, összetett szénhidrogénkeverék. Főként C15-C30 szénatomszámú szénhidrogénekből áll, és végtermék olajként viszkozitása nem éri el a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). Viszonylag kevés normál paraffint tartalmaz.] |
265-180-7 | 64742-76-3 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-481-00-4 | Lubricating oils (petroleum), C20-50, hydrotreated neutral oil-based, high-viscosity; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treating light vacuum gas oil, heavy vacuum gas oil, and solvent deasphalted residual oil with hydrogen in the presence of a catalyst in a two stage process with dewaxing being carried out between the two stages. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil having a viscosity of approximately 112cSt at 40 °C. It contains a relatively large proportion of saturated hydrocarbons.] | Kenőolajok
(ásványolaj), C20-50, hidrogénnel kezelt, semleges olaj alapú, nagy
viszkozitású; Alapolaj – nem meghatározott; [Összetett szénhidrogénkeverék, melyet könnyű és nehéz vákuum gázolaj és oldószerrel aszfaltmentesített maradék olaj katalitikus hidrogénezésével két lépésben állítanak elő, és a két lépés között eltávolítják a viaszt. Főként C20-C50 szénatomszámú szénhidrogénekből áll, és a végtermék olaj viszkozitása hozzávetőleg 112 cSt 40 oC-on. Viszonylag nagy arányban tartalmaz telített szénhidrogéneket is.] |
276-736-3 | 72623-85-9 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-482-00-X | Lubricating oils (petroleum), C15-30, hydrotreated neutral oil-based; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treating light vacuum gas oil and heavy vacuum gas oil with hydrogen in the presence of a catalyst in a two stage process with dewaxing being carried out between the two stages. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil having a viscosity of approximately 15cSt at 40 °C. It contains a relatively large proportion of saturated hydrocabons.] | Kenőolajok
(ásványolaj), C15-30, hidrogénnel kezelt, semleges olaj alapú; Alapolaj – nem meghatározott; [Összetett szénhidrogénkeverék, melyet könnyű és nehéz vákuum gázolaj katalitikus hidrogénezésével két lépésben állítanak elő, és a két lépés között eltávolítják a viaszt. Főként C15-C30 szénatomszámú szénhidrogénekből áll, és a végtermék olaj viszkozitása hozzávetőleg 15 cSt 40 oC-on. Viszonylag nagy arányban tartalmaz telített szénhidrogéneket is.] |
276-737-9 | 72623-86-0 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-483-00-5 | Lubricating oils (petroleum), C20-50, hydrotreated neutral oil-based; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treating light vacuum gas oil, heavy vacuum gas oil and solvent deasphalted residual oil with hydrogen in the presence of a catalyst in a two stage process with dewaxing being carried out between the two stages. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of approximately 32cSt at 40 °C. It contains a relatively large proportion of saturated hydrocarbons.] | Kenőolajok
(ásványolaj), C20-50, hidrogénnel kezelt, semleges olaj alapú; Alapolaj – nem meghatározott; [Összetett szénhidrogénkeverék, melyet könnyű és nehéz vákuum gázolaj és oldószerrel aszfaltmentesített maradék olaj katalitikus hidrogénezésével két lépésben állítanak elő, és a két lépés között eltávolítják a viaszt. Főként C20-C50 szénatomszámú szénhidrogénekből áll, és a végtermék olaj viszkozitása hozzávetőleg 32 cSt 40 oC-on. Viszonylag nagy arányban tartalmaz telített szénhidrogéneket is.] |
276-738-4 | 72623-87-1 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-484-00-0 | Lubricating oils; Baseoil - unspecified; [A complex combination of hydrocarbons obtained from solvent extraction and dewaxing processes. It consists predominantly of saturated hydrocarbons having carbon numbers in the range C15 through C50.] | Kenőolajok; Alapolaj – nem meghatározott; [Oldószeres extrahálási és viaszmentesítési folyamatok útján előállított, összetett szénhidrogénkeverék. Főként C15-C50 szénatomszámú telített szénhidrogénekből áll.] |
278-012-2 | 74869-22-0 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-485-00-6 | Distillates (petroleum), complex dewaxed heavy paraffinci; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by dewaxing heavy paraffinic distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil with a viscosity of equal to or greater than 100 SUS at 100 °F (19cSt at 40 °C). It contains relatively few normal paraffins.] | Párlatok
(ásványolaj), komplex viasztalanított nehéz paraffinbázisú; Alapolaj –
nem meghatározott; [Paraffinbázisú nehézpárlat viaszmentesítésével előállított, összetett szénhidrogénkeverék. Főként C20-C50 szénatomszámú szénhidrogénekből áll, és végtermék olajként viszkozitása eléri vagy meghaladja a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). Viszonylag kevés normál paraffint tartalmaz.] |
292-613-7 | 90640-91-8 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-486-00-1 | Distillates (petroleum), complex dewaxed light paraffinic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by dewaxing light paraffinic distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C12 through C30 and produces a finished oil with a viscosity of less than 100 SUS at 100 °F (19cSt at 40 °C). It contains relatively few normal paraffins.] | Párlatok
(ásványolaj), komplex viasztalanított könnyű paraffinbázisú; Alapolaj – nem meghatározott; [Paraffinbázisú könnyűpárlat viaszmentesítésével előállított, összetett szénhidrogénkeverék. Főként C12-C30 szénatomszámú szénhidrogénekből áll, és végtermék olajként viszkozitása nem éri el a 100 SUS értéket 100 oF-on (19 cSt 40 oC-on). Viszonylag kevés normál paraffint tartalmaz.] |
292-614-2 | 90640-92-9 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-487-00-7 | Distillates (petroleum), solvent dewaxed heavy paraffinic, clay-treated; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treating dewaxed heavy paraffinic distillate with neutral or modified clay in either a contacting or percolation process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C20 through C50.] | Párlatok
(ásványolaj), oldószerrel viasztalanított nehéz paraffinbázisú, agyaggal
kezelt; Alapolaj – nem meghatározott; [Viasztalanított paraffinbázisú nehézpárlat érintkezéses módszerrel vagy perkolálással, természetes vagy módosított agyaggal történő kezelésével előállított, összetett szénhidrogénkeverék. Főként C20-C50 szénatomszámú szénhidrogénekből áll.] |
292-616-3 | 90640-94-1 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-488-00-2 | Hydrocarbons, C20-50, solvent dewaxed heavy paraffinic, hydrotreated; Baseoil - unspecified; [A complex combination of hydrocarbons produced by treating dewaxed heavy paraffinic distillate with hydrogen in the presence of a catalyst. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C20 through C50.] | Szénhidrogének,
C20-50, oldószerrel viasztalanított nehéz paraffinbázisú, hidrogénnel
kezelt; Alapolaj – nem meghatározott; [Szénhidrogének összetett keveréke, melyet viasztalanított paraffinbázisú nehézpárlat katalitikus hidrogénezéssel állítanak elő. Főként C20-C50 szénatomszámú szénhidrogénekből áll.] |
292-617-9 | 90640-95-2 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-489-00-8 | Distillates (petroleum), solvent dewaxed light paraffinic, clay-treated; Baseoil - unspecified; [A complex combination of hydrocarbons resulting from treatment of dewaxed light paraffinic distillate with natural or modified clay in either a contacting or percolation process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C15 through C30.] | Párlatok
(ásványolaj), oldószerrel viasztalanított könnyű paraffinbázisú, agyaggal
kezelt; Alapolaj – nem meghatározott; [Viasztalanított paraffinbázisú könnyűpárlat érintkezéses módszerrel vagy perkolálással, természetes vagy módosított agyaggal történő kezelésével előállított, összetett szénhidrogénkeverék. Főként C15-C30 szénatomszámú szénhidrogénekből áll.] |
292-618-4 | 90640-96-3 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-490-00-3 | Distillates (petroleum), solvent dewaxed light paraffinic, hydrotreated; Baseoil - unspecified; [A complex combination of hydrocarbons produced by treating a dewaxed light paraffinic distillate with hydrogen in the presence of a catalyst. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C15 through C30.] | Párlatok
(ásványolaj), oldószerrel viasztalanított könnyű paraffinbázisú, hidrogénnel
kezelt; Alapolaj – nem meghatározott; [Szénhidrogének összetett keveréke, melyet viasztalanított paraffinbázisú könnyűpárlat katalitikus hidrogénezéssel állítanak elő. Főként C15-C30 szénatomszámú szénhidrogénekből áll.] |
292-620-5 | 90640-97-4 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-491-00-9 | Residual oils (petroleum), hydrotreated solvent dewaxed; Baseoil - unspecified | maradék olajok (ásványolaj), oldószerrel viasztalanított, hidrogénnel kezelt; Alapolaj – nem meghatározott | 292-656-1 | 90669-74-2 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-492-00-4 | Residual oils (petroleum), catalytic dewaxed; Baseoil - unspecified | maradék
olajok (ásványolaj), katalitikusan viaszmentesített; Alapolaj – nem meghatározott |
294-843-3 | 91770-57-9 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-493-00-X | Distillates (petroleum), dewaxed heavy paraffinic, hydrotreated; Baseoil - unspecified; [A complex combination of hydrocarbons obtained from an intensive treatment of dewaxed distillate by hydrogenation in the presence of a catalyst. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C25 through C39 and produces a finished oil with a viscosity of approximately 44 cSt at 50 °C.] | Párlatok
(ásványolaj), viasztalanított nehéz paraffinbázisú, hidrogénnel kezelt;
Alapolaj – nem meghatározott; [Viasztalanított párlat katalizátor jelenlétében, hidrogénnel történő intenzív kezelésével előállított, összetett szénhidrogénkeverék. Főként C25-C39 szénatomszámú szénhidrogénekből áll, és a végtermék olaj viszkozitása hozzávetőleg 44 cSt 50 oC-on.] |
295-300-3 | 91995-39-0 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-494-00-5 | Distillates (petroleum), dewaxed light paraffinic, hydrotreated; Baseoil - unspecified; [A complex combination of hydrocarbons obtained from an intensive treatment of dewaxed distillate by hydrogenation in the presence of a catalyst. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C21 through C29 and produces a finished oil with a viscosity of approximately 13 cSt at 50 °C.] | Párlatok
(ásványolaj), viasztalanított könnyű paraffinbázisú, hidrogénnel kezelt;
Alapolaj – nem meghatározott; [Viasztalanított párlat katalizátor jelenlétében, hidrogénnel történő intenzív kezelésével előállított, összetett szénhidrogénkeverék. Főként C21-C29 szénatomszámú telített szénhidrogénekből áll, és a végtermék olaj viszkozitása hozzávetőleg 13 cSt 50 oC-on. |
295-301-9 | 91995-40-3 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-495-00-0 | Distillates (petroleum), hydrocracked solvent-refined, dewaxed; Baseoil - unspecified; [A complex combination of liquid hydrocarbons obtained by recrystallization of dewaxed hydrocracked solvent-refined petroleum distillates.] | Párlatok
(ásványolaj), hidrogénnel krakkolt, oldószerrel finomított,
viasztalanított; Alapolaj – nem meghatározott; [Viaszmentesített, hidrogénnel krakkolt, oldószerrel finomított ásványolaj párlat újrakristályosításával előállított, összetett folyékony szénhidrogénkeverék.] |
295-306-6 | 91995-45-8 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-496-00-6 | Distillates (petroleum), solvent-refined light naphthenic, hydrotreated; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treating a petroleum fraction with hydrogen in the presence of a catalyst and removing the aromatic hydrocarbons by solvent extraction. It consists predominantly of naphthenic hydrocarbons having carbon numbers predominantly in the range of C15 through C30 and produces a finished oil with a viscosity of between 13-15cSt at 40 °C.] | Párlatok
(ásványolaj), oldószerrel finomított könnyű nafténbázisú, hidrogénnel
kezelt; Alapolaj – nem meghatározott; [Ásványolaj frakció katalizátor jelenlétében, hidrogénnel történő kezelésével, és az aromás szénhidrogének oldószeres kivonásával kapott, összetett szénhidrogénkeverék. Főként C15-C30 szénatomszámú nafténbázisú szénhidrogénekből áll, és a végtermék olaj viszkozitása hozzávetőleg 13-15 cSt 40 oC-on. |
295-316-0 | 91995-54-9 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-497-00-1 | Lubricating oils (petroleum), C17-35, solvent-extd., dewaxed, hydrotreated; Baseoil - unspecified | Kenőolajok
(ásványolaj), C17-35, oldószerrel extr., viasztalanított, hidrogénnel
kezelt; Alapolaj – nem meghatározott |
295-423-2 | 92045-42-6 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-498-00-7 | Lubricating oils (petroleum), hydrocracked nonarom. solvent-deparaffined; Baseoil - unspecified | Kenőolajok
(ásványolaj), hidrogénnel krakkolt, nem aromás, oldószerrel
paraffinmentesített; Alapolaj – nem meghatározott |
295-424-8 | 92045-43-7 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-499-00-2 | Residual oils (petroleum), hydrocracked acid-treated solvent-dewaxed; Baseoil - unspecified; [A complex combination of hydrocarbons produced by solvent removal of paraffins from the residue of the distillation of acid-treated, hydrocracked heavy paraffins and boiling approximately above 380 °C (716 °F).] | maradék
olajok (ásványolaj), hidrogénnel krakkolt, oldószerrel viasztalanított; Alapolaj – nem meghatározott; [Savval kezelt, hidrogénnel krakkolt nehézparaffinok desztillációs maradékának oldószeres paraffinmentesítésével előállított, összetett szénhidrogénkeverék, melynek hozzávetőleges forráspontja 380 oC (716 oF) fölött van.] |
295-499-7 | 92061-86-4 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-500-00-6 | Paraffin oils (petroleum), solvent-refined dewaxed heavy; Baseoil - unspecified; [A complex combination of hydrocarbons obtained from sulfur-containing paraffinic crude oil. It consists predominantly of a solvent refined deparaffinated lubricating oil with a viscosity of 65cSt at 50 °C.] | Paraffinolajok
(ásványolaj), oldószerrel finomított, viasztalanított nehéz; Alapolaj –
nem meghatározott; [Kéntartalmú, paraffinbázisú nyersolajból előállított, összetett szénhidrogénkeverék. Túlnyomóan oldószerrel finomított, paraffinmentesített kenőolajból áll, melynek viszkozitása 65 cSt 50 oC-on.] |
295-810-6 | 92129-09-4 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-501-00-1 | Lubricating oils (petroleum), base oils, paraffinic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by refining of crude oil. It consists predominantly of aromatics, naphthenics and paraffinics and produces a finished oil with a viscosity of 120 SUS at 100 °F (23cSt at 40 °C).] | Kenőolajok
(ásványolaj), alapolajok, paraffinbázisú; Alapolaj – nem meghatározott; [Nyersolaj finomítása útján előállított, összetett szénhidrogénkeverék. Túlnyomóan aromás, naftén és paraffin szénhidrogénekből áll, és a végtermék olaj viszkozitása 120 SUS 100 oF-on (23 cSt 40 oC-on).] |
297-474-6 | 93572-43-1 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-502-00-7 | Hydrocarbons, hydrocracked paraffinic distn. residues, solvent-dewaxed; Baseoil - unspecified | Szénhidrogének,
hidrogénnel krakkolt, paraffinbázisú desztillációs maradékok, oldószerrel
viasztalanított; Alapolaj – nem meghatározott |
297-857-8 | 93763-38-3 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-503-00-2 | Hydrocarbons, C20-50, residual oil hydrogenation vacuum distillate; Baseoil - unspecified | Szénhidrogének,
C20-50, maradék olaj hidrogénezés vákuumdesztillációs párlat; Alapolaj – nem meghatározott |
300-257-1 | 93924-61-9 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-504-00-8 | Distillates (petroleum), solvent-refined hydrotreated heavy, hydrogenated; Baseoil - unspecified | Párlatok
(ásványolaj), oldószerrel finomított, hidrogénnel kezelt nehéz,
hidrogénezett; Alapolaj – nem meghatározott |
305-588-5 | 94733-08-1 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-505-00-3 | Distillates (petroleum), solvent-refined hydrocracked light; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by solvent dearomatization of the residue of hydrocracked petroleum. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C18 through C27 and boiling in the range of approximately 370 °C to 450 °C (698 °F to 842 °F).] | Párlatok
(ásványolaj), oldószerrel finomított, hidrogénnel krakkolt könnyű;
Alapolaj – nem meghatározott; [Hidrogénnel krakkolt ásványolaj frakció maradékából oldószeres aromásmentesítéssel előállított, összetett szénhidrogénkeverék. Főként C18-C27 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 370 oC-450 oC (698 oF-842 oF). |
305-589-0 | 94733-09-2 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-506-00-9 | Lubricating oils (petroleum), C18-40, solvent-dewaxed hydrocracked distillate-based; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by solvent deparaffination of the distillation residue from hydrocracked petroleum. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C18 through C40 and boiling in the range of approximately 370 °C to 550 °C (698 °F to 1022 °F).] | Kenőolajok
(ásványolaj), C18-40, oldószerrel viasztalanított, hidrogénnel krakkolt
párlat alapú; Alapolaj – nem meghatározott; [Hidrogénnel krakkolt ásványolaj párlat desztillációs maradékának oldószeres paraffinmentesítésével előállított, összetett szénhidrogénkeverék. Főként C18-C40 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 370 oC-550 oC (698 oF-1022 oF). |
305-594-8 | 94733-15-0 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-507-00-4 | Lubricating oils (petroleum), C18-40, solvent-dewaxed hydrogenated raffinate-based; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by solvent deparaffination of the hydrogenated raffinate obtained by solvent extraction of a hydrotreated petroleum distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C18 through C40 and boiling in the range of approximately 370 °C to 550 °C (698 °F to 1022 °F).] | Kenőolajok
(ásványolaj), C18-40, oldószerrel viasztalanított, hidrogénezett raffinátum
alapú; Alapolaj – nem meghatározott; [Hidrogénnel kezelt ásványolaj párlat oldószeres extrakciójával kapott hidrogénezett raffinátum oldószeres paraffinmentesítésével előállított, összetett szénhidrogénkeverék. Főként C18-C40 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 370 oC-550 oC (698 oF-1022 oF). |
305-595-3 | 94733-16-1 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-508-00-X | Hydrocarbons, C13-30, arom.-rich, solvent-extd. naphthenic distillate; Baseoil - unspecified | Szénhidrogének,
C13-30, aromásban gazdag, oldószerrel extrahált, nafténbázisú párlat; Alapolaj – nem meghatározott |
305-971-7 | 95371-04-3 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-509-00-5 | Hydrocarbons, C16-32, arom. rich, solvent-extd. naphthenic distillate; Baseoil - unspecified | Szénhidrogének,
C16-32, aromásban gazdag, oldószerrel extrahált, nafténbázisú párlat; Alapolaj – nem meghatározott |
305-972-2 | 95371-05-4 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-510-00-0 | Hydrocarbons, C37-68, dewaxed deasphalted hydrotreated vacuum distn. residues; Baseoil - unspecified | Szénhidrogének,
C37-68, viaszmentesített, aszfaltmentesített, hidrogénnel kezelt
vákuumdesztillációs maradékok; Alapolaj – nem meghatározott |
305-974-3 | 95371-07-6 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-511-00-6 | Hydrocarbons, C37-65, hydrotreated deasphalted vacuum distn. residues; Baseoil - unspecified | Szénhidrogének,
C37-65, aszfaltmentesített, hidrogénnel kezelt vákuumdesztillációs
maradékok; Alapolaj – nem meghatározott |
305-975-9 | 95371-08-7 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-512-00-1 | Distillates (petroleum), hydrocracked solvent-refined light; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by the solvent treatment of a distillate from hydrocracked petroleum distillates. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C18 through C27 and boiling in the range of approximately 370 °C to 450 °C (698 °F to 842 °F.] | Párlatok
(ásványolaj), hidrogénnel krakkolt, oldószerrel finomított, viasztalanított
könnyű; Alapolaj – nem meghatározott; [Hidrogénnel krakkolt petróleum desztillátumból oldószeres kezeléssel kapott, összetett szénhidrogénkeverék. Főként C18-C27 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 370 oC-450 oC (698 oF-842 oF). |
307-010-7 | 97488-73-8 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-513-00-7 | Distillates (petroleum), solvent-refined hydrogenated heavy; Baseoil - unspecified; [A complex combination of hydrocarbons, obtained by the treatment of a hydrogenated petroleum distillate with a solvent. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C19 through C40 and boiling in the range of approximately 390 °C to 550 °C (734 °F to 1022 °F).] | Desztillátumok (ásványolaj), oldószerrel finomított, hidrogénezett nehéz frakció; Alapolaj – nem meghatározott; [Hidrogénezett petróleum desztillátumból oldószeres kezeléssel kapott, összetett szénhidrogénkeverék. Főként C19-C40 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 390 oC-550 oC (734 oF-1022 oF). | 307-011-2 | 97488-74-9 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-514-00-2 | Lubricating oils (petroleum), C18-27, hydrocracked solvent-dewaxed; Baseoil - unspecified | Kenőolajok
(ásványolaj), C18-27, hidrogénnel krakkolt, oldószerrel
viasztalanított; Alapolaj – nem meghatározott |
307-034-8 | 97488-95-4 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-515-00-8 | Hydrocarbons, C17-30, hydrotreated solvent-deasphalted atm. distn. residue, distn. lights; Baseoil - unspecified; [A complex combination of hydrocarbons obtained as first runnings from the vacuum distillation of effluents from the treatment of a solvent deasphalted short residue with hydrogen in the presence of a catalyst. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C17 through C30 and boiling in the range of approximately 300 °C to 400 °C (572 °F to 752 °F). It produces a finished oil having a viscosity of 4cSt at approximately 100 °C (212 °F).] | Szénhidrogének,
C17-30, hidrogénnel kezelt, oldószerrel aszfaltmentesített, atmoszferikus
lepárlási maradék, desztillációs könnyű; Alapolaj – nem
meghatározott; [Oldószerrel aszfaltmentesített lepárlási maradék katalitikus hidrogénezéssel nyert termékeinek vákuumdesztillációja során előpárlatként kapott, összetett szénhidrogénkeverék. Főként C17-C30 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 300 oC-400 oC (572 oF-752 oF). A végtermék olaj viszkozitása 4 cSt 100 oC-on (212 oF-on).] |
307-661-7 | 97675-87-1 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-516-00-3 | Hydrocarbons, C17-40, hydrotreated solvent-deasphalted distn. residue, vacuum distn. lights; Baseoil - unspecified; [A complex combination of hydrocarbons obtained as first runnings from the vacuum distillation of effluents from the catalytic hydrotreatment of a solvent deasphalted short residue having a viscosity of 8cSt at approximately 100 °C (212 °F). It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C17 through C40 and boiling in the range of approximately 300 °C to 500 °C (592 °F to 932 °F).] | Szénhidrogének,
C17-40, , hidrogénnel kezelt, oldószerrel aszfaltmentesített lepárlási
maradék, vákuumdesztillációs könnyű; Alapolaj – nem meghatározott; [Oldószerrel aszfaltmentesített lepárlási maradék katalitikus hidrogénezéssel nyert termékeinek vákuumdesztillációja során előpárlatként kapott, összetett szénhidrogénkeverék, melynek hozzávetőleges viszkozitása 8 cSt 100 oC-on (212 oF-on). Főként C17-C40 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 300 oC-500 oC (592 oF-932 oF). |
307-755-8 | 97722-06-0 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-517-00-9 | Hydrocarbons, C13-27, solvent-extd. light naphthenic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by extraction of the aromatics from a light naphthenic distillate having a viscosity of 9.5cSt at 40 °C (104 °F). It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C13 through C27 and boiling in the range of approximately 240 °C to 400 °C (464 °F to 752 °F.] | Szénhidrogének,
C13-27, oldószerrel extrahált könnyű nafténbázisú; Alapolaj – nem meghatározott; [Nafténes könnyűpárlatból az aromás vegyületek extrahálásával kapott, 40 oC-on (104 oF-on) 9,5 cSt viszkozitású, összetett szénhidrogénkeverék. Főként C13-C27 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 240 oC-400 oC (464 oF-752 oF). |
307-758-4 | 97722-09-3 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-518-00-4 | Hydrocarbons, C14-29, solvent-extd. light naphthenic; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by extraction of the aromatics from a light naphthenic distillate having a viscosity of 16cSt at 40 °C (104 °F). It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C14 through C29 and boiling in the range of approximately 250 °C to 425 °C (482 °F to 797 °F).] | Szénhidrogének,
C14-29, oldószerrel extrahált könnyű nafténbázisú; Alapolaj – nem meghatározott; [Nafténes könnyűpárlatból az aromás vegyületek extrahálásával kapott, 40 oC (104 oF) 16 cSt viszkozitású, összetett szénhidrogénkeverék. Főként C14-C29 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 250 oC-425 oC (482 oF-797 oF). |
307-760-5 | 97722-10-6 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-519-00-X | Hydrocarbons, C27-42, dearomatized; Baseoil - unspecified | Szénhidrogének,
C27-42, aromásoktól mentesített; Alapolaj – nem meghatározott |
308-131-8 | 97862-81-2 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-520-00-5 | Hydrocarbons, C17-30, hydrotreated distillates, distn. lights; Baseoil - unspecified | Szénhidrogének, C17-30, hidrogénnel kezelt párlatos, deszt. könnyű; Alapolaj – nem meghatározott; | 308-132-3 | 97862-82-3 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-521-00-0 | Hydrocarbons, C27-45, naphthenic vacuum distn.; Baseoil - unspecified | Szénhidrogének,
C27-45, nafténbázisú vákuumdeszt.; Alapolaj – nem meghatározott |
308-133-9 | 97862-83-4 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-522-00-6 | Hydrocarbons, C27-45, dearomatized; Baseoil - unspecified | Szénhidrogének,
C27-45, aromásoktól mentesített; Alapolaj – nem meghatározott |
308-287-7 | 97926-68-6 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-523-00-1 | Hydrocarbons, C20-58, hydrotreated; Baseoil - unspecified | Szénhidrogének,
C20-58, hidrogénnel kezelt; Alapolaj – nem meghatározott |
308-289-8 | 97926-70-0 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-524-00-7 | Hydrocarbons, C27-42, naphthenic; Baseoil - unspecified | Szénhidrogének,
C27-42, nafténbázisú; Alapolaj – nem meghatározott |
308-290-3 | 97926-71-1 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-525-00-2 | Residual oils (petroleum), carbon-treated solvent-dewaxed; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by the treatment of solvent-dewaxed petroleum residual oils with activated charcoal for the removal of trace polar constituents and impurities.] | Maradék
olajok (ásványolaj), aktív szénnel kezelt oldószerrel viasztalanított;
Alapolaj – nem meghatározott; [Oldószerrel viasztalanított ásványolaj maradék olajoknak a nyomnyi mennyiségű poláros vegyületek és szennyezések eltávolítása érdekében aktív szénnel történő kezelésével előállított összetett szénhidrogénkeverék.] |
309-710-8 | 100684-37-5 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-526-00-8 | Residual oils (petroleum), clay-treated solvent-dewaxed; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by treatment of solvent-dewaxed petroleum residual oils with bleaching earth for the removal of trace polar constituents and impurities.] | Maradék
olajok (ásványolaj), agyaggal kezelt oldószerrel viasztalanított; Alapolaj – nem meghatározott; [Oldószerrel viasztalanított ásványolaj maradék olajoknak a nyomnyi mennyiségű poláros vegyületek és szennyezések eltávolítása érdekében derítőfölddel történő kezelésével előállított összetett szénhidrogénkeverék.] |
309-711-3 | 100684-38-6 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-527-00-3 | Lubricating oils (petroleum), C >25, solvent-extd., deasphalted, dewaxed, hydrogenated; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by solvent extraction and hydrogenation of vacuum distillation residues. It consists predominantly of hydrocarbons having carbon numbers predominantly greater than C25 and produces a finished oil with a viscosity in the order of 32cSt to 37cSt at 100 °C (212 °F).] | Kenőolajok
(ásványolaj), C>25, oldószerrel extr., aszfaltmentesített,
viaszmentesített, hidrogénezett; Alapolaj – nem meghatározott; [Vákuumdesztillációs maradékok oldószeres extrahálásával és hidrogénezésével előállított, összetett szénhidrogénkeverék. Túlnyomóan C25 fölötti szénatomszámú szénhidrogénekből áll, és a végtermék olaj viszkozitása hozzávetőlegesen 32 cSt-37 cSt 100 oC-on (212 oF-on).] |
309-874-0 | 101316-69-2 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-528-00-9 | Lubricating oils (petroleum), C17-32, solvent-extd., dewaxed, hydrogenated; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by solvent extraction and hydrogenation of atmospheric distillation residues. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C17 through C32 and produced a finished oil with a viscosity in the order of 17cSt to 23cSt at 40 °C (104 °F.] | Kenőolajok
(ásványolaj), C17-32, oldószerrel extr., viasztalanított,
hidrogénezett; Alapolaj – nem meghatározott; [Atmoszferikus desztillációs maradékok oldószeres extrahálásával és hidrogénezésével előállított, összetett szénhidrogénkeverék. Túlnyomóan C17-C32 szénatomszámú szénhidrogénekből áll, és a végtermék olaj viszkozitása hozzávetőlegesen 17 cSt-23 cSt 40 oC-on (104 oF-on.] |
309-875-6 | 101316-70-5 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-529-00-4 | Lubricating oils (petroleum), C20-35, solvent-extd., dewaxed, hydrogenated; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by solvent extraction and hydrogenation of atmospheric distillation residues. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C20 through C35 and produces a finished oil with a viscosity in the order of 37cSt to 44cSt at 40 °C (104 °F).] | Kenőolajok
(ásványolaj), C20-35, oldószerrel extr., viasztalanított,
hidrogénezett; Alapolaj – nem meghatározott; [Atmoszferikus desztillációs maradékok oldószeres extrahálásával és hidrogénezésével előállított, összetett szénhidrogénkeverék. Túlnyomóan C20-C35 szénatomszámú szénhidrogénekből áll, és a végtermék olaj viszkozitása hozzávetőlegesen 37 cSt-44 cSt 40 oC-on (104 oF-on).] |
309-876-1 | 101316-71-6 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-530-00-X | Lubricating oils (petroleum), C24-50, solvent-extd., dewaxed, hydrogenated; Baseoil - unspecified; [A complex combination of hydrocarbons obtained by solvent extraction and hydrogenation of atmospheric distillation residues. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C24 through C50 and produces a finished oil with a viscosity in the order of 16cSt to 75cSt at 40 °C (104 °F).] | Kenőolajok
(ásványolaj), C24-50, oldószerrel extr., viasztalanított,
hidrogénezett; Alapolaj – nem meghatározott; [Atmoszferikus desztillációs maradékok oldószeres extrahálásával és hidrogénezésével előállított, összetett szénhidrogénkeverék. Túlnyomóan C24-C50 szénatomszámú szénhidrogénekből áll, és a végtermék olaj viszkozitása hozzávetőlegesen 16 cSt-75 cSt 40 oC-on (104 oF-on).] |
309-877-7 | 101316-72-7 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-531-00-5 | Extracts (petroleum), heavy naphthenic distillate solvent, arom. conc.; Distillate aromatic extract (treated); [An aromatic concentrate produced by adding water to heavy naphthenic distillate solvent extract and extraction solvent.] | Extraktumok
(ásványolaj), nehéz nafténbázisú párlat oldószer, aromás konc.; Párlat, aromás extraktum (kezelt); [Nafténbázisú nehézpárlat oldószeres extraktumához és extrakciós oldószerhez víz hozzáadásával kapott aromás koncentrátum.] |
272-175-3 | 68783-00-6 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-532-00-0 | Extracts (petroleum), solvent-refined heavy paraffinic distillate solvent; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained as the extract from the re-extraction of solvent-refined heavy paraffinic distillate. It consists of saturated and aromatic hydrocarbons having carbon numbers predominantly in the range of C20 through C50.] | Extraktumok
(ásványolaj), oldószerrel finomított, paraffinbázisú nehézpárlat
oldószer; Párlat, aromás extraktum (kezelt); [Oldószerrel finomított paraffinos nehézpárlat újraextrahálása során extraktumként kapott, összetett szénhidrogénkeverék. Főként C20-C50 szénatomszámú telített és aromás szénhidrogénekből áll.] |
272-180-0 | 68783-04-0 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-533-00-6 | Extracts (petroleum), heavy paraffinic distillates, solvent-deasphalted; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained as the extract from a solvent extraction of heavy paraffinic distillate.] | Extraktumok
(ásványolaj), paraffinbázisú nehézpárlatok, oldószerrel
aszfaltmentesített; Párlat, aromás extraktum (kezelt); [Paraffinos nehézpárlat oldószeres extrahálása során extraktumként kapott összetett szénhidrogénkeverék.] |
272-342-0 | 68814-89-1 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-534-00-1 | Extracts (petroleum), heavy naphthenic distillate solvent, hydrotreated; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained by treating a heavy naphthenic distillate solvent extract with hydrogen in the presence of a catalyst. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C20 through C50 and produces a finished oil of at least 19cSt at 40 °C (100 SUS at 100 °F).] | Extraktumok
(ásványolaj), nafténes nehézpárlat oldószer, hidrogénnel kezelt; Párlat, aromás extraktum (kezelt); [Nafténes nehézpárlat oldószeres extraktumának katalitikus hidrogénezésével kapott, összetett szénhidrogénkeverék. Főként C20-C50 szénatomszámú aromás szénhidrogénekből áll, és végtermék olajként viszkozitása eléri vagy meghaladja a 19 cSt értéket 40 oC-on (100 cSt 100 oF-on). |
292-631-5 | 90641-07-9 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-535-00-7 | Extracts (petroleum), heavy paraffinic distillate solvent, hydrotreated; Distillate aromatic extract (treated); [A complex combination of hydrocarbons produced by treating a heavy paraffinic distillate solvent extract with hydrogen in the presence of a catalyst. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C21 through C33 and boiling in the range of approximately 350 °C to 480 °C (662 °F to 896 °F). | Extraktumok
(ásványolaj), paraffinos nehézpárlat oldószer, hidrogénnel kezelt; Párlat, aromás extraktum (kezelt); [Paraffinos nehézpárlat oldószeres extraktumának katalitikus hidrogénezésével kapott, összetett szénhidrogénkeverék. Főként C21-C33 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 350 oC-480 oC (662 oF-896 oF). |
292-632-0 | 90641-08-0 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-536-00-2 | Extracts (petroleum), light paraffinic distillate solvent, hydrotreated; Distillate aromatic extract (treated); [A complex combination of hydrocarbons produced by treating a light paraffinic distillate solvent extract with hydrogen in the presence of a catalyst. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C17 through C26 and boiling in the range of approximately 280 °C to 400 °C (536 °F to 752 °F).] | Extraktumok
(ásványolaj), paraffinos könnyűpárlat oldószer, hidrogénnel kezelt; Párlat, aromás extraktum (kezelt); [Paraffinos könnyűpárlat oldószeres extraktumának katalitikus hidrogénezésével kapott, összetett szénhidrogénkeverék. Főként C17-C26 szénatomszámú szénhidrogénekből áll, hozzávetőleges forráspont-tartománya: 280 oC-400 oC (536 oF-752 oF). |
292-633-6 | 90641-09-1 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-537-00-8 | Extracts (petroleum), hydrotreated light paraffinic distillate solvent; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained as the extract from solvent extraction of intermediate paraffinic top solvent distillate that is treated with hydrogen in the presence of a catalyst. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C16 through C36.] | Extraktumok
(ásványolaj), hidrogénnel kezelt paraffinos könnyűpárlat oldószer; Desztillátum aromás extraktum (kezelt); [Katalitikusan hidrogénezett paraffinos középpárlat oldószeres extrahálása során extraktumként kapott, összetett szénhidrogénkeverék. Főként C16-C36 szénatomszámú aromás szénhidrogénekből áll.] |
295-335-4 | 91995-73-2 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-538-00-3 | Extracts (petroleum), light naphthenic distillate solvent, hydrodesulfurized; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained by treating the extract, obtained from a solvent extraction process, with hydrogen in the presence of a catalyst under conditions primarily to remove sulfur compounds. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C15 through C30. This stream is likely to contain 5 wt.% or more of 4- to 6-membered condensed ring aromatic hydrocarbons.] | Extraktumok
(ásványolaj), nafténes könnyűpárlat oldószer, hidrogénnel
kéntelenített; Párlat, aromás extraktum (kezelt); [Oldószeres extraktumból a kénvegyületek eltávolítására végzett katalitikus hidrogénezéssel előállított, összetett szénhidrogénkeverék. Főként C15-C30 szénatomszámú aromás szénhidrogénekből áll.] Ez a származék tartalmazhat 5 tömeg% vagy több 4-6 tagú kondenzált gyűrűs aromás szénhidrogéneket is.] |
295-338-0 | 91995-75-4 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-539-00-9 | Extracts (petroleum), light paraffinic distillate solvent, acid-treated; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained as a fraction of the distillation of an extract from the solvent extraction of light paraffinic top petroleum distillates that is subjected to a sulfuric acid refining. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C16 through C32.] | Extraktumok
(ásványolaj), paraffinos könnyűpárlat oldószer, savval kezelt; Párlat, aromás extraktum (kezelt); [Kénsavas finomításnak alávetett paraffinos könnyűpárlat oldószeres extraktumának lepárlási frakciójaként kapott, összetett szénhidrogénkeverék. Főként C16-C32 szénatomszámú aromás szénhidrogénekből áll.] |
295-339-6 | 91995-76-5 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-540-00-4 | Extracts (petroleum), light paraffinic distillate solvent, hydrodesulfurized; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained by solvent extraction of a light paraffin distillate and treated with hydrogen to convert the organic sulfur to hydrogen sulfide which is eliminated. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C15 through C40 and produces a finished oil with a viscosity of greater than 10cSt at 40 °C.] | Extraktumok
(ásványolaj), paraffinos könnyűpárlat oldószer, hidrogénnel
kéntelenített; Párlat, aromás extraktum (kezelt); [Paraffinos könnyűpárlat oldószeres extrakciójával és a kénvegyületek kénhidrogénné alakítása és eltávolítása érdekében végzett hidrogénezéssel kapott, összetett szénhidrogénkeverék. Főként C15-C40 szénatomszámú szénhidrogénekből áll, és a végtermék olaj viszkozitása hozzávetőleg 10 cSt 40 oC-on. |
295-340-1 | 91995-77-6 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-541-00-X | Extracts (petroleum), light vacuum gas oil solvent, hydrotreated; Distillate aromatic extract (treated); [A complex combination of hydrocarbons, obtained by solvent extraction from light vacuum petroleum gas oils and treated with hydrogen in the presence of a catalyst. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C13 through C30.] | Extraktumok
(ásványolaj), könnyű vákuum gázolaj oldószer, hidrogénezett; Párlat, aromás extraktum (kezelt); [Könnyű ásványolaj vákuumdesztillációs gázolajokból oldószeres extrakcióval és katalitikus hidrogénezéssel előállított, összetett szénhidrogénkeverék. Főként C13-C30 szénatomszámú aromás szénhidrogénekből áll.] |
295-342-2 | 91995-79-8 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-542-00-5 | Extracts (petroleum), heavy paraffinic distillate solvent, clay-treated; Distillate aromatic extract (treated); [A complex combination of hydrocarbons resulting from treatment of a petroleum fraction with natural or modified clay in either a contact or percolation process to remove the trace amounts of polar compounds and impurities present. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C20 through C50. This stream is likely to contain 5 wt.% or more 4-6 membered ring aromatic hydrocarbons.] | Extraktumok
(ásványolaj), paraffinos nehézpárlat oldószer, agyaggal kezelt; Párlat, aromás extraktum (kezelt); [Ásványolaj frakciónak – a nyomnyi mennyiségű poláros vegyületek és a szennyezések eltávolítása érdekében – érintkezéses módszerrel vagy perkolálással, természetes vagy módosított agyaggal történő kezelésével kapott, összetett szénhidrogénkeverék. Főként C20-C50 szénatomszámú aromás szénhidrogénekből áll.] Ez a származék tartalmazhat 5 tömeg% vagy több 4-6 tagú gyűrűs aromás szénhidrogéneket is.] |
296-437-1 | 92704-08-0 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-543-00-0 | Extracts (petroleum), heavy naphthenic distillate solvent, hydrodesulfurized; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained from a petroleum stock by treating with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C15 through C50 and produces a finished oil with a viscosity of greater than 19cSt at 40 °C.] | Extraktumok
(ásványolaj), nafténes nehézpárlat oldószer, hidrogénnel kéntelenített; Párlat, aromás extraktum (kezelt); [Ásványolaj párlatból nyert összetett szénhidrogénkeverék, melyet a szerves kén hidrogén-szulfiddá alakítása céljából katalizátor jelenlétében hidrogéneznek, és a hidrogén-szulfidot eltávolítják. Főként C15-C50 szénatomszámú szénhidrogénekből áll, és a végtermék olaj viszkozitása hozzávetőleg 19 cSt 40 oC-on. |
297-827-4 | 93763-10-1 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-544-00-6 | Extracts (petroleum), solvent-dewaxed heavy paraffinic distillate solvent, hydrodesulfurized; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained from a solvent dewaxed petroleum stock by treating with hydrogen to convert organic sulfur to hydrogen sulfide which is removed. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C15 through C50 and produces a finished oil with a viscosity of greater than 19cSt at 40 °C.] | Extraktumok
(ásványolaj), oldószerrel viasztalanított paraffinos nehézpárlat oldószer,
hidrogénnel kéntelenített; Párlat, aromás extraktum (kezelt); [Oldószerrel viasztalanított ásványolaj párlatnak a szerves kénvegyületek kénhidrogénné alakítása és eltávolítása érdekében végzett hidrogénezésével előállított, összetett szénhidrogénkeverék. Főként C15-C50 szénatomszámú szénhidrogénekből áll, és a végtermék olaj viszkozitása hozzávetőleg 19 cSt 40 oC-on. |
297-829-5 | 93763-11-2 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-545-00-1 | Extracts (petroleum), light paraffinic distillate solvent, carbon-treated; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained as a fraction from distillation of an extract recovered by solvent extraction of light paraffinic top petroleum distillate treated with activated charcoal to remove traces of polar constituents and impurities. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C16 through C32.] | Extraktumok
(ásványolaj), paraffinos könnyűpárlat oldószer, aktív szénnel kezelt; Párlat, aromás extraktum (kezelt); [A nyomnyi mennyiségű poláros vegyületek és szennyezések eltávolítása érdekében aktív szénnel kezelt könnyű paraffinos ásványolaj párlatból oldószeres extrahálással visszanyert extraktum desztillációjával előállított, összetett szénhidrogénkeverék. Főként C16-C32 szénatomszámú aromás szénhidrogénekből áll.] |
309-672-2 | 100684-02-4 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-546-00-7 | Extracts (petroleum), light paraffinic distillate solvent, clay-treated; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained as a fraction from distillation of an extract recovered by solvent extraction of light paraffinic top petroleum distillates treated with bleaching earth to remove traces of polar constituents and impurities. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C16 through C32.] | Extraktumok
(ásványolaj), paraffinos könnyűpárlat oldószer, agyaggal kezelt; Párlat, aromás extraktum (kezelt); [A nyomnyi mennyiségű poláros vegyületek és szennyezések eltávolítása érdekében derítőfölddel kezelt könnyű paraffinos ásványolaj párlatból oldószeres extrahálással visszanyert extraktum desztillációjával előállított, összetett szénhidrogénkeverék. Főként C16–C32 szénatomszámú aromás szénhidrogénekből áll.] |
309-673-8 | 100684-03-5 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-547-00-2 | Extracts (petroleum), light vacuum, gas oil solvent, carbon-treated; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained by solvent extraction of light vacuum petroleum gas oil treated with activated charcoal for the removal of trace polar constituents and impurities. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C13 through C30.] | Extraktumok
(ásványolaj), könnyű vákuum gázolaj oldószer, aktív szénnel kezelt; Párlat, aromás extraktum (kezelt); [A nyomnyi mennyiségű poláros vegyületek és szennyezések eltávolítása érdekében aktív szénnel kezelt könnyű vákuum ásványolaj gázolajból oldószeres extrahálással előállított, összetett szénhidrogénkeverék. Főként C13-C30 szénatomszámú aromás szénhidrogénekből áll.] |
309-674-3 | 100684-04-6 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-548-00-8 | Extracts (petroleum), light vacuum gas oil solvent, clay-treated; Distillate aromatic extract (treated); [A complex combination of hydrocarbons obtained by solvent extraction of light vacuum petroleum gas oils treated with bleaching earth for removal of trace polar constituents and impurities. It consists predominantly of aromatic hydrocarbons having carbon numbers predominantly in the range of C13 through C30.] | Extraktumok
(ásványolaj), könnyű vákuum gázolaj oldószer, agyaggal kezelt; Párlat, aromás extraktum (kezelt); [A nyomnyi mennyiségű poláros vegyületek és szennyezések eltávolítása érdekében derítőfölddel kezelt könnyű vákuum ásványolaj gázolajokból oldószeres extrahálással előállított, összetett szénhidrogénkeverék. Főként C13-C30 szénatomszámú aromás szénhidrogénekből áll.] |
309-675-9 | 100684-05-7 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-549-00-3 | Foots oil (petroleum); Foots oil; [A complex combination of hydrocarbons obtained as the oil fraction from a solvent deoiling or a wax sweating process. It consists predominantly of branched chain hydrocarbons having carbon numbers predominantly in the range of C20 through C50.] | Gacsolaj
(ásványolaj); Gacsolaj; [Oldószeres olajmentesítési vagy viaszkicsapási eljárás során olajfrakcióként kapott, összetett szénhidrogénkeverék. Főként C20-C50 szénatomszámú elágazó láncú szénhidrogénekből áll.] |
265-171-8 | 64742-67-2 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 649-550-00-9 | Foots oil (petroleum), hydrotreated; Foots oil | Gacsolaj (ásványolaj), hidrogénnel kezelt; Gacsolaj; | 295-394-6 | 92045-12-0 | Carc.
1B |
H350 |
GHS08 Dgr |
H350 |
L | CLP00 | ||
| 650-002-00-6 | turpentine, oil | terpentinolaj | 232-350-7 | 8006-64-2 | Flam.
Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Asp. Tox. 1 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H226 H332 H312 H302 H304 H315 H319 H317 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H226 H332 H312 H302 H304 H319 H315 H317 H411 |
CLP00 | |||
| 650-003-00-1 | fenson (ISO); 4-chlorophenyl benzenesulphonate | fenzon
(ISO); 4-klórfenilbenzolszulfonát; |
201-274-6 | 80-38-6 | Acute
Tox. 4 * Eye Irrit. 2 Aquatic Chronic 2 |
H302 H319 H411 |
GHS07 GHS09 Wng |
H302 H319 H411 |
CLP00 | |||
| 650-004-00-7 | norbormide (ISO); 5-(α-hydroxy-α-2-pyridylbenzyl)-7-(α-2-pyridylbenzylidene)bicyclo [2.2.1] hept-5-ene-2,3-dicarboximide | norbormid
(ISO); 5-(α-hidroxi-α-2-piridilbenzil)-7-(α-2-piridilbenzilidén)biciklo[2.2.1]hept-5-én-2,3-dikarboximid |
213-589-6 | 991-42-4 | Acute
Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
CLP00 | |||
| 650-005-00-2 | (2R,6aS,12aS)-1,2,6,6a,12,12a-hexahydro-2-isopropenyl-8,9-dimethoxychromeno[3,4-b]furo[2,3-h]chromen-6-one, rotenone | (2R,6aS,12aS)-1,2,6,6a,12,12a-hexahidro-2-izopropenil-8,9-dimetoxikromeno[3,4-b]furo[2,3-h]kromén-6-on, rotenon | 201-501-9 | 83-79-4 | Acute
Tox. 3 * STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H335 H315 H319 H400 H410 |
GHS06 GHS09 Dgr |
H301 H319 H335 H315 H410 |
CLP00 | |||
| 650-006-00-8 | benquinox (ISO); p-benzoquinone 1-benzoylhydrazone 4-oxime | benkvinox
(ISO); p-benzokinon-1-benzoilhidrazon-4-oxim |
207-807-9 | 495-73-8 | Acute
Tox. 3 * Acute Tox. 4 * |
H301 H312 |
GHS06 Dgr |
H301 H312 |
CLP00 | |||
| 650-007-00-3 | chlordimeform (ISO); N2-(4-chloro-o-tolyl)-N1,N1-dimethylformamidine | klórdimeform
(ISO); N2-(4-klór-o-tolil)-N1,N1-dimetilformamidin |
228-200-5 | 6164-98-3 | Carc.
2 Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H312 H302 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H312 H302 H410 |
CLP00 | |||
| 650-008-00-9 | drazoxolon (ISO); 4-(2-chlorophenylhydrazone)-3-methyl-5-isoxazolone | drazoxolon
(ISO); 4-(2-klórfenilhidrazon)-3-metil-5-izoxazolon |
227-197-8 | 5707-69-7 | Acute
Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
CLP00 | |||
| 650-009-00-4 | chlordimeform hydrochloride; N'-(4-chloro-o-tolyl)-N,N-dimethylformamidine monohydrochloride; N2-(4-chloro-o-tolyl)-N1,N1-dimethylformamidine hydorchloride | klórdimeform-hidroklorid; N'-(4-klór-o-tolil)-N,N-dimetilformamidin-monohidroklorid; N2-(4-klór-o-tolil)-N1,N1-dimetilformamidin-hidroklorid |
243-269-1 | 19750-95-9 | Carc.
2 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H410 |
CLP00 | |||
| 650-010-00-X | benzyl violet 4B; α-[4-(4-dimethylamino-α-{}{4-[ethyl(3-sodiosulphonatobenzyl)amino] phenyl}}benzylidene)cyclohexa-2,5-dienylidene(ethyl)ammonio]toluene-3-sulphonate | benzil
violet 4B; α-[4-(4-dimetilamino-α-{4-[etil(3-nátriumszulfonátobenzil) amino]fenil]benzilidén]ciklohexa-2,5-dienilidén(etil)ammónio]toluol-3-szulfonát |
216-901-9 | 1694-09-3 | Carc.
2 |
H351 |
GHS08 Wng |
H351 |
CLP00 | |||
| 650-012-00-0 | erionite | erionit | 12510-42-8 | Carc.
1A |
H350 |
GHS08 Dgr |
H350 |
CLP00 | ||||
| 650-013-00-6 | asbestos
[1] asbestos [2] asbestos [3] asbestos [4] asbestos [5] asbestos [6] asbestos [7] |
azbeszt | 12001-28-4
[1] 132207-32-0 [2] 12172-73-5 [3] 77536-66-4 [4] 77536-68-6 [5] 77536-67-5 [6] 12001-29-5 [7] |
Carc.
1A STOT RE 1 |
H350 H372 ** |
GHS08 Dgr |
H350 H372 ** |
CLP00 | ||||
| 650-014-00-1 | diethyl 2,4-dihydroxycyclodisiloxane-2,4-diylbis(trimethylene)diphosphonate, tetrasodium salt, reaction products with disodium metasilicate | dietil-2,4-dihidroxiciklodisziloxán-2,4-diilbisz(trimetilén)difoszfonát-tetranátriumsó reakciótermékei dinátrium-metaszilikáttal | 401-770-4 | Acute
Tox. 4 * Skin Corr. 1B |
H302 H314 |
GHS05 GHS07 Dgr |
H314 H302 |
CLP00 | ||||
| 650-015-00-7 | rosin;
colophony [1] rosin; colophony [2] rosin; colophony [3] |
fenyőgyanta; kolofónium |
232-475-7
[1] 232-484-6 [2] 277-299-1 [3] |
8050-09-7
[1] 8052-10-6 [2] 73138-82-6 [3] |
Skin
Sens. 1 |
H317 |
GHS07 Wng |
H317 |
CLP00 | |||
| 650-016-00-2 | Mineral wool, with the exception of those specified elsewhere in this Annex; [Man-made vitreous (silicate) fibres with random orientation with alkaline oxide and alkali earth oxide (Na2O+K2O+CaO+MgO+BaO) content greater than 18 % by weight] | ásványi
gyapjú (kivéve az e mellékletben külön szereplőket); [mesterséges, rendszertelenül sorakozó üveg-(szilikát)szálak több mint 18 % (w/w) alkáli-oxid és földalkáli-oxid (Na2O+K2O+CaO+MgO+BaO) tartalommal] |
- | - | Carc.
2 |
H351 |
GHS08 Wng |
H351 |
A Q R | CLP00/ATP01 | ||
| 650-017-00-8 | Refractory Ceramic Fibres, Special Purpose Fibres, with the exception of those specified elsewhere in this Annex; [Man-made vitreous (silicate) fibres with random orientation with alkaline oxide and alkali earth oxide (Na2O+K2O+CaO+ MgO+BaO) content less or equal to 18 % by weight] | tűzálló
kerámiaszálak, különleges alkalmazási célokra szánt szálak (kivéve az e
mellékletben külön szereplőket); [mesterséges, rendszertelenül sorakozó üveg-(szilikát) szálak legfeljebb 18 % (w/w) alkáli-oxid és földalkáli-oxid (Na2O+K2O+CaO+MgO+BaO) tartalommal] |
- | - | Carc.
1B |
H350i |
GHS08 Dgr |
H350i |
A R | CLP00/ATP01 | ||
| 650-018-00-3 | reaction product of: acetophenone, formaldehyde, cyclohexylamine, methanol and acetic acid | acetofenon, formaldehid, ciklohexilamin, metanol és ecetsav reakcióterméke | 406-230-1 | Flam.
Liq. 3 Carc. 2 Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H351 H332 H314 H317 H400 H410 |
GHS02 GHS08 GHS05 GHS07 GHS09 Dgr |
H226 H351 H314 H332 H317 H410 |
CLP00 | ||||
| 650-031-00-4 | bis(4-hydroxy-N-methylanilinium) sulphate | bisz(4-hidroxi-N-metilanilínium)-szulfát | 200-237-1 | 55-55-0 | Acute
Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H317 H410 |
CLP00 | |||
| 650-032-00-X | cyproconazole (ISO); (2RS,3RS;2RS,3SR)-2-(4-chlorophenyl)-3-cyclopropyl-1-(1H-1,2,4-triazol-1-yl)butan-2-ol | ciprokonazol (ISO); (2RS,3RS;2RS,3SR)-2-(4-klórfenil)-3-ciklopropil-1-(1H-1,2,4-triazol-1-il)bután-2-ol | 94361-06-5 | Repr.
1B Acute Tox. 3 STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H360D H301 H373 (liver) H400 H410 |
GHS08 GHS06 GHS09 Dgr |
H301 H360D H373 (liver) H410 |
M=10 M=1 |
CLP00/ATP10 | |||
| 650-041-00-9 | triasulfuron (ISO); 1-[2-(2-chloroethoxy)phenylsulfonyl]-3-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)urea | triaszulfuron
(ISO); 1-[2-(2-klóretoxi)fenilszulfonil]-3-(4-metoxi-6-metil-1,3,5-triazin-2-il)karbamid |
82097-50-5 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | ||||
| 650-042-00-4 | reaction product of: polyethylene-polyamine-(C16-C18)-alkylamides with monothio-(C2)-alkyl phosphonates | polietilén-poliamin-(C16-C18)-alkilamidok és monotio-(C2)-alkil-foszfonátok reakcióterméke | 417-450-2 | Skin
Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H315 H319 H317 H412 |
GHS07 Wng |
H319 H315 H317 H412 |
CLP00 | ||||
| 650-043-00-X | reaction product of: 3,5-bis-tert-butylsalicylic acid and aluminiumsulfate | 3,5-bisz-terc-butilszalicilsav és alumínium-szulfát reakcióterméke | 420-310-3 | Acute
Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
CLP00 | ||||
| 650-044-00-5 | mixed linear and branched C14-15 alcohols ethoxylated, reaction product with epichlorohydrin | kevert egyenesláncú és elágazó láncú, etoxilezett C14-15 alkoholok és epiklórhidrin reakcióterméke | 420-480-9 | 158570-99-1 | Skin
Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H315 H317 H410 |
CLP00 | |||
| 650-045-00-0 | reaction product of: 1,2,3-propanetricarboxylic acid, 2-hydroxy, diethyl ester, 1-propanol and zirconium tetra-n-propanolate | 1,2,3-propántrikarbonsav, 2-hidroxi, dietil-észter, 1-propanol és cirkónium-tetra-n-propanolát reakcióterméke | 417-110-3 | Flam.
Liq. 2 Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 2 |
H225 H315 H318 H411 |
GHS02 GHS05 GHS09 Dgr |
H225 H315 H318 H411 |
CLP00 | ||||
| 650-046-00-6 | di(tetramethylammonium)(29H,31H-phthalocyanin-N29,N30,N31,N32)disulfonamide disulfonate, cuprate(2-)complex, derivates | di(tetrametilammónium)(29H,31H-ftalocianin-N29,N30,N31,N32)diszulfonamid-diszulfonát, kuprát(2-) komplex származékai | 416-180-2 | 12222-04-7 | Acute
Tox. 4 * STOT RE 2 * Aquatic Chronic 2 |
H302 H373 ** H411 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H411 |
CLP00 | |||
| 650-047-00-1 | dibenzylphenylsulfonium hexafluoroantimonate | dibenzilfenilszulfónium-hexafluorantimonát | 417-760-8 | 134164-24-2 | Acute
Tox. 4 * STOT RE 1 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H302 H372 ** H318 H317 H411 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H372
** H302 H318 H317 H411 |
CLP00 | |||
| 650-048-00-7 | reaction product of: borax, hydrogen peroxide, acetic acid anhydride and acetic acid | bórax, hidrogén-peroxid, ecetsav-anhidrid és ecetsav reakcióterméke | 420-070-1 | Org.
Perox. D **** Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A Aquatic Acute 1 |
H242 H332 H312 H302 H314 H400 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H242 H332 H312 H302 H314 H400 |
CLP00 | ||||
| 650-049-00-2 | 2-alkoyloxyethyl hydrogen maleate, where alkoyl represents (by weight) 70 to 85 % unsaturated octadecoyl, 0.5 to 10 % saturated octadecoyl, and 2 to 18 % saturated hexadecoyl | 2-alkanoiloxietil-hidrogén-maleát, ahol az alkanoil jelentése 70–85 % telítetlen oktadekanoil, 0,5–10 % telített oktadekanoil és 2–18 % telített hexadekanoil | 417-960-5 | Skin
Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H410 |
CLP00 | ||||
| 650-050-00-8 | reaction mass of: 1-methyl-3-hydroxypropyl 3,5-[1,1-dimethylethyl]-4-hydroxydihydro-cinnamate and/or 3-hydroxybutyl 3,5-[1,1-dimethylethyl]-4-hydroxydihydrocinnamate; 1,3-butanediol bis[3-(3'-(1,1-dimethylethyl)4'-hydroxy-phenyl)propionate] isomers; 1,3-butanediol bis[3-(3',5'-(1,1-dimethylethyl)-4'-hydroxyphenyl)propionate] isomers | a
következő anyagok keveréke:
1-metil-3-hidroxipropil-3,5-[1,1-dimetiletil]-4-hidroxidihidrocinnamát
és/vagy 3-hidroxibutil-3,5-[1,1-dimetiletil]-4-hidroxidihidrocinnamát; 1,3-butándiolbisz[3-(3'-(1,1-dimetiletil)-4'-hidroxifenil)propionát] izomerek; 1,3-butándiolbisz[3-(3'5'-(1,1-dimetiletil)-4'-hidroxifenil)propionát] izomerek; |
423-600-8 | Aquatic
Chronic 2 |
H411 |
GHS09 |
H411 |
CLP00 | ||||
| 650-055-00-5 | silver sodium zirconium hydrogenphosphate | ezüst-nátrium-cirkónium-hidrogén-foszfát | 422-570-3 | 155925-27-2 | Aquatic
Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
CLP00 | |||
| 650-056-00-0 | dibutylbis(pentane-2,4-dionato-O,O')tin | #HIÁNYZIK | 245-152-0 | 22673-19-4 | Repr.
1B STOT RE 1 |
H360FD H372 (immune system) |
GHS08 Dgr |
H360FD H372 (immune system) |
ATP14 | |||
| 650-057-00-6 | Margosa, ext. [cold-pressed oil of Azadirachta indica seeds without shells extracted with super-critical carbon dioxide] | #HIÁNYZIK | 283-644-7 | 84696-25-3 | Aquatic
Chronic 3 |
H412 |
H412 |
ATP15 | ||||